Compare commits
201 Commits
release/0.
...
release/0.
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
2a8c8c2bb6 | ||
|
|
67b083fa03 | ||
|
|
213c270ab4 | ||
|
|
7914ff03d3 | ||
|
|
e3ca356cae | ||
|
|
530ba36b07 | ||
|
|
7a359d5eef | ||
|
|
d1af252ac4 | ||
|
|
dcc46362dc | ||
|
|
4d48a07717 | ||
|
|
958e72877c | ||
|
|
0ba6bbe114 | ||
|
|
361f925526 | ||
|
|
7231039e81 | ||
|
|
1d840e09f8 | ||
|
|
b6fecc8bc0 | ||
|
|
d0f7543f69 | ||
|
|
7587f1603d | ||
|
|
177c96db5a | ||
|
|
07c1ce9c85 | ||
|
|
6097957650 | ||
|
|
9cffaad71f | ||
|
|
3ccdb84523 | ||
|
|
f7d0852e92 | ||
|
|
15079ee4db | ||
|
|
0f25c6ab29 | ||
|
|
0bf9a0ee2c | ||
|
|
973cd9a286 | ||
|
|
78529b6a42 | ||
|
|
0ad65c7776 | ||
|
|
cbcbdd120d | ||
|
|
f507185729 | ||
|
|
573bf52578 | ||
|
|
10608afb76 | ||
|
|
de46a51208 | ||
|
|
e8acafce8e | ||
|
|
bb2b2d6dd8 | ||
|
|
87c558c9cf | ||
|
|
a4647cfa98 | ||
|
|
b111f97c58 | ||
|
|
7a8e6609b1 | ||
|
|
4ec6f3272e | ||
|
|
553df318ff | ||
|
|
9e2e6411f2 | ||
|
|
5d48e37926 | ||
|
|
c2a42493fd | ||
|
|
0c2570ae07 | ||
|
|
e83bb7c4dc | ||
|
|
46273fe72f | ||
|
|
0b26fa75dc | ||
|
|
35bbe2beef | ||
|
|
9e7bad8afa | ||
|
|
4ada11f358 | ||
|
|
cf8cd2f2b4 | ||
|
|
147a4ed141 | ||
|
|
97f8fe3fd1 | ||
|
|
f0cec015b5 | ||
|
|
ff72078095 | ||
|
|
e678aad3c7 | ||
|
|
41dc7f7d0d | ||
|
|
6b92a169ab | ||
|
|
45d41416ed | ||
|
|
9019793bd4 | ||
|
|
32912eaa05 | ||
|
|
2e7a220e39 | ||
|
|
b02bfb347d | ||
|
|
0cce1ce982 | ||
|
|
fb76c9ed9a | ||
|
|
3a782b3b0d | ||
|
|
eac739d395 | ||
|
|
6e5873ebba | ||
|
|
3205f0c16d | ||
|
|
5f0870a741 | ||
|
|
5a483472c1 | ||
|
|
8d4cc3920a | ||
|
|
14bc9c0e35 | ||
|
|
2451c00268 | ||
|
|
4cad18bbca | ||
|
|
634a0575cb | ||
|
|
d3d07564f2 | ||
|
|
0b768d6f0b | ||
|
|
ec9aefac6b | ||
|
|
d72aa7ebc0 | ||
|
|
99930af12e | ||
|
|
d6e730f18a | ||
|
|
d1e5b87bfc | ||
|
|
c101dea460 | ||
|
|
9ddd502538 | ||
|
|
a5d345fff2 | ||
|
|
11dcc14374 | ||
|
|
4c5ceaff14 | ||
|
|
b5fcddcf1a | ||
|
|
d570ff2c65 | ||
|
|
21c96c9c81 | ||
|
|
c51d544932 | ||
|
|
5e56c3b3c1 | ||
|
|
235961a934 | ||
|
|
df905a8d5e | ||
|
|
8b68cf9546 | ||
|
|
150f4d6f41 | ||
|
|
1c95ca33a8 | ||
|
|
108edc3a6b | ||
|
|
f99a6b9f43 | ||
|
|
aedbc8c97d | ||
|
|
5c42102c79 | ||
|
|
5d5b2fb88c | ||
|
|
9cb6f70fc0 | ||
|
|
5720e38033 | ||
|
|
e9bbb8724f | ||
|
|
648282e602 | ||
|
|
c7a43d941f | ||
|
|
1ffd59d469 | ||
|
|
ae4f4e5416 | ||
|
|
9854fd34ea | ||
|
|
60057a7bf7 | ||
|
|
ea47d7a35b | ||
|
|
f2181f5467 | ||
|
|
34987d58ec | ||
|
|
1c76084db8 | ||
|
|
68dd6d2031 | ||
|
|
1437e1ecfe | ||
|
|
1a71eb1f47 | ||
|
|
0695e9fb3e | ||
|
|
a4a43ea860 | ||
|
|
b627455b8f | ||
|
|
1331193800 | ||
|
|
7de8be46c0 | ||
|
|
55145f57a1 | ||
|
|
8e8fd49e04 | ||
|
|
d7bfe68e2d | ||
|
|
b11c86d074 | ||
|
|
e2a4a5884b | ||
|
|
fd34956c29 | ||
|
|
b5b92248c7 | ||
|
|
cf2bc388f2 | ||
|
|
5baf46f84d | ||
|
|
a8cf34e809 | ||
|
|
af0b3698c6 | ||
|
|
92ad4876c4 | ||
|
|
b14e4ee3a0 | ||
|
|
e6f2d029fa | ||
|
|
bbf524b3f9 | ||
|
|
dbf6bf5fdf | ||
|
|
aff41d6e1c | ||
|
|
e2bf9734b1 | ||
|
|
c3faf05be9 | ||
|
|
aad5461ee1 | ||
|
|
0a7a1f4ef2 | ||
|
|
5e9965fca7 | ||
|
|
54d768412a | ||
|
|
97b6fb06aa | ||
|
|
da7670801b | ||
|
|
e1fa0b6695 | ||
|
|
dfeb08fa00 | ||
|
|
8963e8c9f4 | ||
|
|
562cb81cad | ||
|
|
b12dec3620 | ||
|
|
e65edbf53c | ||
|
|
88307045b0 | ||
|
|
e06c3f945c | ||
|
|
ab41679368 | ||
|
|
7b12f35698 | ||
|
|
aa0ea6aeff | ||
|
|
c3a7bbb3ff | ||
|
|
1c4d47825b | ||
|
|
fa998de4b1 | ||
|
|
06310f1dd0 | ||
|
|
8dd02094df | ||
|
|
0010ecd94a | ||
|
|
690411722e | ||
|
|
7001b14b4c | ||
|
|
13cf72ffa7 | ||
|
|
d7163c3a97 | ||
|
|
cf13c80991 | ||
|
|
7c57965999 | ||
|
|
3d69f1c291 | ||
|
|
3451d1c12e | ||
|
|
4fbd8520e6 | ||
|
|
bfd7b2f65d | ||
|
|
061f15af00 | ||
|
|
369e17b801 | ||
|
|
2bff4e5e56 | ||
|
|
138acc3b7d | ||
|
|
d6e1dd1040 | ||
|
|
76034772cb | ||
|
|
12507c707f | ||
|
|
de358f8cdc | ||
|
|
08668ac462 | ||
|
|
0a3734ed2b | ||
|
|
a5d1a3d65c | ||
|
|
7bc2980905 | ||
|
|
34e792e193 | ||
|
|
7b1ad1b629 | ||
|
|
a8f9f6c43a | ||
|
|
c9b1b6d076 | ||
|
|
cd078903a7 | ||
|
|
588c17ff69 | ||
|
|
baf7eaace6 | ||
|
|
9f9ffd0efd | ||
|
|
d9adfbe047 | ||
|
|
c5952dd09a |
2
.cargo/audit.toml
Normal file
2
.cargo/audit.toml
Normal file
@@ -0,0 +1,2 @@
|
|||||||
|
[advisories]
|
||||||
|
ignore = ["RUSTSEC-2022-0046"]
|
||||||
17
.github/ISSUE_TEMPLATE/enhancement_request.md
vendored
Normal file
17
.github/ISSUE_TEMPLATE/enhancement_request.md
vendored
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
---
|
||||||
|
name: Enhancement request
|
||||||
|
about: Request a new feature or change to an existing feature
|
||||||
|
title: ''
|
||||||
|
labels: 'enhancement'
|
||||||
|
assignees: ''
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
**Describe the enhancement**
|
||||||
|
<!-- A clear and concise description of what you would like added or changed. -->
|
||||||
|
|
||||||
|
**Use case**
|
||||||
|
<!-- Tell us how you or others will use this new feature or change to an existing feature. -->
|
||||||
|
|
||||||
|
**Additional context**
|
||||||
|
<!-- Add any other context about the enhancement here. -->
|
||||||
99
.github/ISSUE_TEMPLATE/minor_release.md
vendored
Normal file
99
.github/ISSUE_TEMPLATE/minor_release.md
vendored
Normal file
@@ -0,0 +1,99 @@
|
|||||||
|
---
|
||||||
|
name: Minor Release
|
||||||
|
about: Create a new minor release [for release managers only]
|
||||||
|
title: 'Release MAJOR.MINOR+1.0'
|
||||||
|
labels: 'release'
|
||||||
|
assignees: ''
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Create a new minor release
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
<--release summary to be used in announcements-->
|
||||||
|
|
||||||
|
### Commit
|
||||||
|
|
||||||
|
<--latest commit ID to include in this release-->
|
||||||
|
|
||||||
|
### Changelog
|
||||||
|
|
||||||
|
<--add notices from PRs merged since the prior release, see ["keep a changelog"]-->
|
||||||
|
|
||||||
|
### Checklist
|
||||||
|
|
||||||
|
Release numbering must follow [Semantic Versioning]. These steps assume the current `master`
|
||||||
|
branch **development** version is *MAJOR.MINOR.0*.
|
||||||
|
|
||||||
|
#### On the day of the feature freeze
|
||||||
|
|
||||||
|
Change the `master` branch to the next MINOR+1 version:
|
||||||
|
|
||||||
|
- [ ] Switch to the `master` branch.
|
||||||
|
- [ ] Create a new PR branch called `bump_dev_MAJOR_MINOR+1`, eg. `bump_dev_0_22`.
|
||||||
|
- [ ] Bump the `bump_dev_MAJOR_MINOR+1` branch to the next development MINOR+1 version.
|
||||||
|
- Change the `Cargo.toml` version value to `MAJOR.MINOR+1.0`.
|
||||||
|
- Update the `CHANGELOG.md` file.
|
||||||
|
- The commit message should be "Bump version to MAJOR.MINOR+1.0".
|
||||||
|
- [ ] Create PR and merge the `bump_dev_MAJOR_MINOR+1` branch to `master`.
|
||||||
|
- Title PR "Bump version to MAJOR.MINOR+1.0".
|
||||||
|
|
||||||
|
Create a new release branch and release candidate tag:
|
||||||
|
|
||||||
|
- [ ] Double check that your local `master` is up-to-date with the upstream repo.
|
||||||
|
- [ ] Create a new branch called `release/MAJOR.MINOR+1` from `master`.
|
||||||
|
- [ ] Bump the `release/MAJOR.MINOR+1` branch to `MAJOR.MINOR+1.0-rc.1` version.
|
||||||
|
- Change the `Cargo.toml` version value to `MAJOR.MINOR+1.0-rc.1`.
|
||||||
|
- The commit message should be "Bump version to MAJOR.MINOR+1.0-rc.1".
|
||||||
|
- [ ] Add a tag to the `HEAD` commit in the `release/MAJOR.MINOR+1` branch.
|
||||||
|
- The tag name should be `vMAJOR.MINOR+1.0-rc.1`
|
||||||
|
- Use message "Release MAJOR.MINOR+1.0 rc.1".
|
||||||
|
- Make sure the tag is signed, for extra safety use the explicit `--sign` flag.
|
||||||
|
- [ ] Push the `release/MAJOR.MINOR` branch and new tag to the `bitcoindevkit/bdk` repo.
|
||||||
|
- Use `git push --tags` option to push the new `vMAJOR.MINOR+1.0-rc.1` tag.
|
||||||
|
|
||||||
|
If any issues need to be fixed before the *MAJOR.MINOR+1.0* version is released:
|
||||||
|
|
||||||
|
- [ ] Merge fix PRs to the `master` branch.
|
||||||
|
- [ ] Git cherry-pick fix commits to the `release/MAJOR.MINOR+1` branch.
|
||||||
|
- [ ] Verify fixes in `release/MAJOR.MINOR+1` branch.
|
||||||
|
- [ ] Bump the `release/MAJOR.MINOR+1` branch to `MAJOR.MINOR+1.0-rc.x+1` version.
|
||||||
|
- Change the `Cargo.toml` version value to `MAJOR.MINOR+1.0-rc.x+1`.
|
||||||
|
- The commit message should be "Bump version to MAJOR.MINOR+1.0-rc.x+1".
|
||||||
|
- [ ] Add a tag to the `HEAD` commit in the `release/MAJOR.MINOR+1` branch.
|
||||||
|
- The tag name should be `vMAJOR.MINOR+1.0-rc.x+1`, where x is the current release candidate number.
|
||||||
|
- Use tag message "Release MAJOR.MINOR+1.0 rc.x+1".
|
||||||
|
- Make sure the tag is signed, for extra safety use the explicit `--sign` flag.
|
||||||
|
- [ ] Push the new tag to the `bitcoindevkit/bdk` repo.
|
||||||
|
- Use `git push --tags` option to push the new `vMAJOR.MINOR+1.0-rc.x+1` tag.
|
||||||
|
|
||||||
|
#### On the day of the release
|
||||||
|
|
||||||
|
Tag and publish new release:
|
||||||
|
|
||||||
|
- [ ] Bump the `release/MAJOR.MINOR+1` branch to `MAJOR.MINOR+1.0` version.
|
||||||
|
- Change the `Cargo.toml` version value to `MAJOR.MINOR+1.0`.
|
||||||
|
- The commit message should be "Bump version to MAJOR.MINOR+1.0".
|
||||||
|
- [ ] Add a tag to the `HEAD` commit in the `release/MAJOR.MINOR+1` branch.
|
||||||
|
- The tag name should be `vMAJOR.MINOR+1.0`
|
||||||
|
- The first line of the tag message should be "Release MAJOR.MINOR+1.0".
|
||||||
|
- In the body of the tag message put a copy of the **Summary** and **Changelog** for the release.
|
||||||
|
- Make sure the tag is signed, for extra safety use the explicit `--sign` flag.
|
||||||
|
- [ ] Wait for the CI to finish one last time.
|
||||||
|
- [ ] Push the new tag to the `bitcoindevkit/bdk` repo.
|
||||||
|
- [ ] Publish **all** the updated crates to crates.io.
|
||||||
|
- [ ] Create the release on GitHub.
|
||||||
|
- Go to "tags", click on the dots on the right and select "Create Release".
|
||||||
|
- Set the title to `Release MAJOR.MINOR+1.0`.
|
||||||
|
- In the release notes body put the **Summary** and **Changelog**.
|
||||||
|
- Use the "+ Auto-generate release notes" button to add details from included PRs.
|
||||||
|
- Until we reach a `1.0.0` release check the "Pre-release" box.
|
||||||
|
- [ ] Make sure the new release shows up on [crates.io] and that the docs are built correctly on [docs.rs].
|
||||||
|
- [ ] Announce the release, using the **Summary**, on Discord, Twitter and Mastodon.
|
||||||
|
- [ ] Celebrate 🎉
|
||||||
|
|
||||||
|
[Semantic Versioning]: https://semver.org/
|
||||||
|
[crates.io]: https://crates.io/crates/bdk
|
||||||
|
[docs.rs]: https://docs.rs/bdk/latest/bdk
|
||||||
|
["keep a changelog"]: https://keepachangelog.com/en/1.0.0/
|
||||||
71
.github/ISSUE_TEMPLATE/patch_release.md
vendored
Normal file
71
.github/ISSUE_TEMPLATE/patch_release.md
vendored
Normal file
@@ -0,0 +1,71 @@
|
|||||||
|
---
|
||||||
|
name: Patch Release
|
||||||
|
about: Create a new patch release [for release managers only]
|
||||||
|
title: 'Release MAJOR.MINOR.PATCH+1'
|
||||||
|
labels: 'release'
|
||||||
|
assignees: ''
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Create a new patch release
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
<--release summary to be used in announcements-->
|
||||||
|
|
||||||
|
### Commit
|
||||||
|
|
||||||
|
<--latest commit ID to include in this release-->
|
||||||
|
|
||||||
|
### Changelog
|
||||||
|
|
||||||
|
<--add notices from PRs merged since the prior release, see ["keep a changelog"]-->
|
||||||
|
|
||||||
|
### Checklist
|
||||||
|
|
||||||
|
Release numbering must follow [Semantic Versioning]. These steps assume the current `master`
|
||||||
|
branch **development** version is *MAJOR.MINOR.PATCH*.
|
||||||
|
|
||||||
|
### On the day of the patch release
|
||||||
|
|
||||||
|
Change the `master` branch to the new PATCH+1 version:
|
||||||
|
|
||||||
|
- [ ] Switch to the `master` branch.
|
||||||
|
- [ ] Create a new PR branch called `bump_dev_MAJOR_MINOR_PATCH+1`, eg. `bump_dev_0_22_1`.
|
||||||
|
- [ ] Bump the `bump_dev_MAJOR_MINOR` branch to the next development PATCH+1 version.
|
||||||
|
- Change the `Cargo.toml` version value to `MAJOR.MINOR.PATCH+1`.
|
||||||
|
- Update the `CHANGELOG.md` file.
|
||||||
|
- The commit message should be "Bump version to MAJOR.MINOR.PATCH+1".
|
||||||
|
- [ ] Create PR and merge the `bump_dev_MAJOR_MINOR_PATCH+1` branch to `master`.
|
||||||
|
- Title PR "Bump version to MAJOR.MINOR.PATCH+1".
|
||||||
|
|
||||||
|
Cherry-pick, tag and publish new PATCH+1 release:
|
||||||
|
|
||||||
|
- [ ] Merge fix PRs to the `master` branch.
|
||||||
|
- [ ] Git cherry-pick fix commits to the `release/MAJOR.MINOR` branch to be patched.
|
||||||
|
- [ ] Verify fixes in `release/MAJOR.MINOR` branch.
|
||||||
|
- [ ] Bump the `release/MAJOR.MINOR.PATCH+1` branch to `MAJOR.MINOR.PATCH+1` version.
|
||||||
|
- Change the `Cargo.toml` version value to `MAJOR.MINOR.MINOR.PATCH+1`.
|
||||||
|
- The commit message should be "Bump version to MAJOR.MINOR.PATCH+1".
|
||||||
|
- [ ] Add a tag to the `HEAD` commit in the `release/MAJOR.MINOR` branch.
|
||||||
|
- The tag name should be `vMAJOR.MINOR.PATCH+1`
|
||||||
|
- The first line of the tag message should be "Release MAJOR.MINOR.PATCH+1".
|
||||||
|
- In the body of the tag message put a copy of the **Summary** and **Changelog** for the release.
|
||||||
|
- Make sure the tag is signed, for extra safety use the explicit `--sign` flag.
|
||||||
|
- [ ] Wait for the CI to finish one last time.
|
||||||
|
- [ ] Push the new tag to the `bitcoindevkit/bdk` repo.
|
||||||
|
- [ ] Publish **all** the updated crates to crates.io.
|
||||||
|
- [ ] Create the release on GitHub.
|
||||||
|
- Go to "tags", click on the dots on the right and select "Create Release".
|
||||||
|
- Set the title to `Release MAJOR.MINOR.PATCH+1`.
|
||||||
|
- In the release notes body put the **Summary** and **Changelog**.
|
||||||
|
- Use the "+ Auto-generate release notes" button to add details from included PRs.
|
||||||
|
- Until we reach a `1.0.0` release check the "Pre-release" box.
|
||||||
|
- [ ] Make sure the new release shows up on [crates.io] and that the docs are built correctly on [docs.rs].
|
||||||
|
- [ ] Announce the release, using the **Summary**, on Discord, Twitter and Mastodon.
|
||||||
|
- [ ] Celebrate 🎉
|
||||||
|
|
||||||
|
[Semantic Versioning]: https://semver.org/
|
||||||
|
[crates.io]: https://crates.io/crates/bdk
|
||||||
|
[docs.rs]: https://docs.rs/bdk/latest/bdk
|
||||||
|
["keep a changelog"]: https://keepachangelog.com/en/1.0.0/
|
||||||
6
.github/pull_request_template.md
vendored
6
.github/pull_request_template.md
vendored
@@ -9,6 +9,11 @@
|
|||||||
<!-- In this section you can include notes directed to the reviewers, like explaining why some parts
|
<!-- In this section you can include notes directed to the reviewers, like explaining why some parts
|
||||||
of the PR were done in a specific way -->
|
of the PR were done in a specific way -->
|
||||||
|
|
||||||
|
### Changelog notice
|
||||||
|
|
||||||
|
<!-- Notice the release manager should include in the release tag message changelog -->
|
||||||
|
<!-- See https://keepachangelog.com/en/1.0.0/ for examples -->
|
||||||
|
|
||||||
### Checklists
|
### Checklists
|
||||||
|
|
||||||
#### All Submissions:
|
#### All Submissions:
|
||||||
@@ -21,7 +26,6 @@ of the PR were done in a specific way -->
|
|||||||
|
|
||||||
* [ ] I've added tests for the new feature
|
* [ ] I've added tests for the new feature
|
||||||
* [ ] I've added docs for the new feature
|
* [ ] I've added docs for the new feature
|
||||||
* [ ] I've updated `CHANGELOG.md`
|
|
||||||
|
|
||||||
#### Bugfixes:
|
#### Bugfixes:
|
||||||
|
|
||||||
|
|||||||
3
.github/workflows/audit.yml
vendored
3
.github/workflows/audit.yml
vendored
@@ -2,6 +2,9 @@ name: Audit
|
|||||||
|
|
||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
paths:
|
paths:
|
||||||
- '**/Cargo.toml'
|
- '**/Cargo.toml'
|
||||||
- '**/Cargo.lock'
|
- '**/Cargo.lock'
|
||||||
|
|||||||
64
.github/workflows/code_coverage.yml
vendored
64
.github/workflows/code_coverage.yml
vendored
@@ -1,37 +1,69 @@
|
|||||||
on: [push]
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
|
pull_request:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
|
|
||||||
name: Code Coverage
|
name: Code Coverage
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
|
|
||||||
Codecov:
|
Codecov:
|
||||||
name: Code Coverage
|
name: Code Coverage
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
env:
|
env:
|
||||||
CARGO_INCREMENTAL: '0'
|
RUSTFLAGS: "-Cinstrument-coverage"
|
||||||
RUSTFLAGS: '-Zprofile -Ccodegen-units=1 -Cinline-threshold=0 -Clink-dead-code -Coverflow-checks=off'
|
RUSTDOCFLAGS: "-Cinstrument-coverage"
|
||||||
RUSTDOCFLAGS: '-Zprofile -Ccodegen-units=1 -Cinline-threshold=0 -Clink-dead-code -Coverflow-checks=off'
|
LLVM_PROFILE_FILE: "report-%p-%m.profraw"
|
||||||
|
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
|
- name: Install lcov tools
|
||||||
|
run: sudo apt-get install lcov -y
|
||||||
- name: Install rustup
|
- name: Install rustup
|
||||||
run: curl https://sh.rustup.rs -sSf | sh -s -- -y
|
run: curl https://sh.rustup.rs -sSf | sh -s -- -y
|
||||||
- name: Set default toolchain
|
- name: Set default toolchain
|
||||||
run: rustup default nightly
|
run: rustup default nightly
|
||||||
- name: Set profile
|
- name: Set profile
|
||||||
run: rustup set profile minimal
|
run: rustup set profile minimal
|
||||||
|
- name: Add llvm tools
|
||||||
|
run: rustup component add llvm-tools-preview
|
||||||
- name: Update toolchain
|
- name: Update toolchain
|
||||||
run: rustup update
|
run: rustup update
|
||||||
- name: Test
|
- name: Cache cargo
|
||||||
run: cargo test --features all-keys,compiler,esplora,ureq,compact_filters --no-default-features
|
uses: actions/cache@v3
|
||||||
|
|
||||||
- id: coverage
|
|
||||||
name: Generate coverage
|
|
||||||
uses: actions-rs/grcov@v0.1.5
|
|
||||||
|
|
||||||
- name: Upload coverage to Codecov
|
|
||||||
uses: codecov/codecov-action@v2
|
|
||||||
with:
|
with:
|
||||||
file: ${{ steps.coverage.outputs.report }}
|
path: |
|
||||||
directory: ./coverage/reports/
|
~/.cargo/bin/
|
||||||
|
~/.cargo/registry/index/
|
||||||
|
~/.cargo/registry/cache/
|
||||||
|
~/.cargo/git/db/
|
||||||
|
key: ${{ runner.os }}-cargo-${{ hashFiles('**/Cargo.lock') }}
|
||||||
|
- name: Install grcov
|
||||||
|
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
||||||
|
- name: Test
|
||||||
|
# WARNING: this is not testing the following features: test-esplora, test-hardware-signer, async-interface
|
||||||
|
# This is because some of our features are mutually exclusive, and generating various reports and
|
||||||
|
# merging them doesn't seem to be working very well.
|
||||||
|
# For more info, see:
|
||||||
|
# - https://github.com/bitcoindevkit/bdk/issues/696
|
||||||
|
# - https://github.com/bitcoindevkit/bdk/pull/748#issuecomment-1242721040
|
||||||
|
run: cargo test --features all-keys,compact_filters,compiler,key-value-db,sqlite,sqlite-bundled,test-electrum,test-rpc,verify
|
||||||
|
- name: Run grcov
|
||||||
|
run: mkdir coverage; grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --ignore '/*' -o ./coverage/lcov.info
|
||||||
|
- name: Generate HTML coverage report
|
||||||
|
run: genhtml -o coverage-report.html ./coverage/lcov.info
|
||||||
|
|
||||||
|
- name: Coveralls upload
|
||||||
|
uses: coverallsapp/github-action@master
|
||||||
|
with:
|
||||||
|
github-token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
- name: Upload artifact
|
||||||
|
uses: actions/upload-artifact@v2
|
||||||
|
with:
|
||||||
|
name: coverage-report
|
||||||
|
path: coverage-report.html
|
||||||
|
|||||||
99
.github/workflows/cont_integration.yml
vendored
99
.github/workflows/cont_integration.yml
vendored
@@ -1,4 +1,12 @@
|
|||||||
on: [push, pull_request]
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
|
pull_request:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
|
|
||||||
name: CI
|
name: CI
|
||||||
|
|
||||||
@@ -10,23 +18,23 @@ jobs:
|
|||||||
strategy:
|
strategy:
|
||||||
matrix:
|
matrix:
|
||||||
rust:
|
rust:
|
||||||
- version: 1.60.0 # STABLE
|
- version: 1.65.0 # STABLE
|
||||||
clippy: true
|
clippy: true
|
||||||
- version: 1.56.1 # MSRV
|
- version: 1.57.0 # MSRV
|
||||||
features:
|
features:
|
||||||
- default
|
- default
|
||||||
- minimal
|
- minimal
|
||||||
- all-keys
|
- all-keys
|
||||||
- minimal,use-esplora-ureq
|
- minimal,use-esplora-blocking
|
||||||
- key-value-db
|
- key-value-db
|
||||||
- electrum
|
- electrum
|
||||||
- compact_filters
|
- compact_filters
|
||||||
- esplora,ureq,key-value-db,electrum
|
- use-esplora-blocking,key-value-db,electrum
|
||||||
- compiler
|
- compiler
|
||||||
- rpc
|
- rpc
|
||||||
- verify
|
- verify
|
||||||
- async-interface
|
- async-interface
|
||||||
- use-esplora-reqwest
|
- use-esplora-async
|
||||||
- sqlite
|
- sqlite
|
||||||
- sqlite-bundled
|
- sqlite-bundled
|
||||||
steps:
|
steps:
|
||||||
@@ -51,6 +59,27 @@ jobs:
|
|||||||
run: rustup component add clippy
|
run: rustup component add clippy
|
||||||
- name: Update toolchain
|
- name: Update toolchain
|
||||||
run: rustup update
|
run: rustup update
|
||||||
|
- name: Pin dependencies for MSRV
|
||||||
|
if: matrix.rust.version == '1.57.0'
|
||||||
|
run: |
|
||||||
|
cargo update -p log --precise "0.4.18"
|
||||||
|
cargo update -p tempfile --precise "3.6.0"
|
||||||
|
cargo update -p hashlink --precise "0.8.1"
|
||||||
|
cargo update -p regex --precise "1.7.3"
|
||||||
|
cargo update -p zip:0.6.6 --precise "0.6.3"
|
||||||
|
cargo update -p rustix --precise "0.37.23"
|
||||||
|
cargo update -p tokio --precise "1.29.1"
|
||||||
|
cargo update -p tokio-util --precise "0.7.8"
|
||||||
|
cargo update -p cc --precise "1.0.81"
|
||||||
|
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||||
|
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||||
|
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||||
|
cargo update -p reqwest --precise "0.11.18"
|
||||||
|
cargo update -p h2 --precise "0.3.20"
|
||||||
|
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||||
|
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||||
|
cargo update -p byteorder --precise "1.4.3"
|
||||||
|
cargo update -p webpki --precise "0.22.2"
|
||||||
- name: Build
|
- name: Build
|
||||||
run: cargo build --features ${{ matrix.features }} --no-default-features
|
run: cargo build --features ${{ matrix.features }} --no-default-features
|
||||||
- name: Clippy
|
- name: Clippy
|
||||||
@@ -100,10 +129,10 @@ jobs:
|
|||||||
features: test-rpc-legacy
|
features: test-rpc-legacy
|
||||||
- name: esplora
|
- name: esplora
|
||||||
testprefix: esplora
|
testprefix: esplora
|
||||||
features: test-esplora,use-esplora-reqwest,verify
|
features: test-esplora,use-esplora-async,verify
|
||||||
- name: esplora
|
- name: esplora
|
||||||
testprefix: esplora
|
testprefix: esplora
|
||||||
features: test-esplora,use-esplora-ureq,verify
|
features: test-esplora,use-esplora-blocking,verify
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
@@ -146,7 +175,7 @@ jobs:
|
|||||||
- run: sudo apt-get update || exit 1
|
- run: sudo apt-get update || exit 1
|
||||||
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
||||||
- name: Set default toolchain
|
- name: Set default toolchain
|
||||||
run: rustup default 1.56.1 # STABLE
|
run: rustup default 1.65.0 # STABLE
|
||||||
- name: Set profile
|
- name: Set profile
|
||||||
run: rustup set profile minimal
|
run: rustup set profile minimal
|
||||||
- name: Add target wasm32
|
- name: Add target wasm32
|
||||||
@@ -154,7 +183,7 @@ jobs:
|
|||||||
- name: Update toolchain
|
- name: Update toolchain
|
||||||
run: rustup update
|
run: rustup update
|
||||||
- name: Check
|
- name: Check
|
||||||
run: cargo check --target wasm32-unknown-unknown --features use-esplora-reqwest --no-default-features
|
run: cargo check --target wasm32-unknown-unknown --features async-interface,use-esplora-async,dev-getrandom-wasm --no-default-features
|
||||||
|
|
||||||
fmt:
|
fmt:
|
||||||
name: Rust fmt
|
name: Rust fmt
|
||||||
@@ -172,3 +201,53 @@ jobs:
|
|||||||
run: rustup update
|
run: rustup update
|
||||||
- name: Check fmt
|
- name: Check fmt
|
||||||
run: cargo fmt --all -- --config format_code_in_doc_comments=true --check
|
run: cargo fmt --all -- --config format_code_in_doc_comments=true --check
|
||||||
|
|
||||||
|
test_hardware_wallet:
|
||||||
|
runs-on: ubuntu-20.04
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
rust:
|
||||||
|
- version: 1.65.0 # STABLE
|
||||||
|
- version: 1.57.0 # MSRV
|
||||||
|
steps:
|
||||||
|
- name: Checkout
|
||||||
|
uses: actions/checkout@v3
|
||||||
|
- name: Build simulator image
|
||||||
|
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||||
|
- name: Run simulator image
|
||||||
|
run: docker run --name simulator --network=host hwi/ledger_emulator &
|
||||||
|
- name: Install Python
|
||||||
|
uses: actions/setup-python@v4
|
||||||
|
with:
|
||||||
|
python-version: '3.9'
|
||||||
|
- name: Install python dependencies
|
||||||
|
run: pip install hwi==2.1.1 protobuf==3.20.1
|
||||||
|
- name: Set default toolchain
|
||||||
|
run: rustup default ${{ matrix.rust.version }}
|
||||||
|
- name: Set profile
|
||||||
|
run: rustup set profile minimal
|
||||||
|
- name: Update toolchain
|
||||||
|
run: rustup update
|
||||||
|
- name: Pin dependencies for MSRV
|
||||||
|
if: matrix.rust.version == '1.57.0'
|
||||||
|
run: |
|
||||||
|
cargo update -p log --precise "0.4.18"
|
||||||
|
cargo update -p tempfile --precise "3.6.0"
|
||||||
|
cargo update -p hashlink --precise "0.8.1"
|
||||||
|
cargo update -p regex --precise "1.7.3"
|
||||||
|
cargo update -p zip:0.6.6 --precise "0.6.3"
|
||||||
|
cargo update -p rustix --precise "0.37.23"
|
||||||
|
cargo update -p tokio --precise "1.29.1"
|
||||||
|
cargo update -p tokio-util --precise "0.7.8"
|
||||||
|
cargo update -p cc --precise "1.0.81"
|
||||||
|
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||||
|
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||||
|
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||||
|
cargo update -p reqwest --precise "0.11.18"
|
||||||
|
cargo update -p h2 --precise "0.3.20"
|
||||||
|
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||||
|
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||||
|
cargo update -p byteorder --precise "1.4.3"
|
||||||
|
cargo update -p webpki --precise "0.22.2"
|
||||||
|
- name: Test
|
||||||
|
run: cargo test --features test-hardware-signer
|
||||||
|
|||||||
14
.github/workflows/nightly_docs.yml
vendored
14
.github/workflows/nightly_docs.yml
vendored
@@ -1,6 +1,14 @@
|
|||||||
name: Publish Nightly Docs
|
name: Publish Nightly Docs
|
||||||
|
|
||||||
on: [push, pull_request]
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
|
pull_request:
|
||||||
|
branches:
|
||||||
|
- 'master'
|
||||||
|
- 'release/*'
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build_docs:
|
build_docs:
|
||||||
@@ -18,13 +26,13 @@ jobs:
|
|||||||
target
|
target
|
||||||
key: nightly-docs-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
key: nightly-docs-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
||||||
- name: Set default toolchain
|
- name: Set default toolchain
|
||||||
run: rustup default nightly-2022-01-25
|
run: rustup default nightly-2022-12-14
|
||||||
- name: Set profile
|
- name: Set profile
|
||||||
run: rustup set profile minimal
|
run: rustup set profile minimal
|
||||||
- name: Update toolchain
|
- name: Update toolchain
|
||||||
run: rustup update
|
run: rustup update
|
||||||
- name: Build docs
|
- name: Build docs
|
||||||
run: cargo rustdoc --verbose --features=compiler,electrum,esplora,ureq,compact_filters,key-value-db,all-keys,sqlite -- --cfg docsrs -Dwarnings
|
run: cargo rustdoc --verbose --features=compiler,electrum,esplora,use-esplora-blocking,compact_filters,rpc,key-value-db,sqlite,all-keys,verify,hardware-signer -- --cfg docsrs -Dwarnings
|
||||||
- name: Upload artifact
|
- name: Upload artifact
|
||||||
uses: actions/upload-artifact@v2
|
uses: actions/upload-artifact@v2
|
||||||
with:
|
with:
|
||||||
|
|||||||
1
.gitignore
vendored
1
.gitignore
vendored
@@ -1,5 +1,6 @@
|
|||||||
/target
|
/target
|
||||||
Cargo.lock
|
Cargo.lock
|
||||||
|
/.vscode
|
||||||
|
|
||||||
*.swp
|
*.swp
|
||||||
.idea
|
.idea
|
||||||
|
|||||||
255
CHANGELOG.md
255
CHANGELOG.md
@@ -1,12 +1,202 @@
|
|||||||
# Changelog
|
# Changelog
|
||||||
All notable changes to this project will be documented in this file.
|
|
||||||
|
All notable changes to this project can be found here and in each release's git tag and can be viewed with `git tag -ln100 "v*"`. See also [DEVELOPMENT_CYCLE.md](DEVELOPMENT_CYCLE.md) for more details.
|
||||||
|
|
||||||
|
Contributors do not need to change this file but do need to add changelog details in their PR descriptions. The person making the next release will collect changelog details from included PRs and edit this file prior to each release.
|
||||||
|
|
||||||
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/),
|
||||||
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
## [Unreleased]
|
## [Unreleased]
|
||||||
|
|
||||||
## [v0.21.0] - [v0.20.0]
|
## [v0.29.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This maintenance release updates our `rust-bitcoin` dependency to 0.30.x and fixes a wallet balance bug when a wallet has more than one coinbase transaction.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Update rust-bitcoin to 0.30 #1071
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Fix a bug when syncing coinbase utxos on electrum #1090
|
||||||
|
|
||||||
|
## [v0.28.2]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
Reverts the 0.28.1 esplora-client version update from 0.5.0 back to 0.4.0.
|
||||||
|
|
||||||
|
## [v0.28.1]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This patch release backports (from the BDK 1.0 dev branch) a fix for a bug in the policy condition calculation and adds a new taproot single key descriptor template (BIP-86). The policy condition calculation bug can cause issues when a policy subtree fails due to missing info even if it's not selected when creating a new transaction, errors on unused policy paths are now ignored.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Backported #932 fix for policy condition calculation #1008
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Backported #840 taproot descriptor template (BIP-86) #1033
|
||||||
|
|
||||||
|
## [v0.28.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
Disable default-features for rust-bitcoin and rust-miniscript dependencies, and for rust-esplora-client optional dependency. New default `std` feature must be enabled unless building for wasm.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Bump bip39 crate to v2.0.0 #875
|
||||||
|
- Set default-features = false for rust-bitcoin and rust-miniscript #882
|
||||||
|
- Update esplora client dependency to version 0.4 #884
|
||||||
|
- Added new `std` feature as part of default features #930
|
||||||
|
|
||||||
|
## [v0.27.1]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
Fixes [RUSTSEC-2022-0090], this issue is only applicable if you are using the optional sqlite database feature.
|
||||||
|
|
||||||
|
[RUSTSEC-2022-0090]: https://rustsec.org/advisories/RUSTSEC-2022-0090
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Update optional sqlite dependency from 0.27.0 to 0.28.0. #867
|
||||||
|
|
||||||
|
## [v0.27.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
A maintenance release with a bump in project MSRV to 1.57.0, updated dependence and a few developer oriented improvements. Improvements include better error formatting, don't default to async/await for wasm32 and adding derived PartialEq and Eq on SyncTime.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Improve display error formatting #814
|
||||||
|
- Don't default to use async/await on wasm32 #831
|
||||||
|
- Project MSRV changed from 1.56.1 to 1.57.0 #842
|
||||||
|
- Update rust-miniscript dependency to latest bug fix release 9.0 #844
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Derive PartialEq, Eq on SyncTime #837
|
||||||
|
|
||||||
|
## [v0.26.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This release improves Fulcrum electrum server compatibility and fixes public descriptor template key origin paths. We also snuck in small enhancements to configure the electrum client to validate the domain using SSL and sort TransactionDetails by block height and timestamp.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Make electrum blockchain client `save_tx` function order independent to work with Fulcrum servers. #808
|
||||||
|
- Fix wrong testnet key origin path in public descriptor templates. #818
|
||||||
|
- Make README.md code examples compile without errors. #820
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Bump `hwi` dependency to `0.4.0`. #825
|
||||||
|
- Bump `esplora-client` dependency to `0.3` #830
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- For electrum blockchain client, allow user to configure whether to validate the domain using SSL. #805
|
||||||
|
- Implement ordering for `TransactionDetails`. #812
|
||||||
|
|
||||||
|
## [v0.25.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This release fixes slow sync time and big script_pubkeys table with SQLite, the wallet rescan height for the FullyNodedExport and setting the network for keys in the KeyMap when using descriptor templates. Also added are new blockchain and mnemonic examples.
|
||||||
|
|
||||||
|
### Fixed
|
||||||
|
|
||||||
|
- Slow sync time and big script_pubkeys table with SQLite.
|
||||||
|
- Wallet rescan height for the FullyNodedExport.
|
||||||
|
- Setting the network for keys in the KeyMap when using descriptor templates.
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Examples for connecting to Esplora, Electrum Server, Neutrino and Bitcoin Core.
|
||||||
|
- Example for using a mnemonic in a descriptors.
|
||||||
|
|
||||||
|
## [v0.24.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This release contains important dependency updates for `rust-bitcoin` to `0.29` and `rust-miniscript` to `8.0`, plus related crates that also depend on the latest version of `rust-bitcoin`. The release also includes a breaking change to the BDK signer which now produces low-R signatures by default, saving one byte. A bug was found in the `get_checksum` and `get_checksum_bytes` functions, which are now deprecated in favor of fixed versions called `calc_checksum` and `calc_checksum_bytes`. And finally a new `hardware-signer` features was added that re-exports the `hwi` crate, along with a new `hardware_signers.rs` example file.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Updated dependency versions for `rust-bitcoin` to `0.29` and `rust-miniscript` to `8.0`, plus all related crates. @afilini #770
|
||||||
|
- BDK Signer now produces low-R signatures by default, saving one byte. If you want to preserve the original behavior, set allow_grinding in the SignOptions to false. @vladimirfomene #779
|
||||||
|
- Deprecated `get_checksum`and `get_checksum_bytes` due to bug where they calculates the checksum of a descriptor that already has a checksum. Use `calc_checksum` and `calc_checksum_bytes` instead. @evanlinjin #765
|
||||||
|
- Remove deprecated "address validators". @afilini #770
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- New `calc_checksum` and `calc_checksum_bytes`, replace deprecated `get_checksum` and `get_checksum_bytes`. @evanlinjin #765
|
||||||
|
- Re-export the hwi crate when the feature hardware-signer is on. @danielabrozzoni #758
|
||||||
|
- New examples/hardware_signer.rs. @danielabrozzoni #758
|
||||||
|
- Make psbt module public to expose PsbtUtils trait to downstream projects. @notmandatory #782
|
||||||
|
|
||||||
|
## [v0.23.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This release brings new utilities functions on PSBTs like `fee_amount()` and `fee_rate()` and migrates BDK to use our new external esplora client library.
|
||||||
|
As always many bug fixes, docs and tests improvement are also included.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Update electrum-client to 0.11.0 by @afilini in https://github.com/bitcoindevkit/bdk/pull/737
|
||||||
|
- Change configs for source-base code coverage by @wszdexdrf in https://github.com/bitcoindevkit/bdk/pull/708
|
||||||
|
- Improve docs regarding PSBT finalization by @tnull in https://github.com/bitcoindevkit/bdk/pull/753
|
||||||
|
- Update compiler example to a Policy example by @rajarshimaitra in https://github.com/bitcoindevkit/bdk/pull/730
|
||||||
|
- Fix the release process by @afilini in https://github.com/bitcoindevkit/bdk/pull/754
|
||||||
|
- Remove redundant duplicated keys check by @afilini in https://github.com/bitcoindevkit/bdk/pull/761
|
||||||
|
- Remove genesis_block lazy initialization by @shobitb in https://github.com/bitcoindevkit/bdk/pull/756
|
||||||
|
- Fix `Wallet::descriptor_checksum` to actually return the checksum by @evanlinjin in https://github.com/bitcoindevkit/bdk/pull/763
|
||||||
|
- Use the esplora client crate by @afilini in https://github.com/bitcoindevkit/bdk/pull/764
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Run code coverage on every PR by @danielabrozzoni in https://github.com/bitcoindevkit/bdk/pull/747
|
||||||
|
- Add psbt_signer.rs example by @notmandatory in https://github.com/bitcoindevkit/bdk/pull/744
|
||||||
|
- Add fee_amount() and fee_rate() functions to PsbtUtils trait by @notmandatory in https://github.com/bitcoindevkit/bdk/pull/728
|
||||||
|
- Add tests to improve coverage by @vladimirfomene in https://github.com/bitcoindevkit/bdk/pull/745
|
||||||
|
- Enable signing taproot transactions with only `non_witness_utxos` by @afilini in https://github.com/bitcoindevkit/bdk/pull/757
|
||||||
|
- Add datatype for is_spent sqlite column by @vladimirfomene in https://github.com/bitcoindevkit/bdk/pull/713
|
||||||
|
- Add vscode filter to gitignore by @evanlinjin in https://github.com/bitcoindevkit/bdk/pull/762
|
||||||
|
|
||||||
|
## [v0.22.0]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
This release brings support for hardware signers on desktop through the HWI library.
|
||||||
|
It also includes fixes and improvements which are part of our ongoing effort of integrating
|
||||||
|
BDK and LDK together.
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- FeeRate function name as_sat_vb to as_sat_per_vb. #678
|
||||||
|
- Verify signatures after signing. #718
|
||||||
|
- Dependency electrum-client to 0.11.0. #737
|
||||||
|
|
||||||
|
### Added
|
||||||
|
|
||||||
|
- Functions to create FeeRate from sats/kvbytes and sats/kwu. #678
|
||||||
|
- Custom hardware wallet signer HwiSigner in wallet::hardwaresigner module. #682
|
||||||
|
- Function allow_dust on TxBuilder. #689
|
||||||
|
- Implementation of Deref<Target=UrlClient> for EsploraBlockchain. #722
|
||||||
|
- Implementation of Deref<Target=Client> for ElectrumBlockchain #705
|
||||||
|
- Implementation of Deref<Target=Client> for RpcBlockchain. #731
|
||||||
|
|
||||||
|
## [v0.21.0]
|
||||||
|
|
||||||
- Add `descriptor::checksum::get_checksum_bytes` method.
|
- Add `descriptor::checksum::get_checksum_bytes` method.
|
||||||
- Add `Excess` enum to handle remaining amount after coin selection.
|
- Add `Excess` enum to handle remaining amount after coin selection.
|
||||||
@@ -19,25 +209,25 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
- New `RpcBlockchain` implementation with various fixes.
|
- New `RpcBlockchain` implementation with various fixes.
|
||||||
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
||||||
|
|
||||||
## [v0.20.0] - [v0.19.0]
|
## [v0.20.0]
|
||||||
|
|
||||||
- New MSRV set to `1.56.1`
|
- New MSRV set to `1.56.1`
|
||||||
- Fee sniping discouraging through nLockTime - if the user specifies a `current_height`, we use that as a nlocktime, otherwise we use the last sync height (or 0 if we never synced)
|
- Fee sniping discouraging through nLockTime - if the user specifies a `current_height`, we use that as a nlocktime, otherwise we use the last sync height (or 0 if we never synced)
|
||||||
- Fix hang when `ElectrumBlockchainConfig::stop_gap` is zero.
|
- Fix hang when `ElectrumBlockchainConfig::stop_gap` is zero.
|
||||||
- Set coin type in BIP44, BIP49, and BIP84 templates
|
- Set coin type in BIP44, BIP49, and BIP84 templates
|
||||||
- Get block hash given a block height - A `get_block_hash` method is now defined on the `GetBlockHash` trait and implemented on every blockchain backend. This method expects a block height and returns the corresponding block hash.
|
- Get block hash given a block height - A `get_block_hash` method is now defined on the `GetBlockHash` trait and implemented on every blockchain backend. This method expects a block height and returns the corresponding block hash.
|
||||||
- Add `remove_partial_sigs` and `try_finalize` to `SignOptions`
|
- Add `remove_partial_sigs` and `try_finalize` to `SignOptions`
|
||||||
- Deprecate `AddressValidator`
|
- Deprecate `AddressValidator`
|
||||||
- Fix Electrum wallet sync potentially causing address index decrement - compare proposed index and current index before applying batch operations during sync.
|
- Fix Electrum wallet sync potentially causing address index decrement - compare proposed index and current index before applying batch operations during sync.
|
||||||
|
|
||||||
## [v0.19.0] - [v0.18.0]
|
## [v0.19.0]
|
||||||
|
|
||||||
- added `OldestFirstCoinSelection` impl to `CoinSelectionAlgorithm`
|
- added `OldestFirstCoinSelection` impl to `CoinSelectionAlgorithm`
|
||||||
- New MSRV set to `1.56`
|
- New MSRV set to `1.56`
|
||||||
- Unpinned tokio to `1`
|
- Unpinned tokio to `1`
|
||||||
- Add traits to reuse `Blockchain`s across multiple wallets (`BlockchainFactory` and `StatelessBlockchain`).
|
- Add traits to reuse `Blockchain`s across multiple wallets (`BlockchainFactory` and `StatelessBlockchain`).
|
||||||
- Upgrade to rust-bitcoin `0.28`
|
- Upgrade to rust-bitcoin `0.28`
|
||||||
- If using the `sqlite-db` feature all cached wallet data is deleted due to a possible UTXO inconsistency, a wallet.sync will recreate it
|
- If using the `sqlite-db` feature all cached wallet data is deleted due to a possible UTXO inconsistency, a wallet.sync will recreate it
|
||||||
- Update `PkOrF` in the policy module to become an enum
|
- Update `PkOrF` in the policy module to become an enum
|
||||||
- Add experimental support for Taproot, including:
|
- Add experimental support for Taproot, including:
|
||||||
- Support for `tr()` descriptors with complex tapscript trees
|
- Support for `tr()` descriptors with complex tapscript trees
|
||||||
@@ -46,7 +236,7 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
- Support for `tr()` descriptors in the `descriptor!()` macro
|
- Support for `tr()` descriptors in the `descriptor!()` macro
|
||||||
- Add support for Bitcoin Core 23.0 when using the `rpc` blockchain
|
- Add support for Bitcoin Core 23.0 when using the `rpc` blockchain
|
||||||
|
|
||||||
## [v0.18.0] - [v0.17.0]
|
## [v0.18.0]
|
||||||
|
|
||||||
- Add `sqlite-bundled` feature for deployments that need a bundled version of sqlite, i.e. for mobile platforms.
|
- Add `sqlite-bundled` feature for deployments that need a bundled version of sqlite, i.e. for mobile platforms.
|
||||||
- Added `Wallet::get_signers()`, `Wallet::descriptor_checksum()` and `Wallet::get_address_validators()`, exposed the `AsDerived` trait.
|
- Added `Wallet::get_signers()`, `Wallet::descriptor_checksum()` and `Wallet::get_address_validators()`, exposed the `AsDerived` trait.
|
||||||
@@ -54,9 +244,9 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
- Add `keychain: KeychainKind` to `wallet::AddressInfo`.
|
- Add `keychain: KeychainKind` to `wallet::AddressInfo`.
|
||||||
- Improve key generation traits
|
- Improve key generation traits
|
||||||
- Rename `WalletExport` to `FullyNodedExport`, deprecate the former.
|
- Rename `WalletExport` to `FullyNodedExport`, deprecate the former.
|
||||||
- Bump `miniscript` dependency version to `^6.1`.
|
- Bump `miniscript` dependency version to `^6.1`.
|
||||||
|
|
||||||
## [v0.17.0] - [v0.16.1]
|
## [v0.17.0]
|
||||||
|
|
||||||
- Removed default verification from `wallet::sync`. sync-time verification is added in `script_sync` and is activated by `verify` feature flag.
|
- Removed default verification from `wallet::sync`. sync-time verification is added in `script_sync` and is activated by `verify` feature flag.
|
||||||
- `verify` flag removed from `TransactionDetails`.
|
- `verify` flag removed from `TransactionDetails`.
|
||||||
@@ -77,45 +267,45 @@ To decouple the `Wallet` from the `Blockchain` we've made major changes:
|
|||||||
- Removed `max_addresses` sync parameter which determined how many addresses to cache before syncing since this can just be done with `ensure_addresses_cached`.
|
- Removed `max_addresses` sync parameter which determined how many addresses to cache before syncing since this can just be done with `ensure_addresses_cached`.
|
||||||
- remove `flush` method from the `Database` trait.
|
- remove `flush` method from the `Database` trait.
|
||||||
|
|
||||||
## [v0.16.1] - [v0.16.0]
|
## [v0.16.1]
|
||||||
|
|
||||||
- Pin tokio dependency version to ~1.14 to prevent errors due to their new MSRV 1.49.0
|
- Pin tokio dependency version to ~1.14 to prevent errors due to their new MSRV 1.49.0
|
||||||
|
|
||||||
## [v0.16.0] - [v0.15.0]
|
## [v0.16.0]
|
||||||
|
|
||||||
- Disable `reqwest` default features.
|
- Disable `reqwest` default features.
|
||||||
- Added `reqwest-default-tls` feature: Use this to restore the TLS defaults of reqwest if you don't want to add a dependency to it in your own manifest.
|
- Added `reqwest-default-tls` feature: Use this to restore the TLS defaults of reqwest if you don't want to add a dependency to it in your own manifest.
|
||||||
- Use dust_value from rust-bitcoin
|
- Use dust_value from rust-bitcoin
|
||||||
- Fixed generating WIF in the correct network format.
|
- Fixed generating WIF in the correct network format.
|
||||||
|
|
||||||
## [v0.15.0] - [v0.14.0]
|
## [v0.15.0]
|
||||||
|
|
||||||
- Overhauled sync logic for electrum and esplora.
|
- Overhauled sync logic for electrum and esplora.
|
||||||
- Unify ureq and reqwest esplora backends to have the same configuration parameters. This means reqwest now has a timeout parameter and ureq has a concurrency parameter.
|
- Unify ureq and reqwest esplora backends to have the same configuration parameters. This means reqwest now has a timeout parameter and ureq has a concurrency parameter.
|
||||||
- Fixed esplora fee estimation.
|
- Fixed esplora fee estimation.
|
||||||
|
|
||||||
## [v0.14.0] - [v0.13.0]
|
## [v0.14.0]
|
||||||
|
|
||||||
- BIP39 implementation dependency, in `keys::bip39` changed from tiny-bip39 to rust-bip39.
|
- BIP39 implementation dependency, in `keys::bip39` changed from tiny-bip39 to rust-bip39.
|
||||||
- Add new method on the `TxBuilder` to embed data in the transaction via `OP_RETURN`. To allow that a fix to check the dust only on spendable output has been introduced.
|
- Add new method on the `TxBuilder` to embed data in the transaction via `OP_RETURN`. To allow that a fix to check the dust only on spendable output has been introduced.
|
||||||
- Update the `Database` trait to store the last sync timestamp and block height
|
- Update the `Database` trait to store the last sync timestamp and block height
|
||||||
- Rename `ConfirmationTime` to `BlockTime`
|
- Rename `ConfirmationTime` to `BlockTime`
|
||||||
|
|
||||||
## [v0.13.0] - [v0.12.0]
|
## [v0.13.0]
|
||||||
|
|
||||||
- Exposed `get_tx()` method from `Database` to `Wallet`.
|
- Exposed `get_tx()` method from `Database` to `Wallet`.
|
||||||
|
|
||||||
## [v0.12.0] - [v0.11.0]
|
## [v0.12.0]
|
||||||
|
|
||||||
- Activate `miniscript/use-serde` feature to allow consumers of the library to access it via the re-exported `miniscript` crate.
|
- Activate `miniscript/use-serde` feature to allow consumers of the library to access it via the re-exported `miniscript` crate.
|
||||||
- Add support for proxies in `EsploraBlockchain`
|
- Add support for proxies in `EsploraBlockchain`
|
||||||
- Added `SqliteDatabase` that implements `Database` backed by a sqlite database using `rusqlite` crate.
|
- Added `SqliteDatabase` that implements `Database` backed by a sqlite database using `rusqlite` crate.
|
||||||
|
|
||||||
## [v0.11.0] - [v0.10.0]
|
## [v0.11.0]
|
||||||
|
|
||||||
- Added `flush` method to the `Database` trait to explicitly flush to disk latest changes on the db.
|
- Added `flush` method to the `Database` trait to explicitly flush to disk latest changes on the db.
|
||||||
|
|
||||||
## [v0.10.0] - [v0.9.0]
|
## [v0.10.0]
|
||||||
|
|
||||||
- Added `RpcBlockchain` in the `AnyBlockchain` struct to allow using Rpc backend where `AnyBlockchain` is used (eg `bdk-cli`)
|
- Added `RpcBlockchain` in the `AnyBlockchain` struct to allow using Rpc backend where `AnyBlockchain` is used (eg `bdk-cli`)
|
||||||
- Removed hard dependency on `tokio`.
|
- Removed hard dependency on `tokio`.
|
||||||
@@ -129,21 +319,21 @@ To decouple the `Wallet` from the `Blockchain` we've made major changes:
|
|||||||
- Removed `stop_gap` from `Blockchain` trait and added it to only `ElectrumBlockchain` and `EsploraBlockchain` structs.
|
- Removed `stop_gap` from `Blockchain` trait and added it to only `ElectrumBlockchain` and `EsploraBlockchain` structs.
|
||||||
- Added a `ureq` backend for use when not using feature `async-interface` or target WASM. `ureq` is a blocking HTTP client.
|
- Added a `ureq` backend for use when not using feature `async-interface` or target WASM. `ureq` is a blocking HTTP client.
|
||||||
|
|
||||||
## [v0.9.0] - [v0.8.0]
|
## [v0.9.0]
|
||||||
|
|
||||||
### Wallet
|
### Wallet
|
||||||
|
|
||||||
- Added Bitcoin core RPC added as blockchain backend
|
- Added Bitcoin core RPC added as blockchain backend
|
||||||
- Added a `verify` feature that can be enable to verify the unconfirmed txs we download against the consensus rules
|
- Added a `verify` feature that can be enable to verify the unconfirmed txs we download against the consensus rules
|
||||||
|
|
||||||
## [v0.8.0] - [v0.7.0]
|
## [v0.8.0]
|
||||||
|
|
||||||
### Wallet
|
### Wallet
|
||||||
- Added an option that must be explicitly enabled to allow signing using non-`SIGHASH_ALL` sighashes (#350)
|
- Added an option that must be explicitly enabled to allow signing using non-`SIGHASH_ALL` sighashes (#350)
|
||||||
#### Changed
|
#### Changed
|
||||||
`get_address` now returns an `AddressInfo` struct that includes the index and derefs to `Address`.
|
`get_address` now returns an `AddressInfo` struct that includes the index and derefs to `Address`.
|
||||||
|
|
||||||
## [v0.7.0] - [v0.6.0]
|
## [v0.7.0]
|
||||||
|
|
||||||
### Policy
|
### Policy
|
||||||
#### Changed
|
#### Changed
|
||||||
@@ -158,7 +348,7 @@ Timelocks are considered (optionally) in building the `satisfaction` field
|
|||||||
- Require and validate `non_witness_utxo` for SegWit signatures by default, can be adjusted with `SignOptions`
|
- Require and validate `non_witness_utxo` for SegWit signatures by default, can be adjusted with `SignOptions`
|
||||||
- Replace the opt-in builder option `force_non_witness_utxo` with the opposite `only_witness_utxo`. From now on we will provide the `non_witness_utxo`, unless explicitly asked not to.
|
- Replace the opt-in builder option `force_non_witness_utxo` with the opposite `only_witness_utxo`. From now on we will provide the `non_witness_utxo`, unless explicitly asked not to.
|
||||||
|
|
||||||
## [v0.6.0] - [v0.5.1]
|
## [v0.6.0]
|
||||||
|
|
||||||
### Misc
|
### Misc
|
||||||
#### Changed
|
#### Changed
|
||||||
@@ -182,13 +372,13 @@ Timelocks are considered (optionally) in building the `satisfaction` field
|
|||||||
#### Fixed
|
#### Fixed
|
||||||
- Fixed `coin_select` calculation for UTXOs where `value < fee` that caused over-/underflow errors.
|
- Fixed `coin_select` calculation for UTXOs where `value < fee` that caused over-/underflow errors.
|
||||||
|
|
||||||
## [v0.5.1] - [v0.5.0]
|
## [v0.5.1]
|
||||||
|
|
||||||
### Misc
|
### Misc
|
||||||
#### Changed
|
#### Changed
|
||||||
- Pin `hyper` to `=0.14.4` to make it compile on Rust 1.45
|
- Pin `hyper` to `=0.14.4` to make it compile on Rust 1.45
|
||||||
|
|
||||||
## [v0.5.0] - [v0.4.0]
|
## [v0.5.0]
|
||||||
|
|
||||||
### Misc
|
### Misc
|
||||||
#### Changed
|
#### Changed
|
||||||
@@ -198,7 +388,7 @@ Timelocks are considered (optionally) in building the `satisfaction` field
|
|||||||
#### Changed
|
#### Changed
|
||||||
- `FeeRate` constructors `from_sat_per_vb` and `default_min_relay_fee` are now `const` functions
|
- `FeeRate` constructors `from_sat_per_vb` and `default_min_relay_fee` are now `const` functions
|
||||||
|
|
||||||
## [v0.4.0] - [v0.3.0]
|
## [v0.4.0]
|
||||||
|
|
||||||
### Keys
|
### Keys
|
||||||
#### Changed
|
#### Changed
|
||||||
@@ -227,7 +417,7 @@ Timelocks are considered (optionally) in building the `satisfaction` field
|
|||||||
- Removed unneeded `Result<(), PolicyError>` return type for `Satisfaction::finalize()`
|
- Removed unneeded `Result<(), PolicyError>` return type for `Satisfaction::finalize()`
|
||||||
- Removed the `TooManyItemsSelected` policy error (see commit message for more details)
|
- Removed the `TooManyItemsSelected` policy error (see commit message for more details)
|
||||||
|
|
||||||
## [v0.3.0] - [v0.2.0]
|
## [v0.3.0]
|
||||||
|
|
||||||
### Descriptor
|
### Descriptor
|
||||||
#### Changed
|
#### Changed
|
||||||
@@ -264,7 +454,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
#### Changed
|
#### Changed
|
||||||
- Remove `cli.rs` module, `cli-utils` feature and `repl.rs` example; moved to new [`bdk-cli`](https://github.com/bitcoindevkit/bdk-cli) repository
|
- Remove `cli.rs` module, `cli-utils` feature and `repl.rs` example; moved to new [`bdk-cli`](https://github.com/bitcoindevkit/bdk-cli) repository
|
||||||
|
|
||||||
## [v0.2.0] - [0.1.0-beta.1]
|
## [v0.2.0]
|
||||||
|
|
||||||
### Project
|
### Project
|
||||||
#### Added
|
#### Added
|
||||||
@@ -492,4 +682,15 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
[v0.19.0]: https://github.com/bitcoindevkit/bdk/compare/v0.18.0...v0.19.0
|
[v0.19.0]: https://github.com/bitcoindevkit/bdk/compare/v0.18.0...v0.19.0
|
||||||
[v0.20.0]: https://github.com/bitcoindevkit/bdk/compare/v0.19.0...v0.20.0
|
[v0.20.0]: https://github.com/bitcoindevkit/bdk/compare/v0.19.0...v0.20.0
|
||||||
[v0.21.0]: https://github.com/bitcoindevkit/bdk/compare/v0.20.0...v0.21.0
|
[v0.21.0]: https://github.com/bitcoindevkit/bdk/compare/v0.20.0...v0.21.0
|
||||||
[unreleased]: https://github.com/bitcoindevkit/bdk/compare/v0.21.0...HEAD
|
[v0.22.0]: https://github.com/bitcoindevkit/bdk/compare/v0.21.0...v0.22.0
|
||||||
|
[v0.23.0]: https://github.com/bitcoindevkit/bdk/compare/v0.22.0...v0.23.0
|
||||||
|
[v0.24.0]: https://github.com/bitcoindevkit/bdk/compare/v0.23.0...v0.24.0
|
||||||
|
[v0.25.0]: https://github.com/bitcoindevkit/bdk/compare/v0.24.0...v0.25.0
|
||||||
|
[v0.26.0]: https://github.com/bitcoindevkit/bdk/compare/v0.25.0...v0.26.0
|
||||||
|
[v0.27.0]: https://github.com/bitcoindevkit/bdk/compare/v0.26.0...v0.27.0
|
||||||
|
[v0.27.1]: https://github.com/bitcoindevkit/bdk/compare/v0.27.0...v0.27.1
|
||||||
|
[v0.28.0]: https://github.com/bitcoindevkit/bdk/compare/v0.27.1...v0.28.0
|
||||||
|
[v0.28.1]: https://github.com/bitcoindevkit/bdk/compare/v0.28.0...v0.28.1
|
||||||
|
[v0.28.2]: https://github.com/bitcoindevkit/bdk/compare/v0.28.1...v0.28.2
|
||||||
|
[v0.29.0]: https://github.com/bitcoindevkit/bdk/compare/v0.28.2...v0.29.0
|
||||||
|
[Unreleased]: https://github.com/bitcoindevkit/bdk/compare/v0.29.0...HEAD
|
||||||
|
|||||||
102
Cargo.toml
102
Cargo.toml
@@ -1,6 +1,6 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bdk"
|
name = "bdk"
|
||||||
version = "0.21.1-dev"
|
version = "0.29.0"
|
||||||
edition = "2018"
|
edition = "2018"
|
||||||
authors = ["Alekos Filini <alekos.filini@gmail.com>", "Riccardo Casatta <riccardo@casatta.it>"]
|
authors = ["Alekos Filini <alekos.filini@gmail.com>", "Riccardo Casatta <riccardo@casatta.it>"]
|
||||||
homepage = "https://bitcoindevkit.org"
|
homepage = "https://bitcoindevkit.org"
|
||||||
@@ -13,54 +13,57 @@ license = "MIT OR Apache-2.0"
|
|||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
bdk-macros = "^0.6"
|
bdk-macros = "^0.6"
|
||||||
log = "^0.4"
|
log = "0.4"
|
||||||
miniscript = { version = "7.0", features = ["use-serde"] }
|
miniscript = { version = "10.0", default-features = false, features = ["serde"] }
|
||||||
bitcoin = { version = "0.28.1", features = ["use-serde", "base64", "rand"] }
|
bitcoin = { version = "0.30", default-features = false, features = ["serde", "base64", "rand-std"] }
|
||||||
serde = { version = "^1.0", features = ["derive"] }
|
serde = { version = "^1.0", features = ["derive"] }
|
||||||
serde_json = { version = "^1.0" }
|
serde_json = { version = "^1.0" }
|
||||||
rand = "^0.7"
|
rand = "^0.8"
|
||||||
|
|
||||||
# Optional dependencies
|
# Optional dependencies
|
||||||
sled = { version = "0.34", optional = true }
|
sled = { version = "0.34", optional = true }
|
||||||
electrum-client = { version = "0.10", optional = true }
|
electrum-client = { version = "0.18", optional = true }
|
||||||
rusqlite = { version = "0.27.0", optional = true }
|
esplora-client = { version = "0.6", default-features = false, optional = true }
|
||||||
|
rusqlite = { version = "0.28.0", optional = true }
|
||||||
ahash = { version = "0.7.6", optional = true }
|
ahash = { version = "0.7.6", optional = true }
|
||||||
reqwest = { version = "0.11", optional = true, default-features = false, features = ["json"] }
|
|
||||||
ureq = { version = "~2.2.0", features = ["json"], optional = true }
|
|
||||||
futures = { version = "0.3", optional = true }
|
futures = { version = "0.3", optional = true }
|
||||||
async-trait = { version = "0.1", optional = true }
|
async-trait = { version = "0.1", optional = true }
|
||||||
rocksdb = { version = "0.14", default-features = false, features = ["snappy"], optional = true }
|
rocksdb = { version = "0.14", default-features = false, features = ["snappy"], optional = true }
|
||||||
cc = { version = ">=1.0.64", optional = true }
|
cc = { version = ">=1.0.64", optional = true }
|
||||||
socks = { version = "0.3", optional = true }
|
socks = { version = "0.3", optional = true }
|
||||||
lazy_static = { version = "1.4", optional = true }
|
hwi = { version = "0.7", optional = true, features = ["miniscript"] }
|
||||||
|
|
||||||
bip39 = { version = "1.0.1", optional = true }
|
bip39 = { version = "2.0.0", optional = true }
|
||||||
bitcoinconsensus = { version = "0.19.0-3", optional = true }
|
bitcoinconsensus = { version = "0.19.0-3", optional = true }
|
||||||
|
|
||||||
# Needed by bdk_blockchain_tests macro and the `rpc` feature
|
# Needed by bdk_blockchain_tests macro and the `rpc` feature
|
||||||
bitcoincore-rpc = { version = "0.15", optional = true }
|
bitcoincore-rpc = { package="core-rpc", version = "0.17", optional = true }
|
||||||
|
|
||||||
# Platform-specific dependencies
|
# Platform-specific dependencies
|
||||||
[target.'cfg(not(target_arch = "wasm32"))'.dependencies]
|
[target.'cfg(not(target_arch = "wasm32"))'.dependencies]
|
||||||
tokio = { version = "1", features = ["rt"] }
|
tokio = { version = "1", features = ["rt", "macros"] }
|
||||||
|
|
||||||
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
||||||
|
getrandom = "0.2"
|
||||||
async-trait = "0.1"
|
async-trait = "0.1"
|
||||||
js-sys = "0.3"
|
js-sys = "0.3"
|
||||||
rand = { version = "^0.7", features = ["wasm-bindgen"] }
|
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
minimal = []
|
minimal = []
|
||||||
compiler = ["miniscript/compiler"]
|
compiler = ["miniscript/compiler"]
|
||||||
verify = ["bitcoinconsensus"]
|
verify = ["bitcoinconsensus"]
|
||||||
default = ["key-value-db", "electrum"]
|
default = ["std", "key-value-db", "electrum"]
|
||||||
|
# std feature is always required unless building for wasm32-unknown-unknown target
|
||||||
|
# if building for wasm user must add dependencies bitcoin/no-std,miniscript/no-std
|
||||||
|
std = ["bitcoin/std", "miniscript/std"]
|
||||||
sqlite = ["rusqlite", "ahash"]
|
sqlite = ["rusqlite", "ahash"]
|
||||||
sqlite-bundled = ["sqlite", "rusqlite/bundled"]
|
sqlite-bundled = ["sqlite", "rusqlite/bundled"]
|
||||||
compact_filters = ["rocksdb", "socks", "lazy_static", "cc"]
|
compact_filters = ["rocksdb", "socks", "cc"]
|
||||||
key-value-db = ["sled"]
|
key-value-db = ["sled"]
|
||||||
all-keys = ["keys-bip39"]
|
all-keys = ["keys-bip39"]
|
||||||
keys-bip39 = ["bip39"]
|
keys-bip39 = ["bip39"]
|
||||||
rpc = ["bitcoincore-rpc"]
|
rpc = ["bitcoincore-rpc"]
|
||||||
|
hardware-signer = ["hwi"]
|
||||||
|
|
||||||
# We currently provide mulitple implementations of `Blockchain`, all are
|
# We currently provide mulitple implementations of `Blockchain`, all are
|
||||||
# blocking except for the `EsploraBlockchain` which can be either async or
|
# blocking except for the `EsploraBlockchain` which can be either async or
|
||||||
@@ -68,23 +71,26 @@ rpc = ["bitcoincore-rpc"]
|
|||||||
#
|
#
|
||||||
# - Users wanting asynchronous HTTP calls should enable `async-interface` to get
|
# - Users wanting asynchronous HTTP calls should enable `async-interface` to get
|
||||||
# access to the asynchronous method implementations. Then, if Esplora is wanted,
|
# access to the asynchronous method implementations. Then, if Esplora is wanted,
|
||||||
# enable `esplora` AND `reqwest` (`--features=use-esplora-reqwest`).
|
# enable the `use-esplora-async` feature.
|
||||||
# - Users wanting blocking HTTP calls can use any of the other blockchain
|
# - Users wanting blocking HTTP calls can use any of the other blockchain
|
||||||
# implementations (`compact_filters`, `electrum`, or `esplora`). Users wanting to
|
# implementations (`compact_filters`, `electrum`, or `esplora`). Users wanting to
|
||||||
# use Esplora should enable `esplora` AND `ureq` (`--features=use-esplora-ureq`).
|
# use Esplora should enable the `use-esplora-blocking` feature.
|
||||||
#
|
#
|
||||||
# WARNING: Please take care with the features below, various combinations will
|
# WARNING: Please take care with the features below, various combinations will
|
||||||
# fail to build. We cannot currently build `bdk` with `--all-features`.
|
# fail to build. We cannot currently build `bdk` with `--all-features`.
|
||||||
async-interface = ["async-trait"]
|
async-interface = ["async-trait"]
|
||||||
electrum = ["electrum-client"]
|
electrum = ["electrum-client"]
|
||||||
# MUST ALSO USE `--no-default-features`.
|
# MUST ALSO USE `--no-default-features`.
|
||||||
use-esplora-reqwest = ["esplora", "reqwest", "reqwest/socks", "futures"]
|
use-esplora-async = ["esplora", "esplora-client/async", "futures"]
|
||||||
use-esplora-ureq = ["esplora", "ureq", "ureq/socks"]
|
use-esplora-blocking = ["esplora", "esplora-client/blocking"]
|
||||||
|
# Deprecated aliases
|
||||||
|
use-esplora-reqwest = ["use-esplora-async"]
|
||||||
|
use-esplora-ureq = ["use-esplora-blocking"]
|
||||||
# Typical configurations will not need to use `esplora` feature directly.
|
# Typical configurations will not need to use `esplora` feature directly.
|
||||||
esplora = []
|
esplora = []
|
||||||
|
|
||||||
# Use below feature with `use-esplora-reqwest` to enable reqwest default TLS support
|
# Use below feature with `use-esplora-async` to enable reqwest default TLS support
|
||||||
reqwest-default-tls = ["reqwest/default-tls"]
|
reqwest-default-tls = ["esplora-client/async-https"]
|
||||||
|
|
||||||
# Debug/Test features
|
# Debug/Test features
|
||||||
test-blockchains = ["bitcoincore-rpc", "electrum-client"]
|
test-blockchains = ["bitcoincore-rpc", "electrum-client"]
|
||||||
@@ -93,15 +99,21 @@ test-rpc = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_22_0", "test-bl
|
|||||||
test-rpc-legacy = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_0_20_0", "test-blockchains"]
|
test-rpc-legacy = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_0_20_0", "test-blockchains"]
|
||||||
test-esplora = ["electrsd/legacy", "electrsd/esplora_a33e97e1", "electrsd/bitcoind_22_0", "test-blockchains"]
|
test-esplora = ["electrsd/legacy", "electrsd/esplora_a33e97e1", "electrsd/bitcoind_22_0", "test-blockchains"]
|
||||||
test-md-docs = ["electrum"]
|
test-md-docs = ["electrum"]
|
||||||
|
test-hardware-signer = ["hardware-signer"]
|
||||||
|
|
||||||
|
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
||||||
|
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
||||||
|
# necessary for running our CI. See: https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support
|
||||||
|
dev-getrandom-wasm = ["getrandom/js"]
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
|
miniscript = { version = "10.0", features = ["std"] }
|
||||||
|
bitcoin = { version = "0.30", features = ["std"] }
|
||||||
lazy_static = "1.4"
|
lazy_static = "1.4"
|
||||||
env_logger = "0.7"
|
env_logger = { version = "0.7", default-features = false }
|
||||||
clap = "2.33"
|
electrsd = "0.24"
|
||||||
electrsd = "0.19.1"
|
assert_matches = "1.5.0"
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "address_validator"
|
|
||||||
[[example]]
|
[[example]]
|
||||||
name = "compact_filters_balance"
|
name = "compact_filters_balance"
|
||||||
required-features = ["compact_filters"]
|
required-features = ["compact_filters"]
|
||||||
@@ -111,14 +123,48 @@ name = "miniscriptc"
|
|||||||
path = "examples/compiler.rs"
|
path = "examples/compiler.rs"
|
||||||
required-features = ["compiler"]
|
required-features = ["compiler"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "policy"
|
||||||
|
path = "examples/policy.rs"
|
||||||
|
|
||||||
[[example]]
|
[[example]]
|
||||||
name = "rpcwallet"
|
name = "rpcwallet"
|
||||||
path = "examples/rpcwallet.rs"
|
path = "examples/rpcwallet.rs"
|
||||||
required-features = ["keys-bip39", "key-value-db", "rpc", "electrsd/bitcoind_22_0"]
|
required-features = ["keys-bip39", "key-value-db", "rpc", "electrsd/bitcoind_22_0"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "psbt_signer"
|
||||||
|
path = "examples/psbt_signer.rs"
|
||||||
|
required-features = ["electrum"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "hardware_signer"
|
||||||
|
path = "examples/hardware_signer.rs"
|
||||||
|
required-features = ["electrum", "hardware-signer"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "electrum_backend"
|
||||||
|
path = "examples/electrum_backend.rs"
|
||||||
|
required-features = ["electrum"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "esplora_backend_synchronous"
|
||||||
|
path = "examples/esplora_backend_synchronous.rs"
|
||||||
|
required-features = ["use-esplora-ureq"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "esplora_backend_asynchronous"
|
||||||
|
path = "examples/esplora_backend_asynchronous.rs"
|
||||||
|
required-features = ["use-esplora-reqwest", "reqwest-default-tls", "async-interface"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "mnemonic_to_descriptors"
|
||||||
|
path = "examples/mnemonic_to_descriptors.rs"
|
||||||
|
required-features = ["all-keys"]
|
||||||
|
|
||||||
[workspace]
|
[workspace]
|
||||||
members = ["macros"]
|
members = ["macros"]
|
||||||
[package.metadata.docs.rs]
|
[package.metadata.docs.rs]
|
||||||
features = ["compiler", "electrum", "esplora", "ureq", "compact_filters", "rpc", "key-value-db", "sqlite", "all-keys", "verify"]
|
features = ["compiler", "electrum", "esplora", "use-esplora-blocking", "compact_filters", "rpc", "key-value-db", "sqlite", "all-keys", "verify", "hardware-signer"]
|
||||||
# defines the configuration attribute `docsrs`
|
# defines the configuration attribute `docsrs`
|
||||||
rustdoc-args = ["--cfg", "docsrs"]
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|||||||
@@ -1,46 +1,16 @@
|
|||||||
# Development Cycle
|
# Development Cycle
|
||||||
|
|
||||||
This project follows a regular releasing schedule similar to the one [used by the Rust language](https://doc.rust-lang.org/book/appendix-07-nightly-rust.html). In short, this means that a new release is made at a regular cadence, with all the feature/bugfixes that made it to `master` in time. This ensures that we don't keep delaying releases waiting for "just one more little thing".
