Compare commits
45 Commits
v1.0.0-alp
...
release/0.
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
2a8c8c2bb6 | ||
|
|
67b083fa03 | ||
|
|
213c270ab4 | ||
|
|
7914ff03d3 | ||
|
|
e3ca356cae | ||
|
|
530ba36b07 | ||
|
|
7a359d5eef | ||
|
|
d1af252ac4 | ||
|
|
dcc46362dc | ||
|
|
4d48a07717 | ||
|
|
958e72877c | ||
|
|
0ba6bbe114 | ||
|
|
361f925526 | ||
|
|
7231039e81 | ||
|
|
1d840e09f8 | ||
|
|
b6fecc8bc0 | ||
|
|
d0f7543f69 | ||
|
|
7587f1603d | ||
|
|
177c96db5a | ||
|
|
07c1ce9c85 | ||
|
|
6097957650 | ||
|
|
9cffaad71f | ||
|
|
3ccdb84523 | ||
|
|
f7d0852e92 | ||
|
|
15079ee4db | ||
|
|
0f25c6ab29 | ||
|
|
0bf9a0ee2c | ||
|
|
973cd9a286 | ||
|
|
78529b6a42 | ||
|
|
0ad65c7776 | ||
|
|
cbcbdd120d | ||
|
|
f507185729 | ||
|
|
573bf52578 | ||
|
|
10608afb76 | ||
|
|
de46a51208 | ||
|
|
e8acafce8e | ||
|
|
bb2b2d6dd8 | ||
|
|
87c558c9cf | ||
|
|
a4647cfa98 | ||
|
|
b111f97c58 | ||
|
|
7a8e6609b1 | ||
|
|
4ec6f3272e | ||
|
|
553df318ff | ||
|
|
9e2e6411f2 | ||
|
|
5d48e37926 |
2
.cargo/audit.toml
Normal file
2
.cargo/audit.toml
Normal file
@@ -0,0 +1,2 @@
|
||||
[advisories]
|
||||
ignore = ["RUSTSEC-2022-0046"]
|
||||
3
.github/workflows/audit.yml
vendored
3
.github/workflows/audit.yml
vendored
@@ -2,6 +2,9 @@ name: Audit
|
||||
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
paths:
|
||||
- '**/Cargo.toml'
|
||||
- '**/Cargo.lock'
|
||||
|
||||
63
.github/workflows/code_coverage.yml
vendored
63
.github/workflows/code_coverage.yml
vendored
@@ -1,4 +1,12 @@
|
||||
on: [push, pull_request]
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
pull_request:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
|
||||
name: Code Coverage
|
||||
|
||||
@@ -9,42 +17,47 @@ jobs:
|
||||
env:
|
||||
RUSTFLAGS: "-Cinstrument-coverage"
|
||||
RUSTDOCFLAGS: "-Cinstrument-coverage"
|
||||
LLVM_PROFILE_FILE: "./target/coverage/%p-%m.profraw"
|
||||
LLVM_PROFILE_FILE: "report-%p-%m.profraw"
|
||||
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v2
|
||||
- name: Install lcov tools
|
||||
run: sudo apt-get install lcov -y
|
||||
- name: Install Rust toolchain
|
||||
uses: actions-rs/toolchain@v1
|
||||
- name: Install rustup
|
||||
run: curl https://sh.rustup.rs -sSf | sh -s -- -y
|
||||
- name: Set default toolchain
|
||||
run: rustup default nightly
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Add llvm tools
|
||||
run: rustup component add llvm-tools-preview
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Cache cargo
|
||||
uses: actions/cache@v3
|
||||
with:
|
||||
toolchain: "1.65.0"
|
||||
override: true
|
||||
profile: minimal
|
||||
components: llvm-tools-preview
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
path: |
|
||||
~/.cargo/bin/
|
||||
~/.cargo/registry/index/
|
||||
~/.cargo/registry/cache/
|
||||
~/.cargo/git/db/
|
||||
key: ${{ runner.os }}-cargo-${{ hashFiles('**/Cargo.lock') }}
|
||||
- name: Install grcov
|
||||
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
||||
- name: Build simulator image
|
||||
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||
- name: Run simulator image
|
||||
run: docker run --name simulator --network=host hwi/ledger_emulator &
|
||||
- name: Install Python
|
||||
uses: actions/setup-python@v4
|
||||
with:
|
||||
python-version: '3.9'
|
||||
- name: Install python dependencies
|
||||
run: pip install hwi==2.1.1 protobuf==3.20.1
|
||||
- name: Test
|
||||
run: cargo test --all-features
|
||||
- name: Make coverage directory
|
||||
run: mkdir coverage
|
||||
# WARNING: this is not testing the following features: test-esplora, test-hardware-signer, async-interface
|
||||
# This is because some of our features are mutually exclusive, and generating various reports and
|
||||
# merging them doesn't seem to be working very well.
|
||||
# For more info, see:
|
||||
# - https://github.com/bitcoindevkit/bdk/issues/696
|
||||
# - https://github.com/bitcoindevkit/bdk/pull/748#issuecomment-1242721040
|
||||
run: cargo test --features all-keys,compact_filters,compiler,key-value-db,sqlite,sqlite-bundled,test-electrum,test-rpc,verify
|
||||
- name: Run grcov
|
||||
run: grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --keep-only '**/crates/**' --ignore '**/tests/**' --ignore '**/examples/**' -o ./coverage/lcov.info
|
||||
run: mkdir coverage; grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --ignore '/*' -o ./coverage/lcov.info
|
||||
- name: Generate HTML coverage report
|
||||
run: genhtml -o coverage-report.html --ignore-errors source ./coverage/lcov.info
|
||||
run: genhtml -o coverage-report.html ./coverage/lcov.info
|
||||
|
||||
- name: Coveralls upload
|
||||
uses: coverallsapp/github-action@master
|
||||
with:
|
||||
|
||||
268
.github/workflows/cont_integration.yml
vendored
268
.github/workflows/cont_integration.yml
vendored
@@ -1,4 +1,12 @@
|
||||
on: [push, pull_request]
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
pull_request:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
|
||||
name: CI
|
||||
|
||||
@@ -10,55 +18,139 @@ jobs:
|
||||
strategy:
|
||||
matrix:
|
||||
rust:
|
||||
- version: stable
|
||||
- version: 1.65.0 # STABLE
|
||||
clippy: true
|
||||
- version: 1.57.0 # MSRV
|
||||
features:
|
||||
- --no-default-features
|
||||
- --all-features
|
||||
- default
|
||||
- minimal
|
||||
- all-keys
|
||||
- minimal,use-esplora-blocking
|
||||
- key-value-db
|
||||
- electrum
|
||||
- compact_filters
|
||||
- use-esplora-blocking,key-value-db,electrum
|
||||
- compiler
|
||||
- rpc
|
||||
- verify
|
||||
- async-interface
|
||||
- use-esplora-async
|
||||
- sqlite
|
||||
- sqlite-bundled
|
||||
steps:
|
||||
- name: checkout
|
||||
uses: actions/checkout@v2
|
||||
- name: Install Rust toolchain
|
||||
uses: actions-rs/toolchain@v1
|
||||
- name: Generate cache key
|
||||
run: echo "${{ matrix.rust.version }} ${{ matrix.features }}" | tee .cache_key
|
||||
- name: cache
|
||||
uses: actions/cache@v2
|
||||
with:
|
||||
toolchain: ${{ matrix.rust.version }}
|
||||
override: true
|
||||
profile: minimal
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
path: |
|
||||
~/.cargo/registry
|
||||
~/.cargo/git
|
||||
target
|
||||
key: ${{ runner.os }}-cargo-${{ hashFiles('.cache_key') }}-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
||||
- name: Set default toolchain
|
||||
run: rustup default ${{ matrix.rust.version }}
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Add clippy
|
||||
if: ${{ matrix.rust.clippy }}
|
||||
run: rustup component add clippy
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Pin dependencies for MSRV
|
||||
if: matrix.rust.version == '1.57.0'
|
||||
run: |
|
||||
cargo update -p log --precise "0.4.18"
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
cargo update -p hashlink --precise "0.8.1"
|
||||
cargo update -p regex --precise "1.7.3"
|
||||
cargo update -p zip:0.6.6 --precise "0.6.3"
|
||||
cargo update -p rustix --precise "0.37.23"
|
||||
cargo update -p tokio --precise "1.29.1"
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
- name: Build
|
||||
run: cargo build ${{ matrix.features }}
|
||||
run: cargo build --features ${{ matrix.features }} --no-default-features
|
||||
- name: Clippy
|
||||
if: ${{ matrix.rust.clippy }}
|
||||
run: cargo clippy --all-targets --features ${{ matrix.features }} --no-default-features -- -D warnings
|
||||
- name: Test
|
||||
run: cargo test ${{ matrix.features }}
|
||||
run: cargo test --features ${{ matrix.features }} --no-default-features
|
||||
|
||||
check-no-std:
|
||||
name: Check no_std
|
||||
test-readme-examples:
|
||||
name: Test README.md examples
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: checkout
|
||||
uses: actions/checkout@v2
|
||||
- name: cache
|
||||
uses: actions/cache@v2
|
||||
with:
|
||||
path: |
|
||||
~/.cargo/registry
|
||||
~/.cargo/git
|
||||
target
|
||||
key: ${{ runner.os }}-cargo-test-md-docs-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
||||
- name: Set default toolchain
|
||||
run: rustup default nightly
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Test
|
||||
run: cargo test --features test-md-docs --no-default-features -- doctest::ReadmeDoctests
|
||||
|
||||
test-blockchains:
|
||||
name: Blockchain ${{ matrix.blockchain.features }}
|
||||
runs-on: ubuntu-20.04
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
blockchain:
|
||||
- name: electrum
|
||||
testprefix: blockchain::electrum::test
|
||||
features: test-electrum,verify
|
||||
- name: rpc
|
||||
testprefix: blockchain::rpc::test
|
||||
features: test-rpc
|
||||
- name: rpc-legacy
|
||||
testprefix: blockchain::rpc::test
|
||||
features: test-rpc-legacy
|
||||
- name: esplora
|
||||
testprefix: esplora
|
||||
features: test-esplora,use-esplora-async,verify
|
||||
- name: esplora
|
||||
testprefix: esplora
|
||||
features: test-esplora,use-esplora-blocking,verify
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v2
|
||||
- name: Install Rust toolchain
|
||||
- name: Cache
|
||||
uses: actions/cache@v2
|
||||
with:
|
||||
path: |
|
||||
~/.cargo/registry
|
||||
~/.cargo/git
|
||||
target
|
||||
key: ${{ runner.os }}-cargo-${{ github.job }}-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
||||
- name: Setup rust toolchain
|
||||
uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
toolchain: stable
|
||||
override: true
|
||||
profile: minimal
|
||||
# target: "thumbv6m-none-eabi"
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Check bdk_chain
|
||||
working-directory: ./crates/chain
|
||||
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,hashbrown
|
||||
- name: Check bdk
|
||||
working-directory: ./crates/bdk
|
||||
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown
|
||||
- name: Check esplora
|
||||
working-directory: ./crates/esplora
|
||||
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown
|
||||
- name: Test
|
||||
run: cargo test --no-default-features --features ${{ matrix.blockchain.features }} ${{ matrix.blockchain.testprefix }}::bdk_blockchain_tests
|
||||
|
||||
check-wasm:
|
||||
name: Check WASM
|
||||
@@ -69,26 +161,29 @@ jobs:
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v2
|
||||
- name: Cache
|
||||
uses: actions/cache@v2
|
||||
with:
|
||||
path: |
|
||||
~/.cargo/registry
|
||||
~/.cargo/git
|
||||
target
|
||||
key: ${{ runner.os }}-cargo-${{ github.job }}-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
||||
# Install a recent version of clang that supports wasm32
|
||||
- run: wget -O - https://apt.llvm.org/llvm-snapshot.gpg.key | sudo apt-key add - || exit 1
|
||||
- run: sudo apt-add-repository "deb http://apt.llvm.org/focal/ llvm-toolchain-focal-10 main" || exit 1
|
||||
- run: sudo apt-get update || exit 1
|
||||
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
||||
- name: Install Rust toolchain
|
||||
uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
toolchain: stable
|
||||
override: true
|
||||
profile: minimal
|
||||
target: "wasm32-unknown-unknown"
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Check bdk
|
||||
working-directory: ./crates/bdk
|
||||
run: cargo check --target wasm32-unknown-unknown --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown,dev-getrandom-wasm
|
||||
- name: Check esplora
|
||||
working-directory: ./crates/esplora
|
||||
run: cargo check --target wasm32-unknown-unknown --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown,async
|
||||
- name: Set default toolchain
|
||||
run: rustup default 1.65.0 # STABLE
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Add target wasm32
|
||||
run: rustup target add wasm32-unknown-unknown
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Check
|
||||
run: cargo check --target wasm32-unknown-unknown --features async-interface,use-esplora-async,dev-getrandom-wasm --no-default-features
|
||||
|
||||
fmt:
|
||||
name: Rust fmt
|
||||
@@ -96,30 +191,63 @@ jobs:
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v2
|
||||
- name: Install Rust toolchain
|
||||
uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
toolchain: stable
|
||||
override: true
|
||||
profile: minimal
|
||||
components: rustfmt
|
||||
- name: Set default toolchain
|
||||
run: rustup default nightly
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Add rustfmt
|
||||
run: rustup component add rustfmt
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Check fmt
|
||||
run: cargo fmt --all -- --config format_code_in_doc_comments=true --check
|
||||
|
||||
clippy_check:
|
||||
runs-on: ubuntu-latest
|
||||
test_hardware_wallet:
|
||||
runs-on: ubuntu-20.04
|
||||
strategy:
|
||||
matrix:
|
||||
rust:
|
||||
- version: 1.65.0 # STABLE
|
||||
- version: 1.57.0 # MSRV
|
||||
steps:
|
||||
- uses: actions/checkout@v1
|
||||
- uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
# we pin clippy instead of using "stable" so that our CI doesn't break
|
||||
# at each new cargo release
|
||||
toolchain: "1.67.0"
|
||||
components: clippy
|
||||
override: true
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- uses: actions-rs/clippy-check@v1
|
||||
with:
|
||||
token: ${{ secrets.GITHUB_TOKEN }}
|
||||
args: --all-features --all-targets -- -D warnings
|
||||
- name: Checkout
|
||||
uses: actions/checkout@v3
|
||||
- name: Build simulator image
|
||||
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||
- name: Run simulator image
|
||||
run: docker run --name simulator --network=host hwi/ledger_emulator &
|
||||
- name: Install Python
|
||||
uses: actions/setup-python@v4
|
||||
with:
|
||||
python-version: '3.9'
|
||||
- name: Install python dependencies
|
||||
run: pip install hwi==2.1.1 protobuf==3.20.1
|
||||
- name: Set default toolchain
|
||||
run: rustup default ${{ matrix.rust.version }}
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Pin dependencies for MSRV
|
||||
if: matrix.rust.version == '1.57.0'
|
||||
run: |
|
||||
cargo update -p log --precise "0.4.18"
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
cargo update -p hashlink --precise "0.8.1"
|
||||
cargo update -p regex --precise "1.7.3"
|
||||
cargo update -p zip:0.6.6 --precise "0.6.3"
|
||||
cargo update -p rustix --precise "0.37.23"
|
||||
cargo update -p tokio --precise "1.29.1"
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
- name: Test
|
||||
run: cargo test --features test-hardware-signer
|
||||
|
||||
24
.github/workflows/nightly_docs.yml
vendored
24
.github/workflows/nightly_docs.yml
vendored
@@ -1,6 +1,14 @@
|
||||
name: Publish Nightly Docs
|
||||
|
||||
on: [push, pull_request]
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
pull_request:
|
||||
branches:
|
||||
- 'master'
|
||||
- 'release/*'
|
||||
|
||||
jobs:
|
||||
build_docs:
|
||||
@@ -9,18 +17,22 @@ jobs:
|
||||
steps:
|
||||
- name: Checkout sources
|
||||
uses: actions/checkout@v2
|
||||
- name: Setup cache
|
||||
uses: actions/cache@v2
|
||||
with:
|
||||
path: |
|
||||
~/.cargo/registry
|
||||
~/.cargo/git
|
||||
target
|
||||
key: nightly-docs-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
||||
- name: Set default toolchain
|
||||
run: rustup default nightly-2022-12-14
|
||||
- name: Set profile
|
||||
run: rustup set profile minimal
|
||||
- name: Update toolchain
|
||||
run: rustup update
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Build docs
|
||||
run: cargo doc --no-deps
|
||||
env:
|
||||
RUSTDOCFLAGS: '--cfg docsrs -Dwarnings'
|
||||
run: cargo rustdoc --verbose --features=compiler,electrum,esplora,use-esplora-blocking,compact_filters,rpc,key-value-db,sqlite,all-keys,verify,hardware-signer -- --cfg docsrs -Dwarnings
|
||||
- name: Upload artifact
|
||||
uses: actions/upload-artifact@v2
|
||||
with:
|
||||
|
||||
53
CHANGELOG.md
53
CHANGELOG.md
@@ -9,6 +9,53 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
||||
|
||||
## [Unreleased]
|
||||
|
||||
## [v0.29.0]
|
||||
|
||||
### Summary
|
||||
|
||||
This maintenance release updates our `rust-bitcoin` dependency to 0.30.x and fixes a wallet balance bug when a wallet has more than one coinbase transaction.
|
||||
|
||||
### Changed
|
||||
|
||||
- Update rust-bitcoin to 0.30 #1071
|
||||
|
||||
### Fixed
|
||||
|
||||
- Fix a bug when syncing coinbase utxos on electrum #1090
|
||||
|
||||
## [v0.28.2]
|
||||
|
||||
### Summary
|
||||
|
||||
Reverts the 0.28.1 esplora-client version update from 0.5.0 back to 0.4.0.
|
||||
|
||||
## [v0.28.1]
|
||||
|
||||
### Summary
|
||||
|
||||
This patch release backports (from the BDK 1.0 dev branch) a fix for a bug in the policy condition calculation and adds a new taproot single key descriptor template (BIP-86). The policy condition calculation bug can cause issues when a policy subtree fails due to missing info even if it's not selected when creating a new transaction, errors on unused policy paths are now ignored.
|
||||
|
||||
### Fixed
|
||||
|
||||
- Backported #932 fix for policy condition calculation #1008
|
||||
|
||||
### Added
|
||||
|
||||
- Backported #840 taproot descriptor template (BIP-86) #1033
|
||||
|
||||
## [v0.28.0]
|
||||
|
||||
### Summary
|
||||
|
||||
Disable default-features for rust-bitcoin and rust-miniscript dependencies, and for rust-esplora-client optional dependency. New default `std` feature must be enabled unless building for wasm.
|
||||
|
||||
### Changed
|
||||
|
||||
- Bump bip39 crate to v2.0.0 #875
|
||||
- Set default-features = false for rust-bitcoin and rust-miniscript #882
|
||||
- Update esplora client dependency to version 0.4 #884
|
||||
- Added new `std` feature as part of default features #930
|
||||
|
||||
## [v0.27.1]
|
||||
|
||||
### Summary
|
||||
@@ -642,4 +689,8 @@ final transaction is created by calling `finish` on the builder.
|
||||
[v0.26.0]: https://github.com/bitcoindevkit/bdk/compare/v0.25.0...v0.26.0
|
||||
[v0.27.0]: https://github.com/bitcoindevkit/bdk/compare/v0.26.0...v0.27.0
|
||||
[v0.27.1]: https://github.com/bitcoindevkit/bdk/compare/v0.27.0...v0.27.1
|
||||
[Unreleased]: https://github.com/bitcoindevkit/bdk/compare/v0.27.1...HEAD
|
||||
[v0.28.0]: https://github.com/bitcoindevkit/bdk/compare/v0.27.1...v0.28.0
|
||||
[v0.28.1]: https://github.com/bitcoindevkit/bdk/compare/v0.28.0...v0.28.1
|
||||
[v0.28.2]: https://github.com/bitcoindevkit/bdk/compare/v0.28.1...v0.28.2
|
||||
[v0.29.0]: https://github.com/bitcoindevkit/bdk/compare/v0.28.2...v0.29.0
|
||||
[Unreleased]: https://github.com/bitcoindevkit/bdk/compare/v0.29.0...HEAD
|
||||
|
||||
@@ -28,7 +28,7 @@ The codebase is maintained using the "contributor workflow" where everyone
|
||||
without exception contributes patch proposals using "pull requests". This
|
||||
facilitates social contribution, easy testing and peer review.
|
||||
|
||||
To contribute a patch, the workflow is as follows:
|
||||
To contribute a patch, the worflow is a as follows:
|
||||
|
||||
1. Fork Repository
|
||||
2. Create topic branch
|
||||
|
||||
186
Cargo.toml
186
Cargo.toml
@@ -1,18 +1,170 @@
|
||||
[workspace]
|
||||
members = [
|
||||
"crates/bdk",
|
||||
"crates/chain",
|
||||
"crates/file_store",
|
||||
"crates/electrum",
|
||||
"crates/esplora",
|
||||
"example-crates/example_cli",
|
||||
"example-crates/example_electrum",
|
||||
"example-crates/wallet_electrum",
|
||||
"example-crates/wallet_esplora",
|
||||
"example-crates/wallet_esplora_async",
|
||||
"nursery/tmp_plan",
|
||||
"nursery/coin_select"
|
||||
]
|
||||
[package]
|
||||
name = "bdk"
|
||||
version = "0.29.0"
|
||||
edition = "2018"
|
||||
authors = ["Alekos Filini <alekos.filini@gmail.com>", "Riccardo Casatta <riccardo@casatta.it>"]
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk"
|
||||
description = "A modern, lightweight, descriptor-based wallet library"
|
||||
keywords = ["bitcoin", "wallet", "descriptor", "psbt"]
|
||||
readme = "README.md"
|
||||
license = "MIT OR Apache-2.0"
|
||||
|
||||
[workspace.package]
|
||||
authors = ["Bitcoin Dev Kit Developers"]
|
||||
[dependencies]
|
||||
bdk-macros = "^0.6"
|
||||
log = "0.4"
|
||||
miniscript = { version = "10.0", default-features = false, features = ["serde"] }
|
||||
bitcoin = { version = "0.30", default-features = false, features = ["serde", "base64", "rand-std"] }
|
||||
serde = { version = "^1.0", features = ["derive"] }
|
||||
serde_json = { version = "^1.0" }
|
||||
rand = "^0.8"
|
||||
|
||||
# Optional dependencies
|
||||
sled = { version = "0.34", optional = true }
|
||||
electrum-client = { version = "0.18", optional = true }
|
||||
esplora-client = { version = "0.6", default-features = false, optional = true }
|
||||
rusqlite = { version = "0.28.0", optional = true }
|
||||
ahash = { version = "0.7.6", optional = true }
|
||||
futures = { version = "0.3", optional = true }
|
||||
async-trait = { version = "0.1", optional = true }
|
||||
rocksdb = { version = "0.14", default-features = false, features = ["snappy"], optional = true }
|
||||
cc = { version = ">=1.0.64", optional = true }
|
||||
socks = { version = "0.3", optional = true }
|
||||
hwi = { version = "0.7", optional = true, features = ["miniscript"] }
|
||||
|
||||
bip39 = { version = "2.0.0", optional = true }
|
||||
bitcoinconsensus = { version = "0.19.0-3", optional = true }
|
||||
|
||||
# Needed by bdk_blockchain_tests macro and the `rpc` feature
|
||||
bitcoincore-rpc = { package="core-rpc", version = "0.17", optional = true }
|
||||
|
||||
# Platform-specific dependencies
|
||||
[target.'cfg(not(target_arch = "wasm32"))'.dependencies]
|
||||
tokio = { version = "1", features = ["rt", "macros"] }
|
||||
|
||||
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
||||
getrandom = "0.2"
|
||||
async-trait = "0.1"
|
||||
js-sys = "0.3"
|
||||
|
||||
[features]
|
||||
minimal = []
|
||||
compiler = ["miniscript/compiler"]
|
||||
verify = ["bitcoinconsensus"]
|
||||
default = ["std", "key-value-db", "electrum"]
|
||||
# std feature is always required unless building for wasm32-unknown-unknown target
|
||||
# if building for wasm user must add dependencies bitcoin/no-std,miniscript/no-std
|
||||
std = ["bitcoin/std", "miniscript/std"]
|
||||
sqlite = ["rusqlite", "ahash"]
|
||||
sqlite-bundled = ["sqlite", "rusqlite/bundled"]
|
||||
compact_filters = ["rocksdb", "socks", "cc"]
|
||||
key-value-db = ["sled"]
|
||||
all-keys = ["keys-bip39"]
|
||||
keys-bip39 = ["bip39"]
|
||||
rpc = ["bitcoincore-rpc"]
|
||||
hardware-signer = ["hwi"]
|
||||
|
||||
# We currently provide mulitple implementations of `Blockchain`, all are
|
||||
# blocking except for the `EsploraBlockchain` which can be either async or
|
||||
# blocking, depending on the HTTP client in use.
|
||||
#
|
||||
# - Users wanting asynchronous HTTP calls should enable `async-interface` to get
|
||||
# access to the asynchronous method implementations. Then, if Esplora is wanted,
|
||||
# enable the `use-esplora-async` feature.
|
||||
# - Users wanting blocking HTTP calls can use any of the other blockchain
|
||||
# implementations (`compact_filters`, `electrum`, or `esplora`). Users wanting to
|
||||
# use Esplora should enable the `use-esplora-blocking` feature.
|
||||
#
|
||||
# WARNING: Please take care with the features below, various combinations will
|
||||
# fail to build. We cannot currently build `bdk` with `--all-features`.
|
||||
async-interface = ["async-trait"]
|
||||
electrum = ["electrum-client"]
|
||||
# MUST ALSO USE `--no-default-features`.
|
||||
use-esplora-async = ["esplora", "esplora-client/async", "futures"]
|
||||
use-esplora-blocking = ["esplora", "esplora-client/blocking"]
|
||||
# Deprecated aliases
|
||||
use-esplora-reqwest = ["use-esplora-async"]
|
||||
use-esplora-ureq = ["use-esplora-blocking"]
|
||||
# Typical configurations will not need to use `esplora` feature directly.
|
||||
esplora = []
|
||||
|
||||
# Use below feature with `use-esplora-async` to enable reqwest default TLS support
|
||||
reqwest-default-tls = ["esplora-client/async-https"]
|
||||
|
||||
# Debug/Test features
|
||||
test-blockchains = ["bitcoincore-rpc", "electrum-client"]
|
||||
test-electrum = ["electrum", "electrsd/electrs_0_8_10", "electrsd/bitcoind_22_0", "test-blockchains"]
|
||||
test-rpc = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_22_0", "test-blockchains"]
|
||||
test-rpc-legacy = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_0_20_0", "test-blockchains"]
|
||||
test-esplora = ["electrsd/legacy", "electrsd/esplora_a33e97e1", "electrsd/bitcoind_22_0", "test-blockchains"]
|
||||
test-md-docs = ["electrum"]
|
||||
test-hardware-signer = ["hardware-signer"]
|
||||
|
||||
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
||||
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
||||
# necessary for running our CI. See: https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support
|
||||
dev-getrandom-wasm = ["getrandom/js"]
|
||||
|
||||
[dev-dependencies]
|
||||
miniscript = { version = "10.0", features = ["std"] }
|
||||
bitcoin = { version = "0.30", features = ["std"] }
|
||||
lazy_static = "1.4"
|
||||
env_logger = { version = "0.7", default-features = false }
|
||||
electrsd = "0.24"
|
||||
assert_matches = "1.5.0"
|
||||
|
||||
[[example]]
|
||||
name = "compact_filters_balance"
|
||||
required-features = ["compact_filters"]
|
||||
|
||||
[[example]]
|
||||
name = "miniscriptc"
|
||||
path = "examples/compiler.rs"
|
||||
required-features = ["compiler"]
|
||||
|
||||
[[example]]
|
||||
name = "policy"
|
||||
path = "examples/policy.rs"
|
||||
|
||||
[[example]]
|
||||
name = "rpcwallet"
|
||||
path = "examples/rpcwallet.rs"
|
||||
required-features = ["keys-bip39", "key-value-db", "rpc", "electrsd/bitcoind_22_0"]
|
||||
|
||||
[[example]]
|
||||
name = "psbt_signer"
|
||||
path = "examples/psbt_signer.rs"
|
||||
required-features = ["electrum"]
|
||||
|
||||
[[example]]
|
||||
name = "hardware_signer"
|
||||
path = "examples/hardware_signer.rs"
|
||||
required-features = ["electrum", "hardware-signer"]
|
||||
|
||||
[[example]]
|
||||
name = "electrum_backend"
|
||||
path = "examples/electrum_backend.rs"
|
||||
required-features = ["electrum"]
|
||||
|
||||
[[example]]
|
||||
name = "esplora_backend_synchronous"
|
||||
path = "examples/esplora_backend_synchronous.rs"
|
||||
required-features = ["use-esplora-ureq"]
|
||||
|
||||
[[example]]
|
||||
name = "esplora_backend_asynchronous"
|
||||
path = "examples/esplora_backend_asynchronous.rs"
|
||||
required-features = ["use-esplora-reqwest", "reqwest-default-tls", "async-interface"]
|
||||
|
||||
[[example]]
|
||||
name = "mnemonic_to_descriptors"
|
||||
path = "examples/mnemonic_to_descriptors.rs"
|
||||
required-features = ["all-keys"]
|
||||
|
||||
[workspace]
|
||||
members = ["macros"]
|
||||
[package.metadata.docs.rs]
|
||||
features = ["compiler", "electrum", "esplora", "use-esplora-blocking", "compact_filters", "rpc", "key-value-db", "sqlite", "all-keys", "verify", "hardware-signer"]
|
||||
# defines the configuration attribute `docsrs`
|
||||
rustdoc-args = ["--cfg", "docsrs"]
|
||||
|
||||
234
README.md
234
README.md
@@ -1,5 +1,3 @@
|
||||
# The Bitcoin Dev Kit
|
||||
|
||||
<div align="center">
|
||||
<h1>BDK</h1>
|
||||
|
||||
@@ -28,27 +26,223 @@
|
||||
|
||||
## About
|
||||
|
||||
The `bdk` libraries aims to provide well engineered and reviewed components for Bitcoin based applications.
|
||||
It is built upon the excellent [`rust-bitcoin`] and [`rust-miniscript`] crates.
|
||||
The `bdk` library aims to be the core building block for Bitcoin wallets of any kind.
|
||||
|
||||
> ⚠ The Bitcoin Dev Kit developers are in the process of releasing a `v1.0` which is a fundamental re-write of how the library works.
|
||||
> See for some background on this project: https://bitcoindevkit.org/blog/road-to-bdk-1/ (ignore the timeline 😁)
|
||||
> For a release timeline see the [`bdk_core_staging`] repo where a lot of the component work is being done. The plan is that everything in the `bdk_core_staging` repo will be moved into the `crates` directory here.
|
||||
* It uses [Miniscript](https://github.com/rust-bitcoin/rust-miniscript) to support descriptors with generalized conditions. This exact same library can be used to build
|
||||
single-sig wallets, multisigs, timelocked contracts and more.
|
||||
* It supports multiple blockchain backends and databases, allowing developers to choose exactly what's right for their projects.
|
||||
* It's built to be cross-platform: the core logic works on desktop, mobile, and even WebAssembly.
|
||||
* It's very easy to extend: developers can implement customized logic for blockchain backends, databases, signers, coin selection, and more, without having to fork and modify this library.
|
||||
|
||||
## Architecture
|
||||
## Examples
|
||||
|
||||
The project is split up into several crates in the `/crates` directory:
|
||||
### Sync the balance of a descriptor
|
||||
|
||||
- [`bdk`](./crates/bdk): Contains the central high level `Wallet` type that is built from the low-level mechanisms provided by the other components
|
||||
- [`chain`](./crates/chain): Tools for storing and indexing chain data
|
||||
- [`file_store`](./crates/file_store): A (experimental) persistence backend for storing chain data in a single file.
|
||||
- [`esplora`](./crates/esplora): Extends the [`esplora-client`] crate with methods to fetch chain data from an esplora HTTP server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||
- [`electrum`](./crates/electrum): Extends the [`electrum-client`] crate with methods to fetch chain data from an electrum server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||
```rust,no_run
|
||||
use bdk::Wallet;
|
||||
use bdk::database::MemoryDatabase;
|
||||
use bdk::blockchain::ElectrumBlockchain;
|
||||
use bdk::SyncOptions;
|
||||
use bdk::electrum_client::Client;
|
||||
use bdk::bitcoin::Network;
|
||||
|
||||
Fully working examples of how to use these components are in `/example-crates`
|
||||
fn main() -> Result<(), bdk::Error> {
|
||||
let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||
let wallet = Wallet::new(
|
||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
[`bdk_core_staging`]: https://github.com/LLFourn/bdk_core_staging
|
||||
[`rust-miniscript`]: https://github.com/rust-bitcoin/rust-miniscript
|
||||
[`rust-bitcoin`]: https://github.com/rust-bitcoin/rust-bitcoin
|
||||
[`esplora-client`]: https://docs.rs/esplora-client/0.3.0/esplora_client/
|
||||
[`electrum-client`]: https://docs.rs/electrum-client/0.13.0/electrum_client/
|
||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
println!("Descriptor balance: {} SAT", wallet.get_balance()?);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
```
|
||||
|
||||
### Generate a few addresses
|
||||
|
||||
```rust
|
||||
use bdk::{Wallet, database::MemoryDatabase};
|
||||
use bdk::wallet::AddressIndex::New;
|
||||
use bdk::bitcoin::Network;
|
||||
|
||||
fn main() -> Result<(), bdk::Error> {
|
||||
let wallet = Wallet::new(
|
||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
println!("Address #0: {}", wallet.get_address(New)?);
|
||||
println!("Address #1: {}", wallet.get_address(New)?);
|
||||
println!("Address #2: {}", wallet.get_address(New)?);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
```
|
||||
|
||||
### Create a transaction
|
||||
|
||||
```rust,no_run
|
||||
use bdk::{FeeRate, Wallet, SyncOptions};
|
||||
use bdk::database::MemoryDatabase;
|
||||
use bdk::blockchain::ElectrumBlockchain;
|
||||
|
||||
use bdk::electrum_client::Client;
|
||||
use bdk::wallet::AddressIndex::New;
|
||||
|
||||
use bitcoin::base64;
|
||||
use bdk::bitcoin::consensus::serialize;
|
||||
use bdk::bitcoin::Network;
|
||||
|
||||
fn main() -> Result<(), bdk::Error> {
|
||||
let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||
let wallet = Wallet::new(
|
||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
let send_to = wallet.get_address(New)?;
|
||||
let (psbt, details) = {
|
||||
let mut builder = wallet.build_tx();
|
||||
builder
|
||||
.add_recipient(send_to.script_pubkey(), 50_000)
|
||||
.enable_rbf()
|
||||
.do_not_spend_change()
|
||||
.fee_rate(FeeRate::from_sat_per_vb(5.0));
|
||||
builder.finish()?
|
||||
};
|
||||
|
||||
println!("Transaction details: {:#?}", details);
|
||||
println!("Unsigned PSBT: {}", base64::encode(psbt.serialize()));
|
||||
|
||||
Ok(())
|
||||
}
|
||||
```
|
||||
|
||||
### Sign a transaction
|
||||
|
||||
```rust,no_run
|
||||
use bdk::{Wallet, SignOptions, database::MemoryDatabase};
|
||||
|
||||
use bitcoin::base64;
|
||||
use bdk::bitcoin::consensus::deserialize;
|
||||
use bdk::bitcoin::{psbt::Psbt, Network};
|
||||
|
||||
fn main() -> Result<(), bdk::Error> {
|
||||
let wallet = Wallet::new(
|
||||
"wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/0/*)",
|
||||
Some("wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/1/*)"),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
let psbt = "...";
|
||||
let mut psbt = Psbt::deserialize(&base64::decode(psbt).unwrap())?;
|
||||
|
||||
let _finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
```
|
||||
|
||||
## Testing
|
||||
|
||||
### Unit testing
|
||||
|
||||
```bash
|
||||
cargo test
|
||||
```
|
||||
|
||||
### Integration testing
|
||||
|
||||
Integration testing require testing features, for example:
|
||||
|
||||
```bash
|
||||
cargo test --features test-electrum
|
||||
```
|
||||
|
||||
The other options are `test-esplora`, `test-rpc` or `test-rpc-legacy` which runs against an older version of Bitcoin Core.
|
||||
Note that `electrs` and `bitcoind` binaries are automatically downloaded (on mac and linux), to specify you already have installed binaries you must use `--no-default-features` and provide `BITCOIND_EXE` and `ELECTRS_EXE` as environment variables.
|
||||
|
||||
## Running under WASM
|
||||
|
||||
If you want to run this library under WASM you will probably have to add the following lines to you `Cargo.toml`:
|
||||
|
||||
```toml
|
||||
[dependencies]
|
||||
getrandom = { version = "0.2", features = ["js"] }
|
||||
```
|
||||
|
||||
This enables the `rand` crate to work in environments where JavaScript is available. See [this link](https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support) to learn more.
|
||||
|
||||
## License
|
||||
|
||||
Licensed under either of
|
||||
|
||||
* Apache License, Version 2.0
|
||||
([LICENSE-APACHE](LICENSE-APACHE) or http://www.apache.org/licenses/LICENSE-2.0)
|
||||
* MIT license
|
||||
([LICENSE-MIT](LICENSE-MIT) or http://opensource.org/licenses/MIT)
|
||||
|
||||
at your option.
|
||||
|
||||
## Contribution
|
||||
|
||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
||||
dual licensed as above, without any additional terms or conditions.
|
||||
|
||||
## Minimum Supported Rust Version (MSRV)
|
||||
|
||||
This library should compile with any combination of features with Rust 1.57.0.
|
||||
|
||||
To build with the MSRV you will need to pin dependencies as follows:
|
||||
|
||||
```shell
|
||||
# log 0.4.19 has MSRV 1.60.0
|
||||
cargo update -p log --precise "0.4.18"
|
||||
# tempfile 3.7.0 has MSRV 1.63.0
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
# required for sqlite feature, hashlink 0.8.2 has MSRV 1.61.0
|
||||
cargo update -p hashlink --precise "0.8.1"
|
||||
# required for compact_filters feature, regex after 1.7.3 has MSRV 1.60.0
|
||||
cargo update -p regex --precise "1.7.3"
|
||||
# zip 0.6.3 has MSRV 1.59.0 but still works
|
||||
cargo update -p zip:0.6.6 --precise "0.6.3"
|
||||
# rustix 0.38.0 has MSRV 1.65.0
|
||||
cargo update -p rustix --precise "0.37.23"
|
||||
# tokio 1.30 has MSRV 1.63.0+
|
||||
cargo update -p tokio --precise "1.29.1"
|
||||
# tokio-util 0.7.9 doesn't build with MSRV 1.57.0
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
# cc 1.0.82 is throwing error with rust 1.57.0, "error[E0599]: no method named `retain_mut`..."
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
# rustls 0.20.9 has MSRV 1.60.0+
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
# rustls 0.21.2 has MSRV 1.60.0+
|
||||
cargo update -p rustls:0.21.7 --precise "0.21.1"
|
||||
# flate2 1.0.27 has MSRV 1.63.0+
|
||||
cargo update -p flate2:1.0.27 --precise "1.0.26"
|
||||
# reqwest 0.11.19 has MSRV 1.63.0+
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
# h2 0.3.21 has MSRV 1.63.0+
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
# rustls-webpki 0.100.2 has MSRV 1.60+
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
# rustls-webpki 0.101.6 has MSRV 1.60+
|
||||
cargo update -p rustls-webpki:0.101.6 --precise "0.101.1"
|
||||
# byteorder 1.5.0 has MSRV 1.60.0+
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
# webpki 0.22.4 requires `ring:0.17.2` which has MSRV 1.61.0+
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
```
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
msrv="1.57.0"
|
||||
@@ -1,65 +0,0 @@
|
||||
[package]
|
||||
name = "bdk"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
version = "1.0.0-alpha.1"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk"
|
||||
description = "A modern, lightweight, descriptor-based wallet library"
|
||||
keywords = ["bitcoin", "wallet", "descriptor", "psbt"]
|
||||
readme = "README.md"
|
||||
license = "MIT OR Apache-2.0"
|
||||
authors = ["Bitcoin Dev Kit Developers"]
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
|
||||
[dependencies]
|
||||
log = "=0.4.18"
|
||||
rand = "^0.8"
|
||||
miniscript = { version = "9", features = ["serde"], default-features = false }
|
||||
bitcoin = { version = "0.29", features = ["serde", "base64", "rand"], default-features = false }
|
||||
serde = { version = "^1.0", features = ["derive"] }
|
||||
serde_json = { version = "^1.0" }
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", features = ["miniscript", "serde"], default-features = false }
|
||||
|
||||
# Optional dependencies
|
||||
hwi = { version = "0.5", optional = true, features = [ "use-miniscript"] }
|
||||
bip39 = { version = "1.0.1", optional = true }
|
||||
|
||||
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
||||
getrandom = "0.2"
|
||||
js-sys = "0.3"
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = ["bitcoin/std", "miniscript/std", "bdk_chain/std"]
|
||||
compiler = ["miniscript/compiler"]
|
||||
all-keys = ["keys-bip39"]
|
||||
keys-bip39 = ["bip39"]
|
||||
hardware-signer = ["hwi"]
|
||||
test-hardware-signer = ["hardware-signer"]
|
||||
|
||||
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
||||
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
||||
# necessary for running our CI. See: https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support
|
||||
dev-getrandom-wasm = ["getrandom/js"]
|
||||
|
||||
[dev-dependencies]
|
||||
lazy_static = "1.4"
|
||||
env_logger = "0.7"
|
||||
# Move back to importing from rust-bitcoin once https://github.com/rust-bitcoin/rust-bitcoin/pull/1342 is released
|
||||
base64 = "^0.13"
|
||||
assert_matches = "1.5.0"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
rustdoc-args = ["--cfg", "docsrs"]
|
||||
|
||||
[[example]]
|
||||
name = "mnemonic_to_descriptors"
|
||||
path = "examples/mnemonic_to_descriptors.rs"
|
||||
required-features = ["all-keys"]
|
||||
|
||||
[[example]]
|
||||
name = "miniscriptc"
|
||||
path = "examples/compiler.rs"
|
||||
required-features = ["compiler"]
|
||||
@@ -1,227 +0,0 @@
|
||||
<div align="center">
|
||||
<h1>BDK</h1>
|
||||
|
||||
<img src="https://raw.githubusercontent.com/bitcoindevkit/bdk/master/static/bdk.png" width="220" />
|
||||
|
||||
<p>
|
||||
<strong>A modern, lightweight, descriptor-based wallet library written in Rust!</strong>
|
||||
</p>
|
||||
|
||||
<p>
|
||||
<a href="https://crates.io/crates/bdk"><img alt="Crate Info" src="https://img.shields.io/crates/v/bdk.svg"/></a>
|
||||
<a href="https://github.com/bitcoindevkit/bdk/blob/master/LICENSE"><img alt="MIT or Apache-2.0 Licensed" src="https://img.shields.io/badge/license-MIT%2FApache--2.0-blue.svg"/></a>
|
||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||
</p>
|
||||
|
||||
<h4>
|
||||
<a href="https://bitcoindevkit.org">Project Homepage</a>
|
||||
<span> | </span>
|
||||
<a href="https://docs.rs/bdk">Documentation</a>
|
||||
</h4>
|
||||
</div>
|
||||
|
||||
## `bdk`
|
||||
|
||||
The `bdk` crate provides the [`Wallet`](`crate::Wallet`) type which is a simple, high-level
|
||||
interface built from the low-level components of [`bdk_chain`]. `Wallet` is a good starting point
|
||||
for many simple applications as well as a good demonstration of how to use the other mechanisms to
|
||||
construct a wallet. It has two keychains (external and internal) which are defined by
|
||||
[miniscript descriptors][`rust-miniscript`] and uses them to generate addresses. When you give it
|
||||
chain data it also uses the descriptors to find transaction outputs owned by them. From there, you
|
||||
can create and sign transactions.
|
||||
|
||||
For more information, see the [`Wallet`'s documentation](https://docs.rs/bdk/latest/bdk/wallet/struct.Wallet.html).
|
||||
|
||||
### Blockchain data
|
||||
|
||||
In order to get blockchain data for `Wallet` to consume, you have to put it into particular form.
|
||||
Right now this is [`KeychainScan`] which is defined in [`bdk_chain`].
|
||||
|
||||
This can be created manually or from blockchain-scanning crates.
|
||||
|
||||
**Blockchain Data Sources**
|
||||
|
||||
* [`bdk_esplora`]: Grabs blockchain data from Esplora for updating BDK structures.
|
||||
* [`bdk_electrum`]: Grabs blockchain data from Electrum for updating BDK structures.
|
||||
|
||||
**Examples**
|
||||
|
||||
* [`example-crates/wallet_esplora`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora)
|
||||
* [`example-crates/wallet_electrum`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_electrum)
|
||||
|
||||
### Persistence
|
||||
|
||||
To persist the `Wallet` on disk, `Wallet` needs to be constructed with a
|
||||
[`Persist`](https://docs.rs/bdk_chain/latest/bdk_chain/keychain/struct.KeychainPersist.html) implementation.
|
||||
|
||||
**Implementations**
|
||||
|
||||
* [`bdk_file_store`]: a simple flat-file implementation of `Persist`.
|
||||
|
||||
**Example**
|
||||
|
||||
```rust
|
||||
use bdk::{bitcoin::Network, wallet::{AddressIndex, Wallet}};
|
||||
|
||||
fn main() {
|
||||
// a type that implements `Persist`
|
||||
let db = ();
|
||||
|
||||
let descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let mut wallet = Wallet::new(descriptor, None, db, Network::Testnet).expect("should create");
|
||||
|
||||
// get a new address (this increments revealed derivation index)
|
||||
println!("revealed address: {}", wallet.get_address(AddressIndex::New));
|
||||
println!("staged changes: {:?}", wallet.staged());
|
||||
// persist changes
|
||||
wallet.commit().expect("must save");
|
||||
}
|
||||
```
|
||||
|
||||
<!-- ### Sync the balance of a descriptor -->
|
||||
|
||||
<!-- ```rust,no_run -->
|
||||
<!-- use bdk::Wallet; -->
|
||||
<!-- use bdk::blockchain::ElectrumBlockchain; -->
|
||||
<!-- use bdk::SyncOptions; -->
|
||||
<!-- use bdk::electrum_client::Client; -->
|
||||
<!-- use bdk::bitcoin::Network; -->
|
||||
|
||||
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||
<!-- let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?); -->
|
||||
<!-- let wallet = Wallet::new( -->
|
||||
<!-- "wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)", -->
|
||||
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"), -->
|
||||
<!-- Network::Testnet, -->
|
||||
<!-- )?; -->
|
||||
|
||||
<!-- wallet.sync(&blockchain, SyncOptions::default())?; -->
|
||||
|
||||
<!-- println!("Descriptor balance: {} SAT", wallet.get_balance()?); -->
|
||||
|
||||
<!-- Ok(()) -->
|
||||
<!-- } -->
|
||||
<!-- ``` -->
|
||||
<!-- ### Generate a few addresses -->
|
||||
|
||||
<!-- ```rust -->
|
||||
<!-- use bdk::Wallet; -->
|
||||
<!-- use bdk::wallet::AddressIndex::New; -->
|
||||
<!-- use bdk::bitcoin::Network; -->
|
||||
|
||||
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||
<!-- let wallet = Wallet::new_no_persist( -->
|
||||
<!-- "wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)", -->
|
||||
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"), -->
|
||||
<!-- Network::Testnet, -->
|
||||
<!-- )?; -->
|
||||
|
||||
<!-- println!("Address #0: {}", wallet.get_address(New)); -->
|
||||
<!-- println!("Address #1: {}", wallet.get_address(New)); -->
|
||||
<!-- println!("Address #2: {}", wallet.get_address(New)); -->
|
||||
|
||||
<!-- Ok(()) -->
|
||||
<!-- } -->
|
||||
<!-- ``` -->
|
||||
|
||||
<!-- ### Create a transaction -->
|
||||
|
||||
<!-- ```rust,no_run -->
|
||||
<!-- use bdk::{FeeRate, Wallet, SyncOptions}; -->
|
||||
<!-- use bdk::blockchain::ElectrumBlockchain; -->
|
||||
|
||||
<!-- use bdk::electrum_client::Client; -->
|
||||
<!-- use bdk::wallet::AddressIndex::New; -->
|
||||
|
||||
<!-- use base64; -->
|
||||
<!-- use bdk::bitcoin::consensus::serialize; -->
|
||||
<!-- use bdk::bitcoin::Network; -->
|
||||
|
||||
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||
<!-- let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?); -->
|
||||
<!-- let wallet = Wallet::new_no_persist( -->
|
||||
<!-- "wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)", -->
|
||||
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"), -->
|
||||
<!-- Network::Testnet, -->
|
||||
<!-- )?; -->
|
||||
|
||||
<!-- wallet.sync(&blockchain, SyncOptions::default())?; -->
|
||||
|
||||
<!-- let send_to = wallet.get_address(New); -->
|
||||
<!-- let (psbt, details) = { -->
|
||||
<!-- let mut builder = wallet.build_tx(); -->
|
||||
<!-- builder -->
|
||||
<!-- .add_recipient(send_to.script_pubkey(), 50_000) -->
|
||||
<!-- .enable_rbf() -->
|
||||
<!-- .do_not_spend_change() -->
|
||||
<!-- .fee_rate(FeeRate::from_sat_per_vb(5.0)); -->
|
||||
<!-- builder.finish()? -->
|
||||
<!-- }; -->
|
||||
|
||||
<!-- println!("Transaction details: {:#?}", details); -->
|
||||
<!-- println!("Unsigned PSBT: {}", base64::encode(&serialize(&psbt))); -->
|
||||
|
||||
<!-- Ok(()) -->
|
||||
<!-- } -->
|
||||
<!-- ``` -->
|
||||
|
||||
<!-- ### Sign a transaction -->
|
||||
|
||||
<!-- ```rust,no_run -->
|
||||
<!-- use bdk::{Wallet, SignOptions}; -->
|
||||
|
||||
<!-- use base64; -->
|
||||
<!-- use bdk::bitcoin::consensus::deserialize; -->
|
||||
<!-- use bdk::bitcoin::Network; -->
|
||||
|
||||
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||
<!-- let wallet = Wallet::new_no_persist( -->
|
||||
<!-- "wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/0/*)", -->
|
||||
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/1/*)"), -->
|
||||
<!-- Network::Testnet, -->
|
||||
<!-- )?; -->
|
||||
|
||||
<!-- let psbt = "..."; -->
|
||||
<!-- let mut psbt = deserialize(&base64::decode(psbt).unwrap())?; -->
|
||||
|
||||
<!-- let _finalized = wallet.sign(&mut psbt, SignOptions::default())?; -->
|
||||
|
||||
<!-- Ok(()) -->
|
||||
<!-- } -->
|
||||
<!-- ``` -->
|
||||
|
||||
## Testing
|
||||
|
||||
### Unit testing
|
||||
|
||||
```bash
|
||||
cargo test
|
||||
```
|
||||
|
||||
## License
|
||||
|
||||
Licensed under either of
|
||||
|
||||
* Apache License, Version 2.0
|
||||
([LICENSE-APACHE](LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||
* MIT license
|
||||
([LICENSE-MIT](LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||
|
||||
at your option.
|
||||
|
||||
## Contribution
|
||||
|
||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
||||
dual licensed as above, without any additional terms or conditions.
|
||||
|
||||
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
||||
[`bdk_file_store`]: https://docs.rs/bdk_file_store/latest
|
||||
[`bdk_electrum`]: https://docs.rs/bdk_electrum/latest
|
||||
[`bdk_esplora`]: https://docs.rs/bdk_esplora/latest
|
||||
[`KeychainScan`]: https://docs.rs/bdk_chain/latest/bdk_chain/keychain/struct.KeychainScan.html
|
||||
[`rust-miniscript`]: https://docs.rs/miniscript/latest/miniscript/index.html
|
||||
@@ -1,54 +0,0 @@
|
||||
#![doc = include_str!("../README.md")]
|
||||
// only enables the `doc_cfg` feature when the `docsrs` configuration attribute is defined
|
||||
#![cfg_attr(docsrs, feature(doc_cfg))]
|
||||
#![cfg_attr(
|
||||
docsrs,
|
||||
doc(html_logo_url = "https://github.com/bitcoindevkit/bdk/raw/master/static/bdk.png")
|
||||
)]
|
||||
#![no_std]
|
||||
#![warn(missing_docs)]
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
#[macro_use]
|
||||
extern crate std;
|
||||
|
||||
#[doc(hidden)]
|
||||
#[macro_use]
|
||||
pub extern crate alloc;
|
||||
|
||||
pub extern crate bitcoin;
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
pub extern crate hwi;
|
||||
extern crate log;
|
||||
pub extern crate miniscript;
|
||||
extern crate serde;
|
||||
extern crate serde_json;
|
||||
|
||||
#[cfg(feature = "keys-bip39")]
|
||||
extern crate bip39;
|
||||
|
||||
#[allow(unused_imports)]
|
||||
#[macro_use]
|
||||
pub(crate) mod error;
|
||||
pub mod descriptor;
|
||||
pub mod keys;
|
||||
pub mod psbt;
|
||||
pub(crate) mod types;
|
||||
pub mod wallet;
|
||||
|
||||
pub use descriptor::template;
|
||||
pub use descriptor::HdKeyPaths;
|
||||
pub use error::Error;
|
||||
pub use types::*;
|
||||
pub use wallet::signer;
|
||||
pub use wallet::signer::SignOptions;
|
||||
pub use wallet::tx_builder::TxBuilder;
|
||||
pub use wallet::Wallet;
|
||||
|
||||
/// Get the version of BDK at runtime
|
||||
pub fn version() -> &'static str {
|
||||
env!("CARGO_PKG_VERSION", "unknown")
|
||||
}
|
||||
|
||||
pub use bdk_chain as chain;
|
||||
pub(crate) use bdk_chain::collections;
|
||||
@@ -1,79 +0,0 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
//! Additional functions on the `rust-bitcoin` `PartiallySignedTransaction` structure.
|
||||
|
||||
use crate::FeeRate;
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
||||
use bitcoin::TxOut;
|
||||
|
||||
// TODO upstream the functions here to `rust-bitcoin`?
|
||||
|
||||
/// Trait to add functions to extract utxos and calculate fees.
|
||||
pub trait PsbtUtils {
|
||||
/// Get the `TxOut` for the specified input index, if it doesn't exist in the PSBT `None` is returned.
|
||||
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut>;
|
||||
|
||||
/// The total transaction fee amount, sum of input amounts minus sum of output amounts, in sats.
|
||||
/// If the PSBT is missing a TxOut for an input returns None.
|
||||
fn fee_amount(&self) -> Option<u64>;
|
||||
|
||||
/// The transaction's fee rate. This value will only be accurate if calculated AFTER the
|
||||
/// `PartiallySignedTransaction` is finalized and all witness/signature data is added to the
|
||||
/// transaction.
|
||||
/// If the PSBT is missing a TxOut for an input returns None.
|
||||
fn fee_rate(&self) -> Option<FeeRate>;
|
||||
}
|
||||
|
||||
impl PsbtUtils for Psbt {
|
||||
#[allow(clippy::all)] // We want to allow `manual_map` but it is too new.
|
||||
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut> {
|
||||
let tx = &self.unsigned_tx;
|
||||
|
||||
if input_index >= tx.input.len() {
|
||||
return None;
|
||||
}
|
||||
|
||||
if let Some(input) = self.inputs.get(input_index) {
|
||||
if let Some(wit_utxo) = &input.witness_utxo {
|
||||
Some(wit_utxo.clone())
|
||||
} else if let Some(in_tx) = &input.non_witness_utxo {
|
||||
Some(in_tx.output[tx.input[input_index].previous_output.vout as usize].clone())
|
||||
} else {
|
||||
None
|
||||
}
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
fn fee_amount(&self) -> Option<u64> {
|
||||
let tx = &self.unsigned_tx;
|
||||
let utxos: Option<Vec<TxOut>> = (0..tx.input.len()).map(|i| self.get_utxo_for(i)).collect();
|
||||
|
||||
utxos.map(|inputs| {
|
||||
let input_amount: u64 = inputs.iter().map(|i| i.value).sum();
|
||||
let output_amount: u64 = self.unsigned_tx.output.iter().map(|o| o.value).sum();
|
||||
input_amount
|
||||
.checked_sub(output_amount)
|
||||
.expect("input amount must be greater than output amount")
|
||||
})
|
||||
}
|
||||
|
||||
fn fee_rate(&self) -> Option<FeeRate> {
|
||||
let fee_amount = self.fee_amount();
|
||||
fee_amount.map(|fee| {
|
||||
let weight = self.clone().extract_tx().weight();
|
||||
FeeRate::from_wu(fee, weight)
|
||||
})
|
||||
}
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,93 +0,0 @@
|
||||
#![allow(unused)]
|
||||
use bdk::{wallet::AddressIndex, Wallet};
|
||||
use bdk_chain::{BlockId, ConfirmationTime};
|
||||
use bitcoin::hashes::Hash;
|
||||
use bitcoin::{BlockHash, Network, Transaction, TxOut};
|
||||
|
||||
/// Return a fake wallet that appears to be funded for testing.
|
||||
pub fn get_funded_wallet_with_change(
|
||||
descriptor: &str,
|
||||
change: Option<&str>,
|
||||
) -> (Wallet, bitcoin::Txid) {
|
||||
let mut wallet = Wallet::new_no_persist(descriptor, change, Network::Regtest).unwrap();
|
||||
let address = wallet.get_address(AddressIndex::New).address;
|
||||
|
||||
let tx = Transaction {
|
||||
version: 1,
|
||||
lock_time: bitcoin::PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 50_000,
|
||||
script_pubkey: address.script_pubkey(),
|
||||
}],
|
||||
};
|
||||
|
||||
wallet
|
||||
.insert_checkpoint(BlockId {
|
||||
height: 1_000,
|
||||
hash: BlockHash::all_zeros(),
|
||||
})
|
||||
.unwrap();
|
||||
wallet
|
||||
.insert_tx(
|
||||
tx.clone(),
|
||||
ConfirmationTime::Confirmed {
|
||||
height: 1_000,
|
||||
time: 100,
|
||||
},
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
(wallet, tx.txid())
|
||||
}
|
||||
|
||||
pub fn get_funded_wallet(descriptor: &str) -> (Wallet, bitcoin::Txid) {
|
||||
get_funded_wallet_with_change(descriptor, None)
|
||||
}
|
||||
|
||||
pub fn get_test_wpkh() -> &'static str {
|
||||
"wpkh(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW)"
|
||||
}
|
||||
|
||||
pub fn get_test_single_sig_csv() -> &'static str {
|
||||
// and(pk(Alice),older(6))
|
||||
"wsh(and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),older(6)))"
|
||||
}
|
||||
|
||||
pub fn get_test_a_or_b_plus_csv() -> &'static str {
|
||||
// or(pk(Alice),and(pk(Bob),older(144)))
|
||||
"wsh(or_d(pk(cRjo6jqfVNP33HhSS76UhXETZsGTZYx8FMFvR9kpbtCSV1PmdZdu),and_v(v:pk(cMnkdebixpXMPfkcNEjjGin7s94hiehAH4mLbYkZoh9KSiNNmqC8),older(144))))"
|
||||
}
|
||||
|
||||
pub fn get_test_single_sig_cltv() -> &'static str {
|
||||
// and(pk(Alice),after(100000))
|
||||
"wsh(and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),after(100000)))"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_single_sig() -> &'static str {
|
||||
"tr(cNJmN3fH9DDbDt131fQNkVakkpzawJBSeybCUNmP1BovpmGQ45xG)"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_with_taptree() -> &'static str {
|
||||
"tr(b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55,{pk(cPZzKuNmpuUjD1e8jUU4PVzy2b5LngbSip8mBsxf4e7rSFZVb4Uh),pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642)})"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_with_taptree_both_priv() -> &'static str {
|
||||
"tr(b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55,{pk(cPZzKuNmpuUjD1e8jUU4PVzy2b5LngbSip8mBsxf4e7rSFZVb4Uh),pk(cNaQCDwmmh4dS9LzCgVtyy1e1xjCJ21GUDHe9K98nzb689JvinGV)})"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_repeated_key() -> &'static str {
|
||||
"tr(b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55,{and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),after(100)),and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),after(200))})"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_single_sig_xprv() -> &'static str {
|
||||
"tr(tprv8ZgxMBicQKsPdDArR4xSAECuVxeX1jwwSXR4ApKbkYgZiziDc4LdBy2WvJeGDfUSE4UT4hHhbgEwbdq8ajjUHiKDegkwrNU6V55CxcxonVN/*)"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_with_taptree_xprv() -> &'static str {
|
||||
"tr(cNJmN3fH9DDbDt131fQNkVakkpzawJBSeybCUNmP1BovpmGQ45xG,{pk(tprv8ZgxMBicQKsPdDArR4xSAECuVxeX1jwwSXR4ApKbkYgZiziDc4LdBy2WvJeGDfUSE4UT4hHhbgEwbdq8ajjUHiKDegkwrNU6V55CxcxonVN/*),pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642)})"
|
||||
}
|
||||
|
||||
pub fn get_test_tr_dup_keys() -> &'static str {
|
||||
"tr(cNJmN3fH9DDbDt131fQNkVakkpzawJBSeybCUNmP1BovpmGQ45xG,{pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642),pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642)})"
|
||||
}
|
||||
@@ -1,158 +0,0 @@
|
||||
use bdk::bitcoin::TxIn;
|
||||
use bdk::wallet::AddressIndex;
|
||||
use bdk::wallet::AddressIndex::New;
|
||||
use bdk::{psbt, FeeRate, SignOptions};
|
||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
||||
use core::str::FromStr;
|
||||
mod common;
|
||||
use common::*;
|
||||
|
||||
// from bip 174
|
||||
const PSBT_STR: &str = "cHNidP8BAKACAAAAAqsJSaCMWvfEm4IS9Bfi8Vqz9cM9zxU4IagTn4d6W3vkAAAAAAD+////qwlJoIxa98SbghL0F+LxWrP1wz3PFTghqBOfh3pbe+QBAAAAAP7///8CYDvqCwAAAAAZdqkUdopAu9dAy+gdmI5x3ipNXHE5ax2IrI4kAAAAAAAAGXapFG9GILVT+glechue4O/p+gOcykWXiKwAAAAAAAEHakcwRAIgR1lmF5fAGwNrJZKJSGhiGDR9iYZLcZ4ff89X0eURZYcCIFMJ6r9Wqk2Ikf/REf3xM286KdqGbX+EhtdVRs7tr5MZASEDXNxh/HupccC1AaZGoqg7ECy0OIEhfKaC3Ibi1z+ogpIAAQEgAOH1BQAAAAAXqRQ1RebjO4MsRwUPJNPuuTycA5SLx4cBBBYAFIXRNTfy4mVAWjTbr6nj3aAfuCMIAAAA";
|
||||
|
||||
#[test]
|
||||
#[should_panic(expected = "InputIndexOutOfRange")]
|
||||
fn test_psbt_malformed_psbt_input_legacy() {
|
||||
let psbt_bip = Psbt::from_str(PSBT_STR).unwrap();
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||
let options = SignOptions {
|
||||
trust_witness_utxo: true,
|
||||
..Default::default()
|
||||
};
|
||||
let _ = wallet.sign(&mut psbt, options).unwrap();
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(expected = "InputIndexOutOfRange")]
|
||||
fn test_psbt_malformed_psbt_input_segwit() {
|
||||
let psbt_bip = Psbt::from_str(PSBT_STR).unwrap();
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
psbt.inputs.push(psbt_bip.inputs[1].clone());
|
||||
let options = SignOptions {
|
||||
trust_witness_utxo: true,
|
||||
..Default::default()
|
||||
};
|
||||
let _ = wallet.sign(&mut psbt, options).unwrap();
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(expected = "InputIndexOutOfRange")]
|
||||
fn test_psbt_malformed_tx_input() {
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
psbt.unsigned_tx.input.push(TxIn::default());
|
||||
let options = SignOptions {
|
||||
trust_witness_utxo: true,
|
||||
..Default::default()
|
||||
};
|
||||
let _ = wallet.sign(&mut psbt, options).unwrap();
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_psbt_sign_with_finalized() {
|
||||
let psbt_bip = Psbt::from_str(PSBT_STR).unwrap();
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
|
||||
// add a finalized input
|
||||
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||
psbt.unsigned_tx
|
||||
.input
|
||||
.push(psbt_bip.unsigned_tx.input[0].clone());
|
||||
|
||||
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_psbt_fee_rate_with_witness_utxo() {
|
||||
use psbt::PsbtUtils;
|
||||
|
||||
let expected_fee_rate = 1.2345;
|
||||
|
||||
let (mut wallet, _) = get_funded_wallet("wpkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||
let addr = wallet.get_address(New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let fee_amount = psbt.fee_amount();
|
||||
assert!(fee_amount.is_some());
|
||||
|
||||
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||
|
||||
let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||
assert!(finalized);
|
||||
|
||||
let finalized_fee_rate = psbt.fee_rate().unwrap();
|
||||
assert!(finalized_fee_rate.as_sat_per_vb() >= expected_fee_rate);
|
||||
assert!(finalized_fee_rate.as_sat_per_vb() < unfinalized_fee_rate.as_sat_per_vb());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_psbt_fee_rate_with_nonwitness_utxo() {
|
||||
use psbt::PsbtUtils;
|
||||
|
||||
let expected_fee_rate = 1.2345;
|
||||
|
||||
let (mut wallet, _) = get_funded_wallet("pkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||
let addr = wallet.get_address(New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let fee_amount = psbt.fee_amount();
|
||||
assert!(fee_amount.is_some());
|
||||
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||
|
||||
let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||
assert!(finalized);
|
||||
|
||||
let finalized_fee_rate = psbt.fee_rate().unwrap();
|
||||
assert!(finalized_fee_rate.as_sat_per_vb() >= expected_fee_rate);
|
||||
assert!(finalized_fee_rate.as_sat_per_vb() < unfinalized_fee_rate.as_sat_per_vb());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_psbt_fee_rate_with_missing_txout() {
|
||||
use psbt::PsbtUtils;
|
||||
|
||||
let expected_fee_rate = 1.2345;
|
||||
|
||||
let (mut wpkh_wallet, _) = get_funded_wallet("wpkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||
let addr = wpkh_wallet.get_address(New);
|
||||
let mut builder = wpkh_wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut wpkh_psbt, _) = builder.finish().unwrap();
|
||||
|
||||
wpkh_psbt.inputs[0].witness_utxo = None;
|
||||
wpkh_psbt.inputs[0].non_witness_utxo = None;
|
||||
assert!(wpkh_psbt.fee_amount().is_none());
|
||||
assert!(wpkh_psbt.fee_rate().is_none());
|
||||
|
||||
let (mut pkh_wallet, _) = get_funded_wallet("pkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||
let addr = pkh_wallet.get_address(New);
|
||||
let mut builder = pkh_wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut pkh_psbt, _) = builder.finish().unwrap();
|
||||
|
||||
pkh_psbt.inputs[0].non_witness_utxo = None;
|
||||
assert!(pkh_psbt.fee_amount().is_none());
|
||||
assert!(pkh_psbt.fee_rate().is_none());
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,31 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_chain"
|
||||
version = "0.5.0"
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_chain"
|
||||
description = "Collection of core structures for Bitcoin Dev Kit."
|
||||
license = "MIT OR Apache-2.0"
|
||||
readme = "README.md"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
# For no-std, remember to enable the bitcoin/no-std feature
|
||||
bitcoin = { version = "0.29", default-features = false }
|
||||
serde_crate = { package = "serde", version = "1", optional = true, features = ["derive"] }
|
||||
|
||||
# Use hashbrown as a feature flag to have HashSet and HashMap from it.
|
||||
# note version 0.13 breaks outs MSRV.
|
||||
hashbrown = { version = "0.11", optional = true, features = ["serde"] }
|
||||
miniscript = { version = "9.0.0", optional = true, default-features = false }
|
||||
|
||||
[dev-dependencies]
|
||||
rand = "0.8"
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = ["bitcoin/std", "miniscript/std"]
|
||||
serde = ["serde_crate", "bitcoin/serde"]
|
||||
@@ -1,3 +0,0 @@
|
||||
# BDK Chain
|
||||
|
||||
BDK keychain tracker, tools for storing and indexing chain data.
|
||||
@@ -1,258 +0,0 @@
|
||||
use bitcoin::{hashes::Hash, BlockHash, OutPoint, TxOut, Txid};
|
||||
|
||||
use crate::{Anchor, COINBASE_MATURITY};
|
||||
|
||||
/// Represents the observed position of some chain data.
|
||||
///
|
||||
/// The generic `A` should be a [`Anchor`] implementation.
|
||||
#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, core::hash::Hash)]
|
||||
pub enum ChainPosition<A> {
|
||||
/// The chain data is seen as confirmed, and in anchored by `A`.
|
||||
Confirmed(A),
|
||||
/// The chain data is seen in mempool at this given timestamp.
|
||||
Unconfirmed(u64),
|
||||
}
|
||||
|
||||
impl<A> ChainPosition<A> {
|
||||
/// Returns whether [`ChainPosition`] is confirmed or not.
|
||||
pub fn is_confirmed(&self) -> bool {
|
||||
matches!(self, Self::Confirmed(_))
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Clone> ChainPosition<&A> {
|
||||
/// Maps a [`ChainPosition<&A>`] into a [`ChainPosition<A>`] by cloning the contents.
|
||||
pub fn cloned(self) -> ChainPosition<A> {
|
||||
match self {
|
||||
ChainPosition::Confirmed(a) => ChainPosition::Confirmed(a.clone()),
|
||||
ChainPosition::Unconfirmed(last_seen) => ChainPosition::Unconfirmed(last_seen),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor> ChainPosition<A> {
|
||||
/// Determines the upper bound of the confirmation height.
|
||||
pub fn confirmation_height_upper_bound(&self) -> Option<u32> {
|
||||
match self {
|
||||
ChainPosition::Confirmed(a) => Some(a.confirmation_height_upper_bound()),
|
||||
ChainPosition::Unconfirmed(_) => None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Block height and timestamp at which a transaction is confirmed.
|
||||
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate")
|
||||
)]
|
||||
pub enum ConfirmationTime {
|
||||
/// The confirmed variant.
|
||||
Confirmed {
|
||||
/// Confirmation height.
|
||||
height: u32,
|
||||
/// Confirmation time in unix seconds.
|
||||
time: u64,
|
||||
},
|
||||
/// The unconfirmed variant.
|
||||
Unconfirmed {
|
||||
/// The last-seen timestamp in unix seconds.
|
||||
last_seen: u64,
|
||||
},
|
||||
}
|
||||
|
||||
impl ConfirmationTime {
|
||||
/// Construct an unconfirmed variant using the given `last_seen` time in unix seconds.
|
||||
pub fn unconfirmed(last_seen: u64) -> Self {
|
||||
Self::Unconfirmed { last_seen }
|
||||
}
|
||||
|
||||
/// Returns whether [`ConfirmationTime`] is the confirmed variant.
|
||||
pub fn is_confirmed(&self) -> bool {
|
||||
matches!(self, Self::Confirmed { .. })
|
||||
}
|
||||
}
|
||||
|
||||
impl From<ChainPosition<ConfirmationTimeAnchor>> for ConfirmationTime {
|
||||
fn from(observed_as: ChainPosition<ConfirmationTimeAnchor>) -> Self {
|
||||
match observed_as {
|
||||
ChainPosition::Confirmed(a) => Self::Confirmed {
|
||||
height: a.confirmation_height,
|
||||
time: a.confirmation_time,
|
||||
},
|
||||
ChainPosition::Unconfirmed(_) => Self::Unconfirmed { last_seen: 0 },
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// A reference to a block in the canonical chain.
|
||||
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate")
|
||||
)]
|
||||
pub struct BlockId {
|
||||
/// The height of the block.
|
||||
pub height: u32,
|
||||
/// The hash of the block.
|
||||
pub hash: BlockHash,
|
||||
}
|
||||
|
||||
impl Default for BlockId {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
height: Default::default(),
|
||||
hash: BlockHash::from_inner([0u8; 32]),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl From<(u32, BlockHash)> for BlockId {
|
||||
fn from((height, hash): (u32, BlockHash)) -> Self {
|
||||
Self { height, hash }
|
||||
}
|
||||
}
|
||||
|
||||
impl From<BlockId> for (u32, BlockHash) {
|
||||
fn from(block_id: BlockId) -> Self {
|
||||
(block_id.height, block_id.hash)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<(&u32, &BlockHash)> for BlockId {
|
||||
fn from((height, hash): (&u32, &BlockHash)) -> Self {
|
||||
Self {
|
||||
height: *height,
|
||||
hash: *hash,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// An [`Anchor`] implementation that also records the exact confirmation height of the transaction.
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate")
|
||||
)]
|
||||
pub struct ConfirmationHeightAnchor {
|
||||
/// The anchor block.
|
||||
pub anchor_block: BlockId,
|
||||
|
||||
/// The exact confirmation height of the transaction.
|
||||
///
|
||||
/// It is assumed that this value is never larger than the height of the anchor block.
|
||||
pub confirmation_height: u32,
|
||||
}
|
||||
|
||||
impl Anchor for ConfirmationHeightAnchor {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
self.anchor_block
|
||||
}
|
||||
|
||||
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||
self.confirmation_height
|
||||
}
|
||||
}
|
||||
|
||||
/// An [`Anchor`] implementation that also records the exact confirmation time and height of the
|
||||
/// transaction.
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate")
|
||||
)]
|
||||
pub struct ConfirmationTimeAnchor {
|
||||
/// The anchor block.
|
||||
pub anchor_block: BlockId,
|
||||
/// The confirmation height of the chain data being anchored.
|
||||
pub confirmation_height: u32,
|
||||
/// The confirmation time of the chain data being anchored.
|
||||
pub confirmation_time: u64,
|
||||
}
|
||||
|
||||
impl Anchor for ConfirmationTimeAnchor {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
self.anchor_block
|
||||
}
|
||||
|
||||
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||
self.confirmation_height
|
||||
}
|
||||
}
|
||||
/// A `TxOut` with as much data as we can retrieve about it
|
||||
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct FullTxOut<A> {
|
||||
/// The location of the `TxOut`.
|
||||
pub outpoint: OutPoint,
|
||||
/// The `TxOut`.
|
||||
pub txout: TxOut,
|
||||
/// The position of the transaction in `outpoint` in the overall chain.
|
||||
pub chain_position: ChainPosition<A>,
|
||||
/// The txid and chain position of the transaction (if any) that has spent this output.
|
||||
pub spent_by: Option<(ChainPosition<A>, Txid)>,
|
||||
/// Whether this output is on a coinbase transaction.
|
||||
pub is_on_coinbase: bool,
|
||||
}
|
||||
|
||||
impl<A: Anchor> FullTxOut<A> {
|
||||
/// Whether the `txout` is considered mature.
|
||||
///
|
||||
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||
/// method may return false-negatives. In other words, interpretted confirmation count may be
|
||||
/// less than the actual value.
|
||||
///
|
||||
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||
pub fn is_mature(&self, tip: u32) -> bool {
|
||||
if self.is_on_coinbase {
|
||||
let tx_height = match &self.chain_position {
|
||||
ChainPosition::Confirmed(anchor) => anchor.confirmation_height_upper_bound(),
|
||||
ChainPosition::Unconfirmed(_) => {
|
||||
debug_assert!(false, "coinbase tx can never be unconfirmed");
|
||||
return false;
|
||||
}
|
||||
};
|
||||
let age = tip.saturating_sub(tx_height);
|
||||
if age + 1 < COINBASE_MATURITY {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
true
|
||||
}
|
||||
|
||||
/// Whether the utxo is/was/will be spendable with chain `tip`.
|
||||
///
|
||||
/// This method does not take into account the locktime.
|
||||
///
|
||||
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||
/// method may return false-negatives. In other words, interpretted confirmation count may be
|
||||
/// less than the actual value.
|
||||
///
|
||||
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||
pub fn is_confirmed_and_spendable(&self, tip: u32) -> bool {
|
||||
if !self.is_mature(tip) {
|
||||
return false;
|
||||
}
|
||||
|
||||
let confirmation_height = match &self.chain_position {
|
||||
ChainPosition::Confirmed(anchor) => anchor.confirmation_height_upper_bound(),
|
||||
ChainPosition::Unconfirmed(_) => return false,
|
||||
};
|
||||
if confirmation_height > tip {
|
||||
return false;
|
||||
}
|
||||
|
||||
// if the spending tx is confirmed within tip height, the txout is no longer spendable
|
||||
if let Some((ChainPosition::Confirmed(spending_anchor), _)) = &self.spent_by {
|
||||
if spending_anchor.anchor_block().height <= tip {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
true
|
||||
}
|
||||
}
|
||||
@@ -1,25 +0,0 @@
|
||||
use crate::BlockId;
|
||||
|
||||
/// Represents a service that tracks the blockchain.
|
||||
///
|
||||
/// The main method is [`is_block_in_chain`] which determines whether a given block of [`BlockId`]
|
||||
/// is an ancestor of another "static block".
|
||||
///
|
||||
/// [`is_block_in_chain`]: Self::is_block_in_chain
|
||||
pub trait ChainOracle {
|
||||
/// Error type.
|
||||
type Error: core::fmt::Debug;
|
||||
|
||||
/// Determines whether `block` of [`BlockId`] exists as an ancestor of `chain_tip`.
|
||||
///
|
||||
/// If `None` is returned, it means the implementation cannot determine whether `block` exists
|
||||
/// under `chain_tip`.
|
||||
fn is_block_in_chain(
|
||||
&self,
|
||||
block: BlockId,
|
||||
chain_tip: BlockId,
|
||||
) -> Result<Option<bool>, Self::Error>;
|
||||
|
||||
/// Get the best chain's chain tip.
|
||||
fn get_chain_tip(&self) -> Result<Option<BlockId>, Self::Error>;
|
||||
}
|
||||
@@ -1,16 +0,0 @@
|
||||
use crate::miniscript::{Descriptor, DescriptorPublicKey};
|
||||
|
||||
/// A trait to extend the functionality of a miniscript descriptor.
|
||||
pub trait DescriptorExt {
|
||||
/// Returns the minimum value (in satoshis) at which an output is broadcastable.
|
||||
fn dust_value(&self) -> u64;
|
||||
}
|
||||
|
||||
impl DescriptorExt for Descriptor<DescriptorPublicKey> {
|
||||
fn dust_value(&self) -> u64 {
|
||||
self.at_derivation_index(0)
|
||||
.script_pubkey()
|
||||
.dust_value()
|
||||
.to_sat()
|
||||
}
|
||||
}
|
||||
@@ -1,30 +0,0 @@
|
||||
#![allow(unused)]
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{
|
||||
consensus,
|
||||
hashes::{hex::FromHex, Hash},
|
||||
Transaction,
|
||||
};
|
||||
|
||||
use crate::BlockId;
|
||||
|
||||
pub const RAW_TX_1: &str = "0200000000010116d6174da7183d70d0a7d4dc314d517a7d135db79ad63515028b293a76f4f9d10000000000feffffff023a21fc8350060000160014531c405e1881ef192294b8813631e258bf98ea7a1027000000000000225120a60869f0dbcf1dc659c9cecbaf8050135ea9e8cdc487053f1dc6880949dc684c024730440220591b1a172a122da49ba79a3e79f98aaa03fd7a372f9760da18890b6a327e6010022013e82319231da6c99abf8123d7c07e13cf9bd8d76e113e18dc452e5024db156d012102318a2d558b2936c52e320decd6d92a88d7f530be91b6fe0af5caf41661e77da3ef2e0100";
|
||||
pub const RAW_TX_2: &str = "02000000000101a688607020cfae91a61e7c516b5ef1264d5d77f17200c3866826c6c808ebf1620000000000feffffff021027000000000000225120a60869f0dbcf1dc659c9cecbaf8050135ea9e8cdc487053f1dc6880949dc684c20fd48ff530600001600146886c525e41d4522042bd0b159dfbade2504a6bb024730440220740ff7e665cd20565d4296b549df8d26b941be3f1e3af89a0b60e50c0dbeb69a02206213ab7030cf6edc6c90d4ccf33010644261e029950a688dc0b1a9ebe6ddcc5a012102f2ac6b396a97853cb6cd62242c8ae4842024742074475023532a51e9c53194253e760100";
|
||||
pub const RAW_TX_3: &str = "0200000000010135d67ee47b557e68b8c6223958f597381965ed719f1207ee2b9e20432a24a5dc0100000000feffffff021027000000000000225120a82f29944d65b86ae6b5e5cc75e294ead6c59391a1edc5e016e3498c67fc7bbb62215a5055060000160014070df7671dea67a50c4799a744b5c9be8f4bac690247304402207ebf8d29f71fd03e7e6977b3ea78ca5fcc5c49a42ae822348fc401862fdd766c02201d7e4ff0684ecb008b6142f36ead1b0b4d615524c4f58c261113d361f4427e25012103e6a75e2fab85e5ecad641afc4ffba7222f998649d9f18cac92f0fcc8618883b3ee760100";
|
||||
pub const RAW_TX_4: &str = "02000000000101d00e8f76ed313e19b339ee293c0f52b0325c95e24c8f3966fa353fb2bedbcf580100000000feffffff021027000000000000225120882d74e5d0572d5a816cef0041a96b6c1de832f6f9676d9605c44d5e9a97d3dc9cda55fe53060000160014852b5864b8edd42fab4060c87f818e50780865ff0247304402201dccbb9bed7fba924b6d249c5837cc9b37470c0e3d8fbea77cb59baba3efe6fa0220700cc170916913b9bfc2bc0fefb6af776e8b542c561702f136cddc1c7aa43141012103acec3fc79dbbca745815c2a807dc4e81010c80e308e84913f59cb42a275dad97f3760100";
|
||||
|
||||
pub fn tx_from_hex(s: &str) -> Transaction {
|
||||
let raw = Vec::from_hex(s).expect("data must be in hex");
|
||||
consensus::deserialize(raw.as_slice()).expect("must deserialize")
|
||||
}
|
||||
|
||||
pub fn new_hash<H: Hash>(s: &str) -> H {
|
||||
<H as bitcoin::hashes::Hash>::hash(s.as_bytes())
|
||||
}
|
||||
|
||||
pub fn new_block_id(height: u32, hash: &str) -> BlockId {
|
||||
BlockId {
|
||||
height,
|
||||
hash: new_hash(hash),
|
||||
}
|
||||
}
|
||||
@@ -1,245 +0,0 @@
|
||||
//! Contains the [`IndexedTxGraph`] structure and associated types.
|
||||
//!
|
||||
//! This is essentially a [`TxGraph`] combined with an indexer.
|
||||
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{OutPoint, Transaction, TxOut};
|
||||
|
||||
use crate::{
|
||||
keychain::DerivationAdditions,
|
||||
tx_graph::{Additions, TxGraph},
|
||||
Anchor, Append,
|
||||
};
|
||||
|
||||
/// A struct that combines [`TxGraph`] and an [`Indexer`] implementation.
|
||||
///
|
||||
/// This structure ensures that [`TxGraph`] and [`Indexer`] are updated atomically.
|
||||
#[derive(Debug)]
|
||||
pub struct IndexedTxGraph<A, I> {
|
||||
/// Transaction index.
|
||||
pub index: I,
|
||||
graph: TxGraph<A>,
|
||||
}
|
||||
|
||||
impl<A, I: Default> Default for IndexedTxGraph<A, I> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
graph: Default::default(),
|
||||
index: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, I> IndexedTxGraph<A, I> {
|
||||
/// Construct a new [`IndexedTxGraph`] with a given `index`.
|
||||
pub fn new(index: I) -> Self {
|
||||
Self {
|
||||
index,
|
||||
graph: TxGraph::default(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Get a reference of the internal transaction graph.
|
||||
pub fn graph(&self) -> &TxGraph<A> {
|
||||
&self.graph
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I> {
|
||||
/// Applies the [`IndexedAdditions`] to the [`IndexedTxGraph`].
|
||||
pub fn apply_additions(&mut self, additions: IndexedAdditions<A, I::Additions>) {
|
||||
let IndexedAdditions {
|
||||
graph_additions,
|
||||
index_additions,
|
||||
} = additions;
|
||||
|
||||
self.index.apply_additions(index_additions);
|
||||
|
||||
for tx in &graph_additions.txs {
|
||||
self.index.index_tx(tx);
|
||||
}
|
||||
for (&outpoint, txout) in &graph_additions.txouts {
|
||||
self.index.index_txout(outpoint, txout);
|
||||
}
|
||||
|
||||
self.graph.apply_additions(graph_additions);
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||
where
|
||||
I::Additions: Default + Append,
|
||||
{
|
||||
/// Apply an `update` directly.
|
||||
///
|
||||
/// `update` is a [`TxGraph<A>`] and the resultant changes is returned as [`IndexedAdditions`].
|
||||
pub fn apply_update(&mut self, update: TxGraph<A>) -> IndexedAdditions<A, I::Additions> {
|
||||
let graph_additions = self.graph.apply_update(update);
|
||||
|
||||
let mut index_additions = I::Additions::default();
|
||||
for added_tx in &graph_additions.txs {
|
||||
index_additions.append(self.index.index_tx(added_tx));
|
||||
}
|
||||
for (&added_outpoint, added_txout) in &graph_additions.txouts {
|
||||
index_additions.append(self.index.index_txout(added_outpoint, added_txout));
|
||||
}
|
||||
|
||||
IndexedAdditions {
|
||||
graph_additions,
|
||||
index_additions,
|
||||
}
|
||||
}
|
||||
|
||||
/// Insert a floating `txout` of given `outpoint`.
|
||||
pub fn insert_txout(
|
||||
&mut self,
|
||||
outpoint: OutPoint,
|
||||
txout: &TxOut,
|
||||
) -> IndexedAdditions<A, I::Additions> {
|
||||
let mut update = TxGraph::<A>::default();
|
||||
let _ = update.insert_txout(outpoint, txout.clone());
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Insert and index a transaction into the graph.
|
||||
///
|
||||
/// `anchors` can be provided to anchor the transaction to various blocks. `seen_at` is a
|
||||
/// unix timestamp of when the transaction is last seen.
|
||||
pub fn insert_tx(
|
||||
&mut self,
|
||||
tx: &Transaction,
|
||||
anchors: impl IntoIterator<Item = A>,
|
||||
seen_at: Option<u64>,
|
||||
) -> IndexedAdditions<A, I::Additions> {
|
||||
let txid = tx.txid();
|
||||
|
||||
let mut update = TxGraph::<A>::default();
|
||||
if self.graph.get_tx(txid).is_none() {
|
||||
let _ = update.insert_tx(tx.clone());
|
||||
}
|
||||
for anchor in anchors.into_iter() {
|
||||
let _ = update.insert_anchor(txid, anchor);
|
||||
}
|
||||
if let Some(seen_at) = seen_at {
|
||||
let _ = update.insert_seen_at(txid, seen_at);
|
||||
}
|
||||
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Insert relevant transactions from the given `txs` iterator.
|
||||
///
|
||||
/// Relevancy is determined by the [`Indexer::is_tx_relevant`] implementation of `I`. Irrelevant
|
||||
/// transactions in `txs` will be ignored. `txs` do not need to be in topological order.
|
||||
///
|
||||
/// `anchors` can be provided to anchor the transactions to blocks. `seen_at` is a unix
|
||||
/// timestamp of when the transactions are last seen.
|
||||
pub fn insert_relevant_txs<'t>(
|
||||
&mut self,
|
||||
txs: impl IntoIterator<Item = (&'t Transaction, impl IntoIterator<Item = A>)>,
|
||||
seen_at: Option<u64>,
|
||||
) -> IndexedAdditions<A, I::Additions> {
|
||||
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||
// This is achieved by:
|
||||
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||
// not store anything about them.
|
||||
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||
// returns true or not. (in a second loop).
|
||||
let mut additions = IndexedAdditions::<A, I::Additions>::default();
|
||||
let mut transactions = Vec::new();
|
||||
for (tx, anchors) in txs.into_iter() {
|
||||
additions.index_additions.append(self.index.index_tx(tx));
|
||||
transactions.push((tx, anchors));
|
||||
}
|
||||
additions.append(
|
||||
transactions
|
||||
.into_iter()
|
||||
.filter_map(|(tx, anchors)| match self.index.is_tx_relevant(tx) {
|
||||
true => Some(self.insert_tx(tx, anchors, seen_at)),
|
||||
false => None,
|
||||
})
|
||||
.fold(Default::default(), |mut acc, other| {
|
||||
acc.append(other);
|
||||
acc
|
||||
}),
|
||||
);
|
||||
additions
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that represents changes to an [`IndexedTxGraph`].