|
This project follows a regular releasing schedule similar to the one [used by the Rust language]. In short, this means that a new release is made at a regular cadence, with all the feature/bugfixes that made it to `master` in time. This ensures that we don't keep delaying releases waiting for "just one more little thing".
|
||||||
|
|
||||||
|
This project uses [Semantic Versioning], but is currently at MAJOR version zero (0.y.z) meaning it is still in initial development. Anything MAY change at any time. The public API SHOULD NOT be considered stable. Until we reach version `1.0.0` we will do our best to document any breaking API changes in the changelog info attached to each release tag.
|
||||||
|
|
||||||
We decided to maintain a faster release cycle while the library is still in "beta", i.e. before release `1.0.0`: since we are constantly adding new features and, even more importantly, fixing issues, we want developers to have access to those updates as fast as possible. For this reason we will make a release **every 4 weeks**.
|
We decided to maintain a faster release cycle while the library is still in "beta", i.e. before release `1.0.0`: since we are constantly adding new features and, even more importantly, fixing issues, we want developers to have access to those updates as fast as possible. For this reason we will make a release **every 4 weeks**.
|
||||||
|
|
||||||
Once the project will have reached a more mature state (>= `1.0.0`), we will very likely switch to longer release cycles of **6 weeks**.
|
Once the project reaches a more mature state (>= `1.0.0`), we will very likely switch to longer release cycles of **6 weeks**.
|
||||||
|
|
||||||
The "feature freeze" will happen **one week before the release date**. This means a new branch will be created originating from the `master` tip at that time, and in that branch we will stop adding new features and only focus on ensuring the ones we've added are working properly.
|
The "feature freeze" will happen **one week before the release date**. This means a new branch will be created originating from the `master` tip at that time, and in that branch we will stop adding new features and only focus on ensuring the ones we've added are working properly.
|
||||||
|
|
||||||
```
|
To create a new release a release manager will create a new issue using the `Release` template and follow the template instructions.
|
||||||
master: - - - - * - - - * - - - - - - * - - - * ...
|
|
||||||
| / | |
|
|
||||||
release/0.x.0: * - - # | |
|
|
||||||
| /
|
|
||||||
release/0.y.0: * - - #
|
|
||||||
```
|
|
||||||
|
|
||||||
As soon as the release is tagged and published, the `release` branch will be merged back into `master` to update the version in the `Cargo.toml` to apply the new `Cargo.toml` version and all the other fixes made during the feature freeze window.
|
[used by the Rust language]: https://doc.rust-lang.org/book/appendix-07-nightly-rust.html
|
||||||
|
[Semantic Versioning]: https://semver.org/
|
||||||
## Making the Release
|
|
||||||
|
|
||||||
What follows are notes and procedures that maintainers can refer to when making releases. All the commits and tags must be signed and, ideally, also [timestamped](https://github.com/opentimestamps/opentimestamps-client/blob/master/doc/git-integration.md).
|
|
||||||
|
|
||||||
Pre-`v1.0.0` our "major" releases only affect the "minor" semver value. Accordingly, our "minor" releases will only affect the "patch" value.
|
|
||||||
|
|
||||||
1. Create a new branch called `release/x.y.z` from `master`. Double check that your local `master` is up-to-date with the upstream repo before doing so.
|
|
||||||
2. Make a commit on the release branch to bump the version to `x.y.z-rc.1`. The message should be "Bump version to x.y.z-rc.1".
|
|
||||||
3. Push the new branch to `bitcoindevkit/bdk` on GitHub.
|
|
||||||
4. During the one week of feature freeze run additional tests on the release branch.
|
|
||||||
5. If a bug is found:
|
|
||||||
- If it's a minor issue you can just fix it in the release branch, since it will be merged back to `master` eventually
|
|
||||||
- For bigger issues you can fix them on `master` and then *cherry-pick* the commit to the release branch
|
|
||||||
6. Update the changelog with the new release version.
|
|
||||||
7. Update `src/lib.rs` with the new version (line ~43)
|
|
||||||
8. On release day, make a commit on the release branch to bump the version to `x.y.z`. The message should be "Bump version to x.y.z".
|
|
||||||
9. Add a tag to this commit. The tag name should be `vx.y.z` (for example `v0.5.0`), and the message "Release x.y.z". Make sure the tag is signed, for extra safety use the explicit `--sign` flag.
|
|
||||||
10. Push the new commits to the upstream release branch, wait for the CI to finish one last time.
|
|
||||||
11. Publish **all** the updated crates to crates.io.
|
|
||||||
12. Make a new commit to bump the version value to `x.y.(z+1)-dev`. The message should be "Bump version to x.y.(z+1)-dev".
|
|
||||||
13. Merge the release branch back into `master`.
|
|
||||||
14. If the `master` branch contains any unreleased changes to the `bdk-macros` crate, change the `bdk` Cargo.toml `[dependencies]` to point to the local path (i.e. `bdk-macros = { path = "./macros"}`)
|
|
||||||
15. Create the release on GitHub: go to "tags", click on the dots on the right and select "Create Release". Then set the title to `vx.y.z` and write down some brief release notes.
|
|
||||||
16. Make sure the new release shows up on crates.io and that the docs are built correctly on docs.rs.
|
|
||||||
17. Announce the release on Twitter, Discord and Telegram.
|
|
||||||
18. Celebrate :tada:
|
|
||||||
|
|||||||
79
README.md
79
README.md
@@ -11,9 +11,9 @@
|
|||||||
<a href="https://crates.io/crates/bdk"><img alt="Crate Info" src="https://img.shields.io/crates/v/bdk.svg"/></a>
|
<a href="https://crates.io/crates/bdk"><img alt="Crate Info" src="https://img.shields.io/crates/v/bdk.svg"/></a>
|
||||||
<a href="https://github.com/bitcoindevkit/bdk/blob/master/LICENSE"><img alt="MIT or Apache-2.0 Licensed" src="https://img.shields.io/badge/license-MIT%2FApache--2.0-blue.svg"/></a>
|
<a href="https://github.com/bitcoindevkit/bdk/blob/master/LICENSE"><img alt="MIT or Apache-2.0 Licensed" src="https://img.shields.io/badge/license-MIT%2FApache--2.0-blue.svg"/></a>
|
||||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||||
<a href="https://codecov.io/gh/bitcoindevkit/bdk"><img src="https://codecov.io/gh/bitcoindevkit/bdk/branch/master/graph/badge.svg"/></a>
|
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||||
<a href="https://blog.rust-lang.org/2021/11/01/Rust-1.56.1.html"><img alt="Rustc Version 1.56.1+" src="https://img.shields.io/badge/rustc-1.56.1%2B-lightgrey.svg"/></a>
|
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
||||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||||
</p>
|
</p>
|
||||||
|
|
||||||
@@ -68,12 +68,13 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
```rust
|
```rust
|
||||||
use bdk::{Wallet, database::MemoryDatabase};
|
use bdk::{Wallet, database::MemoryDatabase};
|
||||||
use bdk::wallet::AddressIndex::New;
|
use bdk::wallet::AddressIndex::New;
|
||||||
|
use bdk::bitcoin::Network;
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
fn main() -> Result<(), bdk::Error> {
|
||||||
let wallet = Wallet::new(
|
let wallet = Wallet::new(
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
||||||
bitcoin::Network::Testnet,
|
Network::Testnet,
|
||||||
MemoryDatabase::default(),
|
MemoryDatabase::default(),
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
@@ -96,14 +97,15 @@ use bdk::electrum_client::Client;
|
|||||||
use bdk::wallet::AddressIndex::New;
|
use bdk::wallet::AddressIndex::New;
|
||||||
|
|
||||||
use bitcoin::base64;
|
use bitcoin::base64;
|
||||||
use bitcoin::consensus::serialize;
|
use bdk::bitcoin::consensus::serialize;
|
||||||
|
use bdk::bitcoin::Network;
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
fn main() -> Result<(), bdk::Error> {
|
||||||
let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||||
let wallet = Wallet::new(
|
let wallet = Wallet::new(
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
||||||
bitcoin::Network::Testnet,
|
Network::Testnet,
|
||||||
MemoryDatabase::default(),
|
MemoryDatabase::default(),
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
@@ -121,7 +123,7 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
};
|
};
|
||||||
|
|
||||||
println!("Transaction details: {:#?}", details);
|
println!("Transaction details: {:#?}", details);
|
||||||
println!("Unsigned PSBT: {}", base64::encode(&serialize(&psbt)));
|
println!("Unsigned PSBT: {}", base64::encode(psbt.serialize()));
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
@@ -133,20 +135,21 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
use bdk::{Wallet, SignOptions, database::MemoryDatabase};
|
use bdk::{Wallet, SignOptions, database::MemoryDatabase};
|
||||||
|
|
||||||
use bitcoin::base64;
|
use bitcoin::base64;
|
||||||
use bitcoin::consensus::deserialize;
|
use bdk::bitcoin::consensus::deserialize;
|
||||||
|
use bdk::bitcoin::{psbt::Psbt, Network};
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
fn main() -> Result<(), bdk::Error> {
|
||||||
let wallet = Wallet::new(
|
let wallet = Wallet::new(
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/0/*)",
|
"wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/0/*)",
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/1/*)"),
|
Some("wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/1/*)"),
|
||||||
bitcoin::Network::Testnet,
|
Network::Testnet,
|
||||||
MemoryDatabase::default(),
|
MemoryDatabase::default(),
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
let psbt = "...";
|
let psbt = "...";
|
||||||
let mut psbt = deserialize(&base64::decode(psbt).unwrap())?;
|
let mut psbt = Psbt::deserialize(&base64::decode(psbt).unwrap())?;
|
||||||
|
|
||||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
let _finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
@@ -171,6 +174,17 @@ cargo test --features test-electrum
|
|||||||
The other options are `test-esplora`, `test-rpc` or `test-rpc-legacy` which runs against an older version of Bitcoin Core.
|
The other options are `test-esplora`, `test-rpc` or `test-rpc-legacy` which runs against an older version of Bitcoin Core.
|
||||||
Note that `electrs` and `bitcoind` binaries are automatically downloaded (on mac and linux), to specify you already have installed binaries you must use `--no-default-features` and provide `BITCOIND_EXE` and `ELECTRS_EXE` as environment variables.
|
Note that `electrs` and `bitcoind` binaries are automatically downloaded (on mac and linux), to specify you already have installed binaries you must use `--no-default-features` and provide `BITCOIND_EXE` and `ELECTRS_EXE` as environment variables.
|
||||||
|
|
||||||
|
## Running under WASM
|
||||||
|
|
||||||
|
If you want to run this library under WASM you will probably have to add the following lines to you `Cargo.toml`:
|
||||||
|
|
||||||
|
```toml
|
||||||
|
[dependencies]
|
||||||
|
getrandom = { version = "0.2", features = ["js"] }
|
||||||
|
```
|
||||||
|
|
||||||
|
This enables the `rand` crate to work in environments where JavaScript is available. See [this link](https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support) to learn more.
|
||||||
|
|
||||||
## License
|
## License
|
||||||
|
|
||||||
Licensed under either of
|
Licensed under either of
|
||||||
@@ -187,3 +201,48 @@ at your option.
|
|||||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
Unless you explicitly state otherwise, any contribution intentionally submitted
|
||||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
||||||
dual licensed as above, without any additional terms or conditions.
|
dual licensed as above, without any additional terms or conditions.
|
||||||
|
|
||||||
|
## Minimum Supported Rust Version (MSRV)
|
||||||
|
|
||||||
|
This library should compile with any combination of features with Rust 1.57.0.
|
||||||
|
|
||||||
|
To build with the MSRV you will need to pin dependencies as follows:
|
||||||
|
|
||||||
|
```shell
|
||||||
|
# log 0.4.19 has MSRV 1.60.0
|
||||||
|
cargo update -p log --precise "0.4.18"
|
||||||
|
# tempfile 3.7.0 has MSRV 1.63.0
|
||||||
|
cargo update -p tempfile --precise "3.6.0"
|
||||||
|
# required for sqlite feature, hashlink 0.8.2 has MSRV 1.61.0
|
||||||
|
cargo update -p hashlink --precise "0.8.1"
|
||||||
|
# required for compact_filters feature, regex after 1.7.3 has MSRV 1.60.0
|
||||||
|
cargo update -p regex --precise "1.7.3"
|
||||||
|
# zip 0.6.3 has MSRV 1.59.0 but still works
|
||||||
|
cargo update -p zip:0.6.6 --precise "0.6.3"
|
||||||
|
# rustix 0.38.0 has MSRV 1.65.0
|
||||||
|
cargo update -p rustix --precise "0.37.23"
|
||||||
|
# tokio 1.30 has MSRV 1.63.0+
|
||||||
|
cargo update -p tokio --precise "1.29.1"
|
||||||
|
# tokio-util 0.7.9 doesn't build with MSRV 1.57.0
|
||||||
|
cargo update -p tokio-util --precise "0.7.8"
|
||||||
|
# cc 1.0.82 is throwing error with rust 1.57.0, "error[E0599]: no method named `retain_mut`..."
|
||||||
|
cargo update -p cc --precise "1.0.81"
|
||||||
|
# rustls 0.20.9 has MSRV 1.60.0+
|
||||||
|
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||||
|
# rustls 0.21.2 has MSRV 1.60.0+
|
||||||
|
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||||
|
# flate2 1.0.27 has MSRV 1.63.0+
|
||||||
|
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||||
|
# reqwest 0.11.19 has MSRV 1.63.0+
|
||||||
|
cargo update -p reqwest --precise "0.11.18"
|
||||||
|
# h2 0.3.21 has MSRV 1.63.0+
|
||||||
|
cargo update -p h2 --precise "0.3.20"
|
||||||
|
# rustls-webpki 0.100.2 has MSRV 1.60+
|
||||||
|
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||||
|
# rustls-webpki 0.101.6 has MSRV 1.60+
|
||||||
|
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||||
|
# byteorder 1.5.0 has MSRV 1.60.0+
|
||||||
|
cargo update -p byteorder --precise "1.4.3"
|
||||||
|
# webpki 0.22.4 requires `ring:0.17.2` which has MSRV 1.61.0+
|
||||||
|
cargo update -p webpki --precise "0.22.2"
|
||||||
|
```
|
||||||
|
|||||||
9
ci/Dockerfile.ledger
Normal file
9
ci/Dockerfile.ledger
Normal file
@@ -0,0 +1,9 @@
|
|||||||
|
# Taken from bitcoindevkit/rust-hwi
|
||||||
|
FROM ghcr.io/ledgerhq/speculos
|
||||||
|
|
||||||
|
RUN apt-get update
|
||||||
|
RUN apt-get install wget -y
|
||||||
|
RUN wget "https://github.com/LedgerHQ/speculos/blob/master/apps/nanos%23btc%232.1%231c8db8da.elf?raw=true" -O /speculos/btc.elf
|
||||||
|
ADD automation.json /speculos/automation.json
|
||||||
|
|
||||||
|
ENTRYPOINT ["python", "./speculos.py", "--automation", "file:automation.json", "--model", "nanos", "--display", "headless", "--vnc-port", "41000", "btc.elf"]
|
||||||
30
ci/automation.json
Normal file
30
ci/automation.json
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
{
|
||||||
|
"version": 1,
|
||||||
|
"rules": [
|
||||||
|
{
|
||||||
|
"regexp": "Address \\(\\d/\\d\\)|Message hash \\(\\d/\\d\\)|Confirm|Fees|Review|Amount",
|
||||||
|
"actions": [
|
||||||
|
[ "button", 2, true ],
|
||||||
|
[ "button", 2, false ]
|
||||||
|
]
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"text": "Sign",
|
||||||
|
"conditions": [
|
||||||
|
[ "seen", false ]
|
||||||
|
],
|
||||||
|
"actions": [
|
||||||
|
[ "button", 2, true ],
|
||||||
|
[ "button", 2, false ],
|
||||||
|
[ "setbool", "seen", true ]
|
||||||
|
]
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"regexp": "Approve|Sign|Accept",
|
||||||
|
"actions": [
|
||||||
|
[ "button", 3, true ],
|
||||||
|
[ "button", 3, false ]
|
||||||
|
]
|
||||||
|
}
|
||||||
|
]
|
||||||
|
}
|
||||||
13
codecov.yaml
13
codecov.yaml
@@ -1,13 +0,0 @@
|
|||||||
coverage:
|
|
||||||
status:
|
|
||||||
project:
|
|
||||||
default:
|
|
||||||
target: auto
|
|
||||||
threshold: 1%
|
|
||||||
base: auto
|
|
||||||
informational: false
|
|
||||||
patch:
|
|
||||||
default:
|
|
||||||
target: auto
|
|
||||||
threshold: 100%
|
|
||||||
base: auto
|
|
||||||
@@ -1,63 +0,0 @@
|
|||||||
// Bitcoin Dev Kit
|
|
||||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
|
||||||
//
|
|
||||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
|
||||||
//
|
|
||||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
|
||||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
|
||||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
|
||||||
// You may not use this file except in accordance with one or both of these
|
|
||||||
// licenses.
|
|
||||||
|
|
||||||
use std::sync::Arc;
|
|
||||||
|
|
||||||
use bdk::bitcoin;
|
|
||||||
use bdk::database::MemoryDatabase;
|
|
||||||
use bdk::descriptor::HdKeyPaths;
|
|
||||||
#[allow(deprecated)]
|
|
||||||
use bdk::wallet::address_validator::{AddressValidator, AddressValidatorError};
|
|
||||||
use bdk::KeychainKind;
|
|
||||||
use bdk::Wallet;
|
|
||||||
|
|
||||||
use bdk::wallet::AddressIndex::New;
|
|
||||||
use bitcoin::hashes::hex::FromHex;
|
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
|
||||||
use bitcoin::{Network, Script};
|
|
||||||
|
|
||||||
#[derive(Debug)]
|
|
||||||
struct DummyValidator;
|
|
||||||
#[allow(deprecated)]
|
|
||||||
impl AddressValidator for DummyValidator {
|
|
||||||
fn validate(
|
|
||||||
&self,
|
|
||||||
keychain: KeychainKind,
|
|
||||||
hd_keypaths: &HdKeyPaths,
|
|
||||||
script: &Script,
|
|
||||||
) -> Result<(), AddressValidatorError> {
|
|
||||||
let (_, path) = hd_keypaths
|
|
||||||
.values()
|
|
||||||
.find(|(fing, _)| fing == &Fingerprint::from_hex("bc123c3e").unwrap())
|
|
||||||
.ok_or(AddressValidatorError::InvalidScript)?;
|
|
||||||
|
|
||||||
println!(
|
|
||||||
"Validating `{:?}` {} address, script: {}",
|
|
||||||
keychain, path, script
|
|
||||||
);
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
|
||||||
let descriptor = "sh(and_v(v:pk(tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/*),after(630000)))";
|
|
||||||
let mut wallet = Wallet::new(descriptor, None, Network::Regtest, MemoryDatabase::new())?;
|
|
||||||
|
|
||||||
#[allow(deprecated)]
|
|
||||||
wallet.add_address_validator(Arc::new(DummyValidator));
|
|
||||||
|
|
||||||
wallet.get_address(New)?;
|
|
||||||
wallet.get_address(New)?;
|
|
||||||
wallet.get_address(New)?;
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
@@ -11,7 +11,6 @@
|
|||||||
|
|
||||||
extern crate bdk;
|
extern crate bdk;
|
||||||
extern crate bitcoin;
|
extern crate bitcoin;
|
||||||
extern crate clap;
|
|
||||||
extern crate log;
|
extern crate log;
|
||||||
extern crate miniscript;
|
extern crate miniscript;
|
||||||
extern crate serde_json;
|
extern crate serde_json;
|
||||||
@@ -21,8 +20,6 @@ use std::str::FromStr;
|
|||||||
|
|
||||||
use log::info;
|
use log::info;
|
||||||
|
|
||||||
use clap::{App, Arg};
|
|
||||||
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use miniscript::policy::Concrete;
|
use miniscript::policy::Concrete;
|
||||||
use miniscript::Descriptor;
|
use miniscript::Descriptor;
|
||||||
@@ -31,75 +28,49 @@ use bdk::database::memory::MemoryDatabase;
|
|||||||
use bdk::wallet::AddressIndex::New;
|
use bdk::wallet::AddressIndex::New;
|
||||||
use bdk::{KeychainKind, Wallet};
|
use bdk::{KeychainKind, Wallet};
|
||||||
|
|
||||||
|
/// Miniscript policy is a high level abstraction of spending conditions. Defined in the
|
||||||
|
/// rust-miniscript library here https://docs.rs/miniscript/7.0.0/miniscript/policy/index.html
|
||||||
|
/// rust-miniscript provides a `compile()` function that can be used to compile any miniscript policy
|
||||||
|
/// into a descriptor. This descriptor then in turn can be used in bdk a fully functioning wallet
|
||||||
|
/// can be derived from the policy.
|
||||||
|
///
|
||||||
|
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
||||||
|
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
env_logger::init_from_env(
|
env_logger::init_from_env(
|
||||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
||||||
);
|
);
|
||||||
|
|
||||||
let matches = App::new("Miniscript Compiler")
|
// We start with a generic miniscript policy string
|
||||||
.arg(
|
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
||||||
Arg::with_name("POLICY")
|
info!("Compiling policy: \n{}", policy_str);
|
||||||
.help("Sets the spending policy to compile")
|
|
||||||
.required(true)
|
|
||||||
.index(1),
|
|
||||||
)
|
|
||||||
.arg(
|
|
||||||
Arg::with_name("TYPE")
|
|
||||||
.help("Sets the script type used to embed the compiled policy")
|
|
||||||
.required(true)
|
|
||||||
.index(2)
|
|
||||||
.possible_values(&["sh", "wsh", "sh-wsh"]),
|
|
||||||
)
|
|
||||||
.arg(
|
|
||||||
Arg::with_name("parsed_policy")
|
|
||||||
.long("parsed_policy")
|
|
||||||
.short("p")
|
|
||||||
.help("Also return the parsed spending policy in JSON format"),
|
|
||||||
)
|
|
||||||
.arg(
|
|
||||||
Arg::with_name("network")
|
|
||||||
.short("n")
|
|
||||||
.long("network")
|
|
||||||
.help("Sets the network")
|
|
||||||
.takes_value(true)
|
|
||||||
.default_value("testnet")
|
|
||||||
.possible_values(&["testnet", "regtest", "bitcoin", "signet"]),
|
|
||||||
)
|
|
||||||
.get_matches();
|
|
||||||
|
|
||||||
let policy_str = matches.value_of("POLICY").unwrap();
|
|
||||||
info!("Compiling policy: {}", policy_str);
|
|
||||||
|
|
||||||
|
// Parse the string as a [`Concrete`] type miniscript policy.
|
||||||
let policy = Concrete::<String>::from_str(policy_str)?;
|
let policy = Concrete::<String>::from_str(policy_str)?;
|
||||||
|
|
||||||
let descriptor = match matches.value_of("TYPE").unwrap() {
|
// Create a `wsh` type descriptor from the policy.
|
||||||
"sh" => Descriptor::new_sh(policy.compile()?)?,
|
// `policy.compile()` returns the resulting miniscript from the policy.
|
||||||
"wsh" => Descriptor::new_wsh(policy.compile()?)?,
|
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
||||||
"sh-wsh" => Descriptor::new_sh_wsh(policy.compile()?)?,
|
|
||||||
_ => panic!("Invalid type"),
|
|
||||||
};
|
|
||||||
|
|
||||||
info!("... Descriptor: {}", descriptor);
|
info!("Compiled into following Descriptor: \n{}", descriptor);
|
||||||
|
|
||||||
let database = MemoryDatabase::new();
|
let database = MemoryDatabase::new();
|
||||||
|
|
||||||
let network = matches
|
// Create a new wallet from this descriptor
|
||||||
.value_of("network")
|
let wallet = Wallet::new(&format!("{}", descriptor), None, Network::Regtest, database)?;
|
||||||
.map(Network::from_str)
|
|
||||||
.transpose()
|
|
||||||
.unwrap()
|
|
||||||
.unwrap_or(Network::Testnet);
|
|
||||||
let wallet = Wallet::new(&format!("{}", descriptor), None, network, database)?;
|
|
||||||
|
|
||||||
info!("... First address: {}", wallet.get_address(New)?);
|
info!(
|
||||||
|
"First derived address from the descriptor: \n{}",
|
||||||
|
wallet.get_address(New)?
|
||||||
|
);
|
||||||
|
|
||||||
if matches.is_present("parsed_policy") {
|
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
||||||
let spending_policy = wallet.policies(KeychainKind::External)?;
|
// human readable json format.
|
||||||
info!(
|
let spending_policy = wallet.policies(KeychainKind::External)?;
|
||||||
"... Spending policy:\n{}",
|
info!(
|
||||||
serde_json::to_string_pretty(&spending_policy)?
|
"The BDK spending policy: \n{}",
|
||||||
);
|
serde_json::to_string_pretty(&spending_policy)?
|
||||||
}
|
);
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|||||||
87
examples/electrum_backend.rs
Normal file
87
examples/electrum_backend.rs
Normal file
@@ -0,0 +1,87 @@
|
|||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
use bdk::bitcoin::bip32::ExtendedPrivKey;
|
||||||
|
use bdk::bitcoin::Network;
|
||||||
|
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||||
|
use bdk::database::MemoryDatabase;
|
||||||
|
use bdk::template::Bip84;
|
||||||
|
use bdk::wallet::export::FullyNodedExport;
|
||||||
|
use bdk::{KeychainKind, SyncOptions, Wallet};
|
||||||
|
|
||||||
|
use bdk::electrum_client::Client;
|
||||||
|
use bdk::wallet::AddressIndex;
|
||||||
|
use bitcoin::bip32;
|
||||||
|
|
||||||
|
pub mod utils;
|
||||||
|
|
||||||
|
use crate::utils::tx::build_signed_tx;
|
||||||
|
|
||||||
|
/// This will create a wallet from an xpriv and get the balance by connecting to an Electrum server.
|
||||||
|
/// If enough amount is available, this will send a transaction to an address.
|
||||||
|
/// Otherwise, this will display a wallet address to receive funds.
|
||||||
|
///
|
||||||
|
/// This can be run with `cargo run --example electrum_backend` in the root folder.
|
||||||
|
fn main() {
|
||||||
|
let network = Network::Testnet;
|
||||||
|
|
||||||
|
let xpriv = "tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy";
|
||||||
|
|
||||||
|
let electrum_url = "ssl://electrum.blockstream.info:60002";
|
||||||
|
|
||||||
|
run(&network, electrum_url, xpriv);
|
||||||
|
}
|
||||||
|
|
||||||
|
fn create_wallet(network: &Network, xpriv: &ExtendedPrivKey) -> Wallet<MemoryDatabase> {
|
||||||
|
Wallet::new(
|
||||||
|
Bip84(*xpriv, KeychainKind::External),
|
||||||
|
Some(Bip84(*xpriv, KeychainKind::Internal)),
|
||||||
|
*network,
|
||||||
|
MemoryDatabase::default(),
|
||||||
|
)
|
||||||
|
.unwrap()
|
||||||
|
}
|
||||||
|
|
||||||
|
fn run(network: &Network, electrum_url: &str, xpriv: &str) {
|
||||||
|
let xpriv = bip32::ExtendedPrivKey::from_str(xpriv).unwrap();
|
||||||
|
|
||||||
|
// Apparently it works only with Electrs (not EletrumX)
|
||||||
|
let blockchain = ElectrumBlockchain::from(Client::new(electrum_url).unwrap());
|
||||||
|
|
||||||
|
let wallet = create_wallet(network, &xpriv);
|
||||||
|
|
||||||
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
|
|
||||||
|
let address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||||
|
|
||||||
|
println!("address: {}", address);
|
||||||
|
|
||||||
|
let balance = wallet.get_balance().unwrap();
|
||||||
|
|
||||||
|
println!("Available coins in BDK wallet : {} sats", balance);
|
||||||
|
|
||||||
|
if balance.confirmed > 6500 {
|
||||||
|
// the wallet sends the amount to itself.
|
||||||
|
let recipient_address = wallet
|
||||||
|
.get_address(AddressIndex::New)
|
||||||
|
.unwrap()
|
||||||
|
.address
|
||||||
|
.to_string();
|
||||||
|
|
||||||
|
let amount = 5359;
|
||||||
|
|
||||||
|
let tx = build_signed_tx(&wallet, &recipient_address, amount);
|
||||||
|
|
||||||
|
blockchain.broadcast(&tx).unwrap();
|
||||||
|
|
||||||
|
println!("tx id: {}", tx.txid());
|
||||||
|
} else {
|
||||||
|
println!("Insufficient Funds. Fund the wallet with the address above");
|
||||||
|
}
|
||||||
|
|
||||||
|
let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
||||||
|
.map_err(ToString::to_string)
|
||||||
|
.map_err(bdk::Error::Generic)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
println!("------\nWallet Backup: {}", export.to_string());
|
||||||
|
}
|
||||||
93
examples/esplora_backend_asynchronous.rs
Normal file
93
examples/esplora_backend_asynchronous.rs
Normal file
@@ -0,0 +1,93 @@
|
|||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
use bdk::blockchain::Blockchain;
|
||||||
|
use bdk::{
|
||||||
|
blockchain::esplora::EsploraBlockchain,
|
||||||
|
database::MemoryDatabase,
|
||||||
|
template::Bip84,
|
||||||
|
wallet::{export::FullyNodedExport, AddressIndex},
|
||||||
|
KeychainKind, SyncOptions, Wallet,
|
||||||
|
};
|
||||||
|
use bitcoin::{
|
||||||
|
bip32::{self, ExtendedPrivKey},
|
||||||
|
Network,
|
||||||
|
};
|
||||||
|
|
||||||
|
pub mod utils;
|
||||||
|
|
||||||
|
use crate::utils::tx::build_signed_tx;
|
||||||
|
|
||||||
|
/// This will create a wallet from an xpriv and get the balance by connecting to an Esplora server,
|
||||||
|
/// using non blocking asynchronous calls with `reqwest`.
|
||||||
|
/// If enough amount is available, this will send a transaction to an address.
|
||||||
|
/// Otherwise, this will display a wallet address to receive funds.
|
||||||
|
///
|
||||||
|
/// This can be run with `cargo run --no-default-features --features="use-esplora-reqwest, reqwest-default-tls, async-interface" --example esplora_backend_asynchronous`
|
||||||
|
/// in the root folder.
|
||||||
|
#[tokio::main(flavor = "current_thread")]
|
||||||
|
async fn main() {
|
||||||
|
let network = Network::Signet;
|
||||||
|
|
||||||
|
let xpriv = "tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy";
|
||||||
|
|
||||||
|
let esplora_url = "https://explorer.bc-2.jp/api";
|
||||||
|
|
||||||
|
run(&network, esplora_url, xpriv).await;
|
||||||
|
}
|
||||||
|
|
||||||
|
fn create_wallet(network: &Network, xpriv: &ExtendedPrivKey) -> Wallet<MemoryDatabase> {
|
||||||
|
Wallet::new(
|
||||||
|
Bip84(*xpriv, KeychainKind::External),
|
||||||
|
Some(Bip84(*xpriv, KeychainKind::Internal)),
|
||||||
|
*network,
|
||||||
|
MemoryDatabase::default(),
|
||||||
|
)
|
||||||
|
.unwrap()
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn run(network: &Network, esplora_url: &str, xpriv: &str) {
|
||||||
|
let xpriv = bip32::ExtendedPrivKey::from_str(xpriv).unwrap();
|
||||||
|
|
||||||
|
let blockchain = EsploraBlockchain::new(esplora_url, 20);
|
||||||
|
|
||||||
|
let wallet = create_wallet(network, &xpriv);
|
||||||
|
|
||||||
|
wallet
|
||||||
|
.sync(&blockchain, SyncOptions::default())
|
||||||
|
.await
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
let address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||||
|
|
||||||
|
println!("address: {}", address);
|
||||||
|
|
||||||
|
let balance = wallet.get_balance().unwrap();
|
||||||
|
|
||||||
|
println!("Available coins in BDK wallet : {} sats", balance);
|
||||||
|
|
||||||
|
if balance.confirmed > 10500 {
|
||||||
|
// the wallet sends the amount to itself.
|
||||||
|
let recipient_address = wallet
|
||||||
|
.get_address(AddressIndex::New)
|
||||||
|
.unwrap()
|
||||||
|
.address
|
||||||
|
.to_string();
|
||||||
|
|
||||||
|
let amount = 9359;
|
||||||
|
|
||||||
|
let tx = build_signed_tx(&wallet, &recipient_address, amount);
|
||||||
|
|
||||||
|
let _ = blockchain.broadcast(&tx);
|
||||||
|
|
||||||
|
println!("tx id: {}", tx.txid());
|
||||||
|
} else {
|
||||||
|
println!("Insufficient Funds. Fund the wallet with the address above");
|
||||||
|
}
|
||||||
|
|
||||||
|
let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
||||||
|
.map_err(ToString::to_string)
|
||||||
|
.map_err(bdk::Error::Generic)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
println!("------\nWallet Backup: {}", export.to_string());
|
||||||
|
}
|
||||||
89
examples/esplora_backend_synchronous.rs
Normal file
89
examples/esplora_backend_synchronous.rs
Normal file
@@ -0,0 +1,89 @@
|
|||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
use bdk::blockchain::Blockchain;
|
||||||
|
use bdk::{
|
||||||
|
blockchain::esplora::EsploraBlockchain,
|
||||||
|
database::MemoryDatabase,
|
||||||
|
template::Bip84,
|
||||||
|
wallet::{export::FullyNodedExport, AddressIndex},
|
||||||
|
KeychainKind, SyncOptions, Wallet,
|
||||||
|
};
|
||||||
|
use bitcoin::{
|
||||||
|
bip32::{self, ExtendedPrivKey},
|
||||||
|
Network,
|
||||||
|
};
|
||||||
|
|
||||||
|
pub mod utils;
|
||||||
|
|
||||||
|
use crate::utils::tx::build_signed_tx;
|
||||||
|
|
||||||
|
/// This will create a wallet from an xpriv and get the balance by connecting to an Esplora server,
|
||||||
|
/// using blocking calls with `ureq`.
|
||||||
|
/// If enough amount is available, this will send a transaction to an address.
|
||||||
|
/// Otherwise, this will display a wallet address to receive funds.
|
||||||
|
///
|
||||||
|
/// This can be run with `cargo run --features=use-esplora-ureq --example esplora_backend_synchronous`
|
||||||
|
/// in the root folder.
|
||||||
|
fn main() {
|
||||||
|
let network = Network::Signet;
|
||||||
|
|
||||||
|
let xpriv = "tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy";
|
||||||
|
|
||||||
|
let esplora_url = "https://explorer.bc-2.jp/api";
|
||||||
|
|
||||||
|
run(&network, esplora_url, xpriv);
|
||||||
|
}
|
||||||
|
|
||||||
|
fn create_wallet(network: &Network, xpriv: &ExtendedPrivKey) -> Wallet<MemoryDatabase> {
|
||||||
|
Wallet::new(
|
||||||
|
Bip84(*xpriv, KeychainKind::External),
|
||||||
|
Some(Bip84(*xpriv, KeychainKind::Internal)),
|
||||||
|
*network,
|
||||||
|
MemoryDatabase::default(),
|
||||||
|
)
|
||||||
|
.unwrap()
|
||||||
|
}
|
||||||
|
|
||||||
|
fn run(network: &Network, esplora_url: &str, xpriv: &str) {
|
||||||
|
let xpriv = bip32::ExtendedPrivKey::from_str(xpriv).unwrap();
|
||||||
|
|
||||||
|
let blockchain = EsploraBlockchain::new(esplora_url, 20);
|
||||||
|
|
||||||
|
let wallet = create_wallet(network, &xpriv);
|
||||||
|
|
||||||
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
|
|
||||||
|
let address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||||
|
|
||||||
|
println!("address: {}", address);
|
||||||
|
|
||||||
|
let balance = wallet.get_balance().unwrap();
|
||||||
|
|
||||||
|
println!("Available coins in BDK wallet : {} sats", balance);
|
||||||
|
|
||||||
|
if balance.confirmed > 10500 {
|
||||||
|
// the wallet sends the amount to itself.
|
||||||
|
let recipient_address = wallet
|
||||||
|
.get_address(AddressIndex::New)
|
||||||
|
.unwrap()
|
||||||
|
.address
|
||||||
|
.to_string();
|
||||||
|
|
||||||
|
let amount = 9359;
|
||||||
|
|
||||||
|
let tx = build_signed_tx(&wallet, &recipient_address, amount);
|
||||||
|
|
||||||
|
blockchain.broadcast(&tx).unwrap();
|
||||||
|
|
||||||
|
println!("tx id: {}", tx.txid());
|
||||||
|
} else {
|
||||||
|
println!("Insufficient Funds. Fund the wallet with the address above");
|
||||||
|
}
|
||||||
|
|
||||||
|
let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
||||||
|
.map_err(ToString::to_string)
|
||||||
|
.map_err(bdk::Error::Generic)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
println!("------\nWallet Backup: {}", export.to_string());
|
||||||
|
}
|
||||||
106
examples/hardware_signer.rs
Normal file
106
examples/hardware_signer.rs
Normal file
@@ -0,0 +1,106 @@
|
|||||||
|
use bdk::bitcoin::{Address, Network};
|
||||||
|
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||||
|
use bdk::database::MemoryDatabase;
|
||||||
|
use bdk::hwi::HWIClient;
|
||||||
|
use bdk::miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
|
use bdk::signer::SignerOrdering;
|
||||||
|
use bdk::wallet::{hardwaresigner::HWISigner, AddressIndex};
|
||||||
|
use bdk::{FeeRate, KeychainKind, SignOptions, SyncOptions, Wallet};
|
||||||
|
use electrum_client::Client;
|
||||||
|
use std::str::FromStr;
|
||||||
|
use std::sync::Arc;
|
||||||
|
|
||||||
|
// This example shows how to sync a wallet, create a transaction, sign it
|
||||||
|
// and broadcast it using an external hardware wallet.
|
||||||
|
// The hardware wallet must be connected to the computer and unlocked before
|
||||||
|
// running the example. Also, the `hwi` python package should be installed
|
||||||
|
// and available in the environment.
|
||||||
|
//
|
||||||
|
// To avoid loss of funds, consider using an hardware wallet simulator:
|
||||||
|
// * Coldcard: https://github.com/Coldcard/firmware
|
||||||
|
// * Ledger: https://github.com/LedgerHQ/speculos
|
||||||
|
// * Trezor: https://docs.trezor.io/trezor-firmware/core/emulator/index.html
|
||||||
|
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
|
println!("Hold tight, I'm connecting to your hardware wallet...");
|
||||||
|
|
||||||
|
// Listing all the available hardware wallet devices...
|
||||||
|
let mut devices = HWIClient::enumerate()?;
|
||||||
|
if devices.is_empty() {
|
||||||
|
panic!("No devices found. Either plug in a hardware wallet, or start a simulator.");
|
||||||
|
}
|
||||||
|
let first_device = devices.remove(0)?;
|
||||||
|
// ...and creating a client out of the first one
|
||||||
|
let client = HWIClient::get_client(&first_device, true, Network::Testnet.into())?;
|
||||||
|
println!("Look what I found, a {}!", first_device.model);
|
||||||
|
|
||||||
|
// Getting the HW's public descriptors
|
||||||
|
let descriptors = client.get_descriptors::<Descriptor<DescriptorPublicKey>>(None)?;
|
||||||
|
println!(
|
||||||
|
"The hardware wallet's descriptor is: {}",
|
||||||
|
descriptors.receive[0]
|
||||||
|
);
|
||||||
|
|
||||||
|
// Creating a custom signer from the device
|
||||||
|
let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
|
let mut wallet = Wallet::new(
|
||||||
|
descriptors.receive[0].clone(),
|
||||||
|
Some(descriptors.internal[0].clone()),
|
||||||
|
Network::Testnet,
|
||||||
|
MemoryDatabase::default(),
|
||||||
|
)?;
|
||||||
|
|
||||||
|
// Adding the hardware signer to the BDK wallet
|
||||||
|
wallet.add_signer(
|
||||||
|
KeychainKind::External,
|
||||||
|
SignerOrdering(200),
|
||||||
|
Arc::new(custom_signer),
|
||||||
|
);
|
||||||
|
|
||||||
|
// create client for Blockstream's testnet electrum server
|
||||||
|
let blockchain =
|
||||||
|
ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||||
|
|
||||||
|
println!("Syncing the wallet...");
|
||||||
|
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||||
|
|
||||||
|
// get deposit address
|
||||||
|
let deposit_address = wallet.get_address(AddressIndex::New)?;
|
||||||
|
|
||||||
|
let balance = wallet.get_balance()?;
|
||||||
|
println!("Wallet balances in SATs: {}", balance);
|
||||||
|
|
||||||
|
if balance.get_total() < 10000 {
|
||||||
|
println!(
|
||||||
|
"Send some sats from the u01.net testnet faucet to address '{addr}'.\nFaucet URL: https://bitcoinfaucet.uo1.net/?to={addr}",
|
||||||
|
addr = deposit_address.address
|
||||||
|
);
|
||||||
|
return Ok(());
|
||||||
|
}
|
||||||
|
|
||||||
|
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
|
let (mut psbt, _details) = {
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder
|
||||||
|
.drain_wallet()
|
||||||
|
.drain_to(return_address.script_pubkey())
|
||||||
|
.enable_rbf()
|
||||||
|
.fee_rate(FeeRate::from_sat_per_vb(5.0));
|
||||||
|
builder.finish()?
|
||||||
|
};
|
||||||
|
|
||||||
|
// `sign` will call the hardware wallet asking for a signature
|
||||||
|
assert!(
|
||||||
|
wallet.sign(&mut psbt, SignOptions::default())?,
|
||||||
|
"The hardware wallet couldn't finalize the transaction :("
|
||||||
|
);
|
||||||
|
|
||||||
|
println!("Let's broadcast your tx...");
|
||||||
|
let raw_transaction = psbt.extract_tx();
|
||||||
|
let txid = raw_transaction.txid();
|
||||||
|
|
||||||
|
blockchain.broadcast(&raw_transaction)?;
|
||||||
|
println!("Transaction broadcasted! TXID: {txid}.\nExplorer URL: https://mempool.space/testnet/tx/{txid}", txid = txid);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
60
examples/mnemonic_to_descriptors.rs
Normal file
60
examples/mnemonic_to_descriptors.rs
Normal file
@@ -0,0 +1,60 @@
|
|||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
use bdk::bitcoin::bip32::DerivationPath;
|
||||||
|
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||||
|
use bdk::bitcoin::Network;
|
||||||
|
use bdk::descriptor;
|
||||||
|
use bdk::descriptor::IntoWalletDescriptor;
|
||||||
|
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
||||||
|
use bdk::keys::{GeneratableKey, GeneratedKey};
|
||||||
|
use bdk::miniscript::Tap;
|
||||||
|
use bdk::Error as BDK_Error;
|
||||||
|
use std::error::Error;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
/// This example demonstrates how to generate a mnemonic phrase
|
||||||
|
/// using BDK and use that to generate a descriptor string.
|
||||||
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
|
// In this example we are generating a 12 words mnemonic phrase
|
||||||
|
// but it is also possible generate 15, 18, 21 and 24 words
|
||||||
|
// using their respective `WordCount` variant.
|
||||||
|
let mnemonic: GeneratedKey<_, Tap> =
|
||||||
|
Mnemonic::generate((WordCount::Words12, Language::English))
|
||||||
|
.map_err(|_| BDK_Error::Generic("Mnemonic generation error".to_string()))?;
|
||||||
|
|
||||||
|
println!("Mnemonic phrase: {}", *mnemonic);
|
||||||
|
let mnemonic_with_passphrase = (mnemonic, None);
|
||||||
|
|
||||||
|
// define external and internal derivation key path
|
||||||
|
let external_path = DerivationPath::from_str("m/86h/0h/0h/0").unwrap();
|
||||||
|
let internal_path = DerivationPath::from_str("m/86h/0h/0h/1").unwrap();
|
||||||
|
|
||||||
|
// generate external and internal descriptor from mnemonic
|
||||||
|
let (external_descriptor, ext_keymap) =
|
||||||
|
descriptor!(tr((mnemonic_with_passphrase.clone(), external_path)))?
|
||||||
|
.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||||
|
let (internal_descriptor, int_keymap) =
|
||||||
|
descriptor!(tr((mnemonic_with_passphrase, internal_path)))?
|
||||||
|
.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||||
|
|
||||||
|
println!("tpub external descriptor: {}", external_descriptor);
|
||||||
|
println!("tpub internal descriptor: {}", internal_descriptor);
|
||||||
|
println!(
|
||||||
|
"tprv external descriptor: {}",
|
||||||
|
external_descriptor.to_string_with_secret(&ext_keymap)
|
||||||
|
);
|
||||||
|
println!(
|
||||||
|
"tprv internal descriptor: {}",
|
||||||
|
internal_descriptor.to_string_with_secret(&int_keymap)
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
66
examples/policy.rs
Normal file
66
examples/policy.rs
Normal file
@@ -0,0 +1,66 @@
|
|||||||
|
// Bitcoin Dev Kit
|
||||||
|
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||||
|
//
|
||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
extern crate bdk;
|
||||||
|
extern crate env_logger;
|
||||||
|
extern crate log;
|
||||||
|
use std::error::Error;
|
||||||
|
|
||||||
|
use bdk::bitcoin::Network;
|
||||||
|
use bdk::descriptor::{policy::BuildSatisfaction, ExtractPolicy, IntoWalletDescriptor};
|
||||||
|
use bdk::wallet::signer::SignersContainer;
|
||||||
|
|
||||||
|
/// This example describes the use of the BDK's [`bdk::descriptor::policy`] module.
|
||||||
|
///
|
||||||
|
/// Policy is higher abstraction representation of the wallet descriptor spending condition.
|
||||||
|
/// This is useful to express complex miniscript spending conditions into more human readable form.
|
||||||
|
/// The resulting `Policy` structure can be used to derive spending conditions the wallet is capable
|
||||||
|
/// to spend from.
|
||||||
|
///
|
||||||
|
/// This example demos a Policy output for a 2of2 multisig between between 2 parties, where the wallet holds
|
||||||
|
/// one of the Extend Private key.
|
||||||
|
|
||||||
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
|
env_logger::init_from_env(
|
||||||
|
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
||||||
|
);
|
||||||
|
|
||||||
|
let secp = bitcoin::secp256k1::Secp256k1::new();
|
||||||
|
|
||||||
|
// The descriptor used in the example
|
||||||
|
// The form is "wsh(multi(2, <privkey>, <pubkey>))"
|
||||||
|
let desc = "wsh(multi(2,tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/1/*))";
|
||||||
|
|
||||||
|
// Use the descriptor string to derive the full descriptor and a keymap.
|
||||||
|
// The wallet descriptor can be used to create a new bdk::wallet.
|
||||||
|
// While the `keymap` can be used to create a `SignerContainer`.
|
||||||
|
//
|
||||||
|
// The `SignerContainer` can sign for `PSBT`s.
|
||||||
|
// a bdk::wallet internally uses these to handle transaction signing.
|
||||||
|
// But they can be used as independent tools also.
|
||||||
|
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||||
|
|
||||||
|
log::info!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||||
|
|
||||||
|
// Create the signer with the keymap and descriptor.
|
||||||
|
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
||||||
|
|
||||||
|
// Extract the Policy from the given descriptor and signer.
|
||||||
|
// Note that Policy is a wallet specific structure. It depends on the the descriptor, and
|
||||||
|
// what the concerned wallet with a given signer can sign for.
|
||||||
|
let policy = wallet_desc
|
||||||
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
||||||
|
.expect("We expect a policy");
|
||||||
|
|
||||||
|
log::info!("Derived Policy for the descriptor {:#?}", policy);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
121
examples/psbt_signer.rs
Normal file
121
examples/psbt_signer.rs
Normal file
@@ -0,0 +1,121 @@
|
|||||||
|
// Copyright (c) 2020-2022 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||||
|
use bdk::database::MemoryDatabase;
|
||||||
|
use bdk::wallet::AddressIndex;
|
||||||
|
use bdk::{descriptor, SyncOptions};
|
||||||
|
use bdk::{FeeRate, SignOptions, Wallet};
|
||||||
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
|
use bitcoin::{Address, Network};
|
||||||
|
use electrum_client::Client;
|
||||||
|
use miniscript::descriptor::DescriptorSecretKey;
|
||||||
|
use std::error::Error;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
/// This example shows how to sign and broadcast the transaction for a PSBT (Partially Signed
|
||||||
|
/// Bitcoin Transaction) for a single key, witness public key hash (WPKH) based descriptor wallet.
|
||||||
|
/// The electrum protocol is used to sync blockchain data from the testnet bitcoin network and
|
||||||
|
/// wallet data is stored in an ephemeral in-memory database. The process steps are:
|
||||||
|
/// 1. Create a "signing" wallet and a "watch-only" wallet based on the same private keys.
|
||||||
|
/// 2. Deposit testnet funds into the watch only wallet.
|
||||||
|
/// 3. Sync the watch only wallet and create a spending transaction to return all funds to the testnet faucet.
|
||||||
|
/// 4. Sync the signing wallet and sign and finalize the PSBT created by the watch only wallet.
|
||||||
|
/// 5. Broadcast the transactions from the finalized PSBT.
|
||||||
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
|
// test key created with `bdk-cli key generate` and `bdk-cli key derive` commands
|
||||||
|
let external_secret_xkey = DescriptorSecretKey::from_str("[e9824965/84'/1'/0']tprv8fvem7qWxY3SGCQczQpRpqTKg455wf1zgixn6MZ4ze8gRfHjov5gXBQTadNfDgqs9ERbZZ3Bi1PNYrCCusFLucT39K525MWLpeURjHwUsfX/0/*").unwrap();
|
||||||
|
let internal_secret_xkey = DescriptorSecretKey::from_str("[e9824965/84'/1'/0']tprv8fvem7qWxY3SGCQczQpRpqTKg455wf1zgixn6MZ4ze8gRfHjov5gXBQTadNfDgqs9ERbZZ3Bi1PNYrCCusFLucT39K525MWLpeURjHwUsfX/1/*").unwrap();
|
||||||
|
|
||||||
|
let secp = Secp256k1::new();
|
||||||
|
let external_public_xkey = external_secret_xkey.to_public(&secp).unwrap();
|
||||||
|
let internal_public_xkey = internal_secret_xkey.to_public(&secp).unwrap();
|
||||||
|
|
||||||
|
let signing_external_descriptor = descriptor!(wpkh(external_secret_xkey)).unwrap();
|
||||||
|
let signing_internal_descriptor = descriptor!(wpkh(internal_secret_xkey)).unwrap();
|
||||||
|
|
||||||
|
let watch_only_external_descriptor = descriptor!(wpkh(external_public_xkey)).unwrap();
|
||||||
|
let watch_only_internal_descriptor = descriptor!(wpkh(internal_public_xkey)).unwrap();
|
||||||
|
|
||||||
|
// create client for Blockstream's testnet electrum server
|
||||||
|
let blockchain =
|
||||||
|
ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||||
|
|
||||||
|
// create watch only wallet
|
||||||
|
let watch_only_wallet: Wallet<MemoryDatabase> = Wallet::new(
|
||||||
|
watch_only_external_descriptor,
|
||||||
|
Some(watch_only_internal_descriptor),
|
||||||
|
Network::Testnet,
|
||||||
|
MemoryDatabase::default(),
|
||||||
|
)?;
|
||||||
|
|
||||||
|
// create signing wallet
|
||||||
|
let signing_wallet: Wallet<MemoryDatabase> = Wallet::new(
|
||||||
|
signing_external_descriptor,
|
||||||
|
Some(signing_internal_descriptor),
|
||||||
|
Network::Testnet,
|
||||||
|
MemoryDatabase::default(),
|
||||||
|
)?;
|
||||||
|
|
||||||
|
println!("Syncing watch only wallet.");
|
||||||
|
watch_only_wallet.sync(&blockchain, SyncOptions::default())?;
|
||||||
|
|
||||||
|
// get deposit address
|
||||||
|
let deposit_address = watch_only_wallet.get_address(AddressIndex::New)?;
|
||||||
|
|
||||||
|
let balance = watch_only_wallet.get_balance()?;
|
||||||
|
println!("Watch only wallet balances in SATs: {}", balance);
|
||||||
|
|
||||||
|
if balance.get_total() < 10000 {
|
||||||
|
println!(
|
||||||
|
"Send at least 10000 SATs (0.0001 BTC) from the u01.net testnet faucet to address '{addr}'.\nFaucet URL: https://bitcoinfaucet.uo1.net/?to={addr}",
|
||||||
|
addr = deposit_address.address
|
||||||
|
);
|
||||||
|
} else if balance.get_spendable() < 10000 {
|
||||||
|
println!(
|
||||||
|
"Wait for at least 10000 SATs of your wallet transactions to be confirmed...\nBe patient, this could take 10 mins or longer depending on how testnet is behaving."
|
||||||
|
);
|
||||||
|
for tx_details in watch_only_wallet
|
||||||
|
.list_transactions(false)?
|
||||||
|
.iter()
|
||||||
|
.filter(|txd| txd.received > 0 && txd.confirmation_time.is_none())
|
||||||
|
{
|
||||||
|
println!(
|
||||||
|
"See unconfirmed tx for {} SATs: https://mempool.space/testnet/tx/{}",
|
||||||
|
tx_details.received, tx_details.txid
|
||||||
|
);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
println!("Creating a PSBT sending 9800 SATs plus fee to the u01.net testnet faucet return address 'tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt'.");
|
||||||
|
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
|
let mut builder = watch_only_wallet.build_tx();
|
||||||
|
builder
|
||||||
|
.add_recipient(return_address.script_pubkey(), 9_800)
|
||||||
|
.enable_rbf()
|
||||||
|
.fee_rate(FeeRate::from_sat_per_vb(1.0));
|
||||||
|
|
||||||
|
let (mut psbt, details) = builder.finish()?;
|
||||||
|
println!("Transaction details: {:#?}", details);
|
||||||
|
println!("Unsigned PSBT: {}", psbt);
|
||||||
|
|
||||||
|
// Sign and finalize the PSBT with the signing wallet
|
||||||
|
let finalized = signing_wallet.sign(&mut psbt, SignOptions::default())?;
|
||||||
|
assert!(finalized, "The PSBT was not finalized!");
|
||||||
|
println!("The PSBT has been signed and finalized.");
|
||||||
|
|
||||||
|
// Broadcast the transaction
|
||||||
|
let raw_transaction = psbt.extract_tx();
|
||||||
|
let txid = raw_transaction.txid();
|
||||||
|
|
||||||
|
blockchain.broadcast(&raw_transaction)?;
|
||||||
|
println!("Transaction broadcast! TXID: {txid}.\nExplorer URL: https://mempool.space/testnet/tx/{txid}", txid = txid);
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
@@ -62,7 +62,10 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
};
|
};
|
||||||
|
|
||||||
// Get a new core address
|
// Get a new core address
|
||||||
let core_address = bitcoind.client.get_new_address(None, None)?;
|
let core_address = bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)?
|
||||||
|
.require_network(Network::Regtest)?;
|
||||||
|
|
||||||
// Generate 101 blocks and use the above address as coinbase
|
// Generate 101 blocks and use the above address as coinbase
|
||||||
bitcoind.client.generate_to_address(101, &core_address)?;
|
bitcoind.client.generate_to_address(101, &core_address)?;
|
||||||
|
|||||||
33
examples/utils/mod.rs
Normal file
33
examples/utils/mod.rs
Normal file
@@ -0,0 +1,33 @@
|
|||||||
|
pub(crate) mod tx {
|
||||||
|
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
use bdk::{database::BatchDatabase, SignOptions, Wallet};
|
||||||
|
use bitcoin::{Address, Transaction};
|
||||||
|
|
||||||
|
pub fn build_signed_tx<D: BatchDatabase>(
|
||||||
|
wallet: &Wallet<D>,
|
||||||
|
recipient_address: &str,
|
||||||
|
amount: u64,
|
||||||
|
) -> Transaction {
|
||||||
|
// Create a transaction builder
|
||||||
|
let mut tx_builder = wallet.build_tx();
|
||||||
|
|
||||||
|
let to_address = Address::from_str(recipient_address)
|
||||||
|
.unwrap()
|
||||||
|
.require_network(wallet.network())
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
// Set recipient of the transaction
|
||||||
|
tx_builder.set_recipients(vec![(to_address.script_pubkey(), amount)]);
|
||||||
|
|
||||||
|
// Finalise the transaction and extract PSBT
|
||||||
|
let (mut psbt, _) = tx_builder.finish().unwrap();
|
||||||
|
|
||||||
|
// Sign the above psbt with signing option
|
||||||
|
wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||||
|
|
||||||
|
// Extract the final transaction
|
||||||
|
psbt.extract_tx()
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -19,7 +19,7 @@ use syn::{parse, ImplItemMethod, ItemImpl, ItemTrait, Token};
|
|||||||
|
|
||||||
fn add_async_trait(mut parsed: ItemTrait) -> TokenStream {
|
fn add_async_trait(mut parsed: ItemTrait) -> TokenStream {
|
||||||
let output = quote! {
|
let output = quote! {
|
||||||
#[cfg(all(not(target_arch = "wasm32"), not(feature = "async-interface")))]
|
#[cfg(not(feature = "async-interface"))]
|
||||||
#parsed
|
#parsed
|
||||||
};
|
};
|
||||||
|
|
||||||
@@ -32,7 +32,7 @@ fn add_async_trait(mut parsed: ItemTrait) -> TokenStream {
|
|||||||
let output = quote! {
|
let output = quote! {
|
||||||
#output
|
#output
|
||||||
|
|
||||||
#[cfg(any(target_arch = "wasm32", feature = "async-interface"))]
|
#[cfg(feature = "async-interface")]
|
||||||
#[async_trait(?Send)]
|
#[async_trait(?Send)]
|
||||||
#parsed
|
#parsed
|
||||||
};
|
};
|
||||||
@@ -42,7 +42,7 @@ fn add_async_trait(mut parsed: ItemTrait) -> TokenStream {
|
|||||||
|
|
||||||
fn add_async_method(mut parsed: ImplItemMethod) -> TokenStream {
|
fn add_async_method(mut parsed: ImplItemMethod) -> TokenStream {
|
||||||
let output = quote! {
|
let output = quote! {
|
||||||
#[cfg(all(not(target_arch = "wasm32"), not(feature = "async-interface")))]
|
#[cfg(not(feature = "async-interface"))]
|
||||||
#parsed
|
#parsed
|
||||||
};
|
};
|
||||||
|
|
||||||
@@ -51,7 +51,7 @@ fn add_async_method(mut parsed: ImplItemMethod) -> TokenStream {
|
|||||||
let output = quote! {
|
let output = quote! {
|
||||||
#output
|
#output
|
||||||
|
|
||||||
#[cfg(any(target_arch = "wasm32", feature = "async-interface"))]
|
#[cfg(feature = "async-interface")]
|
||||||
#parsed
|
#parsed
|
||||||
};
|
};
|
||||||
|
|
||||||
@@ -60,7 +60,7 @@ fn add_async_method(mut parsed: ImplItemMethod) -> TokenStream {
|
|||||||
|
|
||||||
fn add_async_impl_trait(mut parsed: ItemImpl) -> TokenStream {
|
fn add_async_impl_trait(mut parsed: ItemImpl) -> TokenStream {
|
||||||
let output = quote! {
|
let output = quote! {
|
||||||
#[cfg(all(not(target_arch = "wasm32"), not(feature = "async-interface")))]
|
#[cfg(not(feature = "async-interface"))]
|
||||||
#parsed
|
#parsed
|
||||||
};
|
};
|
||||||
|
|
||||||
@@ -73,7 +73,7 @@ fn add_async_impl_trait(mut parsed: ItemImpl) -> TokenStream {
|
|||||||
let output = quote! {
|
let output = quote! {
|
||||||
#output
|
#output
|
||||||
|
|
||||||
#[cfg(any(target_arch = "wasm32", feature = "async-interface"))]
|
#[cfg(feature = "async-interface")]
|
||||||
#[async_trait(?Send)]
|
#[async_trait(?Send)]
|
||||||
#parsed
|
#parsed
|
||||||
};
|
};
|
||||||
@@ -81,7 +81,7 @@ fn add_async_impl_trait(mut parsed: ItemImpl) -> TokenStream {
|
|||||||
output.into()
|
output.into()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Makes a method or every method of a trait "async" only if the target_arch is "wasm32"
|
/// Makes a method or every method of a trait `async`, if the `async-interface` feature is enabled.
|
||||||
///
|
///
|
||||||
/// Requires the `async-trait` crate as a dependency whenever this attribute is used on a trait
|
/// Requires the `async-trait` crate as a dependency whenever this attribute is used on a trait
|
||||||
/// definition or trait implementation.
|
/// definition or trait implementation.
|
||||||
@@ -101,18 +101,18 @@ pub fn maybe_async(_attr: TokenStream, item: TokenStream) -> TokenStream {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Awaits if target_arch is "wasm32", does nothing otherwise
|
/// Awaits, if the `async-interface` feature is enabled.
|
||||||
#[proc_macro]
|
#[proc_macro]
|
||||||
pub fn maybe_await(expr: TokenStream) -> TokenStream {
|
pub fn maybe_await(expr: TokenStream) -> TokenStream {
|
||||||
let expr: proc_macro2::TokenStream = expr.into();
|
let expr: proc_macro2::TokenStream = expr.into();
|
||||||
let quoted = quote! {
|
let quoted = quote! {
|
||||||
{
|
{
|
||||||
#[cfg(all(not(target_arch = "wasm32"), not(feature = "async-interface")))]
|
#[cfg(not(feature = "async-interface"))]
|
||||||
{
|
{
|
||||||
#expr
|
#expr
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(any(target_arch = "wasm32", feature = "async-interface"))]
|
#[cfg(feature = "async-interface")]
|
||||||
{
|
{
|
||||||
#expr.await
|
#expr.await
|
||||||
}
|
}
|
||||||
@@ -122,20 +122,20 @@ pub fn maybe_await(expr: TokenStream) -> TokenStream {
|
|||||||
quoted.into()
|
quoted.into()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Awaits if target_arch is "wasm32", uses `tokio::Runtime::block_on()` otherwise
|
/// Awaits, if the `async-interface` feature is enabled, uses `tokio::Runtime::block_on()` otherwise
|
||||||
///
|
///
|
||||||
/// Requires the `tokio` crate as a dependecy with `rt-core` or `rt-threaded` to build on non-wasm32 platforms.
|
/// Requires the `tokio` crate as a dependecy with `rt-core` or `rt-threaded` to build.
|
||||||
#[proc_macro]
|
#[proc_macro]
|
||||||
pub fn await_or_block(expr: TokenStream) -> TokenStream {
|
pub fn await_or_block(expr: TokenStream) -> TokenStream {
|
||||||
let expr: proc_macro2::TokenStream = expr.into();
|
let expr: proc_macro2::TokenStream = expr.into();
|
||||||
let quoted = quote! {
|
let quoted = quote! {
|
||||||
{
|
{
|
||||||
#[cfg(all(not(target_arch = "wasm32"), not(feature = "async-interface")))]
|
#[cfg(not(feature = "async-interface"))]
|
||||||
{
|
{
|
||||||
tokio::runtime::Builder::new_current_thread().enable_all().build().unwrap().block_on(#expr)
|
tokio::runtime::Builder::new_current_thread().enable_all().build().unwrap().block_on(#expr)
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(any(target_arch = "wasm32", feature = "async-interface"))]
|
#[cfg(feature = "async-interface")]
|
||||||
{
|
{
|
||||||
#expr.await
|
#expr.await
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -131,7 +131,7 @@ impl GetBlockHash for AnyBlockchain {
|
|||||||
impl WalletSync for AnyBlockchain {
|
impl WalletSync for AnyBlockchain {
|
||||||
fn wallet_sync<D: BatchDatabase>(
|
fn wallet_sync<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
maybe_await!(impl_inner_method!(
|
maybe_await!(impl_inner_method!(
|
||||||
@@ -144,7 +144,7 @@ impl WalletSync for AnyBlockchain {
|
|||||||
|
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
maybe_await!(impl_inner_method!(
|
maybe_await!(impl_inner_method!(
|
||||||
@@ -178,7 +178,8 @@ impl_from!(boxed rpc::RpcBlockchain, AnyBlockchain, Rpc, #[cfg(feature = "rpc")]
|
|||||||
/// "type" : "electrum",
|
/// "type" : "electrum",
|
||||||
/// "url" : "ssl://electrum.blockstream.info:50002",
|
/// "url" : "ssl://electrum.blockstream.info:50002",
|
||||||
/// "retry": 2,
|
/// "retry": 2,
|
||||||
/// "stop_gap": 20
|
/// "stop_gap": 20,
|
||||||
|
/// "validate_domain": true
|
||||||
/// }"#,
|
/// }"#,
|
||||||
/// )
|
/// )
|
||||||
/// .unwrap();
|
/// .unwrap();
|
||||||
@@ -190,11 +191,12 @@ impl_from!(boxed rpc::RpcBlockchain, AnyBlockchain, Rpc, #[cfg(feature = "rpc")]
|
|||||||
/// socks5: None,
|
/// socks5: None,
|
||||||
/// timeout: None,
|
/// timeout: None,
|
||||||
/// stop_gap: 20,
|
/// stop_gap: 20,
|
||||||
|
/// validate_domain: true,
|
||||||
/// })
|
/// })
|
||||||
/// );
|
/// );
|
||||||
/// # }
|
/// # }
|
||||||
/// ```
|
/// ```
|
||||||
#[derive(Debug, serde::Serialize, serde::Deserialize, Clone, PartialEq)]
|
#[derive(Debug, serde::Serialize, serde::Deserialize, Clone, PartialEq, Eq)]
|
||||||
#[serde(tag = "type", rename_all = "snake_case")]
|
#[serde(tag = "type", rename_all = "snake_case")]
|
||||||
pub enum AnyBlockchainConfig {
|
pub enum AnyBlockchainConfig {
|
||||||
#[cfg(feature = "electrum")]
|
#[cfg(feature = "electrum")]
|
||||||
|
|||||||
@@ -51,6 +51,7 @@
|
|||||||
|
|
||||||
use std::collections::HashSet;
|
use std::collections::HashSet;
|
||||||
use std::fmt;
|
use std::fmt;
|
||||||
|
use std::ops::DerefMut;
|
||||||
use std::path::Path;
|
use std::path::Path;
|
||||||
use std::sync::atomic::{AtomicUsize, Ordering};
|
use std::sync::atomic::{AtomicUsize, Ordering};
|
||||||
use std::sync::{Arc, Mutex};
|
use std::sync::{Arc, Mutex};
|
||||||
@@ -274,7 +275,7 @@ impl WalletSync for CompactFiltersBlockchain {
|
|||||||
#[allow(clippy::mutex_atomic)] // Mutex is easier to understand than a CAS loop.
|
#[allow(clippy::mutex_atomic)] // Mutex is easier to understand than a CAS loop.