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(
|
||||
crate = "serde_crate",
|
||||
bound(
|
||||
deserialize = "A: Ord + serde::Deserialize<'de>, IA: serde::Deserialize<'de>",
|
||||
serialize = "A: Ord + serde::Serialize, IA: serde::Serialize"
|
||||
)
|
||||
)
|
||||
)]
|
||||
#[must_use]
|
||||
pub struct IndexedAdditions<A, IA> {
|
||||
/// [`TxGraph`] additions.
|
||||
pub graph_additions: Additions<A>,
|
||||
/// [`Indexer`] additions.
|
||||
pub index_additions: IA,
|
||||
}
|
||||
|
||||
impl<A, IA: Default> Default for IndexedAdditions<A, IA> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
graph_additions: Default::default(),
|
||||
index_additions: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor, IA: Append> Append for IndexedAdditions<A, IA> {
|
||||
fn append(&mut self, other: Self) {
|
||||
self.graph_additions.append(other.graph_additions);
|
||||
self.index_additions.append(other.index_additions);
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
self.graph_additions.is_empty() && self.index_additions.is_empty()
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, IA: Default> From<Additions<A>> for IndexedAdditions<A, IA> {
|
||||
fn from(graph_additions: Additions<A>) -> Self {
|
||||
Self {
|
||||
graph_additions,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, K> From<DerivationAdditions<K>> for IndexedAdditions<A, DerivationAdditions<K>> {
|
||||
fn from(index_additions: DerivationAdditions<K>) -> Self {
|
||||
Self {
|
||||
graph_additions: Default::default(),
|
||||
index_additions,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Represents a structure that can index transaction data.
|
||||
pub trait Indexer {
|
||||
/// The resultant "additions" when new transaction data is indexed.
|
||||
type Additions;
|
||||
|
||||
/// Scan and index the given `outpoint` and `txout`.
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::Additions;
|
||||
|
||||
/// Scan and index the given transaction.
|
||||
fn index_tx(&mut self, tx: &Transaction) -> Self::Additions;
|
||||
|
||||
/// Apply additions to itself.
|
||||
fn apply_additions(&mut self, additions: Self::Additions);
|
||||
|
||||
/// Determines whether the transaction should be included in the index.
|
||||
fn is_tx_relevant(&self, tx: &Transaction) -> bool;
|
||||
}
|
||||
@@ -1,266 +0,0 @@
|
||||
//! Module for keychain related structures.
|
||||
//!
|
||||
//! A keychain here is a set of application-defined indexes for a miniscript descriptor where we can
|
||||
//! derive script pubkeys at a particular derivation index. The application's index is simply
|
||||
//! anything that implements `Ord`.
|
||||
//!
|
||||
//! [`KeychainTxOutIndex`] indexes script pubkeys of keychains and scans in relevant outpoints (that
|
||||
//! has a `txout` containing an indexed script pubkey). Internally, this uses [`SpkTxOutIndex`], but
|
||||
//! also maintains "revealed" and "lookahead" index counts per keychain.
|
||||
//!
|
||||
//! [`SpkTxOutIndex`]: crate::SpkTxOutIndex
|
||||
|
||||
use crate::{
|
||||
collections::BTreeMap,
|
||||
indexed_tx_graph::IndexedAdditions,
|
||||
local_chain::{self, LocalChain},
|
||||
tx_graph::TxGraph,
|
||||
Anchor, Append,
|
||||
};
|
||||
|
||||
#[cfg(feature = "miniscript")]
|
||||
mod txout_index;
|
||||
#[cfg(feature = "miniscript")]
|
||||
pub use txout_index::*;
|
||||
|
||||
/// Represents updates to the derivation index of a [`KeychainTxOutIndex`].
|
||||
///
|
||||
/// It can be applied to [`KeychainTxOutIndex`] with [`apply_additions`]. [`DerivationAdditions] are
|
||||
/// monotone in that they will never decrease the revealed derivation index.
|
||||
///
|
||||
/// [`KeychainTxOutIndex`]: crate::keychain::KeychainTxOutIndex
|
||||
/// [`apply_additions`]: crate::keychain::KeychainTxOutIndex::apply_additions
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(
|
||||
crate = "serde_crate",
|
||||
bound(
|
||||
deserialize = "K: Ord + serde::Deserialize<'de>",
|
||||
serialize = "K: Ord + serde::Serialize"
|
||||
)
|
||||
)
|
||||
)]
|
||||
#[must_use]
|
||||
pub struct DerivationAdditions<K>(pub BTreeMap<K, u32>);
|
||||
|
||||
impl<K> DerivationAdditions<K> {
|
||||
/// Returns whether the additions are empty.
|
||||
pub fn is_empty(&self) -> bool {
|
||||
self.0.is_empty()
|
||||
}
|
||||
|
||||
/// Get the inner map of the keychain to its new derivation index.
|
||||
pub fn as_inner(&self) -> &BTreeMap<K, u32> {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Ord> Append for DerivationAdditions<K> {
|
||||
/// Append another [`DerivationAdditions`] into self.
|
||||
///
|
||||
/// If the keychain already exists, increase the index when the other's index > self's index.
|
||||
/// If the keychain did not exist, append the new keychain.
|
||||
fn append(&mut self, mut other: Self) {
|
||||
self.0.iter_mut().for_each(|(key, index)| {
|
||||
if let Some(other_index) = other.0.remove(key) {
|
||||
*index = other_index.max(*index);
|
||||
}
|
||||
});
|
||||
|
||||
self.0.append(&mut other.0);
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
self.0.is_empty()
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> Default for DerivationAdditions<K> {
|
||||
fn default() -> Self {
|
||||
Self(Default::default())
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> AsRef<BTreeMap<K, u32>> for DerivationAdditions<K> {
|
||||
fn as_ref(&self) -> &BTreeMap<K, u32> {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure to update [`KeychainTxOutIndex`], [`TxGraph`] and [`LocalChain`]
|
||||
/// atomically.
|
||||
#[derive(Debug, Clone, PartialEq)]
|
||||
pub struct LocalUpdate<K, A> {
|
||||
/// Last active derivation index per keychain (`K`).
|
||||
pub keychain: BTreeMap<K, u32>,
|
||||
/// Update for the [`TxGraph`].
|
||||
pub graph: TxGraph<A>,
|
||||
/// Update for the [`LocalChain`].
|
||||
pub chain: LocalChain,
|
||||
}
|
||||
|
||||
impl<K, A> Default for LocalUpdate<K, A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
keychain: Default::default(),
|
||||
graph: Default::default(),
|
||||
chain: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that records the corresponding changes as result of applying an [`LocalUpdate`].
|
||||
#[derive(Debug, Clone, PartialEq)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(
|
||||
crate = "serde_crate",
|
||||
bound(
|
||||
deserialize = "K: Ord + serde::Deserialize<'de>, A: Ord + serde::Deserialize<'de>",
|
||||
serialize = "K: Ord + serde::Serialize, A: Ord + serde::Serialize",
|
||||
)
|
||||
)
|
||||
)]
|
||||
pub struct LocalChangeSet<K, A> {
|
||||
/// Changes to the [`LocalChain`].
|
||||
pub chain_changeset: local_chain::ChangeSet,
|
||||
|
||||
/// Additions to [`IndexedTxGraph`].
|
||||
///
|
||||
/// [`IndexedTxGraph`]: crate::indexed_tx_graph::IndexedTxGraph
|
||||
pub indexed_additions: IndexedAdditions<A, DerivationAdditions<K>>,
|
||||
}
|
||||
|
||||
impl<K, A> Default for LocalChangeSet<K, A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
chain_changeset: Default::default(),
|
||||
indexed_additions: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Ord, A: Anchor> Append for LocalChangeSet<K, A> {
|
||||
fn append(&mut self, other: Self) {
|
||||
Append::append(&mut self.chain_changeset, other.chain_changeset);
|
||||
Append::append(&mut self.indexed_additions, other.indexed_additions);
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
self.chain_changeset.is_empty() && self.indexed_additions.is_empty()
|
||||
}
|
||||
}
|
||||
|
||||
impl<K, A> From<local_chain::ChangeSet> for LocalChangeSet<K, A> {
|
||||
fn from(chain_changeset: local_chain::ChangeSet) -> Self {
|
||||
Self {
|
||||
chain_changeset,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<K, A> From<IndexedAdditions<A, DerivationAdditions<K>>> for LocalChangeSet<K, A> {
|
||||
fn from(indexed_additions: IndexedAdditions<A, DerivationAdditions<K>>) -> Self {
|
||||
Self {
|
||||
indexed_additions,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Balance, differentiated into various categories.
|
||||
#[derive(Debug, PartialEq, Eq, Clone, Default)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate",)
|
||||
)]
|
||||
pub struct Balance {
|
||||
/// All coinbase outputs not yet matured
|
||||
pub immature: u64,
|
||||
/// Unconfirmed UTXOs generated by a wallet tx
|
||||
pub trusted_pending: u64,
|
||||
/// Unconfirmed UTXOs received from an external wallet
|
||||
pub untrusted_pending: u64,
|
||||
/// Confirmed and immediately spendable balance
|
||||
pub confirmed: u64,
|
||||
}
|
||||
|
||||
impl Balance {
|
||||
/// Get sum of trusted_pending and confirmed coins.
|
||||
///
|
||||
/// This is the balance you can spend right now that shouldn't get cancelled via another party
|
||||
/// double spending it.
|
||||
pub fn trusted_spendable(&self) -> u64 {
|
||||
self.confirmed + self.trusted_pending
|
||||
}
|
||||
|
||||
/// Get the whole balance visible to the wallet.
|
||||
pub fn total(&self) -> u64 {
|
||||
self.confirmed + self.trusted_pending + self.untrusted_pending + self.immature
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for Balance {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"{{ immature: {}, trusted_pending: {}, untrusted_pending: {}, confirmed: {} }}",
|
||||
self.immature, self.trusted_pending, self.untrusted_pending, self.confirmed
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
impl core::ops::Add for Balance {
|
||||
type Output = Self;
|
||||
|
||||
fn add(self, other: Self) -> Self {
|
||||
Self {
|
||||
immature: self.immature + other.immature,
|
||||
trusted_pending: self.trusted_pending + other.trusted_pending,
|
||||
untrusted_pending: self.untrusted_pending + other.untrusted_pending,
|
||||
confirmed: self.confirmed + other.confirmed,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use super::*;
|
||||
|
||||
#[test]
|
||||
fn append_keychain_derivation_indices() {
|
||||
#[derive(Ord, PartialOrd, Eq, PartialEq, Clone, Debug)]
|
||||
enum Keychain {
|
||||
One,
|
||||
Two,
|
||||
Three,
|
||||
Four,
|
||||
}
|
||||
let mut lhs_di = BTreeMap::<Keychain, u32>::default();
|
||||
let mut rhs_di = BTreeMap::<Keychain, u32>::default();
|
||||
lhs_di.insert(Keychain::One, 7);
|
||||
lhs_di.insert(Keychain::Two, 0);
|
||||
rhs_di.insert(Keychain::One, 3);
|
||||
rhs_di.insert(Keychain::Two, 5);
|
||||
lhs_di.insert(Keychain::Three, 3);
|
||||
rhs_di.insert(Keychain::Four, 4);
|
||||
|
||||
let mut lhs = DerivationAdditions(lhs_di);
|
||||
let rhs = DerivationAdditions(rhs_di);
|
||||
lhs.append(rhs);
|
||||
|
||||
// Exiting index doesn't update if the new index in `other` is lower than `self`.
|
||||
assert_eq!(lhs.0.get(&Keychain::One), Some(&7));
|
||||
// Existing index updates if the new index in `other` is higher than `self`.
|
||||
assert_eq!(lhs.0.get(&Keychain::Two), Some(&5));
|
||||
// Existing index is unchanged if keychain doesn't exist in `other`.
|
||||
assert_eq!(lhs.0.get(&Keychain::Three), Some(&3));
|
||||
// New keychain gets added if the keychain is in `other` but not in `self`.
|
||||
assert_eq!(lhs.0.get(&Keychain::Four), Some(&4));
|
||||
}
|
||||
}
|
||||
@@ -1,588 +0,0 @@
|
||||
use crate::{
|
||||
collections::*,
|
||||
indexed_tx_graph::Indexer,
|
||||
miniscript::{Descriptor, DescriptorPublicKey},
|
||||
spk_iter::BIP32_MAX_INDEX,
|
||||
ForEachTxOut, SpkIterator, SpkTxOutIndex,
|
||||
};
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{OutPoint, Script, TxOut};
|
||||
use core::{fmt::Debug, ops::Deref};
|
||||
|
||||
use crate::Append;
|
||||
|
||||
use super::DerivationAdditions;
|
||||
|
||||
/// A convenient wrapper around [`SpkTxOutIndex`] that relates script pubkeys to miniscript public
|
||||
/// [`Descriptor`]s.
|
||||
///
|
||||
/// Descriptors are referenced by the provided keychain generic (`K`).
|
||||
///
|
||||
/// Script pubkeys for a descriptor are revealed chronologically from index 0. I.e., If the last
|
||||
/// revealed index of a descriptor is 5; scripts of indices 0 to 4 are guaranteed to be already
|
||||
/// revealed. In addition to revealed scripts, we have a `lookahead` parameter for each keychain,
|
||||
/// which defines the number of script pubkeys to store ahead of the last revealed index.
|
||||
///
|
||||
/// Methods that could update the last revealed index will return [`DerivationAdditions`] to report
|
||||
/// these changes. This can be persisted for future recovery.
|
||||
///
|
||||
/// ## Synopsis
|
||||
///
|
||||
/// ```
|
||||
/// use bdk_chain::keychain::KeychainTxOutIndex;
|
||||
/// # use bdk_chain::{ miniscript::{Descriptor, DescriptorPublicKey} };
|
||||
/// # use core::str::FromStr;
|
||||
///
|
||||
/// // imagine our service has internal and external addresses but also addresses for users
|
||||
/// #[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||
/// enum MyKeychain {
|
||||
/// External,
|
||||
/// Internal,
|
||||
/// MyAppUser {
|
||||
/// user_id: u32
|
||||
/// }
|
||||
/// }
|
||||
///
|
||||
/// let mut txout_index = KeychainTxOutIndex::<MyKeychain>::default();
|
||||
///
|
||||
/// # let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
||||
/// # let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||
/// # let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||
/// # let descriptor_for_user_42 = external_descriptor.clone();
|
||||
/// txout_index.add_keychain(MyKeychain::External, external_descriptor);
|
||||
/// txout_index.add_keychain(MyKeychain::Internal, internal_descriptor);
|
||||
/// txout_index.add_keychain(MyKeychain::MyAppUser { user_id: 42 }, descriptor_for_user_42);
|
||||
///
|
||||
/// let new_spk_for_user = txout_index.reveal_next_spk(&MyKeychain::MyAppUser{ user_id: 42 });
|
||||
/// ```
|
||||
///
|
||||
/// [`Ord`]: core::cmp::Ord
|
||||
/// [`SpkTxOutIndex`]: crate::spk_txout_index::SpkTxOutIndex
|
||||
/// [`Descriptor`]: crate::miniscript::Descriptor
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct KeychainTxOutIndex<K> {
|
||||
inner: SpkTxOutIndex<(K, u32)>,
|
||||
// descriptors of each keychain
|
||||
keychains: BTreeMap<K, Descriptor<DescriptorPublicKey>>,
|
||||
// last revealed indexes
|
||||
last_revealed: BTreeMap<K, u32>,
|
||||
// lookahead settings for each keychain
|
||||
lookahead: BTreeMap<K, u32>,
|
||||
}
|
||||
|
||||
impl<K> Default for KeychainTxOutIndex<K> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
inner: SpkTxOutIndex::default(),
|
||||
keychains: BTreeMap::default(),
|
||||
last_revealed: BTreeMap::default(),
|
||||
lookahead: BTreeMap::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> Deref for KeychainTxOutIndex<K> {
|
||||
type Target = SpkTxOutIndex<(K, u32)>;
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
&self.inner
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Clone + Ord + Debug> Indexer for KeychainTxOutIndex<K> {
|
||||
type Additions = DerivationAdditions<K>;
|
||||
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::Additions {
|
||||
self.scan_txout(outpoint, txout)
|
||||
}
|
||||
|
||||
fn index_tx(&mut self, tx: &bitcoin::Transaction) -> Self::Additions {
|
||||
self.scan(tx)
|
||||
}
|
||||
|
||||
fn apply_additions(&mut self, additions: Self::Additions) {
|
||||
self.apply_additions(additions)
|
||||
}
|
||||
|
||||
fn is_tx_relevant(&self, tx: &bitcoin::Transaction) -> bool {
|
||||
self.is_relevant(tx)
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// Scans an object for relevant outpoints, which are stored and indexed internally.
|
||||
///
|
||||
/// If the matched script pubkey is part of the lookahead, the last stored index is updated for
|
||||
/// the script pubkey's keychain and the [`DerivationAdditions`] returned will reflect the
|
||||
/// change.
|
||||
///
|
||||
/// Typically, this method is used in two situations:
|
||||
///
|
||||
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
||||
/// your txouts.
|
||||
/// 2. When getting new data from the chain, you usually scan it before incorporating it into
|
||||
/// your chain state (i.e., `SparseChain`, `ChainGraph`).
|
||||
///
|
||||
/// See [`ForEachTxout`] for the types that support this.
|
||||
///
|
||||
/// [`ForEachTxout`]: crate::ForEachTxOut
|
||||
pub fn scan(&mut self, txouts: &impl ForEachTxOut) -> DerivationAdditions<K> {
|
||||
let mut additions = DerivationAdditions::<K>::default();
|
||||
txouts.for_each_txout(|(op, txout)| additions.append(self.scan_txout(op, txout)));
|
||||
additions
|
||||
}
|
||||
|
||||
/// Scan a single outpoint for a matching script pubkey.
|
||||
///
|
||||
/// If it matches, this will store and index it.
|
||||
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> DerivationAdditions<K> {
|
||||
match self.inner.scan_txout(op, txout).cloned() {
|
||||
Some((keychain, index)) => self.reveal_to_target(&keychain, index).1,
|
||||
None => DerivationAdditions::default(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Return a reference to the internal [`SpkTxOutIndex`].
|
||||
pub fn inner(&self) -> &SpkTxOutIndex<(K, u32)> {
|
||||
&self.inner
|
||||
}
|
||||
|
||||
/// Get a reference to the set of indexed outpoints.
|
||||
pub fn outpoints(&self) -> &BTreeSet<((K, u32), OutPoint)> {
|
||||
self.inner.outpoints()
|
||||
}
|
||||
|
||||
/// Return a reference to the internal map of the keychain to descriptors.
|
||||
pub fn keychains(&self) -> &BTreeMap<K, Descriptor<DescriptorPublicKey>> {
|
||||
&self.keychains
|
||||
}
|
||||
|
||||
/// Add a keychain to the tracker's `txout_index` with a descriptor to derive addresses.
|
||||
///
|
||||
/// Adding a keychain means you will be able to derive new script pubkeys under that keychain
|
||||
/// and the txout index will discover transaction outputs with those script pubkeys.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// This will panic if a different `descriptor` is introduced to the same `keychain`.
|
||||
pub fn add_keychain(&mut self, keychain: K, descriptor: Descriptor<DescriptorPublicKey>) {
|
||||
let old_descriptor = &*self
|
||||
.keychains
|
||||
.entry(keychain)
|
||||
.or_insert_with(|| descriptor.clone());
|
||||
assert_eq!(
|
||||
&descriptor, old_descriptor,
|
||||
"keychain already contains a different descriptor"
|
||||
);
|
||||
}
|
||||
|
||||
/// Return the lookahead setting for each keychain.
|
||||
///
|
||||
/// Refer to [`set_lookahead`] for a deeper explanation of the `lookahead`.
|
||||
///
|
||||
/// [`set_lookahead`]: Self::set_lookahead
|
||||
pub fn lookaheads(&self) -> &BTreeMap<K, u32> {
|
||||
&self.lookahead
|
||||
}
|
||||
|
||||
/// Convenience method to call [`set_lookahead`] for all keychains.
|
||||
///
|
||||
/// [`set_lookahead`]: Self::set_lookahead
|
||||
pub fn set_lookahead_for_all(&mut self, lookahead: u32) {
|
||||
for keychain in &self.keychains.keys().cloned().collect::<Vec<_>>() {
|
||||
self.lookahead.insert(keychain.clone(), lookahead);
|
||||
self.replenish_lookahead(keychain);
|
||||
}
|
||||
}
|
||||
|
||||
/// Set the lookahead count for `keychain`.
|
||||
///
|
||||
/// The lookahead is the number of scripts to cache ahead of the last stored script index. This
|
||||
/// is useful during a scan via [`scan`] or [`scan_txout`].
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// This will panic if the `keychain` does not exist.
|
||||
///
|
||||
/// [`scan`]: Self::scan
|
||||
/// [`scan_txout`]: Self::scan_txout
|
||||
pub fn set_lookahead(&mut self, keychain: &K, lookahead: u32) {
|
||||
self.lookahead.insert(keychain.clone(), lookahead);
|
||||
self.replenish_lookahead(keychain);
|
||||
}
|
||||
|
||||
/// Convenience method to call [`lookahead_to_target`] for multiple keychains.
|
||||
///
|
||||
/// [`lookahead_to_target`]: Self::lookahead_to_target
|
||||
pub fn lookahead_to_target_multi(&mut self, target_indexes: BTreeMap<K, u32>) {
|
||||
for (keychain, target_index) in target_indexes {
|
||||
self.lookahead_to_target(&keychain, target_index)
|
||||
}
|
||||
}
|
||||
|
||||
/// Store lookahead scripts until `target_index`.
|
||||
///
|
||||
/// This does not change the `lookahead` setting.
|
||||
pub fn lookahead_to_target(&mut self, keychain: &K, target_index: u32) {
|
||||
let next_index = self.next_store_index(keychain);
|
||||
if let Some(temp_lookahead) = target_index.checked_sub(next_index).filter(|&v| v > 0) {
|
||||
let old_lookahead = self.lookahead.insert(keychain.clone(), temp_lookahead);
|
||||
self.replenish_lookahead(keychain);
|
||||
|
||||
// revert
|
||||
match old_lookahead {
|
||||
Some(lookahead) => self.lookahead.insert(keychain.clone(), lookahead),
|
||||
None => self.lookahead.remove(keychain),
|
||||
};
|
||||
}
|
||||
}
|
||||
|
||||
fn replenish_lookahead(&mut self, keychain: &K) {
|
||||
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||
let next_store_index = self.next_store_index(keychain);
|
||||
let next_reveal_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
||||
let lookahead = self.lookahead.get(keychain).map_or(0, |v| *v);
|
||||
|
||||
for (new_index, new_spk) in
|
||||
SpkIterator::new_with_range(descriptor, next_store_index..next_reveal_index + lookahead)
|
||||
{
|
||||
let _inserted = self
|
||||
.inner
|
||||
.insert_spk((keychain.clone(), new_index), new_spk);
|
||||
debug_assert!(_inserted, "replenish lookahead: must not have existing spk: keychain={:?}, lookahead={}, next_store_index={}, next_reveal_index={}", keychain, lookahead, next_store_index, next_reveal_index);
|
||||
}
|
||||
}
|
||||
|
||||
fn next_store_index(&self, keychain: &K) -> u32 {
|
||||
self.inner()
|
||||
.all_spks()
|
||||
.range((keychain.clone(), u32::MIN)..(keychain.clone(), u32::MAX))
|
||||
.last()
|
||||
.map_or(0, |((_, v), _)| *v + 1)
|
||||
}
|
||||
|
||||
/// Generates script pubkey iterators for every `keychain`. The iterators iterate over all
|
||||
/// derivable script pubkeys.
|
||||
pub fn spks_of_all_keychains(
|
||||
&self,
|
||||
) -> BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>> {
|
||||
self.keychains
|
||||
.iter()
|
||||
.map(|(keychain, descriptor)| {
|
||||
(
|
||||
keychain.clone(),
|
||||
SpkIterator::new_with_range(descriptor.clone(), 0..),
|
||||
)
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
/// Generates a script pubkey iterator for the given `keychain`'s descriptor (if it exists). The
|
||||
/// iterator iterates over all derivable scripts of the keychain's descriptor.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// This will panic if the `keychain` does not exist.
|
||||
pub fn spks_of_keychain(&self, keychain: &K) -> SpkIterator<Descriptor<DescriptorPublicKey>> {
|
||||
let descriptor = self
|
||||
.keychains
|
||||
.get(keychain)
|
||||
.expect("keychain must exist")
|
||||
.clone();
|
||||
SpkIterator::new_with_range(descriptor, 0..)
|
||||
}
|
||||
|
||||
/// Convenience method to get [`revealed_spks_of_keychain`] of all keychains.
|
||||
///
|
||||
/// [`revealed_spks_of_keychain`]: Self::revealed_spks_of_keychain
|
||||
pub fn revealed_spks_of_all_keychains(
|
||||
&self,
|
||||
) -> BTreeMap<K, impl Iterator<Item = (u32, &Script)> + Clone> {
|
||||
self.keychains
|
||||
.keys()
|
||||
.map(|keychain| (keychain.clone(), self.revealed_spks_of_keychain(keychain)))
|
||||
.collect()
|
||||
}
|
||||
|
||||
/// Iterates over the script pubkeys revealed by this index under `keychain`.
|
||||
pub fn revealed_spks_of_keychain(
|
||||
&self,
|
||||
keychain: &K,
|
||||
) -> impl DoubleEndedIterator<Item = (u32, &Script)> + Clone {
|
||||
let next_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
||||
self.inner
|
||||
.all_spks()
|
||||
.range((keychain.clone(), u32::MIN)..(keychain.clone(), next_index))
|
||||
.map(|((_, derivation_index), spk)| (*derivation_index, spk))
|
||||
}
|
||||
|
||||
/// Get the next derivation index for `keychain`. The next index is the index after the last revealed
|
||||
/// derivation index.
|
||||
///
|
||||
/// The second field in the returned tuple represents whether the next derivation index is new.
|
||||
/// There are two scenarios where the next derivation index is reused (not new):
|
||||
///
|
||||
/// 1. The keychain's descriptor has no wildcard, and a script has already been revealed.
|
||||
/// 2. The number of revealed scripts has already reached 2^31 (refer to BIP-32).
|
||||
///
|
||||
/// Not checking the second field of the tuple may result in address reuse.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// Panics if the `keychain` does not exist.
|
||||
pub fn next_index(&self, keychain: &K) -> (u32, bool) {
|
||||
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||
let last_index = self.last_revealed.get(keychain).cloned();
|
||||
|
||||
// we can only get the next index if the wildcard exists.
|
||||
let has_wildcard = descriptor.has_wildcard();
|
||||
|
||||
match last_index {
|
||||
// if there is no index, next_index is always 0.
|
||||
None => (0, true),
|
||||
// descriptors without wildcards can only have one index.
|
||||
Some(_) if !has_wildcard => (0, false),
|
||||
// derivation index must be < 2^31 (BIP-32).
|
||||
Some(index) if index > BIP32_MAX_INDEX => {
|
||||
unreachable!("index is out of bounds")
|
||||
}
|
||||
Some(index) if index == BIP32_MAX_INDEX => (index, false),
|
||||
// get the next derivation index.
|
||||
Some(index) => (index + 1, true),
|
||||
}
|
||||
}
|
||||
|
||||
/// Get the last derivation index that is revealed for each keychain.
|
||||
///
|
||||
/// Keychains with no revealed indices will not be included in the returned [`BTreeMap`].
|
||||
pub fn last_revealed_indices(&self) -> &BTreeMap<K, u32> {
|
||||
&self.last_revealed
|
||||
}
|
||||
|
||||
/// Get the last derivation index revealed for `keychain`.
|
||||
pub fn last_revealed_index(&self, keychain: &K) -> Option<u32> {
|
||||
self.last_revealed.get(keychain).cloned()
|
||||
}
|
||||
|
||||
/// Convenience method to call [`Self::reveal_to_target`] on multiple keychains.
|
||||
pub fn reveal_to_target_multi(
|
||||
&mut self,
|
||||
keychains: &BTreeMap<K, u32>,
|
||||
) -> (
|
||||
BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>>,
|
||||
DerivationAdditions<K>,
|
||||
) {
|
||||
let mut additions = DerivationAdditions::default();
|
||||
let mut spks = BTreeMap::new();
|
||||
|
||||
for (keychain, &index) in keychains {
|
||||
let (new_spks, new_additions) = self.reveal_to_target(keychain, index);
|
||||
if !new_additions.is_empty() {
|
||||
spks.insert(keychain.clone(), new_spks);
|
||||
additions.append(new_additions.clone());
|
||||
}
|
||||
}
|
||||
|
||||
(spks, additions)
|
||||
}
|
||||
|
||||
/// Reveals script pubkeys of the `keychain`'s descriptor **up to and including** the
|
||||
/// `target_index`.
|
||||
///
|
||||
/// If the `target_index` cannot be reached (due to the descriptor having no wildcard and/or
|
||||
/// the `target_index` is in the hardened index range), this method will make a best-effort and
|
||||
/// reveal up to the last possible index.
|
||||
///
|
||||
/// This returns an iterator of newly revealed indices (alongside their scripts) and a
|
||||
/// [`DerivationAdditions`], which reports updates to the latest revealed index. If no new script
|
||||
/// pubkeys are revealed, then both of these will be empty.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// Panics if `keychain` does not exist.
|
||||
pub fn reveal_to_target(
|
||||
&mut self,
|
||||
keychain: &K,
|
||||
target_index: u32,
|
||||
) -> (
|
||||
SpkIterator<Descriptor<DescriptorPublicKey>>,
|
||||
DerivationAdditions<K>,
|
||||
) {
|
||||
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||
let has_wildcard = descriptor.has_wildcard();
|
||||
|
||||
let target_index = if has_wildcard { target_index } else { 0 };
|
||||
let next_reveal_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
||||
let lookahead = self.lookahead.get(keychain).map_or(0, |v| *v);
|
||||
|
||||
debug_assert_eq!(
|
||||
next_reveal_index + lookahead,
|
||||
self.next_store_index(keychain)
|
||||
);
|
||||
|
||||
// if we need to reveal new indices, the latest revealed index goes here
|
||||
let mut reveal_to_index = None;
|
||||
|
||||
// if the target is not yet revealed, but is already stored (due to lookahead), we need to
|
||||
// set the `reveal_to_index` as target here (as the `for` loop below only updates
|
||||
// `reveal_to_index` for indexes that are NOT stored)
|
||||
if next_reveal_index <= target_index && target_index < next_reveal_index + lookahead {
|
||||
reveal_to_index = Some(target_index);
|
||||
}
|
||||
|
||||
// we range over indexes that are not stored
|
||||
let range = next_reveal_index + lookahead..=target_index + lookahead;
|
||||
for (new_index, new_spk) in SpkIterator::new_with_range(descriptor, range) {
|
||||
let _inserted = self
|
||||
.inner
|
||||
.insert_spk((keychain.clone(), new_index), new_spk);
|
||||
debug_assert!(_inserted, "must not have existing spk",);
|
||||
|
||||
// everything after `target_index` is stored for lookahead only
|
||||
if new_index <= target_index {
|
||||
reveal_to_index = Some(new_index);
|
||||
}
|
||||
}
|
||||
|
||||
match reveal_to_index {
|
||||
Some(index) => {
|
||||
let _old_index = self.last_revealed.insert(keychain.clone(), index);
|
||||
debug_assert!(_old_index < Some(index));
|
||||
(
|
||||
SpkIterator::new_with_range(descriptor.clone(), next_reveal_index..index + 1),
|
||||
DerivationAdditions(core::iter::once((keychain.clone(), index)).collect()),
|
||||
)
|
||||
}
|
||||
None => (
|
||||
SpkIterator::new_with_range(
|
||||
descriptor.clone(),
|
||||
next_reveal_index..next_reveal_index,
|
||||
),
|
||||
DerivationAdditions::default(),
|
||||
),
|
||||
}
|
||||
}
|
||||
|
||||
/// Attempts to reveal the next script pubkey for `keychain`.
|
||||
///
|
||||
/// Returns the derivation index of the revealed script pubkey, the revealed script pubkey and a
|
||||
/// [`DerivationAdditions`] which represents changes in the last revealed index (if any).
|
||||
///
|
||||
/// When a new script cannot be revealed, we return the last revealed script and an empty
|
||||
/// [`DerivationAdditions`]. There are two scenarios when a new script pubkey cannot be derived:
|
||||
///
|
||||
/// 1. The descriptor has no wildcard and already has one script revealed.
|
||||
/// 2. The descriptor has already revealed scripts up to the numeric bound.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// Panics if the `keychain` does not exist.
|
||||
pub fn reveal_next_spk(&mut self, keychain: &K) -> ((u32, &Script), DerivationAdditions<K>) {
|
||||
let (next_index, _) = self.next_index(keychain);
|
||||
let additions = self.reveal_to_target(keychain, next_index).1;
|
||||
let script = self
|
||||
.inner
|
||||
.spk_at_index(&(keychain.clone(), next_index))
|
||||
.expect("script must already be stored");
|
||||
((next_index, script), additions)
|
||||
}
|
||||
|
||||
/// Gets the next unused script pubkey in the keychain. I.e., the script pubkey with the lowest
|
||||
/// index that has not been used yet.
|
||||
///
|
||||
/// This will derive and reveal a new script pubkey if no more unused script pubkeys exist.
|
||||
///
|
||||
/// If the descriptor has no wildcard and already has a used script pubkey or if a descriptor
|
||||
/// has used all scripts up to the derivation bounds, then the last derived script pubkey will be
|
||||
/// returned.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// Panics if `keychain` has never been added to the index
|
||||
pub fn next_unused_spk(&mut self, keychain: &K) -> ((u32, &Script), DerivationAdditions<K>) {
|
||||
let need_new = self.unused_spks_of_keychain(keychain).next().is_none();
|
||||
// this rather strange branch is needed because of some lifetime issues
|
||||
if need_new {
|
||||
self.reveal_next_spk(keychain)
|
||||
} else {
|
||||
(
|
||||
self.unused_spks_of_keychain(keychain)
|
||||
.next()
|
||||
.expect("we already know next exists"),
|
||||
DerivationAdditions::default(),
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
/// Marks the script pubkey at `index` as used even though the tracker hasn't seen an output with it.
|
||||
/// This only has an effect when the `index` had been added to `self` already and was unused.
|
||||
///
|
||||
/// Returns whether the `index` was initially present as `unused`.
|
||||
///
|
||||
/// This is useful when you want to reserve a script pubkey for something but don't want to add
|
||||
/// the transaction output using it to the index yet. Other callers will consider `index` on
|
||||
/// `keychain` used until you call [`unmark_used`].
|
||||
///
|
||||
/// [`unmark_used`]: Self::unmark_used
|
||||
pub fn mark_used(&mut self, keychain: &K, index: u32) -> bool {
|
||||
self.inner.mark_used(&(keychain.clone(), index))
|
||||
}
|
||||
|
||||
/// Undoes the effect of [`mark_used`]. Returns whether the `index` is inserted back into
|
||||
/// `unused`.
|
||||
///
|
||||
/// Note that if `self` has scanned an output with this script pubkey, then this will have no
|
||||
/// effect.
|
||||
///
|
||||
/// [`mark_used`]: Self::mark_used
|
||||
pub fn unmark_used(&mut self, keychain: &K, index: u32) -> bool {
|
||||
self.inner.unmark_used(&(keychain.clone(), index))
|
||||
}
|
||||
|
||||
/// Iterates over all unused script pubkeys for a `keychain` stored in the index.
|
||||
pub fn unused_spks_of_keychain(
|
||||
&self,
|
||||
keychain: &K,
|
||||
) -> impl DoubleEndedIterator<Item = (u32, &Script)> {
|
||||
let next_index = self.last_revealed.get(keychain).map_or(0, |&v| v + 1);
|
||||
let range = (keychain.clone(), u32::MIN)..(keychain.clone(), next_index);
|
||||
self.inner
|
||||
.unused_spks(range)
|
||||
.map(|((_, i), script)| (*i, script))
|
||||
}
|
||||
|
||||
/// Iterates over all the [`OutPoint`] that have a `TxOut` with a script pubkey derived from
|
||||
/// `keychain`.
|
||||
pub fn txouts_of_keychain(
|
||||
&self,
|
||||
keychain: &K,
|
||||
) -> impl DoubleEndedIterator<Item = (u32, OutPoint)> + '_ {
|
||||
self.inner
|
||||
.outputs_in_range((keychain.clone(), u32::MIN)..(keychain.clone(), u32::MAX))
|
||||
.map(|((_, i), op)| (*i, op))
|
||||
}
|
||||
|
||||
/// Returns the highest derivation index of the `keychain` where [`KeychainTxOutIndex`] has
|
||||
/// found a [`TxOut`] with it's script pubkey.
|
||||
pub fn last_used_index(&self, keychain: &K) -> Option<u32> {
|
||||
self.txouts_of_keychain(keychain).last().map(|(i, _)| i)
|
||||
}
|
||||
|
||||
/// Returns the highest derivation index of each keychain that [`KeychainTxOutIndex`] has found
|
||||
/// a [`TxOut`] with it's script pubkey.
|
||||
pub fn last_used_indices(&self) -> BTreeMap<K, u32> {
|
||||
self.keychains
|
||||
.iter()
|
||||
.filter_map(|(keychain, _)| {
|
||||
self.last_used_index(keychain)
|
||||
.map(|index| (keychain.clone(), index))
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
/// Applies the derivation additions to the [`KeychainTxOutIndex`], extending the number of
|
||||
/// derived scripts per keychain, as specified in the `additions`.
|
||||
pub fn apply_additions(&mut self, additions: DerivationAdditions<K>) {
|
||||
let _ = self.reveal_to_target_multi(&additions.0);
|
||||
}
|
||||
}
|
||||
@@ -1,102 +0,0 @@
|
||||
//! This crate is a collection of core structures for [Bitcoin Dev Kit] (alpha release).
|
||||
//!
|
||||
//! The goal of this crate is to give wallets the mechanisms needed to:
|
||||
//!
|
||||
//! 1. Figure out what data they need to fetch.
|
||||
//! 2. Process the data in a way that never leads to inconsistent states.
|
||||
//! 3. Fully index that data and expose it to be consumed without friction.
|
||||
//!
|
||||
//! Our design goals for these mechanisms are:
|
||||
//!
|
||||
//! 1. Data source agnostic -- nothing in `bdk_chain` cares about where you get data from or whether
|
||||
//! you do it synchronously or asynchronously. If you know a fact about the blockchain, you can just
|
||||
//! tell `bdk_chain`'s APIs about it, and that information will be integrated, if it can be done
|
||||
//! consistently.
|
||||
//! 2. Error-free APIs.
|
||||
//! 3. Data persistence agnostic -- `bdk_chain` does not care where you cache on-chain data, what you
|
||||
//! cache or how you fetch it.
|
||||
//!
|
||||
//! [Bitcoin Dev Kit]: https://bitcoindevkit.org/
|
||||
|
||||
#![no_std]
|
||||
#![warn(missing_docs)]
|
||||
|
||||
pub use bitcoin;
|
||||
mod spk_txout_index;
|
||||
pub use spk_txout_index::*;
|
||||
mod chain_data;
|
||||
pub use chain_data::*;
|
||||
pub mod indexed_tx_graph;
|
||||
pub use indexed_tx_graph::IndexedTxGraph;
|
||||
pub mod keychain;
|
||||
pub mod local_chain;
|
||||
mod tx_data_traits;
|
||||
pub mod tx_graph;
|
||||
pub use tx_data_traits::*;
|
||||
pub use tx_graph::TxGraph;
|
||||
mod chain_oracle;
|
||||
pub use chain_oracle::*;
|
||||
mod persist;
|
||||
pub use persist::*;
|
||||
|
||||
#[doc(hidden)]
|
||||
pub mod example_utils;
|
||||
|
||||
#[cfg(feature = "miniscript")]
|
||||
pub use miniscript;
|
||||
#[cfg(feature = "miniscript")]
|
||||
mod descriptor_ext;
|
||||
#[cfg(feature = "miniscript")]
|
||||
pub use descriptor_ext::DescriptorExt;
|
||||
#[cfg(feature = "miniscript")]
|
||||
mod spk_iter;
|
||||
#[cfg(feature = "miniscript")]
|
||||
pub use spk_iter::*;
|
||||
|
||||
#[allow(unused_imports)]
|
||||
#[macro_use]
|
||||
extern crate alloc;
|
||||
|
||||
#[cfg(feature = "serde")]
|
||||
pub extern crate serde_crate as serde;
|
||||
|
||||
#[cfg(feature = "bincode")]
|
||||
extern crate bincode;
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
#[macro_use]
|
||||
extern crate std;
|
||||
|
||||
#[cfg(all(not(feature = "std"), feature = "hashbrown"))]
|
||||
extern crate hashbrown;
|
||||
|
||||
// When no-std use `alloc`'s Hash collections. This is activated by default
|
||||
#[cfg(all(not(feature = "std"), not(feature = "hashbrown")))]
|
||||
#[doc(hidden)]
|
||||
pub mod collections {
|
||||
#![allow(dead_code)]
|
||||
pub type HashSet<K> = alloc::collections::BTreeSet<K>;
|
||||
pub type HashMap<K, V> = alloc::collections::BTreeMap<K, V>;
|
||||
pub use alloc::collections::{btree_map as hash_map, *};
|
||||
}
|
||||
|
||||
// When we have std, use `std`'s all collections
|
||||
#[cfg(all(feature = "std", not(feature = "hashbrown")))]
|
||||
#[doc(hidden)]
|
||||
pub mod collections {
|
||||
pub use std::collections::{hash_map, *};
|
||||
}
|
||||
|
||||
// With this special feature `hashbrown`, use `hashbrown`'s hash collections, and else from `alloc`.
|
||||
#[cfg(feature = "hashbrown")]
|
||||
#[doc(hidden)]
|
||||
pub mod collections {
|
||||
#![allow(dead_code)]
|
||||
pub type HashSet<K> = hashbrown::HashSet<K>;
|
||||
pub type HashMap<K, V> = hashbrown::HashMap<K, V>;
|
||||
pub use alloc::collections::*;
|
||||
pub use hashbrown::hash_map;
|
||||
}
|
||||
|
||||
/// How many confirmations are needed f or a coinbase output to be spent.
|
||||
pub const COINBASE_MATURITY: u32 = 100;
|
||||
@@ -1,250 +0,0 @@
|
||||
//! The [`LocalChain`] is a local implementation of [`ChainOracle`].
|
||||
|
||||
use core::convert::Infallible;
|
||||
|
||||
use alloc::collections::BTreeMap;
|
||||
use bitcoin::BlockHash;
|
||||
|
||||
use crate::{BlockId, ChainOracle};
|
||||
|
||||
/// This is a local implementation of [`ChainOracle`].
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct LocalChain {
|
||||
blocks: BTreeMap<u32, BlockHash>,
|
||||
}
|
||||
|
||||
impl ChainOracle for LocalChain {
|
||||
type Error = Infallible;
|
||||
|
||||
fn is_block_in_chain(
|
||||
&self,
|
||||
block: BlockId,
|
||||
static_block: BlockId,
|
||||
) -> Result<Option<bool>, Self::Error> {
|
||||
if block.height > static_block.height {
|
||||
return Ok(None);
|
||||
}
|
||||
Ok(
|
||||
match (
|
||||
self.blocks.get(&block.height),
|
||||
self.blocks.get(&static_block.height),
|
||||
) {
|
||||
(Some(&hash), Some(&static_hash)) => {
|
||||
Some(hash == block.hash && static_hash == static_block.hash)
|
||||
}
|
||||
_ => None,
|
||||
},
|
||||
)
|
||||
}
|
||||
|
||||
fn get_chain_tip(&self) -> Result<Option<BlockId>, Self::Error> {
|
||||
Ok(self.tip())
|
||||
}
|
||||
}
|
||||
|
||||
impl AsRef<BTreeMap<u32, BlockHash>> for LocalChain {
|
||||
fn as_ref(&self) -> &BTreeMap<u32, BlockHash> {
|
||||
&self.blocks
|
||||
}
|
||||
}
|
||||
|
||||
impl From<LocalChain> for BTreeMap<u32, BlockHash> {
|
||||
fn from(value: LocalChain) -> Self {
|
||||
value.blocks
|
||||
}
|
||||
}
|
||||
|
||||
impl From<BTreeMap<u32, BlockHash>> for LocalChain {
|
||||
fn from(value: BTreeMap<u32, BlockHash>) -> Self {
|
||||
Self { blocks: value }
|
||||
}
|
||||
}
|
||||
|
||||
impl LocalChain {
|
||||
/// Contruct a [`LocalChain`] from a list of [`BlockId`]s.
|
||||
pub fn from_blocks<B>(blocks: B) -> Self
|
||||
where
|
||||
B: IntoIterator<Item = BlockId>,
|
||||
{
|
||||
Self {
|
||||
blocks: blocks.into_iter().map(|b| (b.height, b.hash)).collect(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Get a reference to a map of block height to hash.
|
||||
pub fn blocks(&self) -> &BTreeMap<u32, BlockHash> {
|
||||
&self.blocks
|
||||
}
|
||||
|
||||
/// Get the chain tip.
|
||||
pub fn tip(&self) -> Option<BlockId> {
|
||||
self.blocks
|
||||
.iter()
|
||||
.last()
|
||||
.map(|(&height, &hash)| BlockId { height, hash })
|
||||
}
|
||||
|
||||
/// This is like the sparsechain's logic, expect we must guarantee that all invalidated heights
|
||||
/// are to be re-filled.
|
||||
pub fn determine_changeset(&self, update: &Self) -> Result<ChangeSet, UpdateNotConnectedError> {
|
||||
let update = update.as_ref();
|
||||
let update_tip = match update.keys().last().cloned() {
|
||||
Some(tip) => tip,
|
||||
None => return Ok(ChangeSet::default()),
|
||||
};
|
||||
|
||||
// this is the latest height where both the update and local chain has the same block hash
|
||||
let agreement_height = update
|
||||
.iter()
|
||||
.rev()
|
||||
.find(|&(u_height, u_hash)| self.blocks.get(u_height) == Some(u_hash))
|
||||
.map(|(&height, _)| height);
|
||||
|
||||
// the lower bound of the range to invalidate
|
||||
let invalidate_lb = match agreement_height {
|
||||
Some(height) if height == update_tip => u32::MAX,
|
||||
Some(height) => height + 1,
|
||||
None => 0,
|
||||
};
|
||||
|
||||
// the first block's height to invalidate in the local chain
|
||||
let invalidate_from_height = self.blocks.range(invalidate_lb..).next().map(|(&h, _)| h);
|
||||
|
||||
// the first block of height to invalidate (if any) should be represented in the update
|
||||
if let Some(first_invalid_height) = invalidate_from_height {
|
||||
if !update.contains_key(&first_invalid_height) {
|
||||
return Err(UpdateNotConnectedError(first_invalid_height));
|
||||
}
|
||||
}
|
||||
|
||||
let mut changeset: BTreeMap<u32, Option<BlockHash>> = match invalidate_from_height {
|
||||
Some(first_invalid_height) => {
|
||||
// the first block of height to invalidate should be represented in the update
|
||||
if !update.contains_key(&first_invalid_height) {
|
||||
return Err(UpdateNotConnectedError(first_invalid_height));
|
||||
}
|
||||
self.blocks
|
||||
.range(first_invalid_height..)
|
||||
.map(|(height, _)| (*height, None))
|
||||
.collect()
|
||||
}
|
||||
None => BTreeMap::new(),
|
||||
};
|
||||
for (height, update_hash) in update {
|
||||
let original_hash = self.blocks.get(height);
|
||||
if Some(update_hash) != original_hash {
|
||||
changeset.insert(*height, Some(*update_hash));
|
||||
}
|
||||
}
|
||||
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Applies the given `changeset`.
|
||||
pub fn apply_changeset(&mut self, changeset: ChangeSet) {
|
||||
for (height, blockhash) in changeset {
|
||||
match blockhash {
|
||||
Some(blockhash) => self.blocks.insert(height, blockhash),
|
||||
None => self.blocks.remove(&height),
|
||||
};
|
||||
}
|
||||
}
|
||||
|
||||
/// Updates [`LocalChain`] with an update [`LocalChain`].
|
||||
///
|
||||
/// This is equivalent to calling [`determine_changeset`] and [`apply_changeset`] in sequence.
|
||||
///
|
||||
/// [`determine_changeset`]: Self::determine_changeset
|
||||
/// [`apply_changeset`]: Self::apply_changeset
|
||||
pub fn apply_update(&mut self, update: Self) -> Result<ChangeSet, UpdateNotConnectedError> {
|
||||
let changeset = self.determine_changeset(&update)?;
|
||||
self.apply_changeset(changeset.clone());
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Derives a [`ChangeSet`] that assumes that there are no preceding changesets.
|
||||
///
|
||||
/// The changeset returned will record additions of all blocks included in [`Self`].
|
||||
pub fn initial_changeset(&self) -> ChangeSet {
|
||||
self.blocks
|
||||
.iter()
|
||||
.map(|(&height, &hash)| (height, Some(hash)))
|
||||
.collect()
|
||||
}
|
||||
|
||||
/// Insert a block of [`BlockId`] into the [`LocalChain`].
|
||||
///
|
||||
/// # Error
|
||||
///
|
||||
/// If the insertion height already contains a block, and the block has a different blockhash,
|
||||
/// this will result in an [`InsertBlockNotMatchingError`].
|
||||
pub fn insert_block(
|
||||
&mut self,
|
||||
block_id: BlockId,
|
||||
) -> Result<ChangeSet, InsertBlockNotMatchingError> {
|
||||
let mut update = Self::from_blocks(self.tip());
|
||||
|
||||
if let Some(original_hash) = update.blocks.insert(block_id.height, block_id.hash) {
|
||||
if original_hash != block_id.hash {
|
||||
return Err(InsertBlockNotMatchingError {
|
||||
height: block_id.height,
|
||||
original_hash,
|
||||
update_hash: block_id.hash,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
Ok(self.apply_update(update).expect("should always connect"))
|
||||
}
|
||||
}
|
||||
|
||||
/// This is the return value of [`determine_changeset`] and represents changes to [`LocalChain`].
|
||||
///
|
||||
/// [`determine_changeset`]: LocalChain::determine_changeset
|
||||
pub type ChangeSet = BTreeMap<u32, Option<BlockHash>>;
|
||||
|
||||
/// Represents an update failure of [`LocalChain`] due to the update not connecting to the original
|
||||
/// chain.
|
||||
///
|
||||
/// The update cannot be applied to the chain because the chain suffix it represents did not
|
||||
/// connect to the existing chain. This error case contains the checkpoint height to include so
|
||||
/// that the chains can connect.
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct UpdateNotConnectedError(pub u32);
|
||||
|
||||
impl core::fmt::Display for UpdateNotConnectedError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"the update cannot connect with the chain, try include block at height {}",
|
||||
self.0
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for UpdateNotConnectedError {}
|
||||
|
||||
/// Represents a failure when trying to insert a checkpoint into [`LocalChain`].
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct InsertBlockNotMatchingError {
|
||||
/// The checkpoints' height.
|
||||
pub height: u32,
|
||||
/// Original checkpoint's block hash.
|
||||
pub original_hash: BlockHash,
|
||||
/// Update checkpoint's block hash.
|
||||
pub update_hash: BlockHash,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for InsertBlockNotMatchingError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"failed to insert block at height {} as blockhashes conflict: original={}, update={}",
|
||||
self.height, self.original_hash, self.update_hash
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for InsertBlockNotMatchingError {}
|
||||
@@ -1,97 +0,0 @@
|
||||
use core::convert::Infallible;
|
||||
|
||||
use crate::Append;
|
||||
|
||||
/// `Persist` wraps a [`PersistBackend`] (`B`) to create a convenient staging area for changes (`C`)
|
||||
/// before they are persisted.
|
||||
///
|
||||
/// Not all changes to the in-memory representation needs to be written to disk right away, so
|
||||
/// [`Persist::stage`] can be used to *stage* changes first and then [`Persist::commit`] can be used
|
||||
/// to write changes to disk.
|
||||
#[derive(Debug)]
|
||||
pub struct Persist<B, C> {
|
||||
backend: B,
|
||||
stage: C,
|
||||
}
|
||||
|
||||
impl<B, C> Persist<B, C>
|
||||
where
|
||||
B: PersistBackend<C>,
|
||||
C: Default + Append,
|
||||
{
|
||||
/// Create a new [`Persist`] from [`PersistBackend`].
|
||||
pub fn new(backend: B) -> Self {
|
||||
Self {
|
||||
backend,
|
||||
stage: Default::default(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Stage a `changeset` to be commited later with [`commit`].
|
||||
///
|
||||
/// [`commit`]: Self::commit
|
||||
pub fn stage(&mut self, changeset: C) {
|
||||
self.stage.append(changeset)
|
||||
}
|
||||
|
||||
/// Get the changes that have not been commited yet.
|
||||
pub fn staged(&self) -> &C {
|
||||
&self.stage
|
||||
}
|
||||
|
||||
/// Commit the staged changes to the underlying persistance backend.
|
||||
///
|
||||
/// Changes that are committed (if any) are returned.
|
||||
///
|
||||
/// # Error
|
||||
///
|
||||
/// Returns a backend-defined error if this fails.
|
||||
pub fn commit(&mut self) -> Result<Option<C>, B::WriteError> {
|
||||
if self.stage.is_empty() {
|
||||
return Ok(None);
|
||||
}
|
||||
self.backend
|
||||
.write_changes(&self.stage)
|
||||
// if written successfully, take and return `self.stage`
|
||||
.map(|_| Some(core::mem::take(&mut self.stage)))
|
||||
}
|
||||
}
|
||||
|
||||
/// A persistence backend for [`Persist`].
|
||||
///
|
||||
/// `C` represents the changeset; a datatype that records changes made to in-memory data structures
|
||||
/// that are to be persisted, or retrieved from persistence.
|
||||
pub trait PersistBackend<C> {
|
||||
/// The error the backend returns when it fails to write.
|
||||
type WriteError: core::fmt::Debug;
|
||||
|
||||
/// The error the backend returns when it fails to load changesets `C`.
|
||||
type LoadError: core::fmt::Debug;
|
||||
|
||||
/// Writes a changeset to the persistence backend.
|
||||
///
|
||||
/// It is up to the backend what it does with this. It could store every changeset in a list or
|
||||
/// it inserts the actual changes into a more structured database. All it needs to guarantee is
|
||||
/// that [`load_from_persistence`] restores a keychain tracker to what it should be if all
|
||||
/// changesets had been applied sequentially.
|
||||
///
|
||||
/// [`load_from_persistence`]: Self::load_from_persistence
|
||||
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError>;
|
||||
|
||||
/// Return the aggregate changeset `C` from persistence.
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError>;
|
||||
}
|
||||
|
||||
impl<C: Default> PersistBackend<C> for () {
|
||||
type WriteError = Infallible;
|
||||
|
||||
type LoadError = Infallible;
|
||||
|
||||
fn write_changes(&mut self, _changeset: &C) -> Result<(), Self::WriteError> {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError> {
|
||||
Ok(C::default())
|
||||
}
|
||||
}
|
||||
@@ -1,215 +0,0 @@
|
||||
use crate::{
|
||||
bitcoin::{secp256k1::Secp256k1, Script},
|
||||
miniscript::{Descriptor, DescriptorPublicKey},
|
||||
};
|
||||
use core::{borrow::Borrow, ops::Bound, ops::RangeBounds};
|
||||
|
||||
/// Maximum [BIP32](https://bips.xyz/32) derivation index.
|
||||
pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
||||
|
||||
/// An iterator for derived script pubkeys.
|
||||
///
|
||||
/// [`SpkIterator`] is an implementation of the [`Iterator`] trait which possesses its own `next()`
|
||||
/// and `nth()` functions, both of which circumvent the unnecessary intermediate derivations required
|
||||
/// when using their default implementations.
|
||||
///
|
||||
/// ## Examples
|
||||
///
|
||||
/// ```
|
||||
/// use bdk_chain::SpkIterator;
|
||||
/// # use miniscript::{Descriptor, DescriptorPublicKey};
|
||||
/// # use bitcoin::{secp256k1::Secp256k1};
|
||||
/// # use std::str::FromStr;
|
||||
/// # let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||
/// # let (descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||
/// # let external_spk_0 = descriptor.at_derivation_index(0).script_pubkey();
|
||||
/// # let external_spk_3 = descriptor.at_derivation_index(3).script_pubkey();
|
||||
/// # let external_spk_4 = descriptor.at_derivation_index(4).script_pubkey();
|
||||
///
|
||||
/// // Creates a new script pubkey iterator starting at 0 from a descriptor.
|
||||
/// let mut spk_iter = SpkIterator::new(&descriptor);
|
||||
/// assert_eq!(spk_iter.next(), Some((0, external_spk_0)));
|
||||
/// assert_eq!(spk_iter.next(), None);
|
||||
/// ```
|
||||
#[derive(Clone)]
|
||||
pub struct SpkIterator<D> {
|
||||
next_index: u32,
|
||||
end: u32,
|
||||
descriptor: D,
|
||||
secp: Secp256k1<bitcoin::secp256k1::VerifyOnly>,
|
||||
}
|
||||
|
||||
impl<D> SpkIterator<D>
|
||||
where
|
||||
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||
{
|
||||
/// Creates a new script pubkey iterator starting at 0 from a descriptor.
|
||||
pub fn new(descriptor: D) -> Self {
|
||||
let end = if descriptor.borrow().has_wildcard() {
|
||||
BIP32_MAX_INDEX
|
||||
} else {
|
||||
0
|
||||
};
|
||||
|
||||
SpkIterator::new_with_range(descriptor, 0..=end)
|
||||
}
|
||||
|
||||
// Creates a new script pubkey iterator from a descriptor with a given range.
|
||||
pub(crate) fn new_with_range<R>(descriptor: D, range: R) -> Self
|
||||
where
|
||||
R: RangeBounds<u32>,
|
||||
{
|
||||
let mut end = match range.end_bound() {
|
||||
Bound::Included(end) => *end + 1,
|
||||
Bound::Excluded(end) => *end,
|
||||
Bound::Unbounded => u32::MAX,
|
||||
};
|
||||
// Because `end` is exclusive, we want the maximum value to be BIP32_MAX_INDEX + 1.
|
||||
end = end.min(BIP32_MAX_INDEX + 1);
|
||||
|
||||
Self {
|
||||
next_index: match range.start_bound() {
|
||||
Bound::Included(start) => *start,
|
||||
Bound::Excluded(start) => *start + 1,
|
||||
Bound::Unbounded => u32::MIN,
|
||||
},
|
||||
end,
|
||||
descriptor,
|
||||
secp: Secp256k1::verification_only(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<D> Iterator for SpkIterator<D>
|
||||
where
|
||||
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||
{
|
||||
type Item = (u32, Script);
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
// For non-wildcard descriptors, we expect the first element to be Some((0, spk)), then None after.
|
||||
// For wildcard descriptors, we expect it to keep iterating until exhausted.
|
||||
if self.next_index >= self.end {
|
||||
return None;
|
||||
}
|
||||
|
||||
let script = self
|
||||
.descriptor
|
||||
.borrow()
|
||||
.at_derivation_index(self.next_index)
|
||||
.derived_descriptor(&self.secp)
|
||||
.expect("the descriptor cannot need hardened derivation")
|
||||
.script_pubkey();
|
||||
let output = (self.next_index, script);
|
||||
|
||||
self.next_index += 1;
|
||||
|
||||
Some(output)
|
||||
}
|
||||
|
||||
fn nth(&mut self, n: usize) -> Option<Self::Item> {
|
||||
self.next_index = self
|
||||
.next_index
|
||||
.saturating_add(u32::try_from(n).unwrap_or(u32::MAX));
|
||||
self.next()
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use crate::{
|
||||
bitcoin::secp256k1::Secp256k1,
|
||||
keychain::KeychainTxOutIndex,
|
||||
miniscript::{Descriptor, DescriptorPublicKey},
|
||||
spk_iter::{SpkIterator, BIP32_MAX_INDEX},
|
||||
};
|
||||
|
||||
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||
enum TestKeychain {
|
||||
External,
|
||||
Internal,
|
||||
}
|
||||
|
||||
fn init_txout_index() -> (
|
||||
KeychainTxOutIndex<TestKeychain>,
|
||||
Descriptor<DescriptorPublicKey>,
|
||||
Descriptor<DescriptorPublicKey>,
|
||||
) {
|
||||
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::default();
|
||||
|
||||
let secp = Secp256k1::signing_only();
|
||||
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||
let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||
|
||||
txout_index.add_keychain(TestKeychain::External, external_descriptor.clone());
|
||||
txout_index.add_keychain(TestKeychain::Internal, internal_descriptor.clone());
|
||||
|
||||
(txout_index, external_descriptor, internal_descriptor)
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[allow(clippy::iter_nth_zero)]
|
||||
fn test_spkiterator_wildcard() {
|
||||
let (_, external_desc, _) = init_txout_index();
|
||||
let external_spk_0 = external_desc.at_derivation_index(0).script_pubkey();
|
||||
let external_spk_16 = external_desc.at_derivation_index(16).script_pubkey();
|
||||
let external_spk_20 = external_desc.at_derivation_index(20).script_pubkey();
|
||||
let external_spk_21 = external_desc.at_derivation_index(21).script_pubkey();
|
||||
let external_spk_max = external_desc
|
||||
.at_derivation_index(BIP32_MAX_INDEX)
|
||||
.script_pubkey();
|
||||
|
||||
let mut external_spk = SpkIterator::new(&external_desc);
|
||||
let max_index = BIP32_MAX_INDEX - 22;
|
||||
|
||||
assert_eq!(external_spk.next().unwrap(), (0, external_spk_0));
|
||||
assert_eq!(external_spk.nth(15).unwrap(), (16, external_spk_16));
|
||||
assert_eq!(external_spk.nth(3).unwrap(), (20, external_spk_20.clone()));
|
||||
assert_eq!(external_spk.next().unwrap(), (21, external_spk_21));
|
||||
assert_eq!(
|
||||
external_spk.nth(max_index as usize).unwrap(),
|
||||
(BIP32_MAX_INDEX, external_spk_max)
|
||||
);
|
||||
assert_eq!(external_spk.nth(0), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||
assert_eq!(external_spk.nth(20).unwrap(), (20, external_spk_20));
|
||||
assert_eq!(external_spk.next(), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||
assert_eq!(external_spk.nth(21), None);
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[allow(clippy::iter_nth_zero)]
|
||||
fn test_spkiterator_non_wildcard() {
|
||||
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||
let external_spk_0 = no_wildcard_descriptor
|
||||
.at_derivation_index(0)
|
||||
.script_pubkey();
|
||||
|
||||
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||
|
||||
assert_eq!(external_spk.next().unwrap(), (0, external_spk_0.clone()));
|
||||
assert_eq!(external_spk.next(), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||
|
||||
assert_eq!(external_spk.nth(0).unwrap(), (0, external_spk_0));
|
||||
assert_eq!(external_spk.nth(0), None);
|
||||
}
|
||||
|
||||
// The following dummy traits were created to test if SpkIterator is working properly.
|
||||
trait TestSendStatic: Send + 'static {
|
||||
fn test(&self) -> u32 {
|
||||
20
|
||||
}
|
||||
}
|
||||
|
||||
impl TestSendStatic for SpkIterator<Descriptor<DescriptorPublicKey>> {
|
||||
fn test(&self) -> u32 {
|
||||
20
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,337 +0,0 @@
|
||||
use core::ops::RangeBounds;
|
||||
|
||||
use crate::{
|
||||
collections::{hash_map::Entry, BTreeMap, BTreeSet, HashMap},
|
||||
indexed_tx_graph::Indexer,
|
||||
ForEachTxOut,
|
||||
};
|
||||
use bitcoin::{self, OutPoint, Script, Transaction, TxOut, Txid};
|
||||
|
||||
/// An index storing [`TxOut`]s that have a script pubkey that matches those in a list.
|
||||
///
|
||||
/// The basic idea is that you insert script pubkeys you care about into the index with
|
||||
/// [`insert_spk`] and then when you call [`scan`], the index will look at any txouts you pass in and
|
||||
/// store and index any txouts matching one of its script pubkeys.
|
||||
///
|
||||
/// Each script pubkey is associated with an application-defined index script index `I`, which must be
|
||||
/// [`Ord`]. Usually, this is used to associate the derivation index of the script pubkey or even a
|
||||
/// combination of `(keychain, derivation_index)`.
|
||||
///
|
||||
/// Note there is no harm in scanning transactions that disappear from the blockchain or were never
|
||||
/// in there in the first place. `SpkTxOutIndex` is intentionally *monotone* -- you cannot delete or
|
||||
/// modify txouts that have been indexed. To find out which txouts from the index are actually in the
|
||||
/// chain or unspent, you must use other sources of information like a [`TxGraph`].
|
||||
///
|
||||
/// [`TxOut`]: bitcoin::TxOut
|
||||
/// [`insert_spk`]: Self::insert_spk
|
||||
/// [`Ord`]: core::cmp::Ord
|
||||
/// [`scan`]: Self::scan
|
||||
/// [`TxGraph`]: crate::tx_graph::TxGraph
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct SpkTxOutIndex<I> {
|
||||
/// script pubkeys ordered by index
|
||||
spks: BTreeMap<I, Script>,
|
||||
/// A reverse lookup from spk to spk index
|
||||
spk_indices: HashMap<Script, I>,
|
||||
/// The set of unused indexes.
|
||||
unused: BTreeSet<I>,
|
||||
/// Lookup index and txout by outpoint.
|
||||
txouts: BTreeMap<OutPoint, (I, TxOut)>,
|
||||
/// Lookup from spk index to outpoints that had that spk
|
||||
spk_txouts: BTreeSet<(I, OutPoint)>,
|
||||
}
|
||||
|
||||
impl<I> Default for SpkTxOutIndex<I> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
txouts: Default::default(),
|
||||
spks: Default::default(),
|
||||
spk_indices: Default::default(),
|
||||
spk_txouts: Default::default(),
|
||||
unused: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<I: Clone + Ord> Indexer for SpkTxOutIndex<I> {
|
||||
type Additions = ();
|
||||
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::Additions {
|
||||
self.scan_txout(outpoint, txout);
|
||||
Default::default()
|
||||
}
|
||||
|
||||
fn index_tx(&mut self, tx: &Transaction) -> Self::Additions {
|
||||
self.scan(tx);
|
||||
Default::default()
|
||||
}
|
||||
|
||||
fn apply_additions(&mut self, _additions: Self::Additions) {
|
||||
// This applies nothing.
|
||||
}
|
||||
|
||||
fn is_tx_relevant(&self, tx: &Transaction) -> bool {
|
||||
self.is_relevant(tx)
|
||||
}
|
||||
}
|
||||
|
||||
/// This macro is used instead of a member function of `SpkTxOutIndex`, which would result in a
|
||||
/// compiler error[E0521]: "borrowed data escapes out of closure" when we attempt to take a
|
||||
/// reference out of the `ForEachTxOut` closure during scanning.
|
||||
macro_rules! scan_txout {
|
||||
($self:ident, $op:expr, $txout:expr) => {{
|
||||
let spk_i = $self.spk_indices.get(&$txout.script_pubkey);
|
||||
if let Some(spk_i) = spk_i {
|
||||
$self.txouts.insert($op, (spk_i.clone(), $txout.clone()));
|
||||
$self.spk_txouts.insert((spk_i.clone(), $op));
|
||||
$self.unused.remove(&spk_i);
|
||||
}
|
||||
spk_i
|
||||
}};
|
||||
}
|
||||
|
||||
impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||
/// Scans an object containing many txouts.
|
||||
///
|
||||
/// Typically, this is used in two situations:
|
||||
///
|
||||
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
||||
/// your txouts.
|
||||
/// 2. When getting new data from the chain, you usually scan it before incorporating it into your chain state.
|
||||
///
|
||||
/// See [`ForEachTxout`] for the types that support this.
|
||||
///
|
||||
/// [`ForEachTxout`]: crate::ForEachTxOut
|
||||
pub fn scan(&mut self, txouts: &impl ForEachTxOut) -> BTreeSet<I> {
|
||||
let mut scanned_indices = BTreeSet::new();
|
||||
|
||||
txouts.for_each_txout(|(op, txout)| {
|
||||
if let Some(spk_i) = scan_txout!(self, op, txout) {
|
||||
scanned_indices.insert(spk_i.clone());
|
||||
}
|
||||
});
|
||||
|
||||
scanned_indices
|
||||
}
|
||||
|
||||
/// Scan a single `TxOut` for a matching script pubkey and returns the index that matches the
|
||||
/// script pubkey (if any).
|
||||
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> Option<&I> {
|
||||
scan_txout!(self, op, txout)
|
||||
}
|
||||
|
||||
/// Get a reference to the set of indexed outpoints.
|
||||
pub fn outpoints(&self) -> &BTreeSet<(I, OutPoint)> {
|
||||
&self.spk_txouts
|
||||
}
|
||||
|
||||
/// Iterate over all known txouts that spend to tracked script pubkeys.
|
||||
pub fn txouts(
|
||||
&self,
|
||||
) -> impl DoubleEndedIterator<Item = (&I, OutPoint, &TxOut)> + ExactSizeIterator {
|
||||
self.txouts
|
||||
.iter()
|
||||
.map(|(op, (index, txout))| (index, *op, txout))
|
||||
}
|
||||
|
||||
/// Finds all txouts on a transaction that has previously been scanned and indexed.
|
||||
pub fn txouts_in_tx(
|
||||
&self,
|
||||
txid: Txid,
|
||||
) -> impl DoubleEndedIterator<Item = (&I, OutPoint, &TxOut)> {
|
||||
self.txouts
|
||||
.range(OutPoint::new(txid, u32::MIN)..=OutPoint::new(txid, u32::MAX))
|
||||
.map(|(op, (index, txout))| (index, *op, txout))
|
||||
}
|
||||
|
||||
/// Iterates over all the outputs with script pubkeys in an index range.
|
||||
pub fn outputs_in_range(
|
||||
&self,
|
||||
range: impl RangeBounds<I>,
|
||||
) -> impl DoubleEndedIterator<Item = (&I, OutPoint)> {
|
||||
use bitcoin::hashes::Hash;
|
||||
use core::ops::Bound::*;
|
||||
let min_op = OutPoint {
|
||||
txid: Txid::from_inner([0x00; 32]),
|
||||
vout: u32::MIN,
|
||||
};
|
||||
let max_op = OutPoint {
|
||||
txid: Txid::from_inner([0xff; 32]),
|
||||
vout: u32::MAX,
|
||||
};
|
||||
|
||||
let start = match range.start_bound() {
|
||||
Included(index) => Included((index.clone(), min_op)),
|
||||
Excluded(index) => Excluded((index.clone(), max_op)),
|
||||
Unbounded => Unbounded,
|
||||
};
|
||||
|
||||
let end = match range.end_bound() {
|
||||
Included(index) => Included((index.clone(), max_op)),
|
||||
Excluded(index) => Excluded((index.clone(), min_op)),
|
||||
Unbounded => Unbounded,
|
||||
};
|
||||
|
||||
self.spk_txouts.range((start, end)).map(|(i, op)| (i, *op))
|
||||
}
|
||||
|
||||
/// Returns the txout and script pubkey index of the `TxOut` at `OutPoint`.
|
||||
///
|
||||
/// Returns `None` if the `TxOut` hasn't been scanned or if nothing matching was found there.
|
||||
pub fn txout(&self, outpoint: OutPoint) -> Option<(&I, &TxOut)> {
|
||||
self.txouts
|
||||
.get(&outpoint)
|
||||
.map(|(spk_i, txout)| (spk_i, txout))
|
||||
}
|
||||
|
||||
/// Returns the script that has been inserted at the `index`.
|
||||
///
|
||||
/// If that index hasn't been inserted yet, it will return `None`.
|
||||
pub fn spk_at_index(&self, index: &I) -> Option<&Script> {
|
||||
self.spks.get(index)
|
||||
}
|
||||
|
||||
/// The script pubkeys that are being tracked by the index.
|
||||
pub fn all_spks(&self) -> &BTreeMap<I, Script> {
|
||||
&self.spks
|
||||
}
|
||||
|
||||
/// Adds a script pubkey to scan for. Returns `false` and does nothing if spk already exists in the map
|
||||
///
|
||||
/// the index will look for outputs spending to this spk whenever it scans new data.
|
||||
pub fn insert_spk(&mut self, index: I, spk: Script) -> bool {
|
||||
match self.spk_indices.entry(spk.clone()) {
|
||||
Entry::Vacant(value) => {
|
||||
value.insert(index.clone());
|
||||
self.spks.insert(index.clone(), spk);
|
||||
self.unused.insert(index);
|
||||
true
|
||||
}
|
||||
Entry::Occupied(_) => false,
|
||||
}
|
||||
}
|
||||
|
||||
/// Iterates over all unused script pubkeys in an index range.
|
||||
///
|
||||
/// Here, "unused" means that after the script pubkey was stored in the index, the index has
|
||||
/// never scanned a transaction output with it.
|
||||
///
|
||||
/// # Example
|
||||
///
|
||||
/// ```rust
|
||||
/// # use bdk_chain::SpkTxOutIndex;
|
||||
///
|
||||
/// // imagine our spks are indexed like (keychain, derivation_index).
|
||||
/// let txout_index = SpkTxOutIndex::<(u32, u32)>::default();
|
||||
/// let all_unused_spks = txout_index.unused_spks(..);
|
||||
/// let change_index = 1;
|
||||
/// let unused_change_spks =
|
||||
/// txout_index.unused_spks((change_index, u32::MIN)..(change_index, u32::MAX));
|
||||
/// ```
|
||||
pub fn unused_spks<R>(&self, range: R) -> impl DoubleEndedIterator<Item = (&I, &Script)>
|
||||
where
|
||||
R: RangeBounds<I>,
|
||||
{
|
||||
self.unused
|
||||
.range(range)
|
||||
.map(move |index| (index, self.spk_at_index(index).expect("must exist")))
|
||||
}
|
||||
|
||||
/// Returns whether the script pubkey at `index` has been used or not.
|
||||
///
|
||||
/// Here, "unused" means that after the script pubkey was stored in the index, the index has
|
||||
/// never scanned a transaction output with it.
|
||||
pub fn is_used(&self, index: &I) -> bool {
|
||||
self.unused.get(index).is_none()
|
||||
}
|
||||
|
||||
/// Marks the script pubkey at `index` as used even though it hasn't seen an output spending to it.
|
||||
/// This only affects when the `index` had already been added to `self` and was unused.
|
||||
///
|
||||
/// Returns whether the `index` was initially present as `unused`.
|
||||
///
|
||||
/// This is useful when you want to reserve a script pubkey for something but don't want to add
|
||||
/// the transaction output using it to the index yet. Other callers will consider the `index` used
|
||||
/// until you call [`unmark_used`].
|
||||
///
|
||||
/// [`unmark_used`]: Self::unmark_used
|
||||
pub fn mark_used(&mut self, index: &I) -> bool {
|
||||
self.unused.remove(index)
|
||||
}
|
||||
|
||||
/// Undoes the effect of [`mark_used`]. Returns whether the `index` is inserted back into
|
||||
/// `unused`.
|
||||
///
|
||||
/// Note that if `self` has scanned an output with this script pubkey then this will have no
|
||||
/// effect.
|
||||
///
|
||||
/// [`mark_used`]: Self::mark_used
|
||||
pub fn unmark_used(&mut self, index: &I) -> bool {
|
||||
// we cannot set the index as unused when it does not exist
|
||||
if !self.spks.contains_key(index) {
|
||||
return false;
|
||||
}
|
||||
// we cannot set the index as unused when txouts are indexed under it
|
||||
if self.outputs_in_range(index..=index).next().is_some() {
|
||||
return false;
|
||||
}
|
||||
self.unused.insert(index.clone())
|
||||
}
|
||||
|
||||
/// Returns the index associated with the script pubkey.
|
||||
pub fn index_of_spk(&self, script: &Script) -> Option<&I> {
|
||||
self.spk_indices.get(script)
|
||||
}
|
||||
|
||||
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
||||
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
||||
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
||||
/// received just uses the transaction outputs directly, so it will be correct even if it has not
|
||||
/// been scanned.
|
||||
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
||||
let mut sent = 0;
|
||||
let mut received = 0;
|
||||
|
||||
for txin in &tx.input {
|
||||
if let Some((_, txout)) = self.txout(txin.previous_output) {
|
||||
sent += txout.value;
|
||||
}
|
||||
}
|
||||
for txout in &tx.output {
|
||||
if self.index_of_spk(&txout.script_pubkey).is_some() {
|
||||
received += txout.value;
|
||||
}
|
||||
}
|
||||
|
||||
(sent, received)
|
||||
}
|
||||
|
||||
/// Computes the net value that this transaction gives to the script pubkeys in the index and
|
||||
/// *takes* from the transaction outputs in the index. Shorthand for calling
|
||||
/// [`sent_and_received`] and subtracting sent from received.
|
||||
///
|
||||
/// [`sent_and_received`]: Self::sent_and_received
|
||||
pub fn net_value(&self, tx: &Transaction) -> i64 {
|
||||
let (sent, received) = self.sent_and_received(tx);
|
||||
received as i64 - sent as i64
|
||||
}
|
||||
|
||||
/// Whether any of the inputs of this transaction spend a txout tracked or whether any output
|
||||
/// matches one of our script pubkeys.
|
||||
///
|
||||
/// It is easily possible to misuse this method and get false negatives by calling it before you
|
||||
/// have scanned the `TxOut`s the transaction is spending. For example, if you want to filter out
|
||||
/// all the transactions in a block that are irrelevant, you **must first scan all the
|
||||
/// transactions in the block** and only then use this method.
|
||||
pub fn is_relevant(&self, tx: &Transaction) -> bool {
|
||||
let input_matches = tx
|
||||
.input
|
||||
.iter()
|
||||
.any(|input| self.txouts.contains_key(&input.previous_output));
|
||||
let output_matches = tx
|
||||
.output
|
||||
.iter()
|
||||
.any(|output| self.spk_indices.contains_key(&output.script_pubkey));
|
||||
input_matches || output_matches
|
||||
}
|
||||
}
|
||||
@@ -1,120 +0,0 @@
|
||||
use crate::collections::BTreeMap;
|
||||
use crate::collections::BTreeSet;
|
||||
use crate::BlockId;
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{Block, OutPoint, Transaction, TxOut};
|
||||
|
||||
/// Trait to do something with every txout contained in a structure.
|
||||
///
|
||||
/// We would prefer to just work with things that can give us an `Iterator<Item=(OutPoint, &TxOut)>`
|
||||
/// here, but rust's type system makes it extremely hard to do this (without trait objects).
|
||||
pub trait ForEachTxOut {
|
||||
/// The provided closure `f` will be called with each `outpoint/txout` pair.
|
||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut)));
|
||||
}
|
||||
|
||||
impl ForEachTxOut for Block {
|
||||
fn for_each_txout(&self, mut f: impl FnMut((OutPoint, &TxOut))) {
|
||||
for tx in self.txdata.iter() {
|
||||
tx.for_each_txout(&mut f)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl ForEachTxOut for Transaction {
|
||||
fn for_each_txout(&self, mut f: impl FnMut((OutPoint, &TxOut))) {
|
||||
let txid = self.txid();
|
||||
for (i, txout) in self.output.iter().enumerate() {
|
||||
f((
|
||||
OutPoint {
|
||||
txid,
|
||||
vout: i as u32,
|
||||
},
|
||||
txout,
|
||||
))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Trait that "anchors" blockchain data to a specific block of height and hash.
|
||||
///
|
||||
/// I.e. If transaction A is anchored in block B, then if block B is in the best chain, we can
|
||||
/// assume that transaction A is also confirmed in the best chain. This does not necessarily mean
|
||||
/// that transaction A is confirmed in block B. It could also mean transaction A is confirmed in a
|
||||
/// parent block of B.
|
||||
pub trait Anchor: core::fmt::Debug + Clone + Eq + PartialOrd + Ord + core::hash::Hash {
|
||||
/// Returns the [`BlockId`] that the associated blockchain data is "anchored" in.
|
||||
fn anchor_block(&self) -> BlockId;
|
||||
|
||||
/// Get the upper bound of the chain data's confirmation height.
|
||||
///
|
||||
/// The default definition gives a pessimistic answer. This can be overridden by the `Anchor`
|
||||
/// implementation for a more accurate value.
|
||||
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||
self.anchor_block().height
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor> Anchor for &'static A {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
<A as Anchor>::anchor_block(self)
|
||||
}
|
||||
}
|
||||
|
||||
/// Trait that makes an object appendable.
|
||||
pub trait Append {
|
||||
/// Append another object of the same type onto `self`.
|
||||
fn append(&mut self, other: Self);
|
||||
|
||||
/// Returns whether the structure is considered empty.
|
||||
fn is_empty(&self) -> bool;
|
||||
}
|
||||
|
||||
impl Append for () {
|
||||
fn append(&mut self, _other: Self) {}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
true
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Ord, V> Append for BTreeMap<K, V> {
|
||||
fn append(&mut self, mut other: Self) {
|
||||
BTreeMap::append(self, &mut other)
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
BTreeMap::is_empty(self)
|
||||
}
|
||||
}
|
||||
|
||||
impl<T: Ord> Append for BTreeSet<T> {
|
||||
fn append(&mut self, mut other: Self) {
|
||||
BTreeSet::append(self, &mut other)
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
BTreeSet::is_empty(self)
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> Append for Vec<T> {
|
||||
fn append(&mut self, mut other: Self) {
|
||||
Vec::append(self, &mut other)
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
Vec::is_empty(self)
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Append, B: Append> Append for (A, B) {
|
||||
fn append(&mut self, other: Self) {
|
||||
Append::append(&mut self.0, other.0);
|
||||
Append::append(&mut self.1, other.1);
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
Append::is_empty(&self.0) && Append::is_empty(&self.1)
|
||||
}
|
||||
}
|
||||
File diff suppressed because it is too large
Load Diff
@@ -1,68 +0,0 @@
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! h {
|
||||
($index:literal) => {{
|
||||
bitcoin::hashes::Hash::hash($index.as_bytes())
|
||||
}};
|
||||
}
|
||||
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! local_chain {
|
||||
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||
#[allow(unused_mut)]
|
||||
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*])
|
||||
}};
|
||||
}
|
||||
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! chain {
|
||||
($([$($tt:tt)*]),*) => { chain!( checkpoints: [$([$($tt)*]),*] ) };
|
||||
(checkpoints: $($tail:tt)*) => { chain!( index: TxHeight, checkpoints: $($tail)*) };
|
||||
(index: $ind:ty, checkpoints: [ $([$height:expr, $block_hash:expr]),* ] $(,txids: [$(($txid:expr, $tx_height:expr)),*])?) => {{
|
||||
#[allow(unused_mut)]
|
||||
let mut chain = bdk_chain::sparse_chain::SparseChain::<$ind>::from_checkpoints([$(($height, $block_hash).into()),*]);
|
||||
|
||||
$(
|
||||
$(
|
||||
let _ = chain.insert_tx($txid, $tx_height).expect("should succeed");
|
||||
)*
|
||||
)?
|
||||
|
||||
chain
|
||||
}};
|
||||
}
|
||||
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! changeset {
|
||||
(checkpoints: $($tail:tt)*) => { changeset!(index: TxHeight, checkpoints: $($tail)*) };
|
||||
(
|
||||
index: $ind:ty,
|
||||
checkpoints: [ $(( $height:expr, $cp_to:expr )),* ]
|
||||
$(,txids: [ $(( $txid:expr, $tx_to:expr )),* ])?
|
||||
) => {{
|
||||
use bdk_chain::collections::BTreeMap;
|
||||
|
||||
#[allow(unused_mut)]
|
||||
bdk_chain::sparse_chain::ChangeSet::<$ind> {
|
||||
checkpoints: {
|
||||
let mut changes = BTreeMap::default();
|
||||
$(changes.insert($height, $cp_to);)*
|
||||
changes
|
||||
},
|
||||
txids: {
|
||||
let mut changes = BTreeMap::default();
|
||||
$($(changes.insert($txid, $tx_to.map(|h: TxHeight| h.into()));)*)?
|
||||
changes
|
||||
}
|
||||
}
|
||||
}};
|
||||
}
|
||||
|
||||
#[allow(unused)]
|
||||
pub fn new_tx(lt: u32) -> bitcoin::Transaction {
|
||||
bitcoin::Transaction {
|
||||
version: 0x00,
|
||||
lock_time: bitcoin::PackedLockTime(lt),
|
||||
input: vec![],
|
||||
output: vec![],
|
||||
}
|
||||
}
|
||||
@@ -1,467 +0,0 @@
|
||||
#[macro_use]
|
||||
mod common;
|
||||
|
||||
use std::collections::{BTreeMap, BTreeSet};
|
||||
|
||||
use bdk_chain::{
|
||||
indexed_tx_graph::{IndexedAdditions, IndexedTxGraph},
|
||||
keychain::{Balance, DerivationAdditions, KeychainTxOutIndex},
|
||||
local_chain::LocalChain,
|
||||
tx_graph::Additions,
|
||||
BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bitcoin::{secp256k1::Secp256k1, BlockHash, OutPoint, Script, Transaction, TxIn, TxOut};
|
||||
use miniscript::Descriptor;
|
||||
|
||||
/// Ensure [`IndexedTxGraph::insert_relevant_txs`] can successfully index transactions NOT presented
|
||||
/// in topological order.