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
let first_peer = &self.peers[0];
|
let first_peer = &self.peers[0];
|
||||||
@@ -322,6 +323,9 @@ impl WalletSync for CompactFiltersBlockchain {
|
|||||||
|
|
||||||
cf_sync.prepare_sync(Arc::clone(first_peer))?;
|
cf_sync.prepare_sync(Arc::clone(first_peer))?;
|
||||||
|
|
||||||
|
let mut database = database.borrow_mut();
|
||||||
|
let database = database.deref_mut();
|
||||||
|
|
||||||
let all_scripts = Arc::new(
|
let all_scripts = Arc::new(
|
||||||
database
|
database
|
||||||
.iter_script_pubkeys(None)?
|
.iter_script_pubkeys(None)?
|
||||||
@@ -351,7 +355,7 @@ impl WalletSync for CompactFiltersBlockchain {
|
|||||||
peer,
|
peer,
|
||||||
|block_hash, filter| {
|
|block_hash, filter| {
|
||||||
if !filter
|
if !filter
|
||||||
.match_any(block_hash, &mut all_scripts.iter().map(AsRef::as_ref))?
|
.match_any(block_hash, all_scripts.iter().map(|s| s.as_slice()))?
|
||||||
{
|
{
|
||||||
return Ok(false);
|
return Ok(false);
|
||||||
}
|
}
|
||||||
@@ -479,7 +483,7 @@ impl WalletSync for CompactFiltersBlockchain {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Data to connect to a Bitcoin P2P peer
|
/// Data to connect to a Bitcoin P2P peer
|
||||||
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq)]
|
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq, Eq)]
|
||||||
pub struct BitcoinPeerConfig {
|
pub struct BitcoinPeerConfig {
|
||||||
/// Peer address such as 127.0.0.1:18333
|
/// Peer address such as 127.0.0.1:18333
|
||||||
pub address: String,
|
pub address: String,
|
||||||
@@ -490,7 +494,7 @@ pub struct BitcoinPeerConfig {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Configuration for a [`CompactFiltersBlockchain`]
|
/// Configuration for a [`CompactFiltersBlockchain`]
|
||||||
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq)]
|
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq, Eq)]
|
||||||
pub struct CompactFiltersBlockchainConfig {
|
pub struct CompactFiltersBlockchainConfig {
|
||||||
/// List of peers to try to connect to for asking headers and filters
|
/// List of peers to try to connect to for asking headers and filters
|
||||||
pub peers: Vec<BitcoinPeerConfig>,
|
pub peers: Vec<BitcoinPeerConfig>,
|
||||||
@@ -566,7 +570,7 @@ pub enum CompactFiltersError {
|
|||||||
/// Internal I/O error
|
/// Internal I/O error
|
||||||
Io(std::io::Error),
|
Io(std::io::Error),
|
||||||
/// Invalid BIP158 filter
|
/// Invalid BIP158 filter
|
||||||
Bip158(bitcoin::util::bip158::Error),
|
Bip158(bitcoin::bip158::Error),
|
||||||
/// Internal system time error
|
/// Internal system time error
|
||||||
Time(std::time::SystemTimeError),
|
Time(std::time::SystemTimeError),
|
||||||
|
|
||||||
@@ -576,7 +580,27 @@ pub enum CompactFiltersError {
|
|||||||
|
|
||||||
impl fmt::Display for CompactFiltersError {
|
impl fmt::Display for CompactFiltersError {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::InvalidResponse => write!(f, "A peer sent an invalid or unexpected response"),
|
||||||
|
Self::InvalidHeaders => write!(f, "Invalid headers"),
|
||||||
|
Self::InvalidFilterHeader => write!(f, "Invalid filter header"),
|
||||||
|
Self::InvalidFilter => write!(f, "Invalid filters"),
|
||||||
|
Self::MissingBlock => write!(f, "The peer is missing a block in the valid chain"),
|
||||||
|
Self::BlockHashNotFound => write!(f, "Block hash not found"),
|
||||||
|
Self::DataCorruption => write!(
|
||||||
|
f,
|
||||||
|
"The data stored in the block filters storage are corrupted"
|
||||||
|
),
|
||||||
|
Self::NotConnected => write!(f, "A peer is not connected"),
|
||||||
|
Self::Timeout => write!(f, "A peer took too long to reply to one of our messages"),
|
||||||
|
Self::PeerBloomDisabled => write!(f, "Peer doesn't advertise the BLOOM service flag"),
|
||||||
|
Self::NoPeers => write!(f, "No peers have been specified"),
|
||||||
|
Self::Db(err) => write!(f, "Internal database error: {}", err),
|
||||||
|
Self::Io(err) => write!(f, "Internal I/O error: {}", err),
|
||||||
|
Self::Bip158(err) => write!(f, "Invalid BIP158 filter: {}", err),
|
||||||
|
Self::Time(err) => write!(f, "Invalid system time: {}", err),
|
||||||
|
Self::Global(err) => write!(f, "Generic error: {}", err),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -584,7 +608,7 @@ impl std::error::Error for CompactFiltersError {}
|
|||||||
|
|
||||||
impl_error!(rocksdb::Error, Db, CompactFiltersError);
|
impl_error!(rocksdb::Error, Db, CompactFiltersError);
|
||||||
impl_error!(std::io::Error, Io, CompactFiltersError);
|
impl_error!(std::io::Error, Io, CompactFiltersError);
|
||||||
impl_error!(bitcoin::util::bip158::Error, Bip158, CompactFiltersError);
|
impl_error!(bitcoin::bip158::Error, Bip158, CompactFiltersError);
|
||||||
impl_error!(std::time::SystemTimeError, Time, CompactFiltersError);
|
impl_error!(std::time::SystemTimeError, Time, CompactFiltersError);
|
||||||
|
|
||||||
impl From<crate::error::Error> for CompactFiltersError {
|
impl From<crate::error::Error> for CompactFiltersError {
|
||||||
|
|||||||
@@ -27,7 +27,7 @@ use bitcoin::network::message::{NetworkMessage, RawNetworkMessage};
|
|||||||
use bitcoin::network::message_blockdata::*;
|
use bitcoin::network::message_blockdata::*;
|
||||||
use bitcoin::network::message_filter::*;
|
use bitcoin::network::message_filter::*;
|
||||||
use bitcoin::network::message_network::VersionMessage;
|
use bitcoin::network::message_network::VersionMessage;
|
||||||
use bitcoin::network::Address;
|
use bitcoin::network::{Address, Magic};
|
||||||
use bitcoin::{Block, Network, Transaction, Txid, Wtxid};
|
use bitcoin::{Block, Network, Transaction, Txid, Wtxid};
|
||||||
|
|
||||||
use super::CompactFiltersError;
|
use super::CompactFiltersError;
|
||||||
@@ -75,7 +75,10 @@ impl Mempool {
|
|||||||
/// Look-up a transaction in the mempool given an [`Inventory`] request
|
/// Look-up a transaction in the mempool given an [`Inventory`] request
|
||||||
pub fn get_tx(&self, inventory: &Inventory) -> Option<Transaction> {
|
pub fn get_tx(&self, inventory: &Inventory) -> Option<Transaction> {
|
||||||
let identifer = match inventory {
|
let identifer = match inventory {
|
||||||
Inventory::Error | Inventory::Block(_) | Inventory::WitnessBlock(_) => return None,
|
Inventory::Error
|
||||||
|
| Inventory::Block(_)
|
||||||
|
| Inventory::WitnessBlock(_)
|
||||||
|
| Inventory::CompactBlock(_) => return None,
|
||||||
Inventory::Transaction(txid) => TxIdentifier::Txid(*txid),
|
Inventory::Transaction(txid) => TxIdentifier::Txid(*txid),
|
||||||
Inventory::WitnessTransaction(txid) => TxIdentifier::Txid(*txid),
|
Inventory::WitnessTransaction(txid) => TxIdentifier::Txid(*txid),
|
||||||
Inventory::WTx(wtxid) => TxIdentifier::Wtxid(*wtxid),
|
Inventory::WTx(wtxid) => TxIdentifier::Wtxid(*wtxid),
|
||||||
@@ -239,7 +242,7 @@ impl Peer {
|
|||||||
/// Send a Bitcoin network message
|
/// Send a Bitcoin network message
|
||||||
fn _send(
|
fn _send(
|
||||||
writer: &mut TcpStream,
|
writer: &mut TcpStream,
|
||||||
magic: u32,
|
magic: Magic,
|
||||||
payload: NetworkMessage,
|
payload: NetworkMessage,
|
||||||
) -> Result<(), CompactFiltersError> {
|
) -> Result<(), CompactFiltersError> {
|
||||||
log::trace!("==> {:?}", payload);
|
log::trace!("==> {:?}", payload);
|
||||||
|
|||||||
@@ -13,7 +13,6 @@ use std::convert::TryInto;
|
|||||||
use std::fmt;
|
use std::fmt;
|
||||||
use std::io::{Read, Write};
|
use std::io::{Read, Write};
|
||||||
use std::marker::PhantomData;
|
use std::marker::PhantomData;
|
||||||
use std::ops::Deref;
|
|
||||||
use std::sync::Arc;
|
use std::sync::Arc;
|
||||||
use std::sync::RwLock;
|
use std::sync::RwLock;
|
||||||
|
|
||||||
@@ -22,28 +21,20 @@ use rand::{thread_rng, Rng};
|
|||||||
|
|
||||||
use rocksdb::{Direction, IteratorMode, ReadOptions, WriteBatch, DB};
|
use rocksdb::{Direction, IteratorMode, ReadOptions, WriteBatch, DB};
|
||||||
|
|
||||||
|
use bitcoin::bip158::BlockFilter;
|
||||||
|
use bitcoin::block::Header;
|
||||||
|
use bitcoin::blockdata::constants::genesis_block;
|
||||||
use bitcoin::consensus::{deserialize, encode::VarInt, serialize, Decodable, Encodable};
|
use bitcoin::consensus::{deserialize, encode::VarInt, serialize, Decodable, Encodable};
|
||||||
use bitcoin::hash_types::{FilterHash, FilterHeader};
|
use bitcoin::hash_types::{FilterHash, FilterHeader};
|
||||||
use bitcoin::hashes::hex::FromHex;
|
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
use bitcoin::util::bip158::BlockFilter;
|
use bitcoin::pow::Work;
|
||||||
use bitcoin::util::uint::Uint256;
|
|
||||||
use bitcoin::Block;
|
use bitcoin::Block;
|
||||||
use bitcoin::BlockHash;
|
use bitcoin::BlockHash;
|
||||||
use bitcoin::BlockHeader;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
use bitcoin::ScriptBuf;
|
||||||
use lazy_static::lazy_static;
|
|
||||||
|
|
||||||
use super::CompactFiltersError;
|
use super::CompactFiltersError;
|
||||||
|
|
||||||
lazy_static! {
|
|
||||||
static ref MAINNET_GENESIS: Block = deserialize(&Vec::<u8>::from_hex("0100000000000000000000000000000000000000000000000000000000000000000000003BA3EDFD7A7B12B27AC72C3E67768F617FC81BC3888A51323A9FB8AA4B1E5E4A29AB5F49FFFF001D1DAC2B7C0101000000010000000000000000000000000000000000000000000000000000000000000000FFFFFFFF4D04FFFF001D0104455468652054696D65732030332F4A616E2F32303039204368616E63656C6C6F72206F6E206272696E6B206F66207365636F6E64206261696C6F757420666F722062616E6B73FFFFFFFF0100F2052A01000000434104678AFDB0FE5548271967F1A67130B7105CD6A828E03909A67962E0EA1F61DEB649F6BC3F4CEF38C4F35504E51EC112DE5C384DF7BA0B8D578A4C702B6BF11D5FAC00000000").unwrap()).unwrap();
|
|
||||||
static ref TESTNET_GENESIS: Block = deserialize(&Vec::<u8>::from_hex("0100000000000000000000000000000000000000000000000000000000000000000000003BA3EDFD7A7B12B27AC72C3E67768F617FC81BC3888A51323A9FB8AA4B1E5E4ADAE5494DFFFF001D1AA4AE180101000000010000000000000000000000000000000000000000000000000000000000000000FFFFFFFF4D04FFFF001D0104455468652054696D65732030332F4A616E2F32303039204368616E63656C6C6F72206F6E206272696E6B206F66207365636F6E64206261696C6F757420666F722062616E6B73FFFFFFFF0100F2052A01000000434104678AFDB0FE5548271967F1A67130B7105CD6A828E03909A67962E0EA1F61DEB649F6BC3F4CEF38C4F35504E51EC112DE5C384DF7BA0B8D578A4C702B6BF11D5FAC00000000").unwrap()).unwrap();
|
|
||||||
static ref REGTEST_GENESIS: Block = deserialize(&Vec::<u8>::from_hex("0100000000000000000000000000000000000000000000000000000000000000000000003BA3EDFD7A7B12B27AC72C3E67768F617FC81BC3888A51323A9FB8AA4B1E5E4ADAE5494DFFFF7F20020000000101000000010000000000000000000000000000000000000000000000000000000000000000FFFFFFFF4D04FFFF001D0104455468652054696D65732030332F4A616E2F32303039204368616E63656C6C6F72206F6E206272696E6B206F66207365636F6E64206261696C6F757420666F722062616E6B73FFFFFFFF0100F2052A01000000434104678AFDB0FE5548271967F1A67130B7105CD6A828E03909A67962E0EA1F61DEB649F6BC3F4CEF38C4F35504E51EC112DE5C384DF7BA0B8D578A4C702B6BF11D5FAC00000000").unwrap()).unwrap();
|
|
||||||
static ref SIGNET_GENESIS: Block = deserialize(&Vec::<u8>::from_hex("0100000000000000000000000000000000000000000000000000000000000000000000003BA3EDFD7A7B12B27AC72C3E67768F617FC81BC3888A51323A9FB8AA4B1E5E4A008F4D5FAE77031E8AD222030101000000010000000000000000000000000000000000000000000000000000000000000000FFFFFFFF4D04FFFF001D0104455468652054696D65732030332F4A616E2F32303039204368616E63656C6C6F72206F6E206272696E6B206F66207365636F6E64206261696C6F757420666F722062616E6B73FFFFFFFF0100F2052A01000000434104678AFDB0FE5548271967F1A67130B7105CD6A828E03909A67962E0EA1F61DEB649F6BC3F4CEF38C4F35504E51EC112DE5C384DF7BA0B8D578A4C702B6BF11D5FAC00000000").unwrap()).unwrap();
|
|
||||||
}
|
|
||||||
|
|
||||||
pub trait StoreType: Default + fmt::Debug {}
|
pub trait StoreType: Default + fmt::Debug {}
|
||||||
|
|
||||||
#[derive(Default, Debug)]
|
#[derive(Default, Debug)]
|
||||||
@@ -79,7 +70,7 @@ impl StoreEntry {
|
|||||||
}
|
}
|
||||||
StoreEntry::Block(Some(height)) => prefix.extend_from_slice(&height.to_be_bytes()),
|
StoreEntry::Block(Some(height)) => prefix.extend_from_slice(&height.to_be_bytes()),
|
||||||
StoreEntry::BlockHeaderIndex(Some(hash)) => {
|
StoreEntry::BlockHeaderIndex(Some(hash)) => {
|
||||||
prefix.extend_from_slice(&hash.into_inner())
|
prefix.extend_from_slice(hash.to_raw_hash().as_ref())
|
||||||
}
|
}
|
||||||
StoreEntry::CFilterTable((filter_type, bundle_index)) => {
|
StoreEntry::CFilterTable((filter_type, bundle_index)) => {
|
||||||
prefix.push(*filter_type);
|
prefix.push(*filter_type);
|
||||||
@@ -113,42 +104,42 @@ where
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl Encodable for BundleStatus {
|
impl Encodable for BundleStatus {
|
||||||
fn consensus_encode<W: Write>(&self, mut e: W) -> Result<usize, std::io::Error> {
|
fn consensus_encode<W: Write + ?Sized>(&self, e: &mut W) -> Result<usize, std::io::Error> {
|
||||||
let mut written = 0;
|
let mut written = 0;
|
||||||
|
|
||||||
match self {
|
match self {
|
||||||
BundleStatus::Init => {
|
BundleStatus::Init => {
|
||||||
written += 0x00u8.consensus_encode(&mut e)?;
|
written += 0x00u8.consensus_encode(e)?;
|
||||||
}
|
}
|
||||||
BundleStatus::CfHeaders { cf_headers } => {
|
BundleStatus::CfHeaders { cf_headers } => {
|
||||||
written += 0x01u8.consensus_encode(&mut e)?;
|
written += 0x01u8.consensus_encode(e)?;
|
||||||
written += VarInt(cf_headers.len() as u64).consensus_encode(&mut e)?;
|
written += VarInt(cf_headers.len() as u64).consensus_encode(e)?;
|
||||||
for header in cf_headers {
|
for header in cf_headers {
|
||||||
written += header.consensus_encode(&mut e)?;
|
written += header.consensus_encode(e)?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
BundleStatus::CFilters { cf_filters } => {
|
BundleStatus::CFilters { cf_filters } => {
|
||||||
written += 0x02u8.consensus_encode(&mut e)?;
|
written += 0x02u8.consensus_encode(e)?;
|
||||||
written += VarInt(cf_filters.len() as u64).consensus_encode(&mut e)?;
|
written += VarInt(cf_filters.len() as u64).consensus_encode(e)?;
|
||||||
for filter in cf_filters {
|
for filter in cf_filters {
|
||||||
written += filter.consensus_encode(&mut e)?;
|
written += filter.consensus_encode(e)?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
BundleStatus::Processed { cf_filters } => {
|
BundleStatus::Processed { cf_filters } => {
|
||||||
written += 0x03u8.consensus_encode(&mut e)?;
|
written += 0x03u8.consensus_encode(e)?;
|
||||||
written += VarInt(cf_filters.len() as u64).consensus_encode(&mut e)?;
|
written += VarInt(cf_filters.len() as u64).consensus_encode(e)?;
|
||||||
for filter in cf_filters {
|
for filter in cf_filters {
|
||||||
written += filter.consensus_encode(&mut e)?;
|
written += filter.consensus_encode(e)?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
BundleStatus::Pruned => {
|
BundleStatus::Pruned => {
|
||||||
written += 0x04u8.consensus_encode(&mut e)?;
|
written += 0x04u8.consensus_encode(e)?;
|
||||||
}
|
}
|
||||||
BundleStatus::Tip { cf_filters } => {
|
BundleStatus::Tip { cf_filters } => {
|
||||||
written += 0x05u8.consensus_encode(&mut e)?;
|
written += 0x05u8.consensus_encode(e)?;
|
||||||
written += VarInt(cf_filters.len() as u64).consensus_encode(&mut e)?;
|
written += VarInt(cf_filters.len() as u64).consensus_encode(e)?;
|
||||||
for filter in cf_filters {
|
for filter in cf_filters {
|
||||||
written += filter.consensus_encode(&mut e)?;
|
written += filter.consensus_encode(e)?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -158,51 +149,53 @@ impl Encodable for BundleStatus {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl Decodable for BundleStatus {
|
impl Decodable for BundleStatus {
|
||||||
fn consensus_decode<D: Read>(mut d: D) -> Result<Self, bitcoin::consensus::encode::Error> {
|
fn consensus_decode<D: Read + ?Sized>(
|
||||||
let byte_type = u8::consensus_decode(&mut d)?;
|
d: &mut D,
|
||||||
|
) -> Result<Self, bitcoin::consensus::encode::Error> {
|
||||||
|
let byte_type = u8::consensus_decode(d)?;
|
||||||
match byte_type {
|
match byte_type {
|
||||||
0x00 => Ok(BundleStatus::Init),
|
0x00 => Ok(BundleStatus::Init),
|
||||||
0x01 => {
|
0x01 => {
|
||||||
let num = VarInt::consensus_decode(&mut d)?;
|
let num = VarInt::consensus_decode(d)?;
|
||||||
let num = num.0 as usize;
|
let num = num.0 as usize;
|
||||||
|
|
||||||
let mut cf_headers = Vec::with_capacity(num);
|
let mut cf_headers = Vec::with_capacity(num);
|
||||||
for _ in 0..num {
|
for _ in 0..num {
|
||||||
cf_headers.push(FilterHeader::consensus_decode(&mut d)?);
|
cf_headers.push(FilterHeader::consensus_decode(d)?);
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(BundleStatus::CfHeaders { cf_headers })
|
Ok(BundleStatus::CfHeaders { cf_headers })
|
||||||
}
|
}
|
||||||
0x02 => {
|
0x02 => {
|
||||||
let num = VarInt::consensus_decode(&mut d)?;
|
let num = VarInt::consensus_decode(d)?;
|
||||||
let num = num.0 as usize;
|
let num = num.0 as usize;
|
||||||
|
|
||||||
let mut cf_filters = Vec::with_capacity(num);
|
let mut cf_filters = Vec::with_capacity(num);
|
||||||
for _ in 0..num {
|
for _ in 0..num {
|
||||||
cf_filters.push(Vec::<u8>::consensus_decode(&mut d)?);
|
cf_filters.push(Vec::<u8>::consensus_decode(d)?);
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(BundleStatus::CFilters { cf_filters })
|
Ok(BundleStatus::CFilters { cf_filters })
|
||||||
}
|
}
|
||||||
0x03 => {
|
0x03 => {
|
||||||
let num = VarInt::consensus_decode(&mut d)?;
|
let num = VarInt::consensus_decode(d)?;
|
||||||
let num = num.0 as usize;
|
let num = num.0 as usize;
|
||||||
|
|
||||||
let mut cf_filters = Vec::with_capacity(num);
|
let mut cf_filters = Vec::with_capacity(num);
|
||||||
for _ in 0..num {
|
for _ in 0..num {
|
||||||
cf_filters.push(Vec::<u8>::consensus_decode(&mut d)?);
|
cf_filters.push(Vec::<u8>::consensus_decode(d)?);
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(BundleStatus::Processed { cf_filters })
|
Ok(BundleStatus::Processed { cf_filters })
|
||||||
}
|
}
|
||||||
0x04 => Ok(BundleStatus::Pruned),
|
0x04 => Ok(BundleStatus::Pruned),
|
||||||
0x05 => {
|
0x05 => {
|
||||||
let num = VarInt::consensus_decode(&mut d)?;
|
let num = VarInt::consensus_decode(d)?;
|
||||||
let num = num.0 as usize;
|
let num = num.0 as usize;
|
||||||
|
|
||||||
let mut cf_filters = Vec::with_capacity(num);
|
let mut cf_filters = Vec::with_capacity(num);
|
||||||
for _ in 0..num {
|
for _ in 0..num {
|
||||||
cf_filters.push(Vec::<u8>::consensus_decode(&mut d)?);
|
cf_filters.push(Vec::<u8>::consensus_decode(d)?);
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(BundleStatus::Tip { cf_filters })
|
Ok(BundleStatus::Tip { cf_filters })
|
||||||
@@ -224,12 +217,7 @@ pub struct ChainStore<T: StoreType> {
|
|||||||
|
|
||||||
impl ChainStore<Full> {
|
impl ChainStore<Full> {
|
||||||
pub fn new(store: DB, network: Network) -> Result<Self, CompactFiltersError> {
|
pub fn new(store: DB, network: Network) -> Result<Self, CompactFiltersError> {
|
||||||
let genesis = match network {
|
let genesis = genesis_block(network);
|
||||||
Network::Bitcoin => MAINNET_GENESIS.deref(),
|
|
||||||
Network::Testnet => TESTNET_GENESIS.deref(),
|
|
||||||
Network::Regtest => REGTEST_GENESIS.deref(),
|
|
||||||
Network::Signet => SIGNET_GENESIS.deref(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let cf_name = "default".to_string();
|
let cf_name = "default".to_string();
|
||||||
let cf_handle = store.cf_handle(&cf_name).unwrap();
|
let cf_handle = store.cf_handle(&cf_name).unwrap();
|
||||||
@@ -241,12 +229,12 @@ impl ChainStore<Full> {
|
|||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
genesis_key,
|
genesis_key,
|
||||||
(genesis.header, genesis.header.work()).serialize(),
|
(genesis.header, genesis.header.work().to_be_bytes()).serialize(),
|
||||||
);
|
);
|
||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
StoreEntry::BlockHeaderIndex(Some(genesis.block_hash())).get_key(),
|
StoreEntry::BlockHeaderIndex(Some(genesis.block_hash())).get_key(),
|
||||||
&0usize.to_be_bytes(),
|
0usize.to_be_bytes(),
|
||||||
);
|
);
|
||||||
store.write(batch)?;
|
store.write(batch)?;
|
||||||
}
|
}
|
||||||
@@ -273,7 +261,7 @@ impl ChainStore<Full> {
|
|||||||
step *= 2;
|
step *= 2;
|
||||||
}
|
}
|
||||||
|
|
||||||
let (header, _): (BlockHeader, Uint256) = SerializeDb::deserialize(
|
let (header, _): (Header, [u8; 32]) = SerializeDb::deserialize(
|
||||||
&store_read
|
&store_read
|
||||||
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(index)).get_key())?
|
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(index)).get_key())?
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
@@ -291,7 +279,11 @@ impl ChainStore<Full> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub fn start_snapshot(&self, from: usize) -> Result<ChainStore<Snapshot>, CompactFiltersError> {
|
pub fn start_snapshot(&self, from: usize) -> Result<ChainStore<Snapshot>, CompactFiltersError> {
|
||||||
let new_cf_name: String = thread_rng().sample_iter(&Alphanumeric).take(16).collect();
|
let new_cf_name: String = thread_rng()
|
||||||
|
.sample_iter(&Alphanumeric)
|
||||||
|
.map(|byte| byte as char)
|
||||||
|
.take(16)
|
||||||
|
.collect();
|
||||||
let new_cf_name = format!("_headers:{}", new_cf_name);
|
let new_cf_name = format!("_headers:{}", new_cf_name);
|
||||||
|
|
||||||
let mut write_store = self.store.write().unwrap();
|
let mut write_store = self.store.write().unwrap();
|
||||||
@@ -301,22 +293,23 @@ impl ChainStore<Full> {
|
|||||||
let cf_handle = write_store.cf_handle(&self.cf_name).unwrap();
|
let cf_handle = write_store.cf_handle(&self.cf_name).unwrap();
|
||||||
let new_cf_handle = write_store.cf_handle(&new_cf_name).unwrap();
|
let new_cf_handle = write_store.cf_handle(&new_cf_name).unwrap();
|
||||||
|
|
||||||
let (header, work): (BlockHeader, Uint256) = SerializeDb::deserialize(
|
let (header, work): (Header, [u8; 32]) = SerializeDb::deserialize(
|
||||||
&write_store
|
&write_store
|
||||||
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
||||||
.ok_or(CompactFiltersError::DataCorruption)?,
|
.ok_or(CompactFiltersError::DataCorruption)?,
|
||||||
)?;
|
)?;
|
||||||
|
let work = Work::from_be_bytes(work);
|
||||||
|
|
||||||
let mut batch = WriteBatch::default();
|
let mut batch = WriteBatch::default();
|
||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
new_cf_handle,
|
new_cf_handle,
|
||||||
StoreEntry::BlockHeaderIndex(Some(header.block_hash())).get_key(),
|
StoreEntry::BlockHeaderIndex(Some(header.block_hash())).get_key(),
|
||||||
&from.to_be_bytes(),
|
from.to_be_bytes(),
|
||||||
);
|
);
|
||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
new_cf_handle,
|
new_cf_handle,
|
||||||
StoreEntry::BlockHeader(Some(from)).get_key(),
|
StoreEntry::BlockHeader(Some(from)).get_key(),
|
||||||
(header, work).serialize(),
|
(header, work.to_be_bytes()).serialize(),
|
||||||
);
|
);
|
||||||
write_store.write(batch)?;
|
write_store.write(batch)?;
|
||||||
|
|
||||||
@@ -390,7 +383,7 @@ impl ChainStore<Full> {
|
|||||||
opts,
|
opts,
|
||||||
IteratorMode::From(&from_key, Direction::Forward),
|
IteratorMode::From(&from_key, Direction::Forward),
|
||||||
) {
|
) {
|
||||||
let (header, _): (BlockHeader, Uint256) = SerializeDb::deserialize(&v)?;
|
let (header, _): (Header, [u8; 32]) = SerializeDb::deserialize(&v)?;
|
||||||
|
|
||||||
batch.delete_cf(
|
batch.delete_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
@@ -442,7 +435,7 @@ impl ChainStore<Full> {
|
|||||||
let key = StoreEntry::BlockHeader(Some(height)).get_key();
|
let key = StoreEntry::BlockHeader(Some(height)).get_key();
|
||||||
let data = read_store.get_pinned_cf(cf_handle, key)?;
|
let data = read_store.get_pinned_cf(cf_handle, key)?;
|
||||||
data.map(|data| {
|
data.map(|data| {
|
||||||
let (header, _): (BlockHeader, Uint256) =
|
let (header, _): (Header, [u8; 32]) =
|
||||||
deserialize(&data).map_err(|_| CompactFiltersError::DataCorruption)?;
|
deserialize(&data).map_err(|_| CompactFiltersError::DataCorruption)?;
|
||||||
Ok::<_, CompactFiltersError>(header.block_hash())
|
Ok::<_, CompactFiltersError>(header.block_hash())
|
||||||
})
|
})
|
||||||
@@ -505,7 +498,7 @@ impl ChainStore<Full> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<T: StoreType> ChainStore<T> {
|
impl<T: StoreType> ChainStore<T> {
|
||||||
pub fn work(&self) -> Result<Uint256, CompactFiltersError> {
|
pub fn work(&self) -> Result<Work, CompactFiltersError> {
|
||||||
let read_store = self.store.read().unwrap();
|
let read_store = self.store.read().unwrap();
|
||||||
let cf_handle = read_store.cf_handle(&self.cf_name).unwrap();
|
let cf_handle = read_store.cf_handle(&self.cf_name).unwrap();
|
||||||
|
|
||||||
@@ -515,12 +508,13 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
Ok(iterator
|
Ok(iterator
|
||||||
.last()
|
.last()
|
||||||
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
||||||
let (_, work): (BlockHeader, Uint256) = SerializeDb::deserialize(&v)?;
|
let (_, work): (Header, [u8; 32]) = SerializeDb::deserialize(&v)?;
|
||||||
|
let work = Work::from_be_bytes(work);
|
||||||
|
|
||||||
Ok(work)
|
Ok(work)
|
||||||
})
|
})
|
||||||
.transpose()?
|
.transpose()?
|
||||||
.unwrap_or_default())
|
.unwrap_or_else(|| Work::from_be_bytes([0; 32])))
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn get_height(&self) -> Result<usize, CompactFiltersError> {
|
pub fn get_height(&self) -> Result<usize, CompactFiltersError> {
|
||||||
@@ -555,7 +549,7 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
iterator
|
iterator
|
||||||
.last()
|
.last()
|
||||||
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
||||||
let (header, _): (BlockHeader, Uint256) = SerializeDb::deserialize(&v)?;
|
let (header, _): (Header, [u8; 32]) = SerializeDb::deserialize(&v)?;
|
||||||
|
|
||||||
Ok(header.block_hash())
|
Ok(header.block_hash())
|
||||||
})
|
})
|
||||||
@@ -565,7 +559,7 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
pub fn apply(
|
pub fn apply(
|
||||||
&mut self,
|
&mut self,
|
||||||
from: usize,
|
from: usize,
|
||||||
headers: Vec<BlockHeader>,
|
headers: Vec<Header>,
|
||||||
) -> Result<BlockHash, CompactFiltersError> {
|
) -> Result<BlockHash, CompactFiltersError> {
|
||||||
let mut batch = WriteBatch::default();
|
let mut batch = WriteBatch::default();
|
||||||
|
|
||||||
@@ -575,7 +569,8 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
let (mut last_hash, mut accumulated_work) = read_store
|
let (mut last_hash, mut accumulated_work) = read_store
|
||||||
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
||||||
.map(|result| {
|
.map(|result| {
|
||||||
let (header, work): (BlockHeader, Uint256) = SerializeDb::deserialize(&result)?;
|
let (header, work): (Header, [u8; 32]) = SerializeDb::deserialize(&result)?;
|
||||||
|
let work = Work::from_be_bytes(work);
|
||||||
Ok::<_, CompactFiltersError>((header.block_hash(), work))
|
Ok::<_, CompactFiltersError>((header.block_hash(), work))
|
||||||
})
|
})
|
||||||
.transpose()?
|
.transpose()?
|
||||||
@@ -593,12 +588,12 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
StoreEntry::BlockHeaderIndex(Some(header.block_hash())).get_key(),
|
StoreEntry::BlockHeaderIndex(Some(header.block_hash())).get_key(),
|
||||||
&(height).to_be_bytes(),
|
(height).to_be_bytes(),
|
||||||
);
|
);
|
||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
StoreEntry::BlockHeader(Some(height)).get_key(),
|
StoreEntry::BlockHeader(Some(height)).get_key(),
|
||||||
(header, accumulated_work).serialize(),
|
(header, accumulated_work.to_be_bytes()).serialize(),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -647,15 +642,10 @@ impl CfStore {
|
|||||||
filter_type,
|
filter_type,
|
||||||
};
|
};
|
||||||
|
|
||||||
let genesis = match headers_store.network {
|
let genesis = genesis_block(headers_store.network);
|
||||||
Network::Bitcoin => MAINNET_GENESIS.deref(),
|
|
||||||
Network::Testnet => TESTNET_GENESIS.deref(),
|
|
||||||
Network::Regtest => REGTEST_GENESIS.deref(),
|
|
||||||
Network::Signet => SIGNET_GENESIS.deref(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let filter = BlockFilter::new_script_filter(genesis, |utxo| {
|
let filter = BlockFilter::new_script_filter(&genesis, |utxo| {
|
||||||
Err(bitcoin::util::bip158::Error::UtxoMissing(*utxo))
|
Err::<ScriptBuf, _>(bitcoin::bip158::Error::UtxoMissing(*utxo))
|
||||||
})?;
|
})?;
|
||||||
let first_key = StoreEntry::CFilterTable((filter_type, Some(0))).get_key();
|
let first_key = StoreEntry::CFilterTable((filter_type, Some(0))).get_key();
|
||||||
|
|
||||||
@@ -667,7 +657,7 @@ impl CfStore {
|
|||||||
&first_key,
|
&first_key,
|
||||||
(
|
(
|
||||||
BundleStatus::Init,
|
BundleStatus::Init,
|
||||||
filter.filter_header(&FilterHeader::from_hash(Default::default())),
|
filter.filter_header(&FilterHeader::from_raw_hash(Hash::all_zeros())),
|
||||||
)
|
)
|
||||||
.serialize(),
|
.serialize(),
|
||||||
)?;
|
)?;
|
||||||
|
|||||||
@@ -13,10 +13,11 @@ use std::collections::{BTreeMap, HashMap, VecDeque};
|
|||||||
use std::sync::{Arc, Mutex};
|
use std::sync::{Arc, Mutex};
|
||||||
use std::time::Duration;
|
use std::time::Duration;
|
||||||
|
|
||||||
|
use bitcoin::bip158::BlockFilter;
|
||||||
use bitcoin::hash_types::{BlockHash, FilterHeader};
|
use bitcoin::hash_types::{BlockHash, FilterHeader};
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
use bitcoin::network::message::NetworkMessage;
|
use bitcoin::network::message::NetworkMessage;
|
||||||
use bitcoin::network::message_blockdata::GetHeadersMessage;
|
use bitcoin::network::message_blockdata::GetHeadersMessage;
|
||||||
use bitcoin::util::bip158::BlockFilter;
|
|
||||||
|
|
||||||
use super::peer::*;
|
use super::peer::*;
|
||||||
use super::store::*;
|
use super::store::*;
|
||||||
@@ -135,7 +136,7 @@ impl CfSync {
|
|||||||
|
|
||||||
let resp = peer.get_cf_headers(0x00, start_height as u32, stop_hash)?;
|
let resp = peer.get_cf_headers(0x00, start_height as u32, stop_hash)?;
|
||||||
|
|
||||||
assert!(resp.previous_filter_header == checkpoint);
|
assert_eq!(resp.previous_filter_header, checkpoint);
|
||||||
status =
|
status =
|
||||||
self.cf_store
|
self.cf_store
|
||||||
.advance_to_cf_headers(index, checkpoint, resp.filter_hashes)?;
|
.advance_to_cf_headers(index, checkpoint, resp.filter_hashes)?;
|
||||||
@@ -254,7 +255,7 @@ where
|
|||||||
|
|
||||||
peer.send(NetworkMessage::GetHeaders(GetHeadersMessage::new(
|
peer.send(NetworkMessage::GetHeaders(GetHeadersMessage::new(
|
||||||
locators_vec,
|
locators_vec,
|
||||||
Default::default(),
|
Hash::all_zeros(),
|
||||||
)))?;
|
)))?;
|
||||||
let (mut snapshot, mut last_hash) = if let NetworkMessage::Headers(headers) = peer
|
let (mut snapshot, mut last_hash) = if let NetworkMessage::Headers(headers) = peer
|
||||||
.recv("headers", Some(Duration::from_secs(TIMEOUT_SECS)))?
|
.recv("headers", Some(Duration::from_secs(TIMEOUT_SECS)))?
|
||||||
@@ -276,7 +277,7 @@ where
|
|||||||
while sync_height < peer.get_version().start_height as usize {
|
while sync_height < peer.get_version().start_height as usize {
|
||||||
peer.send(NetworkMessage::GetHeaders(GetHeadersMessage::new(
|
peer.send(NetworkMessage::GetHeaders(GetHeadersMessage::new(
|
||||||
vec![last_hash],
|
vec![last_hash],
|
||||||
Default::default(),
|
Hash::all_zeros(),
|
||||||
)))?;
|
)))?;
|
||||||
if let NetworkMessage::Headers(headers) = peer
|
if let NetworkMessage::Headers(headers) = peer
|
||||||
.recv("headers", Some(Duration::from_secs(TIMEOUT_SECS)))?
|
.recv("headers", Some(Duration::from_secs(TIMEOUT_SECS)))?
|
||||||
|
|||||||
@@ -25,6 +25,7 @@
|
|||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use std::collections::{HashMap, HashSet};
|
use std::collections::{HashMap, HashSet};
|
||||||
|
use std::ops::{Deref, DerefMut};
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
use log::{debug, error, info, trace};
|
use log::{debug, error, info, trace};
|
||||||
@@ -79,6 +80,14 @@ impl Blockchain for ElectrumBlockchain {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Deref for ElectrumBlockchain {
|
||||||
|
type Target = Client;
|
||||||
|
|
||||||
|
fn deref(&self) -> &Self::Target {
|
||||||
|
&self.client
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl StatelessBlockchain for ElectrumBlockchain {}
|
impl StatelessBlockchain for ElectrumBlockchain {}
|
||||||
|
|
||||||
impl GetHeight for ElectrumBlockchain {
|
impl GetHeight for ElectrumBlockchain {
|
||||||
@@ -108,9 +117,11 @@ impl GetBlockHash for ElectrumBlockchain {
|
|||||||
impl WalletSync for ElectrumBlockchain {
|
impl WalletSync for ElectrumBlockchain {
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
_progress_update: Box<dyn Progress>,
|
_progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
|
let mut database = database.borrow_mut();
|
||||||
|
let database = database.deref_mut();
|
||||||
let mut request = script_sync::start(database, self.stop_gap)?;
|
let mut request = script_sync::start(database, self.stop_gap)?;
|
||||||
let mut block_times = HashMap::<u32, u32>::new();
|
let mut block_times = HashMap::<u32, u32>::new();
|
||||||
let mut txid_to_height = HashMap::<Txid, u32>::new();
|
let mut txid_to_height = HashMap::<Txid, u32>::new();
|
||||||
@@ -272,9 +283,11 @@ impl<'a, 'b, D: Database> TxCache<'a, 'b, D> {
|
|||||||
.client
|
.client
|
||||||
.batch_transaction_get(need_fetch.clone())
|
.batch_transaction_get(need_fetch.clone())
|
||||||
.map_err(Error::Electrum)?;
|
.map_err(Error::Electrum)?;
|
||||||
for (tx, _txid) in txs.into_iter().zip(need_fetch) {
|
let mut txs: HashMap<_, _> = txs.into_iter().map(|tx| (tx.txid(), tx)).collect();
|
||||||
debug_assert_eq!(*_txid, tx.txid());
|
for txid in need_fetch {
|
||||||
self.cache.insert(tx.txid(), tx);
|
if let Some(tx) = txs.remove(txid) {
|
||||||
|
self.cache.insert(*txid, tx);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -287,7 +300,7 @@ impl<'a, 'b, D: Database> TxCache<'a, 'b, D> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Configuration for an [`ElectrumBlockchain`]
|
/// Configuration for an [`ElectrumBlockchain`]
|
||||||
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq)]
|
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq, Eq)]
|
||||||
pub struct ElectrumBlockchainConfig {
|
pub struct ElectrumBlockchainConfig {
|
||||||
/// URL of the Electrum server (such as ElectrumX, Esplora, BWT) may start with `ssl://` or `tcp://` and include a port
|
/// URL of the Electrum server (such as ElectrumX, Esplora, BWT) may start with `ssl://` or `tcp://` and include a port
|
||||||
///
|
///
|
||||||
@@ -301,6 +314,8 @@ pub struct ElectrumBlockchainConfig {
|
|||||||
pub timeout: Option<u8>,
|
pub timeout: Option<u8>,
|
||||||
/// Stop searching addresses for transactions after finding an unused gap of this length
|
/// Stop searching addresses for transactions after finding an unused gap of this length
|
||||||
pub stop_gap: usize,
|
pub stop_gap: usize,
|
||||||
|
/// Validate the domain when using SSL
|
||||||
|
pub validate_domain: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ConfigurableBlockchain for ElectrumBlockchain {
|
impl ConfigurableBlockchain for ElectrumBlockchain {
|
||||||
@@ -310,8 +325,9 @@ impl ConfigurableBlockchain for ElectrumBlockchain {
|
|||||||
let socks5 = config.socks5.as_ref().map(Socks5Config::new);
|
let socks5 = config.socks5.as_ref().map(Socks5Config::new);
|
||||||
let electrum_config = ConfigBuilder::new()
|
let electrum_config = ConfigBuilder::new()
|
||||||
.retry(config.retry)
|
.retry(config.retry)
|
||||||
.timeout(config.timeout)?
|
.timeout(config.timeout)
|
||||||
.socks5(socks5)?
|
.socks5(socks5)
|
||||||
|
.validate_domain(config.validate_domain)
|
||||||
.build();
|
.build();
|
||||||
|
|
||||||
Ok(ElectrumBlockchain {
|
Ok(ElectrumBlockchain {
|
||||||
@@ -406,6 +422,7 @@ mod test {
|
|||||||
retry: 0,
|
retry: 0,
|
||||||
timeout: None,
|
timeout: None,
|
||||||
stop_gap: stop_gap,
|
stop_gap: stop_gap,
|
||||||
|
validate_domain: true,
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,117 +0,0 @@
|
|||||||
//! structs from the esplora API
|
|
||||||
//!
|
|
||||||
//! see: <https://github.com/Blockstream/esplora/blob/master/API.md>
|
|
||||||
use crate::BlockTime;
|
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxIn, TxOut, Txid, Witness};
|
|
||||||
|
|
||||||
#[derive(serde::Deserialize, Clone, Debug)]
|
|
||||||
pub struct PrevOut {
|
|
||||||
pub value: u64,
|
|
||||||
pub scriptpubkey: Script,
|
|
||||||
}
|
|
||||||
|
|
||||||
#[derive(serde::Deserialize, Clone, Debug)]
|
|
||||||
pub struct Vin {
|
|
||||||
pub txid: Txid,
|
|
||||||
pub vout: u32,
|
|
||||||
// None if coinbase
|
|
||||||
pub prevout: Option<PrevOut>,
|
|
||||||
pub scriptsig: Script,
|
|
||||||
#[serde(deserialize_with = "deserialize_witness", default)]
|
|
||||||
pub witness: Vec<Vec<u8>>,
|
|
||||||
pub sequence: u32,
|
|
||||||
pub is_coinbase: bool,
|
|
||||||
}
|
|
||||||
|
|
||||||
#[derive(serde::Deserialize, Clone, Debug)]
|
|
||||||
pub struct Vout {
|
|
||||||
pub value: u64,
|
|
||||||
pub scriptpubkey: Script,
|
|
||||||
}
|
|
||||||
|
|
||||||
#[derive(serde::Deserialize, Clone, Debug)]
|
|
||||||
pub struct TxStatus {
|
|
||||||
pub confirmed: bool,
|
|
||||||
pub block_height: Option<u32>,
|
|
||||||
pub block_time: Option<u64>,
|
|
||||||
}
|
|
||||||
|
|
||||||
#[derive(serde::Deserialize, Clone, Debug)]
|
|
||||||
pub struct Tx {
|
|
||||||
pub txid: Txid,
|
|
||||||
pub version: i32,
|
|
||||||
pub locktime: u32,
|
|
||||||
pub vin: Vec<Vin>,
|
|
||||||
pub vout: Vec<Vout>,
|
|
||||||
pub status: TxStatus,
|
|
||||||
pub fee: u64,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl Tx {
|
|
||||||
pub fn to_tx(&self) -> Transaction {
|
|
||||||
Transaction {
|
|
||||||
version: self.version,
|
|
||||||
lock_time: self.locktime,
|
|
||||||
input: self
|
|
||||||
.vin
|
|
||||||
.iter()
|
|
||||||
.cloned()
|
|
||||||
.map(|vin| TxIn {
|
|
||||||
previous_output: OutPoint {
|
|
||||||
txid: vin.txid,
|
|
||||||
vout: vin.vout,
|
|
||||||
},
|
|
||||||
script_sig: vin.scriptsig,
|
|
||||||
sequence: vin.sequence,
|
|
||||||
witness: Witness::from_vec(vin.witness),
|
|
||||||
})
|
|
||||||
.collect(),
|
|
||||||
output: self
|
|
||||||
.vout
|
|
||||||
.iter()
|
|
||||||
.cloned()
|
|
||||||
.map(|vout| TxOut {
|
|
||||||
value: vout.value,
|
|
||||||
script_pubkey: vout.scriptpubkey,
|
|
||||||
})
|
|
||||||
.collect(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
pub fn confirmation_time(&self) -> Option<BlockTime> {
|
|
||||||
match self.status {
|
|
||||||
TxStatus {
|
|
||||||
confirmed: true,
|
|
||||||
block_height: Some(height),
|
|
||||||
block_time: Some(timestamp),
|
|
||||||
} => Some(BlockTime { timestamp, height }),
|
|
||||||
_ => None,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
pub fn previous_outputs(&self) -> Vec<Option<TxOut>> {
|
|
||||||
self.vin
|
|
||||||
.iter()
|
|
||||||
.cloned()
|
|
||||||
.map(|vin| {
|
|
||||||
vin.prevout.map(|po| TxOut {
|
|
||||||
script_pubkey: po.scriptpubkey,
|
|
||||||
value: po.value,
|
|
||||||
})
|
|
||||||
})
|
|
||||||
.collect()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn deserialize_witness<'de, D>(d: D) -> Result<Vec<Vec<u8>>, D::Error>
|
|
||||||
where
|
|
||||||
D: serde::de::Deserializer<'de>,
|
|
||||||
{
|
|
||||||
use crate::serde::Deserialize;
|
|
||||||
use bitcoin::hashes::hex::FromHex;
|
|
||||||
let list = Vec::<String>::deserialize(d)?;
|
|
||||||
list.into_iter()
|
|
||||||
.map(|hex_str| Vec::<u8>::from_hex(&hex_str))
|
|
||||||
.collect::<Result<Vec<Vec<u8>>, _>>()
|
|
||||||
.map_err(serde::de::Error::custom)
|
|
||||||
}
|
|
||||||
@@ -12,49 +12,38 @@
|
|||||||
//! Esplora by way of `reqwest` HTTP client.
|
//! Esplora by way of `reqwest` HTTP client.
|
||||||
|
|
||||||
use std::collections::{HashMap, HashSet};
|
use std::collections::{HashMap, HashSet};
|
||||||
|
use std::ops::{Deref, DerefMut};
|
||||||
|
|
||||||
use bitcoin::consensus::{deserialize, serialize};
|
use bitcoin::{Transaction, Txid};
|
||||||
use bitcoin::hashes::hex::{FromHex, ToHex};
|
|
||||||
use bitcoin::hashes::{sha256, Hash};
|
|
||||||
use bitcoin::{BlockHeader, Script, Transaction, Txid};
|
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
use log::{debug, error, info, trace};
|
use log::{debug, error, info, trace};
|
||||||
|
|
||||||
use ::reqwest::{Client, StatusCode};
|
use esplora_client::{convert_fee_rate, AsyncClient, Builder, Tx};
|
||||||
use futures::stream::{FuturesOrdered, TryStreamExt};
|
use futures::stream::{FuturesOrdered, TryStreamExt};
|
||||||
|
|
||||||
use super::api::Tx;
|
|
||||||
use crate::blockchain::esplora::EsploraError;
|
|
||||||
use crate::blockchain::*;
|
use crate::blockchain::*;
|
||||||
use crate::database::BatchDatabase;
|
use crate::database::BatchDatabase;
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
use crate::FeeRate;
|
use crate::FeeRate;
|
||||||
|
|
||||||
#[derive(Debug)]
|
|
||||||
struct UrlClient {
|
|
||||||
url: String,
|
|
||||||
// We use the async client instead of the blocking one because it automatically uses `fetch`
|
|
||||||
// when the target platform is wasm32.
|
|
||||||
client: Client,
|
|
||||||
concurrency: u8,
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Structure that implements the logic to sync with Esplora
|
/// Structure that implements the logic to sync with Esplora
|
||||||
///
|
///
|
||||||
/// ## Example
|
/// ## Example
|
||||||
/// See the [`blockchain::esplora`](crate::blockchain::esplora) module for a usage example.
|
/// See the [`blockchain::esplora`](crate::blockchain::esplora) module for a usage example.
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
pub struct EsploraBlockchain {
|
pub struct EsploraBlockchain {
|
||||||
url_client: UrlClient,
|
url_client: AsyncClient,
|
||||||
stop_gap: usize,
|
stop_gap: usize,
|
||||||
|
concurrency: u8,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::convert::From<UrlClient> for EsploraBlockchain {
|
impl std::convert::From<AsyncClient> for EsploraBlockchain {
|
||||||
fn from(url_client: UrlClient) -> Self {
|
fn from(url_client: AsyncClient) -> Self {
|
||||||
EsploraBlockchain {
|
EsploraBlockchain {
|
||||||
url_client,
|
url_client,
|
||||||
stop_gap: 20,
|
stop_gap: 20,
|
||||||
|
concurrency: super::DEFAULT_CONCURRENT_REQUESTS,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -62,19 +51,25 @@ impl std::convert::From<UrlClient> for EsploraBlockchain {
|
|||||||
impl EsploraBlockchain {
|
impl EsploraBlockchain {
|
||||||
/// Create a new instance of the client from a base URL and `stop_gap`.
|
/// Create a new instance of the client from a base URL and `stop_gap`.
|
||||||
pub fn new(base_url: &str, stop_gap: usize) -> Self {
|
pub fn new(base_url: &str, stop_gap: usize) -> Self {
|
||||||
|
let url_client = Builder::new(base_url)
|
||||||
|
.build_async()
|
||||||
|
.expect("Should never fail with no proxy and timeout");
|
||||||
|
|
||||||
|
Self::from_client(url_client, stop_gap)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Build a new instance given a client
|
||||||
|
pub fn from_client(url_client: AsyncClient, stop_gap: usize) -> Self {
|
||||||
EsploraBlockchain {
|
EsploraBlockchain {
|
||||||
url_client: UrlClient {
|
url_client,
|
||||||
url: base_url.to_string(),
|
|
||||||
client: Client::new(),
|
|
||||||
concurrency: super::DEFAULT_CONCURRENT_REQUESTS,
|
|
||||||
},
|
|
||||||
stop_gap,
|
stop_gap,
|
||||||
|
concurrency: super::DEFAULT_CONCURRENT_REQUESTS,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Set the concurrency to use when doing batch queries against the Esplora instance.
|
/// Set the concurrency to use when doing batch queries against the Esplora instance.
|
||||||
pub fn with_concurrency(mut self, concurrency: u8) -> Self {
|
pub fn with_concurrency(mut self, concurrency: u8) -> Self {
|
||||||
self.url_client.concurrency = concurrency;
|
self.concurrency = concurrency;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -92,12 +87,22 @@ impl Blockchain for EsploraBlockchain {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn broadcast(&self, tx: &Transaction) -> Result<(), Error> {
|
fn broadcast(&self, tx: &Transaction) -> Result<(), Error> {
|
||||||
Ok(await_or_block!(self.url_client._broadcast(tx))?)
|
Ok(await_or_block!(self.url_client.broadcast(tx))?)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn estimate_fee(&self, target: usize) -> Result<FeeRate, Error> {
|
fn estimate_fee(&self, target: usize) -> Result<FeeRate, Error> {
|
||||||
let estimates = await_or_block!(self.url_client._get_fee_estimates())?;
|
let estimates = await_or_block!(self.url_client.get_fee_estimates())?;
|
||||||
super::into_fee_rate(target, estimates)
|
Ok(FeeRate::from_sat_per_vb(convert_fee_rate(
|
||||||
|
target, estimates,
|
||||||
|
)?))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Deref for EsploraBlockchain {
|
||||||
|
type Target = AsyncClient;
|
||||||
|
|
||||||
|
fn deref(&self) -> &Self::Target {
|
||||||
|
&self.url_client
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -106,22 +111,23 @@ impl StatelessBlockchain for EsploraBlockchain {}
|
|||||||
#[maybe_async]
|
#[maybe_async]
|
||||||
impl GetHeight for EsploraBlockchain {
|
impl GetHeight for EsploraBlockchain {
|
||||||
fn get_height(&self) -> Result<u32, Error> {
|
fn get_height(&self) -> Result<u32, Error> {
|
||||||
Ok(await_or_block!(self.url_client._get_height())?)
|
Ok(await_or_block!(self.url_client.get_height())?)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[maybe_async]
|
#[maybe_async]
|
||||||
impl GetTx for EsploraBlockchain {
|
impl GetTx for EsploraBlockchain {
|
||||||
fn get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
fn get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||||
Ok(await_or_block!(self.url_client._get_tx(txid))?)
|
Ok(await_or_block!(self.url_client.get_tx(txid))?)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[maybe_async]
|
#[maybe_async]
|
||||||
impl GetBlockHash for EsploraBlockchain {
|
impl GetBlockHash for EsploraBlockchain {
|
||||||
fn get_block_hash(&self, height: u64) -> Result<BlockHash, Error> {
|
fn get_block_hash(&self, height: u64) -> Result<BlockHash, Error> {
|
||||||
let block_header = await_or_block!(self.url_client._get_header(height as u32))?;
|
Ok(await_or_block!(self
|
||||||
Ok(block_header.block_hash())
|
.url_client
|
||||||
|
.get_block_hash(height as u32))?)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -129,10 +135,12 @@ impl GetBlockHash for EsploraBlockchain {
|
|||||||
impl WalletSync for EsploraBlockchain {
|
impl WalletSync for EsploraBlockchain {
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
_progress_update: Box<dyn Progress>,
|
_progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
use crate::blockchain::script_sync::Request;
|
use crate::blockchain::script_sync::Request;
|
||||||
|
let mut database = database.borrow_mut();
|
||||||
|
let database = database.deref_mut();
|
||||||
let mut request = script_sync::start(database, self.stop_gap)?;
|
let mut request = script_sync::start(database, self.stop_gap)?;
|
||||||
let mut tx_index: HashMap<Txid, Tx> = HashMap::new();
|
let mut tx_index: HashMap<Txid, Tx> = HashMap::new();
|
||||||
|
|
||||||
@@ -141,10 +149,10 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
Request::Script(script_req) => {
|
Request::Script(script_req) => {
|
||||||
let futures: FuturesOrdered<_> = script_req
|
let futures: FuturesOrdered<_> = script_req
|
||||||
.request()
|
.request()
|
||||||
.take(self.url_client.concurrency as usize)
|
.take(self.concurrency as usize)
|
||||||
.map(|script| async move {
|
.map(|script| async move {
|
||||||
let mut related_txs: Vec<Tx> =
|
let mut related_txs: Vec<Tx> =
|
||||||
self.url_client._scripthash_txs(script, None).await?;
|
self.url_client.scripthash_txs(script, None).await?;
|
||||||
|
|
||||||
let n_confirmed =
|
let n_confirmed =
|
||||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
||||||
@@ -154,7 +162,7 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
loop {
|
loop {
|
||||||
let new_related_txs: Vec<Tx> = self
|
let new_related_txs: Vec<Tx> = self
|
||||||
.url_client
|
.url_client
|
||||||
._scripthash_txs(
|
.scripthash_txs(
|
||||||
script,
|
script,
|
||||||
Some(related_txs.last().unwrap().txid),
|
Some(related_txs.last().unwrap().txid),
|
||||||
)
|
)
|
||||||
@@ -194,6 +202,7 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
.get(txid)
|
.get(txid)
|
||||||
.expect("must be in index")
|
.expect("must be in index")
|
||||||
.confirmation_time()
|
.confirmation_time()
|
||||||
|
.map(Into::into)
|
||||||
})
|
})
|
||||||
.collect();
|
.collect();
|
||||||
conftime_req.satisfy(conftimes)?
|
conftime_req.satisfy(conftimes)?
|
||||||
@@ -217,132 +226,26 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl UrlClient {
|
|
||||||
async fn _get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.client
|
|
||||||
.get(&format!("{}/tx/{}/raw", self.url, txid))
|
|
||||||
.send()
|
|
||||||
.await?;
|
|
||||||
|
|
||||||
if let StatusCode::NOT_FOUND = resp.status() {
|
|
||||||
return Ok(None);
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(Some(deserialize(&resp.error_for_status()?.bytes().await?)?))
|
|
||||||
}
|
|
||||||
|
|
||||||
async fn _get_tx_no_opt(&self, txid: &Txid) -> Result<Transaction, EsploraError> {
|
|
||||||
match self._get_tx(txid).await {
|
|
||||||
Ok(Some(tx)) => Ok(tx),
|
|
||||||
Ok(None) => Err(EsploraError::TransactionNotFound(*txid)),
|
|
||||||
Err(e) => Err(e),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
async fn _get_header(&self, block_height: u32) -> Result<BlockHeader, EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.client
|
|
||||||
.get(&format!("{}/block-height/{}", self.url, block_height))
|
|
||||||
.send()
|
|
||||||
.await?;
|
|
||||||
|
|
||||||
if let StatusCode::NOT_FOUND = resp.status() {
|
|
||||||
return Err(EsploraError::HeaderHeightNotFound(block_height));
|
|
||||||
}
|
|
||||||
let bytes = resp.bytes().await?;
|
|
||||||
let hash = std::str::from_utf8(&bytes)
|
|
||||||
.map_err(|_| EsploraError::HeaderHeightNotFound(block_height))?;
|
|
||||||
|
|
||||||
let resp = self
|
|
||||||
.client
|
|
||||||
.get(&format!("{}/block/{}/header", self.url, hash))
|
|
||||||
.send()
|
|
||||||
.await?;
|
|
||||||
|
|
||||||
let header = deserialize(&Vec::from_hex(&resp.text().await?)?)?;
|
|
||||||
|
|
||||||
Ok(header)
|
|
||||||
}
|
|
||||||
|
|
||||||
async fn _broadcast(&self, transaction: &Transaction) -> Result<(), EsploraError> {
|
|
||||||
self.client
|
|
||||||
.post(&format!("{}/tx", self.url))
|
|
||||||
.body(serialize(transaction).to_hex())
|
|
||||||
.send()
|
|
||||||
.await?
|
|
||||||
.error_for_status()?;
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
|
|
||||||
async fn _get_height(&self) -> Result<u32, EsploraError> {
|
|
||||||
let req = self
|
|
||||||
.client
|
|
||||||
.get(&format!("{}/blocks/tip/height", self.url))
|
|
||||||
.send()
|
|
||||||
.await?;
|
|
||||||
|
|
||||||
Ok(req.error_for_status()?.text().await?.parse()?)
|
|
||||||
}
|
|
||||||
|
|
||||||
async fn _scripthash_txs(
|
|
||||||
&self,
|
|
||||||
script: &Script,
|
|
||||||
last_seen: Option<Txid>,
|
|
||||||
) -> Result<Vec<Tx>, EsploraError> {
|
|
||||||
let script_hash = sha256::Hash::hash(script.as_bytes()).into_inner().to_hex();
|
|
||||||
let url = match last_seen {
|
|
||||||
Some(last_seen) => format!(
|
|
||||||
"{}/scripthash/{}/txs/chain/{}",
|
|
||||||
self.url, script_hash, last_seen
|
|
||||||
),
|
|
||||||
None => format!("{}/scripthash/{}/txs", self.url, script_hash),
|
|
||||||
};
|
|
||||||
Ok(self
|
|
||||||
.client
|
|
||||||
.get(url)
|
|
||||||
.send()
|
|
||||||
.await?
|
|
||||||
.error_for_status()?
|
|
||||||
.json::<Vec<Tx>>()
|
|
||||||
.await?)
|
|
||||||
}
|
|
||||||
|
|
||||||
async fn _get_fee_estimates(&self) -> Result<HashMap<String, f64>, EsploraError> {
|
|
||||||
Ok(self
|
|
||||||
.client
|
|
||||||
.get(&format!("{}/fee-estimates", self.url,))
|
|
||||||
.send()
|
|
||||||
.await?
|
|
||||||
.error_for_status()?
|
|
||||||
.json::<HashMap<String, f64>>()
|
|
||||||
.await?)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ConfigurableBlockchain for EsploraBlockchain {
|
impl ConfigurableBlockchain for EsploraBlockchain {
|
||||||
type Config = super::EsploraBlockchainConfig;
|
type Config = super::EsploraBlockchainConfig;
|
||||||
|
|
||||||
fn from_config(config: &Self::Config) -> Result<Self, Error> {
|
fn from_config(config: &Self::Config) -> Result<Self, Error> {
|
||||||
let map_e = |e: reqwest::Error| Error::Esplora(Box::new(e.into()));
|
let mut builder = Builder::new(config.base_url.as_str());
|
||||||
|
|
||||||
let mut blockchain = EsploraBlockchain::new(config.base_url.as_str(), config.stop_gap);
|
|
||||||
if let Some(concurrency) = config.concurrency {
|
|
||||||
blockchain.url_client.concurrency = concurrency;
|
|
||||||
}
|
|
||||||
let mut builder = Client::builder();
|
|
||||||
#[cfg(not(target_arch = "wasm32"))]
|
|
||||||
if let Some(proxy) = &config.proxy {
|
|
||||||
builder = builder.proxy(reqwest::Proxy::all(proxy).map_err(map_e)?);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(not(target_arch = "wasm32"))]
|
|
||||||
if let Some(timeout) = config.timeout {
|
if let Some(timeout) = config.timeout {
|
||||||
builder = builder.timeout(core::time::Duration::from_secs(timeout));
|
builder = builder.timeout(timeout);
|
||||||
}
|
}
|
||||||
|
|
||||||
blockchain.url_client.client = builder.build().map_err(map_e)?;
|
if let Some(proxy) = &config.proxy {
|
||||||
|
builder = builder.proxy(proxy);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut blockchain =
|
||||||
|
EsploraBlockchain::from_client(builder.build_async()?, config.stop_gap);
|
||||||
|
|
||||||
|
if let Some(concurrency) = config.concurrency {
|
||||||
|
blockchain = blockchain.with_concurrency(concurrency);
|
||||||
|
}
|
||||||
|
|
||||||
Ok(blockchain)
|
Ok(blockchain)
|
||||||
}
|
}
|
||||||
@@ -12,40 +12,27 @@
|
|||||||
//! Esplora by way of `ureq` HTTP client.
|
//! Esplora by way of `ureq` HTTP client.
|
||||||
|
|
||||||
use std::collections::{HashMap, HashSet};
|
use std::collections::{HashMap, HashSet};
|
||||||
use std::io;
|
use std::ops::DerefMut;
|
||||||
use std::io::Read;
|
|
||||||
use std::time::Duration;
|
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
use log::{debug, error, info, trace};
|
use log::{debug, error, info, trace};
|
||||||
|
|
||||||
use ureq::{Agent, Proxy, Response};
|
use bitcoin::{Transaction, Txid};
|
||||||
|
|
||||||
use bitcoin::consensus::{deserialize, serialize};
|
use esplora_client::{convert_fee_rate, BlockingClient, Builder, Tx};
|
||||||
use bitcoin::hashes::hex::{FromHex, ToHex};
|
|
||||||
use bitcoin::hashes::{sha256, Hash};
|
|
||||||
use bitcoin::{BlockHeader, Script, Transaction, Txid};
|
|
||||||
|
|
||||||
use super::api::Tx;
|
|
||||||
use crate::blockchain::esplora::EsploraError;
|
|
||||||
use crate::blockchain::*;
|
use crate::blockchain::*;
|
||||||
use crate::database::BatchDatabase;
|
use crate::database::BatchDatabase;
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
use crate::FeeRate;
|
use crate::FeeRate;
|
||||||
|
|
||||||
#[derive(Debug, Clone)]
|
|
||||||
struct UrlClient {
|
|
||||||
url: String,
|
|
||||||
agent: Agent,
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Structure that implements the logic to sync with Esplora
|
/// Structure that implements the logic to sync with Esplora
|
||||||
///
|
///
|
||||||
/// ## Example
|
/// ## Example
|
||||||
/// See the [`blockchain::esplora`](crate::blockchain::esplora) module for a usage example.
|
/// See the [`blockchain::esplora`](crate::blockchain::esplora) module for a usage example.
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
pub struct EsploraBlockchain {
|
pub struct EsploraBlockchain {
|
||||||
url_client: UrlClient,
|
url_client: BlockingClient,
|
||||||
stop_gap: usize,
|
stop_gap: usize,
|
||||||
concurrency: u8,
|
concurrency: u8,
|
||||||
}
|
}
|
||||||
@@ -53,22 +40,22 @@ pub struct EsploraBlockchain {
|
|||||||
impl EsploraBlockchain {
|
impl EsploraBlockchain {
|
||||||
/// Create a new instance of the client from a base URL and the `stop_gap`.
|
/// Create a new instance of the client from a base URL and the `stop_gap`.
|
||||||
pub fn new(base_url: &str, stop_gap: usize) -> Self {
|
pub fn new(base_url: &str, stop_gap: usize) -> Self {
|
||||||
|
let url_client = Builder::new(base_url)
|
||||||
|
.build_blocking()
|
||||||
|
.expect("Should never fail with no proxy and timeout");
|
||||||
|
|
||||||
|
Self::from_client(url_client, stop_gap)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Build a new instance given a client
|
||||||
|
pub fn from_client(url_client: BlockingClient, stop_gap: usize) -> Self {
|
||||||
EsploraBlockchain {
|
EsploraBlockchain {
|
||||||
url_client: UrlClient {
|
url_client,
|
||||||
url: base_url.to_string(),
|
|
||||||
agent: Agent::new(),
|
|
||||||
},
|
|
||||||
concurrency: super::DEFAULT_CONCURRENT_REQUESTS,
|
concurrency: super::DEFAULT_CONCURRENT_REQUESTS,
|
||||||
stop_gap,
|
stop_gap,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Set the inner `ureq` agent.
|
|
||||||
pub fn with_agent(mut self, agent: Agent) -> Self {
|
|
||||||
self.url_client.agent = agent;
|
|
||||||
self
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Set the number of parallel requests the client can make.
|
/// Set the number of parallel requests the client can make.
|
||||||
pub fn with_concurrency(mut self, concurrency: u8) -> Self {
|
pub fn with_concurrency(mut self, concurrency: u8) -> Self {
|
||||||
self.concurrency = concurrency;
|
self.concurrency = concurrency;
|
||||||
@@ -88,13 +75,23 @@ impl Blockchain for EsploraBlockchain {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn broadcast(&self, tx: &Transaction) -> Result<(), Error> {
|
fn broadcast(&self, tx: &Transaction) -> Result<(), Error> {
|
||||||
self.url_client._broadcast(tx)?;
|
self.url_client.broadcast(tx)?;
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn estimate_fee(&self, target: usize) -> Result<FeeRate, Error> {
|
fn estimate_fee(&self, target: usize) -> Result<FeeRate, Error> {
|
||||||
let estimates = self.url_client._get_fee_estimates()?;
|
let estimates = self.url_client.get_fee_estimates()?;
|
||||||
super::into_fee_rate(target, estimates)
|
Ok(FeeRate::from_sat_per_vb(convert_fee_rate(
|
||||||
|
target, estimates,
|
||||||
|
)?))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Deref for EsploraBlockchain {
|
||||||
|
type Target = BlockingClient;
|
||||||
|
|
||||||
|
fn deref(&self) -> &Self::Target {
|
||||||
|
&self.url_client
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -102,30 +99,31 @@ impl StatelessBlockchain for EsploraBlockchain {}
|
|||||||
|
|
||||||
impl GetHeight for EsploraBlockchain {
|
impl GetHeight for EsploraBlockchain {
|
||||||
fn get_height(&self) -> Result<u32, Error> {
|
fn get_height(&self) -> Result<u32, Error> {
|
||||||
Ok(self.url_client._get_height()?)
|
Ok(self.url_client.get_height()?)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl GetTx for EsploraBlockchain {
|
impl GetTx for EsploraBlockchain {
|
||||||
fn get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
fn get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||||
Ok(self.url_client._get_tx(txid)?)
|
Ok(self.url_client.get_tx(txid)?)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl GetBlockHash for EsploraBlockchain {
|
impl GetBlockHash for EsploraBlockchain {
|
||||||
fn get_block_hash(&self, height: u64) -> Result<BlockHash, Error> {
|
fn get_block_hash(&self, height: u64) -> Result<BlockHash, Error> {
|
||||||
let block_header = self.url_client._get_header(height as u32)?;
|
Ok(self.url_client.get_block_hash(height as u32)?)
|
||||||
Ok(block_header.block_hash())
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl WalletSync for EsploraBlockchain {
|
impl WalletSync for EsploraBlockchain {
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
_progress_update: Box<dyn Progress>,
|
_progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
use crate::blockchain::script_sync::Request;
|
use crate::blockchain::script_sync::Request;
|
||||||
|
let mut database = database.borrow_mut();
|
||||||
|
let database = database.deref_mut();
|
||||||
let mut request = script_sync::start(database, self.stop_gap)?;
|
let mut request = script_sync::start(database, self.stop_gap)?;
|
||||||
let mut tx_index: HashMap<Txid, Tx> = HashMap::new();
|
let mut tx_index: HashMap<Txid, Tx> = HashMap::new();
|
||||||
let batch_update = loop {
|
let batch_update = loop {
|
||||||
@@ -134,14 +132,14 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
let scripts = script_req
|
let scripts = script_req
|
||||||
.request()
|
.request()
|
||||||
.take(self.concurrency as usize)
|
.take(self.concurrency as usize)
|
||||||
.cloned();
|
.map(bitcoin::ScriptBuf::from);
|
||||||
|
|
||||||
let mut handles = vec![];
|
let mut handles = vec![];
|
||||||
for script in scripts {
|
for script in scripts {
|
||||||
let client = self.url_client.clone();
|
let client = self.url_client.clone();
|
||||||
// make each request in its own thread.
|
// make each request in its own thread.
|
||||||
handles.push(std::thread::spawn(move || {
|
handles.push(std::thread::spawn(move || {
|
||||||
let mut related_txs: Vec<Tx> = client._scripthash_txs(&script, None)?;
|
let mut related_txs: Vec<Tx> = client.scripthash_txs(&script, None)?;
|
||||||
|
|
||||||
let n_confirmed =
|
let n_confirmed =
|
||||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
||||||
@@ -149,7 +147,7 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
// keep requesting to see if there's more.
|
// keep requesting to see if there's more.
|
||||||
if n_confirmed >= 25 {
|
if n_confirmed >= 25 {
|
||||||
loop {
|
loop {
|
||||||
let new_related_txs: Vec<Tx> = client._scripthash_txs(
|
let new_related_txs: Vec<Tx> = client.scripthash_txs(
|
||||||
&script,
|
&script,
|
||||||
Some(related_txs.last().unwrap().txid),
|
Some(related_txs.last().unwrap().txid),
|
||||||
)?;
|
)?;
|
||||||
@@ -192,6 +190,7 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
.get(txid)
|
.get(txid)
|
||||||
.expect("must be in index")
|
.expect("must be in index")
|
||||||
.confirmation_time()
|
.confirmation_time()
|
||||||
|
.map(Into::into)
|
||||||
})
|
})
|
||||||
.collect();
|
.collect();
|
||||||
conftime_req.satisfy(conftimes)?
|
conftime_req.satisfy(conftimes)?
|
||||||
@@ -216,159 +215,22 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl UrlClient {
|
|
||||||
fn _get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.agent
|
|
||||||
.get(&format!("{}/tx/{}/raw", self.url, txid))
|
|
||||||
.call();
|
|
||||||
|
|
||||||
match resp {
|
|
||||||
Ok(resp) => Ok(Some(deserialize(&into_bytes(resp)?)?)),
|
|
||||||
Err(ureq::Error::Status(code, _)) => {
|
|
||||||
if is_status_not_found(code) {
|
|
||||||
return Ok(None);
|
|
||||||
}
|
|
||||||
Err(EsploraError::HttpResponse(code))
|
|
||||||
}
|
|
||||||
Err(e) => Err(EsploraError::Ureq(e)),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn _get_tx_no_opt(&self, txid: &Txid) -> Result<Transaction, EsploraError> {
|
|
||||||
match self._get_tx(txid) {
|
|
||||||
Ok(Some(tx)) => Ok(tx),
|
|
||||||
Ok(None) => Err(EsploraError::TransactionNotFound(*txid)),
|
|
||||||
Err(e) => Err(e),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn _get_header(&self, block_height: u32) -> Result<BlockHeader, EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.agent
|
|
||||||
.get(&format!("{}/block-height/{}", self.url, block_height))
|
|
||||||
.call();
|
|
||||||
|
|
||||||
let bytes = match resp {
|
|
||||||
Ok(resp) => Ok(into_bytes(resp)?),
|
|
||||||
Err(ureq::Error::Status(code, _)) => Err(EsploraError::HttpResponse(code)),
|
|
||||||
Err(e) => Err(EsploraError::Ureq(e)),
|
|
||||||
}?;
|
|
||||||
|
|
||||||
let hash = std::str::from_utf8(&bytes)
|
|
||||||
.map_err(|_| EsploraError::HeaderHeightNotFound(block_height))?;
|
|
||||||
|
|
||||||
let resp = self
|
|
||||||
.agent
|
|
||||||
.get(&format!("{}/block/{}/header", self.url, hash))
|
|
||||||
.call();
|
|
||||||
|
|
||||||
match resp {
|
|
||||||
Ok(resp) => Ok(deserialize(&Vec::from_hex(&resp.into_string()?)?)?),
|
|
||||||
Err(ureq::Error::Status(code, _)) => Err(EsploraError::HttpResponse(code)),
|
|
||||||
Err(e) => Err(EsploraError::Ureq(e)),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn _broadcast(&self, transaction: &Transaction) -> Result<(), EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.agent
|
|
||||||
.post(&format!("{}/tx", self.url))
|
|
||||||
.send_string(&serialize(transaction).to_hex());
|
|
||||||
|
|
||||||
match resp {
|
|
||||||
Ok(_) => Ok(()), // We do not return the txid?
|
|
||||||
Err(ureq::Error::Status(code, _)) => Err(EsploraError::HttpResponse(code)),
|
|
||||||
Err(e) => Err(EsploraError::Ureq(e)),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn _get_height(&self) -> Result<u32, EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.agent
|
|
||||||
.get(&format!("{}/blocks/tip/height", self.url))
|
|
||||||
.call();
|
|
||||||
|
|
||||||
match resp {
|
|
||||||
Ok(resp) => Ok(resp.into_string()?.parse()?),
|
|
||||||
Err(ureq::Error::Status(code, _)) => Err(EsploraError::HttpResponse(code)),
|
|
||||||
Err(e) => Err(EsploraError::Ureq(e)),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn _get_fee_estimates(&self) -> Result<HashMap<String, f64>, EsploraError> {
|
|
||||||
let resp = self
|
|
||||||
.agent
|
|
||||||
.get(&format!("{}/fee-estimates", self.url,))
|
|
||||||
.call();
|
|
||||||
|
|
||||||
let map = match resp {
|
|
||||||
Ok(resp) => {
|
|
||||||
let map: HashMap<String, f64> = resp.into_json()?;
|
|
||||||
Ok(map)
|
|
||||||
}
|
|
||||||
Err(ureq::Error::Status(code, _)) => Err(EsploraError::HttpResponse(code)),
|
|
||||||
Err(e) => Err(EsploraError::Ureq(e)),
|
|
||||||
}?;
|
|
||||||
|
|
||||||
Ok(map)
|
|
||||||
}
|
|
||||||
|
|
||||||
fn _scripthash_txs(
|
|
||||||
&self,
|
|
||||||
script: &Script,
|
|
||||||
last_seen: Option<Txid>,
|
|
||||||
) -> Result<Vec<Tx>, EsploraError> {
|
|
||||||
let script_hash = sha256::Hash::hash(script.as_bytes()).into_inner().to_hex();
|
|
||||||
let url = match last_seen {
|
|
||||||
Some(last_seen) => format!(
|
|
||||||
"{}/scripthash/{}/txs/chain/{}",
|
|
||||||
self.url, script_hash, last_seen
|
|
||||||
),
|
|
||||||
None => format!("{}/scripthash/{}/txs", self.url, script_hash),
|
|
||||||
};
|
|
||||||
Ok(self.agent.get(&url).call()?.into_json()?)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn is_status_not_found(status: u16) -> bool {
|
|
||||||
status == 404
|
|
||||||
}
|
|
||||||
|
|
||||||
fn into_bytes(resp: Response) -> Result<Vec<u8>, io::Error> {
|
|
||||||
const BYTES_LIMIT: usize = 10 * 1_024 * 1_024;
|
|
||||||
|
|
||||||
let mut buf: Vec<u8> = vec![];
|
|
||||||
resp.into_reader()
|
|
||||||
.take((BYTES_LIMIT + 1) as u64)
|
|
||||||
.read_to_end(&mut buf)?;
|
|
||||||
if buf.len() > BYTES_LIMIT {
|
|
||||||
return Err(io::Error::new(
|
|
||||||
io::ErrorKind::Other,
|
|
||||||
"response too big for into_bytes",
|
|
||||||
));
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(buf)
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ConfigurableBlockchain for EsploraBlockchain {
|
impl ConfigurableBlockchain for EsploraBlockchain {
|
||||||
type Config = super::EsploraBlockchainConfig;
|
type Config = super::EsploraBlockchainConfig;
|
||||||
|
|
||||||
fn from_config(config: &Self::Config) -> Result<Self, Error> {
|
fn from_config(config: &Self::Config) -> Result<Self, Error> {
|
||||||
let mut agent_builder = ureq::AgentBuilder::new();
|
let mut builder = Builder::new(config.base_url.as_str());
|
||||||
|
|
||||||
if let Some(timeout) = config.timeout {
|
if let Some(timeout) = config.timeout {
|
||||||
agent_builder = agent_builder.timeout(Duration::from_secs(timeout));
|
builder = builder.timeout(timeout);
|
||||||
}
|
}
|
||||||
|
|
||||||
if let Some(proxy) = &config.proxy {
|
if let Some(proxy) = &config.proxy {
|
||||||
agent_builder = agent_builder
|
builder = builder.proxy(proxy);
|
||||||
.proxy(Proxy::new(proxy).map_err(|e| Error::Esplora(Box::new(e.into())))?);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
let mut blockchain = EsploraBlockchain::new(config.base_url.as_str(), config.stop_gap)
|
let mut blockchain =
|
||||||
.with_agent(agent_builder.build());
|
EsploraBlockchain::from_client(builder.build_blocking()?, config.stop_gap);
|
||||||
|
|
||||||
if let Some(concurrency) = config.concurrency {
|
if let Some(concurrency) = config.concurrency {
|
||||||
blockchain = blockchain.with_concurrency(concurrency);
|
blockchain = blockchain.with_concurrency(concurrency);
|
||||||
@@ -377,12 +239,3 @@ impl ConfigurableBlockchain for EsploraBlockchain {
|
|||||||
Ok(blockchain)
|
Ok(blockchain)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl From<ureq::Error> for EsploraError {
|
|
||||||
fn from(e: ureq::Error) -> Self {
|
|
||||||
match e {
|
|
||||||
ureq::Error::Status(code, _) => EsploraError::HttpResponse(code),
|
|
||||||
e => EsploraError::Ureq(e),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -15,89 +15,25 @@
|
|||||||
//! depending on your needs (blocking or async respectively).
|
//! depending on your needs (blocking or async respectively).
|
||||||
//!
|
//!
|
||||||
//! Please note, to configure the Esplora HTTP client correctly use one of:
|
//! Please note, to configure the Esplora HTTP client correctly use one of:
|
||||||
//! Blocking: --features='esplora,ureq'
|
//! Blocking: --features='use-esplora-blocking'
|
||||||
//! Async: --features='async-interface,esplora,reqwest' --no-default-features
|
//! Async: --features='async-interface,use-esplora-async' --no-default-features
|
||||||
use std::collections::HashMap;
|
|
||||||
use std::fmt;
|
|
||||||
use std::io;
|
|
||||||
|
|
||||||
use bitcoin::consensus;
|
pub use esplora_client::Error as EsploraError;
|
||||||
use bitcoin::{BlockHash, Txid};
|
|
||||||
|
|
||||||
use crate::error::Error;
|
#[cfg(feature = "use-esplora-async")]
|
||||||
use crate::FeeRate;
|
mod r#async;
|
||||||
|
|
||||||
#[cfg(feature = "reqwest")]
|
#[cfg(feature = "use-esplora-async")]
|
||||||
mod reqwest;
|
pub use self::r#async::*;
|
||||||
|
|
||||||
#[cfg(feature = "reqwest")]
|
#[cfg(feature = "use-esplora-blocking")]
|
||||||
pub use self::reqwest::*;
|
mod blocking;
|
||||||
|
|
||||||
#[cfg(feature = "ureq")]
|
#[cfg(feature = "use-esplora-blocking")]
|
||||||
mod ureq;
|
pub use self::blocking::*;
|
||||||
|
|
||||||
#[cfg(feature = "ureq")]
|
|
||||||
pub use self::ureq::*;
|
|
||||||
|
|
||||||
mod api;
|
|
||||||
|
|
||||||
fn into_fee_rate(target: usize, estimates: HashMap<String, f64>) -> Result<FeeRate, Error> {
|
|
||||||
let fee_val = {
|
|
||||||
let mut pairs = estimates
|
|
||||||
.into_iter()
|
|
||||||
.filter_map(|(k, v)| Some((k.parse::<usize>().ok()?, v)))
|
|
||||||
.collect::<Vec<_>>();
|
|
||||||
pairs.sort_unstable_by_key(|(k, _)| std::cmp::Reverse(*k));
|
|
||||||
pairs
|
|
||||||
.into_iter()
|
|
||||||
.find(|(k, _)| k <= &target)
|
|
||||||
.map(|(_, v)| v)
|
|
||||||
.unwrap_or(1.0)
|
|
||||||
};
|
|
||||||
Ok(FeeRate::from_sat_per_vb(fee_val as f32))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Errors that can happen during a sync with [`EsploraBlockchain`]
|
|
||||||
#[derive(Debug)]
|
|
||||||
pub enum EsploraError {
|
|
||||||
/// Error during ureq HTTP request
|
|
||||||
#[cfg(feature = "ureq")]
|
|
||||||
Ureq(::ureq::Error),
|
|
||||||
/// Transport error during the ureq HTTP call
|
|
||||||
#[cfg(feature = "ureq")]
|
|
||||||
UreqTransport(::ureq::Transport),
|
|
||||||
/// Error during reqwest HTTP request
|
|
||||||
#[cfg(feature = "reqwest")]
|
|
||||||
Reqwest(::reqwest::Error),
|
|
||||||
/// HTTP response error
|
|
||||||
HttpResponse(u16),
|
|
||||||
/// IO error during ureq response read
|
|
||||||
Io(io::Error),
|
|
||||||
/// No header found in ureq response
|
|
||||||
NoHeader,
|
|
||||||
/// Invalid number returned
|
|
||||||
Parsing(std::num::ParseIntError),
|
|
||||||
/// Invalid Bitcoin data returned
|
|
||||||
BitcoinEncoding(bitcoin::consensus::encode::Error),
|
|
||||||
/// Invalid Hex data returned
|
|
||||||
Hex(bitcoin::hashes::hex::Error),
|
|
||||||
|
|
||||||
/// Transaction not found
|
|
||||||
TransactionNotFound(Txid),
|
|
||||||
/// Header height not found
|
|
||||||
HeaderHeightNotFound(u32),
|
|
||||||
/// Header hash not found
|
|
||||||
HeaderHashNotFound(BlockHash),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl fmt::Display for EsploraError {
|
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
||||||
write!(f, "{:?}", self)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Configuration for an [`EsploraBlockchain`]
|
/// Configuration for an [`EsploraBlockchain`]
|
||||||
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq)]
|
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq, Eq)]
|
||||||
pub struct EsploraBlockchainConfig {
|
pub struct EsploraBlockchainConfig {
|
||||||
/// Base URL of the esplora service
|
/// Base URL of the esplora service
|
||||||
///
|
///
|
||||||
@@ -138,16 +74,11 @@ impl EsploraBlockchainConfig {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::error::Error for EsploraError {}
|
impl From<esplora_client::BlockTime> for crate::BlockTime {
|
||||||
|
fn from(esplora_client::BlockTime { timestamp, height }: esplora_client::BlockTime) -> Self {
|
||||||
#[cfg(feature = "ureq")]
|
Self { timestamp, height }
|
||||||
impl_error!(::ureq::Transport, UreqTransport, EsploraError);
|
}
|
||||||
#[cfg(feature = "reqwest")]
|
}
|
||||||
impl_error!(::reqwest::Error, Reqwest, EsploraError);
|
|
||||||
impl_error!(io::Error, Io, EsploraError);
|
|
||||||
impl_error!(std::num::ParseIntError, Parsing, EsploraError);
|
|
||||||
impl_error!(consensus::encode::Error, BitcoinEncoding, EsploraError);
|
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex, EsploraError);
|
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
#[cfg(feature = "test-esplora")]
|
#[cfg(feature = "test-esplora")]
|
||||||
@@ -161,58 +92,11 @@ const DEFAULT_CONCURRENT_REQUESTS: u8 = 4;
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use super::*;
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn feerate_parsing() {
|
|
||||||
let esplora_fees = serde_json::from_str::<HashMap<String, f64>>(
|
|
||||||
r#"{
|
|
||||||
"25": 1.015,
|
|
||||||
"5": 2.3280000000000003,
|
|
||||||
"12": 2.0109999999999997,
|
|
||||||
"15": 1.018,
|
|
||||||
"17": 1.018,
|
|
||||||
"11": 2.0109999999999997,
|
|
||||||
"3": 3.01,
|
|
||||||
"2": 4.9830000000000005,
|
|
||||||
"6": 2.2359999999999998,
|
|
||||||
"21": 1.018,
|
|
||||||
"13": 1.081,
|
|
||||||
"7": 2.2359999999999998,
|
|
||||||
"8": 2.2359999999999998,
|
|
||||||
"16": 1.018,
|
|
||||||
"20": 1.018,
|
|
||||||
"22": 1.017,
|
|
||||||
"23": 1.017,
|
|
||||||
"504": 1,
|
|
||||||
"9": 2.2359999999999998,
|
|
||||||
"14": 1.018,
|
|
||||||
"10": 2.0109999999999997,
|
|
||||||
"24": 1.017,
|
|
||||||
"1008": 1,
|
|
||||||
"1": 4.9830000000000005,
|
|
||||||
"4": 2.3280000000000003,
|
|
||||||
"19": 1.018,
|
|
||||||
"144": 1,
|
|
||||||
"18": 1.018
|
|
||||||
}
|
|
||||||
"#,
|
|
||||||
)
|
|
||||||
.unwrap();
|
|
||||||
assert_eq!(
|
|
||||||
into_fee_rate(6, esplora_fees.clone()).unwrap(),
|
|
||||||
FeeRate::from_sat_per_vb(2.236)
|
|
||||||
);
|
|
||||||
assert_eq!(
|
|
||||||
into_fee_rate(26, esplora_fees).unwrap(),
|
|
||||||
FeeRate::from_sat_per_vb(1.015),
|
|
||||||
"should inherit from value for 25"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
#[cfg(feature = "test-esplora")]
|
#[cfg(feature = "test-esplora")]
|
||||||
fn test_esplora_with_variable_configs() {
|
fn test_esplora_with_variable_configs() {
|
||||||
|
use super::*;
|
||||||
|
|
||||||
use crate::testutils::{
|
use crate::testutils::{
|
||||||
blockchain_tests::TestClient,
|
blockchain_tests::TestClient,
|
||||||
configurable_blockchain_tests::ConfigurableBlockchainTester,
|
configurable_blockchain_tests::ConfigurableBlockchainTester,
|
||||||
|
|||||||
@@ -16,6 +16,7 @@
|
|||||||
//! [Compact Filters/Neutrino](crate::blockchain::compact_filters), along with a generalized trait
|
//! [Compact Filters/Neutrino](crate::blockchain::compact_filters), along with a generalized trait
|
||||||
//! [`Blockchain`] that can be implemented to build customized backends.
|
//! [`Blockchain`] that can be implemented to build customized backends.
|
||||||
|
|
||||||
|
use std::cell::RefCell;
|
||||||
use std::collections::HashSet;
|
use std::collections::HashSet;
|
||||||
use std::ops::Deref;
|
use std::ops::Deref;
|
||||||
use std::sync::mpsc::{channel, Receiver, Sender};
|
use std::sync::mpsc::{channel, Receiver, Sender};
|
||||||
@@ -133,7 +134,7 @@ pub trait WalletSync {
|
|||||||
/// Populate the internal database with transactions and UTXOs
|
/// Populate the internal database with transactions and UTXOs
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error>;
|
) -> Result<(), Error>;
|
||||||
|
|
||||||
@@ -156,7 +157,7 @@ pub trait WalletSync {
|
|||||||
/// [`BatchOperations::del_utxo`]: crate::database::BatchOperations::del_utxo
|
/// [`BatchOperations::del_utxo`]: crate::database::BatchOperations::del_utxo
|
||||||
fn wallet_sync<D: BatchDatabase>(
|
fn wallet_sync<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
maybe_await!(self.wallet_setup(database, progress_update))
|
maybe_await!(self.wallet_setup(database, progress_update))
|
||||||
@@ -248,11 +249,8 @@ pub trait BlockchainFactory {
|
|||||||
/// operations to build a blockchain for a given wallet, so if a wallet needs to be synced
|
/// operations to build a blockchain for a given wallet, so if a wallet needs to be synced
|
||||||
/// often it's recommended to use [`BlockchainFactory::build_for_wallet`] to reuse the same
|
/// often it's recommended to use [`BlockchainFactory::build_for_wallet`] to reuse the same
|
||||||
/// blockchain multiple times.
|
/// blockchain multiple times.
|
||||||
#[cfg(not(any(target_arch = "wasm32", feature = "async-interface")))]
|
#[cfg(not(feature = "async-interface"))]
|
||||||
#[cfg_attr(
|
#[cfg_attr(docsrs, doc(cfg(not(feature = "async-interface"))))]
|
||||||
docsrs,
|
|
||||||
doc(cfg(not(any(target_arch = "wasm32", feature = "async-interface"))))
|
|
||||||
)]
|
|
||||||
fn sync_wallet<D: BatchDatabase>(
|
fn sync_wallet<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
wallet: &Wallet<D>,
|
wallet: &Wallet<D>,
|
||||||
@@ -377,7 +375,7 @@ impl<T: GetBlockHash> GetBlockHash for Arc<T> {
|
|||||||
impl<T: WalletSync> WalletSync for Arc<T> {
|
impl<T: WalletSync> WalletSync for Arc<T> {
|
||||||
fn wallet_setup<D: BatchDatabase>(
|
fn wallet_setup<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
maybe_await!(self.deref().wallet_setup(database, progress_update))
|
maybe_await!(self.deref().wallet_setup(database, progress_update))
|
||||||
@@ -385,7 +383,7 @@ impl<T: WalletSync> WalletSync for Arc<T> {
|
|||||||
|
|
||||||
fn wallet_sync<D: BatchDatabase>(
|
fn wallet_sync<D: BatchDatabase>(
|
||||||
&self,
|
&self,
|
||||||
database: &mut D,
|
database: &RefCell<D>,
|
||||||
progress_update: Box<dyn Progress>,
|
progress_update: Box<dyn Progress>,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
maybe_await!(self.deref().wallet_sync(database, progress_update))
|
maybe_await!(self.deref().wallet_sync(database, progress_update))
|
||||||
|
|||||||
@@ -31,25 +31,26 @@
|
|||||||
//! let blockchain = RpcBlockchain::from_config(&config);
|
//! let blockchain = RpcBlockchain::from_config(&config);
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use crate::bitcoin::hashes::hex::ToHex;
|
|
||||||
use crate::bitcoin::{Network, OutPoint, Transaction, TxOut, Txid};
|
use crate::bitcoin::{Network, OutPoint, Transaction, TxOut, Txid};
|
||||||
use crate::blockchain::*;
|
use crate::blockchain::*;
|
||||||
use crate::database::{BatchDatabase, BatchOperations, DatabaseUtils};
|
use crate::database::{BatchDatabase, BatchOperations, DatabaseUtils};
|
||||||
use crate::descriptor::get_checksum;
|
use crate::descriptor::calc_checksum;
|
||||||
use crate::error::MissingCachedScripts;
|
use crate::error::MissingCachedScripts;
|
||||||
use crate::{BlockTime, Error, FeeRate, KeychainKind, LocalUtxo, TransactionDetails};
|
use crate::{BlockTime, Error, FeeRate, KeychainKind, LocalUtxo, TransactionDetails};
|
||||||
use bitcoin::Script;
|
use bitcoin::{Script, ScriptBuf};
|
||||||
use bitcoincore_rpc::json::{
|
use bitcoincore_rpc::json::{
|
||||||
GetTransactionResultDetailCategory, ImportMultiOptions, ImportMultiRequest,
|
GetTransactionResultDetailCategory, ImportMultiOptions, ImportMultiRequest,
|
||||||
ImportMultiRequestScriptPubkey, ImportMultiRescanSince, ListTransactionResult,
|
ImportMultiRequestScriptPubkey, ListTransactionResult, ListUnspentResultEntry, ScanningDetails,
|
||||||
ListUnspentResultEntry, ScanningDetails,
|
Timestamp,
|
||||||
};
|
};
|
||||||
use bitcoincore_rpc::jsonrpc::serde_json::{json, Value};
|
use bitcoincore_rpc::jsonrpc::serde_json::{json, Value};
|
||||||
use bitcoincore_rpc::Auth as RpcAuth;
|
use bitcoincore_rpc::Auth as RpcAuth;
|
||||||
use bitcoincore_rpc::{Client, RpcApi};
|
use bitcoincore_rpc::{Client, RpcApi};
|
||||||
use log::{debug, info};
|
use log::{debug, info};
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
use std::cell::RefCell;
|
||||||
use std::collections::{HashMap, HashSet};
|
use std::collections::{HashMap, HashSet};
|
||||||
|
use std::ops::{Deref, DerefMut};
|
||||||
use std::path::PathBuf;
|
use std::path::PathBuf;
|
||||||
use std::thread;
|
use std::thread;
|
||||||
use std::time::Duration;
|
use std::time::Duration;
|
||||||
@@ -67,8 +68,16 @@ pub struct RpcBlockchain {
|
|||||||
sync_params: RpcSyncParams,
|
sync_params: RpcSyncParams,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Deref for RpcBlockchain {
|
||||||
|
type Target = Client;
|
||||||
|
|
||||||
|
fn deref(&self) -> &Self::Target {
|
||||||
|
&self.client
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// RpcBlockchain configuration options
|
/// RpcBlockchain configuration options
|
||||||
#[derive(Debug, Serialize, Deserialize, Clone, PartialEq)]
|
#[derive(Debug, Serialize, Deserialize, Clone, PartialEq, Eq)]
|
||||||
pub struct RpcConfig {
|
pub struct RpcConfig {
|
||||||
/// The bitcoin node url
|
/// The bitcoin node url
|
||||||
pub url: String,
|
pub url: String,
|
||||||
@@ -87,7 +96,7 @@ pub struct RpcConfig {
|
|||||||
/// In general, BDK tries to sync `scriptPubKey`s cached in [`crate::database::Database`] with
|
/// In general, BDK tries to sync `scriptPubKey`s cached in [`crate::database::Database`] with
|
||||||
/// `scriptPubKey`s imported in the Bitcoin Core Wallet. These parameters are used for determining
|
/// `scriptPubKey`s imported in the Bitcoin Core Wallet. These parameters are used for determining
|
||||||
/// how the `importdescriptors` RPC calls are to be made.
|
/// how the `importdescriptors` RPC calls are to be made.
|
||||||
#[derive(Debug, Serialize, Deserialize, Clone, PartialEq)]
|
#[derive(Debug, Serialize, Deserialize, Clone, PartialEq, Eq)]
|
||||||
pub struct RpcSyncParams {
|
pub struct RpcSyncParams {
|
||||||
/// The minimum number of scripts to scan for on initial sync.
|
/// The minimum number of scripts to scan for on initial sync.
|
||||||
pub start_script_count: usize,
|
pub start_script_count: usize,
|
||||||
@@ -158,7 +167,7 @@ impl Blockchain for RpcBlockchain {
|
|||||||
.estimate_smart_fee(target as u16, None)?
|
.estimate_smart_fee(target as u16, None)?
|
||||||
.fee_rate
|
.fee_rate
|
||||||
.ok_or(Error::FeeRateUnavailable)?
|
.ok_or(Error::FeeRateUnavailable)?
|
||||||
.as_sat() as f64;
|
.to_sat() as f64;
|
||||||
|
|
||||||
Ok(FeeRate::from_sat_per_vb((sat_per_kb / 1000f64) as f32))
|
Ok(FeeRate::from_sat_per_vb((sat_per_kb / 1000f64) as f32))
|
||||||
}
|
}
|
||||||
@@ -183,10 +192,12 @@ impl GetBlockHash for RpcBlockchain {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl WalletSync for RpcBlockchain {
|
impl WalletSync for RpcBlockchain {
|
||||||
fn wallet_setup<D>(&self, db: &mut D, prog: Box<dyn Progress>) -> Result<(), Error>
|
fn wallet_setup<D>(&self, db: &RefCell<D>, prog: Box<dyn Progress>) -> Result<(), Error>
|
||||||
where
|
where
|
||||||
D: BatchDatabase,
|
D: BatchDatabase,
|
||||||
{
|
{
|
||||||
|
let mut db = db.borrow_mut();
|
||||||
|
let db = db.deref_mut();
|
||||||
let batch = DbState::new(db, &self.sync_params, &*prog)?
|
let batch = DbState::new(db, &self.sync_params, &*prog)?
|
||||||
.sync_with_core(&self.client, self.is_descriptors)?
|
.sync_with_core(&self.client, self.is_descriptors)?
|
||||||
.as_db_batch()?;
|
.as_db_batch()?;
|
||||||
@@ -290,8 +301,8 @@ struct DbState<'a, D> {
|
|||||||
params: &'a RpcSyncParams,
|
params: &'a RpcSyncParams,
|
||||||
prog: &'a dyn Progress,
|
prog: &'a dyn Progress,
|
||||||
|
|
||||||
ext_spks: Vec<Script>,
|
ext_spks: Vec<ScriptBuf>,
|
||||||
int_spks: Vec<Script>,
|
int_spks: Vec<ScriptBuf>,
|
||||||
txs: HashMap<Txid, TransactionDetails>,
|
txs: HashMap<Txid, TransactionDetails>,
|
||||||
utxos: HashSet<LocalUtxo>,
|
utxos: HashSet<LocalUtxo>,
|
||||||
last_indexes: HashMap<KeychainKind, u32>,
|
last_indexes: HashMap<KeychainKind, u32>,
|
||||||
@@ -401,7 +412,12 @@ impl<'a, D: BatchDatabase> DbState<'a, D> {
|
|||||||
updated = true;
|
updated = true;
|
||||||
TransactionDetails {
|
TransactionDetails {
|
||||||
txid: tx_res.info.txid,
|
txid: tx_res.info.txid,
|
||||||
..Default::default()
|
transaction: None,
|
||||||
|
|
||||||
|
received: 0,
|
||||||
|
sent: 0,
|
||||||
|
fee: None,
|
||||||
|
confirmation_time: None,
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
|
|
||||||
@@ -421,7 +437,7 @@ impl<'a, D: BatchDatabase> DbState<'a, D> {
|
|||||||
// update fee (if needed)
|
// update fee (if needed)
|
||||||
if let (None, Some(new_fee)) = (db_tx.fee, tx_res.detail.fee) {
|
if let (None, Some(new_fee)) = (db_tx.fee, tx_res.detail.fee) {
|
||||||
updated = true;
|
updated = true;
|
||||||
db_tx.fee = Some(new_fee.as_sat().unsigned_abs());
|
db_tx.fee = Some(new_fee.to_sat().unsigned_abs());
|
||||||
}
|
}
|
||||||
|
|
||||||
// update confirmation time (if needed)
|
// update confirmation time (if needed)
|
||||||
@@ -594,7 +610,7 @@ impl<'a, D: BatchDatabase> DbState<'a, D> {
|
|||||||
LocalUtxo {
|
LocalUtxo {
|
||||||
outpoint: OutPoint::new(entry.txid, entry.vout),
|
outpoint: OutPoint::new(entry.txid, entry.vout),
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value: entry.amount.as_sat(),
|
value: entry.amount.to_sat(),
|
||||||
script_pubkey: entry.script_pub_key,
|
script_pubkey: entry.script_pub_key,
|
||||||
},
|
},
|
||||||
keychain,
|
keychain,
|
||||||
@@ -651,7 +667,7 @@ fn import_descriptors<'a, S>(
|
|||||||
scripts_iter: S,
|
scripts_iter: S,
|
||||||
) -> Result<(), Error>
|
) -> Result<(), Error>
|
||||||
where
|
where
|
||||||
S: Iterator<Item = &'a Script>,
|
S: Iterator<Item = &'a ScriptBuf>,
|
||||||
{
|
{
|
||||||
let requests = Value::Array(
|
let requests = Value::Array(
|
||||||
scripts_iter
|
scripts_iter
|
||||||
@@ -679,11 +695,11 @@ where
|
|||||||
|
|
||||||
fn import_multi<'a, S>(client: &Client, start_epoch: u64, scripts_iter: S) -> Result<(), Error>
|
fn import_multi<'a, S>(client: &Client, start_epoch: u64, scripts_iter: S) -> Result<(), Error>
|
||||||
where
|
where
|
||||||
S: Iterator<Item = &'a Script>,
|
S: Iterator<Item = &'a ScriptBuf>,
|
||||||
{
|
{
|
||||||
let requests = scripts_iter
|
let requests = scripts_iter
|
||||||
.map(|script| ImportMultiRequest {
|
.map(|script| ImportMultiRequest {
|
||||||
timestamp: ImportMultiRescanSince::Timestamp(start_epoch),
|
timestamp: Timestamp::Time(start_epoch),
|
||||||
script_pubkey: Some(ImportMultiRequestScriptPubkey::Script(script)),
|
script_pubkey: Some(ImportMultiRequestScriptPubkey::Script(script)),
|
||||||
watchonly: Some(true),
|
watchonly: Some(true),
|
||||||
..Default::default()
|
..Default::default()
|
||||||
@@ -791,8 +807,8 @@ fn is_wallet_descriptor(client: &Client) -> Result<bool, Error> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn descriptor_from_script_pubkey(script: &Script) -> String {
|
fn descriptor_from_script_pubkey(script: &Script) -> String {
|
||||||
let desc = format!("raw({})", script.to_hex());
|
let desc = format!("raw({})", script.to_hex_string());
|
||||||
format!("{}#{}", desc, get_checksum(&desc).unwrap())
|
format!("{}#{}", desc, calc_checksum(&desc).unwrap())
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Factory of [`RpcBlockchain`] instances, implements [`BlockchainFactory`]
|
/// Factory of [`RpcBlockchain`] instances, implements [`BlockchainFactory`]
|
||||||
@@ -864,15 +880,13 @@ impl BlockchainFactory for RpcBlockchainFactory {
|
|||||||
mod test {
|
mod test {
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::{
|
use crate::{
|
||||||
descriptor::{into_wallet_descriptor_checked, AsDerived},
|
descriptor::into_wallet_descriptor_checked, testutils::blockchain_tests::TestClient,
|
||||||
testutils::blockchain_tests::TestClient,
|
|
||||||
wallet::utils::SecpCtx,
|
wallet::utils::SecpCtx,
|
||||||
};
|
};
|
||||||
|
|
||||||
use bitcoin::{Address, Network};
|
use bitcoin::{Address, Network};
|
||||||
use bitcoincore_rpc::RpcApi;
|
use bitcoincore_rpc::RpcApi;
|
||||||
use log::LevelFilter;
|
use log::LevelFilter;
|
||||||
use miniscript::DescriptorTrait;
|
|
||||||
|
|
||||||
crate::bdk_blockchain_tests! {
|
crate::bdk_blockchain_tests! {
|
||||||
fn test_instance(test_client: &TestClient) -> RpcBlockchain {
|
fn test_instance(test_client: &TestClient) -> RpcBlockchain {
|
||||||
@@ -949,7 +963,7 @@ mod test {
|
|||||||
|
|
||||||
// generate scripts (1 tx per script)
|
// generate scripts (1 tx per script)
|
||||||
let scripts = (0..TX_COUNT)
|
let scripts = (0..TX_COUNT)
|
||||||
.map(|index| desc.as_derived(index, &secp).script_pubkey())
|
.map(|index| desc.at_derivation_index(index).unwrap().script_pubkey())
|
||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// import scripts and wait
|
// import scripts and wait
|
||||||
|
|||||||
@@ -9,7 +9,7 @@ use crate::{
|
|||||||
wallet::time::Instant,
|
wallet::time::Instant,
|
||||||
BlockTime, Error, KeychainKind, LocalUtxo, TransactionDetails,
|
BlockTime, Error, KeychainKind, LocalUtxo, TransactionDetails,
|
||||||
};
|
};
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxOut, Txid};
|
use bitcoin::{hashes::Hash, OutPoint, Script, ScriptBuf, Transaction, TxOut, Txid};
|
||||||
use log::*;
|
use log::*;
|
||||||
use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet, VecDeque};
|
use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet, VecDeque};
|
||||||
|
|
||||||
@@ -53,7 +53,7 @@ pub struct ScriptReq<'a, D: BatchDatabase> {
|
|||||||
state: State<'a, D>,
|
state: State<'a, D>,
|
||||||
script_index: usize,
|
script_index: usize,
|
||||||
initial_scripts_needed: usize, // if this is 1, we assume the descriptor is not derivable
|
initial_scripts_needed: usize, // if this is 1, we assume the descriptor is not derivable
|
||||||
scripts_needed: VecDeque<Script>,
|
scripts_needed: VecDeque<ScriptBuf>,
|
||||||
stop_gap: usize,
|
stop_gap: usize,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
next_keychains: Vec<KeychainKind>,
|
next_keychains: Vec<KeychainKind>,
|
||||||
@@ -62,7 +62,7 @@ pub struct ScriptReq<'a, D: BatchDatabase> {
|
|||||||
/// The sync starts by returning script pubkeys we are interested in.
|
/// The sync starts by returning script pubkeys we are interested in.
|
||||||
impl<'a, D: BatchDatabase> ScriptReq<'a, D> {
|
impl<'a, D: BatchDatabase> ScriptReq<'a, D> {
|
||||||
pub fn request(&self) -> impl Iterator<Item = &Script> + Clone {
|
pub fn request(&self) -> impl Iterator<Item = &Script> + Clone {
|
||||||
self.scripts_needed.iter()
|
self.scripts_needed.iter().map(|s| s.as_script())
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn satisfy(
|
pub fn satisfy(
|
||||||
@@ -444,8 +444,14 @@ impl<'a, D: BatchDatabase> State<'a, D> {
|
|||||||
/// Remove conflicting transactions -- tie breaking them by fee.
|
/// Remove conflicting transactions -- tie breaking them by fee.
|
||||||
fn make_txs_consistent(txs: &[TransactionDetails]) -> Vec<&TransactionDetails> {
|
fn make_txs_consistent(txs: &[TransactionDetails]) -> Vec<&TransactionDetails> {
|
||||||
let mut utxo_index: HashMap<OutPoint, &TransactionDetails> = HashMap::default();
|
let mut utxo_index: HashMap<OutPoint, &TransactionDetails> = HashMap::default();
|
||||||
|
let mut coinbase_txs = vec![];
|
||||||
for tx in txs {
|
for tx in txs {
|
||||||
for input in &tx.transaction.as_ref().unwrap().input {
|
for input in &tx.transaction.as_ref().unwrap().input {
|
||||||
|
if input.previous_output.txid == Txid::all_zeros() {
|
||||||
|
coinbase_txs.push(tx);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
utxo_index
|
utxo_index
|
||||||
.entry(input.previous_output)
|
.entry(input.previous_output)
|
||||||
.and_modify(|existing| match (tx.fee, existing.fee) {
|
.and_modify(|existing| match (tx.fee, existing.fee) {
|
||||||
@@ -463,5 +469,6 @@ fn make_txs_consistent(txs: &[TransactionDetails]) -> Vec<&TransactionDetails> {
|
|||||||
.collect::<HashMap<_, _>>()
|
.collect::<HashMap<_, _>>()
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.map(|(_, tx)| tx)
|
.map(|(_, tx)| tx)
|
||||||
|
.chain(coinbase_txs)
|
||||||
.collect()
|
.collect()
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -153,7 +153,7 @@ impl BatchOperations for AnyDatabase {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(
|
impl_inner_method!(
|
||||||
AnyDatabase,
|
AnyDatabase,
|
||||||
self,
|
self,
|
||||||
@@ -204,7 +204,7 @@ impl Database for AnyDatabase {
|
|||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(AnyDatabase, self, iter_script_pubkeys, keychain)
|
impl_inner_method!(AnyDatabase, self, iter_script_pubkeys, keychain)
|
||||||
}
|
}
|
||||||
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error> {
|
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error> {
|
||||||
@@ -221,7 +221,7 @@ impl Database for AnyDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(
|
impl_inner_method!(
|
||||||
AnyDatabase,
|
AnyDatabase,
|
||||||
self,
|
self,
|
||||||
@@ -286,7 +286,7 @@ impl BatchOperations for AnyBatch {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(AnyBatch, self, del_script_pubkey_from_path, keychain, child)
|
impl_inner_method!(AnyBatch, self, del_script_pubkey_from_path, keychain, child)
|
||||||
}
|
}
|
||||||
fn del_path_from_script_pubkey(
|
fn del_path_from_script_pubkey(
|
||||||
|
|||||||
@@ -15,7 +15,7 @@ use sled::{Batch, Tree};
|
|||||||
|
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction};
|
||||||
|
|
||||||
use crate::database::memory::MapKey;
|
use crate::database::memory::MapKey;
|
||||||
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
||||||
@@ -90,7 +90,7 @@ macro_rules! impl_batch_operations {
|
|||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn del_script_pubkey_from_path(&mut self, keychain: KeychainKind, path: u32) -> Result<Option<Script>, Error> {
|
fn del_script_pubkey_from_path(&mut self, keychain: KeychainKind, path: u32) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
let res = self.remove(key);
|
let res = self.remove(key);
|
||||||
let res = $process_delete!(res);
|
let res = $process_delete!(res);
|
||||||
@@ -221,7 +221,7 @@ impl Database for Tree {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((keychain, None)).as_map_key();
|
let key = MapKey::Path((keychain, None)).as_map_key();
|
||||||
self.scan_prefix(key)
|
self.scan_prefix(key)
|
||||||
.map(|x| -> Result<_, Error> {
|
.map(|x| -> Result<_, Error> {
|
||||||
@@ -286,7 +286,7 @@ impl Database for Tree {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
Ok(self.get(key)?.map(|b| deserialize(&b)).transpose()?)
|
Ok(self.get(key)?.map(|b| deserialize(&b)).transpose()?)
|
||||||
}
|
}
|
||||||
@@ -492,4 +492,44 @@ mod test {
|
|||||||
fn test_sync_time() {
|
fn test_sync_time() {
|
||||||
crate::database::test::test_sync_time(get_tree());
|
crate::database::test::test_sync_time(get_tree());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_iter_raw_txs() {
|
||||||
|
crate::database::test::test_iter_raw_txs(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_path_from_script_pubkey() {
|
||||||
|
crate::database::test::test_del_path_from_script_pubkey(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_iter_script_pubkeys() {
|
||||||
|
crate::database::test::test_iter_script_pubkeys(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_utxo() {
|
||||||
|
crate::database::test::test_del_utxo(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_raw_tx() {
|
||||||
|
crate::database::test::test_del_raw_tx(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_tx() {
|
||||||
|
crate::database::test::test_del_tx(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_last_index() {
|
||||||
|
crate::database::test::test_del_last_index(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_check_descriptor_checksum() {
|
||||||
|
crate::database::test::test_check_descriptor_checksum(get_tree());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -20,7 +20,7 @@ use std::ops::Bound::{Excluded, Included};
|
|||||||
|
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction};
|
||||||
|
|
||||||
use crate::database::{BatchDatabase, BatchOperations, ConfigurableDatabase, Database, SyncTime};
|
use crate::database::{BatchDatabase, BatchOperations, ConfigurableDatabase, Database, SyncTime};
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
@@ -136,7 +136,7 @@ impl BatchOperations for MemoryDatabase {
|
|||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
self.map.insert(key, Box::new(script.clone()));
|
self.map.insert(key, Box::new(ScriptBuf::from(script)));
|
||||||
|
|
||||||
let key = MapKey::Script(Some(script)).as_map_key();
|
let key = MapKey::Script(Some(script)).as_map_key();
|
||||||
let value = json!({
|
let value = json!({
|
||||||
@@ -196,7 +196,7 @@ impl BatchOperations for MemoryDatabase {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
let res = self.map.remove(&key);
|
let res = self.map.remove(&key);
|
||||||
self.deleted_keys.push(key);
|
self.deleted_keys.push(key);
|
||||||
@@ -315,7 +315,7 @@ impl Database for MemoryDatabase {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((keychain, None)).as_map_key();
|
let key = MapKey::Path((keychain, None)).as_map_key();
|
||||||
self.map
|
self.map
|
||||||
.range::<Vec<u8>, _>((Included(&key), Excluded(&after(&key))))
|
.range::<Vec<u8>, _>((Included(&key), Excluded(&after(&key))))
|
||||||
@@ -368,7 +368,7 @@ impl Database for MemoryDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
Ok(self
|
Ok(self
|
||||||
.map
|
.map
|
||||||
@@ -485,19 +485,18 @@ macro_rules! populate_test_db {
|
|||||||
$crate::populate_test_db!($db, $tx_meta, $current_height, (@coinbase false))
|
$crate::populate_test_db!($db, $tx_meta, $current_height, (@coinbase false))
|
||||||
}};
|
}};
|
||||||
($db:expr, $tx_meta:expr, $current_height:expr, (@coinbase $is_coinbase:expr)$(,)?) => {{
|
($db:expr, $tx_meta:expr, $current_height:expr, (@coinbase $is_coinbase:expr)$(,)?) => {{
|
||||||
use std::str::FromStr;
|
use $crate::database::SyncTime;
|
||||||
use $crate::database::BatchOperations;
|
use $crate::database::{BatchOperations, Database};
|
||||||
let mut db = $db;
|
let mut db = $db;
|
||||||
let tx_meta = $tx_meta;
|
let tx_meta = $tx_meta;
|
||||||
let current_height: Option<u32> = $current_height;
|
let current_height: Option<u32> = $current_height;
|
||||||
let input = if $is_coinbase {
|
let mut input = vec![$crate::bitcoin::TxIn::default()];
|
||||||
vec![$crate::bitcoin::TxIn::default()]
|
if !$is_coinbase {
|
||||||
} else {
|
input[0].previous_output.vout = 0;
|
||||||
vec![]
|
}
|
||||||
};
|
|
||||||
let tx = $crate::bitcoin::Transaction {
|
let tx = $crate::bitcoin::Transaction {
|
||||||
version: 1,
|
version: 1,
|
||||||
lock_time: 0,
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
input,
|
input,
|
||||||
output: tx_meta
|
output: tx_meta
|
||||||
.output
|
.output
|
||||||
@@ -506,20 +505,39 @@ macro_rules! populate_test_db {
|
|||||||
value: out_meta.value,
|
value: out_meta.value,
|
||||||
script_pubkey: $crate::bitcoin::Address::from_str(&out_meta.to_address)
|
script_pubkey: $crate::bitcoin::Address::from_str(&out_meta.to_address)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.script_pubkey(),
|
.script_pubkey(),
|
||||||
})
|
})
|
||||||
.collect(),
|
.collect(),
|
||||||
};
|
};
|
||||||
|
|
||||||
let txid = tx.txid();
|
let txid = tx.txid();
|
||||||
|
// Set Confirmation time only if current height is provided.
|
||||||
|
// panics if `tx_meta.min_confirmation` is Some, and current_height is None.
|
||||||
let confirmation_time = tx_meta
|
let confirmation_time = tx_meta
|
||||||
.min_confirmations
|
.min_confirmations
|
||||||
.and_then(|v| if v == 0 { None } else { Some(v) })
|
.and_then(|v| if v == 0 { None } else { Some(v) })
|
||||||
.map(|conf| $crate::BlockTime {
|
.map(|conf| $crate::BlockTime {
|
||||||
height: current_height.unwrap().checked_sub(conf as u32).unwrap() + 1,
|
height: current_height.expect("Current height is needed for testing transaction with min-confirmation values").checked_sub(conf as u32).unwrap() + 1,
|
||||||
timestamp: 0,
|
timestamp: 0,
|
||||||
});
|
});
|
||||||
|
|
||||||
|
// Set the database sync_time.
|
||||||
|
// Check if the current_height is less than already known sync height, apply the max
|
||||||
|
// If any of them is None, the other will be applied instead.
|
||||||
|
// If both are None, this will not be set.
|
||||||
|
if let Some(height) = db.get_sync_time().unwrap()
|
||||||
|
.map(|sync_time| sync_time.block_time.height)
|
||||||
|
.max(current_height) {
|
||||||
|
let sync_time = SyncTime {
|
||||||
|
block_time: BlockTime {
|
||||||
|
height,
|
||||||
|
timestamp: 0
|
||||||
|
}
|
||||||
|
};
|
||||||
|
db.set_sync_time(sync_time).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
let tx_details = $crate::TransactionDetails {
|
let tx_details = $crate::TransactionDetails {
|
||||||
transaction: Some(tx.clone()),
|
transaction: Some(tx.clone()),
|
||||||
txid,
|
txid,
|
||||||
@@ -629,4 +647,44 @@ mod test {
|
|||||||
fn test_sync_time() {
|
fn test_sync_time() {
|
||||||
crate::database::test::test_sync_time(get_tree());
|
crate::database::test::test_sync_time(get_tree());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_iter_raw_txs() {
|
||||||
|
crate::database::test::test_iter_raw_txs(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_path_from_script_pubkey() {
|
||||||
|
crate::database::test::test_del_path_from_script_pubkey(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_iter_script_pubkeys() {
|
||||||
|
crate::database::test::test_iter_script_pubkeys(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_utxo() {
|
||||||
|
crate::database::test::test_del_utxo(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_raw_tx() {
|
||||||
|
crate::database::test::test_del_raw_tx(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_tx() {
|
||||||
|
crate::database::test::test_del_tx(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_last_index() {
|
||||||
|
crate::database::test::test_del_last_index(get_tree());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_check_descriptor_checksum() {
|
||||||
|
crate::database::test::test_check_descriptor_checksum(get_tree());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -27,7 +27,7 @@
|
|||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxOut};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction, TxOut};
|
||||||
|
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
use crate::types::*;
|
use crate::types::*;
|
||||||
@@ -49,7 +49,7 @@ pub use memory::MemoryDatabase;
|
|||||||
/// Blockchain state at the time of syncing
|
/// Blockchain state at the time of syncing
|
||||||
///
|
///
|
||||||
/// Contains only the block time and height at the moment
|
/// Contains only the block time and height at the moment
|
||||||
#[derive(Clone, Debug, Serialize, Deserialize)]
|
#[derive(Clone, Debug, PartialEq, Eq, Serialize, Deserialize)]
|
||||||
pub struct SyncTime {
|
pub struct SyncTime {
|
||||||
/// Block timestamp and height at the time of sync
|
/// Block timestamp and height at the time of sync
|
||||||
pub block_time: BlockTime,
|
pub block_time: BlockTime,
|
||||||
@@ -83,7 +83,7 @@ pub trait BatchOperations {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error>;
|
) -> Result<Option<ScriptBuf>, Error>;
|
||||||
/// Delete the data related to a specific script_pubkey, meaning the keychain and the child
|
/// Delete the data related to a specific script_pubkey, meaning the keychain and the child
|
||||||
/// number.
|
/// number.
|
||||||
fn del_path_from_script_pubkey(
|
fn del_path_from_script_pubkey(
|
||||||
@@ -124,7 +124,7 @@ pub trait Database: BatchOperations {
|
|||||||
) -> Result<(), Error>;
|
) -> Result<(), Error>;
|
||||||
|
|
||||||
/// Return the list of script_pubkeys
|
/// Return the list of script_pubkeys
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error>;
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error>;
|
||||||
/// Return the list of [`LocalUtxo`]s
|
/// Return the list of [`LocalUtxo`]s
|
||||||
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error>;
|
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error>;
|
||||||
/// Return the list of raw transactions
|
/// Return the list of raw transactions
|
||||||
@@ -137,7 +137,7 @@ pub trait Database: BatchOperations {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error>;
|
) -> Result<Option<ScriptBuf>, Error>;
|
||||||
/// Fetch the keychain and child number of a given script_pubkey
|
/// Fetch the keychain and child number of a given script_pubkey
|
||||||
fn get_path_from_script_pubkey(
|
fn get_path_from_script_pubkey(
|
||||||
&self,
|
&self,
|
||||||
@@ -214,37 +214,38 @@ impl<T: Database> DatabaseUtils for T {}
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub mod test {
|
pub mod test {
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
use bitcoin::consensus::encode::deserialize;
|
use bitcoin::consensus::encode::deserialize;
|
||||||
|
use bitcoin::consensus::serialize;
|
||||||
use bitcoin::hashes::hex::*;
|
use bitcoin::hashes::hex::*;
|
||||||
|
use bitcoin::Witness;
|
||||||
use bitcoin::*;
|
use bitcoin::*;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
pub fn test_script_pubkey<D: Database>(mut tree: D) {
|
pub fn test_script_pubkey<D: Database>(mut db: D) {
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
let keychain = KeychainKind::External;
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
tree.set_script_pubkey(&script, keychain, path).unwrap();
|
db.set_script_pubkey(&script, keychain, path).unwrap();
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_script_pubkey_from_path(keychain, path).unwrap(),
|
db.get_script_pubkey_from_path(keychain, path).unwrap(),
|
||||||
Some(script.clone())
|
Some(script.clone())
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_path_from_script_pubkey(&script).unwrap(),
|
db.get_path_from_script_pubkey(&script).unwrap(),
|
||||||
Some((keychain, path))
|
Some((keychain, path))
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_batch_script_pubkey<D: BatchDatabase>(mut tree: D) {
|
pub fn test_batch_script_pubkey<D: BatchDatabase>(mut db: D) {
|
||||||
let mut batch = tree.begin_batch();
|
let mut batch = db.begin_batch();
|
||||||
|
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
@@ -253,55 +254,55 @@ pub mod test {
|
|||||||
batch.set_script_pubkey(&script, keychain, path).unwrap();
|
batch.set_script_pubkey(&script, keychain, path).unwrap();
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_script_pubkey_from_path(keychain, path).unwrap(),
|
db.get_script_pubkey_from_path(keychain, path).unwrap(),
|
||||||
None
|
None
|
||||||
);
|
);
|
||||||
assert_eq!(tree.get_path_from_script_pubkey(&script).unwrap(), None);
|
assert_eq!(db.get_path_from_script_pubkey(&script).unwrap(), None);
|
||||||
|
|
||||||
tree.commit_batch(batch).unwrap();
|
db.commit_batch(batch).unwrap();
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_script_pubkey_from_path(keychain, path).unwrap(),
|
db.get_script_pubkey_from_path(keychain, path).unwrap(),
|
||||||
Some(script.clone())
|
Some(script.clone())
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_path_from_script_pubkey(&script).unwrap(),
|
db.get_path_from_script_pubkey(&script).unwrap(),
|
||||||
Some((keychain, path))
|
Some((keychain, path))
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_iter_script_pubkey<D: Database>(mut tree: D) {
|
pub fn test_iter_script_pubkey<D: Database>(mut db: D) {
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
let keychain = KeychainKind::External;
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
tree.set_script_pubkey(&script, keychain, path).unwrap();
|
db.set_script_pubkey(&script, keychain, path).unwrap();
|
||||||
|
|
||||||
assert_eq!(tree.iter_script_pubkeys(None).unwrap().len(), 1);
|
assert_eq!(db.iter_script_pubkeys(None).unwrap().len(), 1);
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_del_script_pubkey<D: Database>(mut tree: D) {
|
pub fn test_del_script_pubkey<D: Database>(mut db: D) {
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
let keychain = KeychainKind::External;
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
tree.set_script_pubkey(&script, keychain, path).unwrap();
|
db.set_script_pubkey(&script, keychain, path).unwrap();
|
||||||
assert_eq!(tree.iter_script_pubkeys(None).unwrap().len(), 1);
|
assert_eq!(db.iter_script_pubkeys(None).unwrap().len(), 1);
|
||||||
|
|
||||||
tree.del_script_pubkey_from_path(keychain, path).unwrap();
|
db.del_script_pubkey_from_path(keychain, path).unwrap();
|
||||||
assert_eq!(tree.iter_script_pubkeys(None).unwrap().len(), 0);
|
assert_eq!(db.iter_script_pubkeys(None).unwrap().len(), 0);
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_utxo<D: Database>(mut tree: D) {
|
pub fn test_utxo<D: Database>(mut db: D) {
|
||||||
let outpoint = OutPoint::from_str(
|
let outpoint = OutPoint::from_str(
|
||||||
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let txout = TxOut {
|
let txout = TxOut {
|
||||||
@@ -315,24 +316,40 @@ pub mod test {
|
|||||||
is_spent: true,
|
is_spent: true,
|
||||||
};
|
};
|
||||||
|
|
||||||
tree.set_utxo(&utxo).unwrap();
|
db.set_utxo(&utxo).unwrap();
|
||||||
tree.set_utxo(&utxo).unwrap();
|
db.set_utxo(&utxo).unwrap();
|
||||||
assert_eq!(tree.iter_utxos().unwrap().len(), 1);
|
assert_eq!(db.iter_utxos().unwrap().len(), 1);
|
||||||
assert_eq!(tree.get_utxo(&outpoint).unwrap(), Some(utxo));
|
assert_eq!(db.get_utxo(&outpoint).unwrap(), Some(utxo));
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_raw_tx<D: Database>(mut tree: D) {
|
pub fn test_raw_tx<D: Database>(mut db: D) {
|
||||||
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
let hex_tx = Vec::<u8>::from_hex("02000000000101f58c18a90d7a76b30c7e47d4e817adfdd79a6a589a615ef36e360f913adce2cd0000000000feffffff0210270000000000001600145c9a1816d38db5cbdd4b067b689dc19eb7d930e2cf70aa2b080000001600140f48b63160043047f4f60f7f8f551f80458f693f024730440220413f42b7bc979945489a38f5221e5527d4b8e3aa63eae2099e01945896ad6c10022024ceec492d685c31d8adb64e935a06933877c5ae0e21f32efe029850914c5bad012102361caae96f0e9f3a453d354bb37a5c3244422fb22819bf0166c0647a38de39f21fca2300").unwrap();
|
||||||
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
let mut tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
|
|
||||||
tree.set_raw_tx(&tx).unwrap();
|
db.set_raw_tx(&tx).unwrap();
|
||||||
|
|
||||||
let txid = tx.txid();
|
let txid = tx.txid();
|
||||||
|
|
||||||
assert_eq!(tree.get_raw_tx(&txid).unwrap(), Some(tx));
|
assert_eq!(db.get_raw_tx(&txid).unwrap(), Some(tx.clone()));
|
||||||
|
|
||||||
|
// mutate transaction's witnesses
|
||||||
|
for tx_in in tx.input.iter_mut() {
|
||||||
|
tx_in.witness = Witness::new();
|
||||||
|
}
|
||||||
|
|
||||||
|
let updated_hex_tx = serialize(&tx);
|
||||||
|
|
||||||
|
// verify that mutation was successful
|
||||||
|
assert_ne!(hex_tx, updated_hex_tx);
|
||||||
|
|
||||||
|
db.set_raw_tx(&tx).unwrap();
|
||||||
|
|
||||||
|
let txid = tx.txid();
|
||||||
|
|
||||||
|
assert_eq!(db.get_raw_tx(&txid).unwrap(), Some(tx));
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_tx<D: Database>(mut tree: D) {
|
pub fn test_tx<D: Database>(mut db: D) {
|
||||||
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
||||||
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
let txid = tx.txid();
|
let txid = tx.txid();
|
||||||
@@ -348,28 +365,28 @@ pub mod test {
|
|||||||
}),
|
}),
|
||||||
};
|
};
|
||||||
|
|
||||||
tree.set_tx(&tx_details).unwrap();
|
db.set_tx(&tx_details).unwrap();
|
||||||
|
|
||||||
// get with raw tx too
|
// get with raw tx too
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_tx(&tx_details.txid, true).unwrap(),
|
db.get_tx(&tx_details.txid, true).unwrap(),
|
||||||
Some(tx_details.clone())
|
Some(tx_details.clone())
|
||||||
);
|
);
|
||||||
// get only raw_tx
|
// get only raw_tx
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_raw_tx(&tx_details.txid).unwrap(),
|
db.get_raw_tx(&tx_details.txid).unwrap(),
|
||||||
tx_details.transaction
|
tx_details.transaction
|
||||||
);
|
);
|
||||||
|
|
||||||
// now get without raw_tx
|
// now get without raw_tx
|
||||||
tx_details.transaction = None;
|
tx_details.transaction = None;
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_tx(&tx_details.txid, false).unwrap(),
|
db.get_tx(&tx_details.txid, false).unwrap(),
|
||||||
Some(tx_details)
|
Some(tx_details)
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_list_transaction<D: Database>(mut tree: D) {
|
pub fn test_list_transaction<D: Database>(mut db: D) {
|
||||||
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
||||||
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
let txid = tx.txid();
|
let txid = tx.txid();
|
||||||
@@ -385,46 +402,43 @@ pub mod test {
|
|||||||
}),
|
}),
|
||||||
};
|
};
|
||||||
|
|
||||||
tree.set_tx(&tx_details).unwrap();
|
db.set_tx(&tx_details).unwrap();
|
||||||
|
|
||||||
// get raw tx
|
// get raw tx
|
||||||
assert_eq!(tree.iter_txs(true).unwrap(), vec![tx_details.clone()]);
|
assert_eq!(db.iter_txs(true).unwrap(), vec![tx_details.clone()]);
|
||||||
|
|
||||||
// now get without raw tx
|
// now get without raw tx
|
||||||
tx_details.transaction = None;
|
tx_details.transaction = None;
|
||||||
|
|
||||||
// get not raw tx
|
// get not raw tx
|
||||||
assert_eq!(tree.iter_txs(false).unwrap(), vec![tx_details.clone()]);
|
assert_eq!(db.iter_txs(false).unwrap(), vec![tx_details.clone()]);
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_last_index<D: Database>(mut tree: D) {
|
pub fn test_last_index<D: Database>(mut db: D) {
|
||||||
tree.set_last_index(KeychainKind::External, 1337).unwrap();
|
db.set_last_index(KeychainKind::External, 1337).unwrap();
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_last_index(KeychainKind::External).unwrap(),
|
db.get_last_index(KeychainKind::External).unwrap(),
|
||||||
Some(1337)
|
Some(1337)
|
||||||
);
|
);
|
||||||
assert_eq!(tree.get_last_index(KeychainKind::Internal).unwrap(), None);
|
assert_eq!(db.get_last_index(KeychainKind::Internal).unwrap(), None);
|
||||||
|
|
||||||
let res = tree.increment_last_index(KeychainKind::External).unwrap();
|
let res = db.increment_last_index(KeychainKind::External).unwrap();
|
||||||
assert_eq!(res, 1338);
|
assert_eq!(res, 1338);
|
||||||
let res = tree.increment_last_index(KeychainKind::Internal).unwrap();
|
let res = db.increment_last_index(KeychainKind::Internal).unwrap();
|
||||||
assert_eq!(res, 0);
|
assert_eq!(res, 0);
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tree.get_last_index(KeychainKind::External).unwrap(),
|
db.get_last_index(KeychainKind::External).unwrap(),
|
||||||
Some(1338)
|
Some(1338)
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(db.get_last_index(KeychainKind::Internal).unwrap(), Some(0));
|
||||||
tree.get_last_index(KeychainKind::Internal).unwrap(),
|
|
||||||
Some(0)
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_sync_time<D: Database>(mut tree: D) {
|
pub fn test_sync_time<D: Database>(mut db: D) {
|
||||||
assert!(tree.get_sync_time().unwrap().is_none());
|
assert!(db.get_sync_time().unwrap().is_none());
|
||||||
|
|
||||||
tree.set_sync_time(SyncTime {
|
db.set_sync_time(SyncTime {
|
||||||
block_time: BlockTime {
|
block_time: BlockTime {
|
||||||
height: 100,
|
height: 100,
|
||||||
timestamp: 1000,
|
timestamp: 1000,
|
||||||
@@ -432,13 +446,211 @@ pub mod test {
|
|||||||
})
|
})
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
let extracted = tree.get_sync_time().unwrap();
|
let extracted = db.get_sync_time().unwrap();
|
||||||
assert!(extracted.is_some());
|
assert!(extracted.is_some());
|
||||||
assert_eq!(extracted.as_ref().unwrap().block_time.height, 100);
|
assert_eq!(extracted.as_ref().unwrap().block_time.height, 100);
|
||||||
assert_eq!(extracted.as_ref().unwrap().block_time.timestamp, 1000);
|
assert_eq!(extracted.as_ref().unwrap().block_time.timestamp, 1000);
|
||||||
|
|
||||||
tree.del_sync_time().unwrap();
|
db.del_sync_time().unwrap();
|
||||||
assert!(tree.get_sync_time().unwrap().is_none());
|
assert!(db.get_sync_time().unwrap().is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_iter_raw_txs<D: Database>(mut db: D) {
|
||||||
|
let txs = db.iter_raw_txs().unwrap();
|
||||||
|
assert!(txs.is_empty());
|
||||||
|
|
||||||
|
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
||||||
|
let first_tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
|
|
||||||
|
let hex_tx = Vec::<u8>::from_hex("02000000000101f58c18a90d7a76b30c7e47d4e817adfdd79a6a589a615ef36e360f913adce2cd0000000000feffffff0210270000000000001600145c9a1816d38db5cbdd4b067b689dc19eb7d930e2cf70aa2b080000001600140f48b63160043047f4f60f7f8f551f80458f693f024730440220413f42b7bc979945489a38f5221e5527d4b8e3aa63eae2099e01945896ad6c10022024ceec492d685c31d8adb64e935a06933877c5ae0e21f32efe029850914c5bad012102361caae96f0e9f3a453d354bb37a5c3244422fb22819bf0166c0647a38de39f21fca2300").unwrap();
|
||||||
|
let second_tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
|
|
||||||
|
db.set_raw_tx(&first_tx).unwrap();
|
||||||
|
db.set_raw_tx(&second_tx).unwrap();
|
||||||
|
|
||||||
|
let txs = db.iter_raw_txs().unwrap();
|
||||||
|
|
||||||
|
assert!(txs.contains(&first_tx));
|
||||||
|
assert!(txs.contains(&second_tx));
|
||||||
|
assert_eq!(txs.len(), 2);
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_del_path_from_script_pubkey<D: Database>(mut db: D) {
|
||||||
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
|
let script = ScriptBuf::from(
|
||||||
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
|
);
|
||||||
|
let path = 42;
|
||||||
|
|
||||||
|
let res = db.del_path_from_script_pubkey(&script).unwrap();
|
||||||
|
|
||||||
|
assert!(res.is_none());
|
||||||
|
|
||||||
|
let _res = db.set_script_pubkey(&script, keychain, path);
|
||||||
|
let (chain, child) = db.del_path_from_script_pubkey(&script).unwrap().unwrap();
|
||||||
|
|
||||||
|
assert_eq!(chain, keychain);
|
||||||
|
assert_eq!(child, path);
|
||||||
|
|
||||||
|
let res = db.get_path_from_script_pubkey(&script).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_iter_script_pubkeys<D: Database>(mut db: D) {
|
||||||
|
let keychain = KeychainKind::External;
|
||||||
|
let scripts = db.iter_script_pubkeys(Some(keychain)).unwrap();
|
||||||
|
assert!(scripts.is_empty());
|
||||||
|
|
||||||
|
let first_script = ScriptBuf::from(
|
||||||
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
|
);
|
||||||
|
let path = 42;
|
||||||
|
|
||||||
|
db.set_script_pubkey(&first_script, keychain, path).unwrap();
|
||||||
|
|
||||||
|
let second_script = ScriptBuf::from(
|
||||||
|
Vec::<u8>::from_hex("00145c9a1816d38db5cbdd4b067b689dc19eb7d930e2").unwrap(),
|
||||||
|
);
|
||||||
|
let path = 57;
|
||||||
|
|
||||||
|
db.set_script_pubkey(&second_script, keychain, path)
|
||||||
|
.unwrap();
|
||||||
|
let scripts = db.iter_script_pubkeys(Some(keychain)).unwrap();
|
||||||
|
|
||||||
|
assert!(scripts.contains(&first_script));
|
||||||
|
assert!(scripts.contains(&second_script));
|
||||||
|
assert_eq!(scripts.len(), 2);
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_del_utxo<D: Database>(mut db: D) {
|
||||||
|
let outpoint = OutPoint::from_str(
|
||||||
|
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
let script = ScriptBuf::from(
|
||||||
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
|
);
|
||||||
|
let txout = TxOut {
|
||||||
|
value: 133742,
|
||||||
|
script_pubkey: script,
|
||||||
|
};
|
||||||
|
let utxo = LocalUtxo {
|
||||||
|
txout,
|
||||||
|
outpoint,
|
||||||
|
keychain: KeychainKind::External,
|
||||||
|
is_spent: true,
|
||||||
|
};
|
||||||
|
|
||||||
|
let res = db.del_utxo(&outpoint).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
|
||||||
|
db.set_utxo(&utxo).unwrap();
|
||||||
|
|
||||||
|
let res = db.del_utxo(&outpoint).unwrap();
|
||||||
|
|
||||||
|
assert_eq!(res.unwrap(), utxo);
|
||||||
|
|
||||||
|
let res = db.get_utxo(&outpoint).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_del_raw_tx<D: Database>(mut db: D) {
|
||||||
|
let hex_tx = Vec::<u8>::from_hex("02000000000101f58c18a90d7a76b30c7e47d4e817adfdd79a6a589a615ef36e360f913adce2cd0000000000feffffff0210270000000000001600145c9a1816d38db5cbdd4b067b689dc19eb7d930e2cf70aa2b080000001600140f48b63160043047f4f60f7f8f551f80458f693f024730440220413f42b7bc979945489a38f5221e5527d4b8e3aa63eae2099e01945896ad6c10022024ceec492d685c31d8adb64e935a06933877c5ae0e21f32efe029850914c5bad012102361caae96f0e9f3a453d354bb37a5c3244422fb22819bf0166c0647a38de39f21fca2300").unwrap();
|
||||||
|
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
|
|
||||||
|
let res = db.del_raw_tx(&tx.txid()).unwrap();
|
||||||
|
|
||||||
|
assert!(res.is_none());
|
||||||
|
|
||||||
|
db.set_raw_tx(&tx).unwrap();
|
||||||
|
|
||||||
|
let res = db.del_raw_tx(&tx.txid()).unwrap();
|
||||||
|
|
||||||
|
assert_eq!(res.unwrap(), tx);
|
||||||
|
|
||||||
|
let res = db.get_raw_tx(&tx.txid()).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_del_tx<D: Database>(mut db: D) {
|
||||||
|
let hex_tx = Vec::<u8>::from_hex("0100000001a15d57094aa7a21a28cb20b59aab8fc7d1149a3bdbcddba9c622e4f5f6a99ece010000006c493046022100f93bb0e7d8db7bd46e40132d1f8242026e045f03a0efe71bbb8e3f475e970d790221009337cd7f1f929f00cc6ff01f03729b069a7c21b59b1736ddfee5db5946c5da8c0121033b9b137ee87d5a812d6f506efdd37f0affa7ffc310711c06c7f3e097c9447c52ffffffff0100e1f505000000001976a9140389035a9225b3839e2bbf32d826a1e222031fd888ac00000000").unwrap();
|
||||||
|
let tx: Transaction = deserialize(&hex_tx).unwrap();
|
||||||
|
let txid = tx.txid();
|
||||||
|
let mut tx_details = TransactionDetails {
|
||||||
|
transaction: Some(tx.clone()),
|
||||||
|
txid,
|
||||||
|
received: 1337,
|
||||||
|
sent: 420420,
|
||||||
|
fee: Some(140),
|
||||||
|
confirmation_time: Some(BlockTime {
|
||||||
|
timestamp: 123456,
|
||||||
|
height: 1000,
|
||||||
|
}),
|
||||||
|
};
|
||||||
|
|
||||||
|
let res = db.del_tx(&tx.txid(), true).unwrap();
|
||||||
|
|
||||||
|
assert!(res.is_none());
|
||||||
|
|
||||||
|
db.set_tx(&tx_details).unwrap();
|
||||||
|
|
||||||
|
let res = db.del_tx(&tx.txid(), false).unwrap();
|
||||||
|
tx_details.transaction = None;
|
||||||
|
assert_eq!(res.unwrap(), tx_details);
|
||||||
|
|
||||||
|
let res = db.get_tx(&tx.txid(), true).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
|
||||||
|
let res = db.get_raw_tx(&tx.txid()).unwrap();
|
||||||
|
assert_eq!(res.unwrap(), tx);
|
||||||
|
|
||||||
|
db.set_tx(&tx_details).unwrap();
|
||||||
|
let res = db.del_tx(&tx.txid(), true).unwrap();
|
||||||
|
tx_details.transaction = Some(tx.clone());
|
||||||
|
assert_eq!(res.unwrap(), tx_details);
|
||||||
|
|
||||||
|
let res = db.get_tx(&tx.txid(), true).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
|
||||||
|
let res = db.get_raw_tx(&tx.txid()).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_del_last_index<D: Database>(mut db: D) {
|
||||||
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
|
let _res = db.increment_last_index(keychain);
|
||||||
|
|
||||||
|
let res = db.get_last_index(keychain).unwrap().unwrap();
|
||||||
|
|
||||||
|
assert_eq!(res, 0);
|
||||||
|
|
||||||
|
let _res = db.increment_last_index(keychain);
|
||||||
|
|
||||||
|
let res = db.del_last_index(keychain).unwrap().unwrap();
|
||||||
|
|
||||||
|
assert_eq!(res, 1);
|
||||||
|
|
||||||
|
let res = db.get_last_index(keychain).unwrap();
|
||||||
|
assert!(res.is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn test_check_descriptor_checksum<D: Database>(mut db: D) {
|
||||||
|
// insert checksum associated to keychain
|
||||||
|
let checksum = "1cead456".as_bytes();
|
||||||
|
let keychain = KeychainKind::External;
|
||||||
|
let _res = db.check_descriptor_checksum(keychain, checksum);
|
||||||
|
|
||||||
|
// check if `check_descriptor_checksum` throws
|
||||||
|
// `Error::ChecksumMismatch` error if the
|
||||||
|
// function is passed a checksum that does
|
||||||
|
// not match the one initially inserted
|
||||||
|
let checksum = "1cead454".as_bytes();
|
||||||
|
let keychain = KeychainKind::External;
|
||||||
|
let res = db.check_descriptor_checksum(keychain, checksum);
|
||||||
|
|
||||||
|
assert!(res.is_err());
|
||||||
}
|
}
|
||||||
|
|
||||||
// TODO: more tests...
|
// TODO: more tests...