|
||||
///
|
||||
/// Given 3 transactions (A, B, C), where A has 2 owned outputs. B and C spends an output each of A.
|
||||
/// Typically, we would only know whether B and C are relevant if we have indexed A (A's outpoints
|
||||
/// are associated with owned spks in the index). Ensure insertion and indexing is topological-
|
||||
/// agnostic.
|
||||
#[test]
|
||||
fn insert_relevant_txs() {
|
||||
const DESCRIPTOR: &str = "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)";
|
||||
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), DESCRIPTOR)
|
||||
.expect("must be valid");
|
||||
let spk_0 = descriptor.at_derivation_index(0).script_pubkey();
|
||||
let spk_1 = descriptor.at_derivation_index(9).script_pubkey();
|
||||
|
||||
let mut graph = IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<()>>::default();
|
||||
graph.index.add_keychain((), descriptor);
|
||||
graph.index.set_lookahead(&(), 10);
|
||||
|
||||
let tx_a = Transaction {
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: spk_0,
|
||||
},
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: spk_1,
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
let tx_b = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_a.txid(), 0),
|
||||
..Default::default()
|
||||
}],
|
||||
..common::new_tx(1)
|
||||
};
|
||||
|
||||
let tx_c = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_a.txid(), 1),
|
||||
..Default::default()
|
||||
}],
|
||||
..common::new_tx(2)
|
||||
};
|
||||
|
||||
let txs = [tx_c, tx_b, tx_a];
|
||||
|
||||
assert_eq!(
|
||||
graph.insert_relevant_txs(txs.iter().map(|tx| (tx, None)), None),
|
||||
IndexedAdditions {
|
||||
graph_additions: Additions {
|
||||
txs: txs.into(),
|
||||
..Default::default()
|
||||
},
|
||||
index_additions: DerivationAdditions([((), 9_u32)].into()),
|
||||
}
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
/// Ensure consistency IndexedTxGraph list_* and balance methods. These methods lists
|
||||
/// relevant txouts and utxos from the information fetched from a ChainOracle (here a LocalChain).
|
||||
///
|
||||
/// Test Setup:
|
||||
///
|
||||
/// Local Chain => <0> ----- <1> ----- <2> ----- <3> ---- ... ---- <150>
|
||||
///
|
||||
/// Keychains:
|
||||
///
|
||||
/// keychain_1: Trusted
|
||||
/// keychain_2: Untrusted
|
||||
///
|
||||
/// Transactions:
|
||||
///
|
||||
/// tx1: A Coinbase, sending 70000 sats to "trusted" address. [Block 0]
|
||||
/// tx2: A external Receive, sending 30000 sats to "untrusted" address. [Block 1]
|
||||
/// tx3: Internal Spend. Spends tx2 and returns change of 10000 to "trusted" address. [Block 2]
|
||||
/// tx4: Mempool tx, sending 20000 sats to "trusted" address.
|
||||
/// tx5: Mempool tx, sending 15000 sats to "untested" address.
|
||||
/// tx6: Complete unrelated tx. [Block 3]
|
||||
///
|
||||
/// Different transactions are added via `insert_relevant_txs`.
|
||||
/// `list_owned_txout`, `list_owned_utxos` and `balance` method is asserted
|
||||
/// with expected values at Block height 0, 1, and 2.
|
||||
///
|
||||
/// Finally Add more blocks to local chain until tx1 coinbase maturity hits.
|
||||
/// Assert maturity at coinbase maturity inflection height. Block height 98 and 99.
|
||||
|
||||
fn test_list_owned_txouts() {
|
||||
// Create Local chains
|
||||
|
||||
let local_chain = (0..150)
|
||||
.map(|i| (i as u32, h!("random")))
|
||||
.collect::<BTreeMap<u32, BlockHash>>();
|
||||
let local_chain = LocalChain::from(local_chain);
|
||||
|
||||
// Initiate IndexedTxGraph
|
||||
|
||||
let (desc_1, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/0/*)").unwrap();
|
||||
let (desc_2, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/1/*)").unwrap();
|
||||
|
||||
let mut graph =
|
||||
IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<String>>::default();
|
||||
|
||||
graph.index.add_keychain("keychain_1".into(), desc_1);
|
||||
graph.index.add_keychain("keychain_2".into(), desc_2);
|
||||
graph.index.set_lookahead_for_all(10);
|
||||
|
||||
// Get trusted and untrusted addresses
|
||||
|
||||
let mut trusted_spks = Vec::new();
|
||||
let mut untrusted_spks = Vec::new();
|
||||
|
||||
{
|
||||
// we need to scope here to take immutanble reference of the graph
|
||||
for _ in 0..10 {
|
||||
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_1".to_string());
|
||||
// TODO Assert indexes
|
||||
trusted_spks.push(script.clone());
|
||||
}
|
||||
}
|
||||
{
|
||||
for _ in 0..10 {
|
||||
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_2".to_string());
|
||||
untrusted_spks.push(script.clone());
|
||||
}
|
||||
}
|
||||
|
||||
// Create test transactions
|
||||
|
||||
// tx1 is the genesis coinbase
|
||||
let tx1 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 70000,
|
||||
script_pubkey: trusted_spks[0].clone(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx2 is an incoming transaction received at untrusted keychain at block 1.
|
||||
let tx2 = Transaction {
|
||||
output: vec![TxOut {
|
||||
value: 30000,
|
||||
script_pubkey: untrusted_spks[0].clone(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx3 spends tx2 and gives a change back in trusted keychain. Confirmed at Block 2.
|
||||
let tx3 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx2.txid(), 0),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 10000,
|
||||
script_pubkey: trusted_spks[1].clone(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx4 is an external transaction receiving at untrusted keychain, unconfirmed.
|
||||
let tx4 = Transaction {
|
||||
output: vec![TxOut {
|
||||
value: 20000,
|
||||
script_pubkey: untrusted_spks[1].clone(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx5 is spending tx3 and receiving change at trusted keychain, unconfirmed.
|
||||
let tx5 = Transaction {
|
||||
output: vec![TxOut {
|
||||
value: 15000,
|
||||
script_pubkey: trusted_spks[2].clone(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx6 is an unrelated transaction confirmed at 3.
|
||||
let tx6 = common::new_tx(0);
|
||||
|
||||
// Insert transactions into graph with respective anchors
|
||||
// For unconfirmed txs we pass in `None`.
|
||||
|
||||
let _ = graph.insert_relevant_txs(
|
||||
[&tx1, &tx2, &tx3, &tx6].iter().enumerate().map(|(i, tx)| {
|
||||
let height = i as u32;
|
||||
(
|
||||
*tx,
|
||||
local_chain
|
||||
.blocks()
|
||||
.get(&height)
|
||||
.map(|&hash| BlockId { height, hash })
|
||||
.map(|anchor_block| ConfirmationHeightAnchor {
|
||||
anchor_block,
|
||||
confirmation_height: anchor_block.height,
|
||||
}),
|
||||
)
|
||||
}),
|
||||
None,
|
||||
);
|
||||
|
||||
let _ = graph.insert_relevant_txs([&tx4, &tx5].iter().map(|tx| (*tx, None)), Some(100));
|
||||
|
||||
// A helper lambda to extract and filter data from the graph.
|
||||
let fetch =
|
||||
|height: u32,
|
||||
graph: &IndexedTxGraph<ConfirmationHeightAnchor, KeychainTxOutIndex<String>>| {
|
||||
let chain_tip = local_chain
|
||||
.blocks()
|
||||
.get(&height)
|
||||
.map(|&hash| BlockId { height, hash })
|
||||
.expect("block must exist");
|
||||
let txouts = graph
|
||||
.graph()
|
||||
.filter_chain_txouts(
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
)
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let utxos = graph
|
||||
.graph()
|
||||
.filter_chain_unspents(
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
)
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let balance = graph.graph().balance(
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|_, spk: &Script| trusted_spks.contains(spk),
|
||||
);
|
||||
|
||||
assert_eq!(txouts.len(), 5);
|
||||
assert_eq!(utxos.len(), 4);
|
||||
|
||||
let confirmed_txouts_txid = txouts
|
||||
.iter()
|
||||
.filter_map(|(_, full_txout)| {
|
||||
if matches!(full_txout.chain_position, ChainPosition::Confirmed(_)) {
|
||||
Some(full_txout.outpoint.txid)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
|
||||
let unconfirmed_txouts_txid = txouts
|
||||
.iter()
|
||||
.filter_map(|(_, full_txout)| {
|
||||
if matches!(full_txout.chain_position, ChainPosition::Unconfirmed(_)) {
|
||||
Some(full_txout.outpoint.txid)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
|
||||
let confirmed_utxos_txid = utxos
|
||||
.iter()
|
||||
.filter_map(|(_, full_txout)| {
|
||||
if matches!(full_txout.chain_position, ChainPosition::Confirmed(_)) {
|
||||
Some(full_txout.outpoint.txid)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
|
||||
let unconfirmed_utxos_txid = utxos
|
||||
.iter()
|
||||
.filter_map(|(_, full_txout)| {
|
||||
if matches!(full_txout.chain_position, ChainPosition::Unconfirmed(_)) {
|
||||
Some(full_txout.outpoint.txid)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
|
||||
(
|
||||
confirmed_txouts_txid,
|
||||
unconfirmed_txouts_txid,
|
||||
confirmed_utxos_txid,
|
||||
unconfirmed_utxos_txid,
|
||||
balance,
|
||||
)
|
||||
};
|
||||
|
||||
// ----- TEST BLOCK -----
|
||||
|
||||
// AT Block 0
|
||||
{
|
||||
let (
|
||||
confirmed_txouts_txid,
|
||||
unconfirmed_txouts_txid,
|
||||
confirmed_utxos_txid,
|
||||
unconfirmed_utxos_txid,
|
||||
balance,
|
||||
) = fetch(0, &graph);
|
||||
|
||||
assert_eq!(confirmed_txouts_txid, [tx1.txid()].into());
|
||||
assert_eq!(
|
||||
unconfirmed_txouts_txid,
|
||||
[tx2.txid(), tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||
);
|
||||
|
||||
assert_eq!(confirmed_utxos_txid, [tx1.txid()].into());
|
||||
assert_eq!(
|
||||
unconfirmed_utxos_txid,
|
||||
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
balance,
|
||||
Balance {
|
||||
immature: 70000, // immature coinbase
|
||||
trusted_pending: 25000, // tx3 + tx5
|
||||
untrusted_pending: 20000, // tx4
|
||||
confirmed: 0 // Nothing is confirmed yet
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
// AT Block 1
|
||||
{
|
||||
let (
|
||||
confirmed_txouts_txid,
|
||||
unconfirmed_txouts_txid,
|
||||
confirmed_utxos_txid,
|
||||
unconfirmed_utxos_txid,
|
||||
balance,
|
||||
) = fetch(1, &graph);
|
||||
|
||||
// tx2 gets into confirmed txout set
|
||||
assert_eq!(confirmed_txouts_txid, [tx1.txid(), tx2.txid()].into());
|
||||
assert_eq!(
|
||||
unconfirmed_txouts_txid,
|
||||
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||
);
|
||||
|
||||
// tx2 doesn't get into confirmed utxos set
|
||||
assert_eq!(confirmed_utxos_txid, [tx1.txid()].into());
|
||||
assert_eq!(
|
||||
unconfirmed_utxos_txid,
|
||||
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
balance,
|
||||
Balance {
|
||||
immature: 70000, // immature coinbase
|
||||
trusted_pending: 25000, // tx3 + tx5
|
||||
untrusted_pending: 20000, // tx4
|
||||
confirmed: 0 // Nothing is confirmed yet
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
// AT Block 2
|
||||
{
|
||||
let (
|
||||
confirmed_txouts_txid,
|
||||
unconfirmed_txouts_txid,
|
||||
confirmed_utxos_txid,
|
||||
unconfirmed_utxos_txid,
|
||||
balance,
|
||||
) = fetch(2, &graph);
|
||||
|
||||
// tx3 now gets into the confirmed txout set
|
||||
assert_eq!(
|
||||
confirmed_txouts_txid,
|
||||
[tx1.txid(), tx2.txid(), tx3.txid()].into()
|
||||
);
|
||||
assert_eq!(unconfirmed_txouts_txid, [tx4.txid(), tx5.txid()].into());
|
||||
|
||||
// tx3 also gets into confirmed utxo set
|
||||
assert_eq!(confirmed_utxos_txid, [tx1.txid(), tx3.txid()].into());
|
||||
assert_eq!(unconfirmed_utxos_txid, [tx4.txid(), tx5.txid()].into());
|
||||
|
||||
assert_eq!(
|
||||
balance,
|
||||
Balance {
|
||||
immature: 70000, // immature coinbase
|
||||
trusted_pending: 15000, // tx5
|
||||
untrusted_pending: 20000, // tx4
|
||||
confirmed: 10000 // tx3 got confirmed
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
// AT Block 98
|
||||
{
|
||||
let (
|
||||
confirmed_txouts_txid,
|
||||
unconfirmed_txouts_txid,
|
||||
confirmed_utxos_txid,
|
||||
unconfirmed_utxos_txid,
|
||||
balance,
|
||||
) = fetch(98, &graph);
|
||||
|
||||
assert_eq!(
|
||||
confirmed_txouts_txid,
|
||||
[tx1.txid(), tx2.txid(), tx3.txid()].into()
|
||||
);
|
||||
assert_eq!(unconfirmed_txouts_txid, [tx4.txid(), tx5.txid()].into());
|
||||
|
||||
assert_eq!(confirmed_utxos_txid, [tx1.txid(), tx3.txid()].into());
|
||||
assert_eq!(unconfirmed_utxos_txid, [tx4.txid(), tx5.txid()].into());
|
||||
|
||||
// Coinbase is still immature
|
||||
assert_eq!(
|
||||
balance,
|
||||
Balance {
|
||||
immature: 70000, // immature coinbase
|
||||
trusted_pending: 15000, // tx5
|
||||
untrusted_pending: 20000, // tx4
|
||||
confirmed: 10000 // tx1 got matured
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
// AT Block 99
|
||||
{
|
||||
let (_, _, _, _, balance) = fetch(100, &graph);
|
||||
|
||||
// Coinbase maturity hits
|
||||
assert_eq!(
|
||||
balance,
|
||||
Balance {
|
||||
immature: 0, // coinbase matured
|
||||
trusted_pending: 15000, // tx5
|
||||
untrusted_pending: 20000, // tx4
|
||||
confirmed: 80000 // tx1 + tx3
|
||||
}
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -1,368 +0,0 @@
|
||||
#![cfg(feature = "miniscript")]
|
||||
|
||||
#[macro_use]
|
||||
mod common;
|
||||
use bdk_chain::{
|
||||
collections::BTreeMap,
|
||||
keychain::{DerivationAdditions, KeychainTxOutIndex},
|
||||
};
|
||||
|
||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, Transaction, TxOut};
|
||||
use miniscript::{Descriptor, DescriptorPublicKey};
|
||||
|
||||
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||
enum TestKeychain {
|
||||
External,
|
||||
Internal,
|
||||
}
|
||||
|
||||
fn init_txout_index() -> (
|
||||
bdk_chain::keychain::KeychainTxOutIndex<TestKeychain>,
|
||||
Descriptor<DescriptorPublicKey>,
|
||||
Descriptor<DescriptorPublicKey>,
|
||||
) {
|
||||
let mut txout_index = bdk_chain::keychain::KeychainTxOutIndex::<TestKeychain>::default();
|
||||
|
||||
let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
||||
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||
let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||
|
||||
txout_index.add_keychain(TestKeychain::External, external_descriptor.clone());
|
||||
txout_index.add_keychain(TestKeychain::Internal, internal_descriptor.clone());
|
||||
|
||||
(txout_index, external_descriptor, internal_descriptor)
|
||||
}
|
||||
|
||||
fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> Script {
|
||||
descriptor
|
||||
.derived_descriptor(&Secp256k1::verification_only(), index)
|
||||
.expect("must derive")
|
||||
.script_pubkey()
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_set_all_derivation_indices() {
|
||||
let (mut txout_index, _, _) = init_txout_index();
|
||||
let derive_to: BTreeMap<_, _> =
|
||||
[(TestKeychain::External, 12), (TestKeychain::Internal, 24)].into();
|
||||
assert_eq!(
|
||||
txout_index.reveal_to_target_multi(&derive_to).1.as_inner(),
|
||||
&derive_to
|
||||
);
|
||||
assert_eq!(txout_index.last_revealed_indices(), &derive_to);
|
||||
assert_eq!(
|
||||
txout_index.reveal_to_target_multi(&derive_to).1,
|
||||
DerivationAdditions::default(),
|
||||
"no changes if we set to the same thing"
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_lookahead() {
|
||||
let (mut txout_index, external_desc, internal_desc) = init_txout_index();
|
||||
|
||||
// ensure it does not break anything if lookahead is set multiple times
|
||||
(0..=10).for_each(|lookahead| txout_index.set_lookahead(&TestKeychain::External, lookahead));
|
||||
(0..=20)
|
||||
.filter(|v| v % 2 == 0)
|
||||
.for_each(|lookahead| txout_index.set_lookahead(&TestKeychain::Internal, lookahead));
|
||||
|
||||
assert_eq!(txout_index.inner().all_spks().len(), 30);
|
||||
|
||||
// given:
|
||||
// - external lookahead set to 10
|
||||
// - internal lookahead set to 20
|
||||
// when:
|
||||
// - set external derivation index to value higher than last, but within the lookahead value
|
||||
// expect:
|
||||
// - scripts cached in spk_txout_index should increase correctly
|
||||
// - stored scripts of external keychain should be of expected counts
|
||||
for index in (0..20).skip_while(|i| i % 2 == 1) {
|
||||
let (revealed_spks, revealed_additions) =
|
||||
txout_index.reveal_to_target(&TestKeychain::External, index);
|
||||
assert_eq!(
|
||||
revealed_spks.collect::<Vec<_>>(),
|
||||
vec![(index, spk_at_index(&external_desc, index))],
|
||||
);
|
||||
assert_eq!(
|
||||
revealed_additions.as_inner(),
|
||||
&[(TestKeychain::External, index)].into()
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
txout_index.inner().all_spks().len(),
|
||||
10 /* external lookahead */ +
|
||||
20 /* internal lookahead */ +
|
||||
index as usize + 1 /* `derived` count */
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.revealed_spks_of_keychain(&TestKeychain::External)
|
||||
.count(),
|
||||
index as usize + 1,
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.revealed_spks_of_keychain(&TestKeychain::Internal)
|
||||
.count(),
|
||||
0,
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.unused_spks_of_keychain(&TestKeychain::External)
|
||||
.count(),
|
||||
index as usize + 1,
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.unused_spks_of_keychain(&TestKeychain::Internal)
|
||||
.count(),
|
||||
0,
|
||||
);
|
||||
}
|
||||
|
||||
// given:
|
||||
// - internal lookahead is 20
|
||||
// - internal derivation index is `None`
|
||||
// when:
|
||||
// - derivation index is set ahead of current derivation index + lookahead
|
||||
// expect:
|
||||
// - scripts cached in spk_txout_index should increase correctly, a.k.a. no scripts are skipped
|
||||
let (revealed_spks, revealed_additions) =
|
||||
txout_index.reveal_to_target(&TestKeychain::Internal, 24);
|
||||
assert_eq!(
|
||||
revealed_spks.collect::<Vec<_>>(),
|
||||
(0..=24)
|
||||
.map(|index| (index, spk_at_index(&internal_desc, index)))
|
||||
.collect::<Vec<_>>(),
|
||||
);
|
||||
assert_eq!(
|
||||
revealed_additions.as_inner(),
|
||||
&[(TestKeychain::Internal, 24)].into()
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index.inner().all_spks().len(),
|
||||
10 /* external lookahead */ +
|
||||
20 /* internal lookahead */ +
|
||||
20 /* external stored index count */ +
|
||||
25 /* internal stored index count */
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.revealed_spks_of_keychain(&TestKeychain::Internal)
|
||||
.count(),
|
||||
25,
|
||||
);
|
||||
|
||||
// ensure derivation indices are expected for each keychain
|
||||
let last_external_index = txout_index
|
||||
.last_revealed_index(&TestKeychain::External)
|
||||
.expect("already derived");
|
||||
let last_internal_index = txout_index
|
||||
.last_revealed_index(&TestKeychain::Internal)
|
||||
.expect("already derived");
|
||||
assert_eq!(last_external_index, 19);
|
||||
assert_eq!(last_internal_index, 24);
|
||||
|
||||
// when:
|
||||
// - scanning txouts with spks within stored indexes
|
||||
// expect:
|
||||
// - no changes to stored index counts
|
||||
let external_iter = 0..=last_external_index;
|
||||
let internal_iter = last_internal_index - last_external_index..=last_internal_index;
|
||||
for (external_index, internal_index) in external_iter.zip(internal_iter) {
|
||||
let tx = Transaction {
|
||||
output: vec![
|
||||
TxOut {
|
||||
script_pubkey: external_desc
|
||||
.at_derivation_index(external_index)
|
||||
.script_pubkey(),
|
||||
value: 10_000,
|
||||
},
|
||||
TxOut {
|
||||
script_pubkey: internal_desc
|
||||
.at_derivation_index(internal_index)
|
||||
.script_pubkey(),
|
||||
value: 10_000,
|
||||
},
|
||||
],
|
||||
..common::new_tx(external_index)
|
||||
};
|
||||
assert_eq!(txout_index.scan(&tx), DerivationAdditions::default());
|
||||
assert_eq!(
|
||||
txout_index.last_revealed_index(&TestKeychain::External),
|
||||
Some(last_external_index)
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index.last_revealed_index(&TestKeychain::Internal),
|
||||
Some(last_internal_index)
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.revealed_spks_of_keychain(&TestKeychain::External)
|
||||
.count(),
|
||||
last_external_index as usize + 1,
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.revealed_spks_of_keychain(&TestKeychain::Internal)
|
||||
.count(),
|
||||
last_internal_index as usize + 1,
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
// when:
|
||||
// - scanning txouts with spks above last stored index
|
||||
// expect:
|
||||
// - last revealed index should increase as expected
|
||||
// - last used index should change as expected
|
||||
#[test]
|
||||
fn test_scan_with_lookahead() {
|
||||
let (mut txout_index, external_desc, _) = init_txout_index();
|
||||
txout_index.set_lookahead_for_all(10);
|
||||
|
||||
let spks: BTreeMap<u32, Script> = [0, 10, 20, 30]
|
||||
.into_iter()
|
||||
.map(|i| (i, external_desc.at_derivation_index(i).script_pubkey()))
|
||||
.collect();
|
||||
|
||||
for (&spk_i, spk) in &spks {
|
||||
let op = OutPoint::new(h!("fake tx"), spk_i);
|
||||
let txout = TxOut {
|
||||
script_pubkey: spk.clone(),
|
||||
value: 0,
|
||||
};
|
||||
|
||||
let additions = txout_index.scan_txout(op, &txout);
|
||||
assert_eq!(
|
||||
additions.as_inner(),
|
||||
&[(TestKeychain::External, spk_i)].into()
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index.last_revealed_index(&TestKeychain::External),
|
||||
Some(spk_i)
|
||||
);
|
||||
assert_eq!(
|
||||
txout_index.last_used_index(&TestKeychain::External),
|
||||
Some(spk_i)
|
||||
);
|
||||
}
|
||||
|
||||
// now try with index 41 (lookahead surpassed), we expect that the txout to not be indexed
|
||||
let spk_41 = external_desc.at_derivation_index(41).script_pubkey();
|
||||
let op = OutPoint::new(h!("fake tx"), 41);
|
||||
let txout = TxOut {
|
||||
script_pubkey: spk_41,
|
||||
value: 0,
|
||||
};
|
||||
let additions = txout_index.scan_txout(op, &txout);
|
||||
assert!(additions.is_empty());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_wildcard_derivations() {
|
||||
let (mut txout_index, external_desc, _) = init_txout_index();
|
||||
let external_spk_0 = external_desc.at_derivation_index(0).script_pubkey();
|
||||
let external_spk_16 = external_desc.at_derivation_index(16).script_pubkey();
|
||||
let external_spk_26 = external_desc.at_derivation_index(26).script_pubkey();
|
||||
let external_spk_27 = external_desc.at_derivation_index(27).script_pubkey();
|
||||
|
||||
// - nothing is derived
|
||||
// - unused list is also empty
|
||||
//
|
||||
// - next_derivation_index() == (0, true)
|
||||
// - derive_new() == ((0, <spk>), DerivationAdditions)
|
||||
// - next_unused() == ((0, <spk>), DerivationAdditions:is_empty())
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0_u32, &external_spk_0));
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0_u32, &external_spk_0));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
// - derived till 25
|
||||
// - used all spks till 15.
|
||||
// - used list : [0..=15, 17, 20, 23]
|
||||
// - unused list: [16, 18, 19, 21, 22, 24, 25]
|
||||
|
||||
// - next_derivation_index() = (26, true)
|
||||
// - derive_new() = ((26, <spk>), DerivationAdditions)
|
||||
// - next_unused() == ((16, <spk>), DerivationAdditions::is_empty())
|
||||
let _ = txout_index.reveal_to_target(&TestKeychain::External, 25);
|
||||
|
||||
(0..=15)
|
||||
.chain(vec![17, 20, 23].into_iter())
|
||||
.for_each(|index| assert!(txout_index.mark_used(&TestKeychain::External, index)));
|
||||
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (26, true));
|
||||
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (26, &external_spk_26));
|
||||
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 26)].into());
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (16, &external_spk_16));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
// - Use all the derived till 26.
|
||||
// - next_unused() = ((27, <spk>), DerivationAdditions)
|
||||
(0..=26).for_each(|index| {
|
||||
txout_index.mark_used(&TestKeychain::External, index);
|
||||
});
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (27, &external_spk_27));
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 27)].into());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_non_wildcard_derivations() {
|
||||
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::default();
|
||||
|
||||
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||
let external_spk = no_wildcard_descriptor
|
||||
.at_derivation_index(0)
|
||||
.script_pubkey();
|
||||
|
||||
txout_index.add_keychain(TestKeychain::External, no_wildcard_descriptor);
|
||||
|
||||
// given:
|
||||
// - `txout_index` with no stored scripts
|
||||
// expect:
|
||||
// - next derivation index should be new
|
||||
// - when we derive a new script, script @ index 0
|
||||
// - when we get the next unused script, script @ index 0
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
// given:
|
||||
// - the non-wildcard descriptor already has a stored and used script
|
||||
// expect:
|
||||
// - next derivation index should not be new
|
||||
// - derive new and next unused should return the old script
|
||||
// - store_up_to should not panic and return empty additions
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, false));
|
||||
txout_index.mark_used(&TestKeychain::External, 0);
|
||||
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
let (revealed_spks, revealed_additions) =
|
||||
txout_index.reveal_to_target(&TestKeychain::External, 200);
|
||||
assert_eq!(revealed_spks.count(), 0);
|
||||
assert!(revealed_additions.is_empty());
|
||||
}
|
||||
@@ -1,228 +0,0 @@
|
||||
use bdk_chain::local_chain::{
|
||||
ChangeSet, InsertBlockNotMatchingError, LocalChain, UpdateNotConnectedError,
|
||||
};
|
||||
use bitcoin::BlockHash;
|
||||
|
||||
#[macro_use]
|
||||
mod common;
|
||||
|
||||
#[test]
|
||||
fn add_first_tip() {
|
||||
let chain = LocalChain::default();
|
||||
assert_eq!(
|
||||
chain.determine_changeset(&local_chain![(0, h!("A"))]),
|
||||
Ok([(0, Some(h!("A")))].into()),
|
||||
"add first tip"
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn add_second_tip() {
|
||||
let chain = local_chain![(0, h!("A"))];
|
||||
assert_eq!(
|
||||
chain.determine_changeset(&local_chain![(0, h!("A")), (1, h!("B"))]),
|
||||
Ok([(1, Some(h!("B")))].into())
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn two_disjoint_chains_cannot_merge() {
|
||||
let chain1 = local_chain![(0, h!("A"))];
|
||||
let chain2 = local_chain![(1, h!("B"))];
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Err(UpdateNotConnectedError(0))
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn duplicate_chains_should_merge() {
|
||||
let chain1 = local_chain![(0, h!("A"))];
|
||||
let chain2 = local_chain![(0, h!("A"))];
|
||||
assert_eq!(chain1.determine_changeset(&chain2), Ok(Default::default()));
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn can_introduce_older_checkpoints() {
|
||||
let chain1 = local_chain![(2, h!("C")), (3, h!("D"))];
|
||||
let chain2 = local_chain![(1, h!("B")), (2, h!("C"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([(1, Some(h!("B")))].into())
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn fix_blockhash_before_agreement_point() {
|
||||
let chain1 = local_chain![(0, h!("im-wrong")), (1, h!("we-agree"))];
|
||||
let chain2 = local_chain![(0, h!("fix")), (1, h!("we-agree"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([(0, Some(h!("fix")))].into())
|
||||
)
|
||||
}
|
||||
|
||||
/// B and C are in both chain and update
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | B C
|
||||
/// update | A B C D
|
||||
/// ```
|
||||
/// This should succeed with the point of agreement being C and A should be added in addition.
|
||||
#[test]
|
||||
fn two_points_of_agreement() {
|
||||
let chain1 = local_chain![(1, h!("B")), (2, h!("C"))];
|
||||
let chain2 = local_chain![(0, h!("A")), (1, h!("B")), (2, h!("C")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([(0, Some(h!("A"))), (3, Some(h!("D")))].into()),
|
||||
);
|
||||
}
|
||||
|
||||
/// Update and chain does not connect:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | B C
|
||||
/// update | A B D
|
||||
/// ```
|
||||
/// This should fail as we cannot figure out whether C & D are on the same chain
|
||||
#[test]
|
||||
fn update_and_chain_does_not_connect() {
|
||||
let chain1 = local_chain![(1, h!("B")), (2, h!("C"))];
|
||||
let chain2 = local_chain![(0, h!("A")), (1, h!("B")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Err(UpdateNotConnectedError(2)),
|
||||
);
|
||||
}
|
||||
|
||||
/// Transient invalidation:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
/// chain | A B C E
|
||||
/// update | A B' C' D
|
||||
/// ```
|
||||
/// This should succeed and invalidate B,C and E with point of agreement being A.
|
||||
#[test]
|
||||
fn transitive_invalidation_applies_to_checkpoints_higher_than_invalidation() {
|
||||
let chain1 = local_chain![(0, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))];
|
||||
let chain2 = local_chain![(0, h!("A")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([
|
||||
(2, Some(h!("B'"))),
|
||||
(3, Some(h!("C'"))),
|
||||
(4, Some(h!("D"))),
|
||||
(5, None),
|
||||
]
|
||||
.into())
|
||||
);
|
||||
}
|
||||
|
||||
/// Transient invalidation:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | B C E
|
||||
/// update | B' C' D
|
||||
/// ```
|
||||
///
|
||||
/// This should succeed and invalidate B, C and E with no point of agreement
|
||||
#[test]
|
||||
fn transitive_invalidation_applies_to_checkpoints_higher_than_invalidation_no_point_of_agreement() {
|
||||
let chain1 = local_chain![(1, h!("B")), (2, h!("C")), (4, h!("E"))];
|
||||
let chain2 = local_chain![(1, h!("B'")), (2, h!("C'")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([
|
||||
(1, Some(h!("B'"))),
|
||||
(2, Some(h!("C'"))),
|
||||
(3, Some(h!("D"))),
|
||||
(4, None)
|
||||
]
|
||||
.into())
|
||||
)
|
||||
}
|
||||
|
||||
/// Transient invalidation:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | A B C E
|
||||
/// update | B' C' D
|
||||
/// ```
|
||||
///
|
||||
/// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
||||
/// A was invalid.
|
||||
#[test]
|
||||
fn invalidation_but_no_connection() {
|
||||
let chain1 = local_chain![(0, h!("A")), (1, h!("B")), (2, h!("C")), (4, h!("E"))];
|
||||
let chain2 = local_chain![(1, h!("B'")), (2, h!("C'")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Err(UpdateNotConnectedError(0))
|
||||
)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_block() {
|
||||
struct TestCase {
|
||||
original: LocalChain,
|
||||
insert: (u32, BlockHash),
|
||||
expected_result: Result<ChangeSet, InsertBlockNotMatchingError>,
|
||||
expected_final: LocalChain,
|
||||
}
|
||||
|
||||
let test_cases = [
|
||||
TestCase {
|
||||
original: local_chain![],
|
||||
insert: (5, h!("block5")),
|
||||
expected_result: Ok([(5, Some(h!("block5")))].into()),
|
||||
expected_final: local_chain![(5, h!("block5"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(3, h!("A"))],
|
||||
insert: (4, h!("B")),
|
||||
expected_result: Ok([(4, Some(h!("B")))].into()),
|
||||
expected_final: local_chain![(3, h!("A")), (4, h!("B"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(4, h!("B"))],
|
||||
insert: (3, h!("A")),
|
||||
expected_result: Ok([(3, Some(h!("A")))].into()),
|
||||
expected_final: local_chain![(3, h!("A")), (4, h!("B"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(2, h!("K"))],
|
||||
insert: (2, h!("K")),
|
||||
expected_result: Ok([].into()),
|
||||
expected_final: local_chain![(2, h!("K"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(2, h!("K"))],
|
||||
insert: (2, h!("J")),
|
||||
expected_result: Err(InsertBlockNotMatchingError {
|
||||
height: 2,
|
||||
original_hash: h!("K"),
|
||||
update_hash: h!("J"),
|
||||
}),
|
||||
expected_final: local_chain![(2, h!("K"))],
|
||||
},
|
||||
];
|
||||
|
||||
for (i, t) in test_cases.into_iter().enumerate() {
|
||||
let mut chain = t.original;
|
||||
assert_eq!(
|
||||
chain.insert_block(t.insert.into()),
|
||||
t.expected_result,
|
||||
"[{}] unexpected result when inserting block",
|
||||
i,
|
||||
);
|
||||
assert_eq!(chain, t.expected_final, "[{}] unexpected final chain", i,);
|
||||
}
|
||||
}
|
||||
@@ -1,100 +0,0 @@
|
||||
use bdk_chain::SpkTxOutIndex;
|
||||
use bitcoin::{hashes::hex::FromHex, OutPoint, PackedLockTime, Script, Transaction, TxIn, TxOut};
|
||||
|
||||
#[test]
|
||||
fn spk_txout_sent_and_received() {
|
||||
let spk1 = Script::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||
let spk2 = Script::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||
|
||||
let mut index = SpkTxOutIndex::default();
|
||||
index.insert_spk(0, spk1.clone());
|
||||
index.insert_spk(1, spk2.clone());
|
||||
|
||||
let tx1 = Transaction {
|
||||
version: 0x02,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
script_pubkey: spk1.clone(),
|
||||
}],
|
||||
};
|
||||
|
||||
assert_eq!(index.sent_and_received(&tx1), (0, 42_000));
|
||||
assert_eq!(index.net_value(&tx1), 42_000);
|
||||
index.scan(&tx1);
|
||||
assert_eq!(
|
||||
index.sent_and_received(&tx1),
|
||||
(0, 42_000),
|
||||
"shouldn't change after scanning"
|
||||
);
|
||||
|
||||
let tx2 = Transaction {
|
||||
version: 0x1,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: tx1.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: spk2,
|
||||
},
|
||||
TxOut {
|
||||
script_pubkey: spk1,
|
||||
value: 30_000,
|
||||
},
|
||||
],
|
||||
};
|
||||
|
||||
assert_eq!(index.sent_and_received(&tx2), (42_000, 50_000));
|
||||
assert_eq!(index.net_value(&tx2), 8_000);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn mark_used() {
|
||||
let spk1 = Script::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||
let spk2 = Script::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||
|
||||
let mut spk_index = SpkTxOutIndex::default();
|
||||
spk_index.insert_spk(1, spk1.clone());
|
||||
spk_index.insert_spk(2, spk2);
|
||||
|
||||
assert!(!spk_index.is_used(&1));
|
||||
spk_index.mark_used(&1);
|
||||
assert!(spk_index.is_used(&1));
|
||||
spk_index.unmark_used(&1);
|
||||
assert!(!spk_index.is_used(&1));
|
||||
spk_index.mark_used(&1);
|
||||
assert!(spk_index.is_used(&1));
|
||||
|
||||
let tx1 = Transaction {
|
||||
version: 0x02,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
script_pubkey: spk1,
|
||||
}],
|
||||
};
|
||||
|
||||
spk_index.scan(&tx1);
|
||||
spk_index.unmark_used(&1);
|
||||
assert!(
|
||||
spk_index.is_used(&1),
|
||||
"even though we unmark_used it doesn't matter because there was a tx scanned that used it"
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn unmark_used_does_not_result_in_invalid_representation() {
|
||||
let mut spk_index = SpkTxOutIndex::default();
|
||||
assert!(!spk_index.unmark_used(&0));
|
||||
assert!(!spk_index.unmark_used(&1));
|
||||
assert!(!spk_index.unmark_used(&2));
|
||||
assert!(spk_index.unused_spks(..).collect::<Vec<_>>().is_empty());
|
||||
}
|
||||
@@ -1,824 +0,0 @@
|
||||
#[macro_use]
|
||||
mod common;
|
||||
use bdk_chain::{
|
||||
collections::*,
|
||||
local_chain::LocalChain,
|
||||
tx_graph::{Additions, TxGraph},
|
||||
Append, BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bitcoin::{
|
||||
hashes::Hash, BlockHash, OutPoint, PackedLockTime, Script, Transaction, TxIn, TxOut, Txid,
|
||||
};
|
||||
use core::iter;
|
||||
use std::vec;
|
||||
|
||||
#[test]
|
||||
fn insert_txouts() {
|
||||
// 2 (Outpoint, TxOut) tupples that denotes original data in the graph, as partial transactions.
|
||||
let original_ops = [
|
||||
(
|
||||
OutPoint::new(h!("tx1"), 1),
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
),
|
||||
(
|
||||
OutPoint::new(h!("tx1"), 2),
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
),
|
||||
];
|
||||
|
||||
// Another (OutPoint, TxOut) tupple to be used as update as partial transaction.
|
||||
let update_ops = [(
|
||||
OutPoint::new(h!("tx2"), 0),
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
)];
|
||||
|
||||
// One full transaction to be included in the update
|
||||
let update_txs = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 30_000,
|
||||
script_pubkey: Script::new(),
|
||||
}],
|
||||
};
|
||||
|
||||
// Conf anchor used to mark the full transaction as confirmed.
|
||||
let conf_anchor = ChainPosition::Confirmed(BlockId {
|
||||
height: 100,
|
||||
hash: h!("random blockhash"),
|
||||
});
|
||||
|
||||
// Unconfirmed anchor to mark the partial transactions as unconfirmed
|
||||
let unconf_anchor = ChainPosition::<BlockId>::Unconfirmed(1000000);
|
||||
|
||||
// Make the original graph
|
||||
let mut graph = {
|
||||
let mut graph = TxGraph::<ChainPosition<BlockId>>::default();
|
||||
for (outpoint, txout) in &original_ops {
|
||||
assert_eq!(
|
||||
graph.insert_txout(*outpoint, txout.clone()),
|
||||
Additions {
|
||||
txouts: [(*outpoint, txout.clone())].into(),
|
||||
..Default::default()
|
||||
}
|
||||
);
|
||||
}
|
||||
graph
|
||||
};
|
||||
|
||||
// Make the update graph
|
||||
let update = {
|
||||
let mut graph = TxGraph::default();
|
||||
for (outpoint, txout) in &update_ops {
|
||||
// Insert partials transactions
|
||||
assert_eq!(
|
||||
graph.insert_txout(*outpoint, txout.clone()),
|
||||
Additions {
|
||||
txouts: [(*outpoint, txout.clone())].into(),
|
||||
..Default::default()
|
||||
}
|
||||
);
|
||||
// Mark them unconfirmed.
|
||||
assert_eq!(
|
||||
graph.insert_anchor(outpoint.txid, unconf_anchor),
|
||||
Additions {
|
||||
txs: [].into(),
|
||||
txouts: [].into(),
|
||||
anchors: [(unconf_anchor, outpoint.txid)].into(),
|
||||
last_seen: [].into()
|
||||
}
|
||||
);
|
||||
// Mark them last seen at.
|
||||
assert_eq!(
|
||||
graph.insert_seen_at(outpoint.txid, 1000000),
|
||||
Additions {
|
||||
txs: [].into(),
|
||||
txouts: [].into(),
|
||||
anchors: [].into(),
|
||||
last_seen: [(outpoint.txid, 1000000)].into()
|
||||
}
|
||||
);
|
||||
}
|
||||
// Insert the full transaction
|
||||
assert_eq!(
|
||||
graph.insert_tx(update_txs.clone()),
|
||||
Additions {
|
||||
txs: [update_txs.clone()].into(),
|
||||
..Default::default()
|
||||
}
|
||||
);
|
||||
|
||||
// Mark it as confirmed.
|
||||
assert_eq!(
|
||||
graph.insert_anchor(update_txs.txid(), conf_anchor),
|
||||
Additions {
|
||||
txs: [].into(),
|
||||
txouts: [].into(),
|
||||
anchors: [(conf_anchor, update_txs.txid())].into(),
|
||||
last_seen: [].into()
|
||||
}
|
||||
);
|
||||
graph
|
||||
};
|
||||
|
||||
// Check the resulting addition.
|
||||
let additions = graph.determine_additions(&update);
|
||||
|
||||
assert_eq!(
|
||||
additions,
|
||||
Additions {
|
||||
txs: [update_txs.clone()].into(),
|
||||
txouts: update_ops.into(),
|
||||
anchors: [(conf_anchor, update_txs.txid()), (unconf_anchor, h!("tx2"))].into(),
|
||||
last_seen: [(h!("tx2"), 1000000)].into()
|
||||
}
|
||||
);
|
||||
|
||||
// Apply addition and check the new graph counts.
|
||||
graph.apply_additions(additions);
|
||||
assert_eq!(graph.all_txouts().count(), 4);
|
||||
assert_eq!(graph.full_txs().count(), 1);
|
||||
assert_eq!(graph.floating_txouts().count(), 3);
|
||||
|
||||
// Check TxOuts are fetched correctly from the graph.