|
||||||
|
|||||||
@@ -13,7 +13,7 @@ use std::path::PathBuf;
|
|||||||
|
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxOut};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction, TxOut};
|
||||||
|
|
||||||
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
@@ -52,7 +52,22 @@ static MIGRATIONS: &[&str] = &[
|
|||||||
"DELETE FROM transactions;",
|
"DELETE FROM transactions;",
|
||||||
"DELETE FROM utxos;",
|
"DELETE FROM utxos;",
|
||||||
"DROP INDEX idx_txid_vout;",
|
"DROP INDEX idx_txid_vout;",
|
||||||
"CREATE UNIQUE INDEX idx_utxos_txid_vout ON utxos(txid, vout);"
|
"CREATE UNIQUE INDEX idx_utxos_txid_vout ON utxos(txid, vout);",
|
||||||
|
"ALTER TABLE utxos RENAME TO utxos_old;",
|
||||||
|
"CREATE TABLE utxos (value INTEGER, keychain TEXT, vout INTEGER, txid BLOB, script BLOB, is_spent BOOLEAN DEFAULT 0);",
|
||||||
|
"INSERT INTO utxos SELECT value, keychain, vout, txid, script, is_spent FROM utxos_old;",
|
||||||
|
"DROP TABLE utxos_old;",
|
||||||
|
"CREATE UNIQUE INDEX idx_utxos_txid_vout ON utxos(txid, vout);",
|
||||||
|
// Fix issue https://github.com/bitcoindevkit/bdk/issues/801: drop duplicated script_pubkeys
|
||||||
|
"ALTER TABLE script_pubkeys RENAME TO script_pubkeys_old;",
|
||||||
|
"DROP INDEX idx_keychain_child;",
|
||||||
|
"DROP INDEX idx_script;",
|
||||||
|
"CREATE TABLE script_pubkeys (keychain TEXT, child INTEGER, script BLOB);",
|
||||||
|
"CREATE INDEX idx_keychain_child ON script_pubkeys(keychain, child);",
|
||||||
|
"CREATE INDEX idx_script ON script_pubkeys(script);",
|
||||||
|
"CREATE UNIQUE INDEX idx_script_pks_unique ON script_pubkeys(keychain, child);",
|
||||||
|
"INSERT OR REPLACE INTO script_pubkeys SELECT keychain, child, script FROM script_pubkeys_old;",
|
||||||
|
"DROP TABLE script_pubkeys_old;"
|
||||||
];
|
];
|
||||||
|
|
||||||
/// Sqlite database stored on filesystem
|
/// Sqlite database stored on filesystem
|
||||||
@@ -83,7 +98,7 @@ impl SqliteDatabase {
|
|||||||
child: u32,
|
child: u32,
|
||||||
script: &[u8],
|
script: &[u8],
|
||||||
) -> Result<i64, Error> {
|
) -> Result<i64, Error> {
|
||||||
let mut statement = self.connection.prepare_cached("INSERT INTO script_pubkeys (keychain, child, script) VALUES (:keychain, :child, :script)")?;
|
let mut statement = self.connection.prepare_cached("INSERT OR REPLACE INTO script_pubkeys (keychain, child, script) VALUES (:keychain, :child, :script)")?;
|
||||||
statement.execute(named_params! {
|
statement.execute(named_params! {
|
||||||
":keychain": keychain,
|
":keychain": keychain,
|
||||||
":child": child,
|
":child": child,
|
||||||
@@ -147,7 +162,7 @@ impl SqliteDatabase {
|
|||||||
None => (None, None),
|
None => (None, None),
|
||||||
};
|
};
|
||||||
|
|
||||||
let txid: &[u8] = &transaction.txid;
|
let txid: &[u8] = transaction.txid.as_ref();
|
||||||
|
|
||||||
let mut statement = self.connection.prepare_cached("INSERT INTO transaction_details (txid, timestamp, received, sent, fee, height) VALUES (:txid, :timestamp, :received, :sent, :fee, :height)")?;
|
let mut statement = self.connection.prepare_cached("INSERT INTO transaction_details (txid, timestamp, received, sent, fee, height) VALUES (:txid, :timestamp, :received, :sent, :fee, :height)")?;
|
||||||
|
|
||||||
@@ -172,7 +187,7 @@ impl SqliteDatabase {
|
|||||||
None => (None, None),
|
None => (None, None),
|
||||||
};
|
};
|
||||||
|
|
||||||
let txid: &[u8] = &transaction.txid;
|
let txid: &[u8] = transaction.txid.as_ref();
|
||||||
|
|
||||||
let mut statement = self.connection.prepare_cached("UPDATE transaction_details SET timestamp=:timestamp, received=:received, sent=:sent, fee=:fee, height=:height WHERE txid=:txid")?;
|
let mut statement = self.connection.prepare_cached("UPDATE transaction_details SET timestamp=:timestamp, received=:received, sent=:sent, fee=:fee, height=:height WHERE txid=:txid")?;
|
||||||
|
|
||||||
@@ -239,11 +254,11 @@ impl SqliteDatabase {
|
|||||||
Ok(self.connection.last_insert_rowid())
|
Ok(self.connection.last_insert_rowid())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn select_script_pubkeys(&self) -> Result<Vec<Script>, Error> {
|
fn select_script_pubkeys(&self) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let mut statement = self
|
let mut statement = self
|
||||||
.connection
|
.connection
|
||||||
.prepare_cached("SELECT script FROM script_pubkeys")?;
|
.prepare_cached("SELECT script FROM script_pubkeys")?;
|
||||||
let mut scripts: Vec<Script> = vec![];
|
let mut scripts: Vec<ScriptBuf> = vec![];
|
||||||
let mut rows = statement.query([])?;
|
let mut rows = statement.query([])?;
|
||||||
while let Some(row) = rows.next()? {
|
while let Some(row) = rows.next()? {
|
||||||
let raw_script: Vec<u8> = row.get(0)?;
|
let raw_script: Vec<u8> = row.get(0)?;
|
||||||
@@ -253,11 +268,11 @@ impl SqliteDatabase {
|
|||||||
Ok(scripts)
|
Ok(scripts)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn select_script_pubkeys_by_keychain(&self, keychain: String) -> Result<Vec<Script>, Error> {
|
fn select_script_pubkeys_by_keychain(&self, keychain: String) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let mut statement = self
|
let mut statement = self
|
||||||
.connection
|
.connection
|
||||||
.prepare_cached("SELECT script FROM script_pubkeys WHERE keychain=:keychain")?;
|
.prepare_cached("SELECT script FROM script_pubkeys WHERE keychain=:keychain")?;
|
||||||
let mut scripts: Vec<Script> = vec![];
|
let mut scripts: Vec<ScriptBuf> = vec![];
|
||||||
let mut rows = statement.query(named_params! {":keychain": keychain})?;
|
let mut rows = statement.query(named_params! {":keychain": keychain})?;
|
||||||
while let Some(row) = rows.next()? {
|
while let Some(row) = rows.next()? {
|
||||||
let raw_script: Vec<u8> = row.get(0)?;
|
let raw_script: Vec<u8> = row.get(0)?;
|
||||||
@@ -271,7 +286,7 @@ impl SqliteDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: String,
|
keychain: String,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let mut statement = self.connection.prepare_cached(
|
let mut statement = self.connection.prepare_cached(
|
||||||
"SELECT script FROM script_pubkeys WHERE keychain=:keychain AND child=:child",
|
"SELECT script FROM script_pubkeys WHERE keychain=:keychain AND child=:child",
|
||||||
)?;
|
)?;
|
||||||
@@ -280,7 +295,7 @@ impl SqliteDatabase {
|
|||||||
match rows.next()? {
|
match rows.next()? {
|
||||||
Some(row) => {
|
Some(row) => {
|
||||||
let script: Vec<u8> = row.get(0)?;
|
let script: Vec<u8> = row.get(0)?;
|
||||||
let script: Script = script.into();
|
let script: ScriptBuf = script.into();
|
||||||
Ok(Some(script))
|
Ok(Some(script))
|
||||||
}
|
}
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
@@ -347,7 +362,7 @@ impl SqliteDatabase {
|
|||||||
let keychain: String = row.get(1)?;
|
let keychain: String = row.get(1)?;
|
||||||
let keychain: KeychainKind = serde_json::from_str(&keychain)?;
|
let keychain: KeychainKind = serde_json::from_str(&keychain)?;
|
||||||
let script: Vec<u8> = row.get(2)?;
|
let script: Vec<u8> = row.get(2)?;
|
||||||
let script_pubkey: Script = script.into();
|
let script_pubkey: ScriptBuf = script.into();
|
||||||
let is_spent: bool = row.get(3)?;
|
let is_spent: bool = row.get(3)?;
|
||||||
|
|
||||||
Ok(Some(LocalUtxo {
|
Ok(Some(LocalUtxo {
|
||||||
@@ -643,7 +658,7 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
utxo.txout.value,
|
utxo.txout.value,
|
||||||
serde_json::to_string(&utxo.keychain)?,
|
serde_json::to_string(&utxo.keychain)?,
|
||||||
utxo.outpoint.vout,
|
utxo.outpoint.vout,
|
||||||
&utxo.outpoint.txid,
|
utxo.outpoint.txid.as_ref(),
|
||||||
utxo.txout.script_pubkey.as_bytes(),
|
utxo.txout.script_pubkey.as_bytes(),
|
||||||
utxo.is_spent,
|
utxo.is_spent,
|
||||||
)?;
|
)?;
|
||||||
@@ -651,19 +666,19 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn set_raw_tx(&mut self, transaction: &Transaction) -> Result<(), Error> {
|
fn set_raw_tx(&mut self, transaction: &Transaction) -> Result<(), Error> {
|
||||||
match self.select_transaction_by_txid(&transaction.txid())? {
|
match self.select_transaction_by_txid(transaction.txid().as_ref())? {
|
||||||
Some(_) => {
|
Some(_) => {
|
||||||
self.update_transaction(&transaction.txid(), &serialize(transaction))?;
|
self.update_transaction(transaction.txid().as_ref(), &serialize(transaction))?;
|
||||||
}
|
}
|
||||||
None => {
|
None => {
|
||||||
self.insert_transaction(&transaction.txid(), &serialize(transaction))?;
|
self.insert_transaction(transaction.txid().as_ref(), &serialize(transaction))?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn set_tx(&mut self, transaction: &TransactionDetails) -> Result<(), Error> {
|
fn set_tx(&mut self, transaction: &TransactionDetails) -> Result<(), Error> {
|
||||||
match self.select_transaction_details_by_txid(&transaction.txid)? {
|
match self.select_transaction_details_by_txid(transaction.txid.as_ref())? {
|
||||||
Some(_) => {
|
Some(_) => {
|
||||||
self.update_transaction_details(transaction)?;
|
self.update_transaction_details(transaction)?;
|
||||||
}
|
}
|
||||||
@@ -693,7 +708,7 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let keychain = serde_json::to_string(&keychain)?;
|
let keychain = serde_json::to_string(&keychain)?;
|
||||||
let script = self.select_script_pubkey_by_path(keychain.clone(), child)?;
|
let script = self.select_script_pubkey_by_path(keychain.clone(), child)?;
|
||||||
match script {
|
match script {
|
||||||
@@ -719,9 +734,9 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn del_utxo(&mut self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
fn del_utxo(&mut self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
||||||
match self.select_utxo_by_outpoint(&outpoint.txid, outpoint.vout)? {
|
match self.select_utxo_by_outpoint(outpoint.txid.as_ref(), outpoint.vout)? {
|
||||||
Some(local_utxo) => {
|
Some(local_utxo) => {
|
||||||
self.delete_utxo_by_outpoint(&outpoint.txid, outpoint.vout)?;
|
self.delete_utxo_by_outpoint(outpoint.txid.as_ref(), outpoint.vout)?;
|
||||||
Ok(Some(local_utxo))
|
Ok(Some(local_utxo))
|
||||||
}
|
}
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
@@ -729,9 +744,9 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn del_raw_tx(&mut self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
fn del_raw_tx(&mut self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||||
match self.select_transaction_by_txid(txid)? {
|
match self.select_transaction_by_txid(txid.as_ref())? {
|
||||||
Some(tx) => {
|
Some(tx) => {
|
||||||
self.delete_transaction_by_txid(txid)?;
|
self.delete_transaction_by_txid(txid.as_ref())?;
|
||||||
Ok(Some(tx))
|
Ok(Some(tx))
|
||||||
}
|
}
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
@@ -743,12 +758,14 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
txid: &Txid,
|
txid: &Txid,
|
||||||
include_raw: bool,
|
include_raw: bool,
|
||||||
) -> Result<Option<TransactionDetails>, Error> {
|
) -> Result<Option<TransactionDetails>, Error> {
|
||||||
match self.select_transaction_details_by_txid(txid)? {
|
match self.select_transaction_details_by_txid(txid.as_ref())? {
|
||||||
Some(transaction_details) => {
|
Some(mut transaction_details) => {
|
||||||
self.delete_transaction_details_by_txid(txid)?;
|
self.delete_transaction_details_by_txid(txid.as_ref())?;
|
||||||
|
|
||||||
if include_raw {
|
if include_raw {
|
||||||
self.delete_transaction_by_txid(txid)?;
|
self.delete_transaction_by_txid(txid.as_ref())?;
|
||||||
|
} else {
|
||||||
|
transaction_details.transaction = None;
|
||||||
}
|
}
|
||||||
Ok(Some(transaction_details))
|
Ok(Some(transaction_details))
|
||||||
}
|
}
|
||||||
@@ -803,7 +820,7 @@ impl Database for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
match keychain {
|
match keychain {
|
||||||
Some(keychain) => {
|
Some(keychain) => {
|
||||||
let keychain = serde_json::to_string(&keychain)?;
|
let keychain = serde_json::to_string(&keychain)?;
|
||||||
@@ -832,7 +849,7 @@ impl Database for SqliteDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let keychain = serde_json::to_string(&keychain)?;
|
let keychain = serde_json::to_string(&keychain)?;
|
||||||
match self.select_script_pubkey_by_path(keychain, child)? {
|
match self.select_script_pubkey_by_path(keychain, child)? {
|
||||||
Some(script) => Ok(Some(script)),
|
Some(script) => Ok(Some(script)),
|
||||||
@@ -851,18 +868,18 @@ impl Database for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn get_utxo(&self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
fn get_utxo(&self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
||||||
self.select_utxo_by_outpoint(&outpoint.txid, outpoint.vout)
|
self.select_utxo_by_outpoint(outpoint.txid.as_ref(), outpoint.vout)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_raw_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
fn get_raw_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||||
match self.select_transaction_by_txid(txid)? {
|
match self.select_transaction_by_txid(txid.as_ref())? {
|
||||||
Some(tx) => Ok(Some(tx)),
|
Some(tx) => Ok(Some(tx)),
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_tx(&self, txid: &Txid, include_raw: bool) -> Result<Option<TransactionDetails>, Error> {
|
fn get_tx(&self, txid: &Txid, include_raw: bool) -> Result<Option<TransactionDetails>, Error> {
|
||||||
match self.select_transaction_details_by_txid(txid)? {
|
match self.select_transaction_details_by_txid(txid.as_ref())? {
|
||||||
Some(mut transaction_details) => {
|
Some(mut transaction_details) => {
|
||||||
if !include_raw {
|
if !include_raw {
|
||||||
transaction_details.transaction = None;
|
transaction_details.transaction = None;
|
||||||
@@ -914,8 +931,8 @@ impl BatchDatabase for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub fn get_connection<T: AsRef<Path>>(path: &T) -> Result<Connection, Error> {
|
pub fn get_connection<T: AsRef<Path>>(path: &T) -> Result<Connection, Error> {
|
||||||
let connection = Connection::open(path)?;
|
let mut connection = Connection::open(path)?;
|
||||||
migrate(&connection)?;
|
migrate(&mut connection)?;
|
||||||
Ok(connection)
|
Ok(connection)
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -950,28 +967,41 @@ pub fn set_schema_version(conn: &Connection, version: i32) -> rusqlite::Result<u
|
|||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn migrate(conn: &Connection) -> rusqlite::Result<()> {
|
pub fn migrate(conn: &mut Connection) -> Result<(), Error> {
|
||||||
let version = get_schema_version(conn)?;
|
let version = get_schema_version(conn)?;
|
||||||
let stmts = &MIGRATIONS[(version as usize)..];
|
let stmts = &MIGRATIONS[(version as usize)..];
|
||||||
let mut i: i32 = version;
|
|
||||||
|
|
||||||
if version == MIGRATIONS.len() as i32 {
|
// begin transaction, all migration statements and new schema version commit or rollback
|
||||||
|
let tx = conn.transaction()?;
|
||||||
|
|
||||||
|
// execute every statement and return `Some` new schema version
|
||||||
|
// if execution fails, return `Error::Rusqlite`
|
||||||
|
// if no statements executed returns `None`
|
||||||
|
let new_version = stmts
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|version_stmt| {
|
||||||
|
log::info!(
|
||||||
|
"executing db migration {}: `{}`",
|
||||||
|
version + version_stmt.0 as i32 + 1,
|
||||||
|
version_stmt.1
|
||||||
|
);
|
||||||
|
tx.execute(version_stmt.1, [])
|
||||||
|
// map result value to next migration version
|
||||||
|
.map(|_| version_stmt.0 as i32 + version + 1)
|
||||||
|
})
|
||||||
|
.last()
|
||||||
|
.transpose()?;
|
||||||
|
|
||||||
|
// if `Some` new statement version, set new schema version
|
||||||
|
if let Some(version) = new_version {
|
||||||
|
set_schema_version(&tx, version)?;
|
||||||
|
} else {
|
||||||
log::info!("db up to date, no migration needed");
|
log::info!("db up to date, no migration needed");
|
||||||
return Ok(());
|
|
||||||
}
|
}
|
||||||
|
|
||||||
for stmt in stmts {
|
// commit transaction
|
||||||
let res = conn.execute(stmt, []);
|
tx.commit()?;
|
||||||
if res.is_err() {
|
|
||||||
println!("migration failed on:\n{}\n{:?}", stmt, res);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
|
|
||||||
i += 1;
|
|
||||||
}
|
|
||||||
|
|
||||||
set_schema_version(conn, i)?;
|
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1036,4 +1066,82 @@ pub mod test {
|
|||||||
fn test_txs() {
|
fn test_txs() {
|
||||||
crate::database::test::test_list_transaction(get_database());
|
crate::database::test::test_list_transaction(get_database());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_iter_raw_txs() {
|
||||||
|
crate::database::test::test_iter_raw_txs(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_path_from_script_pubkey() {
|
||||||
|
crate::database::test::test_del_path_from_script_pubkey(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_iter_script_pubkeys() {
|
||||||
|
crate::database::test::test_iter_script_pubkeys(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_utxo() {
|
||||||
|
crate::database::test::test_del_utxo(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_raw_tx() {
|
||||||
|
crate::database::test::test_del_raw_tx(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_tx() {
|
||||||
|
crate::database::test::test_del_tx(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_del_last_index() {
|
||||||
|
crate::database::test::test_del_last_index(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_check_descriptor_checksum() {
|
||||||
|
crate::database::test::test_check_descriptor_checksum(get_database());
|
||||||
|
}
|
||||||
|
|
||||||
|
// Issue 801: https://github.com/bitcoindevkit/bdk/issues/801
|
||||||
|
#[test]
|
||||||
|
fn test_unique_spks() {
|
||||||
|
use crate::bitcoin::hashes::hex::FromHex;
|
||||||
|
use crate::database::*;
|
||||||
|
|
||||||
|
let mut db = get_database();
|
||||||
|
|
||||||
|
let script = ScriptBuf::from(
|
||||||
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
|
);
|
||||||
|
let path = 42;
|
||||||
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
|
for _ in 0..100 {
|
||||||
|
db.set_script_pubkey(&script, keychain, path).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut statement = db
|
||||||
|
.connection
|
||||||
|
.prepare_cached(
|
||||||
|
"select keychain,child,count(child) from script_pubkeys group by keychain,child;",
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
let mut rows = statement.query([]).unwrap();
|
||||||
|
while let Some(row) = rows.next().unwrap() {
|
||||||
|
let keychain: String = row.get(0).unwrap();
|
||||||
|
let child: u32 = row.get(1).unwrap();
|
||||||
|
let count: usize = row.get(2).unwrap();
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
count, 1,
|
||||||
|
"keychain={}, child={}, count={}",
|
||||||
|
keychain, child, count
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -41,12 +41,24 @@ fn poly_mod(mut c: u64, val: u64) -> u64 {
|
|||||||
c
|
c
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Computes the checksum bytes of a descriptor
|
/// Computes the checksum bytes of a descriptor.
|
||||||
pub fn get_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
/// `exclude_hash = true` ignores all data after the first '#' (inclusive).
|
||||||
|
pub(crate) fn calc_checksum_bytes_internal(
|
||||||
|
mut desc: &str,
|
||||||
|
exclude_hash: bool,
|
||||||
|
) -> Result<[u8; 8], DescriptorError> {
|
||||||
let mut c = 1;
|
let mut c = 1;
|
||||||
let mut cls = 0;
|
let mut cls = 0;
|
||||||
let mut clscount = 0;
|
let mut clscount = 0;
|
||||||
|
|
||||||
|
let mut original_checksum = None;
|
||||||
|
if exclude_hash {
|
||||||
|
if let Some(split) = desc.split_once('#') {
|
||||||
|
desc = split.0;
|
||||||
|
original_checksum = Some(split.1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
for ch in desc.as_bytes() {
|
for ch in desc.as_bytes() {
|
||||||
let pos = INPUT_CHARSET
|
let pos = INPUT_CHARSET
|
||||||
.iter()
|
.iter()
|
||||||
@@ -72,38 +84,98 @@ pub fn get_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
|||||||
checksum[j] = CHECKSUM_CHARSET[((c >> (5 * (7 - j))) & 31) as usize];
|
checksum[j] = CHECKSUM_CHARSET[((c >> (5 * (7 - j))) & 31) as usize];
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// if input data already had a checksum, check calculated checksum against original checksum
|
||||||
|
if let Some(original_checksum) = original_checksum {
|
||||||
|
if original_checksum.as_bytes() != checksum {
|
||||||
|
return Err(DescriptorError::InvalidDescriptorChecksum);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
Ok(checksum)
|
Ok(checksum)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Compute the checksum bytes of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
||||||
|
pub fn calc_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
||||||
|
calc_checksum_bytes_internal(desc, true)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Compute the checksum of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
||||||
|
pub fn calc_checksum(desc: &str) -> Result<String, DescriptorError> {
|
||||||
|
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
||||||
|
calc_checksum_bytes_internal(desc, true)
|
||||||
|
.map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
||||||
|
}
|
||||||
|
|
||||||
|
// TODO in release 0.25.0, remove get_checksum_bytes and get_checksum
|
||||||
|
// TODO in release 0.25.0, consolidate calc_checksum_bytes_internal into calc_checksum_bytes
|
||||||
|
|
||||||
|
/// Compute the checksum bytes of a descriptor
|
||||||
|
#[deprecated(
|
||||||
|
since = "0.24.0",
|
||||||
|
note = "Use new `calc_checksum_bytes` function which excludes any existing checksum in the descriptor string before calculating the checksum hash bytes. See https://github.com/bitcoindevkit/bdk/pull/765."
|
||||||
|
)]
|
||||||
|
pub fn get_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
||||||
|
calc_checksum_bytes_internal(desc, false)
|
||||||
|
}
|
||||||
|
|
||||||
/// Compute the checksum of a descriptor
|
/// Compute the checksum of a descriptor
|
||||||
|
#[deprecated(
|
||||||
|
since = "0.24.0",
|
||||||
|
note = "Use new `calc_checksum` function which excludes any existing checksum in the descriptor string before calculating the checksum hash. See https://github.com/bitcoindevkit/bdk/pull/765."
|
||||||
|
)]
|
||||||
pub fn get_checksum(desc: &str) -> Result<String, DescriptorError> {
|
pub fn get_checksum(desc: &str) -> Result<String, DescriptorError> {
|
||||||
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
||||||
get_checksum_bytes(desc).map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
calc_checksum_bytes_internal(desc, false)
|
||||||
|
.map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::descriptor::get_checksum;
|
use crate::descriptor::calc_checksum;
|
||||||
|
use assert_matches::assert_matches;
|
||||||
|
|
||||||
// test get_checksum() function; it should return the same value as Bitcoin Core
|
// test calc_checksum() function; it should return the same value as Bitcoin Core
|
||||||
#[test]
|
#[test]
|
||||||
fn test_get_checksum() {
|
fn test_calc_checksum() {
|
||||||
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)";
|
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)";
|
||||||
assert_eq!(get_checksum(desc).unwrap(), "tqz0nc62");
|
assert_eq!(calc_checksum(desc).unwrap(), "tqz0nc62");
|
||||||
|
|
||||||
let desc = "pkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/44'/1'/0'/0/*)";
|
let desc = "pkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/44'/1'/0'/0/*)";
|
||||||
assert_eq!(get_checksum(desc).unwrap(), "lasegmfs");
|
assert_eq!(calc_checksum(desc).unwrap(), "lasegmfs");
|
||||||
|
}
|
||||||
|
|
||||||
|
// test calc_checksum() function; it should return the same value as Bitcoin Core even if the
|
||||||
|
// descriptor string includes a checksum hash
|
||||||
|
#[test]
|
||||||
|
fn test_calc_checksum_with_checksum_hash() {
|
||||||
|
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)#tqz0nc62";
|
||||||
|
assert_eq!(calc_checksum(desc).unwrap(), "tqz0nc62");
|
||||||
|
|
||||||
|
let desc = "pkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/44'/1'/0'/0/*)#lasegmfs";
|
||||||
|
assert_eq!(calc_checksum(desc).unwrap(), "lasegmfs");
|
||||||
|
|
||||||
|
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)#tqz0nc26";
|
||||||
|
assert_matches!(
|
||||||
|
calc_checksum(desc),
|
||||||
|
Err(DescriptorError::InvalidDescriptorChecksum)
|
||||||
|
);
|
||||||
|
|
||||||
|
let desc = "pkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/44'/1'/0'/0/*)#lasegmsf";
|
||||||
|
assert_matches!(
|
||||||
|
calc_checksum(desc),
|
||||||
|
Err(DescriptorError::InvalidDescriptorChecksum)
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_get_checksum_invalid_character() {
|
fn test_calc_checksum_invalid_character() {
|
||||||
let sparkle_heart = unsafe { std::str::from_utf8_unchecked(&[240, 159, 146, 150]) };
|
let sparkle_heart = unsafe { std::str::from_utf8_unchecked(&[240, 159, 146, 150]) };
|
||||||
let invalid_desc = format!("wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcL{}fjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)", sparkle_heart);
|
let invalid_desc = format!("wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcL{}fjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)", sparkle_heart);
|
||||||
|
|
||||||
assert!(matches!(
|
assert_matches!(
|
||||||
get_checksum(&invalid_desc).err(),
|
calc_checksum(&invalid_desc),
|
||||||
Some(DescriptorError::InvalidDescriptorCharacter(invalid_char)) if invalid_char == sparkle_heart.as_bytes()[0]
|
Err(DescriptorError::InvalidDescriptorCharacter(invalid_char)) if invalid_char == sparkle_heart.as_bytes()[0]
|
||||||
));
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,210 +0,0 @@
|
|||||||
// Bitcoin Dev Kit
|
|
||||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
|
||||||
//
|
|
||||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
|
||||||
//
|
|
||||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
|
||||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
|
||||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
|
||||||
// You may not use this file except in accordance with one or both of these
|
|
||||||
// licenses.
|
|
||||||
|
|
||||||
//! Derived descriptor keys
|
|
||||||
//!
|
|
||||||
//! The [`DerivedDescriptorKey`] type is a wrapper over the standard [`DescriptorPublicKey`] which
|
|
||||||
//! guarantees that all the extended keys have a fixed derivation path, i.e. all the wildcards have
|
|
||||||
//! been replaced by actual derivation indexes.
|
|
||||||
//!
|
|
||||||
//! The [`AsDerived`] trait provides a quick way to derive descriptors to obtain a
|
|
||||||
//! `Descriptor<DerivedDescriptorKey>` type. This, in turn, can be used to derive public
|
|
||||||
//! keys for arbitrary derivation indexes.
|
|
||||||
//!
|
|
||||||
//! Combining this with [`Wallet::get_signers`], secret keys can also be derived.
|
|
||||||
//!
|
|
||||||
//! # Example
|
|
||||||
//!
|
|
||||||
//! ```
|
|
||||||
//! # use std::str::FromStr;
|
|
||||||
//! # use bitcoin::secp256k1::Secp256k1;
|
|
||||||
//! use bdk::descriptor::{AsDerived, DescriptorPublicKey};
|
|
||||||
//! use bdk::miniscript::{ToPublicKey, TranslatePk, MiniscriptKey};
|
|
||||||
//!
|
|
||||||
//! let secp = Secp256k1::gen_new();
|
|
||||||
//!
|
|
||||||
//! let key = DescriptorPublicKey::from_str("[aa600a45/84'/0'/0']tpubDCbDXFKoLTQp44wQuC12JgSn5g9CWGjZdpBHeTqyypZ4VvgYjTJmK9CkyR5bFvG9f4PutvwmvpYCLkFx2rpx25hiMs4sUgxJveW8ZzSAVAc/0/*")?;
|
|
||||||
//! let (descriptor, _, _) = bdk::descriptor!(wpkh(key))?;
|
|
||||||
//!
|
|
||||||
//! // derived: wpkh([aa600a45/84'/0'/0']tpubDCbDXFKoLTQp44wQuC12JgSn5g9CWGjZdpBHeTqyypZ4VvgYjTJmK9CkyR5bFvG9f4PutvwmvpYCLkFx2rpx25hiMs4sUgxJveW8ZzSAVAc/0/42)#3ladd0t2
|
|
||||||
//! let derived = descriptor.as_derived(42, &secp);
|
|
||||||
//! println!("derived: {}", derived);
|
|
||||||
//!
|
|
||||||
//! // with_pks: wpkh(02373ecb54c5e83bd7e0d40adf78b65efaf12fafb13571f0261fc90364eee22e1e)#p4jjgvll
|
|
||||||
//! let with_pks = derived.translate_pk_infallible(|pk| pk.to_public_key(), |pkh| pkh.to_public_key().to_pubkeyhash());
|
|
||||||
//! println!("with_pks: {}", with_pks);
|
|
||||||
//! # Ok::<(), Box<dyn std::error::Error>>(())
|
|
||||||
//! ```
|
|
||||||
//!
|
|
||||||
//! [`Wallet::get_signers`]: crate::wallet::Wallet::get_signers
|
|
||||||
|
|
||||||
use std::cmp::Ordering;
|
|
||||||
use std::fmt;
|
|
||||||
use std::hash::{Hash, Hasher};
|
|
||||||
use std::ops::Deref;
|
|
||||||
|
|
||||||
use bitcoin::hashes::hash160;
|
|
||||||
use bitcoin::{PublicKey, XOnlyPublicKey};
|
|
||||||
|
|
||||||
use miniscript::descriptor::{DescriptorSinglePub, SinglePubKey, Wildcard};
|
|
||||||
use miniscript::{Descriptor, DescriptorPublicKey, MiniscriptKey, ToPublicKey, TranslatePk};
|
|
||||||
|
|
||||||
use crate::wallet::utils::SecpCtx;
|
|
||||||
|
|
||||||
/// Extended [`DescriptorPublicKey`] that has been derived
|
|
||||||
///
|
|
||||||
/// Derived keys are guaranteed to never contain wildcards of any kind
|
|
||||||
#[derive(Debug, Clone)]
|
|
||||||
pub struct DerivedDescriptorKey<'s>(DescriptorPublicKey, &'s SecpCtx);
|
|
||||||
|
|
||||||
impl<'s> DerivedDescriptorKey<'s> {
|
|
||||||
/// Construct a new derived key
|
|
||||||
///
|
|
||||||
/// Panics if the key is wildcard
|
|
||||||
pub fn new(key: DescriptorPublicKey, secp: &'s SecpCtx) -> DerivedDescriptorKey<'s> {
|
|
||||||
if let DescriptorPublicKey::XPub(xpub) = &key {
|
|
||||||
assert!(xpub.wildcard == Wildcard::None)
|
|
||||||
}
|
|
||||||
|
|
||||||
DerivedDescriptorKey(key, secp)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> Deref for DerivedDescriptorKey<'s> {
|
|
||||||
type Target = DescriptorPublicKey;
|
|
||||||
|
|
||||||
fn deref(&self) -> &Self::Target {
|
|
||||||
&self.0
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> PartialEq for DerivedDescriptorKey<'s> {
|
|
||||||
fn eq(&self, other: &Self) -> bool {
|
|
||||||
self.0 == other.0
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> Eq for DerivedDescriptorKey<'s> {}
|
|
||||||
|
|
||||||
impl<'s> PartialOrd for DerivedDescriptorKey<'s> {
|
|
||||||
fn partial_cmp(&self, other: &Self) -> Option<Ordering> {
|
|
||||||
self.0.partial_cmp(&other.0)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> Ord for DerivedDescriptorKey<'s> {
|
|
||||||
fn cmp(&self, other: &Self) -> Ordering {
|
|
||||||
self.0.cmp(&other.0)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> fmt::Display for DerivedDescriptorKey<'s> {
|
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
||||||
self.0.fmt(f)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> Hash for DerivedDescriptorKey<'s> {
|
|
||||||
fn hash<H: Hasher>(&self, state: &mut H) {
|
|
||||||
self.0.hash(state);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> MiniscriptKey for DerivedDescriptorKey<'s> {
|
|
||||||
type Hash = Self;
|
|
||||||
|
|
||||||
fn to_pubkeyhash(&self) -> Self::Hash {
|
|
||||||
DerivedDescriptorKey(self.0.to_pubkeyhash(), self.1)
|
|
||||||
}
|
|
||||||
|
|
||||||
fn is_uncompressed(&self) -> bool {
|
|
||||||
self.0.is_uncompressed()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> ToPublicKey for DerivedDescriptorKey<'s> {
|
|
||||||
fn to_public_key(&self) -> PublicKey {
|
|
||||||
match &self.0 {
|
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
|
||||||
key: SinglePubKey::XOnly(_),
|
|
||||||
..
|
|
||||||
}) => panic!("Found x-only public key in non-tr descriptor"),
|
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
|
||||||
key: SinglePubKey::FullKey(ref pk),
|
|
||||||
..
|
|
||||||
}) => *pk,
|
|
||||||
DescriptorPublicKey::XPub(ref xpub) => PublicKey::new(
|
|
||||||
xpub.xkey
|
|
||||||
.derive_pub(self.1, &xpub.derivation_path)
|
|
||||||
.expect("Shouldn't fail, only normal derivations")
|
|
||||||
.public_key,
|
|
||||||
),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn to_x_only_pubkey(&self) -> XOnlyPublicKey {
|
|
||||||
match &self.0 {
|
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
|
||||||
key: SinglePubKey::XOnly(ref pk),
|
|
||||||
..
|
|
||||||
}) => *pk,
|
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
|
||||||
key: SinglePubKey::FullKey(ref pk),
|
|
||||||
..
|
|
||||||
}) => XOnlyPublicKey::from(pk.inner),
|
|
||||||
DescriptorPublicKey::XPub(ref xpub) => XOnlyPublicKey::from(
|
|
||||||
xpub.xkey
|
|
||||||
.derive_pub(self.1, &xpub.derivation_path)
|
|
||||||
.expect("Shouldn't fail, only normal derivations")
|
|
||||||
.public_key,
|
|
||||||
),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn hash_to_hash160(hash: &Self::Hash) -> hash160::Hash {
|
|
||||||
hash.to_public_key().to_pubkeyhash()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Utilities to derive descriptors
|
|
||||||
///
|
|
||||||
/// Check out the [module level] documentation for more.
|
|
||||||
///
|
|
||||||
/// [module level]: crate::descriptor::derived
|
|
||||||
pub trait AsDerived {
|
|
||||||
/// Derive a descriptor and transform all of its keys to `DerivedDescriptorKey`
|
|
||||||
fn as_derived<'s>(&self, index: u32, secp: &'s SecpCtx)
|
|
||||||
-> Descriptor<DerivedDescriptorKey<'s>>;
|
|
||||||
|
|
||||||
/// Transform the keys into `DerivedDescriptorKey`.
|
|
||||||
///
|
|
||||||
/// Panics if the descriptor is not "fixed", i.e. if it's derivable
|
|
||||||
fn as_derived_fixed<'s>(&self, secp: &'s SecpCtx) -> Descriptor<DerivedDescriptorKey<'s>>;
|
|
||||||
}
|
|
||||||
|
|
||||||
impl AsDerived for Descriptor<DescriptorPublicKey> {
|
|
||||||
fn as_derived<'s>(
|
|
||||||
&self,
|
|
||||||
index: u32,
|
|
||||||
secp: &'s SecpCtx,
|
|
||||||
) -> Descriptor<DerivedDescriptorKey<'s>> {
|
|
||||||
self.derive(index).translate_pk_infallible(
|
|
||||||
|key| DerivedDescriptorKey::new(key.clone(), secp),
|
|
||||||
|key| DerivedDescriptorKey::new(key.clone(), secp),
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
fn as_derived_fixed<'s>(&self, secp: &'s SecpCtx) -> Descriptor<DerivedDescriptorKey<'s>> {
|
|
||||||
assert!(!self.is_deriveable());
|
|
||||||
|
|
||||||
self.as_derived(0, secp)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -514,13 +514,14 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
||||||
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
||||||
});
|
});
|
||||||
( wpkh ( $key:expr ) ) => ({
|
( wpkh ( $key:expr ) ) => ({
|
||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
||||||
});
|
});
|
||||||
( sh ( wpkh ( $key:expr ) ) ) => ({
|
( sh ( wpkh ( $key:expr ) ) ) => ({
|
||||||
@@ -530,7 +531,7 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
||||||
});
|
});
|
||||||
( sh ( $( $minisc:tt )* ) ) => ({
|
( sh ( $( $minisc:tt )* ) ) => ({
|
||||||
@@ -700,10 +701,10 @@ macro_rules! fragment {
|
|||||||
$crate::keys::make_pkh($key, &secp)
|
$crate::keys::make_pkh($key, &secp)
|
||||||
});
|
});
|
||||||
( after ( $value:expr ) ) => ({
|
( after ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(After, $value)
|
$crate::impl_leaf_opcode_value!(After, $crate::miniscript::AbsLockTime::from_consensus($value))
|
||||||
});
|
});
|
||||||
( older ( $value:expr ) ) => ({
|
( older ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(Older, $value)
|
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
||||||
});
|
});
|
||||||
( sha256 ( $hash:expr ) ) => ({
|
( sha256 ( $hash:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(Sha256, $hash)
|
$crate::impl_leaf_opcode_value!(Sha256, $hash)
|
||||||
@@ -793,21 +794,18 @@ macro_rules! fragment {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use bitcoin::hashes::hex::ToHex;
|
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, DescriptorTrait, KeyMap};
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::{Descriptor, Legacy, Segwitv0};
|
use miniscript::{Descriptor, Legacy, Segwitv0};
|
||||||
|
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::PrivateKey;
|
use bitcoin::PrivateKey;
|
||||||
|
|
||||||
use crate::descriptor::derived::AsDerived;
|
|
||||||
|
|
||||||
// test the descriptor!() macro
|
// test the descriptor!() macro
|
||||||
|
|
||||||
// verify descriptor generates expected script(s) (if bare or pk) or address(es)
|
// verify descriptor generates expected script(s) (if bare or pk) or address(es)
|
||||||
@@ -817,24 +815,19 @@ mod test {
|
|||||||
is_fixed: bool,
|
is_fixed: bool,
|
||||||
expected: &[&str],
|
expected: &[&str],
|
||||||
) {
|
) {
|
||||||
let secp = Secp256k1::new();
|
|
||||||
|
|
||||||
let (desc, _key_map, _networks) = desc.unwrap();
|
let (desc, _key_map, _networks) = desc.unwrap();
|
||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
assert_eq!(!desc.is_deriveable(), is_fixed);
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let child_desc = desc
|
||||||
let child_desc = if !desc.is_deriveable() {
|
.at_derivation_index(i as u32)
|
||||||
desc.as_derived_fixed(&secp)
|
.expect("i is not hardened");
|
||||||
} else {
|
|
||||||
desc.as_derived(index, &secp)
|
|
||||||
};
|
|
||||||
let address = child_desc.address(Regtest);
|
let address = child_desc.address(Regtest);
|
||||||
if let Ok(address) = address {
|
if let Ok(address) = address {
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
} else {
|
} else {
|
||||||
let script = child_desc.script_pubkey();
|
let script = child_desc.script_pubkey();
|
||||||
assert_eq!(script.to_hex().as_str(), *expected.get(i).unwrap());
|
assert_eq!(script.to_hex_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1179,9 +1172,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
#[should_panic(
|
#[should_panic(expected = "Miniscript(ContextError(UncompressedKeysNotAllowed))")]
|
||||||
expected = "Miniscript(ContextError(CompressedOnly(\"04b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a87378ec38ff91d43e8c2092ebda601780485263da089465619e0358a5c1be7ac91f4\")))"
|
|
||||||
)]
|
|
||||||
fn test_dsl_miniscript_checks() {
|
fn test_dsl_miniscript_checks() {
|
||||||
let mut uncompressed_pk =
|
let mut uncompressed_pk =
|
||||||
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
||||||
|
|||||||
@@ -20,8 +20,8 @@ pub enum Error {
|
|||||||
InvalidDescriptorChecksum,
|
InvalidDescriptorChecksum,
|
||||||
/// The descriptor contains hardened derivation steps on public extended keys
|
/// The descriptor contains hardened derivation steps on public extended keys
|
||||||
HardenedDerivationXpub,
|
HardenedDerivationXpub,
|
||||||
/// The descriptor contains multiple keys with the same BIP32 fingerprint
|
/// The descriptor contains multipath keys
|
||||||
DuplicatedKeys,
|
MultiPath,
|
||||||
|
|
||||||
/// Error thrown while working with [`keys`](crate::keys)
|
/// Error thrown while working with [`keys`](crate::keys)
|
||||||
Key(crate::keys::KeyError),
|
Key(crate::keys::KeyError),
|
||||||
@@ -32,11 +32,11 @@ pub enum Error {
|
|||||||
InvalidDescriptorCharacter(u8),
|
InvalidDescriptorCharacter(u8),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Error during base58 decoding
|
/// Error during base58 decoding
|
||||||
Base58(bitcoin::util::base58::Error),
|
Base58(bitcoin::base58::Error),
|
||||||
/// Key-related error
|
/// Key-related error
|
||||||
Pk(bitcoin::util::key::Error),
|
Pk(bitcoin::key::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
/// Hex decoding error
|
/// Hex decoding error
|
||||||
@@ -55,15 +55,38 @@ impl From<crate::keys::KeyError> for Error {
|
|||||||
|
|
||||||
impl std::fmt::Display for Error {
|
impl std::fmt::Display for Error {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::InvalidHdKeyPath => write!(f, "Invalid HD key path"),
|
||||||
|
Self::InvalidDescriptorChecksum => {
|
||||||
|
write!(f, "The provided descriptor doesn't match its checksum")
|
||||||
|
}
|
||||||
|
Self::HardenedDerivationXpub => write!(
|
||||||
|
f,
|
||||||
|
"The descriptor contains hardened derivation steps on public extended keys"
|
||||||
|
),
|
||||||
|
Self::MultiPath => write!(
|
||||||
|
f,
|
||||||
|
"The descriptor contains multipath keys, which are not supported yet"
|
||||||
|
),
|
||||||
|
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||||
|
Self::Policy(err) => write!(f, "Policy error: {}", err),
|
||||||
|
Self::InvalidDescriptorCharacter(char) => {
|
||||||
|
write!(f, "Invalid descriptor character: {}", char)
|
||||||
|
}
|
||||||
|
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
||||||
|
Self::Base58(err) => write!(f, "Base58 error: {}", err),
|
||||||
|
Self::Pk(err) => write!(f, "Key-related error: {}", err),
|
||||||
|
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
||||||
|
Self::Hex(err) => write!(f, "Hex decoding error: {}", err),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::error::Error for Error {}
|
impl std::error::Error for Error {}
|
||||||
|
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
impl_error!(bitcoin::bip32::Error, Bip32);
|
||||||
impl_error!(bitcoin::util::base58::Error, Base58);
|
impl_error!(bitcoin::base58::Error, Base58);
|
||||||
impl_error!(bitcoin::util::key::Error, Pk);
|
impl_error!(bitcoin::key::Error, Pk);
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
impl_error!(miniscript::Error, Miniscript);
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
||||||
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
||||||
|
|||||||
@@ -14,33 +14,33 @@
|
|||||||
//! This module contains generic utilities to work with descriptors, plus some re-exported types
|
//! This module contains generic utilities to work with descriptors, plus some re-exported types
|
||||||
//! from [`miniscript`].
|
//! from [`miniscript`].
|
||||||
|
|
||||||
use std::collections::{BTreeMap, HashSet};
|
use std::collections::BTreeMap;
|
||||||
use std::ops::Deref;
|
|
||||||
|
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
||||||
use bitcoin::util::{psbt, taproot};
|
use bitcoin::{key::XOnlyPublicKey, secp256k1, PublicKey};
|
||||||
use bitcoin::{secp256k1, PublicKey, XOnlyPublicKey};
|
use bitcoin::{psbt, taproot};
|
||||||
use bitcoin::{Network, Script, TxOut};
|
use bitcoin::{Network, TxOut};
|
||||||
|
|
||||||
use miniscript::descriptor::{DescriptorType, InnerXKey, SinglePubKey};
|
use miniscript::descriptor::{
|
||||||
pub use miniscript::{
|
DefiniteDescriptorKey, DescriptorMultiXKey, DescriptorSecretKey, DescriptorType,
|
||||||
descriptor::DescriptorXKey, descriptor::KeyMap, descriptor::Wildcard, Descriptor,
|
DescriptorXKey, InnerXKey, KeyMap, SinglePubKey, Wildcard,
|
||||||
DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
|
||||||
};
|
};
|
||||||
use miniscript::{DescriptorTrait, ForEachKey, TranslatePk};
|
pub use miniscript::{
|
||||||
|
Descriptor, DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
||||||
|
};
|
||||||
|
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
||||||
|
|
||||||
use crate::descriptor::policy::BuildSatisfaction;
|
use crate::descriptor::policy::BuildSatisfaction;
|
||||||
|
|
||||||
pub mod checksum;
|
pub mod checksum;
|
||||||
pub mod derived;
|
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
pub mod dsl;
|
pub mod dsl;
|
||||||
pub mod error;
|
pub mod error;
|
||||||
pub mod policy;
|
pub mod policy;
|
||||||
pub mod template;
|
pub mod template;
|
||||||
|
|
||||||
pub use self::checksum::get_checksum;
|
pub use self::checksum::calc_checksum;
|
||||||
pub use self::derived::{AsDerived, DerivedDescriptorKey};
|
use self::checksum::calc_checksum_bytes;
|
||||||
pub use self::error::Error as DescriptorError;
|
pub use self::error::Error as DescriptorError;
|
||||||
pub use self::policy::Policy;
|
pub use self::policy::Policy;
|
||||||
use self::template::DescriptorTemplateOut;
|
use self::template::DescriptorTemplateOut;
|
||||||
@@ -52,21 +52,21 @@ use crate::wallet::utils::SecpCtx;
|
|||||||
pub type ExtendedDescriptor = Descriptor<DescriptorPublicKey>;
|
pub type ExtendedDescriptor = Descriptor<DescriptorPublicKey>;
|
||||||
|
|
||||||
/// Alias for a [`Descriptor`] that contains extended **derived** keys
|
/// Alias for a [`Descriptor`] that contains extended **derived** keys
|
||||||
pub type DerivedDescriptor<'s> = Descriptor<DerivedDescriptorKey<'s>>;
|
pub type DerivedDescriptor = Descriptor<DefiniteDescriptorKey>;
|
||||||
|
|
||||||
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
||||||
|
|
||||||
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type TapKeyOrigins = BTreeMap<bitcoin::XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
pub type TapKeyOrigins = BTreeMap<XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
||||||
|
|
||||||
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
||||||
pub trait IntoWalletDescriptor {
|
pub trait IntoWalletDescriptor {
|
||||||
@@ -84,19 +84,15 @@ impl IntoWalletDescriptor for &str {
|
|||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
network: Network,
|
network: Network,
|
||||||
) -> Result<(ExtendedDescriptor, KeyMap), DescriptorError> {
|
) -> Result<(ExtendedDescriptor, KeyMap), DescriptorError> {
|
||||||
let descriptor = if self.contains('#') {
|
let descriptor = match self.split_once('#') {
|
||||||
let parts: Vec<&str> = self.splitn(2, '#').collect();
|
Some((desc, original_checksum)) => {
|
||||||
if !get_checksum(parts[0])
|
let checksum = calc_checksum_bytes(desc)?;
|
||||||
.ok()
|
if original_checksum.as_bytes() != checksum {
|
||||||
.map(|computed| computed == parts[1])
|
return Err(DescriptorError::InvalidDescriptorChecksum);
|
||||||
.unwrap_or(false)
|
}
|
||||||
{
|
desc
|
||||||
return Err(DescriptorError::InvalidDescriptorChecksum);
|
|
||||||
}
|
}
|
||||||
|
None => self,
|
||||||
parts[0]
|
|
||||||
} else {
|
|
||||||
self
|
|
||||||
};
|
};
|
||||||
|
|
||||||
ExtendedDescriptor::parse_descriptor(secp, descriptor)?
|
ExtendedDescriptor::parse_descriptor(secp, descriptor)?
|
||||||
@@ -132,28 +128,77 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
) -> Result<(ExtendedDescriptor, KeyMap), DescriptorError> {
|
) -> Result<(ExtendedDescriptor, KeyMap), DescriptorError> {
|
||||||
use crate::keys::DescriptorKey;
|
use crate::keys::DescriptorKey;
|
||||||
|
|
||||||
let check_key = |pk: &DescriptorPublicKey| {
|
struct Translator<'s, 'd> {
|
||||||
let (pk, _, networks) = if self.0.is_witness() {
|
secp: &'s SecpCtx,
|
||||||
let descriptor_key: DescriptorKey<miniscript::Segwitv0> =
|
descriptor: &'d ExtendedDescriptor,
|
||||||
pk.clone().into_descriptor_key()?;
|
network: Network,
|
||||||
descriptor_key.extract(secp)?
|
}
|
||||||
} else {
|
|
||||||
let descriptor_key: DescriptorKey<miniscript::Legacy> =
|
|
||||||
pk.clone().into_descriptor_key()?;
|
|
||||||
descriptor_key.extract(secp)?
|
|
||||||
};
|
|
||||||
|
|
||||||
if networks.contains(&network) {
|
impl<'s, 'd> miniscript::Translator<DescriptorPublicKey, String, DescriptorError>
|
||||||
Ok(pk)
|
for Translator<'s, 'd>
|
||||||
} else {
|
{
|
||||||
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
fn pk(&mut self, pk: &DescriptorPublicKey) -> Result<String, DescriptorError> {
|
||||||
|
let secp = &self.secp;
|
||||||
|
|
||||||
|
let (_, _, networks) = if self.descriptor.is_taproot() {
|
||||||
|
let descriptor_key: DescriptorKey<miniscript::Tap> =
|
||||||
|
pk.clone().into_descriptor_key()?;
|
||||||
|
descriptor_key.extract(secp)?
|
||||||
|
} else if self.descriptor.is_witness() {
|
||||||
|
let descriptor_key: DescriptorKey<miniscript::Segwitv0> =
|
||||||
|
pk.clone().into_descriptor_key()?;
|
||||||
|
descriptor_key.extract(secp)?
|
||||||
|
} else {
|
||||||
|
let descriptor_key: DescriptorKey<miniscript::Legacy> =
|
||||||
|
pk.clone().into_descriptor_key()?;
|
||||||
|
descriptor_key.extract(secp)?
|
||||||
|
};
|
||||||
|
|
||||||
|
if networks.contains(&self.network) {
|
||||||
|
Ok(Default::default())
|
||||||
|
} else {
|
||||||
|
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
||||||
|
}
|
||||||
}
|
}
|
||||||
};
|
fn sha256(
|
||||||
|
&mut self,
|
||||||
|
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
||||||
|
) -> Result<String, DescriptorError> {
|
||||||
|
Ok(Default::default())
|
||||||
|
}
|
||||||
|
fn hash256(
|
||||||
|
&mut self,
|
||||||
|
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
||||||
|
) -> Result<String, DescriptorError> {
|
||||||
|
Ok(Default::default())
|
||||||
|
}
|
||||||
|
fn ripemd160(
|
||||||
|
&mut self,
|
||||||
|
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
||||||
|
) -> Result<String, DescriptorError> {
|
||||||
|
Ok(Default::default())
|
||||||
|
}
|
||||||
|
fn hash160(
|
||||||
|
&mut self,
|
||||||
|
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
||||||
|
) -> Result<String, DescriptorError> {
|
||||||
|
Ok(Default::default())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// check the network for the keys
|
// check the network for the keys
|
||||||
let translated = self.0.translate_pk(check_key, check_key)?;
|
use miniscript::TranslateErr;
|
||||||
|
match self.0.translate_pk(&mut Translator {
|
||||||
|
secp,
|
||||||
|
network,
|
||||||
|
descriptor: &self.0,
|
||||||
|
}) {
|
||||||
|
Ok(_) => {}
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
}
|
||||||
|
|
||||||
Ok((translated, self.1))
|
Ok(self)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -163,10 +208,17 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
|||||||
_secp: &SecpCtx,
|
_secp: &SecpCtx,
|
||||||
network: Network,
|
network: Network,
|
||||||
) -> Result<(ExtendedDescriptor, KeyMap), DescriptorError> {
|
) -> Result<(ExtendedDescriptor, KeyMap), DescriptorError> {
|
||||||
let valid_networks = &self.2;
|
struct Translator {
|
||||||
|
network: Network,
|
||||||
|
}
|
||||||
|
|
||||||
let fix_key = |pk: &DescriptorPublicKey| {
|
impl miniscript::Translator<DescriptorPublicKey, DescriptorPublicKey, DescriptorError>
|
||||||
if valid_networks.contains(&network) {
|
for Translator
|
||||||
|
{
|
||||||
|
fn pk(
|
||||||
|
&mut self,
|
||||||
|
pk: &DescriptorPublicKey,
|
||||||
|
) -> Result<DescriptorPublicKey, DescriptorError> {
|
||||||
// workaround for xpubs generated by other key types, like bip39: since when the
|
// workaround for xpubs generated by other key types, like bip39: since when the
|
||||||
// conversion is made one network has to be chosen, what we generally choose
|
// conversion is made one network has to be chosen, what we generally choose
|
||||||
// "mainnet", but then override the set of valid networks to specify that all of
|
// "mainnet", but then override the set of valid networks to specify that all of
|
||||||
@@ -175,7 +227,7 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
|||||||
let pk = match pk {
|
let pk = match pk {
|
||||||
DescriptorPublicKey::XPub(ref xpub) => {
|
DescriptorPublicKey::XPub(ref xpub) => {
|
||||||
let mut xpub = xpub.clone();
|
let mut xpub = xpub.clone();
|
||||||
xpub.xkey.network = network;
|
xpub.xkey.network = self.network;
|
||||||
|
|
||||||
DescriptorPublicKey::XPub(xpub)
|
DescriptorPublicKey::XPub(xpub)
|
||||||
}
|
}
|
||||||
@@ -183,15 +235,47 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
|||||||
};
|
};
|
||||||
|
|
||||||
Ok(pk)
|
Ok(pk)
|
||||||
} else {
|
|
||||||
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
|
||||||
}
|
}
|
||||||
|
miniscript::translate_hash_clone!(
|
||||||
|
DescriptorPublicKey,
|
||||||
|
DescriptorPublicKey,
|
||||||
|
DescriptorError
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
let (desc, keymap, networks) = self;
|
||||||
|
|
||||||
|
if !networks.contains(&network) {
|
||||||
|
return Err(DescriptorError::Key(KeyError::InvalidNetwork));
|
||||||
|
}
|
||||||
|
|
||||||
|
// fixup the network for keys that need it in the descriptor
|
||||||
|
use miniscript::TranslateErr;
|
||||||
|
let translated = match desc.translate_pk(&mut Translator { network }) {
|
||||||
|
Ok(descriptor) => descriptor,
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
};
|
};
|
||||||
|
// ...and in the key map
|
||||||
|
let fixed_keymap = keymap
|
||||||
|
.into_iter()
|
||||||
|
.map(|(mut k, mut v)| {
|
||||||
|
match (&mut k, &mut v) {
|
||||||
|
(DescriptorPublicKey::XPub(xpub), DescriptorSecretKey::XPrv(xprv)) => {
|
||||||
|
xpub.xkey.network = network;
|
||||||
|
xprv.xkey.network = network;
|
||||||
|
}
|
||||||
|
(_, DescriptorSecretKey::Single(key)) => {
|
||||||
|
key.key.network = network;
|
||||||
|
}
|
||||||
|
_ => {}
|
||||||
|
}
|
||||||
|
|
||||||
// fixup the network for keys that need it
|
(k, v)
|
||||||
let translated = self.0.translate_pk(fix_key, fix_key)?;
|
})
|
||||||
|
.collect();
|
||||||
|
|
||||||
Ok((translated, self.1))
|
Ok((translated, fixed_keymap))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -210,7 +294,7 @@ pub(crate) fn into_wallet_descriptor_checked<T: IntoWalletDescriptor>(
|
|||||||
derivation_path,
|
derivation_path,
|
||||||
wildcard,
|
wildcard,
|
||||||
..
|
..
|
||||||
}) = k.as_key()
|
}) = k
|
||||||
{
|
{
|
||||||
return *wildcard == Wildcard::Hardened
|
return *wildcard == Wildcard::Hardened
|
||||||
|| derivation_path.into_iter().any(ChildNumber::is_hardened);
|
|| derivation_path.into_iter().any(ChildNumber::is_hardened);
|
||||||
@@ -222,24 +306,14 @@ pub(crate) fn into_wallet_descriptor_checked<T: IntoWalletDescriptor>(
|
|||||||
return Err(DescriptorError::HardenedDerivationXpub);
|
return Err(DescriptorError::HardenedDerivationXpub);
|
||||||
}
|
}
|
||||||
|
|
||||||
// Ensure that there are no duplicated keys
|
if descriptor.is_multipath() {
|
||||||
let mut found_keys = HashSet::new();
|
return Err(DescriptorError::MultiPath);
|
||||||
let descriptor_contains_duplicated_keys = descriptor.for_any_key(|k| {
|
|
||||||
if let DescriptorPublicKey::XPub(xkey) = k.as_key() {
|
|
||||||
let fingerprint = xkey.root_fingerprint(secp);
|
|
||||||
if found_keys.contains(&fingerprint) {
|
|
||||||
return true;
|
|
||||||
}
|
|
||||||
|
|
||||||
found_keys.insert(fingerprint);
|
|
||||||
}
|
|
||||||
|
|
||||||
false
|
|
||||||
});
|
|
||||||
if descriptor_contains_duplicated_keys {
|
|
||||||
return Err(DescriptorError::DuplicatedKeys);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Run miniscript's sanity check, which will look for duplicated keys and other potential
|
||||||
|
// issues
|
||||||
|
descriptor.sanity_check()?;
|
||||||
|
|
||||||
Ok((descriptor, keymap))
|
Ok((descriptor, keymap))
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -271,35 +345,13 @@ pub trait ExtractPolicy {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) trait XKeyUtils {
|
pub(crate) trait XKeyUtils {
|
||||||
fn full_path(&self, append: &[ChildNumber]) -> DerivationPath;
|
|
||||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<T> XKeyUtils for DescriptorXKey<T>
|
impl<T> XKeyUtils for DescriptorMultiXKey<T>
|
||||||
where
|
where
|
||||||
T: InnerXKey,
|
T: InnerXKey,
|
||||||
{
|
{
|
||||||
fn full_path(&self, append: &[ChildNumber]) -> DerivationPath {
|
|
||||||
let full_path = match self.origin {
|
|
||||||
Some((_, ref path)) => path
|
|
||||||
.into_iter()
|
|
||||||
.chain(self.derivation_path.into_iter())
|
|
||||||
.cloned()
|
|
||||||
.collect(),
|
|
||||||
None => self.derivation_path.clone(),
|
|
||||||
};
|
|
||||||
|
|
||||||
if self.wildcard != Wildcard::None {
|
|
||||||
full_path
|
|
||||||
.into_iter()
|
|
||||||
.chain(append.iter())
|
|
||||||
.cloned()
|
|
||||||
.collect()
|
|
||||||
} else {
|
|
||||||
full_path
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
||||||
match self.origin {
|
match self.origin {
|
||||||
Some((fingerprint, _)) => fingerprint,
|
Some((fingerprint, _)) => fingerprint,
|
||||||
@@ -308,9 +360,16 @@ where
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) trait DerivedDescriptorMeta {
|
impl<T> XKeyUtils for DescriptorXKey<T>
|
||||||
fn get_hd_keypaths(&self, secp: &SecpCtx) -> HdKeyPaths;
|
where
|
||||||
fn get_tap_key_origins(&self, secp: &SecpCtx) -> TapKeyOrigins;
|
T: InnerXKey,
|
||||||
|
{
|
||||||
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
||||||
|
match self.origin {
|
||||||
|
Some((fingerprint, _)) => fingerprint,
|
||||||
|
None => self.xkey.xkey_fingerprint(secp),
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) trait DescriptorMeta {
|
pub(crate) trait DescriptorMeta {
|
||||||
@@ -321,63 +380,23 @@ pub(crate) trait DescriptorMeta {
|
|||||||
&self,
|
&self,
|
||||||
hd_keypaths: &HdKeyPaths,
|
hd_keypaths: &HdKeyPaths,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>>;
|
) -> Option<DerivedDescriptor>;
|
||||||
fn derive_from_tap_key_origins<'s>(
|
fn derive_from_tap_key_origins<'s>(
|
||||||
&self,
|
&self,
|
||||||
tap_key_origins: &TapKeyOrigins,
|
tap_key_origins: &TapKeyOrigins,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>>;
|
) -> Option<DerivedDescriptor>;
|
||||||
fn derive_from_psbt_key_origins<'s>(
|
fn derive_from_psbt_key_origins<'s>(
|
||||||
&self,
|
&self,
|
||||||
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>>;
|
) -> Option<DerivedDescriptor>;
|
||||||
fn derive_from_psbt_input<'s>(
|
fn derive_from_psbt_input<'s>(
|
||||||
&self,
|
&self,
|
||||||
psbt_input: &psbt::Input,
|
psbt_input: &psbt::Input,
|
||||||
utxo: Option<TxOut>,
|
utxo: Option<TxOut>,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>>;
|
) -> Option<DerivedDescriptor>;
|
||||||
}
|
|
||||||
|
|
||||||
pub(crate) trait DescriptorScripts {
|
|
||||||
fn psbt_redeem_script(&self) -> Option<Script>;
|
|
||||||
fn psbt_witness_script(&self) -> Option<Script>;
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'s> DescriptorScripts for DerivedDescriptor<'s> {
|
|
||||||
fn psbt_redeem_script(&self) -> Option<Script> {
|
|
||||||
match self.desc_type() {
|
|
||||||
DescriptorType::ShWpkh => Some(self.explicit_script().unwrap()),
|
|
||||||
DescriptorType::ShWsh => Some(self.explicit_script().unwrap().to_v0_p2wsh()),
|
|
||||||
DescriptorType::Sh => Some(self.explicit_script().unwrap()),
|
|
||||||
DescriptorType::Bare => Some(self.explicit_script().unwrap()),
|
|
||||||
DescriptorType::ShSortedMulti => Some(self.explicit_script().unwrap()),
|
|
||||||
DescriptorType::ShWshSortedMulti => Some(self.explicit_script().unwrap().to_v0_p2wsh()),
|
|
||||||
DescriptorType::Pkh
|
|
||||||
| DescriptorType::Wpkh
|
|
||||||
| DescriptorType::Tr
|
|
||||||
| DescriptorType::Wsh
|
|
||||||
| DescriptorType::WshSortedMulti => None,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn psbt_witness_script(&self) -> Option<Script> {
|
|
||||||
match self.desc_type() {
|
|
||||||
DescriptorType::Wsh => Some(self.explicit_script().unwrap()),
|
|
||||||
DescriptorType::ShWsh => Some(self.explicit_script().unwrap()),
|
|
||||||
DescriptorType::WshSortedMulti | DescriptorType::ShWshSortedMulti => {
|
|
||||||
Some(self.explicit_script().unwrap())
|
|
||||||
}
|
|
||||||
DescriptorType::Bare
|
|
||||||
| DescriptorType::Sh
|
|
||||||
| DescriptorType::Pkh
|
|
||||||
| DescriptorType::Wpkh
|
|
||||||
| DescriptorType::ShSortedMulti
|
|
||||||
| DescriptorType::Tr
|
|
||||||
| DescriptorType::ShWpkh => None,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl DescriptorMeta for ExtendedDescriptor {
|
impl DescriptorMeta for ExtendedDescriptor {
|
||||||
@@ -401,7 +420,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
let mut answer = Vec::new();
|
let mut answer = Vec::new();
|
||||||
|
|
||||||
self.for_each_key(|pk| {
|
self.for_each_key(|pk| {
|
||||||
if let DescriptorPublicKey::XPub(xpub) = pk.as_key() {
|
if let DescriptorPublicKey::XPub(xpub) = pk {
|
||||||
answer.push(xpub.clone());
|
answer.push(xpub.clone());
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -415,7 +434,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
&self,
|
&self,
|
||||||
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>> {
|
) -> Option<DerivedDescriptor> {
|
||||||
// Ensure that deriving `xpub` with `path` yields `expected`
|
// Ensure that deriving `xpub` with `path` yields `expected`
|
||||||
let verify_key = |xpub: &DescriptorXKey<ExtendedPubKey>,
|
let verify_key = |xpub: &DescriptorXKey<ExtendedPubKey>,
|
||||||
path: &DerivationPath,
|
path: &DerivationPath,
|
||||||
@@ -437,7 +456,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
|
|
||||||
// using `for_any_key` should make this stop as soon as we return `true`
|
// using `for_any_key` should make this stop as soon as we return `true`
|
||||||
self.for_any_key(|key| {
|
self.for_any_key(|key| {
|
||||||
if let DescriptorPublicKey::XPub(xpub) = key.as_key().deref() {
|
if let DescriptorPublicKey::XPub(xpub) = key {
|
||||||
// Check if the key matches one entry in our `key_origins`. If it does, `matches()` will
|
// Check if the key matches one entry in our `key_origins`. If it does, `matches()` will
|
||||||
// return the "prefix" that matched, so we remove that prefix from the full path
|
// return the "prefix" that matched, so we remove that prefix from the full path
|
||||||
// found in `key_origins` and save it in `derive_path`. We expect this to be a derivation
|
// found in `key_origins` and save it in `derive_path`. We expect this to be a derivation
|
||||||
@@ -495,14 +514,17 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
false
|
false
|
||||||
});
|
});
|
||||||
|
|
||||||
path_found.map(|path| self.as_derived(path, secp))
|
path_found.map(|path| {
|
||||||
|
self.at_derivation_index(path)
|
||||||
|
.expect("We ignore hardened wildcards")
|
||||||
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_hd_keypaths<'s>(
|
fn derive_from_hd_keypaths<'s>(
|
||||||
&self,
|
&self,
|
||||||
hd_keypaths: &HdKeyPaths,
|
hd_keypaths: &HdKeyPaths,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>> {
|
) -> Option<DerivedDescriptor> {
|
||||||
// "Convert" an hd_keypaths map to the format required by `derive_from_psbt_key_origins`
|
// "Convert" an hd_keypaths map to the format required by `derive_from_psbt_key_origins`
|
||||||
let key_origins = hd_keypaths
|
let key_origins = hd_keypaths
|
||||||
.iter()
|
.iter()
|
||||||
@@ -520,7 +542,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
&self,
|
&self,
|
||||||
tap_key_origins: &TapKeyOrigins,
|
tap_key_origins: &TapKeyOrigins,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>> {
|
) -> Option<DerivedDescriptor> {
|
||||||
// "Convert" a tap_key_origins map to the format required by `derive_from_psbt_key_origins`
|
// "Convert" a tap_key_origins map to the format required by `derive_from_psbt_key_origins`
|
||||||
let key_origins = tap_key_origins
|
let key_origins = tap_key_origins
|
||||||
.iter()
|
.iter()
|
||||||
@@ -534,19 +556,19 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
psbt_input: &psbt::Input,
|
psbt_input: &psbt::Input,
|
||||||
utxo: Option<TxOut>,
|
utxo: Option<TxOut>,
|
||||||
secp: &'s SecpCtx,
|
secp: &'s SecpCtx,
|
||||||
) -> Option<DerivedDescriptor<'s>> {
|
) -> Option<DerivedDescriptor> {
|
||||||
if let Some(derived) = self.derive_from_hd_keypaths(&psbt_input.bip32_derivation, secp) {
|
if let Some(derived) = self.derive_from_hd_keypaths(&psbt_input.bip32_derivation, secp) {
|
||||||
return Some(derived);
|
return Some(derived);
|
||||||
}
|
}
|
||||||
if let Some(derived) = self.derive_from_tap_key_origins(&psbt_input.tap_key_origins, secp) {
|
if let Some(derived) = self.derive_from_tap_key_origins(&psbt_input.tap_key_origins, secp) {
|
||||||
return Some(derived);
|
return Some(derived);
|
||||||
}
|
}
|
||||||
if self.is_deriveable() {
|
if self.has_wildcard() {
|
||||||
// We can't try to bruteforce the derivation index, exit here
|
// We can't try to bruteforce the derivation index, exit here
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
let descriptor = self.as_derived_fixed(secp);
|
let descriptor = self.at_derivation_index(0).expect("0 is not hardened");
|
||||||
match descriptor.desc_type() {
|
match descriptor.desc_type() {
|
||||||
// TODO: add pk() here
|
// TODO: add pk() here
|
||||||
DescriptorType::Pkh
|
DescriptorType::Pkh
|
||||||
@@ -580,95 +602,15 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'s> DerivedDescriptorMeta for DerivedDescriptor<'s> {
|
|
||||||
fn get_hd_keypaths(&self, secp: &SecpCtx) -> HdKeyPaths {
|
|
||||||
let mut answer = BTreeMap::new();
|
|
||||||
self.for_each_key(|key| {
|
|
||||||
if let DescriptorPublicKey::XPub(xpub) = key.as_key().deref() {
|
|
||||||
let derived_pubkey = xpub
|
|
||||||
.xkey
|
|
||||||
.derive_pub(secp, &xpub.derivation_path)
|
|
||||||
.expect("Derivation can't fail");
|
|
||||||
|
|
||||||
answer.insert(
|
|
||||||
derived_pubkey.public_key,
|
|
||||||
(xpub.root_fingerprint(secp), xpub.full_path(&[])),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
true
|
|
||||||
});
|
|
||||||
|
|
||||||
answer
|
|
||||||
}
|
|
||||||
|
|
||||||
fn get_tap_key_origins(&self, secp: &SecpCtx) -> TapKeyOrigins {
|
|
||||||
use miniscript::ToPublicKey;
|
|
||||||
|
|
||||||
let mut answer = BTreeMap::new();
|
|
||||||
let mut insert_path = |pk: &DerivedDescriptorKey<'_>, lh| {
|
|
||||||
let key_origin = match pk.deref() {
|
|
||||||
DescriptorPublicKey::XPub(xpub) => {
|
|
||||||
Some((xpub.root_fingerprint(secp), xpub.full_path(&[])))
|
|
||||||
}
|
|
||||||
DescriptorPublicKey::SinglePub(_) => None,
|
|
||||||
};
|
|
||||||
|
|
||||||
// If this is the internal key, we only insert the key origin if it's not None.
|
|
||||||
// For keys found in the tap tree we always insert a key origin (because the signer
|
|
||||||
// looks for it to know which leaves to sign for), even though it may be None
|
|
||||||
match (lh, key_origin) {
|
|
||||||
(None, Some(ko)) => {
|
|
||||||
answer
|
|
||||||
.entry(pk.to_x_only_pubkey())
|
|
||||||
.or_insert_with(|| (vec![], ko));
|
|
||||||
}
|
|
||||||
(Some(lh), origin) => {
|
|
||||||
answer
|
|
||||||
.entry(pk.to_x_only_pubkey())
|
|
||||||
.or_insert_with(|| (vec![], origin.unwrap_or_default()))
|
|
||||||
.0
|
|
||||||
.push(lh);
|
|
||||||
}
|
|
||||||
_ => {}
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
if let Descriptor::Tr(tr) = &self {
|
|
||||||
// Internal key first, then iterate the scripts
|
|
||||||
insert_path(tr.internal_key(), None);
|
|
||||||
|
|
||||||
for (_, ms) in tr.iter_scripts() {
|
|
||||||
// Assume always the same leaf version
|
|
||||||
let leaf_hash = taproot::TapLeafHash::from_script(
|
|
||||||
&ms.encode(),
|
|
||||||
taproot::LeafVersion::TapScript,
|
|
||||||
);
|
|
||||||
|
|
||||||
for key in ms.iter_pk_pkh() {
|
|
||||||
let key = match key {
|
|
||||||
miniscript::miniscript::iter::PkPkh::PlainPubkey(pk) => pk,
|
|
||||||
miniscript::miniscript::iter::PkPkh::HashedPubkey(pk) => pk,
|
|
||||||
};
|
|
||||||
|
|
||||||
insert_path(&key, Some(leaf_hash));
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
answer
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::consensus::encode::deserialize;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::{bip32, psbt};
|
use bitcoin::ScriptBuf;
|
||||||
use bitcoin::Script;
|
use bitcoin::{bip32, psbt::Psbt};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::psbt::PsbtUtils;
|
use crate::psbt::PsbtUtils;
|
||||||
@@ -679,7 +621,7 @@ mod test {
|
|||||||
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
||||||
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
||||||
@@ -702,7 +644,7 @@ mod test {
|
|||||||
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
||||||
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
||||||
@@ -733,7 +675,7 @@ mod test {
|
|||||||
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
||||||
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
||||||
@@ -757,7 +699,7 @@ mod test {
|
|||||||
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
||||||
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
||||||
@@ -787,23 +729,40 @@ mod test {
|
|||||||
|
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
let xpub = bip32::ExtendedPubKey::from_str("xpub6ERApfZwUNrhLCkDtcHTcxd75RbzS1ed54G1LkBUHQVHQKqhMkhgbmJbZRkrgZw4koxb5JaHWkY4ALHY2grBGRjaDMzQLcgJvLJuZZvRcEL").unwrap();
|
let xprv = bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3c3gF1DUWpWNr2SG2XrG8oYPpqYh7hoWsJy9NjabErnzriJPpnGHyKz5NgdXmq1KVbqS1r4NXdCoKitWg5e86zqXHa8kxyB").unwrap();
|
||||||
let path = bip32::DerivationPath::from_str("m/0").unwrap();
|
let path = bip32::DerivationPath::from_str("m/0").unwrap();
|
||||||
|
|
||||||
// here `to_descriptor_key` will set the valid networks for the key to only mainnet, since
|
// here `to_descriptor_key` will set the valid networks for the key to only mainnet, since
|
||||||
// we are using an "xpub"
|
// we are using an "xpub"
|
||||||
let key = (xpub, path).into_descriptor_key().unwrap();
|
let key = (xprv, path.clone()).into_descriptor_key().unwrap();
|
||||||
// override it with any. this happens in some key conversions, like bip39
|
// override it with any. this happens in some key conversions, like bip39
|
||||||
let key = key.override_valid_networks(any_network());
|
let key = key.override_valid_networks(any_network());
|
||||||
|
|
||||||
// make a descriptor out of it
|
// make a descriptor out of it
|
||||||
let desc = crate::descriptor!(wpkh(key)).unwrap();
|
let desc = crate::descriptor!(wpkh(key)).unwrap();
|
||||||
// this should convert the key that supports "any_network" to the right network (testnet)
|
// this should convert the key that supports "any_network" to the right network (testnet)
|
||||||
let (wallet_desc, _) = desc
|
let (wallet_desc, keymap) = desc
|
||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert_eq!(wallet_desc.to_string(), "wpkh(tpubDEnoLuPdBep9bzw5LoGYpsxUQYheRQ9gcgrJhJEcdKFB9cWQRyYmkCyRoTqeD4tJYiVVgt6A3rN6rWn9RYhR9sBsGxji29LYWHuKKbdb1ev/0/*)#y8p7e8kk");
|
let mut xprv_testnet = xprv;
|
||||||
|
xprv_testnet.network = Network::Testnet;
|
||||||
|
|
||||||
|
let xpub_testnet = bip32::ExtendedPubKey::from_priv(&secp, &xprv_testnet);
|
||||||
|
let desc_pubkey = DescriptorPublicKey::XPub(DescriptorXKey {
|
||||||
|
xkey: xpub_testnet,
|
||||||
|
origin: None,
|
||||||
|
derivation_path: path,
|
||||||
|
wildcard: Wildcard::Unhardened,
|
||||||
|
});
|
||||||
|
|
||||||
|
assert_eq!(wallet_desc.to_string(), "wpkh(tpubD6NzVbkrYhZ4XtJzoDja5snUjBNQRP5B3f4Hyn1T1x6PVPxzzVjvw6nJx2D8RBCxog9GEVjZoyStfepTz7TtKoBVdkCtnc7VCJh9dD4RAU9/0/*)#a3svx0ha");
|
||||||
|
assert_eq!(
|
||||||
|
keymap
|
||||||
|
.get(&desc_pubkey)
|
||||||
|
.map(|key| key.to_public(&secp).unwrap()),
|
||||||
|
Some(desc_pubkey)
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
// test IntoWalletDescriptor trait from &str with and without checksum appended
|
// test IntoWalletDescriptor trait from &str with and without checksum appended
|
||||||
@@ -829,17 +788,11 @@ mod test {
|
|||||||
|
|
||||||
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)#67ju93jw"
|
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)#67ju93jw"
|
||||||
.into_wallet_descriptor(&secp, Network::Testnet);
|
.into_wallet_descriptor(&secp, Network::Testnet);
|
||||||
assert!(matches!(
|
assert_matches!(desc, Err(DescriptorError::InvalidDescriptorChecksum));
|
||||||
desc.err(),
|
|
||||||
Some(DescriptorError::InvalidDescriptorChecksum)
|
|
||||||
));
|
|
||||||
|
|
||||||
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)#67ju93jw"
|
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)#67ju93jw"
|
||||||
.into_wallet_descriptor(&secp, Network::Testnet);
|
.into_wallet_descriptor(&secp, Network::Testnet);
|
||||||
assert!(matches!(
|
assert_matches!(desc, Err(DescriptorError::InvalidDescriptorChecksum));
|
||||||
desc.err(),
|
|
||||||
Some(DescriptorError::InvalidDescriptorChecksum)
|
|
||||||
));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// test IntoWalletDescriptor trait from &str with keys from right and wrong network
|
// test IntoWalletDescriptor trait from &str with keys from right and wrong network
|
||||||
@@ -873,17 +826,11 @@ mod test {
|
|||||||
|
|
||||||
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)"
|
let desc = "wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)"
|
||||||
.into_wallet_descriptor(&secp, Network::Bitcoin);
|
.into_wallet_descriptor(&secp, Network::Bitcoin);
|
||||||
assert!(matches!(
|
assert_matches!(desc, Err(DescriptorError::Key(KeyError::InvalidNetwork)));
|
||||||
desc.err(),
|
|
||||||
Some(DescriptorError::Key(KeyError::InvalidNetwork))
|
|
||||||
));
|
|
||||||
|
|
||||||
let desc = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/1/2/*)"
|
let desc = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/1/2/*)"
|
||||||
.into_wallet_descriptor(&secp, Network::Bitcoin);
|
.into_wallet_descriptor(&secp, Network::Bitcoin);
|
||||||
assert!(matches!(
|
assert_matches!(desc, Err(DescriptorError::Key(KeyError::InvalidNetwork)));
|
||||||
desc.err(),
|
|
||||||
Some(DescriptorError::Key(KeyError::InvalidNetwork))
|
|
||||||
));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// test IntoWalletDescriptor trait from the output of the descriptor!() macro
|
// test IntoWalletDescriptor trait from the output of the descriptor!() macro
|
||||||
@@ -917,25 +864,23 @@ mod test {
|
|||||||
let descriptor = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0'/1/2/*)";
|
let descriptor = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0'/1/2/*)";
|
||||||
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
assert!(result.is_err());
|
assert_matches!(result, Err(DescriptorError::HardenedDerivationXpub));
|
||||||
assert!(matches!(
|
|
||||||
result.unwrap_err(),
|
|
||||||
DescriptorError::HardenedDerivationXpub
|
|
||||||
));
|
|
||||||
|
|
||||||
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/1/*))";
|
let descriptor = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/<0;1>/*)";
|
||||||
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
|
assert_matches!(result, Err(DescriptorError::MultiPath));
|
||||||
|
|
||||||
|
// repeated pubkeys
|
||||||
|
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*))";
|
||||||
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
assert!(result.is_err());
|
assert!(result.is_err());
|
||||||
assert!(matches!(
|
|
||||||
result.unwrap_err(),
|
|
||||||
DescriptorError::DuplicatedKeys
|
|
||||||
));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_sh_wsh_sortedmulti_redeemscript() {
|
fn test_sh_wsh_sortedmulti_redeemscript() {
|
||||||
use super::{AsDerived, DescriptorScripts};
|
use miniscript::psbt::PsbtInputExt;
|
||||||
|
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
@@ -943,11 +888,16 @@ mod test {
|
|||||||
let (descriptor, _) =
|
let (descriptor, _) =
|
||||||
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
||||||
|
|
||||||
let descriptor = descriptor.as_derived(0, &secp);
|
let descriptor = descriptor.at_derivation_index(0).unwrap();
|
||||||
|
|
||||||
let script = Script::from_str("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
let script = ScriptBuf::from_hex("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
||||||
|
|
||||||
assert_eq!(descriptor.psbt_redeem_script(), Some(script.to_v0_p2wsh()));
|
let mut psbt_input = psbt::Input::default();
|
||||||
assert_eq!(descriptor.psbt_witness_script(), Some(script));
|
psbt_input
|
||||||
|
.update_with_descriptor_unchecked(&descriptor)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
assert_eq!(psbt_input.redeem_script, Some(script.to_v0_p2wsh()));
|
||||||
|
assert_eq!(psbt_input.witness_script, Some(script));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -43,14 +43,17 @@ use std::fmt;
|
|||||||
use serde::ser::SerializeMap;
|
use serde::ser::SerializeMap;
|
||||||
use serde::{Serialize, Serializer};
|
use serde::{Serialize, Serializer};
|
||||||
|
|
||||||
use bitcoin::hashes::*;
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
||||||
use bitcoin::{PublicKey, XOnlyPublicKey};
|
use bitcoin::{absolute, key::XOnlyPublicKey, PublicKey, Sequence};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DescriptorPublicKey, DescriptorSinglePub, ShInner, SinglePubKey, SortedMultiVec, WshInner,
|
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
||||||
|
};
|
||||||
|
use miniscript::hash256;
|
||||||
|
use miniscript::{
|
||||||
|
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
||||||
};
|
};
|
||||||
use miniscript::{Descriptor, Miniscript, MiniscriptKey, Satisfier, ScriptContext, Terminal};
|
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
use log::{debug, error, info, trace};
|
use log::{debug, error, info, trace};
|
||||||
@@ -58,12 +61,12 @@ use log::{debug, error, info, trace};
|
|||||||
use crate::descriptor::ExtractPolicy;
|
use crate::descriptor::ExtractPolicy;
|
||||||
use crate::keys::ExtScriptContext;
|
use crate::keys::ExtScriptContext;
|
||||||
use crate::wallet::signer::{SignerId, SignersContainer};
|
use crate::wallet::signer::{SignerId, SignersContainer};
|
||||||
use crate::wallet::utils::{self, After, Older, SecpCtx};
|
use crate::wallet::utils::{After, Older, SecpCtx};
|
||||||
|
|
||||||
use super::checksum::get_checksum;
|
use super::checksum::calc_checksum;
|
||||||
use super::error::Error;
|
use super::error::Error;
|
||||||
use super::XKeyUtils;
|
use super::XKeyUtils;
|
||||||
use bitcoin::util::psbt::{Input as PsbtInput, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, Psbt};
|
||||||
use miniscript::psbt::PsbtInputSatisfier;
|
use miniscript::psbt::PsbtInputSatisfier;
|
||||||
|
|
||||||
/// A unique identifier for a key
|
/// A unique identifier for a key
|
||||||
@@ -81,15 +84,18 @@ pub enum PkOrF {
|
|||||||
impl PkOrF {
|
impl PkOrF {
|
||||||
fn from_key(k: &DescriptorPublicKey, secp: &SecpCtx) -> Self {
|
fn from_key(k: &DescriptorPublicKey, secp: &SecpCtx) -> Self {
|
||||||
match k {
|
match k {
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
DescriptorPublicKey::Single(SinglePub {
|
||||||
key: SinglePubKey::FullKey(pk),
|
key: SinglePubKey::FullKey(pk),
|
||||||
..
|
..
|
||||||
}) => PkOrF::Pubkey(*pk),
|
}) => PkOrF::Pubkey(*pk),
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
DescriptorPublicKey::Single(SinglePub {
|
||||||
key: SinglePubKey::XOnly(pk),
|
key: SinglePubKey::XOnly(pk),
|
||||||
..
|
..
|
||||||
}) => PkOrF::XOnlyPubkey(*pk),
|
}) => PkOrF::XOnlyPubkey(*pk),
|
||||||
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
||||||
|
DescriptorPublicKey::MultiXPub(multi) => {
|
||||||
|
PkOrF::Fingerprint(multi.root_fingerprint(secp))
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -111,7 +117,7 @@ pub enum SatisfiableItem {
|
|||||||
/// Double SHA256 preimage hash
|
/// Double SHA256 preimage hash
|
||||||
Hash256Preimage {
|
Hash256Preimage {
|
||||||
/// The digest value
|
/// The digest value
|
||||||
hash: sha256d::Hash,
|
hash: hash256::Hash,
|
||||||
},
|
},
|
||||||
/// RIPEMD160 preimage hash
|
/// RIPEMD160 preimage hash
|
||||||
Ripemd160Preimage {
|
Ripemd160Preimage {
|
||||||
@@ -125,13 +131,13 @@ pub enum SatisfiableItem {
|
|||||||
},
|
},
|
||||||
/// Absolute timeclock timestamp
|
/// Absolute timeclock timestamp
|
||||||
AbsoluteTimelock {
|
AbsoluteTimelock {
|
||||||
/// The timestamp value
|
/// The timelock value
|
||||||
value: u32,
|
value: absolute::LockTime,
|
||||||
},
|
},
|
||||||
/// Relative timelock locktime
|
/// Relative timelock locktime
|
||||||
RelativeTimelock {
|
RelativeTimelock {
|
||||||
/// The locktime value
|
/// The timelock value
|
||||||
value: u32,
|
value: Sequence,
|
||||||
},
|
},
|
||||||
/// Multi-signature public keys with threshold count
|
/// Multi-signature public keys with threshold count
|
||||||
Multisig {
|
Multisig {
|
||||||
@@ -165,7 +171,7 @@ impl SatisfiableItem {
|
|||||||
|
|
||||||
/// Returns a unique id for the [`SatisfiableItem`]
|
/// Returns a unique id for the [`SatisfiableItem`]
|
||||||
pub fn id(&self) -> String {
|
pub fn id(&self) -> String {
|
||||||
get_checksum(&serde_json::to_string(self).expect("Failed to serialize a SatisfiableItem"))
|
calc_checksum(&serde_json::to_string(self).expect("Failed to serialize a SatisfiableItem"))
|
||||||
.expect("Failed to compute a SatisfiableItem id")
|
.expect("Failed to compute a SatisfiableItem id")
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -438,32 +444,33 @@ pub struct Policy {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// An extra condition that must be satisfied but that is out of control of the user
|
/// An extra condition that must be satisfied but that is out of control of the user
|
||||||
#[derive(Hash, Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord, Default, Serialize)]
|
/// TODO: use `bitcoin::LockTime` and `bitcoin::Sequence`
|
||||||
|
#[derive(Hash, Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Default, Serialize)]
|
||||||
pub struct Condition {
|
pub struct Condition {
|
||||||
/// Optional CheckSequenceVerify condition
|
/// Optional CheckSequenceVerify condition
|
||||||
#[serde(skip_serializing_if = "Option::is_none")]
|
#[serde(skip_serializing_if = "Option::is_none")]
|
||||||
pub csv: Option<u32>,
|
pub csv: Option<Sequence>,
|
||||||
/// Optional timelock condition
|
/// Optional timelock condition
|
||||||
#[serde(skip_serializing_if = "Option::is_none")]
|
#[serde(skip_serializing_if = "Option::is_none")]
|
||||||
pub timelock: Option<u32>,
|
pub timelock: Option<absolute::LockTime>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Condition {
|
impl Condition {
|
||||||
fn merge_nlocktime(a: u32, b: u32) -> Result<u32, PolicyError> {
|
fn merge_nlocktime(
|
||||||
if (a < utils::BLOCKS_TIMELOCK_THRESHOLD) != (b < utils::BLOCKS_TIMELOCK_THRESHOLD) {
|
a: absolute::LockTime,
|
||||||
|
b: absolute::LockTime,
|
||||||
|
) -> Result<absolute::LockTime, PolicyError> {
|
||||||
|
if !a.is_same_unit(b) {
|
||||||
Err(PolicyError::MixedTimelockUnits)
|
Err(PolicyError::MixedTimelockUnits)
|
||||||
|
} else if a > b {
|
||||||
|
Ok(a)
|
||||||
} else {
|
} else {
|
||||||
Ok(max(a, b))
|
Ok(b)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn merge_nsequence(a: u32, b: u32) -> Result<u32, PolicyError> {
|
fn merge_nsequence(a: Sequence, b: Sequence) -> Result<Sequence, PolicyError> {
|
||||||
let mask = utils::SEQUENCE_LOCKTIME_TYPE_FLAG | utils::SEQUENCE_LOCKTIME_MASK;
|
if a.is_time_locked() != b.is_time_locked() {
|
||||||
|
|
||||||
let a = a & mask;
|
|
||||||
let b = b & mask;
|
|
||||||
|
|
||||||
if (a < utils::SEQUENCE_LOCKTIME_TYPE_FLAG) != (b < utils::SEQUENCE_LOCKTIME_TYPE_FLAG) {
|
|
||||||
Err(PolicyError::MixedTimelockUnits)
|
Err(PolicyError::MixedTimelockUnits)
|
||||||
} else {
|
} else {
|
||||||
Ok(max(a, b))
|
Ok(max(a, b))
|
||||||
@@ -511,7 +518,14 @@ pub enum PolicyError {
|
|||||||
|
|
||||||
impl fmt::Display for PolicyError {
|
impl fmt::Display for PolicyError {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::NotEnoughItemsSelected(err) => write!(f, "Not enought items selected: {}", err),
|
||||||
|
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
||||||
|
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
||||||
|
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
||||||
|
Self::MixedTimelockUnits => write!(f, "Mixed timelock units"),
|
||||||
|
Self::IncompatibleConditions => write!(f, "Incompatible conditions"),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -651,11 +665,11 @@ impl Policy {
|
|||||||
(0..*threshold).collect()
|
(0..*threshold).collect()
|
||||||
}
|
}
|
||||||
SatisfiableItem::Multisig { keys, .. } => (0..keys.len()).collect(),
|
SatisfiableItem::Multisig { keys, .. } => (0..keys.len()).collect(),
|
||||||
_ => vec![],
|
_ => HashSet::new(),
|
||||||
};
|
};
|
||||||
let selected = match path.get(&self.id) {
|
let selected: HashSet<_> = match path.get(&self.id) {
|
||||||
Some(arr) => arr,
|
Some(arr) => arr.iter().copied().collect(),
|
||||||
_ => &default,
|
_ => default,
|
||||||
};
|
};
|
||||||
|
|
||||||
match &self.item {
|
match &self.item {
|
||||||
@@ -663,14 +677,24 @@ impl Policy {
|
|||||||
let mapped_req = items
|
let mapped_req = items
|
||||||
.iter()
|
.iter()
|
||||||
.map(|i| i.get_condition(path))
|
.map(|i| i.get_condition(path))
|
||||||
.collect::<Result<Vec<_>, _>>()?;
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// if all the requirements are null we don't care about `selected` because there
|
// if all the requirements are null we don't care about `selected` because there
|
||||||
// are no requirements
|
// are no requirements
|
||||||
if mapped_req.iter().all(Condition::is_null) {
|
if mapped_req
|
||||||
|
.iter()
|
||||||
|
.all(|cond| matches!(cond, Ok(c) if c.is_null()))
|
||||||
|
{
|
||||||
return Ok(Condition::default());
|
return Ok(Condition::default());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// make sure all the indexes in the `selected` list are within range
|
||||||
|
for index in &selected {
|
||||||
|
if *index >= items.len() {
|
||||||
|
return Err(PolicyError::IndexOutOfRange(*index));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// if we have something, make sure we have enough items. note that the user can set
|
// if we have something, make sure we have enough items. note that the user can set
|
||||||
// an empty value for this step in case of n-of-n, because `selected` is set to all
|
// an empty value for this step in case of n-of-n, because `selected` is set to all
|
||||||
// the elements above
|
// the elements above
|
||||||
@@ -679,23 +703,18 @@ impl Policy {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// check the selected items, see if there are conflicting requirements
|
// check the selected items, see if there are conflicting requirements
|
||||||
let mut requirements = Condition::default();
|
mapped_req
|
||||||
for item_index in selected {
|
.into_iter()
|
||||||
requirements = requirements.merge(
|
.enumerate()
|
||||||
mapped_req
|
.filter(|(index, _)| selected.contains(index))
|
||||||
.get(*item_index)
|
.try_fold(Condition::default(), |acc, (_, cond)| acc.merge(&cond?))
|
||||||
.ok_or(PolicyError::IndexOutOfRange(*item_index))?,
|
|
||||||
)?;
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(requirements)
|
|
||||||
}
|
}
|
||||||
SatisfiableItem::Multisig { keys, threshold } => {
|
SatisfiableItem::Multisig { keys, threshold } => {
|
||||||
if selected.len() < *threshold {
|
if selected.len() < *threshold {
|
||||||
return Err(PolicyError::NotEnoughItemsSelected(self.id.clone()));
|
return Err(PolicyError::NotEnoughItemsSelected(self.id.clone()));
|
||||||
}
|
}
|
||||||
if let Some(item) = selected.iter().find(|i| **i >= keys.len()) {
|
if let Some(item) = selected.into_iter().find(|&i| i >= keys.len()) {
|
||||||
return Err(PolicyError::IndexOutOfRange(*item));
|
return Err(PolicyError::IndexOutOfRange(item));
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(Condition::default())
|
Ok(Condition::default())
|
||||||
@@ -720,16 +739,20 @@ impl From<SatisfiableItem> for Policy {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn signer_id(key: &DescriptorPublicKey, secp: &SecpCtx) -> SignerId {
|
fn signer_id(key: &DescriptorPublicKey, secp: &SecpCtx) -> SignerId {
|
||||||
|
// For consistency we always compute the key hash in "ecdsa" form (with the leading sign
|
||||||
|
// prefix) even if we are in a taproot descriptor. We just want some kind of unique identifier
|
||||||
|
// for a key, so it doesn't really matter how the identifier is computed.
|
||||||
match key {
|
match key {
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
DescriptorPublicKey::Single(SinglePub {
|
||||||
key: SinglePubKey::FullKey(pk),
|
key: SinglePubKey::FullKey(pk),
|
||||||
..
|
..
|
||||||
}) => pk.to_pubkeyhash().into(),
|
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
DescriptorPublicKey::Single(SinglePub {
|
||||||
key: SinglePubKey::XOnly(pk),
|
key: SinglePubKey::XOnly(pk),
|
||||||
..
|
..
|
||||||
}) => pk.to_pubkeyhash().into(),
|
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
||||||
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -767,9 +790,9 @@ fn make_generic_signature<M: Fn() -> SatisfiableItem, F: Fn(&Psbt) -> bool>(
|
|||||||
fn generic_sig_in_psbt<
|
fn generic_sig_in_psbt<
|
||||||
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
||||||
// for a specific key
|
// for a specific key
|
||||||
C: Fn(&PsbtInput, &SinglePubKey) -> bool,
|
C: Fn(&psbt::Input, &SinglePubKey) -> bool,
|
||||||
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
||||||
E: Fn(&PsbtInput, Fingerprint) -> Option<SinglePubKey>,
|
E: Fn(&psbt::Input, Fingerprint) -> Option<SinglePubKey>,
|
||||||
>(
|
>(
|
||||||
psbt: &Psbt,
|
psbt: &Psbt,
|
||||||
key: &DescriptorPublicKey,
|
key: &DescriptorPublicKey,
|
||||||
@@ -779,7 +802,7 @@ fn generic_sig_in_psbt<
|
|||||||
) -> bool {
|
) -> bool {
|
||||||
//TODO check signature validity
|
//TODO check signature validity
|
||||||
psbt.inputs.iter().all(|input| match key {
|
psbt.inputs.iter().all(|input| match key {
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub { key, .. }) => check(input, key),
|
DescriptorPublicKey::Single(SinglePub { key, .. }) => check(input, key),
|
||||||
DescriptorPublicKey::XPub(xpub) => {
|
DescriptorPublicKey::XPub(xpub) => {
|
||||||
//TODO check actual derivation matches
|
//TODO check actual derivation matches
|
||||||
match extract(input, xpub.root_fingerprint(secp)) {
|
match extract(input, xpub.root_fingerprint(secp)) {
|
||||||
@@ -787,6 +810,13 @@ fn generic_sig_in_psbt<
|
|||||||
None => false,
|
None => false,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => {
|
||||||
|
//TODO check actual derivation matches
|
||||||
|
match extract(input, xpub.root_fingerprint(secp)) {
|
||||||
|
Some(pubkey) => check(input, &pubkey),
|
||||||
|
None => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -891,10 +921,13 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
Some(Ctx::make_signature(pubkey_hash, signers, build_sat, secp))
|
Some(Ctx::make_signature(pubkey_hash, signers, build_sat, secp))
|
||||||
}
|
}
|
||||||
Terminal::After(value) => {
|
Terminal::After(value) => {
|
||||||
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock { value: *value }.into();
|
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
||||||
|
value: (*value).into(),
|
||||||
|
}
|
||||||
|
.into();
|
||||||
policy.contribution = Satisfaction::Complete {
|
policy.contribution = Satisfaction::Complete {
|
||||||
condition: Condition {
|
condition: Condition {
|
||||||
timelock: Some(*value),
|
timelock: Some((*value).into()),
|
||||||
csv: None,
|
csv: None,
|
||||||
},
|
},
|
||||||
};
|
};
|
||||||
@@ -905,9 +938,11 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
} = build_sat
|
} = build_sat
|
||||||
{
|
{
|
||||||
let after = After::new(Some(current_height), false);
|
let after = After::new(Some(current_height), false);
|
||||||
let after_sat = Satisfier::<bitcoin::PublicKey>::check_after(&after, *value);
|
let after_sat =
|
||||||
let inputs_sat = psbt_inputs_sat(psbt)
|
Satisfier::<bitcoin::PublicKey>::check_after(&after, (*value).into());
|
||||||
.all(|sat| Satisfier::<bitcoin::PublicKey>::check_after(&sat, *value));
|
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
||||||
|
Satisfier::<bitcoin::PublicKey>::check_after(&sat, (*value).into())
|
||||||
|
});
|
||||||
if after_sat && inputs_sat {
|
if after_sat && inputs_sat {
|
||||||
policy.satisfaction = policy.contribution.clone();
|
policy.satisfaction = policy.contribution.clone();
|
||||||
}
|
}
|
||||||
@@ -999,6 +1034,9 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
|
|
||||||
Policy::make_thresh(mapped, threshold)?
|
Policy::make_thresh(mapped, threshold)?
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Unsupported
|
||||||
|
Terminal::RawPkH(_) => None,
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1124,14 +1162,13 @@ mod test {
|
|||||||
use crate::descriptor::{ExtractPolicy, IntoWalletDescriptor};
|
use crate::descriptor::{ExtractPolicy, IntoWalletDescriptor};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::descriptor::derived::AsDerived;
|
|
||||||
use crate::descriptor::policy::SatisfiableItem::{EcdsaSignature, Multisig, Thresh};
|
use crate::descriptor::policy::SatisfiableItem::{EcdsaSignature, Multisig, Thresh};
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
use crate::wallet::signer::SignersContainer;
|
use crate::wallet::signer::SignersContainer;
|
||||||
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use miniscript::DescriptorTrait;
|
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
use std::sync::Arc;
|
use std::sync::Arc;
|
||||||
|
|
||||||
@@ -1172,8 +1209,8 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint));
|
assert_matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint);
|
||||||
assert!(matches!(&policy.contribution, Satisfaction::None));
|
assert_matches!(&policy.contribution, Satisfaction::None);
|
||||||
|
|
||||||
let desc = descriptor!(wpkh(prvkey)).unwrap();
|
let desc = descriptor!(wpkh(prvkey)).unwrap();
|
||||||
let (wallet_desc, keymap) = desc
|
let (wallet_desc, keymap) = desc
|
||||||
@@ -1185,10 +1222,8 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint));
|
assert_matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint);
|
||||||
assert!(
|
assert_matches!(&policy.contribution, Satisfaction::Complete {condition} if condition.csv.is_none() && condition.timelock.is_none());
|
||||||
matches!(&policy.contribution, Satisfaction::Complete {condition} if condition.csv == None && condition.timelock == None)
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// 2 pub keys descriptor, required 2 prv keys
|
// 2 pub keys descriptor, required 2 prv keys
|
||||||
@@ -1207,19 +1242,16 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.item, Multisig { keys, threshold } if threshold == &2usize
|
||||||
matches!(&policy.item, Multisig { keys, threshold } if threshold == &2usize
|
|
||||||
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
||||||
&& keys[1] == PkOrF::Fingerprint(fingerprint1))
|
&& keys[1] == PkOrF::Fingerprint(fingerprint1)
|
||||||
);
|
);
|
||||||
// TODO should this be "Satisfaction::None" since we have no prv keys?
|
// TODO should this be "Satisfaction::None" since we have no prv keys?
|
||||||
// TODO should items and conditions not be empty?
|
// TODO should items and conditions not be empty?
|
||||||
assert!(
|
assert_matches!(&policy.contribution, Satisfaction::Partial { n, m, items, conditions, ..} if n == &2usize
|
||||||
matches!(&policy.contribution, Satisfaction::Partial { n, m, items, conditions, ..} if n == &2usize
|
|
||||||
&& m == &2usize
|
&& m == &2usize
|
||||||
&& items.is_empty()
|
&& items.is_empty()
|
||||||
&& conditions.is_empty()
|
&& conditions.is_empty()
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1238,18 +1270,15 @@ mod test {
|
|||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert!(
|
assert_matches!(&policy.item, Multisig { keys, threshold } if threshold == &2usize
|
||||||
matches!(&policy.item, Multisig { keys, threshold } if threshold == &2usize
|
|
||||||
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
||||||
&& keys[1] == PkOrF::Fingerprint(fingerprint1))
|
&& keys[1] == PkOrF::Fingerprint(fingerprint1)
|
||||||
);
|
);
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.contribution, Satisfaction::Partial { n, m, items, conditions, ..} if n == &2usize
|
||||||
matches!(&policy.contribution, Satisfaction::Partial { n, m, items, conditions, ..} if n == &2usize
|
|
||||||
&& m == &2usize
|
&& m == &2usize
|
||||||
&& items.len() == 1
|
&& items.len() == 1
|
||||||
&& conditions.contains_key(&0)
|
&& conditions.contains_key(&0)
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1271,18 +1300,15 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.item, Multisig { keys, threshold } if threshold == &1
|
||||||
matches!(&policy.item, Multisig { keys, threshold } if threshold == &1
|
|
||||||
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
||||||
&& keys[1] == PkOrF::Fingerprint(fingerprint1))
|
&& keys[1] == PkOrF::Fingerprint(fingerprint1)
|
||||||
);
|
);
|
||||||
assert!(
|
assert_matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &2
|
||||||
matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &2
|
|
||||||
&& m == &1
|
&& m == &1
|
||||||
&& items.len() == 2
|
&& items.len() == 2
|
||||||
&& conditions.contains_key(&vec![0])
|
&& conditions.contains_key(&vec![0])
|
||||||
&& conditions.contains_key(&vec![1])
|
&& conditions.contains_key(&vec![1])
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1303,18 +1329,15 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.item, Multisig { keys, threshold } if threshold == &2
|
||||||
matches!(&policy.item, Multisig { keys, threshold } if threshold == &2
|
|
||||||
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
||||||
&& keys[1] == PkOrF::Fingerprint(fingerprint1))
|
&& keys[1] == PkOrF::Fingerprint(fingerprint1)
|
||||||
);
|
);
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &2
|
||||||
matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &2
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items.len() == 2
|
&& items.len() == 2
|
||||||
&& conditions.contains_key(&vec![0,1])
|
&& conditions.contains_key(&vec![0,1])
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1329,31 +1352,27 @@ mod test {
|
|||||||
let (wallet_desc, keymap) = desc
|
let (wallet_desc, keymap) = desc
|
||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let single_key = wallet_desc.derive(0);
|
|
||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
let policy = single_key
|
let policy = wallet_desc
|
||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint));
|
assert_matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint);
|
||||||
assert!(matches!(&policy.contribution, Satisfaction::None));
|
assert_matches!(&policy.contribution, Satisfaction::None);
|
||||||
|
|
||||||
let desc = descriptor!(wpkh(prvkey)).unwrap();
|
let desc = descriptor!(wpkh(prvkey)).unwrap();
|
||||||
let (wallet_desc, keymap) = desc
|
let (wallet_desc, keymap) = desc
|
||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let single_key = wallet_desc.derive(0);
|
|
||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
let policy = single_key
|
let policy = wallet_desc
|
||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(matches!(&policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == &fingerprint));
|
assert_matches!(policy.item, EcdsaSignature(PkOrF::Fingerprint(f)) if f == fingerprint);
|
||||||
assert!(
|
assert_matches!(policy.contribution, Satisfaction::Complete {condition} if condition.csv.is_none() && condition.timelock.is_none());
|
||||||
matches!(&policy.contribution, Satisfaction::Complete {condition} if condition.csv == None && condition.timelock == None)
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// single key, 1 prv and 1 pub key descriptor, required 1 prv keys
|
// single key, 1 prv and 1 pub key descriptor, required 1 prv keys
|
||||||
@@ -1368,25 +1387,21 @@ mod test {
|
|||||||
let (wallet_desc, keymap) = desc
|
let (wallet_desc, keymap) = desc
|
||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let single_key = wallet_desc.derive(0);
|
|
||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
let policy = single_key
|
let policy = wallet_desc
|
||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(policy.item, Multisig { keys, threshold } if threshold == 1
|
||||||
matches!(&policy.item, Multisig { keys, threshold } if threshold == &1
|
|
||||||
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
&& keys[0] == PkOrF::Fingerprint(fingerprint0)
|
||||||
&& keys[1] == PkOrF::Fingerprint(fingerprint1))
|
&& keys[1] == PkOrF::Fingerprint(fingerprint1)
|
||||||
);
|
);
|
||||||
assert!(
|
assert_matches!(policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == 2
|
||||||
matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &2
|
&& m == 1
|
||||||
&& m == &1
|
|
||||||
&& items.len() == 2
|
&& items.len() == 2
|
||||||
&& conditions.contains_key(&vec![0])
|
&& conditions.contains_key(&vec![0])
|
||||||
&& conditions.contains_key(&vec![1])
|
&& conditions.contains_key(&vec![1])
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1418,18 +1433,14 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.item, Thresh { items, threshold } if items.len() == 3 && threshold == &2);
|
||||||
matches!(&policy.item, Thresh { items, threshold } if items.len() == 3 && threshold == &2)
|
|
||||||
);
|
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &3
|
||||||
matches!(&policy.contribution, Satisfaction::PartialComplete { n, m, items, conditions, .. } if n == &3
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items.len() == 3
|
&& items.len() == 3
|
||||||
&& conditions.get(&vec![0,1]).unwrap().iter().next().unwrap().csv.is_none()
|
&& conditions.get(&vec![0,1]).unwrap().iter().next().unwrap().csv.is_none()
|
||||||
&& conditions.get(&vec![0,2]).unwrap().iter().next().unwrap().csv == Some(sequence)
|
&& conditions.get(&vec![0,2]).unwrap().iter().next().unwrap().csv == Some(Sequence(sequence))
|
||||||
&& conditions.get(&vec![1,2]).unwrap().iter().next().unwrap().csv == Some(sequence)
|
&& conditions.get(&vec![1,2]).unwrap().iter().next().unwrap().csv == Some(Sequence(sequence))
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1574,7 +1585,8 @@ mod test {
|
|||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.as_derived(0, &secp)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -1592,11 +1604,9 @@ mod test {
|
|||||||
.unwrap();
|
.unwrap();
|
||||||
//println!("{}", serde_json::to_string(&policy_alice_psbt).unwrap());
|
//println!("{}", serde_json::to_string(&policy_alice_psbt).unwrap());
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy_alice_psbt.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &2
|
||||||
matches!(&policy_alice_psbt.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &2
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items == &vec![0]
|
&& items == &vec![0]
|
||||||
)
|
|
||||||
);
|
);
|
||||||
|
|
||||||
let psbt = Psbt::from_str(BOB_SIGNED_PSBT).unwrap();
|
let psbt = Psbt::from_str(BOB_SIGNED_PSBT).unwrap();
|
||||||
@@ -1606,11 +1616,9 @@ mod test {
|
|||||||
.unwrap();
|
.unwrap();
|
||||||
//println!("{}", serde_json::to_string(&policy_bob_psbt).unwrap());
|
//println!("{}", serde_json::to_string(&policy_bob_psbt).unwrap());
|
||||||
|
|
||||||
assert!(
|
assert_matches!(&policy_bob_psbt.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &2
|
||||||
matches!(&policy_bob_psbt.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &2
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items == &vec![1]
|
&& items == &vec![1]
|
||||||
)
|
|
||||||
);
|
);
|
||||||
|
|
||||||
let psbt = Psbt::from_str(ALICE_BOB_SIGNED_PSBT).unwrap();
|
let psbt = Psbt::from_str(ALICE_BOB_SIGNED_PSBT).unwrap();
|
||||||
@@ -1618,11 +1626,9 @@ mod test {
|
|||||||
.extract_policy(&signers_container, BuildSatisfaction::Psbt(&psbt), &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::Psbt(&psbt), &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert!(
|
assert_matches!(&policy_alice_bob_psbt.satisfaction, Satisfaction::PartialComplete { n, m, items, .. } if n == &2
|
||||||
matches!(&policy_alice_bob_psbt.satisfaction, Satisfaction::PartialComplete { n, m, items, .. } if n == &2
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items == &vec![0, 1]
|
&& items == &vec![0, 1]
|
||||||
)
|
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1646,7 +1652,8 @@ mod test {
|
|||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.as_derived(0, &secp)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -1666,11 +1673,9 @@ mod test {
|
|||||||
.extract_policy(&signers_container, build_sat, &secp)
|
.extract_policy(&signers_container, build_sat, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert!(
|
assert_matches!(&policy.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &3
|
||||||
matches!(&policy.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &3
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items.is_empty()
|
&& items.is_empty()
|
||||||
)
|
|
||||||
);
|
);
|
||||||
//println!("{}", serde_json::to_string(&policy).unwrap());
|
//println!("{}", serde_json::to_string(&policy).unwrap());
|
||||||
|
|
||||||
@@ -1684,11 +1689,9 @@ mod test {
|
|||||||
.extract_policy(&signers_container, build_sat_expired, &secp)
|
.extract_policy(&signers_container, build_sat_expired, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert!(
|
assert_matches!(&policy_expired.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &3
|
||||||
matches!(&policy_expired.satisfaction, Satisfaction::Partial { n, m, items, .. } if n == &3
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items == &vec![0]
|
&& items == &vec![0]
|
||||||
)
|
|
||||||
);
|
);
|
||||||
//println!("{}", serde_json::to_string(&policy_expired).unwrap());
|
//println!("{}", serde_json::to_string(&policy_expired).unwrap());
|
||||||
|
|
||||||
@@ -1704,11 +1707,9 @@ mod test {
|
|||||||
.extract_policy(&signers_container, build_sat_expired_signed, &secp)
|
.extract_policy(&signers_container, build_sat_expired_signed, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert!(
|
assert_matches!(&policy_expired_signed.satisfaction, Satisfaction::PartialComplete { n, m, items, .. } if n == &3
|
||||||
matches!(&policy_expired_signed.satisfaction, Satisfaction::PartialComplete { n, m, items, .. } if n == &3
|
|
||||||
&& m == &2
|
&& m == &2
|
||||||
&& items == &vec![0, 1]
|
&& items == &vec![0, 1]
|
||||||
)
|
|
||||||
);
|
);
|
||||||
//println!("{}", serde_json::to_string(&policy_expired_signed).unwrap());
|
//println!("{}", serde_json::to_string(&policy_expired_signed).unwrap());
|
||||||
}
|
}
|
||||||
@@ -1783,12 +1784,8 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(policy.item, SatisfiableItem::Thresh { ref items, threshold: 1 } if items.len() == 2);
|
||||||
matches!(policy.item, SatisfiableItem::Thresh { ref items, threshold: 1 } if items.len() == 2)
|
assert_matches!(policy.contribution, Satisfaction::PartialComplete { n: 2, m: 1, items, .. } if items == vec![1]);
|
||||||
);
|
|
||||||
assert!(
|
|
||||||
matches!(policy.contribution, Satisfaction::PartialComplete { n: 2, m: 1, items, .. } if items == vec![1])
|
|
||||||
);
|
|
||||||
|
|
||||||
let alice_sig = SatisfiableItem::SchnorrSignature(PkOrF::Fingerprint(alice_fing));
|
let alice_sig = SatisfiableItem::SchnorrSignature(PkOrF::Fingerprint(alice_fing));
|
||||||
let bob_sig = SatisfiableItem::SchnorrSignature(PkOrF::Fingerprint(bob_fing));
|
let bob_sig = SatisfiableItem::SchnorrSignature(PkOrF::Fingerprint(bob_fing));
|
||||||
@@ -1880,19 +1877,11 @@ mod test {
|
|||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
assert!(
|
assert_matches!(policy_unsigned.item, SatisfiableItem::Thresh { ref items, threshold: 1 } if items.len() == 2);
|
||||||
matches!(policy_unsigned.item, SatisfiableItem::Thresh { ref items, threshold: 1 } if items.len() == 2)
|
assert_matches!(policy_unsigned.satisfaction, Satisfaction::Partial { n: 2, m: 1, items, .. } if items.is_empty());
|
||||||
);
|
|
||||||
assert!(
|
|
||||||
matches!(policy_unsigned.satisfaction, Satisfaction::Partial { n: 2, m: 1, items, .. } if items.is_empty())
|
|
||||||
);
|
|
||||||
|
|
||||||
assert!(
|
assert_matches!(policy_signed.item, SatisfiableItem::Thresh { ref items, threshold: 1 } if items.len() == 2);
|
||||||
matches!(policy_signed.item, SatisfiableItem::Thresh { ref items, threshold: 1 } if items.len() == 2)
|
assert_matches!(policy_signed.satisfaction, Satisfaction::PartialComplete { n: 2, m: 1, items, .. } if items == vec![0, 1]);
|
||||||
);
|
|
||||||
assert!(
|
|
||||||
matches!(policy_signed.satisfaction, Satisfaction::PartialComplete { n: 2, m: 1, items, .. } if items == vec![0, 1])
|
|
||||||
);
|
|
||||||
|
|
||||||
let satisfied_items = match policy_signed.item {
|
let satisfied_items = match policy_signed.item {
|
||||||
SatisfiableItem::Thresh { items, .. } => items,
|
SatisfiableItem::Thresh { items, .. } => items,
|
||||||
|
|||||||
@@ -14,10 +14,10 @@
|
|||||||
//! This module contains the definition of various common script templates that are ready to be
|
//! This module contains the definition of various common script templates that are ready to be
|
||||||
//! used. See the documentation of each template for an example.
|
//! used. See the documentation of each template for an example.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::{Legacy, Segwitv0};
|
use miniscript::{Legacy, Segwitv0, Tap};
|
||||||
|
|
||||||
use super::{ExtendedDescriptor, IntoWalletDescriptor, KeyMap};
|
use super::{ExtendedDescriptor, IntoWalletDescriptor, KeyMap};
|
||||||
use crate::descriptor::DescriptorError;
|
use crate::descriptor::DescriptorError;
|
||||||
@@ -170,6 +170,35 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh<K> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// P2TR template. Expands to a descriptor `tr(key)`
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::Wallet;
|
||||||
|
/// # use bdk::database::MemoryDatabase;
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::P2TR;
|
||||||
|
///
|
||||||
|
/// let key =
|
||||||
|
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
||||||
|
/// let mut wallet = Wallet::new(P2TR(key), None, Network::Testnet, MemoryDatabase::default())?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(
|
||||||
|
/// wallet.get_address(New)?.to_string(),
|
||||||
|
/// "tb1pvjf9t34fznr53u5tqhejz4nr69luzkhlvsdsdfq9pglutrpve2xq7hps46"
|
||||||
|
/// );
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct P2TR<K: IntoDescriptorKey<Tap>>(pub K);
|
||||||
|
|
||||||
|
impl<K: IntoDescriptorKey<Tap>> DescriptorTemplate for P2TR<K> {
|
||||||
|
fn build(self, _network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
descriptor!(tr(self.0))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// BIP44 template. Expands to `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
/// BIP44 template. Expands to `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
///
|
///
|
||||||
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
||||||
@@ -186,7 +215,7 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44;
|
/// use bdk::template::Bip44;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip44(key.clone(), KeychainKind::External),
|
/// Bip44(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip44(key, KeychainKind::Internal)),
|
/// Some(Bip44(key, KeychainKind::Internal)),
|
||||||
@@ -225,8 +254,8 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44Public;
|
/// use bdk::template::Bip44Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@@ -235,14 +264,17 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44<K> {
|
|||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "miNG7dJTzJqNbFS19svRdTCisC65dsubtR");
|
/// assert_eq!(wallet.get_address(New)?.to_string(), "miNG7dJTzJqNbFS19svRdTCisC65dsubtR");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "pkh([c55b303f/44'/0'/0']tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU/0/*)#xgaaevjx");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "pkh([c55b303f/44'/1'/0']tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU/0/*)#cfhumdqz");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip44Public<K: DerivableKey<Legacy>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
pub struct Bip44Public<K: DerivableKey<Legacy>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
|
|
||||||
impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
||||||
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
P2Pkh(legacy::make_bipxx_public(44, self.0, self.1, self.2)?).build(network)
|
P2Pkh(legacy::make_bipxx_public(
|
||||||
|
44, self.0, self.1, self.2, network,
|
||||||
|
)?)
|
||||||
|
.build(network)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -262,7 +294,7 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49;
|
/// use bdk::template::Bip49;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip49(key.clone(), KeychainKind::External),
|
/// Bip49(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip49(key, KeychainKind::Internal)),
|
/// Some(Bip49(key, KeychainKind::Internal)),
|
||||||
@@ -284,7 +316,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
|||||||
|
|
||||||
/// BIP49 public template. Expands to `sh(wpkh(key/{0,1}/*))`
|
/// BIP49 public template. Expands to `sh(wpkh(key/{0,1}/*))`
|
||||||
///
|
///
|
||||||
/// This assumes that the key used has already been derived with `m/49'/0'/0'`.
|
/// This assumes that the key used has already been derived with `m/49'/0'/0'` for Mainnet or `m/49'/1'/0'` for Testnet.
|
||||||
///
|
///
|
||||||
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
||||||
///
|
///
|
||||||
@@ -301,8 +333,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49Public;
|
/// use bdk::template::Bip49Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@@ -311,14 +343,17 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
|||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt");
|
/// assert_eq!(wallet.get_address(New)?.to_string(), "2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "sh(wpkh([c55b303f/49'/0'/0']tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L/0/*))#gsmdv4xr");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "sh(wpkh([c55b303f/49'/1'/0']tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L/0/*))#3tka9g0q");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip49Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
pub struct Bip49Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
|
|
||||||
impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
||||||
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
P2Wpkh_P2Sh(segwit_v0::make_bipxx_public(49, self.0, self.1, self.2)?).build(network)
|
P2Wpkh_P2Sh(segwit_v0::make_bipxx_public(
|
||||||
|
49, self.0, self.1, self.2, network,
|
||||||
|
)?)
|
||||||
|
.build(network)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -338,7 +373,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84;
|
/// use bdk::template::Bip84;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip84(key.clone(), KeychainKind::External),
|
/// Bip84(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip84(key, KeychainKind::Internal)),
|
/// Some(Bip84(key, KeychainKind::Internal)),
|
||||||
@@ -360,7 +395,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
|||||||
|
|
||||||
/// BIP84 public template. Expands to `wpkh(key/{0,1}/*)`
|
/// BIP84 public template. Expands to `wpkh(key/{0,1}/*)`
|
||||||
///
|
///
|
||||||
/// This assumes that the key used has already been derived with `m/84'/0'/0'`.
|
/// This assumes that the key used has already been derived with `m/84'/0'/0'` for Mainnet or `m/84'/1'/0'` for Testnet.
|
||||||
///
|
///
|
||||||
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
||||||
///
|
///
|
||||||
@@ -377,8 +412,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84Public;
|
/// use bdk::template::Bip84Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@@ -387,14 +422,96 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
|||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "tb1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2pr6y4qc7");
|
/// assert_eq!(wallet.get_address(New)?.to_string(), "tb1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2pr6y4qc7");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "wpkh([c55b303f/84\'/0\'/0\']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#nkk5dtkg");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "wpkh([c55b303f/84'/1'/0']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#dhu402yv");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip84Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
pub struct Bip84Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
|
|
||||||
impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84Public<K> {
|
impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84Public<K> {
|
||||||
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
P2Wpkh(segwit_v0::make_bipxx_public(84, self.0, self.1, self.2)?).build(network)
|
P2Wpkh(segwit_v0::make_bipxx_public(
|
||||||
|
84, self.0, self.1, self.2, network,
|
||||||
|
)?)
|
||||||
|
.build(network)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// BIP86 template. Expands to `tr(key/86'/{0,1}'/0'/{0,1}/*)`
|
||||||
|
///
|
||||||
|
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
||||||
|
///
|
||||||
|
/// See [`Bip86Public`] for a template that can work with a `xpub`/`tpub`.
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
|
/// # use bdk::database::MemoryDatabase;
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::Bip86;
|
||||||
|
///
|
||||||
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
|
/// let mut wallet = Wallet::new(
|
||||||
|
/// Bip86(key.clone(), KeychainKind::External),
|
||||||
|
/// Some(Bip86(key, KeychainKind::Internal)),
|
||||||
|
/// Network::Testnet,
|
||||||
|
/// MemoryDatabase::default()
|
||||||
|
/// )?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(wallet.get_address(New)?.to_string(), "tb1p5unlj09djx8xsjwe97269kqtxqpwpu2epeskgqjfk4lnf69v4tnqpp35qu");
|
||||||
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "tr([c55b303f/86'/1'/0']tpubDCiHofpEs47kx358bPdJmTZHmCDqQ8qw32upCSxHrSEdeeBs2T5Mq6QMB2ukeMqhNBiyhosBvJErteVhfURPGXPv3qLJPw5MVpHUewsbP2m/0/*)#dkgvr5hm");
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct Bip86<K: DerivableKey<Tap>>(pub K, pub KeychainKind);
|
||||||
|
|
||||||
|
impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86<K> {
|
||||||
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
P2TR(segwit_v1::make_bipxx_private(86, self.0, self.1, network)?).build(network)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// BIP86 public template. Expands to `tr(key/{0,1}/*)`
|
||||||
|
///
|
||||||
|
/// This assumes that the key used has already been derived with `m/86'/0'/0'` for Mainnet or `m/86'/1'/0'` for Testnet.
|
||||||
|
///
|
||||||
|
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
||||||
|
///
|
||||||
|
/// See [`Bip86`] for a template that does the full derivation, but requires private data
|
||||||
|
/// for the key.
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
|
/// # use bdk::database::MemoryDatabase;
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::Bip86Public;
|
||||||
|
///
|
||||||
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
|
/// let mut wallet = Wallet::new(
|
||||||
|
/// Bip86Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
|
/// Some(Bip86Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
|
/// Network::Testnet,
|
||||||
|
/// MemoryDatabase::default()
|
||||||
|
/// )?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(wallet.get_address(New)?.to_string(), "tb1pwjp9f2k5n0xq73ecuu0c5njvgqr3vkh7yaylmpqvsuuaafymh0msvcmh37");
|
||||||
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "tr([c55b303f/86'/1'/0']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#2p65srku");
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct Bip86Public<K: DerivableKey<Tap>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
|
|
||||||
|
impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86Public<K> {
|
||||||
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
P2TR(segwit_v1::make_bipxx_public(
|
||||||
|
86, self.0, self.1, self.2, network,
|
||||||
|
)?)
|
||||||
|
.build(network)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -440,6 +557,7 @@ macro_rules! expand_make_bipxx {
|
|||||||
key: K,
|
key: K,
|
||||||
parent_fingerprint: bip32::Fingerprint,
|
parent_fingerprint: bip32::Fingerprint,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
|
network: Network,
|
||||||
) -> Result<impl IntoDescriptorKey<$ctx>, DescriptorError> {
|
) -> Result<impl IntoDescriptorKey<$ctx>, DescriptorError> {
|
||||||
let derivation_path: bip32::DerivationPath = match keychain {
|
let derivation_path: bip32::DerivationPath = match keychain {
|
||||||
KeychainKind::External => vec![bip32::ChildNumber::from_normal_idx(0)?].into(),
|
KeychainKind::External => vec![bip32::ChildNumber::from_normal_idx(0)?].into(),
|
||||||
@@ -448,7 +566,10 @@ macro_rules! expand_make_bipxx {
|
|||||||
|
|
||||||
let source_path = bip32::DerivationPath::from(vec![
|
let source_path = bip32::DerivationPath::from(vec![
|
||||||
bip32::ChildNumber::from_hardened_idx(bip)?,
|
bip32::ChildNumber::from_hardened_idx(bip)?,
|
||||||
bip32::ChildNumber::from_hardened_idx(0)?,
|
match network {
|
||||||
|
Network::Bitcoin => bip32::ChildNumber::from_hardened_idx(0)?,
|
||||||
|
_ => bip32::ChildNumber::from_hardened_idx(1)?,
|
||||||
|
},
|
||||||
bip32::ChildNumber::from_hardened_idx(0)?,
|
bip32::ChildNumber::from_hardened_idx(0)?,
|
||||||
]);
|
]);
|
||||||
|
|
||||||
@@ -460,6 +581,7 @@ macro_rules! expand_make_bipxx {
|
|||||||
|
|
||||||
expand_make_bipxx!(legacy, Legacy);
|
expand_make_bipxx!(legacy, Legacy);
|
||||||
expand_make_bipxx!(segwit_v0, Segwitv0);
|
expand_make_bipxx!(segwit_v0, Segwitv0);
|
||||||
|
expand_make_bipxx!(segwit_v1, Tap);
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
@@ -468,45 +590,43 @@ mod test {
|
|||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::descriptor::derived::AsDerived;
|
|
||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::ValidNetworks;
|
use crate::keys::ValidNetworks;
|
||||||
use bitcoin::network::constants::Network::Regtest;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, DescriptorTrait, KeyMap};
|
|
||||||
use miniscript::Descriptor;
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template_cointype() {
|
fn test_bip44_template_cointype() {
|
||||||
use bitcoin::util::bip32::ChildNumber::{self, Hardened};
|
use bitcoin::bip32::ChildNumber::{self, Hardened};
|
||||||
|
|
||||||
let xprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
let xprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
||||||
assert_eq!(Network::Bitcoin, xprvkey.network);
|
assert_eq!(Network::Bitcoin, xprvkey.network);
|
||||||
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Bitcoin)
|
.build(Network::Bitcoin)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.get(0).unwrap();
|
||||||
assert!(matches!(purpose, Hardened { index: 44 }));
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert!(matches!(coin_type, Hardened { index: 0 }));
|
assert_matches!(coin_type, Hardened { index: 0 });
|
||||||
}
|
}
|
||||||
|
|
||||||
let tprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let tprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
assert_eq!(Network::Testnet, tprvkey.network);
|
assert_eq!(Network::Testnet, tprvkey.network);
|
||||||
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Testnet)
|
.build(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.get(0).unwrap();
|
||||||
assert!(matches!(purpose, Hardened { index: 44 }));
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert!(matches!(coin_type, Hardened { index: 1 }));
|
assert_matches!(coin_type, Hardened { index: 1 });
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -514,22 +634,23 @@ mod test {
|
|||||||
fn check(
|
fn check(
|
||||||
desc: Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>,
|
desc: Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>,
|
||||||
is_witness: bool,
|
is_witness: bool,
|
||||||
|
is_taproot: bool,
|
||||||
is_fixed: bool,
|
is_fixed: bool,
|
||||||
|
network: Network,
|
||||||
expected: &[&str],
|
expected: &[&str],
|
||||||
) {
|
) {
|
||||||
let secp = Secp256k1::new();
|
|
||||||
|
|
||||||
let (desc, _key_map, _networks) = desc.unwrap();
|
let (desc, _key_map, _networks) = desc.unwrap();
|
||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
assert_eq!(!desc.is_deriveable(), is_fixed);
|
assert_eq!(desc.is_taproot(), is_taproot);
|
||||||
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let index = i as u32;
|
||||||
let child_desc = if !desc.is_deriveable() {
|
let child_desc = if !desc.has_wildcard() {
|
||||||
desc.as_derived_fixed(&secp)
|
desc.at_derivation_index(0).unwrap()
|
||||||
} else {
|
} else {
|
||||||
desc.as_derived(index, &secp)
|
desc.at_derivation_index(index).unwrap()
|
||||||
};
|
};
|
||||||
let address = child_desc.address(Regtest).unwrap();
|
let address = child_desc.address(network).unwrap();
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -543,7 +664,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Pkh(prvkey).build(Network::Bitcoin),
|
P2Pkh(prvkey).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"],
|
&["mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -554,7 +677,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Pkh(pubkey).build(Network::Bitcoin),
|
P2Pkh(pubkey).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["muZpTpBYhxmRFuCjLc7C6BBDF32C8XVJUi"],
|
&["muZpTpBYhxmRFuCjLc7C6BBDF32C8XVJUi"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@@ -568,7 +693,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh_P2Sh(prvkey).build(Network::Bitcoin),
|
P2Wpkh_P2Sh(prvkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"],
|
&["2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -579,7 +706,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh_P2Sh(pubkey).build(Network::Bitcoin),
|
P2Wpkh_P2Sh(pubkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["2N5LiC3CqzxDamRTPG1kiNv1FpNJQ7x28sb"],
|
&["2N5LiC3CqzxDamRTPG1kiNv1FpNJQ7x28sb"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@@ -593,7 +722,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh(prvkey).build(Network::Bitcoin),
|
P2Wpkh(prvkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["bcrt1q4525hmgw265tl3drrl8jjta7ayffu6jfcwxx9y"],
|
&["bcrt1q4525hmgw265tl3drrl8jjta7ayffu6jfcwxx9y"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -604,19 +735,52 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh(pubkey).build(Network::Bitcoin),
|
P2Wpkh(pubkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["bcrt1qngw83fg8dz0k749cg7k3emc7v98wy0c7azaa6h"],
|
&["bcrt1qngw83fg8dz0k749cg7k3emc7v98wy0c7azaa6h"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// P2TR `tr(key)`
|
||||||
|
#[test]
|
||||||
|
fn test_p2tr_template() {
|
||||||
|
let prvkey =
|
||||||
|
bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")
|
||||||
|
.unwrap();
|
||||||
|
check(
|
||||||
|
P2TR(prvkey).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
true,
|
||||||
|
Network::Regtest,
|
||||||
|
&["bcrt1pvjf9t34fznr53u5tqhejz4nr69luzkhlvsdsdfq9pglutrpve2xqnwtkqq"],
|
||||||
|
);
|
||||||
|
|
||||||
|
let pubkey = bitcoin::PublicKey::from_str(
|
||||||
|
"03a34b99f22c790c4e36b2b3c2c35a36db06226e41c692fc82b8b56ac1c540c5bd",
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
check(
|
||||||
|
P2TR(pubkey).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
true,
|
||||||
|
Network::Regtest,
|
||||||
|
&["bcrt1pw74tdcrxlzn5r8z6ku2vztr86fgq0m245s72mjktf4afwzsf8ugs4evwdf"],
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template() {
|
fn test_bip44_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"n453VtnjDHPyDt2fDstKSu7A3YCJoHZ5g5",
|
"n453VtnjDHPyDt2fDstKSu7A3YCJoHZ5g5",
|
||||||
"mvfrrumXgTtwFPWDNUecBBgzuMXhYM7KRP",
|
"mvfrrumXgTtwFPWDNUecBBgzuMXhYM7KRP",
|
||||||
@@ -627,6 +791,8 @@ mod test {
|
|||||||
Bip44(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"muHF98X9KxEzdKrnFAX85KeHv96eXopaip",
|
"muHF98X9KxEzdKrnFAX85KeHv96eXopaip",
|
||||||
"n4hpyLJE5ub6B5Bymv4eqFxS5KjrewSmYR",
|
"n4hpyLJE5ub6B5Bymv4eqFxS5KjrewSmYR",
|
||||||
@@ -638,12 +804,14 @@ mod test {
|
|||||||
// BIP44 public `pkh(key/{0,1}/*)`
|
// BIP44 public `pkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_public_template() {
|
fn test_bip44_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"miNG7dJTzJqNbFS19svRdTCisC65dsubtR",
|
"miNG7dJTzJqNbFS19svRdTCisC65dsubtR",
|
||||||
"n2UqaDbCjWSFJvpC84m3FjUk5UaeibCzYg",
|
"n2UqaDbCjWSFJvpC84m3FjUk5UaeibCzYg",
|
||||||
@@ -654,6 +822,8 @@ mod test {
|
|||||||
Bip44Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"moDr3vJ8wpt5nNxSK55MPq797nXJb2Ru9H",
|
"moDr3vJ8wpt5nNxSK55MPq797nXJb2Ru9H",
|
||||||
"ms7A1Yt4uTezT2XkefW12AvLoko8WfNJMG",
|
"ms7A1Yt4uTezT2XkefW12AvLoko8WfNJMG",
|
||||||
@@ -665,11 +835,13 @@ mod test {
|
|||||||
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_template() {
|
fn test_bip49_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2N9bCAJXGm168MjVwpkBdNt6ucka3PKVoUV",
|
"2N9bCAJXGm168MjVwpkBdNt6ucka3PKVoUV",
|
||||||
"2NDckYkqrYyDMtttEav5hB3Bfw9EGAW5HtS",
|
"2NDckYkqrYyDMtttEav5hB3Bfw9EGAW5HtS",
|
||||||
@@ -680,6 +852,8 @@ mod test {
|
|||||||
Bip49(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2NB3pA8PnzJLGV8YEKNDFpbViZv3Bm1K6CG",
|
"2NB3pA8PnzJLGV8YEKNDFpbViZv3Bm1K6CG",
|
||||||
"2NBiX2Wzxngb5rPiWpUiJQ2uLVB4HBjFD4p",
|
"2NBiX2Wzxngb5rPiWpUiJQ2uLVB4HBjFD4p",
|
||||||
@@ -691,12 +865,14 @@ mod test {
|
|||||||
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_public_template() {
|
fn test_bip49_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt",
|
"2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt",
|
||||||
"2NCTQfJ1sZa3wQ3pPseYRHbaNEpC3AquEfX",
|
"2NCTQfJ1sZa3wQ3pPseYRHbaNEpC3AquEfX",
|
||||||
@@ -707,6 +883,8 @@ mod test {
|
|||||||
Bip49Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2NF2vttKibwyxigxtx95Zw8K7JhDbo5zPVJ",
|
"2NF2vttKibwyxigxtx95Zw8K7JhDbo5zPVJ",
|
||||||
"2Mtmyd8taksxNVWCJ4wVvaiss7QPZGcAJuH",
|
"2Mtmyd8taksxNVWCJ4wVvaiss7QPZGcAJuH",
|
||||||
@@ -718,11 +896,13 @@ mod test {
|
|||||||
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_template() {
|
fn test_bip84_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qkmvk2nadgplmd57ztld8nf8v2yxkzmdvwtjf8s",
|
"bcrt1qkmvk2nadgplmd57ztld8nf8v2yxkzmdvwtjf8s",
|
||||||
"bcrt1qx0v6zgfwe50m4kqc58cqzcyem7ay2sfl3gvqhp",
|
"bcrt1qx0v6zgfwe50m4kqc58cqzcyem7ay2sfl3gvqhp",
|
||||||
@@ -733,6 +913,8 @@ mod test {
|
|||||||
Bip84(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qtrwtz00wxl69e5xex7amy4xzlxkaefg3gfdkxa",
|
"bcrt1qtrwtz00wxl69e5xex7amy4xzlxkaefg3gfdkxa",
|
||||||
"bcrt1qqqasfhxpkkf7zrxqnkr2sfhn74dgsrc3e3ky45",
|
"bcrt1qqqasfhxpkkf7zrxqnkr2sfhn74dgsrc3e3ky45",
|
||||||
@@ -744,12 +926,14 @@ mod test {
|
|||||||
// BIP84 public `wpkh(key/{0,1}/*)`
|
// BIP84 public `wpkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_public_template() {
|
fn test_bip84_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2prcdvd0h",
|
"bcrt1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2prcdvd0h",
|
||||||
"bcrt1q3lncdlwq3lgcaaeyruynjnlccr0ve0kakh6ana",
|
"bcrt1q3lncdlwq3lgcaaeyruynjnlccr0ve0kakh6ana",
|
||||||
@@ -760,6 +944,8 @@ mod test {
|
|||||||
Bip84Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qm6wqukenh7guu792lj2njgw9n78cmwsy8xy3z2",
|
"bcrt1qm6wqukenh7guu792lj2njgw9n78cmwsy8xy3z2",
|
||||||
"bcrt1q694twxtjn4nnrvnyvra769j0a23rllj5c6cgwp",
|
"bcrt1q694twxtjn4nnrvnyvra769j0a23rllj5c6cgwp",
|
||||||
@@ -767,4 +953,67 @@ mod test {
|
|||||||
],
|
],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// BIP86 `tr(key/86'/0'/0'/{0,1}/*)`
|
||||||
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
|
#[test]
|
||||||
|
fn test_bip86_template() {
|
||||||
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
||||||
|
check(
|
||||||
|
Bip86(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p5cyxnuxmeuwuvkwfem96lqzszd02n6xdcjrs20cac6yqjjwudpxqkedrcr",
|
||||||
|
"bc1p4qhjn9zdvkux4e44uhx8tc55attvtyu358kutcqkudyccelu0was9fqzwh",
|
||||||
|
"bc1p0d0rhyynq0awa9m8cqrcr8f5nxqx3aw29w4ru5u9my3h0sfygnzs9khxz8",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
check(
|
||||||
|
Bip86(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p3qkhfews2uk44qtvauqyr2ttdsw7svhkl9nkm9s9c3x4ax5h60wqwruhk7",
|
||||||
|
"bc1ptdg60grjk9t3qqcqczp4tlyy3z47yrx9nhlrjsmw36q5a72lhdrs9f00nj",
|
||||||
|
"bc1pgcwgsu8naxp7xlp5p7ufzs7emtfza2las7r2e7krzjhe5qj5xz2q88kmk5",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// BIP86 public `tr(key/{0,1}/*)`
|
||||||
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
|
#[test]
|
||||||
|
fn test_bip86_public_template() {
|
||||||
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
||||||
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
||||||
|
check(
|
||||||
|
Bip86Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p5cyxnuxmeuwuvkwfem96lqzszd02n6xdcjrs20cac6yqjjwudpxqkedrcr",
|
||||||
|
"bc1p4qhjn9zdvkux4e44uhx8tc55attvtyu358kutcqkudyccelu0was9fqzwh",
|
||||||
|
"bc1p0d0rhyynq0awa9m8cqrcr8f5nxqx3aw29w4ru5u9my3h0sfygnzs9khxz8",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
check(
|
||||||
|
Bip86Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p3qkhfews2uk44qtvauqyr2ttdsw7svhkl9nkm9s9c3x4ax5h60wqwruhk7",
|
||||||
|
"bc1ptdg60grjk9t3qqcqczp4tlyy3z47yrx9nhlrjsmw36q5a72lhdrs9f00nj",
|
||||||
|
"bc1pgcwgsu8naxp7xlp5p7ufzs7emtfza2las7r2e7krzjhe5qj5xz2q88kmk5",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
133
src/error.rs
133
src/error.rs
@@ -12,7 +12,7 @@
|
|||||||
use std::fmt;
|
use std::fmt;
|
||||||
|
|
||||||
use crate::bitcoin::Network;
|
use crate::bitcoin::Network;
|
||||||
use crate::{descriptor, wallet, wallet::address_validator};
|
use crate::{descriptor, wallet};
|
||||||
use bitcoin::{OutPoint, Txid};
|
use bitcoin::{OutPoint, Txid};
|
||||||
|
|
||||||
/// Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
/// Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||||
@@ -86,6 +86,8 @@ pub enum Error {
|
|||||||
/// found network, for example the network of the bitcoin node
|
/// found network, for example the network of the bitcoin node
|
||||||
found: Network,
|
found: Network,
|
||||||
},
|
},
|
||||||
|
/// The address requested comes from an hardened index
|
||||||
|
HardenedIndex,
|
||||||
#[cfg(feature = "verify")]
|
#[cfg(feature = "verify")]
|
||||||
/// Transaction verification error
|
/// Transaction verification error
|
||||||
Verification(crate::wallet::verify::VerifyError),
|
Verification(crate::wallet::verify::VerifyError),
|
||||||
@@ -99,24 +101,24 @@ pub enum Error {
|
|||||||
|
|
||||||
/// Error related to the parsing and usage of descriptors
|
/// Error related to the parsing and usage of descriptors
|
||||||
Descriptor(crate::descriptor::error::Error),
|
Descriptor(crate::descriptor::error::Error),
|
||||||
/// Error that can be returned to fail the validation of an address
|
|
||||||
AddressValidator(crate::wallet::address_validator::AddressValidatorError),
|
|
||||||
/// Encoding error
|
/// Encoding error
|
||||||
Encode(bitcoin::consensus::encode::Error),
|
Encode(bitcoin::consensus::encode::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
|
/// Miniscript PSBT error
|
||||||
|
MiniscriptPsbt(MiniscriptPsbtError),
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// An ECDSA error
|
/// A secp256k1 error
|
||||||
Secp256k1(bitcoin::secp256k1::Error),
|
Secp256k1(bitcoin::secp256k1::Error),
|
||||||
/// Error serializing or deserializing JSON data
|
/// Error serializing or deserializing JSON data
|
||||||
Json(serde_json::Error),
|
Json(serde_json::Error),
|
||||||
/// Hex decoding error
|
/// Hex decoding error
|
||||||
Hex(bitcoin::hashes::hex::Error),
|
Hex(bitcoin::hashes::hex::Error),
|
||||||
/// Partially signed bitcoin transaction error
|
/// Partially signed bitcoin transaction error
|
||||||
Psbt(bitcoin::util::psbt::Error),
|
Psbt(bitcoin::psbt::Error),
|
||||||
/// Partially signed bitcoin transaction parse error
|
/// Partially signed bitcoin transaction parse error
|
||||||
PsbtParse(bitcoin::util::psbt::PsbtParseError),
|
PsbtParse(bitcoin::psbt::PsbtParseError),
|
||||||
|
|
||||||
//KeyMismatch(bitcoin::secp256k1::PublicKey, bitcoin::secp256k1::PublicKey),
|
//KeyMismatch(bitcoin::secp256k1::PublicKey, bitcoin::secp256k1::PublicKey),
|
||||||
//MissingInputUTXO(usize),
|
//MissingInputUTXO(usize),
|
||||||
@@ -149,6 +151,26 @@ pub enum Error {
|
|||||||
Rusqlite(rusqlite::Error),
|
Rusqlite(rusqlite::Error),
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub enum MiniscriptPsbtError {
|
||||||
|
Conversion(miniscript::descriptor::ConversionError),
|
||||||
|
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||||
|
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for MiniscriptPsbtError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||||
|
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||||
|
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl std::error::Error for MiniscriptPsbtError {}
|
||||||
|
|
||||||
/// Represents the last failed [`crate::blockchain::WalletSync`] sync attempt in which we were short
|
/// Represents the last failed [`crate::blockchain::WalletSync`] sync attempt in which we were short
|
||||||
/// on cached `scriptPubKey`s.
|
/// on cached `scriptPubKey`s.