|
||||
assert_eq!(
|
||||
graph.tx_outputs(h!("tx1")).expect("should exists"),
|
||||
[
|
||||
(
|
||||
1u32,
|
||||
&TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
}
|
||||
),
|
||||
(
|
||||
2u32,
|
||||
&TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
}
|
||||
)
|
||||
]
|
||||
.into()
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
graph.tx_outputs(update_txs.txid()).expect("should exists"),
|
||||
[(
|
||||
0u32,
|
||||
&TxOut {
|
||||
value: 30_000,
|
||||
script_pubkey: Script::new()
|
||||
}
|
||||
)]
|
||||
.into()
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_tx_graph_doesnt_count_coinbase_as_spent() {
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![],
|
||||
};
|
||||
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let _ = graph.insert_tx(tx);
|
||||
assert!(graph.outspends(OutPoint::null()).is_empty());
|
||||
assert!(graph.tx_spends(Txid::all_zeros()).next().is_none());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_tx_graph_keeps_track_of_spend() {
|
||||
let tx1 = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut::default()],
|
||||
};
|
||||
|
||||
let op = OutPoint {
|
||||
txid: tx1.txid(),
|
||||
vout: 0,
|
||||
};
|
||||
|
||||
let tx2 = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![TxIn {
|
||||
previous_output: op,
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![],
|
||||
};
|
||||
|
||||
let mut graph1 = TxGraph::<()>::default();
|
||||
let mut graph2 = TxGraph::<()>::default();
|
||||
|
||||
// insert in different order
|
||||
let _ = graph1.insert_tx(tx1.clone());
|
||||
let _ = graph1.insert_tx(tx2.clone());
|
||||
|
||||
let _ = graph2.insert_tx(tx2.clone());
|
||||
let _ = graph2.insert_tx(tx1);
|
||||
|
||||
assert_eq!(
|
||||
graph1.outspends(op),
|
||||
&iter::once(tx2.txid()).collect::<HashSet<_>>()
|
||||
);
|
||||
assert_eq!(graph2.outspends(op), graph1.outspends(op));
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_tx_can_retrieve_full_tx_from_graph() {
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
};
|
||||
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let _ = graph.insert_tx(tx.clone());
|
||||
assert_eq!(graph.get_tx(tx.txid()), Some(&tx));
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_tx_displaces_txouts() {
|
||||
let mut tx_graph = TxGraph::<()>::default();
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
script_pubkey: Script::default(),
|
||||
}],
|
||||
};
|
||||
|
||||
let _ = tx_graph.insert_txout(
|
||||
OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
TxOut {
|
||||
value: 1_337_000,
|
||||
script_pubkey: Script::default(),
|
||||
},
|
||||
);
|
||||
|
||||
let _ = tx_graph.insert_txout(
|
||||
OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
TxOut {
|
||||
value: 1_000_000_000,
|
||||
script_pubkey: Script::default(),
|
||||
},
|
||||
);
|
||||
|
||||
let _additions = tx_graph.insert_tx(tx.clone());
|
||||
|
||||
assert_eq!(
|
||||
tx_graph
|
||||
.get_txout(OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 0
|
||||
})
|
||||
.unwrap()
|
||||
.value,
|
||||
42_000
|
||||
);
|
||||
assert_eq!(
|
||||
tx_graph.get_txout(OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 1
|
||||
}),
|
||||
None
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_txout_does_not_displace_tx() {
|
||||
let mut tx_graph = TxGraph::<()>::default();
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
script_pubkey: Script::default(),
|
||||
}],
|
||||
};
|
||||
|
||||
let _additions = tx_graph.insert_tx(tx.clone());
|
||||
|
||||
let _ = tx_graph.insert_txout(
|
||||
OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
TxOut {
|
||||
value: 1_337_000,
|
||||
script_pubkey: Script::default(),
|
||||
},
|
||||
);
|
||||
|
||||
let _ = tx_graph.insert_txout(
|
||||
OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
TxOut {
|
||||
value: 1_000_000_000,
|
||||
script_pubkey: Script::default(),
|
||||
},
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
tx_graph
|
||||
.get_txout(OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 0
|
||||
})
|
||||
.unwrap()
|
||||
.value,
|
||||
42_000
|
||||
);
|
||||
assert_eq!(
|
||||
tx_graph.get_txout(OutPoint {
|
||||
txid: tx.txid(),
|
||||
vout: 1
|
||||
}),
|
||||
None
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_calculate_fee() {
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let intx1 = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 100,
|
||||
..Default::default()
|
||||
}],
|
||||
};
|
||||
let intx2 = Transaction {
|
||||
version: 0x02,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 200,
|
||||
..Default::default()
|
||||
}],
|
||||
};
|
||||
|
||||
let intxout1 = (
|
||||
OutPoint {
|
||||
txid: h!("dangling output"),
|
||||
vout: 0,
|
||||
},
|
||||
TxOut {
|
||||
value: 300,
|
||||
..Default::default()
|
||||
},
|
||||
);
|
||||
|
||||
let _ = graph.insert_tx(intx1.clone());
|
||||
let _ = graph.insert_tx(intx2.clone());
|
||||
let _ = graph.insert_txout(intxout1.0, intxout1.1);
|
||||
|
||||
let mut tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![
|
||||
TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: intx1.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
..Default::default()
|
||||
},
|
||||
TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: intx2.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
..Default::default()
|
||||
},
|
||||
TxIn {
|
||||
previous_output: intxout1.0,
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
output: vec![TxOut {
|
||||
value: 500,
|
||||
..Default::default()
|
||||
}],
|
||||
};
|
||||
|
||||
assert_eq!(graph.calculate_fee(&tx), Some(100));
|
||||
|
||||
tx.input.remove(2);
|
||||
|
||||
// fee would be negative
|
||||
assert_eq!(graph.calculate_fee(&tx), Some(-200));
|
||||
|
||||
// If we have an unknown outpoint, fee should return None.
|
||||
tx.input.push(TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: h!("unknown_txid"),
|
||||
vout: 0,
|
||||
},
|
||||
..Default::default()
|
||||
});
|
||||
assert_eq!(graph.calculate_fee(&tx), None);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_calculate_fee_on_coinbase() {
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
};
|
||||
|
||||
let graph = TxGraph::<()>::default();
|
||||
|
||||
assert_eq!(graph.calculate_fee(&tx), Some(0));
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_conflicting_descendants() {
|
||||
let previous_output = OutPoint::new(h!("op"), 2);
|
||||
|
||||
// tx_a spends previous_output
|
||||
let tx_a = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output,
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_a2 spends previous_output and conflicts with tx_a
|
||||
let tx_a2 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output,
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default(), TxOut::default()],
|
||||
..common::new_tx(1)
|
||||
};
|
||||
|
||||
// tx_b spends tx_a
|
||||
let tx_b = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_a.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(2)
|
||||
};
|
||||
|
||||
let txid_a = tx_a.txid();
|
||||
let txid_b = tx_b.txid();
|
||||
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let _ = graph.insert_tx(tx_a);
|
||||
let _ = graph.insert_tx(tx_b);
|
||||
|
||||
assert_eq!(
|
||||
graph
|
||||
.walk_conflicts(&tx_a2, |depth, txid| Some((depth, txid)))
|
||||
.collect::<Vec<_>>(),
|
||||
vec![(0_usize, txid_a), (1_usize, txid_b),],
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_descendants_no_repeat() {
|
||||
let tx_a = Transaction {
|
||||
output: vec![TxOut::default(), TxOut::default(), TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
let txs_b = (0..3)
|
||||
.map(|vout| Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_a.txid(), vout),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(1)
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let txs_c = (0..2)
|
||||
.map(|vout| Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(txs_b[vout as usize].txid(), vout),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(2)
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let tx_d = Transaction {
|
||||
input: vec![
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(txs_c[0].txid(), 0),
|
||||
..TxIn::default()
|
||||
},
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(txs_c[1].txid(), 0),
|
||||
..TxIn::default()
|
||||
},
|
||||
],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(3)
|
||||
};
|
||||
|
||||
let tx_e = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_d.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(4)
|
||||
};
|
||||
|
||||
let txs_not_connected = (10..20)
|
||||
.map(|v| Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(h!("tx_does_not_exist"), v),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(v)
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let mut expected_txids = BTreeSet::new();
|
||||
|
||||
// these are NOT descendants of `tx_a`
|
||||
for tx in txs_not_connected {
|
||||
let _ = graph.insert_tx(tx.clone());
|
||||
}
|
||||
|
||||
// these are the expected descendants of `tx_a`
|
||||
for tx in txs_b
|
||||
.iter()
|
||||
.chain(&txs_c)
|
||||
.chain(core::iter::once(&tx_d))
|
||||
.chain(core::iter::once(&tx_e))
|
||||
{
|
||||
let _ = graph.insert_tx(tx.clone());
|
||||
assert!(expected_txids.insert(tx.txid()));
|
||||
}
|
||||
|
||||
let descendants = graph
|
||||
.walk_descendants(tx_a.txid(), |_, txid| Some(txid))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
assert_eq!(descendants.len(), expected_txids.len());
|
||||
|
||||
for txid in descendants {
|
||||
assert!(expected_txids.remove(&txid));
|
||||
}
|
||||
assert!(expected_txids.is_empty());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_chain_spends() {
|
||||
let local_chain: LocalChain = (0..=100)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect::<BTreeMap<u32, BlockHash>>()
|
||||
.into();
|
||||
let tip = local_chain.tip().expect("must have tip");
|
||||
|
||||
// The parent tx contains 2 outputs. Which are spent by one confirmed and one unconfirmed tx.
|
||||
// The parent tx is confirmed at block 95.
|
||||
let tx_0 = Transaction {
|
||||
input: vec![],
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// The first confirmed transaction spends vout: 0. And is confirmed at block 98.
|
||||
let tx_1 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_0.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 5_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
TxOut {
|
||||
value: 5_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// The second transactions spends vout:1, and is unconfirmed.
|
||||
let tx_2 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_0.txid(), 1),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
let mut graph = TxGraph::<ConfirmationHeightAnchor>::default();
|
||||
|
||||
let _ = graph.insert_tx(tx_0.clone());
|
||||
let _ = graph.insert_tx(tx_1.clone());
|
||||
let _ = graph.insert_tx(tx_2.clone());
|
||||
|
||||
[95, 98]
|
||||
.iter()
|
||||
.zip([&tx_0, &tx_1].into_iter())
|
||||
.for_each(|(ht, tx)| {
|
||||
let _ = graph.insert_anchor(
|
||||
tx.txid(),
|
||||
ConfirmationHeightAnchor {
|
||||
anchor_block: tip,
|
||||
confirmation_height: *ht,
|
||||
},
|
||||
);
|
||||
});
|
||||
|
||||
// Assert that confirmed spends are returned correctly.
|
||||
assert_eq!(
|
||||
graph.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 0)),
|
||||
Some((
|
||||
ChainPosition::Confirmed(&ConfirmationHeightAnchor {
|
||||
anchor_block: tip,
|
||||
confirmation_height: 98
|
||||
}),
|
||||
tx_1.txid(),
|
||||
)),
|
||||
);
|
||||
|
||||
// Check if chain position is returned correctly.
|
||||
assert_eq!(
|
||||
graph.get_chain_position(&local_chain, tip, tx_0.txid()),
|
||||
// Some(ObservedAs::Confirmed(&local_chain.get_block(95).expect("block expected"))),
|
||||
Some(ChainPosition::Confirmed(&ConfirmationHeightAnchor {
|
||||
anchor_block: tip,
|
||||
confirmation_height: 95
|
||||
}))
|
||||
);
|
||||
|
||||
// Even if unconfirmed tx has a last_seen of 0, it can still be part of a chain spend.
|
||||
assert_eq!(
|
||||
graph.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 1)),
|
||||
Some((ChainPosition::Unconfirmed(0), tx_2.txid())),
|
||||
);
|
||||
|
||||
// Mark the unconfirmed as seen and check correct ObservedAs status is returned.
|
||||
let _ = graph.insert_seen_at(tx_2.txid(), 1234567);
|
||||
|
||||
// Check chain spend returned correctly.
|
||||
assert_eq!(
|
||||
graph
|
||||
.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 1))
|
||||
.unwrap(),
|
||||
(ChainPosition::Unconfirmed(1234567), tx_2.txid())
|
||||
);
|
||||
|
||||
// A conflicting transaction that conflicts with tx_1.
|
||||
let tx_1_conflict = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_0.txid(), 0),
|
||||
..Default::default()
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
let _ = graph.insert_tx(tx_1_conflict.clone());
|
||||
|
||||
// Because this tx conflicts with an already confirmed transaction, chain position should return none.
|
||||
assert!(graph
|
||||
.get_chain_position(&local_chain, tip, tx_1_conflict.txid())
|
||||
.is_none());
|
||||
|
||||
// Another conflicting tx that conflicts with tx_2.
|
||||
let tx_2_conflict = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_0.txid(), 1),
|
||||
..Default::default()
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// Insert in graph and mark it as seen.
|
||||
let _ = graph.insert_tx(tx_2_conflict.clone());
|
||||
let _ = graph.insert_seen_at(tx_2_conflict.txid(), 1234568);
|
||||
|
||||
// This should return a valid observation with correct last seen.
|
||||
assert_eq!(
|
||||
graph
|
||||
.get_chain_position(&local_chain, tip, tx_2_conflict.txid())
|
||||
.expect("position expected"),
|
||||
ChainPosition::Unconfirmed(1234568)
|
||||
);
|
||||
|
||||
// Chain_spend now catches the new transaction as the spend.
|
||||
assert_eq!(
|
||||
graph
|
||||
.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 1))
|
||||
.expect("expect observation"),
|
||||
(ChainPosition::Unconfirmed(1234568), tx_2_conflict.txid())
|
||||
);
|
||||
|
||||
// Chain position of the `tx_2` is now none, as it is older than `tx_2_conflict`
|
||||
assert!(graph
|
||||
.get_chain_position(&local_chain, tip, tx_2.txid())
|
||||
.is_none());
|
||||
}
|
||||
|
||||
/// Ensure that `last_seen` values only increase during [`Append::append`].
|
||||
#[test]
|
||||
fn test_additions_last_seen_append() {
|
||||
let txid: Txid = h!("test txid");
|
||||
|
||||
let test_cases: &[(Option<u64>, Option<u64>)] = &[
|
||||
(Some(5), Some(6)),
|
||||
(Some(5), Some(5)),
|
||||
(Some(6), Some(5)),
|
||||
(None, Some(5)),
|
||||
(Some(5), None),
|
||||
];
|
||||
|
||||
for (original_ls, update_ls) in test_cases {
|
||||
let mut original = Additions::<()> {
|
||||
last_seen: original_ls.map(|ls| (txid, ls)).into_iter().collect(),
|
||||
..Default::default()
|
||||
};
|
||||
let update = Additions::<()> {
|
||||
last_seen: update_ls.map(|ls| (txid, ls)).into_iter().collect(),
|
||||
..Default::default()
|
||||
};
|
||||
|
||||
original.append(update);
|
||||
assert_eq!(
|
||||
&original.last_seen.get(&txid).cloned(),
|
||||
Ord::max(original_ls, update_ls),
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -1,16 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_electrum"
|
||||
version = "0.3.0"
|
||||
edition = "2021"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_electrum"
|
||||
description = "Fetch data from electrum in the form BDK accepts"
|
||||
license = "MIT OR Apache-2.0"
|
||||
readme = "README.md"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", features = ["serde", "miniscript"] }
|
||||
electrum-client = { version = "0.12" }
|
||||
@@ -1,3 +0,0 @@
|
||||
# BDK Electrum
|
||||
|
||||
BDK Electrum client library for updating the keychain tracker.
|
||||
@@ -1,486 +0,0 @@
|
||||
use bdk_chain::{
|
||||
bitcoin::{hashes::hex::FromHex, BlockHash, OutPoint, Script, Transaction, Txid},
|
||||
keychain::LocalUpdate,
|
||||
local_chain::LocalChain,
|
||||
tx_graph::{self, TxGraph},
|
||||
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeAnchor,
|
||||
};
|
||||
use electrum_client::{Client, ElectrumApi, Error};
|
||||
use std::{
|
||||
collections::{BTreeMap, BTreeSet, HashMap, HashSet},
|
||||
fmt::Debug,
|
||||
};
|
||||
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct ElectrumUpdate<K, A> {
|
||||
pub graph_update: HashMap<Txid, BTreeSet<A>>,
|
||||
pub chain_update: LocalChain,
|
||||
pub keychain_update: BTreeMap<K, u32>,
|
||||
}
|
||||
|
||||
impl<K, A> Default for ElectrumUpdate<K, A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
graph_update: Default::default(),
|
||||
chain_update: Default::default(),
|
||||
keychain_update: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<K, A: Anchor> ElectrumUpdate<K, A> {
|
||||
pub fn missing_full_txs<A2>(&self, graph: &TxGraph<A2>) -> Vec<Txid> {
|
||||
self.graph_update
|
||||
.keys()
|
||||
.filter(move |&&txid| graph.as_ref().get_tx(txid).is_none())
|
||||
.cloned()
|
||||
.collect()
|
||||
}
|
||||
|
||||
pub fn finalize(
|
||||
self,
|
||||
client: &Client,
|
||||
seen_at: Option<u64>,
|
||||
missing: Vec<Txid>,
|
||||
) -> Result<LocalUpdate<K, A>, Error> {
|
||||
let new_txs = client.batch_transaction_get(&missing)?;
|
||||
let mut graph_update = TxGraph::<A>::new(new_txs);
|
||||
for (txid, anchors) in self.graph_update {
|
||||
if let Some(seen_at) = seen_at {
|
||||
let _ = graph_update.insert_seen_at(txid, seen_at);
|
||||
}
|
||||
for anchor in anchors {
|
||||
let _ = graph_update.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
Ok(LocalUpdate {
|
||||
keychain: self.keychain_update,
|
||||
graph: graph_update,
|
||||
chain: self.chain_update,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> ElectrumUpdate<K, ConfirmationHeightAnchor> {
|
||||
/// Finalizes the [`ElectrumUpdate`] with `new_txs` and anchors of type
|
||||
/// [`ConfirmationTimeAnchor`].
|
||||
///
|
||||
/// **Note:** The confirmation time might not be precisely correct if there has been a reorg.
|
||||
/// Electrum's API intends that we use the merkle proof API, we should change `bdk_electrum` to
|
||||
/// use it.
|
||||
pub fn finalize_as_confirmation_time(
|
||||
self,
|
||||
client: &Client,
|
||||
seen_at: Option<u64>,
|
||||
missing: Vec<Txid>,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error> {
|
||||
let update = self.finalize(client, seen_at, missing)?;
|
||||
|
||||
let relevant_heights = {
|
||||
let mut visited_heights = HashSet::new();
|
||||
update
|
||||
.graph
|
||||
.all_anchors()
|
||||
.iter()
|
||||
.map(|(a, _)| a.confirmation_height_upper_bound())
|
||||
.filter(move |&h| visited_heights.insert(h))
|
||||
.collect::<Vec<_>>()
|
||||
};
|
||||
|
||||
let height_to_time = relevant_heights
|
||||
.clone()
|
||||
.into_iter()
|
||||
.zip(
|
||||
client
|
||||
.batch_block_header(relevant_heights)?
|
||||
.into_iter()
|
||||
.map(|bh| bh.time as u64),
|
||||
)
|
||||
.collect::<HashMap<u32, u64>>();
|
||||
|
||||
let graph_additions = {
|
||||
let old_additions = TxGraph::default().determine_additions(&update.graph);
|
||||
tx_graph::Additions {
|
||||
txs: old_additions.txs,
|
||||
txouts: old_additions.txouts,
|
||||
last_seen: old_additions.last_seen,
|
||||
anchors: old_additions
|
||||
.anchors
|
||||
.into_iter()
|
||||
.map(|(height_anchor, txid)| {
|
||||
let confirmation_height = height_anchor.confirmation_height;
|
||||
let confirmation_time = height_to_time[&confirmation_height];
|
||||
let time_anchor = ConfirmationTimeAnchor {
|
||||
anchor_block: height_anchor.anchor_block,
|
||||
confirmation_height,
|
||||
confirmation_time,
|
||||
};
|
||||
(time_anchor, txid)
|
||||
})
|
||||
.collect(),
|
||||
}
|
||||
};
|
||||
|
||||
Ok(LocalUpdate {
|
||||
keychain: update.keychain,
|
||||
graph: {
|
||||
let mut graph = TxGraph::default();
|
||||
graph.apply_additions(graph_additions);
|
||||
graph
|
||||
},
|
||||
chain: update.chain,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
pub trait ElectrumExt<A> {
|
||||
fn get_tip(&self) -> Result<(u32, BlockHash), Error>;
|
||||
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
batch_size: usize,
|
||||
) -> Result<ElectrumUpdate<K, A>, Error>;
|
||||
|
||||
fn scan_without_keychain(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
misc_spks: impl IntoIterator<Item = Script>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
batch_size: usize,
|
||||
) -> Result<ElectrumUpdate<(), A>, Error> {
|
||||
let spk_iter = misc_spks
|
||||
.into_iter()
|
||||
.enumerate()
|
||||
.map(|(i, spk)| (i as u32, spk));
|
||||
|
||||
self.scan(
|
||||
local_chain,
|
||||
[((), spk_iter)].into(),
|
||||
txids,
|
||||
outpoints,
|
||||
usize::MAX,
|
||||
batch_size,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
impl ElectrumExt<ConfirmationHeightAnchor> for Client {
|
||||
fn get_tip(&self) -> Result<(u32, BlockHash), Error> {
|
||||
// TODO: unsubscribe when added to the client, or is there a better call to use here?
|
||||
self.block_headers_subscribe()
|
||||
.map(|data| (data.height as u32, data.header.block_hash()))
|
||||
}
|
||||
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
batch_size: usize,
|
||||
) -> Result<ElectrumUpdate<K, ConfirmationHeightAnchor>, Error> {
|
||||
let mut request_spks = keychain_spks
|
||||
.into_iter()
|
||||
.map(|(k, s)| (k, s.into_iter()))
|
||||
.collect::<BTreeMap<K, _>>();
|
||||
let mut scanned_spks = BTreeMap::<(K, u32), (Script, bool)>::new();
|
||||
|
||||
let txids = txids.into_iter().collect::<Vec<_>>();
|
||||
let outpoints = outpoints.into_iter().collect::<Vec<_>>();
|
||||
|
||||
let update = loop {
|
||||
let mut update = ElectrumUpdate::<K, ConfirmationHeightAnchor> {
|
||||
chain_update: prepare_chain_update(self, local_chain)?,
|
||||
..Default::default()
|
||||
};
|
||||
let anchor_block = update
|
||||
.chain_update
|
||||
.tip()
|
||||
.expect("must have atleast one block");
|
||||
|
||||
if !request_spks.is_empty() {
|
||||
if !scanned_spks.is_empty() {
|
||||
scanned_spks.append(&mut populate_with_spks(
|
||||
self,
|
||||
anchor_block,
|
||||
&mut update,
|
||||
&mut scanned_spks
|
||||
.iter()
|
||||
.map(|(i, (spk, _))| (i.clone(), spk.clone())),
|
||||
stop_gap,
|
||||
batch_size,
|
||||
)?);
|
||||
}
|
||||
for (keychain, keychain_spks) in &mut request_spks {
|
||||
scanned_spks.extend(
|
||||
populate_with_spks(
|
||||
self,
|
||||
anchor_block,
|
||||
&mut update,
|
||||
keychain_spks,
|
||||
stop_gap,
|
||||
batch_size,
|
||||
)?
|
||||
.into_iter()
|
||||
.map(|(spk_i, spk)| ((keychain.clone(), spk_i), spk)),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
populate_with_txids(self, anchor_block, &mut update, &mut txids.iter().cloned())?;
|
||||
|
||||
let _txs = populate_with_outpoints(
|
||||
self,
|
||||
anchor_block,
|
||||
&mut update,
|
||||
&mut outpoints.iter().cloned(),
|
||||
)?;
|
||||
|
||||
// check for reorgs during scan process
|
||||
let server_blockhash = self
|
||||
.block_header(anchor_block.height as usize)?
|
||||
.block_hash();
|
||||
if anchor_block.hash != server_blockhash {
|
||||
continue; // reorg
|
||||
}
|
||||
|
||||
update.keychain_update = request_spks
|
||||
.into_keys()
|
||||
.filter_map(|k| {
|
||||
scanned_spks
|
||||
.range((k.clone(), u32::MIN)..=(k.clone(), u32::MAX))
|
||||
.rev()
|
||||
.find(|(_, (_, active))| *active)
|
||||
.map(|((_, i), _)| (k, *i))
|
||||
})
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
break update;
|
||||
};
|
||||
|
||||
Ok(update)
|
||||
}
|
||||
}
|
||||
|
||||
/// Prepare an update "template" based on the checkpoints of the `local_chain`.
|
||||
fn prepare_chain_update(
|
||||
client: &Client,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
) -> Result<LocalChain, Error> {
|
||||
let mut update = LocalChain::default();
|
||||
|
||||
// Find the local chain block that is still there so our update can connect to the local chain.
|
||||
for (&existing_height, &existing_hash) in local_chain.iter().rev() {
|
||||
// TODO: a batch request may be safer, as a reorg that happens when we are obtaining
|
||||
// `block_header`s will result in inconsistencies
|
||||
let current_hash = client.block_header(existing_height as usize)?.block_hash();
|
||||
let _ = update
|
||||
.insert_block(BlockId {
|
||||
height: existing_height,
|
||||
hash: current_hash,
|
||||
})
|
||||
.expect("This never errors because we are working with a fresh chain");
|
||||
|
||||
if current_hash == existing_hash {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Insert the new tip so new transactions will be accepted into the sparsechain.
|
||||
let tip = {
|
||||
let (height, hash) = crate::get_tip(client)?;
|
||||
BlockId { height, hash }
|
||||
};
|
||||
if update.insert_block(tip).is_err() {
|
||||
// There has been a re-org before we even begin scanning addresses.
|
||||
// Just recursively call (this should never happen).
|
||||
return prepare_chain_update(client, local_chain);
|
||||
}
|
||||
|
||||
Ok(update)
|
||||
}
|
||||
|
||||
fn determine_tx_anchor(
|
||||
anchor_block: BlockId,
|
||||
raw_height: i32,
|
||||
txid: Txid,
|
||||
) -> Option<ConfirmationHeightAnchor> {
|
||||
// The electrum API has a weird quirk where an unconfirmed transaction is presented with a
|
||||
// height of 0. To avoid invalid representation in our data structures, we manually set
|
||||
// transactions residing in the genesis block to have height 0, then interpret a height of 0 as
|
||||
// unconfirmed for all other transactions.
|
||||
if txid
|
||||
== Txid::from_hex("4a5e1e4baab89f3a32518a88c31bc87f618f76673e2cc77ab2127b7afdeda33b")
|
||||
.expect("must deserialize genesis coinbase txid")
|
||||
{
|
||||
return Some(ConfirmationHeightAnchor {
|
||||
anchor_block,
|
||||
confirmation_height: 0,
|
||||
});
|
||||
}
|
||||
match raw_height {
|
||||
h if h <= 0 => {
|
||||
debug_assert!(h == 0 || h == -1, "unexpected height ({}) from electrum", h);
|
||||
None
|
||||
}
|
||||
h => {
|
||||
let h = h as u32;
|
||||
if h > anchor_block.height {
|
||||
None
|
||||
} else {
|
||||
Some(ConfirmationHeightAnchor {
|
||||
anchor_block,
|
||||
confirmation_height: h,
|
||||
})
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn populate_with_outpoints<K>(
|
||||
client: &Client,
|
||||
anchor_block: BlockId,
|
||||
update: &mut ElectrumUpdate<K, ConfirmationHeightAnchor>,
|
||||
outpoints: &mut impl Iterator<Item = OutPoint>,
|
||||
) -> Result<HashMap<Txid, Transaction>, Error> {
|
||||
let mut full_txs = HashMap::new();
|
||||
for outpoint in outpoints {
|
||||
let txid = outpoint.txid;
|
||||
let tx = client.transaction_get(&txid)?;
|
||||
debug_assert_eq!(tx.txid(), txid);
|
||||
let txout = match tx.output.get(outpoint.vout as usize) {
|
||||
Some(txout) => txout,
|
||||
None => continue,
|
||||
};
|
||||
// attempt to find the following transactions (alongside their chain positions), and
|
||||
// add to our sparsechain `update`:
|
||||
let mut has_residing = false; // tx in which the outpoint resides
|
||||
let mut has_spending = false; // tx that spends the outpoint
|
||||
for res in client.script_get_history(&txout.script_pubkey)? {
|
||||
if has_residing && has_spending {
|
||||
break;
|
||||
}
|
||||
|
||||
if res.tx_hash == txid {
|
||||
if has_residing {
|
||||
continue;
|
||||
}
|
||||
has_residing = true;
|
||||
full_txs.insert(res.tx_hash, tx.clone());
|
||||
} else {
|
||||
if has_spending {
|
||||
continue;
|
||||
}
|
||||
let res_tx = match full_txs.get(&res.tx_hash) {
|
||||
Some(tx) => tx,
|
||||
None => {
|
||||
let res_tx = client.transaction_get(&res.tx_hash)?;
|
||||
full_txs.insert(res.tx_hash, res_tx);
|
||||
full_txs.get(&res.tx_hash).expect("just inserted")
|
||||
}
|
||||
};
|
||||
has_spending = res_tx
|
||||
.input
|
||||
.iter()
|
||||
.any(|txin| txin.previous_output == outpoint);
|
||||
if !has_spending {
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
let anchor = determine_tx_anchor(anchor_block, res.height, res.tx_hash);
|
||||
|
||||
let tx_entry = update.graph_update.entry(res.tx_hash).or_default();
|
||||
if let Some(anchor) = anchor {
|
||||
tx_entry.insert(anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
Ok(full_txs)
|
||||
}
|
||||
|
||||
fn populate_with_txids<K>(
|
||||
client: &Client,
|
||||
anchor_block: BlockId,
|
||||
update: &mut ElectrumUpdate<K, ConfirmationHeightAnchor>,
|
||||
txids: &mut impl Iterator<Item = Txid>,
|
||||
) -> Result<(), Error> {
|
||||
for txid in txids {
|
||||
let tx = match client.transaction_get(&txid) {
|
||||
Ok(tx) => tx,
|
||||
Err(electrum_client::Error::Protocol(_)) => continue,
|
||||
Err(other_err) => return Err(other_err),
|
||||
};
|
||||
|
||||
let spk = tx
|
||||
.output
|
||||
.get(0)
|
||||
.map(|txo| &txo.script_pubkey)
|
||||
.expect("tx must have an output");
|
||||
|
||||
let anchor = match client
|
||||
.script_get_history(spk)?
|
||||
.into_iter()
|
||||
.find(|r| r.tx_hash == txid)
|
||||
{
|
||||
Some(r) => determine_tx_anchor(anchor_block, r.height, txid),
|
||||
None => continue,
|
||||
};
|
||||
|
||||
let tx_entry = update.graph_update.entry(txid).or_default();
|
||||
if let Some(anchor) = anchor {
|
||||
tx_entry.insert(anchor);
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn populate_with_spks<K, I: Ord + Clone>(
|
||||
client: &Client,
|
||||
anchor_block: BlockId,
|
||||
update: &mut ElectrumUpdate<K, ConfirmationHeightAnchor>,
|
||||
spks: &mut impl Iterator<Item = (I, Script)>,
|
||||
stop_gap: usize,
|
||||
batch_size: usize,
|
||||
) -> Result<BTreeMap<I, (Script, bool)>, Error> {
|
||||
let mut unused_spk_count = 0_usize;
|
||||
let mut scanned_spks = BTreeMap::new();
|
||||
|
||||
loop {
|
||||
let spks = (0..batch_size)
|
||||
.map_while(|_| spks.next())
|
||||
.collect::<Vec<_>>();
|
||||
if spks.is_empty() {
|
||||
return Ok(scanned_spks);
|
||||
}
|
||||
|
||||
let spk_histories = client.batch_script_get_history(spks.iter().map(|(_, s)| s))?;
|
||||
|
||||
for ((spk_index, spk), spk_history) in spks.into_iter().zip(spk_histories) {
|
||||
if spk_history.is_empty() {
|
||||
scanned_spks.insert(spk_index, (spk, false));
|
||||
unused_spk_count += 1;
|
||||
if unused_spk_count > stop_gap {
|
||||
return Ok(scanned_spks);
|
||||
}
|
||||
continue;
|
||||
} else {
|
||||
scanned_spks.insert(spk_index, (spk, true));
|
||||
unused_spk_count = 0;
|
||||
}
|
||||
|
||||
for tx in spk_history {
|
||||
let tx_entry = update.graph_update.entry(tx.tx_hash).or_default();
|
||||
if let Some(anchor) = determine_tx_anchor(anchor_block, tx.height, tx.tx_hash) {
|
||||
tx_entry.insert(anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,35 +0,0 @@
|
||||
//! This crate is used for updating structures of the [`bdk_chain`] crate with data from electrum.
|
||||
//!
|
||||
//! The star of the show is the [`ElectrumExt::scan`] method, which scans for relevant blockchain
|
||||
//! data (via electrum) and outputs an [`ElectrumUpdate`].
|
||||
//!
|
||||
//! An [`ElectrumUpdate`] only includes `txid`s and no full transactions. The caller is responsible
|
||||
//! for obtaining full transactions before applying. This can be done with
|
||||
//! these steps:
|
||||
//!
|
||||
//! 1. Determine which full transactions are missing. The method [`missing_full_txs`] of
|
||||
//! [`ElectrumUpdate`] can be used.
|
||||
//!
|
||||
//! 2. Obtaining the full transactions. To do this via electrum, the method
|
||||
//! [`batch_transaction_get`] can be used.
|
||||
//!
|
||||
//! Refer to [`bdk_electrum_example`] for a complete example.
|
||||
//!
|
||||
//! [`ElectrumClient::scan`]: ElectrumClient::scan
|
||||
//! [`missing_full_txs`]: ElectrumUpdate::missing_full_txs
|
||||
//! [`batch_transaction_get`]: ElectrumApi::batch_transaction_get
|
||||
//! [`bdk_electrum_example`]: https://github.com/LLFourn/bdk_core_staging/tree/master/bdk_electrum_example
|
||||
|
||||
use bdk_chain::bitcoin::BlockHash;
|
||||
use electrum_client::{Client, ElectrumApi, Error};
|
||||
mod electrum_ext;
|
||||
pub use bdk_chain;
|
||||
pub use electrum_client;
|
||||
pub use electrum_ext::*;
|
||||
|
||||
fn get_tip(client: &Client) -> Result<(u32, BlockHash), Error> {
|
||||
// TODO: unsubscribe when added to the client, or is there a better call to use here?
|
||||
client
|
||||
.block_headers_subscribe()
|
||||
.map(|data| (data.height as u32, data.header.block_hash()))
|
||||
}
|
||||
@@ -1,29 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_esplora"
|
||||
version = "0.3.0"
|
||||
edition = "2021"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_esplora"
|
||||
description = "Fetch data from esplora in the form that accepts"
|
||||
license = "MIT OR Apache-2.0"
|
||||
readme = "README.md"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", default-features = false, features = ["serde", "miniscript"] }
|
||||
esplora-client = { version = "0.5", default-features = false }
|
||||
async-trait = { version = "0.1.66", optional = true }
|
||||
futures = { version = "0.3.26", optional = true }
|
||||
|
||||
# use these dependencies if you need to enable their /no-std features
|
||||
bitcoin = { version = "0.29", optional = true, default-features = false }
|
||||
miniscript = { version = "9.0.0", optional = true, default-features = false }
|
||||
|
||||
[features]
|
||||
default = ["std", "async-https", "blocking"]
|
||||
std = ["bdk_chain/std"]
|
||||
async = ["async-trait", "futures", "esplora-client/async"]
|
||||
async-https = ["async", "esplora-client/async-https"]
|
||||
blocking = ["esplora-client/blocking"]
|
||||
@@ -1,33 +0,0 @@
|
||||
# BDK Esplora
|
||||
|
||||
BDK Esplora extends [`esplora_client`](crate::esplora_client) to update [`bdk_chain`] structures
|
||||
from an Esplora server.
|
||||
|
||||
## Usage
|
||||
|
||||
There are two versions of the extension trait (blocking and async).
|
||||
|
||||
For blocking-only:
|
||||
```toml
|
||||
bdk_esplora = { version = "0.3", features = ["blocking"] }
|
||||
```
|
||||
|
||||
For async-only:
|
||||
```toml
|
||||
bdk_esplora = { version = "0.3", features = ["async"] }
|
||||
```
|
||||
|
||||
For async-only (with https):
|
||||
```toml
|
||||
bdk_esplora = { version = "0.3", features = ["async-https"] }
|
||||
```
|
||||
|
||||
To use the extension traits:
|
||||
```rust
|
||||
// for blocking
|
||||
use bdk_esplora::EsploraExt;
|
||||
// for async
|
||||
// use bdk_esplora::EsploraAsyncExt;
|
||||
```
|
||||
|
||||
For full examples, refer to [`example-crates/wallet_esplora`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora) (blocking) and [`example-crates/wallet_esplora_async`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_async).
|
||||
@@ -1,269 +0,0 @@
|
||||
use async_trait::async_trait;
|
||||
use bdk_chain::{
|
||||
bitcoin::{BlockHash, OutPoint, Script, Txid},
|
||||
collections::BTreeMap,
|
||||
keychain::LocalUpdate,
|
||||
BlockId, ConfirmationTimeAnchor,
|
||||
};
|
||||
use esplora_client::{Error, OutputStatus, TxStatus};
|
||||
use futures::{stream::FuturesOrdered, TryStreamExt};
|
||||
|
||||
use crate::map_confirmation_time_anchor;
|
||||
|
||||
/// Trait to extend [`esplora_client::AsyncClient`] functionality.
|
||||
///
|
||||
/// This is the async version of [`EsploraExt`]. Refer to
|
||||
/// [crate-level documentation] for more.
|
||||
///
|
||||
/// [`EsploraExt`]: crate::EsploraExt
|
||||
/// [crate-level documentation]: crate
|
||||
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||
pub trait EsploraAsyncExt {
|
||||
/// Scan the blockchain (via esplora) for the data specified and returns a
|
||||
/// [`LocalUpdate<K, ConfirmationTimeAnchor>`].
|
||||
///
|
||||
/// - `local_chain`: the most recent block hashes present locally
|
||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// - `txids`: transactions for which we want updated [`ConfirmationTimeAnchor`]s
|
||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to included in the update
|
||||
///
|
||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||
/// parallel.
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
async fn scan<K: Ord + Clone + Send>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<
|
||||
K,
|
||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, Script)> + Send> + Send,
|
||||
>,
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error>;
|
||||
|
||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
||||
///
|
||||
/// [`scan`]: EsploraAsyncExt::scan
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
async fn scan_without_keychain(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = Script> + Send> + Send,
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<(), ConfirmationTimeAnchor>, Error> {
|
||||
self.scan(
|
||||
local_chain,
|
||||
[(
|
||||
(),
|
||||
misc_spks
|
||||
.into_iter()
|
||||
.enumerate()
|
||||
.map(|(i, spk)| (i as u32, spk)),
|
||||
)]
|
||||
.into(),
|
||||
txids,
|
||||
outpoints,
|
||||
usize::MAX,
|
||||
parallel_requests,
|
||||
)
|
||||
.await
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||
impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
async fn scan<K: Ord + Clone + Send>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<
|
||||
K,
|
||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, Script)> + Send> + Send,
|
||||
>,
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error> {
|
||||
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||
|
||||
let (mut update, tip_at_start) = loop {
|
||||
let mut update = LocalUpdate::<K, ConfirmationTimeAnchor>::default();
|
||||
|
||||
for (&height, &original_hash) in local_chain.iter().rev() {
|
||||
let update_block_id = BlockId {
|
||||
height,
|
||||
hash: self.get_block_hash(height).await?,
|
||||
};
|
||||
let _ = update
|
||||
.chain
|
||||
.insert_block(update_block_id)
|
||||
.expect("cannot repeat height here");
|
||||
if update_block_id.hash == original_hash {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
let tip_at_start = BlockId {
|
||||
height: self.get_height().await?,
|
||||
hash: self.get_tip_hash().await?,
|
||||
};
|
||||
|
||||
if update.chain.insert_block(tip_at_start).is_ok() {
|
||||
break (update, tip_at_start);
|
||||
}
|
||||
};
|
||||
|
||||
for (keychain, spks) in keychain_spks {
|
||||
let mut spks = spks.into_iter();
|
||||
let mut last_active_index = None;
|
||||
let mut empty_scripts = 0;
|
||||
type IndexWithTxs = (u32, Vec<esplora_client::Tx>);
|
||||
|
||||
loop {
|
||||
let futures = (0..parallel_requests)
|
||||
.filter_map(|_| {
|
||||
let (index, script) = spks.next()?;
|
||||
let client = self.clone();
|
||||
Some(async move {
|
||||
let mut related_txs = client.scripthash_txs(&script, None).await?;
|
||||
|
||||
let n_confirmed =
|
||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
||||
// esplora pages on 25 confirmed transactions. If there are 25 or more we
|
||||
// keep requesting to see if there's more.
|
||||
if n_confirmed >= 25 {
|
||||
loop {
|
||||
let new_related_txs = client
|
||||
.scripthash_txs(
|
||||
&script,
|
||||
Some(related_txs.last().unwrap().txid),
|
||||
)
|
||||
.await?;
|
||||
let n = new_related_txs.len();
|
||||
related_txs.extend(new_related_txs);
|
||||
// we've reached the end
|
||||
if n < 25 {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Result::<_, esplora_client::Error>::Ok((index, related_txs))
|
||||
})
|
||||
})
|
||||
.collect::<FuturesOrdered<_>>();
|
||||
|
||||
let n_futures = futures.len();
|
||||
|
||||
for (index, related_txs) in futures.try_collect::<Vec<IndexWithTxs>>().await? {
|
||||
if related_txs.is_empty() {
|
||||
empty_scripts += 1;
|
||||
} else {
|
||||
last_active_index = Some(index);
|
||||
empty_scripts = 0;
|
||||
}
|
||||
for tx in related_txs {
|
||||
let anchor = map_confirmation_time_anchor(&tx.status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx.to_tx());
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(tx.txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if n_futures == 0 || empty_scripts >= stop_gap {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(last_active_index) = last_active_index {
|
||||
update.keychain.insert(keychain, last_active_index);
|
||||
}
|
||||
}
|
||||
|
||||
for txid in txids.into_iter() {
|
||||
if update.graph.get_tx(txid).is_none() {
|
||||
match self.get_tx(&txid).await? {
|
||||
Some(tx) => {
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
}
|
||||
None => continue,
|
||||
}
|
||||
}
|
||||
match self.get_tx_status(&txid).await? {
|
||||
tx_status if tx_status.confirmed => {
|
||||
if let Some(anchor) = map_confirmation_time_anchor(&tx_status, tip_at_start) {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
|
||||
for op in outpoints.into_iter() {
|
||||
let mut op_txs = Vec::with_capacity(2);
|
||||
if let (
|
||||
Some(tx),
|
||||
tx_status @ TxStatus {
|
||||
confirmed: true, ..
|
||||
},
|
||||
) = (
|
||||
self.get_tx(&op.txid).await?,
|
||||
self.get_tx_status(&op.txid).await?,
|
||||
) {
|
||||
op_txs.push((tx, tx_status));
|
||||
if let Some(OutputStatus {
|
||||
txid: Some(txid),
|
||||
status: Some(spend_status),
|
||||
..
|
||||
}) = self.get_output_status(&op.txid, op.vout as _).await?
|
||||
{
|
||||
if let Some(spend_tx) = self.get_tx(&txid).await? {
|
||||
op_txs.push((spend_tx, spend_status));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for (tx, status) in op_txs {
|
||||
let txid = tx.txid();
|
||||
let anchor = map_confirmation_time_anchor(&status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if tip_at_start.hash != self.get_block_hash(tip_at_start.height).await? {
|
||||
// A reorg occurred, so let's find out where all the txids we found are now in the chain
|
||||
let txids_found = update
|
||||
.graph
|
||||
.full_txs()
|
||||
.map(|tx_node| tx_node.txid)
|
||||
.collect::<Vec<_>>();
|
||||
update.chain = EsploraAsyncExt::scan_without_keychain(
|
||||
self,
|
||||
local_chain,
|
||||
[],
|
||||
txids_found,
|
||||
[],
|
||||
parallel_requests,
|
||||
)
|
||||
.await?
|
||||
.chain;
|
||||
}
|
||||
|
||||
Ok(update)
|
||||
}
|
||||
}
|
||||
@@ -1,251 +0,0 @@
|
||||
use bdk_chain::bitcoin::{BlockHash, OutPoint, Script, Txid};
|
||||
use bdk_chain::collections::BTreeMap;
|
||||
use bdk_chain::BlockId;
|
||||
use bdk_chain::{keychain::LocalUpdate, ConfirmationTimeAnchor};
|
||||
use esplora_client::{Error, OutputStatus, TxStatus};
|
||||
|
||||
use crate::map_confirmation_time_anchor;
|
||||
|
||||
/// Trait to extend [`esplora_client::BlockingClient`] functionality.
|
||||
///
|
||||
/// Refer to [crate-level documentation] for more.
|
||||
///
|
||||
/// [crate-level documentation]: crate
|
||||
pub trait EsploraExt {
|
||||
/// Scan the blockchain (via esplora) for the data specified and returns a
|
||||
/// [`LocalUpdate<K, ConfirmationTimeAnchor>`].
|
||||
///
|
||||
/// - `local_chain`: the most recent block hashes present locally
|
||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// - `txids`: transactions for which we want updated [`ConfirmationTimeAnchor`]s
|
||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to included in the update
|
||||
///
|
||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||
/// parallel.