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
@@ -161,7 +183,94 @@ pub struct MissingCachedScripts {
|
|||||||
|
|
||||||
impl fmt::Display for Error {
|
impl fmt::Display for Error {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::InvalidU32Bytes(_) => write!(
|
||||||
|
f,
|
||||||
|
"Wrong number of bytes found when trying to convert to u32"
|
||||||
|
),
|
||||||
|
Self::Generic(err) => write!(f, "Generic error: {}", err),
|
||||||
|
Self::ScriptDoesntHaveAddressForm => write!(f, "Script doesn't have address form"),
|
||||||
|
Self::NoRecipients => write!(f, "Cannot build tx without recipients"),
|
||||||
|
Self::NoUtxosSelected => write!(f, "No UTXO selected"),
|
||||||
|
Self::OutputBelowDustLimit(limit) => {
|
||||||
|
write!(f, "Output below the dust limit: {}", limit)
|
||||||
|
}
|
||||||
|
Self::InsufficientFunds { needed, available } => write!(
|
||||||
|
f,
|
||||||
|
"Insufficient funds: {} sat available of {} sat needed",
|
||||||
|
available, needed
|
||||||
|
),
|
||||||
|
Self::BnBTotalTriesExceeded => {
|
||||||
|
write!(f, "Branch and bound coin selection: total tries exceeded")
|
||||||
|
}
|
||||||
|
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
||||||
|
Self::UnknownUtxo => write!(f, "UTXO not found in the internal database"),
|
||||||
|
Self::TransactionNotFound => {
|
||||||
|
write!(f, "Transaction not found in the internal database")
|
||||||
|
}
|
||||||
|
Self::TransactionConfirmed => write!(f, "Transaction already confirmed"),
|
||||||
|
Self::IrreplaceableTransaction => write!(f, "Transaction can't be replaced"),
|
||||||
|
Self::FeeRateTooLow { required } => write!(
|
||||||
|
f,
|
||||||
|
"Fee rate too low: required {} sat/vbyte",
|
||||||
|
required.as_sat_per_vb()
|
||||||
|
),
|
||||||
|
Self::FeeTooLow { required } => write!(f, "Fee to low: required {} sat", required),
|
||||||
|
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||||
|
Self::MissingKeyOrigin(err) => write!(f, "Missing key origin: {}", err),
|
||||||
|
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||||
|
Self::ChecksumMismatch => write!(f, "Descriptor checksum mismatch"),
|
||||||
|
Self::SpendingPolicyRequired(keychain_kind) => {
|
||||||
|
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||||
|
}
|
||||||
|
Self::InvalidPolicyPathError(err) => write!(f, "Invalid policy path: {}", err),
|
||||||
|
Self::Signer(err) => write!(f, "Signer error: {}", err),
|
||||||
|
Self::InvalidNetwork { requested, found } => write!(
|
||||||
|
f,
|
||||||
|
"Invalid network: requested {} but found {}",
|
||||||
|
requested, found
|
||||||
|
),
|
||||||
|
Self::HardenedIndex => write!(f, "Requested address from an hardened index"),
|
||||||
|
#[cfg(feature = "verify")]
|
||||||
|
Self::Verification(err) => write!(f, "Transaction verification error: {}", err),
|
||||||
|
Self::InvalidProgressValue(progress) => {
|
||||||
|
write!(f, "Invalid progress value: {}", progress)
|
||||||
|
}
|
||||||
|
Self::ProgressUpdateError => write!(
|
||||||
|
f,
|
||||||
|
"Progress update error (maybe the channel has been closed)"
|
||||||
|
),
|
||||||
|
Self::InvalidOutpoint(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"Requested outpoint doesn't exist in the tx: {}",
|
||||||
|
outpoint
|
||||||
|
),
|
||||||
|
Self::Descriptor(err) => write!(f, "Descriptor error: {}", err),
|
||||||
|
Self::Encode(err) => write!(f, "Encoding error: {}", err),
|
||||||
|
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
||||||
|
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||||
|
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
||||||
|
Self::Secp256k1(err) => write!(f, "Secp256k1 error: {}", err),
|
||||||
|
Self::Json(err) => write!(f, "Serialize/Deserialize JSON error: {}", err),
|
||||||
|
Self::Hex(err) => write!(f, "Hex decoding error: {}", err),
|
||||||
|
Self::Psbt(err) => write!(f, "PSBT error: {}", err),
|
||||||
|
Self::PsbtParse(err) => write!(f, "Impossible to parse PSBT: {}", err),
|
||||||
|
Self::MissingCachedScripts(missing_cached_scripts) => {
|
||||||
|
write!(f, "Missing cached scripts: {:?}", missing_cached_scripts)
|
||||||
|
}
|
||||||
|
#[cfg(feature = "electrum")]
|
||||||
|
Self::Electrum(err) => write!(f, "Electrum client error: {}", err),
|
||||||
|
#[cfg(feature = "esplora")]
|
||||||
|
Self::Esplora(err) => write!(f, "Esplora client error: {}", err),
|
||||||
|
#[cfg(feature = "compact_filters")]
|
||||||
|
Self::CompactFilters(err) => write!(f, "Compact filters client error: {}", err),
|
||||||
|
#[cfg(feature = "key-value-db")]
|
||||||
|
Self::Sled(err) => write!(f, "Sled database error: {}", err),
|
||||||
|
#[cfg(feature = "rpc")]
|
||||||
|
Self::Rpc(err) => write!(f, "RPC client error: {}", err),
|
||||||
|
#[cfg(feature = "sqlite")]
|
||||||
|
Self::Rusqlite(err) => write!(f, "SQLite error: {}", err),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -181,7 +290,6 @@ macro_rules! impl_error {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl_error!(descriptor::error::Error, Descriptor);
|
impl_error!(descriptor::error::Error, Descriptor);
|
||||||
impl_error!(address_validator::AddressValidatorError, AddressValidator);
|
|
||||||
impl_error!(descriptor::policy::PolicyError, InvalidPolicyPathError);
|
impl_error!(descriptor::policy::PolicyError, InvalidPolicyPathError);
|
||||||
impl_error!(wallet::signer::SignerError, Signer);
|
impl_error!(wallet::signer::SignerError, Signer);
|
||||||
|
|
||||||
@@ -198,12 +306,13 @@ impl From<crate::keys::KeyError> for Error {
|
|||||||
|
|
||||||
impl_error!(bitcoin::consensus::encode::Error, Encode);
|
impl_error!(bitcoin::consensus::encode::Error, Encode);
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
impl_error!(miniscript::Error, Miniscript);
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
impl_error!(MiniscriptPsbtError, MiniscriptPsbt);
|
||||||
|
impl_error!(bitcoin::bip32::Error, Bip32);
|
||||||
impl_error!(bitcoin::secp256k1::Error, Secp256k1);
|
impl_error!(bitcoin::secp256k1::Error, Secp256k1);
|
||||||
impl_error!(serde_json::Error, Json);
|
impl_error!(serde_json::Error, Json);
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
||||||
impl_error!(bitcoin::util::psbt::Error, Psbt);
|
impl_error!(bitcoin::psbt::Error, Psbt);
|
||||||
impl_error!(bitcoin::util::psbt::PsbtParseError, PsbtParse);
|
impl_error!(bitcoin::psbt::PsbtParseError, PsbtParse);
|
||||||
|
|
||||||
#[cfg(feature = "electrum")]
|
#[cfg(feature = "electrum")]
|
||||||
impl_error!(electrum_client::Error, Electrum);
|
impl_error!(electrum_client::Error, Electrum);
|
||||||
|
|||||||
@@ -14,7 +14,7 @@
|
|||||||
// TODO: maybe write our own implementation of bip39? Seems stupid to have an extra dependency for
|
// TODO: maybe write our own implementation of bip39? Seems stupid to have an extra dependency for
|
||||||
// something that should be fairly simple to re-implement.
|
// something that should be fairly simple to re-implement.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
@@ -141,7 +141,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
(word_count, language): Self::Options,
|
(word_count, language): Self::Options,
|
||||||
entropy: Self::Entropy,
|
entropy: Self::Entropy,
|
||||||
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
||||||
let entropy = &entropy.as_ref()[..(word_count as usize / 8)];
|
let entropy = &entropy[..(word_count as usize / 8)];
|
||||||
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
||||||
|
|
||||||
Ok(GeneratedKey::new(mnemonic, any_network()))
|
Ok(GeneratedKey::new(mnemonic, any_network()))
|
||||||
@@ -152,7 +152,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use bip39::{Language, Mnemonic};
|
use bip39::{Language, Mnemonic};
|
||||||
|
|
||||||
|
|||||||
@@ -19,13 +19,13 @@ use std::str::FromStr;
|
|||||||
|
|
||||||
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::{Network, PrivateKey, PublicKey, XOnlyPublicKey};
|
use bitcoin::{key::XOnlyPublicKey, Network, PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
||||||
pub use miniscript::descriptor::{
|
pub use miniscript::descriptor::{
|
||||||
DescriptorPublicKey, DescriptorSecretKey, DescriptorSinglePriv, DescriptorSinglePub, KeyMap,
|
DescriptorPublicKey, DescriptorSecretKey, KeyMap, SinglePriv, SinglePub, SinglePubKey,
|
||||||
SinglePubKey, SortedMultiVec,
|
SortedMultiVec,
|
||||||
};
|
};
|
||||||
pub use miniscript::ScriptContext;
|
pub use miniscript::ScriptContext;
|
||||||
use miniscript::{Miniscript, Terminal};
|
use miniscript::{Miniscript, Terminal};
|
||||||
@@ -40,7 +40,7 @@ pub mod bip39;
|
|||||||
/// Set of valid networks for a key
|
/// Set of valid networks for a key
|
||||||
pub type ValidNetworks = HashSet<Network>;
|
pub type ValidNetworks = HashSet<Network>;
|
||||||
|
|
||||||
/// Create a set containing mainnet, testnet and regtest
|
/// Create a set containing mainnet, testnet, signet, and regtest
|
||||||
pub fn any_network() -> ValidNetworks {
|
pub fn any_network() -> ValidNetworks {
|
||||||
vec![
|
vec![
|
||||||
Network::Bitcoin,
|
Network::Bitcoin,
|
||||||
@@ -95,7 +95,7 @@ impl<Ctx: ScriptContext> DescriptorKey<Ctx> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// This method is used internally by `bdk::fragment!` and `bdk::descriptor!`. It has to be
|
// This method is used internally by `bdk::fragment!` and `bdk::descriptor!`. It has to be
|
||||||
// public because it is effectively called by external crates, once the macros are expanded,
|
// public because it is effectively called by external crates once the macros are expanded,
|
||||||
// but since it is not meant to be part of the public api we hide it from the docs.
|
// but since it is not meant to be part of the public api we hide it from the docs.
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
pub fn extract(
|
pub fn extract(
|
||||||
@@ -110,7 +110,7 @@ impl<Ctx: ScriptContext> DescriptorKey<Ctx> {
|
|||||||
let mut key_map = KeyMap::with_capacity(1);
|
let mut key_map = KeyMap::with_capacity(1);
|
||||||
|
|
||||||
let public = secret
|
let public = secret
|
||||||
.as_public(secp)
|
.to_public(secp)
|
||||||
.map_err(|e| miniscript::Error::Unexpected(e.to_string()))?;
|
.map_err(|e| miniscript::Error::Unexpected(e.to_string()))?;
|
||||||
key_map.insert(public.clone(), secret);
|
key_map.insert(public.clone(), secret);
|
||||||
|
|
||||||
@@ -224,8 +224,8 @@ impl<Ctx: ScriptContext + 'static> ExtScriptContext for Ctx {
|
|||||||
/// use bdk::bitcoin::PublicKey;
|
/// use bdk::bitcoin::PublicKey;
|
||||||
///
|
///
|
||||||
/// use bdk::keys::{
|
/// use bdk::keys::{
|
||||||
/// mainnet_network, DescriptorKey, DescriptorPublicKey, DescriptorSinglePub,
|
/// mainnet_network, DescriptorKey, DescriptorPublicKey, IntoDescriptorKey, KeyError,
|
||||||
/// IntoDescriptorKey, KeyError, ScriptContext, SinglePubKey,
|
/// ScriptContext, SinglePub, SinglePubKey,
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// pub struct MyKeyType {
|
/// pub struct MyKeyType {
|
||||||
@@ -235,7 +235,7 @@ impl<Ctx: ScriptContext + 'static> ExtScriptContext for Ctx {
|
|||||||
/// impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for MyKeyType {
|
/// impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for MyKeyType {
|
||||||
/// fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
/// fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
||||||
/// Ok(DescriptorKey::from_public(
|
/// Ok(DescriptorKey::from_public(
|
||||||
/// DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
/// DescriptorPublicKey::Single(SinglePub {
|
||||||
/// origin: None,
|
/// origin: None,
|
||||||
/// key: SinglePubKey::FullKey(self.pubkey),
|
/// key: SinglePubKey::FullKey(self.pubkey),
|
||||||
/// }),
|
/// }),
|
||||||
@@ -375,7 +375,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// `(DerivableKey, KeySource, DerivationPath)` tuples.
|
/// `(DerivableKey, KeySource, DerivationPath)` tuples.
|
||||||
///
|
///
|
||||||
/// For key types that don't encode any indication about the path to use (like bip39), it's
|
/// For key types that don't encode any indication about the path to use (like bip39), it's
|
||||||
/// generally recommended to implemented this trait instead of [`IntoDescriptorKey`]. The same
|
/// generally recommended to implement this trait instead of [`IntoDescriptorKey`]. The same
|
||||||
/// rules regarding script context and valid networks apply.
|
/// rules regarding script context and valid networks apply.
|
||||||
///
|
///
|
||||||
/// ## Examples
|
/// ## Examples
|
||||||
@@ -385,12 +385,12 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// network: bitcoin::Network,
|
/// network: bitcoin::Network,
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
@@ -401,7 +401,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@@ -416,14 +416,14 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{
|
/// use bdk::keys::{
|
||||||
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
||||||
@@ -433,7 +433,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@@ -842,7 +842,7 @@ impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorKey<Ctx> {
|
|||||||
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorPublicKey {
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorPublicKey {
|
||||||
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
||||||
let networks = match self {
|
let networks = match self {
|
||||||
DescriptorPublicKey::SinglePub(_) => any_network(),
|
DescriptorPublicKey::Single(_) => any_network(),
|
||||||
DescriptorPublicKey::XPub(DescriptorXKey { xkey, .. })
|
DescriptorPublicKey::XPub(DescriptorXKey { xkey, .. })
|
||||||
if xkey.network == Network::Bitcoin =>
|
if xkey.network == Network::Bitcoin =>
|
||||||
{
|
{
|
||||||
@@ -857,7 +857,7 @@ impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorPublicKey {
|
|||||||
|
|
||||||
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PublicKey {
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PublicKey {
|
||||||
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
DescriptorPublicKey::Single(SinglePub {
|
||||||
key: SinglePubKey::FullKey(self),
|
key: SinglePubKey::FullKey(self),
|
||||||
origin: None,
|
origin: None,
|
||||||
})
|
})
|
||||||
@@ -867,7 +867,7 @@ impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PublicKey {
|
|||||||
|
|
||||||
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for XOnlyPublicKey {
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for XOnlyPublicKey {
|
||||||
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
||||||
DescriptorPublicKey::SinglePub(DescriptorSinglePub {
|
DescriptorPublicKey::Single(SinglePub {
|
||||||
key: SinglePubKey::XOnly(self),
|
key: SinglePubKey::XOnly(self),
|
||||||
origin: None,
|
origin: None,
|
||||||
})
|
})
|
||||||
@@ -878,7 +878,7 @@ impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for XOnlyPublicKey {
|
|||||||
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorSecretKey {
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorSecretKey {
|
||||||
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
||||||
let networks = match &self {
|
let networks = match &self {
|
||||||
DescriptorSecretKey::SinglePriv(sk) if sk.key.network == Network::Bitcoin => {
|
DescriptorSecretKey::Single(sk) if sk.key.network == Network::Bitcoin => {
|
||||||
mainnet_network()
|
mainnet_network()
|
||||||
}
|
}
|
||||||
DescriptorSecretKey::XPrv(DescriptorXKey { xkey, .. })
|
DescriptorSecretKey::XPrv(DescriptorXKey { xkey, .. })
|
||||||
@@ -903,7 +903,7 @@ impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for &'_ str {
|
|||||||
|
|
||||||
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PrivateKey {
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PrivateKey {
|
||||||
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
||||||
DescriptorSecretKey::SinglePriv(DescriptorSinglePriv {
|
DescriptorSecretKey::Single(SinglePriv {
|
||||||
key: self,
|
key: self,
|
||||||
origin: None,
|
origin: None,
|
||||||
})
|
})
|
||||||
@@ -925,17 +925,24 @@ pub enum KeyError {
|
|||||||
Message(String),
|
Message(String),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl_error!(miniscript::Error, Miniscript, KeyError);
|
impl_error!(miniscript::Error, Miniscript, KeyError);
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32, KeyError);
|
impl_error!(bitcoin::bip32::Error, Bip32, KeyError);
|
||||||
|
|
||||||
impl std::fmt::Display for KeyError {
|
impl std::fmt::Display for KeyError {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::InvalidScriptContext => write!(f, "Invalid script context"),
|
||||||
|
Self::InvalidNetwork => write!(f, "Invalid network"),
|
||||||
|
Self::InvalidChecksum => write!(f, "Invalid checksum"),
|
||||||
|
Self::Message(err) => write!(f, "{}", err),
|
||||||
|
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
||||||
|
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -943,7 +950,7 @@ impl std::error::Error for KeyError {}
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub mod test {
|
pub mod test {
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
|
|||||||
23
src/lib.rs
23
src/lib.rs
@@ -43,10 +43,6 @@
|
|||||||
//! blockchain data and an [electrum](https://docs.rs/electrum-client/) blockchain client to
|
//! blockchain data and an [electrum](https://docs.rs/electrum-client/) blockchain client to
|
||||||
//! interact with the bitcoin P2P network.
|
//! interact with the bitcoin P2P network.
|
||||||
//!
|
//!
|
||||||
//! ```toml
|
|
||||||
//! bdk = "0.21.0"
|
|
||||||
//! ```
|
|
||||||
//!
|
|
||||||
//! # Examples
|
//! # Examples
|
||||||
#![cfg_attr(
|
#![cfg_attr(
|
||||||
feature = "electrum",
|
feature = "electrum",
|
||||||
@@ -81,6 +77,7 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
//!
|
//!
|
||||||
//! ## Generate a few addresses
|
//! ## Generate a few addresses
|
||||||
//!
|
//!
|
||||||
|
//! ### Example
|
||||||
//! ```
|
//! ```
|
||||||
//! use bdk::{Wallet};
|
//! use bdk::{Wallet};
|
||||||
//! use bdk::database::MemoryDatabase;
|
//! use bdk::database::MemoryDatabase;
|
||||||
@@ -152,7 +149,7 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
//! ```no_run
|
//! ```no_run
|
||||||
//! use std::str::FromStr;
|
//! use std::str::FromStr;
|
||||||
//!
|
//!
|
||||||
//! use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
//! use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
//!
|
//!
|
||||||
//! use bdk::{Wallet, SignOptions};
|
//! use bdk::{Wallet, SignOptions};
|
||||||
//! use bdk::database::MemoryDatabase;
|
//! use bdk::database::MemoryDatabase;
|
||||||
@@ -206,6 +203,8 @@ pub extern crate miniscript;
|
|||||||
extern crate serde;
|
extern crate serde;
|
||||||
#[macro_use]
|
#[macro_use]
|
||||||
extern crate serde_json;
|
extern crate serde_json;
|
||||||
|
#[cfg(feature = "hardware-signer")]
|
||||||
|
pub extern crate hwi;
|
||||||
|
|
||||||
#[cfg(all(feature = "reqwest", feature = "ureq"))]
|
#[cfg(all(feature = "reqwest", feature = "ureq"))]
|
||||||
compile_error!("Features reqwest and ureq are mutually exclusive and cannot be enabled together");
|
compile_error!("Features reqwest and ureq are mutually exclusive and cannot be enabled together");
|
||||||
@@ -228,21 +227,21 @@ compile_error!(
|
|||||||
#[cfg(feature = "keys-bip39")]
|
#[cfg(feature = "keys-bip39")]
|
||||||
extern crate bip39;
|
extern crate bip39;
|
||||||
|
|
||||||
#[cfg(any(target_arch = "wasm32", feature = "async-interface"))]
|
#[cfg(feature = "async-interface")]
|
||||||
#[macro_use]
|
#[macro_use]
|
||||||
extern crate async_trait;
|
extern crate async_trait;
|
||||||
#[macro_use]
|
#[macro_use]
|
||||||
extern crate bdk_macros;
|
extern crate bdk_macros;
|
||||||
|
|
||||||
#[cfg(feature = "compact_filters")]
|
|
||||||
extern crate lazy_static;
|
|
||||||
|
|
||||||
#[cfg(feature = "rpc")]
|
#[cfg(feature = "rpc")]
|
||||||
pub extern crate bitcoincore_rpc;
|
pub extern crate bitcoincore_rpc;
|
||||||
|
|
||||||
#[cfg(feature = "electrum")]
|
#[cfg(feature = "electrum")]
|
||||||
pub extern crate electrum_client;
|
pub extern crate electrum_client;
|
||||||
|
|
||||||
|
#[cfg(feature = "esplora")]
|
||||||
|
pub extern crate esplora_client;
|
||||||
|
|
||||||
#[cfg(feature = "key-value-db")]
|
#[cfg(feature = "key-value-db")]
|
||||||
pub extern crate sled;
|
pub extern crate sled;
|
||||||
|
|
||||||
@@ -257,6 +256,9 @@ pub extern crate rusqlite;
|
|||||||
#[macro_use]
|
#[macro_use]
|
||||||
pub mod testutils;
|
pub mod testutils;
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
extern crate assert_matches;
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
#[macro_use]
|
#[macro_use]
|
||||||
pub(crate) mod error;
|
pub(crate) mod error;
|
||||||
@@ -266,7 +268,7 @@ pub mod descriptor;
|
|||||||
#[cfg(feature = "test-md-docs")]
|
#[cfg(feature = "test-md-docs")]
|
||||||
mod doctest;
|
mod doctest;
|
||||||
pub mod keys;
|
pub mod keys;
|
||||||
pub(crate) mod psbt;
|
pub mod psbt;
|
||||||
pub(crate) mod types;
|
pub(crate) mod types;
|
||||||
pub mod wallet;
|
pub mod wallet;
|
||||||
|
|
||||||
@@ -274,7 +276,6 @@ pub use descriptor::template;
|
|||||||
pub use descriptor::HdKeyPaths;
|
pub use descriptor::HdKeyPaths;
|
||||||
pub use error::Error;
|
pub use error::Error;
|
||||||
pub use types::*;
|
pub use types::*;
|
||||||
pub use wallet::address_validator;
|
|
||||||
pub use wallet::signer;
|
pub use wallet::signer;
|
||||||
pub use wallet::signer::SignOptions;
|
pub use wallet::signer::SignOptions;
|
||||||
pub use wallet::tx_builder::TxBuilder;
|
pub use wallet::tx_builder::TxBuilder;
|
||||||
|
|||||||
122
src/psbt/mod.rs
122
src/psbt/mod.rs
@@ -9,11 +9,28 @@
|
|||||||
// You may not use this file except in accordance with one or both of these
|
// You may not use this file except in accordance with one or both of these
|
||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
//! Additional functions on the `rust-bitcoin` `PartiallySignedTransaction` structure.
|
||||||
|
|
||||||
|
use crate::FeeRate;
|
||||||
|
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
use bitcoin::TxOut;
|
use bitcoin::TxOut;
|
||||||
|
|
||||||
|
// TODO upstream the functions here to `rust-bitcoin`?
|
||||||
|
|
||||||
|
/// Trait to add functions to extract utxos and calculate fees.
|
||||||
pub trait PsbtUtils {
|
pub trait PsbtUtils {
|
||||||
|
/// Get the `TxOut` for the specified input index, if it doesn't exist in the PSBT `None` is returned.
|
||||||
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut>;
|
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut>;
|
||||||
|
|
||||||
|
/// The total transaction fee amount, sum of input amounts minus sum of output amounts, in sats.
|
||||||
|
/// If the PSBT is missing a TxOut for an input returns None.
|
||||||
|
fn fee_amount(&self) -> Option<u64>;
|
||||||
|
|
||||||
|
/// The transaction's fee rate. This value will only be accurate if calculated AFTER the
|
||||||
|
/// `PartiallySignedTransaction` is finalized and all witness/signature data is added to the
|
||||||
|
/// transaction.
|
||||||
|
/// If the PSBT is missing a TxOut for an input returns None.
|
||||||
|
fn fee_rate(&self) -> Option<FeeRate>;
|
||||||
}
|
}
|
||||||
|
|
||||||
impl PsbtUtils for Psbt {
|
impl PsbtUtils for Psbt {
|
||||||
@@ -37,6 +54,27 @@ impl PsbtUtils for Psbt {
|
|||||||
None
|
None
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fn fee_amount(&self) -> Option<u64> {
|
||||||
|
let tx = &self.unsigned_tx;
|
||||||
|
let utxos: Option<Vec<TxOut>> = (0..tx.input.len()).map(|i| self.get_utxo_for(i)).collect();
|
||||||
|
|
||||||
|
utxos.map(|inputs| {
|
||||||
|
let input_amount: u64 = inputs.iter().map(|i| i.value).sum();
|
||||||
|
let output_amount: u64 = self.unsigned_tx.output.iter().map(|o| o.value).sum();
|
||||||
|
input_amount
|
||||||
|
.checked_sub(output_amount)
|
||||||
|
.expect("input amount must be greater than output amount")
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn fee_rate(&self) -> Option<FeeRate> {
|
||||||
|
let fee_amount = self.fee_amount();
|
||||||
|
fee_amount.map(|fee| {
|
||||||
|
let weight = self.clone().extract_tx().weight();
|
||||||
|
FeeRate::from_wu(fee, weight)
|
||||||
|
})
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
@@ -44,8 +82,9 @@ mod test {
|
|||||||
use crate::bitcoin::TxIn;
|
use crate::bitcoin::TxIn;
|
||||||
use crate::psbt::Psbt;
|
use crate::psbt::Psbt;
|
||||||
use crate::wallet::AddressIndex;
|
use crate::wallet::AddressIndex;
|
||||||
|
use crate::wallet::AddressIndex::New;
|
||||||
use crate::wallet::{get_funded_wallet, test::get_test_wpkh};
|
use crate::wallet::{get_funded_wallet, test::get_test_wpkh};
|
||||||
use crate::SignOptions;
|
use crate::{psbt, FeeRate, SignOptions};
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
// from bip 174
|
// from bip 174
|
||||||
@@ -118,4 +157,83 @@ mod test {
|
|||||||
|
|
||||||
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_fee_rate_with_witness_utxo() {
|
||||||
|
use psbt::PsbtUtils;
|
||||||
|
|
||||||
|
let expected_fee_rate = 1.2345;
|
||||||
|
|
||||||
|
let (wallet, _, _) = get_funded_wallet("wpkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = wallet.get_address(New).unwrap();
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let (mut psbt, _) = builder.finish().unwrap();
|
||||||
|
let fee_amount = psbt.fee_amount();
|
||||||
|
assert!(fee_amount.is_some());
|
||||||
|
|
||||||
|
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
|
||||||
|
let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let finalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() >= expected_fee_rate);
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() < unfinalized_fee_rate.as_sat_per_vb());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_fee_rate_with_nonwitness_utxo() {
|
||||||
|
use psbt::PsbtUtils;
|
||||||
|
|
||||||
|
let expected_fee_rate = 1.2345;
|
||||||
|
|
||||||
|
let (wallet, _, _) = get_funded_wallet("pkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = wallet.get_address(New).unwrap();
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let (mut psbt, _) = builder.finish().unwrap();
|
||||||
|
let fee_amount = psbt.fee_amount();
|
||||||
|
assert!(fee_amount.is_some());
|
||||||
|
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
|
||||||
|
let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let finalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() >= expected_fee_rate);
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() < unfinalized_fee_rate.as_sat_per_vb());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_fee_rate_with_missing_txout() {
|
||||||
|
use psbt::PsbtUtils;
|
||||||
|
|
||||||
|
let expected_fee_rate = 1.2345;
|
||||||
|
|
||||||
|
let (wpkh_wallet, _, _) = get_funded_wallet("wpkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = wpkh_wallet.get_address(New).unwrap();
|
||||||
|
let mut builder = wpkh_wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let (mut wpkh_psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
|
wpkh_psbt.inputs[0].witness_utxo = None;
|
||||||
|
wpkh_psbt.inputs[0].non_witness_utxo = None;
|
||||||
|
assert!(wpkh_psbt.fee_amount().is_none());
|
||||||
|
assert!(wpkh_psbt.fee_rate().is_none());
|
||||||
|
|
||||||
|
let (pkh_wallet, _, _) = get_funded_wallet("pkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = pkh_wallet.get_address(New).unwrap();
|
||||||
|
let mut builder = pkh_wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let (mut pkh_psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
|
pkh_psbt.inputs[0].non_witness_utxo = None;
|
||||||
|
assert!(pkh_psbt.fee_amount().is_none());
|
||||||
|
assert!(pkh_psbt.fee_rate().is_none());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,12 +1,22 @@
|
|||||||
|
// Bitcoin Dev Kit
|
||||||
|
//
|
||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
use crate::testutils::TestIncomingTx;
|
use crate::testutils::TestIncomingTx;
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hashes::hex::{FromHex, ToHex};
|
|
||||||
use bitcoin::hashes::sha256d;
|
use bitcoin::hashes::sha256d;
|
||||||
use bitcoin::{Address, Amount, Script, Transaction, Txid, Witness};
|
use bitcoin::{absolute, Address, Amount, Script, ScriptBuf, Sequence, Transaction, Txid, Witness};
|
||||||
pub use bitcoincore_rpc::bitcoincore_rpc_json::AddressType;
|
pub use bitcoincore_rpc::json::AddressType;
|
||||||
pub use bitcoincore_rpc::{Auth, Client as RpcClient, RpcApi};
|
pub use bitcoincore_rpc::{Auth, Client as RpcClient, RpcApi};
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
use electrsd::bitcoind::BitcoinD;
|
use electrsd::bitcoind::BitcoinD;
|
||||||
|
use electrsd::electrum_client::ElectrumApi as _;
|
||||||
use electrsd::{bitcoind, ElectrsD};
|
use electrsd::{bitcoind, ElectrsD};
|
||||||
pub use electrum_client::{Client as ElectrumClient, ElectrumApi};
|
pub use electrum_client::{Client as ElectrumClient, ElectrumApi};
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
@@ -35,7 +45,11 @@ impl TestClient {
|
|||||||
|
|
||||||
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &conf).unwrap();
|
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &conf).unwrap();
|
||||||
|
|
||||||
let node_address = bitcoind.client.get_new_address(None, None).unwrap();
|
let node_address = bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
bitcoind
|
bitcoind
|
||||||
.client
|
.client
|
||||||
.generate_to_address(101, &node_address)
|
.generate_to_address(101, &node_address)
|
||||||
@@ -97,7 +111,7 @@ impl TestClient {
|
|||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
if self.get_balance(None, None).unwrap() < Amount::from_sat(required_balance) {
|
if self.get_balance(None, None).unwrap() < Amount::from_sat(required_balance) {
|
||||||
panic!("Insufficient funds in bitcoind. Please generate a few blocks with: `bitcoin-cli generatetoaddress 10 {}`", self.get_new_address(None, None).unwrap());
|
panic!("Insufficient funds in bitcoind. Please generate a few blocks with: `bitcoin-cli generatetoaddress 10 {}`", self.get_new_address(None, None).unwrap().assume_checked());
|
||||||
}
|
}
|
||||||
|
|
||||||
// FIXME: core can't create a tx with two outputs to the same address
|
// FIXME: core can't create a tx with two outputs to the same address
|
||||||
@@ -110,7 +124,7 @@ impl TestClient {
|
|||||||
if let Some(true) = meta_tx.replaceable {
|
if let Some(true) = meta_tx.replaceable {
|
||||||
// for some reason core doesn't set this field right
|
// for some reason core doesn't set this field right
|
||||||
for input in &mut tx.input {
|
for input in &mut tx.input {
|
||||||
input.sequence = 0xFFFFFFFD;
|
input.sequence = Sequence(0xFFFFFFFD);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -133,6 +147,7 @@ impl TestClient {
|
|||||||
|
|
||||||
let monitor_script = Address::from_str(&meta_tx.output[0].to_address)
|
let monitor_script = Address::from_str(&meta_tx.output[0].to_address)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
self.wait_for_tx(txid, &monitor_script);
|
self.wait_for_tx(txid, &monitor_script);
|
||||||
|
|
||||||
@@ -151,7 +166,7 @@ impl TestClient {
|
|||||||
|
|
||||||
let bumped: serde_json::Value = self.call("bumpfee", &[txid.to_string().into()]).unwrap();
|
let bumped: serde_json::Value = self.call("bumpfee", &[txid.to_string().into()]).unwrap();
|
||||||
let new_txid = Txid::from_str(&bumped["txid"].as_str().unwrap().to_string()).unwrap();
|
let new_txid = Txid::from_str(&bumped["txid"].as_str().unwrap().to_string()).unwrap();
|
||||||
let monitor_script = Script::from_hex(&mut tx.vout[0].script_pub_key.hex.to_hex()).unwrap();
|
let monitor_script = ScriptBuf::from_bytes(tx.vout[0].script_pub_key.hex.clone());
|
||||||
self.wait_for_tx(new_txid, &monitor_script);
|
self.wait_for_tx(new_txid, &monitor_script);
|
||||||
|
|
||||||
debug!("Bumped {}, new txid {}", txid, new_txid);
|
debug!("Bumped {}, new txid {}", txid, new_txid);
|
||||||
@@ -160,40 +175,44 @@ impl TestClient {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub fn generate_manually(&mut self, txs: Vec<Transaction>) -> String {
|
pub fn generate_manually(&mut self, txs: Vec<Transaction>) -> String {
|
||||||
use bitcoin::blockdata::block::{Block, BlockHeader};
|
use bitcoin::blockdata::block::{Block, Header, Version};
|
||||||
use bitcoin::blockdata::script::Builder;
|
use bitcoin::blockdata::script::Builder;
|
||||||
use bitcoin::blockdata::transaction::{OutPoint, TxIn, TxOut};
|
use bitcoin::blockdata::transaction::{OutPoint, TxIn, TxOut};
|
||||||
use bitcoin::hash_types::{BlockHash, TxMerkleNode};
|
use bitcoin::hash_types::{BlockHash, TxMerkleNode};
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
|
use bitcoin::pow::CompactTarget;
|
||||||
|
|
||||||
let block_template: serde_json::Value = self
|
let block_template: serde_json::Value = self
|
||||||
.call("getblocktemplate", &[json!({"rules": ["segwit"]})])
|
.call("getblocktemplate", &[json!({"rules": ["segwit"]})])
|
||||||
.unwrap();
|
.unwrap();
|
||||||
trace!("getblocktemplate: {:#?}", block_template);
|
trace!("getblocktemplate: {:#?}", block_template);
|
||||||
|
|
||||||
let header = BlockHeader {
|
let header = Header {
|
||||||
version: block_template["version"].as_i64().unwrap() as i32,
|
version: Version::from_consensus(block_template["version"].as_i64().unwrap() as i32),
|
||||||
prev_blockhash: BlockHash::from_hex(
|
prev_blockhash: BlockHash::from_str(
|
||||||
block_template["previousblockhash"].as_str().unwrap(),
|
block_template["previousblockhash"].as_str().unwrap(),
|
||||||
)
|
)
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
merkle_root: TxMerkleNode::default(),
|
merkle_root: TxMerkleNode::all_zeros(),
|
||||||
time: block_template["curtime"].as_u64().unwrap() as u32,
|
time: block_template["curtime"].as_u64().unwrap() as u32,
|
||||||
bits: u32::from_str_radix(block_template["bits"].as_str().unwrap(), 16).unwrap(),
|
bits: CompactTarget::from_consensus(
|
||||||
|
u32::from_str_radix(block_template["bits"].as_str().unwrap(), 16).unwrap(),
|
||||||
|
),
|
||||||
nonce: 0,
|
nonce: 0,
|
||||||
};
|
};
|
||||||
debug!("header: {:#?}", header);
|
debug!("header: {:#?}", header);
|
||||||
|
|
||||||
let height = block_template["height"].as_u64().unwrap() as i64;
|
let height = block_template["height"].as_u64().unwrap() as i64;
|
||||||
let witness_reserved_value: Vec<u8> = sha256d::Hash::default().as_ref().into();
|
let witness_reserved_value = sha256d::Hash::all_zeros().as_byte_array().to_vec();
|
||||||
// burn block subsidy and fees, not a big deal
|
// burn block subsidy and fees, not a big deal
|
||||||
let mut coinbase_tx = Transaction {
|
let mut coinbase_tx = Transaction {
|
||||||
version: 1,
|
version: 1,
|
||||||
lock_time: 0,
|
lock_time: absolute::LockTime::ZERO,
|
||||||
input: vec![TxIn {
|
input: vec![TxIn {
|
||||||
previous_output: OutPoint::null(),
|
previous_output: OutPoint::null(),
|
||||||
script_sig: Builder::new().push_int(height).into_script(),
|
script_sig: Builder::new().push_int(height).into_script(),
|
||||||
sequence: 0xFFFFFFFF,
|
sequence: Sequence(0xFFFFFFFF),
|
||||||
witness: Witness::from_vec(vec![witness_reserved_value]),
|
witness: Witness::from_slice(&vec![witness_reserved_value]),
|
||||||
}],
|
}],
|
||||||
output: vec![],
|
output: vec![],
|
||||||
};
|
};
|
||||||
@@ -214,7 +233,7 @@ impl TestClient {
|
|||||||
|
|
||||||
// now update and replace the coinbase tx
|
// now update and replace the coinbase tx
|
||||||
let mut coinbase_witness_commitment_script = vec![0x6a, 0x24, 0xaa, 0x21, 0xa9, 0xed];
|
let mut coinbase_witness_commitment_script = vec![0x6a, 0x24, 0xaa, 0x21, 0xa9, 0xed];
|
||||||
coinbase_witness_commitment_script.extend_from_slice(&witness_commitment);
|
coinbase_witness_commitment_script.extend_from_slice(witness_commitment.as_ref());
|
||||||
|
|
||||||
coinbase_tx.output.push(TxOut {
|
coinbase_tx.output.push(TxOut {
|
||||||
value: 0,
|
value: 0,
|
||||||
@@ -234,11 +253,11 @@ impl TestClient {
|
|||||||
|
|
||||||
// now do PoW :)
|
// now do PoW :)
|
||||||
let target = block.header.target();
|
let target = block.header.target();
|
||||||
while block.header.validate_pow(&target).is_err() {
|
while block.header.validate_pow(target).is_err() {
|
||||||
block.header.nonce = block.header.nonce.checked_add(1).unwrap(); // panic if we run out of nonces
|
block.header.nonce = block.header.nonce.checked_add(1).unwrap(); // panic if we run out of nonces
|
||||||
}
|
}
|
||||||
|
|
||||||
let block_hex: String = serialize(&block).to_hex();
|
let block_hex: String = bitcoin::consensus::encode::serialize_hex(&block);
|
||||||
debug!("generated block hex: {}", block_hex);
|
debug!("generated block hex: {}", block_hex);
|
||||||
|
|
||||||
self.electrsd.client.block_headers_subscribe().unwrap();
|
self.electrsd.client.block_headers_subscribe().unwrap();
|
||||||
@@ -254,11 +273,12 @@ impl TestClient {
|
|||||||
|
|
||||||
self.wait_for_block(height as usize);
|
self.wait_for_block(height as usize);
|
||||||
|
|
||||||
block.header.block_hash().to_hex()
|
block.header.block_hash().to_string()
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn generate(&mut self, num_blocks: u64, address: Option<Address>) {
|
pub fn generate(&mut self, num_blocks: u64, address: Option<Address>) {
|
||||||
let address = address.unwrap_or_else(|| self.get_new_address(None, None).unwrap());
|
let address =
|
||||||
|
address.unwrap_or_else(|| self.get_new_address(None, None).unwrap().assume_checked());
|
||||||
let hashes = self.generate_to_address(num_blocks, &address).unwrap();
|
let hashes = self.generate_to_address(num_blocks, &address).unwrap();
|
||||||
let best_hash = hashes.last().unwrap();
|
let best_hash = hashes.last().unwrap();
|
||||||
let height = self.get_block_info(best_hash).unwrap().height;
|
let height = self.get_block_info(best_hash).unwrap().height;
|
||||||
@@ -306,9 +326,11 @@ impl TestClient {
|
|||||||
&self
|
&self
|
||||||
.get_new_address(None, address_type)
|
.get_new_address(None, address_type)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.to_string(),
|
.to_string(),
|
||||||
)
|
)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -367,7 +389,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
fn $_fn_name:ident ( $( $test_client:ident : &TestClient )? $(,)? ) -> $blockchain:ty $block:block) => {
|
fn $_fn_name:ident ( $( $test_client:ident : &TestClient )? $(,)? ) -> $blockchain:ty $block:block) => {
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod bdk_blockchain_tests {
|
mod bdk_blockchain_tests {
|
||||||
use $crate::bitcoin::{Transaction, Network};
|
use $crate::bitcoin::{Transaction, Network, blockdata::script::PushBytesBuf};
|
||||||
use $crate::testutils::blockchain_tests::TestClient;
|
use $crate::testutils::blockchain_tests::TestClient;
|
||||||
use $crate::blockchain::Blockchain;
|
use $crate::blockchain::Blockchain;
|
||||||
use $crate::database::MemoryDatabase;
|
use $crate::database::MemoryDatabase;
|
||||||
@@ -375,6 +397,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
use $crate::wallet::AddressIndex;
|
use $crate::wallet::AddressIndex;
|
||||||
use $crate::{Wallet, FeeRate, SyncOptions};
|
use $crate::{Wallet, FeeRate, SyncOptions};
|
||||||
use $crate::testutils;
|
use $crate::testutils;
|
||||||
|
use std::convert::TryFrom;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
@@ -1047,7 +1070,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
assert_eq!(wallet.get_balance().unwrap().untrusted_pending, 50_000, "incorrect balance");
|
assert_eq!(wallet.get_balance().unwrap().untrusted_pending, 50_000, "incorrect balance");
|
||||||
|
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
let data = [42u8;80];
|
let data = PushBytesBuf::try_from(vec![42u8;80]).unwrap();
|
||||||
builder.add_data(&data);
|
builder.add_data(&data);
|
||||||
let (mut psbt, details) = builder.finish().unwrap();
|
let (mut psbt, details) = builder.finish().unwrap();
|
||||||
|
|
||||||
@@ -1055,7 +1078,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
assert!(finalized, "Cannot finalize transaction");
|
assert!(finalized, "Cannot finalize transaction");
|
||||||
let tx = psbt.extract_tx();
|
let tx = psbt.extract_tx();
|
||||||
let serialized_tx = bitcoin::consensus::encode::serialize(&tx);
|
let serialized_tx = bitcoin::consensus::encode::serialize(&tx);
|
||||||
assert!(serialized_tx.windows(data.len()).any(|e| e==data), "cannot find op_return data in transaction");
|
assert!(serialized_tx.windows(data.len()).any(|e| e==data.as_bytes()), "cannot find op_return data in transaction");
|
||||||
blockchain.broadcast(&tx).unwrap();
|
blockchain.broadcast(&tx).unwrap();
|
||||||
test_client.generate(1, Some(node_addr));
|
test_client.generate(1, Some(node_addr));
|
||||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
@@ -1075,18 +1098,18 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
assert_eq!(wallet.get_balance().unwrap().immature, 0, "incorrect balance");
|
assert_eq!(wallet.get_balance().unwrap().immature, 0, "incorrect balance");
|
||||||
|
|
||||||
test_client.generate(1, Some(wallet_addr));
|
test_client.generate(2, Some(wallet_addr));
|
||||||
|
|
||||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
|
|
||||||
assert!(wallet.get_balance().unwrap().immature > 0, "incorrect balance after receiving coinbase");
|
assert_eq!(wallet.get_balance().unwrap().immature, 5000000000*2, "incorrect balance after receiving coinbase");
|
||||||
|
|
||||||
// make coinbase mature (100 blocks)
|
// make coinbase mature (100 blocks)
|
||||||
let node_addr = test_client.get_node_address(None);
|
let node_addr = test_client.get_node_address(None);
|
||||||
test_client.generate(100, Some(node_addr));
|
test_client.generate(100, Some(node_addr));
|
||||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
|
|
||||||
assert!(wallet.get_balance().unwrap().confirmed > 0, "incorrect balance after maturing coinbase");
|
assert_eq!(wallet.get_balance().unwrap().confirmed, 5000000000 * 2, "incorrect balance after maturing coinbase");
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1154,8 +1177,9 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
// 2. Get a new bech32m address from test bitcoind node taproot wallet
|
// 2. Get a new bech32m address from test bitcoind node taproot wallet
|
||||||
|
|
||||||
// TODO replace once rust-bitcoincore-rpc with PR 199 released
|
// TODO replace once rust-bitcoincore-rpc with PR 199 released
|
||||||
let node_addr: bitcoin::Address = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).unwrap();
|
let node_addr: bitcoin::Address<bitcoin::address::NetworkUnchecked> = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).unwrap();
|
||||||
assert_eq!(node_addr, bitcoin::Address::from_str("bcrt1pj5y3f0fu4y7g98k4v63j9n0xvj3lmln0cpwhsjzknm6nt0hr0q7qnzwsy9").unwrap());
|
let node_addr = node_addr.assume_checked();
|
||||||
|
assert_eq!(node_addr, bitcoin::Address::from_str("bcrt1pj5y3f0fu4y7g98k4v63j9n0xvj3lmln0cpwhsjzknm6nt0hr0q7qnzwsy9").unwrap().assume_checked());
|
||||||
|
|
||||||
// 3. Send 50_000 sats from test bitcoind node to test BDK wallet
|
// 3. Send 50_000 sats from test bitcoind node to test BDK wallet
|
||||||
|
|
||||||
@@ -1184,7 +1208,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
// 5. Verify 25_000 sats are received by test bitcoind node taproot wallet
|
// 5. Verify 25_000 sats are received by test bitcoind node taproot wallet
|
||||||
|
|
||||||
let taproot_balance = taproot_wallet_client.get_balance(None, None).unwrap();
|
let taproot_balance = taproot_wallet_client.get_balance(None, None).unwrap();
|
||||||
assert_eq!(taproot_balance.as_sat(), 25_000, "node has incorrect taproot wallet balance");
|
assert_eq!(taproot_balance.to_sat(), 25_000, "node has incorrect taproot wallet balance");
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@@ -1204,7 +1228,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
|
|
||||||
let (wallet, blockchain, _, mut test_client) = init_single_sig();
|
let (wallet, blockchain, _, mut test_client) = init_single_sig();
|
||||||
let bdk_address = wallet.get_address(AddressIndex::New).unwrap().address;
|
let bdk_address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||||
let core_address = test_client.get_new_address(None, None).unwrap();
|
let core_address = test_client.get_new_address(None, None).unwrap().assume_checked();
|
||||||
let tx = testutils! {
|
let tx = testutils! {
|
||||||
@tx ( (@addr bdk_address.clone()) => 50_000, (@addr core_address.clone()) => 40_000 )
|
@tx ( (@addr bdk_address.clone()) => 50_000, (@addr core_address.clone()) => 40_000 )
|
||||||
};
|
};
|
||||||
@@ -1396,8 +1420,8 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
"label":"taproot key spend",
|
"label":"taproot key spend",
|
||||||
}]);
|
}]);
|
||||||
let _importdescriptors_result: Value = taproot_wallet_client.call("importdescriptors", &[import_descriptor_args]).expect("import wallet");
|
let _importdescriptors_result: Value = taproot_wallet_client.call("importdescriptors", &[import_descriptor_args]).expect("import wallet");
|
||||||
let generate_to_address: bitcoin::Address = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).expect("new address");
|
let generate_to_address: bitcoin::Address<bitcoin::address::NetworkUnchecked> = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).expect("new address");
|
||||||
let _generatetoaddress_result = taproot_wallet_client.generate_to_address(101, &generate_to_address).expect("generated to address");
|
let _generatetoaddress_result = taproot_wallet_client.generate_to_address(101, &generate_to_address.assume_checked()).expect("generated to address");
|
||||||
let send_to_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
let send_to_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
||||||
let change_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
let change_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
||||||
let send_addr_amounts = json!([{
|
let send_addr_amounts = json!([{
|
||||||
@@ -1410,7 +1434,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
let send_result: Value = taproot_wallet_client.call("send", &[send_addr_amounts, Value::Null, "unset".into(), Value::Null, send_options]).expect("send psbt");
|
let send_result: Value = taproot_wallet_client.call("send", &[send_addr_amounts, Value::Null, "unset".into(), Value::Null, send_options]).expect("send psbt");
|
||||||
let core_psbt = send_result["psbt"].as_str().expect("core psbt str");
|
let core_psbt = send_result["psbt"].as_str().expect("core psbt str");
|
||||||
|
|
||||||
use bitcoin::util::psbt::PartiallySignedTransaction;
|
use bitcoin::psbt::PartiallySignedTransaction;
|
||||||
|
|
||||||
// Test parsing core created PSBT
|
// Test parsing core created PSBT
|
||||||
let mut psbt = PartiallySignedTransaction::from_str(&core_psbt).expect("core taproot psbt");
|
let mut psbt = PartiallySignedTransaction::from_str(&core_psbt).expect("core taproot psbt");
|
||||||
|
|||||||
@@ -23,7 +23,7 @@ pub trait ConfigurableBlockchainTester<B: ConfigurableBlockchain>: Sized {
|
|||||||
None
|
None
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Runs all avaliable tests.
|
/// Runs all available tests.
|
||||||
fn run(&self) {
|
fn run(&self) {
|
||||||
let test_client = &mut TestClient::default();
|
let test_client = &mut TestClient::default();
|
||||||
|
|
||||||
|
|||||||
@@ -101,25 +101,21 @@ impl TestIncomingTx {
|
|||||||
macro_rules! testutils {
|
macro_rules! testutils {
|
||||||
( @external $descriptors:expr, $child:expr ) => ({
|
( @external $descriptors:expr, $child:expr ) => ({
|
||||||
use $crate::bitcoin::secp256k1::Secp256k1;
|
use $crate::bitcoin::secp256k1::Secp256k1;
|
||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, DescriptorTrait};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
use $crate::descriptor::AsDerived;
|
|
||||||
|
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
let parsed = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &$descriptors.0).expect("Failed to parse descriptor in `testutils!(@external)`").0;
|
let parsed = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &$descriptors.0).expect("Failed to parse descriptor in `testutils!(@external)`").0;
|
||||||
parsed.as_derived($child, &secp).address(bitcoin::Network::Regtest).expect("No address form")
|
parsed.at_derivation_index($child).unwrap().address(bitcoin::Network::Regtest).expect("No address form")
|
||||||
});
|
});
|
||||||
( @internal $descriptors:expr, $child:expr ) => ({
|
( @internal $descriptors:expr, $child:expr ) => ({
|
||||||
use $crate::bitcoin::secp256k1::Secp256k1;
|
use $crate::bitcoin::secp256k1::Secp256k1;
|
||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, DescriptorTrait};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
use $crate::descriptor::AsDerived;
|
|
||||||
|
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
let parsed = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &$descriptors.1.expect("Missing internal descriptor")).expect("Failed to parse descriptor in `testutils!(@internal)`").0;
|
let parsed = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &$descriptors.1.expect("Missing internal descriptor")).expect("Failed to parse descriptor in `testutils!(@internal)`").0;
|
||||||
parsed.as_derived($child, &secp).address($crate::bitcoin::Network::Regtest).expect("No address form")
|
parsed.at_derivation_index($child).address($crate::bitcoin::Network::Regtest).expect("No address form")
|
||||||
});
|
});
|
||||||
( @e $descriptors:expr, $child:expr ) => ({ testutils!(@external $descriptors, $child) });
|
( @e $descriptors:expr, $child:expr ) => ({ testutils!(@external $descriptors, $child) });
|
||||||
( @i $descriptors:expr, $child:expr ) => ({ testutils!(@internal $descriptors, $child) });
|
( @i $descriptors:expr, $child:expr ) => ({ testutils!(@internal $descriptors, $child) });
|
||||||
@@ -150,7 +146,7 @@ macro_rules! testutils {
|
|||||||
let mut seed = [0u8; 32];
|
let mut seed = [0u8; 32];
|
||||||
rand::thread_rng().fill(&mut seed[..]);
|
rand::thread_rng().fill(&mut seed[..]);
|
||||||
|
|
||||||
let key = $crate::bitcoin::util::bip32::ExtendedPrivKey::new_master(
|
let key = $crate::bitcoin::bip32::ExtendedPrivKey::new_master(
|
||||||
$crate::bitcoin::Network::Testnet,
|
$crate::bitcoin::Network::Testnet,
|
||||||
&seed,
|
&seed,
|
||||||
);
|
);
|
||||||
@@ -186,49 +182,50 @@ macro_rules! testutils {
|
|||||||
( @descriptors ( $external_descriptor:expr ) $( ( $internal_descriptor:expr ) )? $( ( @keys $( $keys:tt )* ) )* ) => ({
|
( @descriptors ( $external_descriptor:expr ) $( ( $internal_descriptor:expr ) )? $( ( @keys $( $keys:tt )* ) )* ) => ({
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
use std::collections::HashMap;
|
use std::collections::HashMap;
|
||||||
|
use std::convert::Infallible;
|
||||||
|
|
||||||
use $crate::miniscript::descriptor::Descriptor;
|
use $crate::miniscript::descriptor::Descriptor;
|
||||||
use $crate::miniscript::TranslatePk;
|
use $crate::miniscript::TranslatePk;
|
||||||
|
|
||||||
|
struct Translator {
|
||||||
|
keys: HashMap<&'static str, (String, Option<String>, Option<String>)>,
|
||||||
|
is_internal: bool,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl $crate::miniscript::Translator<String, String, Infallible> for Translator {
|
||||||
|
fn pk(&mut self, pk: &String) -> Result<String, Infallible> {
|
||||||
|
match self.keys.get(pk.as_str()) {
|
||||||
|
Some((key, ext_path, int_path)) => {
|
||||||
|
let path = if self.is_internal { int_path } else { ext_path };
|
||||||
|
Ok(format!("{}{}", key, path.clone().unwrap_or_default()))
|
||||||
|
}
|
||||||
|
None => Ok(pk.clone()),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
fn sha256(&mut self, sha256: &String) -> Result<String, Infallible> { Ok(sha256.clone()) }
|
||||||
|
fn hash256(&mut self, hash256: &String) -> Result<String, Infallible> { Ok(hash256.clone()) }
|
||||||
|
fn ripemd160(&mut self, ripemd160: &String) -> Result<String, Infallible> { Ok(ripemd160.clone()) }
|
||||||
|
fn hash160(&mut self, hash160: &String) -> Result<String, Infallible> { Ok(hash160.clone()) }
|
||||||
|
}
|
||||||
|
|
||||||
#[allow(unused_assignments, unused_mut)]
|
#[allow(unused_assignments, unused_mut)]
|
||||||
let mut keys: HashMap<&'static str, (String, Option<String>, Option<String>)> = HashMap::new();
|
let mut keys = HashMap::new();
|
||||||
$(
|
$(
|
||||||
keys = testutils!{ @keys $( $keys )* };
|
keys = testutils!{ @keys $( $keys )* };
|
||||||
)*
|
)*
|
||||||
|
|
||||||
let external: Descriptor<String> = FromStr::from_str($external_descriptor).unwrap();
|
let mut translator = Translator { keys, is_internal: false };
|
||||||
let external: Descriptor<String> = external.translate_pk_infallible::<_, _>(|k| {
|
|
||||||
if let Some((key, ext_path, _)) = keys.get(&k.as_str()) {
|
|
||||||
format!("{}{}", key, ext_path.as_ref().unwrap_or(&"".into()))
|
|
||||||
} else {
|
|
||||||
k.clone()
|
|
||||||
}
|
|
||||||
}, |kh| {
|
|
||||||
if let Some((key, ext_path, _)) = keys.get(&kh.as_str()) {
|
|
||||||
format!("{}{}", key, ext_path.as_ref().unwrap_or(&"".into()))
|
|
||||||
} else {
|
|
||||||
kh.clone()
|
|
||||||
}
|
|
||||||
|
|
||||||
});
|
let external: Descriptor<String> = FromStr::from_str($external_descriptor).unwrap();
|
||||||
|
let external = external.translate_pk(&mut translator).expect("Infallible conversion");
|
||||||
let external = external.to_string();
|
let external = external.to_string();
|
||||||
|
|
||||||
let internal = None::<String>$(.or({
|
translator.is_internal = true;
|
||||||
let string_internal: Descriptor<String> = FromStr::from_str($internal_descriptor).unwrap();
|
|
||||||
|
|
||||||
let string_internal: Descriptor<String> = string_internal.translate_pk_infallible::<_, _>(|k| {
|
let internal = None::<String>$(.or({
|
||||||
if let Some((key, _, int_path)) = keys.get(&k.as_str()) {
|
let internal: Descriptor<String> = FromStr::from_str($internal_descriptor).unwrap();
|
||||||
format!("{}{}", key, int_path.as_ref().unwrap_or(&"".into()))
|
let internal = internal.translate_pk(&mut translator).expect("Infallible conversion");
|
||||||
} else {
|
Some(internal.to_string())
|
||||||
k.clone()
|
|
||||||
}
|
|
||||||
}, |kh| {
|
|
||||||
if let Some((key, _, int_path)) = keys.get(&kh.as_str()) {
|
|
||||||
format!("{}{}", key, int_path.as_ref().unwrap_or(&"".into()))
|
|
||||||
} else {
|
|
||||||
kh.clone()
|
|
||||||
}
|
|
||||||
});
|
|
||||||
Some(string_internal.to_string())
|
|
||||||
}))?;
|
}))?;
|
||||||
|
|
||||||
(external, internal)
|
(external, internal)
|
||||||
|
|||||||
180
src/types.rs
180
src/types.rs
@@ -13,7 +13,7 @@ use std::convert::AsRef;
|
|||||||
use std::ops::Sub;
|
use std::ops::Sub;
|
||||||
|
|
||||||
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
||||||
use bitcoin::{hash_types::Txid, util::psbt};
|
use bitcoin::{hash_types::Txid, psbt, Weight};
|
||||||
|
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
@@ -63,6 +63,16 @@ impl FeeRate {
|
|||||||
FeeRate(value)
|
FeeRate(value)
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Create a new instance of [`FeeRate`] given a float fee rate in sats/kwu
|
||||||
|
pub fn from_sat_per_kwu(sat_per_kwu: f32) -> Self {
|
||||||
|
FeeRate::new_checked(sat_per_kwu / 250.0_f32)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Create a new instance of [`FeeRate`] given a float fee rate in sats/kvb
|
||||||
|
pub fn from_sat_per_kvb(sat_per_kvb: f32) -> Self {
|
||||||
|
FeeRate::new_checked(sat_per_kvb / 1000.0_f32)
|
||||||
|
}
|
||||||
|
|
||||||
/// Create a new instance of [`FeeRate`] given a float fee rate in btc/kvbytes
|
/// Create a new instance of [`FeeRate`] given a float fee rate in btc/kvbytes
|
||||||
///
|
///
|
||||||
/// ## Panics
|
/// ## Panics
|
||||||
@@ -87,8 +97,8 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and weight units (`wu`).
|
/// Calculate fee rate from `fee` and weight units (`wu`).
|
||||||
pub fn from_wu(fee: u64, wu: usize) -> FeeRate {
|
pub fn from_wu(fee: u64, wu: Weight) -> FeeRate {
|
||||||
Self::from_vb(fee, wu.vbytes())
|
Self::from_vb(fee, wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and `vbytes`.
|
/// Calculate fee rate from `fee` and `vbytes`.
|
||||||
@@ -98,18 +108,18 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Return the value as satoshi/vbyte
|
/// Return the value as satoshi/vbyte
|
||||||
pub fn as_sat_vb(&self) -> f32 {
|
pub fn as_sat_per_vb(&self) -> f32 {
|
||||||
self.0
|
self.0
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in weight units.
|
/// Calculate absolute fee in Satoshis using size in weight units.
|
||||||
pub fn fee_wu(&self, wu: usize) -> u64 {
|
pub fn fee_wu(&self, wu: Weight) -> u64 {
|
||||||
self.fee_vb(wu.vbytes())
|
self.fee_vb(wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
||||||
pub fn fee_vb(&self, vbytes: usize) -> u64 {
|
pub fn fee_vb(&self, vbytes: usize) -> u64 {
|
||||||
(self.as_sat_vb() * vbytes as f32).ceil() as u64
|
(self.as_sat_per_vb() * vbytes as f32).ceil() as u64
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -156,7 +166,7 @@ pub struct LocalUtxo {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// A [`Utxo`] with its `satisfaction_weight`.
|
/// A [`Utxo`] with its `satisfaction_weight`.
|
||||||
#[derive(Debug, Clone, PartialEq)]
|
#[derive(Debug, Clone, PartialEq, Eq)]
|
||||||
pub struct WeightedUtxo {
|
pub struct WeightedUtxo {
|
||||||
/// The weight of the witness data and `scriptSig` expressed in [weight units]. This is used to
|
/// The weight of the witness data and `scriptSig` expressed in [weight units]. This is used to
|
||||||
/// properly maintain the feerate when adding this input to a transaction during coin selection.
|
/// properly maintain the feerate when adding this input to a transaction during coin selection.
|
||||||
@@ -167,7 +177,7 @@ pub struct WeightedUtxo {
|
|||||||
pub utxo: Utxo,
|
pub utxo: Utxo,
|
||||||
}
|
}
|
||||||
|
|
||||||
#[derive(Debug, Clone, PartialEq)]
|
#[derive(Debug, Clone, PartialEq, Eq)]
|
||||||
/// An unspent transaction output (UTXO).
|
/// An unspent transaction output (UTXO).
|
||||||
pub enum Utxo {
|
pub enum Utxo {
|
||||||
/// A UTXO owned by the local wallet.
|
/// A UTXO owned by the local wallet.
|
||||||
@@ -214,13 +224,12 @@ impl Utxo {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// A wallet transaction
|
/// A wallet transaction
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Default)]
|
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq)]
|
||||||
pub struct TransactionDetails {
|
pub struct TransactionDetails {
|
||||||
/// Optional transaction
|
/// Optional transaction
|
||||||
pub transaction: Option<Transaction>,
|
pub transaction: Option<Transaction>,
|
||||||
/// Transaction id
|
/// Transaction id
|
||||||
pub txid: Txid,
|
pub txid: Txid,
|
||||||
|
|
||||||
/// Received value (sats)
|
/// Received value (sats)
|
||||||
/// Sum of owned outputs of this transaction.
|
/// Sum of owned outputs of this transaction.
|
||||||
pub received: u64,
|
pub received: u64,
|
||||||
@@ -232,11 +241,25 @@ pub struct TransactionDetails {
|
|||||||
/// Server backend, but it could be `None` with a Bitcoin RPC node without txindex that receive
|
/// Server backend, but it could be `None` with a Bitcoin RPC node without txindex that receive
|
||||||
/// funds while offline.
|
/// funds while offline.
|
||||||
pub fee: Option<u64>,
|
pub fee: Option<u64>,
|
||||||
/// If the transaction is confirmed, contains height and timestamp of the block containing the
|
/// If the transaction is confirmed, contains height and Unix timestamp of the block containing the
|
||||||
/// transaction, unconfirmed transaction contains `None`.
|
/// transaction, unconfirmed transaction contains `None`.
|
||||||
pub confirmation_time: Option<BlockTime>,
|
pub confirmation_time: Option<BlockTime>,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl PartialOrd for TransactionDetails {
|
||||||
|
fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> {
|
||||||
|
Some(self.cmp(other))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Ord for TransactionDetails {
|
||||||
|
fn cmp(&self, other: &Self) -> std::cmp::Ordering {
|
||||||
|
self.confirmation_time
|
||||||
|
.cmp(&other.confirmation_time)
|
||||||
|
.then_with(|| self.txid.cmp(&other.txid))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// Block height and timestamp of a block
|
/// Block height and timestamp of a block
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Default)]
|
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Default)]
|
||||||
pub struct BlockTime {
|
pub struct BlockTime {
|
||||||
@@ -246,6 +269,20 @@ pub struct BlockTime {
|
|||||||
pub timestamp: u64,
|
pub timestamp: u64,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl PartialOrd for BlockTime {
|
||||||
|
fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> {
|
||||||
|
Some(self.cmp(other))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Ord for BlockTime {
|
||||||
|
fn cmp(&self, other: &Self) -> std::cmp::Ordering {
|
||||||
|
self.height
|
||||||
|
.cmp(&other.height)
|
||||||
|
.then_with(|| self.timestamp.cmp(&other.timestamp))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// **DEPRECATED**: Confirmation time of a transaction
|
/// **DEPRECATED**: Confirmation time of a transaction
|
||||||
///
|
///
|
||||||
/// The structure has been renamed to `BlockTime`
|
/// The structure has been renamed to `BlockTime`
|
||||||
@@ -324,6 +361,95 @@ impl std::iter::Sum for Balance {
|
|||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod tests {
|
mod tests {
|
||||||
use super::*;
|
use super::*;
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn sort_block_time() {
|
||||||
|
let block_time_a = BlockTime {
|
||||||
|
height: 100,
|
||||||
|
timestamp: 100,
|
||||||
|
};
|
||||||
|
|
||||||
|
let block_time_b = BlockTime {
|
||||||
|
height: 100,
|
||||||
|
timestamp: 110,
|
||||||
|
};
|
||||||
|
|
||||||
|
let block_time_c = BlockTime {
|
||||||
|
height: 0,
|
||||||
|
timestamp: 0,
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut vec = vec![
|
||||||
|
block_time_a.clone(),
|
||||||
|
block_time_b.clone(),
|
||||||
|
block_time_c.clone(),
|
||||||
|
];
|
||||||
|
vec.sort();
|
||||||
|
let expected = vec![block_time_c, block_time_a, block_time_b];
|
||||||
|
|
||||||
|
assert_eq!(vec, expected)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn sort_tx_details() {
|
||||||
|
let block_time_a = BlockTime {
|
||||||
|
height: 100,
|
||||||
|
timestamp: 100,
|
||||||
|
};
|
||||||
|
|
||||||
|
let block_time_b = BlockTime {
|
||||||
|
height: 0,
|
||||||
|
timestamp: 0,
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_details_a = TransactionDetails {
|
||||||
|
transaction: None,
|
||||||
|
txid: Txid::all_zeros(),
|
||||||
|
received: 0,
|
||||||
|
sent: 0,
|
||||||
|
fee: None,
|
||||||
|
confirmation_time: None,
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_details_b = TransactionDetails {
|
||||||
|
transaction: None,
|
||||||
|
txid: Txid::all_zeros(),
|
||||||
|
received: 0,
|
||||||
|
sent: 0,
|
||||||
|
fee: None,
|
||||||
|
confirmation_time: Some(block_time_a),
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_details_c = TransactionDetails {
|
||||||
|
transaction: None,
|
||||||
|
txid: Txid::all_zeros(),
|
||||||
|
received: 0,
|
||||||
|
sent: 0,
|
||||||
|
fee: None,
|
||||||
|
confirmation_time: Some(block_time_b.clone()),
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_details_d = TransactionDetails {
|
||||||
|
transaction: None,
|
||||||
|
txid: Txid::from_byte_array([1; Txid::LEN]),
|
||||||
|
received: 0,
|
||||||
|
sent: 0,
|
||||||
|
fee: None,
|
||||||
|
confirmation_time: Some(block_time_b),
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut vec = vec![
|
||||||
|
tx_details_a.clone(),
|
||||||
|
tx_details_b.clone(),
|
||||||
|
tx_details_c.clone(),
|
||||||
|
tx_details_d.clone(),
|
||||||
|
];
|
||||||
|
vec.sort();
|
||||||
|
let expected = vec![tx_details_a, tx_details_c, tx_details_d, tx_details_b];
|
||||||
|
|
||||||
|
assert_eq!(vec, expected)
|
||||||
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn can_store_feerate_in_const() {
|
fn can_store_feerate_in_const() {
|
||||||
@@ -358,4 +484,34 @@ mod tests {
|
|||||||
fn test_valid_feerate_pos_zero() {
|
fn test_valid_feerate_pos_zero() {
|
||||||
let _ = FeeRate::from_sat_per_vb(0.0);
|
let _ = FeeRate::from_sat_per_vb(0.0);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_fee_from_btc_per_kvb() {
|
||||||
|
let fee = FeeRate::from_btc_per_kvb(1e-5);
|
||||||
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_fee_from_sat_per_vbyte() {
|
||||||
|
let fee = FeeRate::from_sat_per_vb(1.0);
|
||||||
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_fee_default_min_relay_fee() {
|
||||||
|
let fee = FeeRate::default_min_relay_fee();
|
||||||
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_fee_from_sat_per_kvb() {
|
||||||
|
let fee = FeeRate::from_sat_per_kvb(1000.0);
|
||||||
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_fee_from_sat_per_kwu() {
|
||||||
|
let fee = FeeRate::from_sat_per_kwu(250.0);
|
||||||
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,158 +0,0 @@
|
|||||||
// Bitcoin Dev Kit
|
|
||||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
|
||||||
//
|
|
||||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
|
||||||
//
|
|
||||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
|
||||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
|
||||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
|
||||||
// You may not use this file except in accordance with one or both of these
|
|
||||||
// licenses.
|
|
||||||
|
|
||||||
//! Address validation callbacks
|
|
||||||
//!
|
|
||||||
//! The typical usage of those callbacks is for displaying the newly-generated address on a
|
|
||||||
//! hardware wallet, so that the user can cross-check its correctness.
|
|
||||||
//!
|
|
||||||
//! More generally speaking though, these callbacks can also be used to "do something" every time
|
|
||||||
//! an address is generated, without necessarily checking or validating it.
|
|
||||||
//!
|
|
||||||
//! An address validator can be attached to a [`Wallet`](super::Wallet) by using the
|
|
||||||
//! [`Wallet::add_address_validator`](super::Wallet::add_address_validator) method, and
|
|
||||||
//! whenever a new address is generated (either explicitly by the user with
|
|
||||||
//! [`Wallet::get_address`](super::Wallet::get_address) or internally to create a change
|
|
||||||
//! address) all the attached validators will be polled, in sequence. All of them must complete
|
|
||||||
//! successfully to continue.
|
|
||||||
//!
|
|
||||||
//! ## Example
|
|
||||||
//!
|
|
||||||
//! ```
|
|
||||||
//! # use std::sync::Arc;
|
|
||||||
//! # use bitcoin::*;
|
|
||||||
//! # use bdk::address_validator::*;
|
|
||||||
//! # use bdk::database::*;
|
|
||||||
//! # use bdk::*;
|
|
||||||
//! # use bdk::wallet::AddressIndex::New;
|
|
||||||
//! #[derive(Debug)]
|
|
||||||
//! struct PrintAddressAndContinue;
|
|
||||||
//!
|
|
||||||
//! impl AddressValidator for PrintAddressAndContinue {
|
|
||||||
//! fn validate(
|
|
||||||
//! &self,
|
|
||||||
//! keychain: KeychainKind,
|
|
||||||
//! hd_keypaths: &HdKeyPaths,
|
|
||||||
//! script: &Script
|
|
||||||
//! ) -> Result<(), AddressValidatorError> {
|
|
||||||
//! let address = Address::from_script(script, Network::Testnet)
|
|
||||||
//! .as_ref()
|
|
||||||
//! .map(Address::to_string)
|
|
||||||
//! .unwrap_or(script.to_string());
|
|
||||||
//! println!("New address of type {:?}: {}", keychain, address);
|
|
||||||
//! println!("HD keypaths: {:#?}", hd_keypaths);
|
|
||||||
//!
|
|
||||||
//! Ok(())
|
|
||||||
//! }
|
|
||||||
//! }
|
|
||||||
//!
|
|
||||||
//! let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
|
||||||
//! let mut wallet = Wallet::new(descriptor, None, Network::Testnet, MemoryDatabase::default())?;
|
|
||||||
//! wallet.add_address_validator(Arc::new(PrintAddressAndContinue));
|
|
||||||
//!
|
|
||||||
//! let address = wallet.get_address(New)?;
|
|
||||||
//! println!("Address: {}", address);
|
|
||||||
//! # Ok::<(), bdk::Error>(())
|
|
||||||
//! ```
|
|
||||||
|
|
||||||
use std::fmt;
|
|
||||||
|
|
||||||
use bitcoin::Script;
|
|
||||||
|
|
||||||
use crate::descriptor::HdKeyPaths;
|
|
||||||
use crate::types::KeychainKind;
|
|
||||||
|
|
||||||
/// Errors that can be returned to fail the validation of an address
|
|
||||||
#[derive(Debug, Clone, PartialEq, Eq)]
|
|
||||||
pub enum AddressValidatorError {
|
|
||||||
/// User rejected the address
|
|
||||||
UserRejected,
|
|
||||||
/// Network connection error
|
|
||||||
ConnectionError,
|
|
||||||
/// Network request timeout error
|
|
||||||
TimeoutError,
|
|
||||||
/// Invalid script
|
|
||||||
InvalidScript,
|
|
||||||
/// A custom error message
|
|
||||||
Message(String),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl fmt::Display for AddressValidatorError {
|
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
||||||
write!(f, "{:?}", self)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::error::Error for AddressValidatorError {}
|
|
||||||
|
|
||||||
/// Trait to build address validators
|
|
||||||
///
|
|
||||||
/// All the address validators attached to a wallet with [`Wallet::add_address_validator`](super::Wallet::add_address_validator) will be polled
|
|
||||||
/// every time an address (external or internal) is generated by the wallet. Errors returned in the
|
|
||||||
/// validator will be propagated up to the original caller that triggered the address generation.
|
|
||||||
///
|
|
||||||
/// For a usage example see [this module](crate::address_validator)'s documentation.
|
|
||||||
#[deprecated = "AddressValidator was rarely used. Address validation can occur outside of BDK"]
|
|
||||||
pub trait AddressValidator: Send + Sync + fmt::Debug {
|
|
||||||
/// Validate or inspect an address
|
|
||||||
fn validate(
|
|
||||||
&self,
|
|
||||||
keychain: KeychainKind,
|
|
||||||
hd_keypaths: &HdKeyPaths,
|
|
||||||
script: &Script,
|
|
||||||
) -> Result<(), AddressValidatorError>;
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(test)]
|
|
||||||
mod test {
|
|
||||||
use std::sync::Arc;
|
|
||||||
|
|
||||||
use super::*;
|
|
||||||
use crate::wallet::AddressIndex::New;
|
|
||||||
use crate::wallet::{get_funded_wallet, test::get_test_wpkh};
|
|
||||||
|
|
||||||
#[derive(Debug)]
|
|
||||||
struct TestValidator;
|
|
||||||
#[allow(deprecated)]
|
|
||||||
impl AddressValidator for TestValidator {
|
|
||||||
fn validate(
|
|
||||||
&self,
|
|
||||||
_keychain: KeychainKind,
|
|
||||||
_hd_keypaths: &HdKeyPaths,
|
|
||||||
_script: &bitcoin::Script,
|
|
||||||
) -> Result<(), AddressValidatorError> {
|
|
||||||
Err(AddressValidatorError::InvalidScript)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
#[should_panic(expected = "InvalidScript")]
|
|
||||||
fn test_address_validator_external() {
|
|
||||||
let (mut wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
|
||||||
#[allow(deprecated)]
|
|
||||||
wallet.add_address_validator(Arc::new(TestValidator));
|
|
||||||
|
|
||||||
wallet.get_address(New).unwrap();
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
#[should_panic(expected = "InvalidScript")]
|
|
||||||
fn test_address_validator_internal() {
|
|
||||||
let (mut wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
|
||||||
#[allow(deprecated)]
|
|
||||||
wallet.add_address_validator(Arc::new(TestValidator));
|
|
||||||
|
|
||||||
let addr = crate::testutils!(@external descriptors, 10);
|
|
||||||
let mut builder = wallet.build_tx();
|
|
||||||
builder.add_recipient(addr.script_pubkey(), 25_000);
|
|
||||||
builder.finish().unwrap();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -40,12 +40,12 @@
|
|||||||
//! database: &D,
|
//! database: &D,
|
||||||
//! required_utxos: Vec<WeightedUtxo>,
|
//! required_utxos: Vec<WeightedUtxo>,
|
||||||
//! optional_utxos: Vec<WeightedUtxo>,
|
//! optional_utxos: Vec<WeightedUtxo>,
|
||||||
//! fee_rate: FeeRate,
|
//! fee_rate: bdk::FeeRate,
|
||||||
//! target_amount: u64,
|
//! target_amount: u64,
|
||||||
//! drain_script: &Script,
|
//! drain_script: &Script,
|
||||||
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
||||||
//! let mut selected_amount = 0;
|
//! let mut selected_amount = 0;
|
||||||
//! let mut additional_weight = 0;
|
//! let mut additional_weight = Weight::ZERO;
|
||||||
//! let all_utxos_selected = required_utxos
|
//! let all_utxos_selected = required_utxos
|
||||||
//! .into_iter()
|
//! .into_iter()
|
||||||
//! .chain(optional_utxos)
|
//! .chain(optional_utxos)
|
||||||
@@ -53,7 +53,9 @@
|
|||||||
//! (&mut selected_amount, &mut additional_weight),
|
//! (&mut selected_amount, &mut additional_weight),
|
||||||
//! |(selected_amount, additional_weight), weighted_utxo| {
|
//! |(selected_amount, additional_weight), weighted_utxo| {
|
||||||
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
||||||
//! **additional_weight += TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight;
|
//! **additional_weight += Weight::from_wu(
|
||||||
|
//! (TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
//! );
|
||||||
//! Some(weighted_utxo.utxo)
|
//! Some(weighted_utxo.utxo)
|
||||||
//! },
|
//! },
|
||||||
//! )
|
//! )
|
||||||
@@ -82,7 +84,10 @@
|
|||||||
//! # let wallet = doctest_wallet!();
|
//! # let wallet = doctest_wallet!();
|
||||||
//! // create wallet, sync, ...