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error>;
|
||||
|
||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
||||
///
|
||||
/// [`scan`]: EsploraExt::scan
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
fn scan_without_keychain(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
misc_spks: impl IntoIterator<Item = Script>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<(), ConfirmationTimeAnchor>, Error> {
|
||||
self.scan(
|
||||
local_chain,
|
||||
[(
|
||||
(),
|
||||
misc_spks
|
||||
.into_iter()
|
||||
.enumerate()
|
||||
.map(|(i, spk)| (i as u32, spk)),
|
||||
)]
|
||||
.into(),
|
||||
txids,
|
||||
outpoints,
|
||||
usize::MAX,
|
||||
parallel_requests,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
impl EsploraExt for esplora_client::BlockingClient {
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error> {
|
||||
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||
|
||||
let (mut update, tip_at_start) = loop {
|
||||
let mut update = LocalUpdate::<K, ConfirmationTimeAnchor>::default();
|
||||
|
||||
for (&height, &original_hash) in local_chain.iter().rev() {
|
||||
let update_block_id = BlockId {
|
||||
height,
|
||||
hash: self.get_block_hash(height)?,
|
||||
};
|
||||
let _ = update
|
||||
.chain
|
||||
.insert_block(update_block_id)
|
||||
.expect("cannot repeat height here");
|
||||
if update_block_id.hash == original_hash {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
let tip_at_start = BlockId {
|
||||
height: self.get_height()?,
|
||||
hash: self.get_tip_hash()?,
|
||||
};
|
||||
|
||||
if update.chain.insert_block(tip_at_start).is_ok() {
|
||||
break (update, tip_at_start);
|
||||
}
|
||||
};
|
||||
|
||||
for (keychain, spks) in keychain_spks {
|
||||
let mut spks = spks.into_iter();
|
||||
let mut last_active_index = None;
|
||||
let mut empty_scripts = 0;
|
||||
type IndexWithTxs = (u32, Vec<esplora_client::Tx>);
|
||||
|
||||
loop {
|
||||
let handles = (0..parallel_requests)
|
||||
.filter_map(
|
||||
|_| -> Option<std::thread::JoinHandle<Result<IndexWithTxs, _>>> {
|
||||
let (index, script) = spks.next()?;
|
||||
let client = self.clone();
|
||||
Some(std::thread::spawn(move || {
|
||||
let mut related_txs = client.scripthash_txs(&script, None)?;
|
||||
|
||||
let n_confirmed =
|
||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
||||
// esplora pages on 25 confirmed transactions. If there are 25 or more we
|
||||
// keep requesting to see if there's more.
|
||||
if n_confirmed >= 25 {
|
||||
loop {
|
||||
let new_related_txs = client.scripthash_txs(
|
||||
&script,
|
||||
Some(related_txs.last().unwrap().txid),
|
||||
)?;
|
||||
let n = new_related_txs.len();
|
||||
related_txs.extend(new_related_txs);
|
||||
// we've reached the end
|
||||
if n < 25 {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Result::<_, esplora_client::Error>::Ok((index, related_txs))
|
||||
}))
|
||||
},
|
||||
)
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let n_handles = handles.len();
|
||||
|
||||
for handle in handles {
|
||||
let (index, related_txs) = handle.join().unwrap()?; // TODO: don't unwrap
|
||||
if related_txs.is_empty() {
|
||||
empty_scripts += 1;
|
||||
} else {
|
||||
last_active_index = Some(index);
|
||||
empty_scripts = 0;
|
||||
}
|
||||
for tx in related_txs {
|
||||
let anchor = map_confirmation_time_anchor(&tx.status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx.to_tx());
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(tx.txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if n_handles == 0 || empty_scripts >= stop_gap {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(last_active_index) = last_active_index {
|
||||
update.keychain.insert(keychain, last_active_index);
|
||||
}
|
||||
}
|
||||
|
||||
for txid in txids.into_iter() {
|
||||
if update.graph.get_tx(txid).is_none() {
|
||||
match self.get_tx(&txid)? {
|
||||
Some(tx) => {
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
}
|
||||
None => continue,
|
||||
}
|
||||
}
|
||||
match self.get_tx_status(&txid)? {
|
||||
tx_status @ TxStatus {
|
||||
confirmed: true, ..
|
||||
} => {
|
||||
if let Some(anchor) = map_confirmation_time_anchor(&tx_status, tip_at_start) {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
|
||||
for op in outpoints.into_iter() {
|
||||
let mut op_txs = Vec::with_capacity(2);
|
||||
if let (
|
||||
Some(tx),
|
||||
tx_status @ TxStatus {
|
||||
confirmed: true, ..
|
||||
},
|
||||
) = (self.get_tx(&op.txid)?, self.get_tx_status(&op.txid)?)
|
||||
{
|
||||
op_txs.push((tx, tx_status));
|
||||
if let Some(OutputStatus {
|
||||
txid: Some(txid),
|
||||
status: Some(spend_status),
|
||||
..
|
||||
}) = self.get_output_status(&op.txid, op.vout as _)?
|
||||
{
|
||||
if let Some(spend_tx) = self.get_tx(&txid)? {
|
||||
op_txs.push((spend_tx, spend_status));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for (tx, status) in op_txs {
|
||||
let txid = tx.txid();
|
||||
let anchor = map_confirmation_time_anchor(&status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if tip_at_start.hash != self.get_block_hash(tip_at_start.height)? {
|
||||
// A reorg occurred, so let's find out where all the txids we found are now in the chain
|
||||
let txids_found = update
|
||||
.graph
|
||||
.full_txs()
|
||||
.map(|tx_node| tx_node.txid)
|
||||
.collect::<Vec<_>>();
|
||||
update.chain = EsploraExt::scan_without_keychain(
|
||||
self,
|
||||
local_chain,
|
||||
[],
|
||||
txids_found,
|
||||
[],
|
||||
parallel_requests,
|
||||
)?
|
||||
.chain;
|
||||
}
|
||||
|
||||
Ok(update)
|
||||
}
|
||||
}
|
||||
@@ -1,29 +0,0 @@
|
||||
#![doc = include_str!("../README.md")]
|
||||
use bdk_chain::{BlockId, ConfirmationTimeAnchor};
|
||||
use esplora_client::TxStatus;
|
||||
|
||||
pub use esplora_client;
|
||||
|
||||
#[cfg(feature = "blocking")]
|
||||
mod blocking_ext;
|
||||
#[cfg(feature = "blocking")]
|
||||
pub use blocking_ext::*;
|
||||
|
||||
#[cfg(feature = "async")]
|
||||
mod async_ext;
|
||||
#[cfg(feature = "async")]
|
||||
pub use async_ext::*;
|
||||
|
||||
pub(crate) fn map_confirmation_time_anchor(
|
||||
tx_status: &TxStatus,
|
||||
tip_at_start: BlockId,
|
||||
) -> Option<ConfirmationTimeAnchor> {
|
||||
match (tx_status.block_time, tx_status.block_height) {
|
||||
(Some(confirmation_time), Some(confirmation_height)) => Some(ConfirmationTimeAnchor {
|
||||
anchor_block: tip_at_start,
|
||||
confirmation_height,
|
||||
confirmation_time,
|
||||
}),
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
@@ -1,19 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_file_store"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
license = "MIT OR Apache-2.0"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_file_store"
|
||||
description = "A simple append-only flat file implementation of Persist for Bitcoin Dev Kit."
|
||||
keywords = ["bitcoin", "persist", "persistence", "bdk", "file"]
|
||||
authors = ["Bitcoin Dev Kit Developers"]
|
||||
readme = "README.md"
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", features = [ "serde", "miniscript" ] }
|
||||
bincode = { version = "1" }
|
||||
serde = { version = "1", features = ["derive"] }
|
||||
|
||||
[dev-dependencies]
|
||||
tempfile = "3"
|
||||
@@ -1,10 +0,0 @@
|
||||
# BDK File Store
|
||||
|
||||
This is a simple append-only flat file implementation of
|
||||
[`Persist`](`bdk_chain::Persist`).
|
||||
|
||||
The main structure is [`Store`](`crate::Store`), which can be used with [`bdk`]'s
|
||||
`Wallet` to persist wallet data into a flat file.
|
||||
|
||||
[`bdk`]: https://docs.rs/bdk/latest
|
||||
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
||||
@@ -1,100 +0,0 @@
|
||||
use bincode::Options;
|
||||
use std::{
|
||||
fs::File,
|
||||
io::{self, Seek},
|
||||
marker::PhantomData,
|
||||
};
|
||||
|
||||
use crate::bincode_options;
|
||||
|
||||
/// Iterator over entries in a file store.
|
||||
///
|
||||
/// Reads and returns an entry each time [`next`] is called. If an error occurs while reading the
|
||||
/// iterator will yield a `Result::Err(_)` instead and then `None` for the next call to `next`.
|
||||
///
|
||||
/// [`next`]: Self::next
|
||||
pub struct EntryIter<'t, T> {
|
||||
db_file: Option<&'t mut File>,
|
||||
|
||||
/// The file position for the first read of `db_file`.
|
||||
start_pos: Option<u64>,
|
||||
types: PhantomData<T>,
|
||||
}
|
||||
|
||||
impl<'t, T> EntryIter<'t, T> {
|
||||
pub fn new(start_pos: u64, db_file: &'t mut File) -> Self {
|
||||
Self {
|
||||
db_file: Some(db_file),
|
||||
start_pos: Some(start_pos),
|
||||
types: PhantomData,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'t, T> Iterator for EntryIter<'t, T>
|
||||
where
|
||||
T: serde::de::DeserializeOwned,
|
||||
{
|
||||
type Item = Result<T, IterError>;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
// closure which reads a single entry starting from `self.pos`
|
||||
let read_one = |f: &mut File, start_pos: Option<u64>| -> Result<Option<T>, IterError> {
|
||||
let pos = match start_pos {
|
||||
Some(pos) => f.seek(io::SeekFrom::Start(pos))?,
|
||||
None => f.stream_position()?,
|
||||
};
|
||||
|
||||
match bincode_options().deserialize_from(&*f) {
|
||||
Ok(changeset) => {
|
||||
f.stream_position()?;
|
||||
Ok(Some(changeset))
|
||||
}
|
||||
Err(e) => {
|
||||
if let bincode::ErrorKind::Io(inner) = &*e {
|
||||
if inner.kind() == io::ErrorKind::UnexpectedEof {
|
||||
let eof = f.seek(io::SeekFrom::End(0))?;
|
||||
if pos == eof {
|
||||
return Ok(None);
|
||||
}
|
||||
}
|
||||
}
|
||||
f.seek(io::SeekFrom::Start(pos))?;
|
||||
Err(IterError::Bincode(*e))
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
let result = read_one(self.db_file.as_mut()?, self.start_pos.take());
|
||||
if result.is_err() {
|
||||
self.db_file = None;
|
||||
}
|
||||
result.transpose()
|
||||
}
|
||||
}
|
||||
|
||||
impl From<io::Error> for IterError {
|
||||
fn from(value: io::Error) -> Self {
|
||||
IterError::Io(value)
|
||||
}
|
||||
}
|
||||
|
||||
/// Error type for [`EntryIter`].
|
||||
#[derive(Debug)]
|
||||
pub enum IterError {
|
||||
/// Failure to read from the file.
|
||||
Io(io::Error),
|
||||
/// Failure to decode data from the file.
|
||||
Bincode(bincode::ErrorKind),
|
||||
}
|
||||
|
||||
impl core::fmt::Display for IterError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
IterError::Io(e) => write!(f, "io error trying to read entry {}", e),
|
||||
IterError::Bincode(e) => write!(f, "bincode error while reading entry {}", e),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl std::error::Error for IterError {}
|
||||
@@ -1,42 +0,0 @@
|
||||
#![doc = include_str!("../README.md")]
|
||||
mod entry_iter;
|
||||
mod store;
|
||||
use std::io;
|
||||
|
||||
use bincode::{DefaultOptions, Options};
|
||||
pub use entry_iter::*;
|
||||
pub use store::*;
|
||||
|
||||
pub(crate) fn bincode_options() -> impl bincode::Options {
|
||||
DefaultOptions::new().with_varint_encoding()
|
||||
}
|
||||
|
||||
/// Error that occurs due to problems encountered with the file.
|
||||
#[derive(Debug)]
|
||||
pub enum FileError<'a> {
|
||||
/// IO error, this may mean that the file is too short.
|
||||
Io(io::Error),
|
||||
/// Magic bytes do not match what is expected.
|
||||
InvalidMagicBytes { got: Vec<u8>, expected: &'a [u8] },
|
||||
}
|
||||
|
||||
impl<'a> core::fmt::Display for FileError<'a> {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
Self::Io(e) => write!(f, "io error trying to read file: {}", e),
|
||||
Self::InvalidMagicBytes { got, expected } => write!(
|
||||
f,
|
||||
"file has invalid magic bytes: expected={:?} got={:?}",
|
||||
expected, got,
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> From<io::Error> for FileError<'a> {
|
||||
fn from(value: io::Error) -> Self {
|
||||
Self::Io(value)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a> std::error::Error for FileError<'a> {}
|
||||
@@ -1,255 +0,0 @@
|
||||
use std::{
|
||||
fmt::Debug,
|
||||
fs::{File, OpenOptions},
|
||||
io::{self, Read, Seek, Write},
|
||||
marker::PhantomData,
|
||||
path::Path,
|
||||
};
|
||||
|
||||
use bdk_chain::{Append, PersistBackend};
|
||||
use bincode::Options;
|
||||
|
||||
use crate::{bincode_options, EntryIter, FileError, IterError};
|
||||
|
||||
/// Persists an append-only list of changesets (`C`) to a single file.
|
||||
///
|
||||
/// The changesets are the results of altering a tracker implementation (`T`).
|
||||
#[derive(Debug)]
|
||||
pub struct Store<'a, C> {
|
||||
magic: &'a [u8],
|
||||
db_file: File,
|
||||
marker: PhantomData<C>,
|
||||
}
|
||||
|
||||
impl<'a, C> PersistBackend<C> for Store<'a, C>
|
||||
where
|
||||
C: Default + Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
{
|
||||
type WriteError = std::io::Error;
|
||||
|
||||
type LoadError = IterError;
|
||||
|
||||
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError> {
|
||||
self.append_changeset(changeset)
|
||||
}
|
||||
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError> {
|
||||
let (changeset, result) = self.aggregate_changesets();
|
||||
result.map(|_| changeset)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, C> Store<'a, C>
|
||||
where
|
||||
C: Default + Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
{
|
||||
/// Creates a new store from a [`File`].
|
||||
///
|
||||
/// The file must have been opened with read and write permissions.
|
||||
///
|
||||
/// `magic` is the expected prefixed bytes of the file. If this does not match, an error will be
|
||||
/// returned.
|
||||
///
|
||||
/// [`File`]: std::fs::File
|
||||
pub fn new(magic: &'a [u8], mut db_file: File) -> Result<Self, FileError> {
|
||||
db_file.rewind()?;
|
||||
|
||||
let mut magic_buf = vec![0_u8; magic.len()];
|
||||
db_file.read_exact(magic_buf.as_mut())?;
|
||||
|
||||
if magic_buf != magic {
|
||||
return Err(FileError::InvalidMagicBytes {
|
||||
got: magic_buf,
|
||||
expected: magic,
|
||||
});
|
||||
}
|
||||
|
||||
Ok(Self {
|
||||
magic,
|
||||
db_file,
|
||||
marker: Default::default(),
|
||||
})
|
||||
}
|
||||
|
||||
/// Creates or loads a store from `db_path`.
|
||||
///
|
||||
/// If no file exists there, it will be created.
|
||||
///
|
||||
/// Refer to [`new`] for documentation on the `magic` input.
|
||||
///
|
||||
/// [`new`]: Self::new
|
||||
pub fn new_from_path<P>(magic: &'a [u8], db_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
let already_exists = db_path.as_ref().exists();
|
||||
|
||||
let mut db_file = OpenOptions::new()
|
||||
.read(true)
|
||||
.write(true)
|
||||
.create(true)
|
||||
.open(db_path)?;
|
||||
|
||||
if !already_exists {
|
||||
db_file.write_all(magic)?;
|
||||
}
|
||||
|
||||
Self::new(magic, db_file)
|
||||
}
|
||||
|
||||
/// Iterates over the stored changeset from first to last, changing the seek position at each
|
||||
/// iteration.
|
||||
///
|
||||
/// The iterator may fail to read an entry and therefore return an error. However, the first time
|
||||
/// it returns an error will be the last. After doing so, the iterator will always yield `None`.
|
||||
///
|
||||
/// **WARNING**: This method changes the write position in the underlying file. You should
|
||||
/// always iterate over all entries until `None` is returned if you want your next write to go
|
||||
/// at the end; otherwise, you will write over existing entries.
|
||||
pub fn iter_changesets(&mut self) -> EntryIter<C> {
|
||||
EntryIter::new(self.magic.len() as u64, &mut self.db_file)
|
||||
}
|
||||
|
||||
/// Loads all the changesets that have been stored as one giant changeset.
|
||||
///
|
||||
/// This function returns a tuple of the aggregate changeset and a result that indicates
|
||||
/// whether an error occurred while reading or deserializing one of the entries. If so the
|
||||
/// changeset will consist of all of those it was able to read.
|
||||
///
|
||||
/// You should usually check the error. In many applications, it may make sense to do a full
|
||||
/// wallet scan with a stop-gap after getting an error, since it is likely that one of the
|
||||
/// changesets it was unable to read changed the derivation indices of the tracker.
|
||||
///
|
||||
/// **WARNING**: This method changes the write position of the underlying file. The next
|
||||
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
||||
pub fn aggregate_changesets(&mut self) -> (C, Result<(), IterError>) {
|
||||
let mut changeset = C::default();
|
||||
let result = (|| {
|
||||
for next_changeset in self.iter_changesets() {
|
||||
changeset.append(next_changeset?);
|
||||
}
|
||||
Ok(())
|
||||
})();
|
||||
|
||||
(changeset, result)
|
||||
}
|
||||
|
||||
/// Append a new changeset to the file and truncate the file to the end of the appended
|
||||
/// changeset.
|
||||
///
|
||||
/// The truncation is to avoid the possibility of having a valid but inconsistent changeset
|
||||
/// directly after the appended changeset.
|
||||
pub fn append_changeset(&mut self, changeset: &C) -> Result<(), io::Error> {
|
||||
// no need to write anything if changeset is empty
|
||||
if changeset.is_empty() {
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
bincode_options()
|
||||
.serialize_into(&mut self.db_file, changeset)
|
||||
.map_err(|e| match *e {
|
||||
bincode::ErrorKind::Io(inner) => inner,
|
||||
unexpected_err => panic!("unexpected bincode error: {}", unexpected_err),
|
||||
})?;
|
||||
|
||||
// truncate file after this changeset addition
|
||||
// if this is not done, data after this changeset may represent valid changesets, however
|
||||
// applying those changesets on top of this one may result in an inconsistent state
|
||||
let pos = self.db_file.stream_position()?;
|
||||
self.db_file.set_len(pos)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use super::*;
|
||||
|
||||
use bincode::DefaultOptions;
|
||||
use std::{
|
||||
io::{Read, Write},
|
||||
vec::Vec,
|
||||
};
|
||||
use tempfile::NamedTempFile;
|
||||
|
||||
const TEST_MAGIC_BYTES_LEN: usize = 12;
|
||||
const TEST_MAGIC_BYTES: [u8; TEST_MAGIC_BYTES_LEN] =
|
||||
[98, 100, 107, 102, 115, 49, 49, 49, 49, 49, 49, 49];
|
||||
|
||||
type TestChangeSet = Vec<String>;
|
||||
|
||||
#[derive(Debug)]
|
||||
struct TestTracker;
|
||||
|
||||
#[test]
|
||||
fn new_fails_if_file_is_too_short() {
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(&TEST_MAGIC_BYTES[..TEST_MAGIC_BYTES_LEN - 1])
|
||||
.expect("should write");
|
||||
|
||||
match Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap()) {
|
||||
Err(FileError::Io(e)) => assert_eq!(e.kind(), std::io::ErrorKind::UnexpectedEof),
|
||||
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||
};
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn new_fails_if_magic_bytes_are_invalid() {
|
||||
let invalid_magic_bytes = "ldkfs0000000";
|
||||
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(invalid_magic_bytes.as_bytes())
|
||||
.expect("should write");
|
||||
|
||||
match Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap()) {
|
||||
Err(FileError::InvalidMagicBytes { got, .. }) => {
|
||||
assert_eq!(got, invalid_magic_bytes.as_bytes())
|
||||
}
|
||||
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||
};
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn append_changeset_truncates_invalid_bytes() {
|
||||
// initial data to write to file (magic bytes + invalid data)
|
||||
let mut data = [255_u8; 2000];
|
||||
data[..TEST_MAGIC_BYTES_LEN].copy_from_slice(&TEST_MAGIC_BYTES);
|
||||
|
||||
let changeset = vec!["one".into(), "two".into(), "three!".into()];
|
||||
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(&data).expect("should write");
|
||||
|
||||
let mut store = Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap())
|
||||
.expect("should open");
|
||||
match store.iter_changesets().next() {
|
||||
Some(Err(IterError::Bincode(_))) => {}
|
||||
unexpected_res => panic!("unexpected result: {:?}", unexpected_res),
|
||||
}
|
||||
|
||||
store.append_changeset(&changeset).expect("should append");
|
||||
|
||||
drop(store);
|
||||
|
||||
let got_bytes = {
|
||||
let mut buf = Vec::new();
|
||||
file.reopen()
|
||||
.unwrap()
|
||||
.read_to_end(&mut buf)
|
||||
.expect("should read");
|
||||
buf
|
||||
};
|
||||
|
||||
let expected_bytes = {
|
||||
let mut buf = TEST_MAGIC_BYTES.to_vec();
|
||||
DefaultOptions::new()
|
||||
.with_varint_encoding()
|
||||
.serialize_into(&mut buf, &changeset)
|
||||
.expect("should encode");
|
||||
buf
|
||||
};
|
||||
|
||||
assert_eq!(got_bytes, expected_bytes);
|
||||
}
|
||||
}
|
||||
@@ -1 +0,0 @@
|
||||
|
||||
@@ -1,17 +0,0 @@
|
||||
[package]
|
||||
name = "example_cli"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../crates/chain", features = ["serde", "miniscript"]}
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
bdk_tmp_plan = { path = "../../nursery/tmp_plan" }
|
||||
bdk_coin_select = { path = "../../nursery/coin_select" }
|
||||
|
||||
clap = { version = "3.2.23", features = ["derive", "env"] }
|
||||
anyhow = "1"
|
||||
serde = { version = "1", features = ["derive"] }
|
||||
serde_json = { version = "^1.0" }
|
||||
@@ -1,736 +0,0 @@
|
||||
pub use anyhow;
|
||||
use anyhow::Context;
|
||||
use bdk_coin_select::{coin_select_bnb, CoinSelector, CoinSelectorOpt, WeightedValue};
|
||||
use bdk_file_store::Store;
|
||||
use serde::{de::DeserializeOwned, Serialize};
|
||||
use std::{cmp::Reverse, collections::HashMap, path::PathBuf, sync::Mutex, time::Duration};
|
||||
|
||||
use bdk_chain::{
|
||||
bitcoin::{
|
||||
psbt::Prevouts, secp256k1::Secp256k1, util::sighash::SighashCache, Address, LockTime,
|
||||
Network, Sequence, Transaction, TxIn, TxOut,
|
||||
},
|
||||
indexed_tx_graph::{IndexedAdditions, IndexedTxGraph},
|
||||
keychain::{DerivationAdditions, KeychainTxOutIndex},
|
||||
miniscript::{
|
||||
descriptor::{DescriptorSecretKey, KeyMap},
|
||||
Descriptor, DescriptorPublicKey,
|
||||
},
|
||||
Anchor, Append, ChainOracle, DescriptorExt, FullTxOut, Persist, PersistBackend,
|
||||
};
|
||||
pub use bdk_file_store;
|
||||
pub use clap;
|
||||
|
||||
use clap::{Parser, Subcommand};
|
||||
|
||||
pub type KeychainTxGraph<A> = IndexedTxGraph<A, KeychainTxOutIndex<Keychain>>;
|
||||
pub type KeychainAdditions<A> = IndexedAdditions<A, DerivationAdditions<Keychain>>;
|
||||
pub type Database<'m, C> = Persist<Store<'m, C>, C>;
|
||||
|
||||
#[derive(Parser)]
|
||||
#[clap(author, version, about, long_about = None)]
|
||||
#[clap(propagate_version = true)]
|
||||
pub struct Args<S: clap::Subcommand> {
|
||||
#[clap(env = "DESCRIPTOR")]
|
||||
pub descriptor: String,
|
||||
#[clap(env = "CHANGE_DESCRIPTOR")]
|
||||
pub change_descriptor: Option<String>,
|
||||
|
||||
#[clap(env = "BITCOIN_NETWORK", long, default_value = "signet")]
|
||||
pub network: Network,
|
||||
|
||||
#[clap(env = "BDK_DB_PATH", long, default_value = ".bdk_example_db")]
|
||||
pub db_path: PathBuf,
|
||||
|
||||
#[clap(env = "BDK_CP_LIMIT", long, default_value = "20")]
|
||||
pub cp_limit: usize,
|
||||
|
||||
#[clap(subcommand)]
|
||||
pub command: Commands<S>,
|
||||
}
|
||||
|
||||
#[allow(clippy::almost_swapped)]
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
pub enum Commands<S: clap::Subcommand> {
|
||||
#[clap(flatten)]
|
||||
ChainSpecific(S),
|
||||
/// Address generation and inspection.
|
||||
Address {
|
||||
#[clap(subcommand)]
|
||||
addr_cmd: AddressCmd,
|
||||
},
|
||||
/// Get the wallet balance.
|
||||
Balance,
|
||||
/// TxOut related commands.
|
||||
#[clap(name = "txout")]
|
||||
TxOut {
|
||||
#[clap(subcommand)]
|
||||
txout_cmd: TxOutCmd,
|
||||
},
|
||||
/// Send coins to an address.
|
||||
Send {
|
||||
value: u64,
|
||||
address: Address,
|
||||
#[clap(short, default_value = "bnb")]
|
||||
coin_select: CoinSelectionAlgo,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum CoinSelectionAlgo {
|
||||
LargestFirst,
|
||||
SmallestFirst,
|
||||
OldestFirst,
|
||||
NewestFirst,
|
||||
BranchAndBound,
|
||||
}
|
||||
|
||||
impl Default for CoinSelectionAlgo {
|
||||
fn default() -> Self {
|
||||
Self::LargestFirst
|
||||
}
|
||||
}
|
||||
|
||||
impl core::str::FromStr for CoinSelectionAlgo {
|
||||
type Err = anyhow::Error;
|
||||
|
||||
fn from_str(s: &str) -> Result<Self, Self::Err> {
|
||||
use CoinSelectionAlgo::*;
|
||||
Ok(match s {
|
||||
"largest-first" => LargestFirst,
|
||||
"smallest-first" => SmallestFirst,
|
||||
"oldest-first" => OldestFirst,
|
||||
"newest-first" => NewestFirst,
|
||||
"bnb" => BranchAndBound,
|
||||
unknown => {
|
||||
return Err(anyhow::anyhow!(
|
||||
"unknown coin selection algorithm '{}'",
|
||||
unknown
|
||||
))
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for CoinSelectionAlgo {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
use CoinSelectionAlgo::*;
|
||||
write!(
|
||||
f,
|
||||
"{}",
|
||||
match self {
|
||||
LargestFirst => "largest-first",
|
||||
SmallestFirst => "smallest-first",
|
||||
OldestFirst => "oldest-first",
|
||||
NewestFirst => "newest-first",
|
||||
BranchAndBound => "bnb",
|
||||
}
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::almost_swapped)]
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
pub enum AddressCmd {
|
||||
/// Get the next unused address.
|
||||
Next,
|
||||
/// Get a new address regardless of the existing unused addresses.
|
||||
New,
|
||||
/// List all addresses
|
||||
List {
|
||||
#[clap(long)]
|
||||
change: bool,
|
||||
},
|
||||
Index,
|
||||
}
|
||||
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
pub enum TxOutCmd {
|
||||
List {
|
||||
/// Return only spent outputs.
|
||||
#[clap(short, long)]
|
||||
spent: bool,
|
||||
/// Return only unspent outputs.
|
||||
#[clap(short, long)]
|
||||
unspent: bool,
|
||||
/// Return only confirmed outputs.
|
||||
#[clap(long)]
|
||||
confirmed: bool,
|
||||
/// Return only unconfirmed outputs.
|
||||
#[clap(long)]
|
||||
unconfirmed: bool,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(
|
||||
Debug, Clone, Copy, PartialOrd, Ord, PartialEq, Eq, serde::Deserialize, serde::Serialize,
|
||||
)]
|
||||
pub enum Keychain {
|
||||
External,
|
||||
Internal,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for Keychain {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
match self {
|
||||
Keychain::External => write!(f, "external"),
|
||||
Keychain::Internal => write!(f, "internal"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn run_address_cmd<A, C>(
|
||||
graph: &mut KeychainTxGraph<A>,
|
||||
db: &Mutex<Database<C>>,
|
||||
network: Network,
|
||||
cmd: AddressCmd,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainAdditions<A>>,
|
||||
{
|
||||
let index = &mut graph.index;
|
||||
|
||||
match cmd {
|
||||
AddressCmd::Next | AddressCmd::New => {
|
||||
let spk_chooser = match cmd {
|
||||
AddressCmd::Next => KeychainTxOutIndex::next_unused_spk,
|
||||
AddressCmd::New => KeychainTxOutIndex::reveal_next_spk,
|
||||
_ => unreachable!("only these two variants exist in match arm"),
|
||||
};
|
||||
|
||||
let ((spk_i, spk), index_additions) = spk_chooser(index, &Keychain::External);
|
||||
let db = &mut *db.lock().unwrap();
|
||||
db.stage(C::from(KeychainAdditions::from(index_additions)));
|
||||
db.commit()?;
|
||||
let addr = Address::from_script(spk, network).context("failed to derive address")?;
|
||||
println!("[address @ {}] {}", spk_i, addr);
|
||||
Ok(())
|
||||
}
|
||||
AddressCmd::Index => {
|
||||
for (keychain, derivation_index) in index.last_revealed_indices() {
|
||||
println!("{:?}: {}", keychain, derivation_index);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
AddressCmd::List { change } => {
|
||||
let target_keychain = match change {
|
||||
true => Keychain::Internal,
|
||||
false => Keychain::External,
|
||||
};
|
||||
for (spk_i, spk) in index.revealed_spks_of_keychain(&target_keychain) {
|
||||
let address = Address::from_script(spk, network)
|
||||
.expect("should always be able to derive address");
|
||||
println!(
|
||||
"{:?} {} used:{}",
|
||||
spk_i,
|
||||
address,
|
||||
index.is_used(&(target_keychain, spk_i))
|
||||
);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn run_balance_cmd<A: Anchor, O: ChainOracle>(
|
||||
graph: &KeychainTxGraph<A>,
|
||||
chain: &O,
|
||||
) -> Result<(), O::Error> {
|
||||
fn print_balances<'a>(title_str: &'a str, items: impl IntoIterator<Item = (&'a str, u64)>) {
|
||||
println!("{}:", title_str);
|
||||
for (name, amount) in items.into_iter() {
|
||||
println!(" {:<10} {:>12} sats", name, amount)
|
||||
}
|
||||
}
|
||||
|
||||
let balance = graph.graph().try_balance(
|
||||
chain,
|
||||
chain.get_chain_tip()?.unwrap_or_default(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)?;
|
||||
|
||||
let confirmed_total = balance.confirmed + balance.immature;
|
||||
let unconfirmed_total = balance.untrusted_pending + balance.trusted_pending;
|
||||
|
||||
print_balances(
|
||||
"confirmed",
|
||||
[
|
||||
("total", confirmed_total),
|
||||
("spendable", balance.confirmed),
|
||||
("immature", balance.immature),
|
||||
],
|
||||
);
|
||||
print_balances(
|
||||
"unconfirmed",
|
||||
[
|
||||
("total", unconfirmed_total),
|
||||
("trusted", balance.trusted_pending),
|
||||
("untrusted", balance.untrusted_pending),
|
||||
],
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn run_txo_cmd<A: Anchor, O: ChainOracle>(
|
||||
graph: &KeychainTxGraph<A>,
|
||||
chain: &O,
|
||||
network: Network,
|
||||
cmd: TxOutCmd,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
{
|
||||
let chain_tip = chain.get_chain_tip()?.unwrap_or_default();
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
|
||||
match cmd {
|
||||
TxOutCmd::List {
|
||||
spent,
|
||||
unspent,
|
||||
confirmed,
|
||||
unconfirmed,
|
||||
} => {
|
||||
let txouts = graph
|
||||
.graph()
|
||||
.try_filter_chain_txouts(chain, chain_tip, outpoints)
|
||||
.filter(|r| match r {
|
||||
Ok((_, full_txo)) => match (spent, unspent) {
|
||||
(true, false) => full_txo.spent_by.is_some(),
|
||||
(false, true) => full_txo.spent_by.is_none(),
|
||||
_ => true,
|
||||
},
|
||||
// always keep errored items
|
||||
Err(_) => true,
|
||||
})
|
||||
.filter(|r| match r {
|
||||
Ok((_, full_txo)) => match (confirmed, unconfirmed) {
|
||||
(true, false) => full_txo.chain_position.is_confirmed(),
|
||||
(false, true) => !full_txo.chain_position.is_confirmed(),
|
||||
_ => true,
|
||||
},
|
||||
// always keep errored items
|
||||
Err(_) => true,
|
||||
})
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
for (spk_i, full_txo) in txouts {
|
||||
let addr = Address::from_script(&full_txo.txout.script_pubkey, network)?;
|
||||
println!(
|
||||
"{:?} {} {} {} spent:{:?}",
|
||||
spk_i, full_txo.txout.value, full_txo.outpoint, addr, full_txo.spent_by
|
||||
)
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::too_many_arguments)]
|
||||
pub fn run_send_cmd<A: Anchor, O: ChainOracle, C>(
|
||||
graph: &Mutex<KeychainTxGraph<A>>,
|
||||
db: &Mutex<Database<'_, C>>,
|
||||
chain: &O,
|
||||
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||
cs_algorithm: CoinSelectionAlgo,
|
||||
address: Address,
|
||||
value: u64,
|
||||
broadcast: impl FnOnce(&Transaction) -> anyhow::Result<()>,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainAdditions<A>>,
|
||||
{
|
||||
let (transaction, change_index) = {
|
||||
let graph = &mut *graph.lock().unwrap();
|
||||
// take mutable ref to construct tx -- it is only open for a short time while building it.
|
||||
let (tx, change_info) = create_tx(graph, chain, keymap, cs_algorithm, address, value)?;
|
||||
|
||||
if let Some((index_additions, (change_keychain, index))) = change_info {
|
||||
// We must first persist to disk the fact that we've got a new address from the
|
||||
// change keychain so future scans will find the tx we're about to broadcast.
|
||||
// If we're unable to persist this, then we don't want to broadcast.
|
||||
{
|
||||
let db = &mut *db.lock().unwrap();
|
||||
db.stage(C::from(KeychainAdditions::from(index_additions)));
|
||||
db.commit()?;
|
||||
}
|
||||
|
||||
// We don't want other callers/threads to use this address while we're using it
|
||||
// but we also don't want to scan the tx we just created because it's not
|
||||
// technically in the blockchain yet.
|
||||
graph.index.mark_used(&change_keychain, index);
|
||||
(tx, Some((change_keychain, index)))
|
||||
} else {
|
||||
(tx, None)
|
||||
}
|
||||
};
|
||||
|
||||
match (broadcast)(&transaction) {
|
||||
Ok(_) => {
|
||||
println!("Broadcasted Tx : {}", transaction.txid());
|
||||
|
||||
let keychain_additions = graph.lock().unwrap().insert_tx(&transaction, None, None);
|
||||
|
||||
// We know the tx is at least unconfirmed now. Note if persisting here fails,
|
||||
// it's not a big deal since we can always find it again form
|
||||
// blockchain.
|
||||
db.lock().unwrap().stage(C::from(keychain_additions));
|
||||
Ok(())
|
||||
}
|
||||
Err(e) => {
|
||||
if let Some((keychain, index)) = change_index {
|
||||
// We failed to broadcast, so allow our change address to be used in the future
|
||||
graph.lock().unwrap().index.unmark_used(&keychain, index);
|
||||
}
|
||||
Err(e)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::type_complexity)]
|
||||
pub fn create_tx<A: Anchor, O: ChainOracle>(
|
||||
graph: &mut KeychainTxGraph<A>,
|
||||
chain: &O,
|
||||
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||
cs_algorithm: CoinSelectionAlgo,
|
||||
address: Address,
|
||||
value: u64,
|
||||
) -> anyhow::Result<(
|
||||
Transaction,
|
||||
Option<(DerivationAdditions<Keychain>, (Keychain, u32))>,
|
||||
)>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
{
|
||||
let mut additions = DerivationAdditions::default();
|
||||
|
||||
let assets = bdk_tmp_plan::Assets {
|
||||
keys: keymap.iter().map(|(pk, _)| pk.clone()).collect(),
|
||||
..Default::default()
|
||||
};
|
||||
|
||||
// TODO use planning module
|
||||
let mut candidates = planned_utxos(graph, chain, &assets)?;
|
||||
|
||||
// apply coin selection algorithm
|
||||
match cs_algorithm {
|
||||
CoinSelectionAlgo::LargestFirst => {
|
||||
candidates.sort_by_key(|(_, utxo)| Reverse(utxo.txout.value))
|
||||
}
|
||||
CoinSelectionAlgo::SmallestFirst => candidates.sort_by_key(|(_, utxo)| utxo.txout.value),
|
||||
CoinSelectionAlgo::OldestFirst => {
|
||||
candidates.sort_by_key(|(_, utxo)| utxo.chain_position.clone())
|
||||
}
|
||||
CoinSelectionAlgo::NewestFirst => {
|
||||
candidates.sort_by_key(|(_, utxo)| Reverse(utxo.chain_position.clone()))
|
||||
}
|
||||
CoinSelectionAlgo::BranchAndBound => {}
|
||||
}
|
||||
|
||||
// turn the txos we chose into weight and value
|
||||
let wv_candidates = candidates
|
||||
.iter()
|
||||
.map(|(plan, utxo)| {
|
||||
WeightedValue::new(
|
||||
utxo.txout.value,
|
||||
plan.expected_weight() as _,
|
||||
plan.witness_version().is_some(),
|
||||
)
|
||||
})
|
||||
.collect();
|
||||
|
||||
let mut outputs = vec![TxOut {
|
||||
value,
|
||||
script_pubkey: address.script_pubkey(),
|
||||
}];
|
||||
|
||||
let internal_keychain = if graph.index.keychains().get(&Keychain::Internal).is_some() {
|
||||
Keychain::Internal
|
||||
} else {
|
||||
Keychain::External
|
||||
};
|
||||
|
||||
let ((change_index, change_script), change_additions) =
|
||||
graph.index.next_unused_spk(&internal_keychain);
|
||||
additions.append(change_additions);
|
||||
|
||||
// Clone to drop the immutable reference.
|
||||
let change_script = change_script.clone();
|
||||
|
||||
let change_plan = bdk_tmp_plan::plan_satisfaction(
|
||||
&graph
|
||||
.index
|
||||
.keychains()
|
||||
.get(&internal_keychain)
|
||||
.expect("must exist")
|
||||
.at_derivation_index(change_index),
|
||||
&assets,
|
||||
)
|
||||
.expect("failed to obtain change plan");
|
||||
|
||||
let mut change_output = TxOut {
|
||||
value: 0,
|
||||
script_pubkey: change_script,
|
||||
};
|
||||
|
||||
let cs_opts = CoinSelectorOpt {
|
||||
target_feerate: 0.5,
|
||||
min_drain_value: graph
|
||||
.index
|
||||
.keychains()
|
||||
.get(&internal_keychain)
|
||||
.expect("must exist")
|
||||
.dust_value(),
|
||||
..CoinSelectorOpt::fund_outputs(
|
||||
&outputs,
|
||||
&change_output,
|
||||
change_plan.expected_weight() as u32,
|
||||
)
|
||||
};
|
||||
|
||||
// TODO: How can we make it easy to shuffle in order of inputs and outputs here?
|
||||
// apply coin selection by saying we need to fund these outputs
|
||||
let mut coin_selector = CoinSelector::new(&wv_candidates, &cs_opts);
|
||||
|
||||
// just select coins in the order provided until we have enough
|
||||
// only use the first result (least waste)
|
||||
let selection = match cs_algorithm {
|
||||
CoinSelectionAlgo::BranchAndBound => {
|
||||
coin_select_bnb(Duration::from_secs(10), coin_selector.clone())
|
||||
.map_or_else(|| coin_selector.select_until_finished(), |cs| cs.finish())?
|
||||
}
|
||||
_ => coin_selector.select_until_finished()?,
|
||||
};
|
||||
let (_, selection_meta) = selection.best_strategy();
|
||||
|
||||
// get the selected utxos
|
||||
let selected_txos = selection.apply_selection(&candidates).collect::<Vec<_>>();
|
||||
|
||||
if let Some(drain_value) = selection_meta.drain_value {
|
||||
change_output.value = drain_value;
|
||||
// if the selection tells us to use change and the change value is sufficient, we add it as an output
|
||||
outputs.push(change_output)
|
||||
}
|
||||
|
||||
let mut transaction = Transaction {
|
||||
version: 0x02,
|
||||
// because the temporary planning module does not support timelocks, we can use the chain
|
||||
// tip as the `lock_time` for anti-fee-sniping purposes
|
||||
lock_time: chain
|
||||
.get_chain_tip()?
|
||||
.and_then(|block_id| LockTime::from_height(block_id.height).ok())
|
||||
.unwrap_or(LockTime::ZERO)
|
||||
.into(),
|
||||
input: selected_txos
|
||||
.iter()
|
||||
.map(|(_, utxo)| TxIn {
|
||||
previous_output: utxo.outpoint,
|
||||
sequence: Sequence::ENABLE_RBF_NO_LOCKTIME,
|
||||
..Default::default()
|
||||
})
|
||||
.collect(),
|
||||
output: outputs,
|
||||
};
|
||||
|
||||
let prevouts = selected_txos
|
||||
.iter()
|
||||
.map(|(_, utxo)| utxo.txout.clone())
|
||||
.collect::<Vec<_>>();
|
||||
let sighash_prevouts = Prevouts::All(&prevouts);
|
||||
|
||||
// first, set tx values for the plan so that we don't change them while signing
|
||||
for (i, (plan, _)) in selected_txos.iter().enumerate() {
|
||||
if let Some(sequence) = plan.required_sequence() {
|
||||
transaction.input[i].sequence = sequence
|
||||
}
|
||||
}
|
||||
|
||||
// create a short lived transaction
|
||||
let _sighash_tx = transaction.clone();
|
||||
let mut sighash_cache = SighashCache::new(&_sighash_tx);
|
||||
|
||||
for (i, (plan, _)) in selected_txos.iter().enumerate() {
|
||||
let requirements = plan.requirements();
|
||||
let mut auth_data = bdk_tmp_plan::SatisfactionMaterial::default();
|
||||
assert!(
|
||||
!requirements.requires_hash_preimages(),
|
||||
"can't have hash pre-images since we didn't provide any."