|
//! // create wallet, sync, ...
|
||||||
//!
|
//!
|
||||||
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
//! .unwrap()
|
||||||
|
//! .require_network(Network::Testnet)
|
||||||
|
//! .unwrap();
|
||||||
//! let (psbt, details) = {
|
//! let (psbt, details) = {
|
||||||
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
||||||
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
||||||
@@ -100,13 +105,13 @@ use crate::{database::Database, WeightedUtxo};
|
|||||||
use crate::{error::Error, Utxo};
|
use crate::{error::Error, Utxo};
|
||||||
|
|
||||||
use bitcoin::consensus::encode::serialize;
|
use bitcoin::consensus::encode::serialize;
|
||||||
use bitcoin::Script;
|
use bitcoin::{Script, Weight};
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
use assert_matches::assert_matches;
|
||||||
use rand::seq::SliceRandom;
|
use rand::seq::SliceRandom;
|
||||||
#[cfg(not(test))]
|
#[cfg(not(test))]
|
||||||
use rand::thread_rng;
|
use rand::thread_rng;
|
||||||
#[cfg(test)]
|
|
||||||
use rand::{rngs::StdRng, SeedableRng};
|
|
||||||
use std::collections::HashMap;
|
use std::collections::HashMap;
|
||||||
use std::convert::TryInto;
|
use std::convert::TryInto;
|
||||||
|
|
||||||
@@ -310,7 +315,7 @@ pub fn decide_change(remaining_amount: u64, fee_rate: FeeRate, drain_script: &Sc
|
|||||||
let drain_val = remaining_amount.saturating_sub(change_fee);
|
let drain_val = remaining_amount.saturating_sub(change_fee);
|
||||||
|
|
||||||
if drain_val.is_dust(drain_script) {
|
if drain_val.is_dust(drain_script) {
|
||||||
let dust_threshold = drain_script.dust_value().as_sat();
|
let dust_threshold = drain_script.dust_value().to_sat();
|
||||||
Excess::NoChange {
|
Excess::NoChange {
|
||||||
dust_threshold,
|
dust_threshold,
|
||||||
change_fee,
|
change_fee,
|
||||||
@@ -337,8 +342,9 @@ fn select_sorted_utxos(
|
|||||||
(&mut selected_amount, &mut fee_amount),
|
(&mut selected_amount, &mut fee_amount),
|
||||||
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
||||||
if must_use || **selected_amount < target_amount + **fee_amount {
|
if must_use || **selected_amount < target_amount + **fee_amount {
|
||||||
**fee_amount +=
|
**fee_amount += fee_rate.fee_wu(Weight::from_wu(
|
||||||
fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
));
|
||||||
**selected_amount += weighted_utxo.utxo.txout().value;
|
**selected_amount += weighted_utxo.utxo.txout().value;
|
||||||
|
|
||||||
log::debug!(
|
log::debug!(
|
||||||
@@ -386,7 +392,9 @@ struct OutputGroup {
|
|||||||
|
|
||||||
impl OutputGroup {
|
impl OutputGroup {
|
||||||
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
||||||
let fee = fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
let fee = fee_rate.fee_wu(Weight::from_wu(
|
||||||
|
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
));
|
||||||
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
||||||
OutputGroup {
|
OutputGroup {
|
||||||
weighted_utxo,
|
weighted_utxo,
|
||||||
@@ -454,7 +462,7 @@ impl<D: Database> CoinSelectionAlgorithm<D> for BranchAndBoundCoinSelection {
|
|||||||
.iter()
|
.iter()
|
||||||
.fold(0, |acc, x| acc + x.effective_value);
|
.fold(0, |acc, x| acc + x.effective_value);
|
||||||
|
|
||||||
let cost_of_change = self.size_of_change as f32 * fee_rate.as_sat_vb();
|
let cost_of_change = self.size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
|
|
||||||
// `curr_value` and `curr_available_value` are both the sum of *effective_values* of
|
// `curr_value` and `curr_available_value` are both the sum of *effective_values* of
|
||||||
// the UTXOs. For the optional UTXOs (curr_available_value) we filter out UTXOs with
|
// the UTXOs. For the optional UTXOs (curr_available_value) we filter out UTXOs with
|
||||||
@@ -671,6 +679,7 @@ impl BranchAndBoundCoinSelection {
|
|||||||
optional_utxos.shuffle(&mut thread_rng());
|
optional_utxos.shuffle(&mut thread_rng());
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
{
|
{
|
||||||
|
use rand::{rngs::StdRng, SeedableRng};
|
||||||
let seed = [0; 32];
|
let seed = [0; 32];
|
||||||
let mut rng: StdRng = SeedableRng::from_seed(seed);
|
let mut rng: StdRng = SeedableRng::from_seed(seed);
|
||||||
optional_utxos.shuffle(&mut rng);
|
optional_utxos.shuffle(&mut rng);
|
||||||
@@ -723,7 +732,7 @@ impl BranchAndBoundCoinSelection {
|
|||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::{OutPoint, Script, TxOut};
|
use bitcoin::{OutPoint, ScriptBuf, TxOut};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::database::{BatchOperations, MemoryDatabase};
|
use crate::database::{BatchOperations, MemoryDatabase};
|
||||||
@@ -734,7 +743,9 @@ mod test {
|
|||||||
use rand::seq::SliceRandom;
|
use rand::seq::SliceRandom;
|
||||||
use rand::{Rng, SeedableRng};
|
use rand::{Rng, SeedableRng};
|
||||||
|
|
||||||
const P2WPKH_SATISFACTION_SIZE: usize = 73 + 33 + 2 + 1;
|
// n. of items on witness (1WU) + signature len (1WU) + signature and sighash (72WU)
|
||||||
|
// + pubkey len (1WU) + pubkey (33WU) + script sig len (1 byte, 4WU)
|
||||||
|
const P2WPKH_SATISFACTION_SIZE: usize = 1 + 1 + 72 + 1 + 33 + 4;
|
||||||
|
|
||||||
const FEE_AMOUNT: u64 = 50;
|
const FEE_AMOUNT: u64 = 50;
|
||||||
|
|
||||||
@@ -751,7 +762,7 @@ mod test {
|
|||||||
outpoint,
|
outpoint,
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value,
|
value,
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@@ -833,8 +844,8 @@ mod test {
|
|||||||
)
|
)
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value: rng.gen_range(0, 200000000),
|
value: rng.gen_range(0..200000000),
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@@ -854,7 +865,7 @@ mod test {
|
|||||||
.unwrap(),
|
.unwrap(),
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value: utxos_value,
|
value: utxos_value,
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@@ -864,7 +875,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn sum_random_utxos(mut rng: &mut StdRng, utxos: &mut Vec<WeightedUtxo>) -> u64 {
|
fn sum_random_utxos(mut rng: &mut StdRng, utxos: &mut Vec<WeightedUtxo>) -> u64 {
|
||||||
let utxos_picked_len = rng.gen_range(2, utxos.len() / 2);
|
let utxos_picked_len = rng.gen_range(2..utxos.len() / 2);
|
||||||
utxos.shuffle(&mut rng);
|
utxos.shuffle(&mut rng);
|
||||||
utxos[..utxos_picked_len]
|
utxos[..utxos_picked_len]
|
||||||
.iter()
|
.iter()
|
||||||
@@ -876,7 +887,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_success() {
|
fn test_largest_first_coin_selection_success() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection::default()
|
||||||
@@ -899,7 +910,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_use_all() {
|
fn test_largest_first_coin_selection_use_all() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection::default()
|
||||||
@@ -922,7 +933,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_use_only_necessary() {
|
fn test_largest_first_coin_selection_use_only_necessary() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection::default()
|
||||||
@@ -946,7 +957,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_insufficient_funds() {
|
fn test_largest_first_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 500_000 + FEE_AMOUNT;
|
let target_amount = 500_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
LargestFirstCoinSelection::default()
|
LargestFirstCoinSelection::default()
|
||||||
@@ -966,7 +977,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
LargestFirstCoinSelection::default()
|
LargestFirstCoinSelection::default()
|
||||||
@@ -985,7 +996,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_success() {
|
fn test_oldest_first_coin_selection_success() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 180_000 + FEE_AMOUNT;
|
let target_amount = 180_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection::default()
|
||||||
@@ -1010,7 +1021,7 @@ mod test {
|
|||||||
let utxo1 = utxo(120_000, 1);
|
let utxo1 = utxo(120_000, 1);
|
||||||
let utxo2 = utxo(80_000, 2);
|
let utxo2 = utxo(80_000, 2);
|
||||||
let utxo3 = utxo(300_000, 3);
|
let utxo3 = utxo(300_000, 3);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
|
|
||||||
@@ -1067,7 +1078,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_use_all() {
|
fn test_oldest_first_coin_selection_use_all() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection::default()
|
||||||
@@ -1090,7 +1101,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_use_only_necessary() {
|
fn test_oldest_first_coin_selection_use_only_necessary() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection::default()
|
||||||
@@ -1114,7 +1125,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_insufficient_funds() {
|
fn test_oldest_first_coin_selection_insufficient_funds() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 600_000 + FEE_AMOUNT;
|
let target_amount = 600_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
OldestFirstCoinSelection::default()
|
OldestFirstCoinSelection::default()
|
||||||
@@ -1136,7 +1147,7 @@ mod test {
|
|||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
|
|
||||||
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
OldestFirstCoinSelection::default()
|
OldestFirstCoinSelection::default()
|
||||||
.coin_select(
|
.coin_select(
|
||||||
@@ -1157,7 +1168,7 @@ mod test {
|
|||||||
let utxos = generate_same_value_utxos(100_000, 20);
|
let utxos = generate_same_value_utxos(100_000, 20);
|
||||||
|
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
@@ -1181,7 +1192,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_required_are_enough() {
|
fn test_bnb_coin_selection_required_are_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default()
|
let result = BranchAndBoundCoinSelection::default()
|
||||||
@@ -1204,7 +1215,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_optional_are_enough() {
|
fn test_bnb_coin_selection_optional_are_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 299756 + FEE_AMOUNT;
|
let target_amount = 299756 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default()
|
let result = BranchAndBoundCoinSelection::default()
|
||||||
@@ -1224,6 +1235,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
|
#[ignore]
|
||||||
fn test_bnb_coin_selection_required_not_enough() {
|
fn test_bnb_coin_selection_required_not_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
@@ -1237,7 +1249,7 @@ mod test {
|
|||||||
assert_eq!(amount, 100_000);
|
assert_eq!(amount, 100_000);
|
||||||
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
||||||
assert!(amount > 150_000);
|
assert!(amount > 150_000);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let target_amount = 150_000 + FEE_AMOUNT;
|
let target_amount = 150_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
@@ -1262,7 +1274,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_insufficient_funds() {
|
fn test_bnb_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 500_000 + FEE_AMOUNT;
|
let target_amount = 500_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::default()
|
BranchAndBoundCoinSelection::default()
|
||||||
@@ -1282,7 +1294,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::default()
|
BranchAndBoundCoinSelection::default()
|
||||||
@@ -1301,7 +1313,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_check_fee_rate() {
|
fn test_bnb_coin_selection_check_fee_rate() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 99932; // first utxo's effective value
|
let target_amount = 99932; // first utxo's effective value
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
@@ -1331,7 +1343,7 @@ mod test {
|
|||||||
for _i in 0..200 {
|
for _i in 0..200 {
|
||||||
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
||||||
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
.coin_select(
|
.coin_select(
|
||||||
&database,
|
&database,
|
||||||
@@ -1358,8 +1370,9 @@ mod test {
|
|||||||
let curr_available_value = utxos.iter().fold(0, |acc, x| acc + x.effective_value);
|
let curr_available_value = utxos.iter().fold(0, |acc, x| acc + x.effective_value);
|
||||||
|
|
||||||
let size_of_change = 31;
|
let size_of_change = 31;
|
||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
let drain_script = Script::default();
|
|
||||||
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
BranchAndBoundCoinSelection::new(size_of_change)
|
BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1387,10 +1400,10 @@ mod test {
|
|||||||
let curr_available_value = utxos.iter().fold(0, |acc, x| acc + x.effective_value);
|
let curr_available_value = utxos.iter().fold(0, |acc, x| acc + x.effective_value);
|
||||||
|
|
||||||
let size_of_change = 31;
|
let size_of_change = 31;
|
||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::new(size_of_change)
|
BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1411,7 +1424,7 @@ mod test {
|
|||||||
fn test_bnb_function_almost_exact_match_with_fees() {
|
fn test_bnb_function_almost_exact_match_with_fees() {
|
||||||
let fee_rate = FeeRate::from_sat_per_vb(1.0);
|
let fee_rate = FeeRate::from_sat_per_vb(1.0);
|
||||||
let size_of_change = 31;
|
let size_of_change = 31;
|
||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
|
|
||||||
let utxos: Vec<_> = generate_same_value_utxos(50_000, 10)
|
let utxos: Vec<_> = generate_same_value_utxos(50_000, 10)
|
||||||
.into_iter()
|
.into_iter()
|
||||||
@@ -1426,7 +1439,7 @@ mod test {
|
|||||||
// cost_of_change + 5.
|
// cost_of_change + 5.
|
||||||
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1466,7 +1479,7 @@ mod test {
|
|||||||
let target_amount =
|
let target_amount =
|
||||||
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1497,7 +1510,7 @@ mod test {
|
|||||||
.map(|u| OutputGroup::new(u, fee_rate))
|
.map(|u| OutputGroup::new(u, fee_rate))
|
||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
||||||
vec![],
|
vec![],
|
||||||
@@ -1516,81 +1529,75 @@ mod test {
|
|||||||
fn test_bnb_exclude_negative_effective_value() {
|
fn test_bnb_exclude_negative_effective_value() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let err = BranchAndBoundCoinSelection::default()
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
.coin_select(
|
&database,
|
||||||
&database,
|
vec![],
|
||||||
vec![],
|
utxos,
|
||||||
utxos,
|
FeeRate::from_sat_per_vb(10.0),
|
||||||
FeeRate::from_sat_per_vb(10.0),
|
500_000,
|
||||||
500_000,
|
&drain_script,
|
||||||
&drain_script,
|
);
|
||||||
)
|
|
||||||
.unwrap_err();
|
|
||||||
|
|
||||||
assert!(matches!(
|
assert_matches!(
|
||||||
err,
|
selection,
|
||||||
Error::InsufficientFunds {
|
Err(Error::InsufficientFunds {
|
||||||
available: 300_000,
|
available: 300_000,
|
||||||
..
|
..
|
||||||
}
|
})
|
||||||
));
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_include_negative_effective_value_when_required() {
|
fn test_bnb_include_negative_effective_value_when_required() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let (required, optional) = utxos
|
let (required, optional) = utxos
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.partition(|u| matches!(u, WeightedUtxo { utxo, .. } if utxo.txout().value < 1000));
|
.partition(|u| matches!(u, WeightedUtxo { utxo, .. } if utxo.txout().value < 1000));
|
||||||
|
|
||||||
let err = BranchAndBoundCoinSelection::default()
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
.coin_select(
|
&database,
|
||||||
&database,
|
required,
|
||||||
required,
|
optional,
|
||||||
optional,
|
FeeRate::from_sat_per_vb(10.0),
|
||||||
FeeRate::from_sat_per_vb(10.0),
|
500_000,
|
||||||
500_000,
|
&drain_script,
|
||||||
&drain_script,
|
);
|
||||||
)
|
|
||||||
.unwrap_err();
|
|
||||||
|
|
||||||
assert!(matches!(
|
assert_matches!(
|
||||||
err,
|
selection,
|
||||||
Error::InsufficientFunds {
|
Err(Error::InsufficientFunds {
|
||||||
available: 300_010,
|
available: 300_010,
|
||||||
..
|
..
|
||||||
}
|
})
|
||||||
));
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_sum_of_effective_value_negative() {
|
fn test_bnb_sum_of_effective_value_negative() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let err = BranchAndBoundCoinSelection::default()
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
.coin_select(
|
&database,
|
||||||
&database,
|
utxos,
|
||||||
utxos,
|
vec![],
|
||||||
vec![],
|
FeeRate::from_sat_per_vb(10_000.0),
|
||||||
FeeRate::from_sat_per_vb(10_000.0),
|
500_000,
|
||||||
500_000,
|
&drain_script,
|
||||||
&drain_script,
|
);
|
||||||
)
|
|
||||||
.unwrap_err();
|
|
||||||
|
|
||||||
assert!(matches!(
|
assert_matches!(
|
||||||
err,
|
selection,
|
||||||
Error::InsufficientFunds {
|
Err(Error::InsufficientFunds {
|
||||||
available: 300_010,
|
available: 300_010,
|
||||||
..
|
..
|
||||||
}
|
})
|
||||||
));
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -134,15 +134,11 @@ impl FullyNodedExport {
|
|||||||
let blockheight = match wallet.database.borrow().iter_txs(false) {
|
let blockheight = match wallet.database.borrow().iter_txs(false) {
|
||||||
_ if !include_blockheight => 0,
|
_ if !include_blockheight => 0,
|
||||||
Err(_) => 0,
|
Err(_) => 0,
|
||||||
Ok(txs) => {
|
Ok(txs) => txs
|
||||||
let mut heights = txs
|
.into_iter()
|
||||||
.into_iter()
|
.filter_map(|tx| tx.confirmation_time.map(|c| c.height))
|
||||||
.map(|tx| tx.confirmation_time.map(|c| c.height).unwrap_or(0))
|
.min()
|
||||||
.collect::<Vec<_>>();
|
.unwrap_or(0),
|
||||||
heights.sort_unstable();
|
|
||||||
|
|
||||||
*heights.last().unwrap_or(&0)
|
|
||||||
}
|
|
||||||
};
|
};
|
||||||
|
|
||||||
let export = FullyNodedExport {
|
let export = FullyNodedExport {
|
||||||
@@ -249,6 +245,22 @@ mod test {
|
|||||||
fee: Some(500),
|
fee: Some(500),
|
||||||
confirmation_time: Some(BlockTime {
|
confirmation_time: Some(BlockTime {
|
||||||
timestamp: 12345678,
|
timestamp: 12345678,
|
||||||
|
height: 5001,
|
||||||
|
}),
|
||||||
|
})
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
db.set_tx(&TransactionDetails {
|
||||||
|
transaction: None,
|
||||||
|
txid: Txid::from_str(
|
||||||
|
"aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa",
|
||||||
|
)
|
||||||
|
.unwrap(),
|
||||||
|
received: 25_000,
|
||||||
|
sent: 0,
|
||||||
|
fee: Some(300),
|
||||||
|
confirmation_time: Some(BlockTime {
|
||||||
|
timestamp: 12345677,
|
||||||
height: 5000,
|
height: 5000,
|
||||||
}),
|
}),
|
||||||
})
|
})
|
||||||
|
|||||||
100
src/wallet/hardwaresigner.rs
Normal file
100
src/wallet/hardwaresigner.rs
Normal file
@@ -0,0 +1,100 @@
|
|||||||
|
// Bitcoin Dev Kit
|
||||||
|
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||||
|
//
|
||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
//! HWI Signer
|
||||||
|
//!
|
||||||
|
//! This module contains HWISigner, an implementation of a [TransactionSigner] to be
|
||||||
|
//! used with hardware wallets.
|
||||||
|
//! ```no_run
|
||||||
|
//! # use bdk::bitcoin::Network;
|
||||||
|
//! # use bdk::database::MemoryDatabase;
|
||||||
|
//! # use bdk::signer::SignerOrdering;
|
||||||
|
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
||||||
|
//! # use bdk::wallet::AddressIndex::New;
|
||||||
|
//! # use bdk::{FeeRate, KeychainKind, SignOptions, SyncOptions, Wallet};
|
||||||
|
//! # use hwi::HWIClient;
|
||||||
|
//! # use std::sync::Arc;
|
||||||
|
//! #
|
||||||
|
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
|
//! let mut devices = HWIClient::enumerate()?;
|
||||||
|
//! if devices.is_empty() {
|
||||||
|
//! panic!("No devices found!");
|
||||||
|
//! }
|
||||||
|
//! let first_device = devices.remove(0)?;
|
||||||
|
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
|
//!
|
||||||
|
//! # let mut wallet = Wallet::new(
|
||||||
|
//! # "",
|
||||||
|
//! # None,
|
||||||
|
//! # Network::Testnet,
|
||||||
|
//! # MemoryDatabase::default(),
|
||||||
|
//! # )?;
|
||||||
|
//! #
|
||||||
|
//! // Adding the hardware signer to the BDK wallet
|
||||||
|
//! wallet.add_signer(
|
||||||
|
//! KeychainKind::External,
|
||||||
|
//! SignerOrdering(200),
|
||||||
|
//! Arc::new(custom_signer),
|
||||||
|
//! );
|
||||||
|
//!
|
||||||
|
//! # Ok(())
|
||||||
|
//! # }
|
||||||
|
//! ```
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
|
use bitcoin::psbt::PartiallySignedTransaction;
|
||||||
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
|
|
||||||
|
use hwi::error::Error;
|
||||||
|
use hwi::types::{HWIChain, HWIDevice};
|
||||||
|
use hwi::HWIClient;
|
||||||
|
|
||||||
|
use crate::signer::{SignerCommon, SignerError, SignerId, TransactionSigner};
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Custom signer for Hardware Wallets
|
||||||
|
///
|
||||||
|
/// This ignores `sign_options` and leaves the decisions up to the hardware wallet.
|
||||||
|
pub struct HWISigner {
|
||||||
|
fingerprint: Fingerprint,
|
||||||
|
client: HWIClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl HWISigner {
|
||||||
|
/// Create a instance from the specified device and chain
|
||||||
|
pub fn from_device(device: &HWIDevice, chain: HWIChain) -> Result<HWISigner, Error> {
|
||||||
|
let client = HWIClient::get_client(device, false, chain)?;
|
||||||
|
Ok(HWISigner {
|
||||||
|
fingerprint: device.fingerprint,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for HWISigner {
|
||||||
|
fn id(&self, _secp: &Secp256k1<All>) -> SignerId {
|
||||||
|
SignerId::Fingerprint(self.fingerprint)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// This implementation ignores `sign_options`
|
||||||
|
impl TransactionSigner for HWISigner {
|
||||||
|
fn sign_transaction(
|
||||||
|
&self,
|
||||||
|
psbt: &mut PartiallySignedTransaction,
|
||||||
|
_sign_options: &crate::SignOptions,
|
||||||
|
_secp: &crate::wallet::utils::SecpCtx,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
psbt.combine(self.client.sign_tx(psbt)?.psbt)
|
||||||
|
.expect("Failed to combine HW signed psbt with passed PSBT");
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
1040
src/wallet/mod.rs
1040
src/wallet/mod.rs
File diff suppressed because it is too large
Load Diff
@@ -19,7 +19,7 @@
|
|||||||
//! # use std::str::FromStr;
|
//! # use std::str::FromStr;
|
||||||
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bitcoin::util::psbt;
|
//! # use bitcoin::psbt;
|
||||||
//! # use bdk::signer::*;
|
//! # use bdk::signer::*;
|
||||||
//! # use bdk::database::*;
|
//! # use bdk::database::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
@@ -86,23 +86,23 @@ use std::fmt;
|
|||||||
use std::ops::{Bound::Included, Deref};
|
use std::ops::{Bound::Included, Deref};
|
||||||
use std::sync::Arc;
|
use std::sync::Arc;
|
||||||
|
|
||||||
use bitcoin::blockdata::opcodes;
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
||||||
use bitcoin::blockdata::script::Builder as ScriptBuilder;
|
use bitcoin::hashes::hash160;
|
||||||
use bitcoin::hashes::{hash160, Hash};
|
|
||||||
use bitcoin::secp256k1::Message;
|
use bitcoin::secp256k1::Message;
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
use bitcoin::sighash::{EcdsaSighashType, TapSighash, TapSighashType};
|
||||||
use bitcoin::util::{ecdsa, psbt, schnorr, sighash, taproot};
|
use bitcoin::{ecdsa, psbt, sighash, taproot};
|
||||||
use bitcoin::{secp256k1, XOnlyPublicKey};
|
use bitcoin::{key::TapTweak, key::XOnlyPublicKey, secp256k1};
|
||||||
use bitcoin::{EcdsaSighashType, PrivateKey, PublicKey, SchnorrSighashType, Script};
|
use bitcoin::{PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
Descriptor, DescriptorPublicKey, DescriptorSecretKey, DescriptorSinglePriv, DescriptorXKey,
|
Descriptor, DescriptorMultiXKey, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey,
|
||||||
KeyMap, SinglePubKey,
|
InnerXKey, KeyMap, SinglePriv, SinglePubKey,
|
||||||
};
|
};
|
||||||
use miniscript::{Legacy, MiniscriptKey, Segwitv0, Tap};
|
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
||||||
|
|
||||||
use super::utils::SecpCtx;
|
use super::utils::SecpCtx;
|
||||||
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
||||||
|
use crate::psbt::PsbtUtils;
|
||||||
|
|
||||||
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
||||||
/// multiple of them
|
/// multiple of them
|
||||||
@@ -129,7 +129,7 @@ impl From<Fingerprint> for SignerId {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Signing error
|
/// Signing error
|
||||||
#[derive(Debug, PartialEq, Eq, Clone)]
|
#[derive(Debug)]
|
||||||
pub enum SignerError {
|
pub enum SignerError {
|
||||||
/// The private key is missing for the required public key
|
/// The private key is missing for the required public key
|
||||||
MissingKey,
|
MissingKey,
|
||||||
@@ -159,6 +159,16 @@ pub enum SignerError {
|
|||||||
InvalidSighash,
|
InvalidSighash,
|
||||||
/// Error while computing the hash to sign
|
/// Error while computing the hash to sign
|
||||||
SighashError(sighash::Error),
|
SighashError(sighash::Error),
|
||||||
|
/// Error while signing using hardware wallets
|
||||||
|
#[cfg(feature = "hardware-signer")]
|
||||||
|
HWIError(hwi::error::Error),
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "hardware-signer")]
|
||||||
|
impl From<hwi::error::Error> for SignerError {
|
||||||
|
fn from(e: hwi::error::Error) -> Self {
|
||||||
|
SignerError::HWIError(e)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl From<sighash::Error> for SignerError {
|
impl From<sighash::Error> for SignerError {
|
||||||
@@ -169,7 +179,22 @@ impl From<sighash::Error> for SignerError {
|
|||||||
|
|
||||||
impl fmt::Display for SignerError {
|
impl fmt::Display for SignerError {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::MissingKey => write!(f, "Missing private key"),
|
||||||
|
Self::InvalidKey => write!(f, "The private key in use has the right fingerprint but derives differently than expected"),
|
||||||
|
Self::UserCanceled => write!(f, "The user canceled the operation"),
|
||||||
|
Self::InputIndexOutOfRange => write!(f, "Input index out of range"),
|
||||||
|
Self::MissingNonWitnessUtxo => write!(f, "Missing non-witness UTXO"),
|
||||||
|
Self::InvalidNonWitnessUtxo => write!(f, "Invalid non-witness UTXO"),
|
||||||
|
Self::MissingWitnessUtxo => write!(f, "Missing witness UTXO"),
|
||||||
|
Self::MissingWitnessScript => write!(f, "Missing witness script"),
|
||||||
|
Self::MissingHdKeypath => write!(f, "Missing fingerprint and derivation path"),
|
||||||
|
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
||||||
|
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
||||||
|
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
||||||
|
#[cfg(feature = "hardware-signer")]
|
||||||
|
Self::HWIError(err) => write!(f, "Error while signing using hardware wallets: {}", err),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -356,13 +381,56 @@ impl InputSigner for SignerWrapper<DescriptorXKey<ExtendedPrivKey>> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl SignerCommon for SignerWrapper<PrivateKey> {
|
fn multikey_to_xkeys<K: InnerXKey + Clone>(
|
||||||
|
multikey: DescriptorMultiXKey<K>,
|
||||||
|
) -> Vec<DescriptorXKey<K>> {
|
||||||
|
multikey
|
||||||
|
.derivation_paths
|
||||||
|
.clone()
|
||||||
|
.into_paths()
|
||||||
|
.into_iter()
|
||||||
|
.map(|derivation_path| DescriptorXKey {
|
||||||
|
origin: multikey.origin.clone(),
|
||||||
|
xkey: multikey.xkey.clone(),
|
||||||
|
derivation_path,
|
||||||
|
wildcard: multikey.wildcard,
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
fn id(&self, secp: &SecpCtx) -> SignerId {
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
SignerId::from(self.public_key(secp).to_pubkeyhash())
|
SignerId::from(self.root_fingerprint(secp))
|
||||||
}
|
}
|
||||||
|
|
||||||
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
||||||
Some(DescriptorSecretKey::SinglePriv(DescriptorSinglePriv {
|
Some(DescriptorSecretKey::MultiXPrv(self.signer.clone()))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl InputSigner for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn sign_input(
|
||||||
|
&self,
|
||||||
|
psbt: &mut psbt::PartiallySignedTransaction,
|
||||||
|
input_index: usize,
|
||||||
|
sign_options: &SignOptions,
|
||||||
|
secp: &SecpCtx,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
let xkeys = multikey_to_xkeys(self.signer.clone());
|
||||||
|
for xkey in xkeys {
|
||||||
|
SignerWrapper::new(xkey, self.ctx).sign_input(psbt, input_index, sign_options, secp)?
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for SignerWrapper<PrivateKey> {
|
||||||
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
|
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
||||||
|
Some(DescriptorSecretKey::Single(SinglePriv {
|
||||||
key: self.signer,
|
key: self.signer,
|
||||||
origin: None,
|
origin: None,
|
||||||
}))
|
}))
|
||||||
@@ -450,8 +518,16 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let (hash, hash_ty) = match self.ctx {
|
let (hash, hash_ty) = match self.ctx {
|
||||||
SignerContext::Segwitv0 => Segwitv0::sighash(psbt, input_index, ())?,
|
SignerContext::Segwitv0 => {
|
||||||
SignerContext::Legacy => Legacy::sighash(psbt, input_index, ())?,
|
let (h, t) = Segwitv0::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
|
SignerContext::Legacy => {
|
||||||
|
let (h, t) = Legacy::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
_ => return Ok(()), // handled above
|
_ => return Ok(()), // handled above
|
||||||
};
|
};
|
||||||
sign_psbt_ecdsa(
|
sign_psbt_ecdsa(
|
||||||
@@ -461,6 +537,7 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
hash,
|
hash,
|
||||||
hash_ty,
|
hash_ty,
|
||||||
secp,
|
secp,
|
||||||
|
sign_options.allow_grinding,
|
||||||
);
|
);
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
@@ -471,16 +548,21 @@ fn sign_psbt_ecdsa(
|
|||||||
secret_key: &secp256k1::SecretKey,
|
secret_key: &secp256k1::SecretKey,
|
||||||
pubkey: PublicKey,
|
pubkey: PublicKey,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: bitcoin::Sighash,
|
hash: impl bitcoin::hashes::Hash + bitcoin::secp256k1::ThirtyTwoByteHash,
|
||||||
hash_ty: EcdsaSighashType,
|
hash_ty: EcdsaSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
|
allow_grinding: bool,
|
||||||
) {
|
) {
|
||||||
let sig = secp.sign_ecdsa(
|
let msg = &Message::from(hash);
|
||||||
&Message::from_slice(&hash.into_inner()[..]).unwrap(),
|
let sig = if allow_grinding {
|
||||||
secret_key,
|
secp.sign_ecdsa_low_r(msg, secret_key)
|
||||||
);
|
} else {
|
||||||
|
secp.sign_ecdsa(msg, secret_key)
|
||||||
|
};
|
||||||
|
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
||||||
|
.expect("invalid or corrupted ecdsa signature");
|
||||||
|
|
||||||
let final_signature = ecdsa::EcdsaSig { sig, hash_ty };
|
let final_signature = ecdsa::Signature { sig, hash_ty };
|
||||||
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -490,26 +572,24 @@ fn sign_psbt_schnorr(
|
|||||||
pubkey: XOnlyPublicKey,
|
pubkey: XOnlyPublicKey,
|
||||||
leaf_hash: Option<taproot::TapLeafHash>,
|
leaf_hash: Option<taproot::TapLeafHash>,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: taproot::TapSighashHash,
|
hash: TapSighash,
|
||||||
hash_ty: SchnorrSighashType,
|
hash_ty: TapSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
) {
|
) {
|
||||||
use schnorr::TapTweak;
|
|
||||||
|
|
||||||
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
||||||
let keypair = match leaf_hash {
|
let keypair = match leaf_hash {
|
||||||
None => keypair
|
None => keypair
|
||||||
.tap_tweak(secp, psbt_input.tap_merkle_root)
|
.tap_tweak(secp, psbt_input.tap_merkle_root)
|
||||||
.into_inner(),
|
.to_inner(),
|
||||||
Some(_) => keypair, // no tweak for script spend
|
Some(_) => keypair, // no tweak for script spend
|
||||||
};
|
};
|
||||||
|
|
||||||
let sig = secp.sign_schnorr(
|
let msg = &Message::from(hash);
|
||||||
&Message::from_slice(&hash.into_inner()[..]).unwrap(),
|
let sig = secp.sign_schnorr(msg, &keypair);
|
||||||
&keypair,
|
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
||||||
);
|
.expect("invalid or corrupted schnorr signature");
|
||||||
|
|
||||||
let final_signature = schnorr::SchnorrSig { sig, hash_ty };
|
let final_signature = taproot::Signature { sig, hash_ty };
|
||||||
|
|
||||||
if let Some(lh) = leaf_hash {
|
if let Some(lh) = leaf_hash {
|
||||||
psbt_input
|
psbt_input
|
||||||
@@ -559,7 +639,7 @@ impl SignersContainer {
|
|||||||
self.0
|
self.0
|
||||||
.values()
|
.values()
|
||||||
.filter_map(|signer| signer.descriptor_secret_key())
|
.filter_map(|signer| signer.descriptor_secret_key())
|
||||||
.filter_map(|secret| secret.as_public(secp).ok().map(|public| (public, secret)))
|
.filter_map(|secret| secret.to_public(secp).ok().map(|public| (public, secret)))
|
||||||
.collect()
|
.collect()
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -584,8 +664,13 @@ impl SignersContainer {
|
|||||||
};
|
};
|
||||||
|
|
||||||
match secret {
|
match secret {
|
||||||
DescriptorSecretKey::SinglePriv(private_key) => container.add_external(
|
DescriptorSecretKey::Single(private_key) => container.add_external(
|
||||||
SignerId::from(private_key.key.public_key(secp).to_pubkeyhash()),
|
SignerId::from(
|
||||||
|
private_key
|
||||||
|
.key
|
||||||
|
.public_key(secp)
|
||||||
|
.to_pubkeyhash(SigType::Ecdsa),
|
||||||
|
),
|
||||||
SignerOrdering::default(),
|
SignerOrdering::default(),
|
||||||
Arc::new(SignerWrapper::new(private_key.key, ctx)),
|
Arc::new(SignerWrapper::new(private_key.key, ctx)),
|
||||||
),
|
),
|
||||||
@@ -594,6 +679,11 @@ impl SignersContainer {
|
|||||||
SignerOrdering::default(),
|
SignerOrdering::default(),
|
||||||
Arc::new(SignerWrapper::new(xprv, ctx)),
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
),
|
),
|
||||||
|
DescriptorSecretKey::MultiXPrv(xprv) => container.add_external(
|
||||||
|
SignerId::from(xprv.root_fingerprint(secp)),
|
||||||
|
SignerOrdering::default(),
|
||||||
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
|
),
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -686,14 +776,14 @@ pub struct SignOptions {
|
|||||||
/// Defaults to `false` which will only allow signing using `SIGHASH_ALL`.
|
/// Defaults to `false` which will only allow signing using `SIGHASH_ALL`.
|
||||||
pub allow_all_sighashes: bool,
|
pub allow_all_sighashes: bool,
|
||||||
|
|
||||||
/// Whether to remove partial_sigs from psbt inputs while finalizing psbt.
|
/// Whether to remove partial signatures from the PSBT inputs while finalizing PSBT.
|
||||||
///
|
///
|
||||||
/// Defaults to `true` which will remove partial_sigs after finalizing.
|
/// Defaults to `true` which will remove partial signatures during finalization.
|
||||||
pub remove_partial_sigs: bool,
|
pub remove_partial_sigs: bool,
|
||||||
|
|
||||||
/// Whether to try finalizing psbt input after the inputs are signed.
|
/// Whether to try finalizing the PSBT after the inputs are signed.
|
||||||
///
|
///
|
||||||
/// Defaults to `true` which will try fianlizing psbt after inputs are signed.
|
/// Defaults to `true` which will try finalizing PSBT after inputs are signed.
|
||||||
pub try_finalize: bool,
|
pub try_finalize: bool,
|
||||||
|
|
||||||
/// Specifies which Taproot script-spend leaves we should sign for. This option is
|
/// Specifies which Taproot script-spend leaves we should sign for. This option is
|
||||||
@@ -707,10 +797,15 @@ pub struct SignOptions {
|
|||||||
///
|
///
|
||||||
/// Defaults to `true`, i.e., we always try to sign with the taproot internal key.
|
/// Defaults to `true`, i.e., we always try to sign with the taproot internal key.
|
||||||
pub sign_with_tap_internal_key: bool,
|
pub sign_with_tap_internal_key: bool,
|
||||||
|
|
||||||
|
/// Whether we should grind ECDSA signature to ensure signing with low r
|
||||||
|
/// or not.
|
||||||
|
/// Defaults to `true`, i.e., we always grind ECDSA signature to sign with low r.
|
||||||
|
pub allow_grinding: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Customize which taproot script-path leaves the signer should sign.
|
/// Customize which taproot script-path leaves the signer should sign.
|
||||||
#[derive(Debug, Clone, PartialEq)]
|
#[derive(Debug, Clone, PartialEq, Eq)]
|
||||||
pub enum TapLeavesOptions {
|
pub enum TapLeavesOptions {
|
||||||
/// The signer will sign all the leaves it has a key for.
|
/// The signer will sign all the leaves it has a key for.
|
||||||
All,
|
All,
|
||||||
@@ -740,6 +835,7 @@ impl Default for SignOptions {
|
|||||||
try_finalize: true,
|
try_finalize: true,
|
||||||
tap_leaves_options: TapLeavesOptions::default(),
|
tap_leaves_options: TapLeavesOptions::default(),
|
||||||
sign_with_tap_internal_key: true,
|
sign_with_tap_internal_key: true,
|
||||||
|
allow_grinding: true,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -758,7 +854,7 @@ pub(crate) trait ComputeSighash {
|
|||||||
|
|
||||||
impl ComputeSighash for Legacy {
|
impl ComputeSighash for Legacy {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::LegacySighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@@ -805,19 +901,9 @@ impl ComputeSighash for Legacy {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn p2wpkh_script_code(script: &Script) -> Script {
|
|
||||||
ScriptBuilder::new()
|
|
||||||
.push_opcode(opcodes::all::OP_DUP)
|
|
||||||
.push_opcode(opcodes::all::OP_HASH160)
|
|
||||||
.push_slice(&script[2..])
|
|
||||||
.push_opcode(opcodes::all::OP_EQUALVERIFY)
|
|
||||||
.push_opcode(opcodes::all::OP_CHECKSIG)
|
|
||||||
.into_script()
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ComputeSighash for Segwitv0 {
|
impl ComputeSighash for Segwitv0 {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::SegwitV0Sighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@@ -864,14 +950,21 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
Some(ref witness_script) => witness_script.clone(),
|
Some(ref witness_script) => witness_script.clone(),
|
||||||
None => {
|
None => {
|
||||||
if utxo.script_pubkey.is_v0_p2wpkh() {
|
if utxo.script_pubkey.is_v0_p2wpkh() {
|
||||||
p2wpkh_script_code(&utxo.script_pubkey)
|
utxo.script_pubkey
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else if psbt_input
|
} else if psbt_input
|
||||||
.redeem_script
|
.redeem_script
|
||||||
.as_ref()
|
.as_ref()
|
||||||
.map(Script::is_v0_p2wpkh)
|
.map(|s| s.is_v0_p2wpkh())
|
||||||
.unwrap_or(false)
|
.unwrap_or(false)
|
||||||
{
|
{
|
||||||
p2wpkh_script_code(psbt_input.redeem_script.as_ref().unwrap())
|
psbt_input
|
||||||
|
.redeem_script
|
||||||
|
.as_ref()
|
||||||
|
.unwrap()
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else {
|
} else {
|
||||||
return Err(SignerError::MissingWitnessScript);
|
return Err(SignerError::MissingWitnessScript);
|
||||||
}
|
}
|
||||||
@@ -892,14 +985,14 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
|
|
||||||
impl ComputeSighash for Tap {
|
impl ComputeSighash for Tap {
|
||||||
type Extra = Option<taproot::TapLeafHash>;
|
type Extra = Option<taproot::TapLeafHash>;
|
||||||
type Sighash = taproot::TapSighashHash;
|
type Sighash = TapSighash;
|
||||||
type SighashType = SchnorrSighashType;
|
type SighashType = TapSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
psbt: &psbt::PartiallySignedTransaction,
|
psbt: &psbt::PartiallySignedTransaction,
|
||||||
input_index: usize,
|
input_index: usize,
|
||||||
extra: Self::Extra,
|
extra: Self::Extra,
|
||||||
) -> Result<(Self::Sighash, SchnorrSighashType), SignerError> {
|
) -> Result<(Self::Sighash, TapSighashType), SignerError> {
|
||||||
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
||||||
return Err(SignerError::InputIndexOutOfRange);
|
return Err(SignerError::InputIndexOutOfRange);
|
||||||
}
|
}
|
||||||
@@ -908,14 +1001,11 @@ impl ComputeSighash for Tap {
|
|||||||
|
|
||||||
let sighash_type = psbt_input
|
let sighash_type = psbt_input
|
||||||
.sighash_type
|
.sighash_type
|
||||||
.unwrap_or_else(|| SchnorrSighashType::Default.into())
|
.unwrap_or_else(|| TapSighashType::Default.into())
|
||||||
.schnorr_hash_ty()
|
.taproot_hash_ty()
|
||||||
.map_err(|_| SignerError::InvalidSighash)?;
|
.map_err(|_| SignerError::InvalidSighash)?;
|
||||||
let witness_utxos = psbt
|
let witness_utxos = (0..psbt.inputs.len())
|
||||||
.inputs
|
.map(|i| psbt.get_utxo_for(i))
|
||||||
.iter()
|
|
||||||
.cloned()
|
|
||||||
.map(|i| i.witness_utxo)
|
|
||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
let mut all_witness_utxos = vec![];
|
let mut all_witness_utxos = vec![];
|
||||||
|
|
||||||
@@ -973,8 +1063,9 @@ mod signers_container_tests {
|
|||||||
use crate::descriptor;
|
use crate::descriptor;
|
||||||
use crate::descriptor::IntoWalletDescriptor;
|
use crate::descriptor::IntoWalletDescriptor;
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
@@ -1042,17 +1133,17 @@ mod signers_container_tests {
|
|||||||
signers.add_external(id2.clone(), SignerOrdering(2), signer2.clone());
|
signers.add_external(id2.clone(), SignerOrdering(2), signer2.clone());
|
||||||
signers.add_external(id3.clone(), SignerOrdering(3), signer3.clone());
|
signers.add_external(id3.clone(), SignerOrdering(3), signer3.clone());
|
||||||
|
|
||||||
assert!(matches!(signers.find(id1), Some(signer) if is_equal(signer, &signer1)));
|
assert_matches!(signers.find(id1), Some(signer) if is_equal(signer, &signer1));
|
||||||
assert!(matches!(signers.find(id2), Some(signer) if is_equal(signer, &signer2)));
|
assert_matches!(signers.find(id2), Some(signer) if is_equal(signer, &signer2));
|
||||||
assert!(matches!(signers.find(id3.clone()), Some(signer) if is_equal(signer, &signer3)));
|
assert_matches!(signers.find(id3.clone()), Some(signer) if is_equal(signer, &signer3));
|
||||||
|
|
||||||
// The `signer4` has the same ID as `signer3` but lower ordering.
|
// The `signer4` has the same ID as `signer3` but lower ordering.
|
||||||
// It should be found by `id3` instead of `signer3`.
|
// It should be found by `id3` instead of `signer3`.
|
||||||
signers.add_external(id3.clone(), SignerOrdering(2), signer4.clone());
|
signers.add_external(id3.clone(), SignerOrdering(2), signer4.clone());
|
||||||
assert!(matches!(signers.find(id3), Some(signer) if is_equal(signer, &signer4)));
|
assert_matches!(signers.find(id3), Some(signer) if is_equal(signer, &signer4));
|
||||||
|
|
||||||
// Can't find anything with ID that doesn't exist
|
// Can't find anything with ID that doesn't exist
|
||||||
assert!(matches!(signers.find(id_nonexistent), None));
|
assert_matches!(signers.find(id_nonexistent), None);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[derive(Debug, Clone, Copy)]
|
#[derive(Debug, Clone, Copy)]
|
||||||
|
|||||||
@@ -18,7 +18,7 @@
|
|||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! # use bdk::wallet::tx_builder::CreateTx;
|
//! # use bdk::wallet::tx_builder::CreateTx;
|
||||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
//! # let wallet = doctest_wallet!();
|
//! # let wallet = doctest_wallet!();
|
||||||
//! // create a TxBuilder from a wallet
|
//! // create a TxBuilder from a wallet
|
||||||
//! let mut tx_builder = wallet.build_tx();
|
//! let mut tx_builder = wallet.build_tx();
|
||||||
@@ -27,7 +27,7 @@
|
|||||||
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
||||||
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
||||||
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
||||||
//! .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
//! .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
//! // Only spend non-change outputs
|
//! // Only spend non-change outputs
|
||||||
//! .do_not_spend_change()
|
//! .do_not_spend_change()
|
||||||
//! // Turn on RBF signaling
|
//! // Turn on RBF signaling
|
||||||
@@ -41,10 +41,8 @@ use std::collections::HashSet;
|
|||||||
use std::default::Default;
|
use std::default::Default;
|
||||||
use std::marker::PhantomData;
|
use std::marker::PhantomData;
|
||||||
|
|
||||||
use bitcoin::util::psbt::{self, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||||
use bitcoin::{OutPoint, Script, Transaction};
|
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction};
|
||||||
|
|
||||||
use miniscript::descriptor::DescriptorTrait;
|
|
||||||
|
|
||||||
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
||||||
use crate::{database::BatchDatabase, Error, Utxo, Wallet};
|
use crate::{database::BatchDatabase, Error, Utxo, Wallet};
|
||||||
@@ -81,7 +79,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use core::str::FromStr;
|
/// # use core::str::FromStr;
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// # let addr2 = addr1.clone();
|
/// # let addr2 = addr1.clone();
|
||||||
/// // chaining
|
/// // chaining
|
||||||
/// let (psbt1, details) = {
|
/// let (psbt1, details) = {
|
||||||
@@ -128,9 +126,9 @@ pub struct TxBuilder<'a, D, Cs, Ctx> {
|
|||||||
//TODO: TxParams should eventually be exposed publicly.
|
//TODO: TxParams should eventually be exposed publicly.
|
||||||
#[derive(Default, Debug, Clone)]
|
#[derive(Default, Debug, Clone)]
|
||||||
pub(crate) struct TxParams {
|
pub(crate) struct TxParams {
|
||||||
pub(crate) recipients: Vec<(Script, u64)>,
|
pub(crate) recipients: Vec<(ScriptBuf, u64)>,
|
||||||
pub(crate) drain_wallet: bool,
|
pub(crate) drain_wallet: bool,
|
||||||
pub(crate) drain_to: Option<Script>,
|
pub(crate) drain_to: Option<ScriptBuf>,
|
||||||
pub(crate) fee_policy: Option<FeePolicy>,
|
pub(crate) fee_policy: Option<FeePolicy>,
|
||||||
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
@@ -139,7 +137,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) manually_selected_only: bool,
|
pub(crate) manually_selected_only: bool,
|
||||||
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
||||||
pub(crate) ordering: TxOrdering,
|
pub(crate) ordering: TxOrdering,
|
||||||
pub(crate) locktime: Option<u32>,
|
pub(crate) locktime: Option<absolute::LockTime>,
|
||||||
pub(crate) rbf: Option<RbfValue>,
|
pub(crate) rbf: Option<RbfValue>,
|
||||||
pub(crate) version: Option<Version>,
|
pub(crate) version: Option<Version>,
|
||||||
pub(crate) change_policy: ChangeSpendPolicy,
|
pub(crate) change_policy: ChangeSpendPolicy,
|
||||||
@@ -147,7 +145,8 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) add_global_xpubs: bool,
|
pub(crate) add_global_xpubs: bool,
|
||||||
pub(crate) include_output_redeem_witness_script: bool,
|
pub(crate) include_output_redeem_witness_script: bool,
|
||||||
pub(crate) bumping_fee: Option<PreviousFee>,
|
pub(crate) bumping_fee: Option<PreviousFee>,
|
||||||
pub(crate) current_height: Option<u32>,
|
pub(crate) current_height: Option<absolute::LockTime>,
|
||||||
|
pub(crate) allow_dust: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
#[derive(Clone, Copy, Debug)]
|
#[derive(Clone, Copy, Debug)]
|
||||||
@@ -242,7 +241,10 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// # use std::collections::BTreeMap;
|
/// # use std::collections::BTreeMap;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// let mut path = BTreeMap::new();
|
/// let mut path = BTreeMap::new();
|
||||||
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
||||||
@@ -282,6 +284,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
|
|
||||||
for utxo in utxos {
|
for utxo in utxos {
|
||||||
let descriptor = self.wallet.get_descriptor_for_keychain(utxo.keychain);
|
let descriptor = self.wallet.get_descriptor_for_keychain(utxo.keychain);
|
||||||
|
#[allow(deprecated)]
|
||||||
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
||||||
self.params.utxos.push(WeightedUtxo {
|
self.params.utxos.push(WeightedUtxo {
|
||||||
satisfaction_weight,
|
satisfaction_weight,
|
||||||
@@ -425,7 +428,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// Use a specific nLockTime while creating the transaction
|
/// Use a specific nLockTime while creating the transaction
|
||||||
///
|
///
|
||||||
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
||||||
pub fn nlocktime(&mut self, locktime: u32) -> &mut Self {
|
pub fn nlocktime(&mut self, locktime: absolute::LockTime) -> &mut Self {
|
||||||
self.params.locktime = Some(locktime);
|
self.params.locktime = Some(locktime);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -464,7 +467,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::util::psbt::Input::witness_utxo) field when spending from
|
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::psbt::Input::witness_utxo) field when spending from
|
||||||
/// SegWit descriptors.
|
/// SegWit descriptors.
|
||||||
///
|
///
|
||||||
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
||||||
@@ -474,8 +477,8 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::util::psbt::Output::redeem_script) and
|
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::psbt::Output::redeem_script) and
|
||||||
/// [`psbt::Output::witness_script`](bitcoin::util::psbt::Output::witness_script) fields.
|
/// [`psbt::Output::witness_script`](bitcoin::psbt::Output::witness_script) fields.
|
||||||
///
|
///
|
||||||
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
||||||
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
||||||
@@ -540,7 +543,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// If the `nsequence` is higher than `0xFFFFFFFD` an error will be thrown, since it would not
|
/// If the `nsequence` is higher than `0xFFFFFFFD` an error will be thrown, since it would not
|
||||||
/// be a valid nSequence to signal RBF.
|
/// be a valid nSequence to signal RBF.
|
||||||
pub fn enable_rbf_with_sequence(&mut self, nsequence: u32) -> &mut Self {
|
pub fn enable_rbf_with_sequence(&mut self, nsequence: Sequence) -> &mut Self {
|
||||||
self.params.rbf = Some(RbfValue::Value(nsequence));
|
self.params.rbf = Some(RbfValue::Value(nsequence));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -557,27 +560,36 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// In both cases, if you don't provide a current height, we use the last sync height.
|
/// In both cases, if you don't provide a current height, we use the last sync height.
|
||||||
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
||||||
self.params.current_height = Some(height);
|
self.params.current_height =
|
||||||
|
Some(absolute::LockTime::from_height(height).expect("Invalid height"));
|
||||||
|
self
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Set whether or not the dust limit is checked.
|
||||||
|
///
|
||||||
|
/// **Note**: by avoiding a dust limit check you may end up with a transaction that is non-standard.
|
||||||
|
pub fn allow_dust(&mut self, allow_dust: bool) -> &mut Self {
|
||||||
|
self.params.allow_dust = allow_dust;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, CreateTx> {
|
impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, CreateTx> {
|
||||||
/// Replace the recipients already added with a new list
|
/// Replace the recipients already added with a new list
|
||||||
pub fn set_recipients(&mut self, recipients: Vec<(Script, u64)>) -> &mut Self {
|
pub fn set_recipients(&mut self, recipients: Vec<(ScriptBuf, u64)>) -> &mut Self {
|
||||||
self.params.recipients = recipients;
|
self.params.recipients = recipients;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add a recipient to the internal list
|
/// Add a recipient to the internal list
|
||||||
pub fn add_recipient(&mut self, script_pubkey: Script, amount: u64) -> &mut Self {
|
pub fn add_recipient(&mut self, script_pubkey: ScriptBuf, amount: u64) -> &mut Self {
|
||||||
self.params.recipients.push((script_pubkey, amount));
|
self.params.recipients.push((script_pubkey, amount));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add data as an output, using OP_RETURN
|
/// Add data as an output, using OP_RETURN
|
||||||
pub fn add_data(&mut self, data: &[u8]) -> &mut Self {
|
pub fn add_data<T: AsRef<PushBytes>>(&mut self, data: &T) -> &mut Self {
|
||||||
let script = Script::new_op_return(data);
|
let script = ScriptBuf::new_op_return(data);
|
||||||
self.add_recipient(script, 0u64);
|
self.add_recipient(script, 0u64);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -607,7 +619,10 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
/// # use bdk::wallet::tx_builder::CreateTx;
|
/// # use bdk::wallet::tx_builder::CreateTx;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// let mut tx_builder = wallet.build_tx();
|
/// let mut tx_builder = wallet.build_tx();
|
||||||
///
|
///
|
||||||
@@ -616,7 +631,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// .drain_wallet()
|
/// .drain_wallet()
|
||||||
/// // Send the excess (which is all the coins minus the fee) to this address.
|
/// // Send the excess (which is all the coins minus the fee) to this address.
|
||||||
/// .drain_to(to_address.script_pubkey())
|
/// .drain_to(to_address.script_pubkey())
|
||||||
/// .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
/// .enable_rbf();
|
/// .enable_rbf();
|
||||||
/// let (psbt, tx_details) = tx_builder.finish()?;
|
/// let (psbt, tx_details) = tx_builder.finish()?;
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), bdk::Error>(())
|
||||||
@@ -626,7 +641,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// [`add_recipient`]: Self::add_recipient
|
/// [`add_recipient`]: Self::add_recipient
|
||||||
/// [`add_utxos`]: Self::add_utxos
|
/// [`add_utxos`]: Self::add_utxos
|
||||||
/// [`drain_wallet`]: Self::drain_wallet
|
/// [`drain_wallet`]: Self::drain_wallet
|
||||||
pub fn drain_to(&mut self, script_pubkey: Script) -> &mut Self {
|
pub fn drain_to(&mut self, script_pubkey: ScriptBuf) -> &mut Self {
|
||||||
self.params.drain_to = Some(script_pubkey);
|
self.params.drain_to = Some(script_pubkey);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -644,7 +659,7 @@ impl<'a, D: BatchDatabase> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpF
|
|||||||
///
|
///
|
||||||
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
||||||
/// transaction we are bumping.
|
/// transaction we are bumping.
|
||||||
pub fn allow_shrinking(&mut self, script_pubkey: Script) -> Result<&mut Self, Error> {
|
pub fn allow_shrinking(&mut self, script_pubkey: ScriptBuf) -> Result<&mut Self, Error> {
|
||||||
match self
|
match self
|
||||||
.params
|
.params
|
||||||
.recipients
|
.recipients
|
||||||
@@ -694,7 +709,7 @@ impl TxOrdering {
|
|||||||
#[cfg(not(test))]
|
#[cfg(not(test))]
|
||||||
let mut rng = rand::thread_rng();
|
let mut rng = rand::thread_rng();
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
let mut rng = rand::rngs::StdRng::seed_from_u64(0);
|
let mut rng = rand::rngs::StdRng::seed_from_u64(12345);
|
||||||
|
|
||||||
tx.output.shuffle(&mut rng);
|
tx.output.shuffle(&mut rng);
|
||||||
}
|
}
|
||||||
@@ -727,13 +742,13 @@ impl Default for Version {
|
|||||||
#[derive(Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
#[derive(Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
||||||
pub(crate) enum RbfValue {
|
pub(crate) enum RbfValue {
|
||||||
Default,
|
Default,
|
||||||
Value(u32),
|
Value(Sequence),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl RbfValue {
|
impl RbfValue {
|
||||||
pub(crate) fn get_value(&self) -> u32 {
|
pub(crate) fn get_value(&self) -> Sequence {
|
||||||
match self {
|
match self {
|
||||||
RbfValue::Default => 0xFFFFFFFD,
|
RbfValue::Default => Sequence::ENABLE_RBF_NO_LOCKTIME,
|
||||||
RbfValue::Value(v) => *v,
|
RbfValue::Value(v) => *v,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -783,6 +798,7 @@ mod test {
|
|||||||
|
|
||||||
use bitcoin::consensus::deserialize;
|
use bitcoin::consensus::deserialize;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
@@ -814,8 +830,6 @@ mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_output_ordering_bip69() {
|
fn test_output_ordering_bip69() {
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
let original_tx = ordering_test_tx!();
|
let original_tx = ordering_test_tx!();
|
||||||
let mut tx = original_tx;
|
let mut tx = original_tx;
|
||||||
|
|
||||||
@@ -844,15 +858,20 @@ mod test {
|
|||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(tx.output[0].value, 800);
|
assert_eq!(tx.output[0].value, 800);
|
||||||
assert_eq!(tx.output[1].script_pubkey, From::from(vec![0xAA]));
|
assert_eq!(tx.output[1].script_pubkey, ScriptBuf::from(vec![0xAA]));
|
||||||
assert_eq!(tx.output[2].script_pubkey, From::from(vec![0xAA, 0xEE]));
|
assert_eq!(
|
||||||
|
tx.output[2].script_pubkey,
|
||||||
|
ScriptBuf::from(vec![0xAA, 0xEE])
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_test_utxos() -> Vec<LocalUtxo> {
|
fn get_test_utxos() -> Vec<LocalUtxo> {
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
|
|
||||||
vec![
|
vec![
|
||||||
LocalUtxo {
|
LocalUtxo {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: Default::default(),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 0,
|
vout: 0,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
@@ -861,7 +880,7 @@ mod test {
|
|||||||
},
|
},
|
||||||
LocalUtxo {
|
LocalUtxo {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: Default::default(),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 1,
|
vout: 1,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
|
|||||||
@@ -9,23 +9,11 @@
|
|||||||
// You may not use this file except in accordance with one or both of these
|
// You may not use this file except in accordance with one or both of these
|
||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
use bitcoin::blockdata::script::Script;
|
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
|
use bitcoin::{absolute, Script, Sequence};
|
||||||
|
|
||||||
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
||||||
|
|
||||||
// MSB of the nSequence. If set there's no consensus-constraint, so it must be disabled when
|
|
||||||
// spending using CSV in order to enforce CSV rules
|
|
||||||
pub(crate) const SEQUENCE_LOCKTIME_DISABLE_FLAG: u32 = 1 << 31;
|
|
||||||
// When nSequence is lower than this flag the timelock is interpreted as block-height-based,
|
|
||||||
// otherwise it's time-based
|
|
||||||
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
|
||||||
// Mask for the bits used to express the timelock
|
|
||||||
pub(crate) const SEQUENCE_LOCKTIME_MASK: u32 = 0x0000FFFF;
|
|
||||||
|
|
||||||
// Threshold for nLockTime to be considered a block-height-based timelock rather than time-based
|
|
||||||
pub(crate) const BLOCKS_TIMELOCK_THRESHOLD: u32 = 500000000;
|
|
||||||
|
|
||||||
/// Trait to check if a value is below the dust limit.
|
/// Trait to check if a value is below the dust limit.
|
||||||
/// We are performing dust value calculation for a given script public key using rust-bitcoin to
|
/// We are performing dust value calculation for a given script public key using rust-bitcoin to
|
||||||
/// keep it compatible with network dust rate
|
/// keep it compatible with network dust rate
|
||||||
@@ -38,7 +26,7 @@ pub trait IsDust {
|
|||||||
|
|
||||||
impl IsDust for u64 {
|
impl IsDust for u64 {
|
||||||
fn is_dust(&self, script: &Script) -> bool {
|
fn is_dust(&self, script: &Script) -> bool {
|
||||||
*self < script.dust_value().as_sat()
|
*self < script.dust_value().to_sat()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -56,19 +44,15 @@ impl After {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn check_nsequence_rbf(rbf: u32, csv: u32) -> bool {
|
pub(crate) fn check_nsequence_rbf(rbf: Sequence, csv: Sequence) -> bool {
|
||||||
// This flag cannot be set in the nSequence when spending using OP_CSV
|
// The RBF value must enable relative timelocks
|
||||||
if rbf & SEQUENCE_LOCKTIME_DISABLE_FLAG != 0 {
|
if !rbf.is_relative_lock_time() {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
let mask = SEQUENCE_LOCKTIME_TYPE_FLAG | SEQUENCE_LOCKTIME_MASK;
|
|
||||||
let rbf = rbf & mask;
|
|
||||||
let csv = csv & mask;
|
|
||||||
|
|
||||||
// Both values should be represented in the same unit (either time-based or
|
// Both values should be represented in the same unit (either time-based or
|
||||||
// block-height based)
|
// block-height based)
|
||||||
if (rbf < SEQUENCE_LOCKTIME_TYPE_FLAG) != (csv < SEQUENCE_LOCKTIME_TYPE_FLAG) {
|
if rbf.is_time_locked() != csv.is_time_locked() {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -80,24 +64,10 @@ pub(crate) fn check_nsequence_rbf(rbf: u32, csv: u32) -> bool {
|
|||||||
true
|
true
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn check_nlocktime(nlocktime: u32, required: u32) -> bool {
|
|
||||||
// Both values should be expressed in the same unit
|
|
||||||
if (nlocktime < BLOCKS_TIMELOCK_THRESHOLD) != (required < BLOCKS_TIMELOCK_THRESHOLD) {
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
// The value should be at least `required`
|
|
||||||
if nlocktime < required {
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
true
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
||||||
fn check_after(&self, n: u32) -> bool {
|
fn check_after(&self, n: absolute::LockTime) -> bool {
|
||||||
if let Some(current_height) = self.current_height {
|
if let Some(current_height) = self.current_height {
|
||||||
current_height >= n
|
current_height >= n.to_consensus_u32()
|
||||||
} else {
|
} else {
|
||||||
self.assume_height_reached
|
self.assume_height_reached
|
||||||
}
|
}
|
||||||
@@ -125,10 +95,15 @@ impl Older {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for Older {
|
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for Older {
|
||||||
fn check_older(&self, n: u32) -> bool {
|
fn check_older(&self, n: Sequence) -> bool {
|
||||||
if let Some(current_height) = self.current_height {
|
if let Some(current_height) = self.current_height {
|
||||||
// TODO: test >= / >
|
// TODO: test >= / >
|
||||||
current_height as u64 >= self.create_height.unwrap_or(0) as u64 + n as u64
|
current_height
|
||||||
|
>= self
|
||||||
|
.create_height
|
||||||
|
.unwrap_or(0)
|
||||||
|
.checked_add(n.to_consensus_u32())
|
||||||
|
.expect("Overflowing addition")
|
||||||
} else {
|
} else {
|
||||||
self.assume_height_reached
|
self.assume_height_reached
|
||||||
}
|
}
|
||||||
@@ -139,17 +114,20 @@ pub(crate) type SecpCtx = Secp256k1<All>;
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use super::{
|
|
||||||
check_nlocktime, check_nsequence_rbf, IsDust, BLOCKS_TIMELOCK_THRESHOLD,
|
|
||||||
SEQUENCE_LOCKTIME_TYPE_FLAG,
|
|
||||||
};
|
|
||||||
use crate::bitcoin::Address;
|
|
||||||
use crate::types::FeeRate;
|
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
// When nSequence is lower than this flag the timelock is interpreted as block-height-based,
|
||||||
|
// otherwise it's time-based
|
||||||
|
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
||||||
|
|
||||||
|
use super::{check_nsequence_rbf, IsDust};
|
||||||
|
use crate::bitcoin::{Address, Network, Sequence};
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_is_dust() {
|
fn test_is_dust() {
|
||||||
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2pkh.is_p2pkh());
|
assert!(script_p2pkh.is_p2pkh());
|
||||||
@@ -157,6 +135,8 @@ mod test {
|
|||||||
assert!(!546.is_dust(&script_p2pkh));
|
assert!(!546.is_dust(&script_p2pkh));
|
||||||
|
|
||||||
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2wpkh.is_v0_p2wpkh());
|
assert!(script_p2wpkh.is_v0_p2wpkh());
|
||||||
@@ -164,86 +144,42 @@ mod test {
|
|||||||
assert!(!294.is_dust(&script_p2wpkh));
|
assert!(!294.is_dust(&script_p2wpkh));
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_fee_from_btc_per_kb() {
|
|
||||||
let fee = FeeRate::from_btc_per_kvb(1e-5);
|
|
||||||
assert!((fee.as_sat_vb() - 1.0).abs() < 0.0001);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_fee_from_sats_vbyte() {
|
|
||||||
let fee = FeeRate::from_sat_per_vb(1.0);
|
|
||||||
assert!((fee.as_sat_vb() - 1.0).abs() < 0.0001);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_fee_default_min_relay_fee() {
|
|
||||||
let fee = FeeRate::default_min_relay_fee();
|
|
||||||
assert!((fee.as_sat_vb() - 1.0).abs() < 0.0001);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_check_nsequence_rbf_msb_set() {
|
fn test_check_nsequence_rbf_msb_set() {
|
||||||
let result = check_nsequence_rbf(0x80000000, 5000);
|
let result = check_nsequence_rbf(Sequence(0x80000000), Sequence(5000));
|
||||||
assert!(!result);
|
assert!(!result);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_check_nsequence_rbf_lt_csv() {
|
fn test_check_nsequence_rbf_lt_csv() {
|
||||||
let result = check_nsequence_rbf(4000, 5000);
|
let result = check_nsequence_rbf(Sequence(4000), Sequence(5000));
|
||||||
assert!(!result);
|
assert!(!result);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_check_nsequence_rbf_different_unit() {
|
fn test_check_nsequence_rbf_different_unit() {
|
||||||
let result = check_nsequence_rbf(SEQUENCE_LOCKTIME_TYPE_FLAG + 5000, 5000);
|
let result =
|
||||||
|
check_nsequence_rbf(Sequence(SEQUENCE_LOCKTIME_TYPE_FLAG + 5000), Sequence(5000));
|
||||||
assert!(!result);
|
assert!(!result);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_check_nsequence_rbf_mask() {
|
fn test_check_nsequence_rbf_mask() {
|
||||||
let result = check_nsequence_rbf(0x3f + 10_000, 5000);
|
let result = check_nsequence_rbf(Sequence(0x3f + 10_000), Sequence(5000));
|
||||||
assert!(result);
|
assert!(result);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_check_nsequence_rbf_same_unit_blocks() {
|
fn test_check_nsequence_rbf_same_unit_blocks() {
|
||||||
let result = check_nsequence_rbf(10_000, 5000);
|
let result = check_nsequence_rbf(Sequence(10_000), Sequence(5000));
|
||||||
assert!(result);
|
assert!(result);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_check_nsequence_rbf_same_unit_time() {
|
fn test_check_nsequence_rbf_same_unit_time() {
|
||||||
let result = check_nsequence_rbf(
|
let result = check_nsequence_rbf(
|
||||||
SEQUENCE_LOCKTIME_TYPE_FLAG + 10_000,
|
Sequence(SEQUENCE_LOCKTIME_TYPE_FLAG + 10_000),
|
||||||
SEQUENCE_LOCKTIME_TYPE_FLAG + 5000,
|
Sequence(SEQUENCE_LOCKTIME_TYPE_FLAG + 5000),
|
||||||
);
|
|
||||||
assert!(result);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_check_nlocktime_lt_cltv() {
|
|
||||||
let result = check_nlocktime(4000, 5000);
|
|
||||||
assert!(!result);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_check_nlocktime_different_unit() {
|
|
||||||
let result = check_nlocktime(BLOCKS_TIMELOCK_THRESHOLD + 5000, 5000);
|
|
||||||
assert!(!result);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_check_nlocktime_same_unit_blocks() {
|
|
||||||
let result = check_nlocktime(10_000, 5000);
|
|
||||||
assert!(result);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_check_nlocktime_same_unit_time() {
|
|
||||||
let result = check_nlocktime(
|
|
||||||
BLOCKS_TIMELOCK_THRESHOLD + 10_000,
|
|
||||||
BLOCKS_TIMELOCK_THRESHOLD + 5000,
|
|
||||||
);
|
);
|
||||||
assert!(result);
|
assert!(result);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -29,6 +29,8 @@ use crate::error::Error;
|
|||||||
/// Depending on the [capabilities](crate::blockchain::Blockchain::get_capabilities) of the
|
/// Depending on the [capabilities](crate::blockchain::Blockchain::get_capabilities) of the
|
||||||
/// [`Blockchain`] backend, the method could fail when called with old "historical" transactions or
|
/// [`Blockchain`] backend, the method could fail when called with old "historical" transactions or
|
||||||
/// with unconfirmed transactions that have been evicted from the backend's memory.
|
/// with unconfirmed transactions that have been evicted from the backend's memory.
|
||||||
|
///
|
||||||
|
/// [`Blockchain`]: crate::blockchain::Blockchain
|
||||||
pub fn verify_tx<D: Database, B: GetTx>(
|
pub fn verify_tx<D: Database, B: GetTx>(
|
||||||
tx: &Transaction,
|
tx: &Transaction,
|
||||||
database: &D,
|
database: &D,
|
||||||
@@ -89,7 +91,12 @@ pub enum VerifyError {
|
|||||||
|
|
||||||
impl fmt::Display for VerifyError {
|
impl fmt::Display for VerifyError {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
write!(f, "{:?}", self)
|
match self {
|
||||||
|
Self::MissingInputTx(txid) => write!(f, "The transaction being spent is not available in the database or the blockchain client: {}", txid),
|
||||||
|
Self::InvalidInput(outpoint) => write!(f, "The transaction being spent doesn't have the requested output: {}", outpoint),
|
||||||
|
Self::Consensus(err) => write!(f, "Consensus error: {:?}", err),
|
||||||
|
Self::Global(err) => write!(f, "Generic error: {}", err),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -106,6 +113,7 @@ impl_error!(bitcoinconsensus::Error, Consensus, VerifyError);
|
|||||||
mod test {
|
mod test {
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::database::{BatchOperations, MemoryDatabase};
|
use crate::database::{BatchOperations, MemoryDatabase};
|
||||||
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::consensus::encode::deserialize;
|
use bitcoin::consensus::encode::deserialize;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::{Transaction, Txid};
|
use bitcoin::{Transaction, Txid};
|
||||||
@@ -135,9 +143,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let result = verify_tx(&signed_tx, &database, &blockchain);
|
let result = verify_tx(&signed_tx, &database, &blockchain);
|
||||||
assert!(result.is_err(), "Should fail with missing input tx");
|
assert_matches!(result, Err(VerifyError::MissingInputTx(txid)) if txid == prev_tx.txid(),
|
||||||
assert!(
|
|
||||||
matches!(result, Err(VerifyError::MissingInputTx(txid)) if txid == prev_tx.txid()),
|
|
||||||
"Error should be a `MissingInputTx` error"
|
"Error should be a `MissingInputTx` error"
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -145,9 +151,9 @@ mod test {
|
|||||||
database.set_raw_tx(&prev_tx).unwrap();
|
database.set_raw_tx(&prev_tx).unwrap();
|
||||||
|
|
||||||
let result = verify_tx(&unsigned_tx, &database, &blockchain);
|
let result = verify_tx(&unsigned_tx, &database, &blockchain);
|
||||||
assert!(result.is_err(), "Should fail since the TX is unsigned");
|
assert_matches!(
|
||||||
assert!(
|
result,
|
||||||
matches!(result, Err(VerifyError::Consensus(_))),
|
Err(VerifyError::Consensus(_)),
|
||||||
"Error should be a `Consensus` error"
|
"Error should be a `Consensus` error"
|
||||||
);
|
);
|
||||||
|
|
||||||
|
|||||||
Reference in New Issue
Block a user