|
||||
);
|
||||
assert!(
|
||||
requirements.signatures.sign_with_keymap(
|
||||
i,
|
||||
keymap,
|
||||
&sighash_prevouts,
|
||||
None,
|
||||
None,
|
||||
&mut sighash_cache,
|
||||
&mut auth_data,
|
||||
&Secp256k1::default(),
|
||||
)?,
|
||||
"we should have signed with this input."
|
||||
);
|
||||
|
||||
match plan.try_complete(&auth_data) {
|
||||
bdk_tmp_plan::PlanState::Complete {
|
||||
final_script_sig,
|
||||
final_script_witness,
|
||||
} => {
|
||||
if let Some(witness) = final_script_witness {
|
||||
transaction.input[i].witness = witness;
|
||||
}
|
||||
|
||||
if let Some(script_sig) = final_script_sig {
|
||||
transaction.input[i].script_sig = script_sig;
|
||||
}
|
||||
}
|
||||
bdk_tmp_plan::PlanState::Incomplete(_) => {
|
||||
return Err(anyhow::anyhow!(
|
||||
"we weren't able to complete the plan with our keys."
|
||||
));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let change_info = if selection_meta.drain_value.is_some() {
|
||||
Some((additions, (internal_keychain, change_index)))
|
||||
} else {
|
||||
None
|
||||
};
|
||||
|
||||
Ok((transaction, change_info))
|
||||
}
|
||||
|
||||
#[allow(clippy::type_complexity)]
|
||||
pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDerive>(
|
||||
graph: &KeychainTxGraph<A>,
|
||||
chain: &O,
|
||||
assets: &bdk_tmp_plan::Assets<K>,
|
||||
) -> Result<Vec<(bdk_tmp_plan::Plan<K>, FullTxOut<A>)>, O::Error> {
|
||||
let chain_tip = chain.get_chain_tip()?.unwrap_or_default();
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
graph
|
||||
.graph()
|
||||
.try_filter_chain_unspents(chain, chain_tip, outpoints)
|
||||
.filter_map(
|
||||
#[allow(clippy::type_complexity)]
|
||||
|r| -> Option<Result<(bdk_tmp_plan::Plan<K>, FullTxOut<A>), _>> {
|
||||
let (k, i, full_txo) = match r {
|
||||
Err(err) => return Some(Err(err)),
|
||||
Ok(((k, i), full_txo)) => (k, i, full_txo),
|
||||
};
|
||||
let desc = graph
|
||||
.index
|
||||
.keychains()
|
||||
.get(&k)
|
||||
.expect("keychain must exist")
|
||||
.at_derivation_index(i);
|
||||
let plan = bdk_tmp_plan::plan_satisfaction(&desc, assets)?;
|
||||
Some(Ok((plan, full_txo)))
|
||||
},
|
||||
)
|
||||
.collect()
|
||||
}
|
||||
|
||||
pub fn handle_commands<S: clap::Subcommand, A: Anchor, O: ChainOracle, C>(
|
||||
graph: &Mutex<KeychainTxGraph<A>>,
|
||||
db: &Mutex<Database<C>>,
|
||||
chain: &Mutex<O>,
|
||||
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||
network: Network,
|
||||
broadcast: impl FnOnce(&Transaction) -> anyhow::Result<()>,
|
||||
cmd: Commands<S>,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainAdditions<A>>,
|
||||
{
|
||||
match cmd {
|
||||
Commands::ChainSpecific(_) => unreachable!("example code should handle this!"),
|
||||
Commands::Address { addr_cmd } => {
|
||||
let graph = &mut *graph.lock().unwrap();
|
||||
run_address_cmd(graph, db, network, addr_cmd)
|
||||
}
|
||||
Commands::Balance => {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
run_balance_cmd(graph, chain).map_err(anyhow::Error::from)
|
||||
}
|
||||
Commands::TxOut { txout_cmd } => {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
run_txo_cmd(graph, chain, network, txout_cmd)
|
||||
}
|
||||
Commands::Send {
|
||||
value,
|
||||
address,
|
||||
coin_select,
|
||||
} => {
|
||||
let chain = &*chain.lock().unwrap();
|
||||
run_send_cmd(
|
||||
graph,
|
||||
db,
|
||||
chain,
|
||||
keymap,
|
||||
coin_select,
|
||||
address,
|
||||
value,
|
||||
broadcast,
|
||||
)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::type_complexity)]
|
||||
pub fn init<'m, S: clap::Subcommand, C>(
|
||||
db_magic: &'m [u8],
|
||||
db_default_path: &str,
|
||||
) -> anyhow::Result<(
|
||||
Args<S>,
|
||||
KeyMap,
|
||||
KeychainTxOutIndex<Keychain>,
|
||||
Mutex<Database<'m, C>>,
|
||||
C,
|
||||
)>
|
||||
where
|
||||
C: Default + Append + Serialize + DeserializeOwned,
|
||||
{
|
||||
if std::env::var("BDK_DB_PATH").is_err() {
|
||||
std::env::set_var("BDK_DB_PATH", db_default_path);
|
||||
}
|
||||
let args = Args::<S>::parse();
|
||||
let secp = Secp256k1::default();
|
||||
|
||||
let mut index = KeychainTxOutIndex::<Keychain>::default();
|
||||
|
||||
let (descriptor, mut keymap) =
|
||||
Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &args.descriptor)?;
|
||||
index.add_keychain(Keychain::External, descriptor);
|
||||
|
||||
if let Some((internal_descriptor, internal_keymap)) = args
|
||||
.change_descriptor
|
||||
.as_ref()
|
||||
.map(|desc_str| Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, desc_str))
|
||||
.transpose()?
|
||||
{
|
||||
keymap.extend(internal_keymap);
|
||||
index.add_keychain(Keychain::Internal, internal_descriptor);
|
||||
}
|
||||
|
||||
let mut db_backend = match Store::<'m, C>::new_from_path(db_magic, &args.db_path) {
|
||||
Ok(db_backend) => db_backend,
|
||||
// we cannot return `err` directly as it has lifetime `'m`
|
||||
Err(err) => return Err(anyhow::anyhow!("failed to init db backend: {:?}", err)),
|
||||
};
|
||||
|
||||
let init_changeset = db_backend.load_from_persistence()?;
|
||||
|
||||
Ok((
|
||||
args,
|
||||
keymap,
|
||||
index,
|
||||
Mutex::new(Database::new(db_backend)),
|
||||
init_changeset,
|
||||
))
|
||||
}
|
||||
@@ -1,11 +0,0 @@
|
||||
[package]
|
||||
name = "example_electrum"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||
bdk_electrum = { path = "../../crates/electrum" }
|
||||
example_cli = { path = "../example_cli" }
|
||||
@@ -1,318 +0,0 @@
|
||||
use std::{
|
||||
collections::BTreeMap,
|
||||
io::{self, Write},
|
||||
sync::Mutex,
|
||||
};
|
||||
|
||||
use bdk_chain::{
|
||||
bitcoin::{Address, BlockHash, Network, OutPoint, Txid},
|
||||
indexed_tx_graph::{IndexedAdditions, IndexedTxGraph},
|
||||
keychain::LocalChangeSet,
|
||||
local_chain::LocalChain,
|
||||
Append, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bdk_electrum::{
|
||||
electrum_client::{self, ElectrumApi},
|
||||
ElectrumExt, ElectrumUpdate,
|
||||
};
|
||||
use example_cli::{
|
||||
anyhow::{self, Context},
|
||||
clap::{self, Parser, Subcommand},
|
||||
Keychain,
|
||||
};
|
||||
|
||||
const DB_MAGIC: &[u8] = b"bdk_example_electrum";
|
||||
const DB_PATH: &str = ".bdk_electrum_example.db";
|
||||
const ASSUME_FINAL_DEPTH: usize = 10;
|
||||
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
enum ElectrumCommands {
|
||||
/// Scans the addresses in the wallet using the electrum API.
|
||||
Scan {
|
||||
/// When a gap this large has been found for a keychain, it will stop.
|
||||
#[clap(long, default_value = "5")]
|
||||
stop_gap: usize,
|
||||
#[clap(flatten)]
|
||||
scan_options: ScanOptions,
|
||||
},
|
||||
/// Scans particular addresses using the electrum API.
|
||||
Sync {
|
||||
/// Scan all the unused addresses.
|
||||
#[clap(long)]
|
||||
unused_spks: bool,
|
||||
/// Scan every address that you have derived.
|
||||
#[clap(long)]
|
||||
all_spks: bool,
|
||||
/// Scan unspent outpoints for spends or changes to confirmation status of residing tx.
|
||||
#[clap(long)]
|
||||
utxos: bool,
|
||||
/// Scan unconfirmed transactions for updates.
|
||||
#[clap(long)]
|
||||
unconfirmed: bool,
|
||||
#[clap(flatten)]
|
||||
scan_options: ScanOptions,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Parser, Debug, Clone, PartialEq)]
|
||||
pub struct ScanOptions {
|
||||
/// Set batch size for each script_history call to electrum client.
|
||||
#[clap(long, default_value = "25")]
|
||||
pub batch_size: usize,
|
||||
}
|
||||
|
||||
type ChangeSet = LocalChangeSet<Keychain, ConfirmationHeightAnchor>;
|
||||
|
||||
fn main() -> anyhow::Result<()> {
|
||||
let (args, keymap, index, db, init_changeset) =
|
||||
example_cli::init::<ElectrumCommands, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||
|
||||
let graph = Mutex::new({
|
||||
let mut graph = IndexedTxGraph::new(index);
|
||||
graph.apply_additions(init_changeset.indexed_additions);
|
||||
graph
|
||||
});
|
||||
|
||||
let chain = Mutex::new({
|
||||
let mut chain = LocalChain::default();
|
||||
chain.apply_changeset(init_changeset.chain_changeset);
|
||||
chain
|
||||
});
|
||||
|
||||
let electrum_url = match args.network {
|
||||
Network::Bitcoin => "ssl://electrum.blockstream.info:50002",
|
||||
Network::Testnet => "ssl://electrum.blockstream.info:60002",
|
||||
Network::Regtest => "tcp://localhost:60401",
|
||||
Network::Signet => "tcp://signet-electrumx.wakiyamap.dev:50001",
|
||||
};
|
||||
let config = electrum_client::Config::builder()
|
||||
.validate_domain(matches!(args.network, Network::Bitcoin))
|
||||
.build();
|
||||
|
||||
let client = electrum_client::Client::from_config(electrum_url, config)?;
|
||||
|
||||
let electrum_cmd = match &args.command {
|
||||
example_cli::Commands::ChainSpecific(electrum_cmd) => electrum_cmd,
|
||||
general_cmd => {
|
||||
let res = example_cli::handle_commands(
|
||||
&graph,
|
||||
&db,
|
||||
&chain,
|
||||
&keymap,
|
||||
args.network,
|
||||
|tx| {
|
||||
client
|
||||
.transaction_broadcast(tx)
|
||||
.map(|_| ())
|
||||
.map_err(anyhow::Error::from)
|
||||
},
|
||||
general_cmd.clone(),
|
||||
);
|
||||
|
||||
db.lock().unwrap().commit()?;
|
||||
return res;
|
||||
}
|
||||
};
|
||||
|
||||
let response = match electrum_cmd.clone() {
|
||||
ElectrumCommands::Scan {
|
||||
stop_gap,
|
||||
scan_options,
|
||||
} => {
|
||||
let (keychain_spks, local_chain) = {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
|
||||
let keychain_spks = graph
|
||||
.index
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
.map(|(keychain, iter)| {
|
||||
let mut first = true;
|
||||
let spk_iter = iter.inspect(move |(i, _)| {
|
||||
if first {
|
||||
eprint!("\nscanning {}: ", keychain);
|
||||
first = false;
|
||||
}
|
||||
|
||||
eprint!("{} ", i);
|
||||
let _ = io::stdout().flush();
|
||||
});
|
||||
(keychain, spk_iter)
|
||||
})
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
|
||||
let c = chain
|
||||
.blocks()
|
||||
.iter()
|
||||
.rev()
|
||||
.take(ASSUME_FINAL_DEPTH)
|
||||
.map(|(k, v)| (*k, *v))
|
||||
.collect::<BTreeMap<u32, BlockHash>>();
|
||||
|
||||
(keychain_spks, c)
|
||||
};
|
||||
|
||||
client
|
||||
.scan(
|
||||
&local_chain,
|
||||
keychain_spks,
|
||||
core::iter::empty(),
|
||||
core::iter::empty(),
|
||||
stop_gap,
|
||||
scan_options.batch_size,
|
||||
)
|
||||
.context("scanning the blockchain")?
|
||||
}
|
||||
ElectrumCommands::Sync {
|
||||
mut unused_spks,
|
||||
all_spks,
|
||||
mut utxos,
|
||||
mut unconfirmed,
|
||||
scan_options,
|
||||
} => {
|
||||
// Get a short lock on the tracker to get the spks we're interested in
|
||||
let graph = graph.lock().unwrap();
|
||||
let chain = chain.lock().unwrap();
|
||||
let chain_tip = chain.tip().unwrap_or_default();
|
||||
|
||||
if !(all_spks || unused_spks || utxos || unconfirmed) {
|
||||
unused_spks = true;
|
||||
unconfirmed = true;
|
||||
utxos = true;
|
||||
} else if all_spks {
|
||||
unused_spks = false;
|
||||
}
|
||||
|
||||
let mut spks: Box<dyn Iterator<Item = bdk_chain::bitcoin::Script>> =
|
||||
Box::new(core::iter::empty());
|
||||
if all_spks {
|
||||
let all_spks = graph
|
||||
.index
|
||||
.all_spks()
|
||||
.iter()
|
||||
.map(|(k, v)| (*k, v.clone()))
|
||||
.collect::<Vec<_>>();
|
||||
spks = Box::new(spks.chain(all_spks.into_iter().map(|(index, script)| {
|
||||
eprintln!("scanning {:?}", index);
|
||||
script
|
||||
})));
|
||||
}
|
||||
if unused_spks {
|
||||
let unused_spks = graph
|
||||
.index
|
||||
.unused_spks(..)
|
||||
.map(|(k, v)| (*k, v.clone()))
|
||||
.collect::<Vec<_>>();
|
||||
spks = Box::new(spks.chain(unused_spks.into_iter().map(|(index, script)| {
|
||||
eprintln!(
|
||||
"Checking if address {} {:?} has been used",
|
||||
Address::from_script(&script, args.network).unwrap(),
|
||||
index
|
||||
);
|
||||
|
||||
script
|
||||
})));
|
||||
}
|
||||
|
||||
let mut outpoints: Box<dyn Iterator<Item = OutPoint>> = Box::new(core::iter::empty());
|
||||
|
||||
if utxos {
|
||||
let init_outpoints = graph.index.outpoints().iter().cloned();
|
||||
|
||||
let utxos = graph
|
||||
.graph()
|
||||
.filter_chain_unspents(&*chain, chain_tip, init_outpoints)
|
||||
.map(|(_, utxo)| utxo)
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
outpoints = Box::new(
|
||||
utxos
|
||||
.into_iter()
|
||||
.inspect(|utxo| {
|
||||
eprintln!(
|
||||
"Checking if outpoint {} (value: {}) has been spent",
|
||||
utxo.outpoint, utxo.txout.value
|
||||
);
|
||||
})
|
||||
.map(|utxo| utxo.outpoint),
|
||||
);
|
||||
};
|
||||
|
||||
let mut txids: Box<dyn Iterator<Item = Txid>> = Box::new(core::iter::empty());
|
||||
|
||||
if unconfirmed {
|
||||
let unconfirmed_txids = graph
|
||||
.graph()
|
||||
.list_chain_txs(&*chain, chain_tip)
|
||||
.filter(|canonical_tx| !canonical_tx.observed_as.is_confirmed())
|
||||
.map(|canonical_tx| canonical_tx.node.txid)
|
||||
.collect::<Vec<Txid>>();
|
||||
|
||||
txids = Box::new(unconfirmed_txids.into_iter().inspect(|txid| {
|
||||
eprintln!("Checking if {} is confirmed yet", txid);
|
||||
}));
|
||||
}
|
||||
|
||||
let c = chain
|
||||
.blocks()
|
||||
.iter()
|
||||
.rev()
|
||||
.take(ASSUME_FINAL_DEPTH)
|
||||
.map(|(k, v)| (*k, *v))
|
||||
.collect::<BTreeMap<u32, BlockHash>>();
|
||||
|
||||
// drop lock on graph and chain
|
||||
drop((graph, chain));
|
||||
|
||||
let update = client
|
||||
.scan_without_keychain(&c, spks, txids, outpoints, scan_options.batch_size)
|
||||
.context("scanning the blockchain")?;
|
||||
ElectrumUpdate {
|
||||
graph_update: update.graph_update,
|
||||
chain_update: update.chain_update,
|
||||
keychain_update: BTreeMap::new(),
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
let missing_txids = {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
response.missing_full_txs(graph.graph())
|
||||
};
|
||||
|
||||
let now = std::time::UNIX_EPOCH
|
||||
.elapsed()
|
||||
.expect("must get time")
|
||||
.as_secs();
|
||||
|
||||
let final_update = response.finalize(&client, Some(now), missing_txids)?;
|
||||
|
||||
let db_changeset = {
|
||||
let mut chain = chain.lock().unwrap();
|
||||
let mut graph = graph.lock().unwrap();
|
||||
|
||||
let chain_changeset = chain.apply_update(final_update.chain)?;
|
||||
|
||||
let indexed_additions = {
|
||||
let mut additions = IndexedAdditions::<ConfirmationHeightAnchor, _>::default();
|
||||
let (_, index_additions) = graph.index.reveal_to_target_multi(&final_update.keychain);
|
||||
additions.append(IndexedAdditions {
|
||||
index_additions,
|
||||
..Default::default()
|
||||
});
|
||||
additions.append(graph.apply_update(final_update.graph));
|
||||
additions
|
||||
};
|
||||
|
||||
ChangeSet {
|
||||
indexed_additions,
|
||||
chain_changeset,
|
||||
}
|
||||
};
|
||||
|
||||
let mut db = db.lock().unwrap();
|
||||
db.stage(db_changeset);
|
||||
db.commit()?;
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,9 +0,0 @@
|
||||
[package]
|
||||
name = "wallet_electrum_example"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
|
||||
[dependencies]
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_electrum = { path = "../../crates/electrum" }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
@@ -1,93 +0,0 @@
|
||||
const DB_MAGIC: &str = "bdk_wallet_electrum_example";
|
||||
const SEND_AMOUNT: u64 = 5000;
|
||||
const STOP_GAP: usize = 50;
|
||||
const BATCH_SIZE: usize = 5;
|
||||
|
||||
use std::io::Write;
|
||||
use std::str::FromStr;
|
||||
|
||||
use bdk::bitcoin::Address;
|
||||
use bdk::SignOptions;
|
||||
use bdk::{bitcoin::Network, Wallet};
|
||||
use bdk_electrum::electrum_client::{self, ElectrumApi};
|
||||
use bdk_electrum::ElectrumExt;
|
||||
use bdk_file_store::Store;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let db_path = std::env::temp_dir().join("bdk-electrum-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(bdk::wallet::AddressIndex::New);
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance before syncing: {} sats", balance.total());
|
||||
|
||||
print!("Syncing...");
|
||||
let client = electrum_client::Client::new("ssl://electrum.blockstream.info:60002")?;
|
||||
|
||||
let local_chain = wallet.checkpoints();
|
||||
let keychain_spks = wallet
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
.map(|(k, k_spks)| {
|
||||
let mut once = Some(());
|
||||
let mut stdout = std::io::stdout();
|
||||
let k_spks = k_spks
|
||||
.inspect(move |(spk_i, _)| match once.take() {
|
||||
Some(_) => print!("\nScanning keychain [{:?}]", k),
|
||||
None => print!(" {:<3}", spk_i),
|
||||
})
|
||||
.inspect(move |_| stdout.flush().expect("must flush"));
|
||||
(k, k_spks)
|
||||
})
|
||||
.collect();
|
||||
|
||||
let electrum_update =
|
||||
client.scan(local_chain, keychain_spks, None, None, STOP_GAP, BATCH_SIZE)?;
|
||||
|
||||
println!();
|
||||
|
||||
let missing = electrum_update.missing_full_txs(wallet.as_ref());
|
||||
let update = electrum_update.finalize_as_confirmation_time(&client, None, missing)?;
|
||||
|
||||
wallet.apply_update(update)?;
|
||||
wallet.commit()?;
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||
|
||||
if balance.total() < SEND_AMOUNT {
|
||||
println!(
|
||||
"Please send at least {} sats to the receiving address",
|
||||
SEND_AMOUNT
|
||||
);
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?;
|
||||
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
tx_builder
|
||||
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||
.enable_rbf();
|
||||
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized);
|
||||
|
||||
let tx = psbt.extract_tx();
|
||||
client.transaction_broadcast(&tx)?;
|
||||
println!("Tx broadcasted! Txid: {}", tx.txid());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,12 +0,0 @@
|
||||
[package]
|
||||
name = "wallet_esplora"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
publish = false
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["blocking"] }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
@@ -1,94 +0,0 @@
|
||||
const DB_MAGIC: &str = "bdk_wallet_esplora_example";
|
||||
const SEND_AMOUNT: u64 = 5000;
|
||||
const STOP_GAP: usize = 50;
|
||||
const PARALLEL_REQUESTS: usize = 5;
|
||||
|
||||
use std::{io::Write, str::FromStr};
|
||||
|
||||
use bdk::{
|
||||
bitcoin::{Address, Network},
|
||||
wallet::AddressIndex,
|
||||
SignOptions, Wallet,
|
||||
};
|
||||
use bdk_esplora::{esplora_client, EsploraExt};
|
||||
use bdk_file_store::Store;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let db_path = std::env::temp_dir().join("bdk-esplora-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New);
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance before syncing: {} sats", balance.total());
|
||||
|
||||
print!("Syncing...");
|
||||
let client =
|
||||
esplora_client::Builder::new("https://blockstream.info/testnet/api").build_blocking()?;
|
||||
|
||||
let local_chain = wallet.checkpoints();
|
||||
let keychain_spks = wallet
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
.map(|(k, k_spks)| {
|
||||
let mut once = Some(());
|
||||
let mut stdout = std::io::stdout();
|
||||
let k_spks = k_spks
|
||||
.inspect(move |(spk_i, _)| match once.take() {
|
||||
Some(_) => print!("\nScanning keychain [{:?}]", k),
|
||||
None => print!(" {:<3}", spk_i),
|
||||
})
|
||||
.inspect(move |_| stdout.flush().expect("must flush"));
|
||||
(k, k_spks)
|
||||
})
|
||||
.collect();
|
||||
let update = client.scan(
|
||||
local_chain,
|
||||
keychain_spks,
|
||||
None,
|
||||
None,
|
||||
STOP_GAP,
|
||||
PARALLEL_REQUESTS,
|
||||
)?;
|
||||
println!();
|
||||
wallet.apply_update(update)?;
|
||||
wallet.commit()?;
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||
|
||||
if balance.total() < SEND_AMOUNT {
|
||||
println!(
|
||||
"Please send at least {} sats to the receiving address",
|
||||
SEND_AMOUNT
|
||||
);
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?;
|
||||
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
tx_builder
|
||||
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||
.enable_rbf();
|
||||
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized);
|
||||
|
||||
let tx = psbt.extract_tx();
|
||||
client.broadcast(&tx)?;
|
||||
println!("Tx broadcasted! Txid: {}", tx.txid());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,12 +0,0 @@
|
||||
[package]
|
||||
name = "wallet_esplora_async"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["async-https"] }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||
@@ -1,97 +0,0 @@
|
||||
use std::{io::Write, str::FromStr};
|
||||
|
||||
use bdk::{
|
||||
bitcoin::{Address, Network},
|
||||
wallet::AddressIndex,
|
||||
SignOptions, Wallet,
|
||||
};
|
||||
use bdk_esplora::{esplora_client, EsploraAsyncExt};
|
||||
use bdk_file_store::Store;
|
||||
|
||||
const DB_MAGIC: &str = "bdk_wallet_esplora_async_example";
|
||||
const SEND_AMOUNT: u64 = 5000;
|
||||
const STOP_GAP: usize = 50;
|
||||
const PARALLEL_REQUESTS: usize = 5;
|
||||
|
||||
#[tokio::main]
|
||||
async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let db_path = std::env::temp_dir().join("bdk-esplora-async-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New);
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance before syncing: {} sats", balance.total());
|
||||
|
||||
print!("Syncing...");
|
||||
let client =
|
||||
esplora_client::Builder::new("https://blockstream.info/testnet/api").build_async()?;
|
||||
|
||||
let local_chain = wallet.checkpoints();
|
||||
let keychain_spks = wallet
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
.map(|(k, k_spks)| {
|
||||
let mut once = Some(());
|
||||
let mut stdout = std::io::stdout();
|
||||
let k_spks = k_spks
|
||||
.inspect(move |(spk_i, _)| match once.take() {
|
||||
Some(_) => print!("\nScanning keychain [{:?}]", k),
|
||||
None => print!(" {:<3}", spk_i),
|
||||
})
|
||||
.inspect(move |_| stdout.flush().expect("must flush"));
|
||||
(k, k_spks)
|
||||
})
|
||||
.collect();
|
||||
let update = client
|
||||
.scan(
|
||||
local_chain,
|
||||
keychain_spks,
|
||||
[],
|
||||
[],
|
||||
STOP_GAP,
|
||||
PARALLEL_REQUESTS,
|
||||
)
|
||||
.await?;
|
||||
println!();
|
||||
wallet.apply_update(update)?;
|
||||
wallet.commit()?;
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||
|
||||
if balance.total() < SEND_AMOUNT {
|
||||
println!(
|
||||
"Please send at least {} sats to the receiving address",
|
||||
SEND_AMOUNT
|
||||
);
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?;
|
||||
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
tx_builder
|
||||
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||
.enable_rbf();
|
||||
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized);
|
||||
|
||||
let tx = psbt.extract_tx();
|
||||
client.broadcast(&tx).await?;
|
||||
println!("Tx broadcasted! Txid: {}", tx.txid());
|
||||
|
||||
Ok(())
|
||||
}
|
||||
41
examples/compact_filters_balance.rs
Normal file
41
examples/compact_filters_balance.rs
Normal file
@@ -0,0 +1,41 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use bdk::blockchain::compact_filters::*;
|
||||
use bdk::database::MemoryDatabase;
|
||||
use bdk::*;
|
||||
use bitcoin::*;
|
||||
use blockchain::compact_filters::CompactFiltersBlockchain;
|
||||
use blockchain::compact_filters::CompactFiltersError;
|
||||
use log::info;
|
||||
use std::sync::Arc;
|
||||
|
||||
/// This will return wallet balance using compact filters
|
||||
/// Requires a synced local bitcoin node 0.21 running on testnet with blockfilterindex=1 and peerblockfilters=1
|
||||
fn main() -> Result<(), CompactFiltersError> {
|
||||
env_logger::init();
|
||||
info!("start");
|
||||
|
||||
let num_threads = 4;
|
||||
let mempool = Arc::new(Mempool::default());
|
||||
let peers = (0..num_threads)
|
||||
.map(|_| Peer::connect("localhost:18333", Arc::clone(&mempool), Network::Testnet))
|
||||
.collect::<Result<_, _>>()?;
|
||||
let blockchain = CompactFiltersBlockchain::new(peers, "./wallet-filters", Some(500_000))?;
|
||||
info!("done {:?}", blockchain);
|
||||
let descriptor = "wpkh(tpubD6NzVbkrYhZ4X2yy78HWrr1M9NT8dKeWfzNiQqDdMqqa9UmmGztGGz6TaLFGsLfdft5iu32gxq1T4eMNxExNNWzVCpf9Y6JZi5TnqoC9wJq/*)";
|
||||
|
||||
let database = MemoryDatabase::default();
|
||||
let wallet = Arc::new(Wallet::new(descriptor, None, Network::Testnet, database).unwrap());
|
||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||
info!("balance: {}", wallet.get_balance()?);
|
||||
Ok(())
|
||||
}
|
||||
@@ -24,6 +24,7 @@ use bitcoin::Network;
|
||||
use miniscript::policy::Concrete;
|
||||
use miniscript::Descriptor;
|
||||
|
||||
use bdk::database::memory::MemoryDatabase;
|
||||
use bdk::wallet::AddressIndex::New;
|
||||
use bdk::{KeychainKind, Wallet};
|
||||
|
||||
@@ -53,12 +54,14 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
|
||||
info!("Compiled into following Descriptor: \n{}", descriptor);
|
||||
|
||||
let database = MemoryDatabase::new();
|
||||
|
||||
// Create a new wallet from this descriptor
|
||||
let mut wallet = Wallet::new_no_persist(&format!("{}", descriptor), None, Network::Regtest)?;
|
||||
let wallet = Wallet::new(&format!("{}", descriptor), None, Network::Regtest, database)?;
|
||||
|
||||
info!(
|
||||
"First derived address from the descriptor: \n{}",
|
||||
wallet.get_address(New)
|
||||
wallet.get_address(New)?
|
||||
);
|
||||
|
||||
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
||||
87
examples/electrum_backend.rs
Normal file
87
examples/electrum_backend.rs
Normal file
@@ -0,0 +1,87 @@
|
||||
use std::str::FromStr;
|
||||
|
||||
use bdk::bitcoin::bip32::ExtendedPrivKey;
|
||||
use bdk::bitcoin::Network;
|
||||
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||
use bdk::database::MemoryDatabase;
|
||||
use bdk::template::Bip84;
|
||||
use bdk::wallet::export::FullyNodedExport;
|
||||
use bdk::{KeychainKind, SyncOptions, Wallet};
|
||||
|
||||
use bdk::electrum_client::Client;
|
||||
use bdk::wallet::AddressIndex;
|
||||
use bitcoin::bip32;
|
||||
|
||||
pub mod utils;
|
||||
|
||||
use crate::utils::tx::build_signed_tx;
|
||||
|
||||
/// This will create a wallet from an xpriv and get the balance by connecting to an Electrum server.
|
||||
/// If enough amount is available, this will send a transaction to an address.
|
||||
/// Otherwise, this will display a wallet address to receive funds.
|
||||
///
|
||||
/// This can be run with `cargo run --example electrum_backend` in the root folder.
|
||||
fn main() {
|
||||
let network = Network::Testnet;
|
||||
|
||||
let xpriv = "tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy";
|
||||
|
||||
let electrum_url = "ssl://electrum.blockstream.info:60002";
|
||||
|
||||
run(&network, electrum_url, xpriv);
|
||||
}
|
||||
|
||||
fn create_wallet(network: &Network, xpriv: &ExtendedPrivKey) -> Wallet<MemoryDatabase> {
|
||||
Wallet::new(
|
||||
Bip84(*xpriv, KeychainKind::External),
|
||||
Some(Bip84(*xpriv, KeychainKind::Internal)),
|
||||
*network,
|
||||
MemoryDatabase::default(),
|
||||
)
|
||||
.unwrap()
|
||||
}
|
||||
|
||||
fn run(network: &Network, electrum_url: &str, xpriv: &str) {
|
||||
let xpriv = bip32::ExtendedPrivKey::from_str(xpriv).unwrap();
|
||||
|
||||
// Apparently it works only with Electrs (not EletrumX)
|
||||
let blockchain = ElectrumBlockchain::from(Client::new(electrum_url).unwrap());
|
||||
|
||||
let wallet = create_wallet(network, &xpriv);
|
||||
|
||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||
|
||||
println!("address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance().unwrap();
|
||||
|
||||
println!("Available coins in BDK wallet : {} sats", balance);
|
||||
|
||||
if balance.confirmed > 6500 {
|
||||
// the wallet sends the amount to itself.
|
||||
let recipient_address = wallet
|
||||
.get_address(AddressIndex::New)
|
||||
.unwrap()
|
||||
.address
|
||||
.to_string();
|
||||
|
||||
let amount = 5359;
|
||||
|
||||
let tx = build_signed_tx(&wallet, &recipient_address, amount);
|
||||
|
||||
blockchain.broadcast(&tx).unwrap();
|
||||
|
||||
println!("tx id: {}", tx.txid());
|
||||
} else {
|
||||
println!("Insufficient Funds. Fund the wallet with the address above");
|
||||
}
|
||||
|
||||
let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
||||
.map_err(ToString::to_string)
|
||||
.map_err(bdk::Error::Generic)
|
||||
.unwrap();
|
||||
|
||||
println!("------\nWallet Backup: {}", export.to_string());
|
||||
}
|
||||
93
examples/esplora_backend_asynchronous.rs
Normal file
93
examples/esplora_backend_asynchronous.rs
Normal file
@@ -0,0 +1,93 @@
|
||||
use std::str::FromStr;
|
||||
|
||||
use bdk::blockchain::Blockchain;
|
||||
use bdk::{
|
||||
blockchain::esplora::EsploraBlockchain,
|
||||
database::MemoryDatabase,
|
||||
template::Bip84,
|
||||
wallet::{export::FullyNodedExport, AddressIndex},
|
||||
KeychainKind, SyncOptions, Wallet,
|
||||
};
|
||||
use bitcoin::{
|
||||
bip32::{self, ExtendedPrivKey},
|
||||
Network,
|
||||
};
|
||||
|
||||
pub mod utils;
|
||||
|
||||
use crate::utils::tx::build_signed_tx;
|
||||
|
||||
/// This will create a wallet from an xpriv and get the balance by connecting to an Esplora server,
|
||||
/// using non blocking asynchronous calls with `reqwest`.
|
||||
/// If enough amount is available, this will send a transaction to an address.
|
||||
/// Otherwise, this will display a wallet address to receive funds.
|
||||
///
|
||||
/// This can be run with `cargo run --no-default-features --features="use-esplora-reqwest, reqwest-default-tls, async-interface" --example esplora_backend_asynchronous`
|
||||
/// in the root folder.
|
||||
#[tokio::main(flavor = "current_thread")]
|
||||
async fn main() {
|
||||
let network = Network::Signet;
|
||||
|
||||
let xpriv = "tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy";
|
||||
|
||||
let esplora_url = "https://explorer.bc-2.jp/api";
|
||||
|
||||
run(&network, esplora_url, xpriv).await;
|
||||
}
|
||||
|
||||
fn create_wallet(network: &Network, xpriv: &ExtendedPrivKey) -> Wallet<MemoryDatabase> {
|
||||
Wallet::new(
|
||||
Bip84(*xpriv, KeychainKind::External),
|
||||
Some(Bip84(*xpriv, KeychainKind::Internal)),
|
||||
*network,
|
||||
MemoryDatabase::default(),
|
||||
)
|
||||
.unwrap()
|
||||
}
|
||||
|
||||
async fn run(network: &Network, esplora_url: &str, xpriv: &str) {
|
||||
let xpriv = bip32::ExtendedPrivKey::from_str(xpriv).unwrap();
|
||||
|
||||
let blockchain = EsploraBlockchain::new(esplora_url, 20);
|
||||
|
||||
let wallet = create_wallet(network, &xpriv);
|
||||
|
||||
wallet
|
||||
.sync(&blockchain, SyncOptions::default())
|
||||
.await
|
||||
.unwrap();
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||
|
||||
println!("address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance().unwrap();
|
||||
|
||||
println!("Available coins in BDK wallet : {} sats", balance);
|
||||
|
||||
if balance.confirmed > 10500 {
|
||||
// the wallet sends the amount to itself.
|
||||
let recipient_address = wallet
|
||||
.get_address(AddressIndex::New)
|
||||
.unwrap()
|
||||
.address
|
||||
.to_string();
|
||||
|
||||
let amount = 9359;
|
||||
|
||||
let tx = build_signed_tx(&wallet, &recipient_address, amount);
|
||||
|
||||
let _ = blockchain.broadcast(&tx);
|
||||
|
||||
println!("tx id: {}", tx.txid());
|
||||
} else {
|
||||
println!("Insufficient Funds. Fund the wallet with the address above");
|
||||
}
|
||||
|
||||
let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
||||
.map_err(ToString::to_string)
|
||||
.map_err(bdk::Error::Generic)
|
||||
.unwrap();
|
||||
|
||||
println!("------\nWallet Backup: {}", export.to_string());
|
||||
}
|
||||
89
examples/esplora_backend_synchronous.rs
Normal file
89
examples/esplora_backend_synchronous.rs
Normal file
@@ -0,0 +1,89 @@
|
||||
use std::str::FromStr;
|
||||
|
||||
use bdk::blockchain::Blockchain;
|
||||
use bdk::{
|
||||
blockchain::esplora::EsploraBlockchain,
|
||||
database::MemoryDatabase,
|
||||
template::Bip84,
|
||||
wallet::{export::FullyNodedExport, AddressIndex},
|
||||
KeychainKind, SyncOptions, Wallet,
|
||||
};
|
||||
use bitcoin::{
|
||||
bip32::{self, ExtendedPrivKey},
|
||||
Network,
|
||||
};
|
||||
|
||||
pub mod utils;
|
||||
|
||||
use crate::utils::tx::build_signed_tx;
|
||||
|
||||
/// This will create a wallet from an xpriv and get the balance by connecting to an Esplora server,
|
||||
/// using blocking calls with `ureq`.
|
||||
/// If enough amount is available, this will send a transaction to an address.
|
||||
/// Otherwise, this will display a wallet address to receive funds.
|
||||
///
|
||||
/// This can be run with `cargo run --features=use-esplora-ureq --example esplora_backend_synchronous`
|
||||
/// in the root folder.
|
||||
fn main() {
|
||||
let network = Network::Signet;
|
||||
|
||||
let xpriv = "tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy";
|
||||
|
||||
let esplora_url = "https://explorer.bc-2.jp/api";
|
||||
|
||||
run(&network, esplora_url, xpriv);
|
||||
}
|
||||
|
||||
fn create_wallet(network: &Network, xpriv: &ExtendedPrivKey) -> Wallet<MemoryDatabase> {
|
||||
Wallet::new(
|
||||
Bip84(*xpriv, KeychainKind::External),
|
||||
Some(Bip84(*xpriv, KeychainKind::Internal)),
|
||||
*network,
|
||||
MemoryDatabase::default(),
|
||||
)
|
||||
.unwrap()
|
||||
}
|
||||
|
||||
fn run(network: &Network, esplora_url: &str, xpriv: &str) {
|
||||
let xpriv = bip32::ExtendedPrivKey::from_str(xpriv).unwrap();
|
||||
|
||||
let blockchain = EsploraBlockchain::new(esplora_url, 20);
|
||||
|
||||
let wallet = create_wallet(network, &xpriv);
|
||||
|
||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||
|
||||
println!("address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance().unwrap();
|
||||
|
||||
println!("Available coins in BDK wallet : {} sats", balance);
|
||||
|
||||
if balance.confirmed > 10500 {
|
||||
// the wallet sends the amount to itself.
|
||||
let recipient_address = wallet
|
||||
.get_address(AddressIndex::New)
|
||||
.unwrap()
|
||||
.address
|
||||
.to_string();
|
||||
|
||||
let amount = 9359;
|
||||
|
||||
let tx = build_signed_tx(&wallet, &recipient_address, amount);
|
||||
|
||||
blockchain.broadcast(&tx).unwrap();
|
||||
|
||||
println!("tx id: {}", tx.txid());
|
||||
} else {
|
||||
println!("Insufficient Funds. Fund the wallet with the address above");
|
||||
}
|
||||
|
||||
let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
||||
.map_err(ToString::to_string)
|
||||
.map_err(bdk::Error::Generic)
|
||||
.unwrap();
|
||||
|
||||
println!("------\nWallet Backup: {}", export.to_string());
|
||||
}
|
||||
106
examples/hardware_signer.rs
Normal file
106
examples/hardware_signer.rs
Normal file
@@ -0,0 +1,106 @@
|
||||
use bdk::bitcoin::{Address, Network};
|
||||
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||
use bdk::database::MemoryDatabase;
|
||||
use bdk::hwi::HWIClient;
|
||||
use bdk::miniscript::{Descriptor, DescriptorPublicKey};
|
||||
use bdk::signer::SignerOrdering;
|
||||
use bdk::wallet::{hardwaresigner::HWISigner, AddressIndex};
|
||||
use bdk::{FeeRate, KeychainKind, SignOptions, SyncOptions, Wallet};
|
||||
use electrum_client::Client;
|
||||
use std::str::FromStr;
|
||||
use std::sync::Arc;
|
||||
|
||||
// This example shows how to sync a wallet, create a transaction, sign it
|
||||
// and broadcast it using an external hardware wallet.
|
||||
// The hardware wallet must be connected to the computer and unlocked before
|
||||
// running the example. Also, the `hwi` python package should be installed
|
||||
// and available in the environment.
|
||||
//
|
||||
// To avoid loss of funds, consider using an hardware wallet simulator:
|
||||
// * Coldcard: https://github.com/Coldcard/firmware
|
||||
// * Ledger: https://github.com/LedgerHQ/speculos
|
||||
// * Trezor: https://docs.trezor.io/trezor-firmware/core/emulator/index.html
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
println!("Hold tight, I'm connecting to your hardware wallet...");
|
||||
|
||||
// Listing all the available hardware wallet devices...
|
||||
let mut devices = HWIClient::enumerate()?;
|
||||
if devices.is_empty() {
|
||||
panic!("No devices found. Either plug in a hardware wallet, or start a simulator.");
|
||||
}
|
||||
let first_device = devices.remove(0)?;
|
||||
// ...and creating a client out of the first one
|
||||
let client = HWIClient::get_client(&first_device, true, Network::Testnet.into())?;
|
||||
println!("Look what I found, a {}!", first_device.model);
|
||||
|
||||
// Getting the HW's public descriptors
|
||||
let descriptors = client.get_descriptors::<Descriptor<DescriptorPublicKey>>(None)?;
|
||||
println!(
|
||||
"The hardware wallet's descriptor is: {}",
|
||||
descriptors.receive[0]
|
||||
);
|
||||
|
||||
// Creating a custom signer from the device
|
||||
let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||
let mut wallet = Wallet::new(
|
||||
descriptors.receive[0].clone(),
|
||||
Some(descriptors.internal[0].clone()),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
// Adding the hardware signer to the BDK wallet
|
||||
wallet.add_signer(
|
||||
KeychainKind::External,
|
||||
SignerOrdering(200),
|
||||
Arc::new(custom_signer),
|
||||
);
|
||||
|
||||
// create client for Blockstream's testnet electrum server
|
||||
let blockchain =
|
||||
ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||
|
||||
println!("Syncing the wallet...");
|
||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
// get deposit address
|
||||
let deposit_address = wallet.get_address(AddressIndex::New)?;
|
||||
|
||||
let balance = wallet.get_balance()?;
|
||||
println!("Wallet balances in SATs: {}", balance);
|
||||
|
||||
if balance.get_total() < 10000 {
|
||||
println!(
|
||||
"Send some sats from the u01.net testnet faucet to address '{addr}'.\nFaucet URL: https://bitcoinfaucet.uo1.net/?to={addr}",
|
||||
addr = deposit_address.address
|
||||
);
|
||||
return Ok(());
|
||||
}
|
||||
|
||||
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?
|
||||
.require_network(Network::Testnet)?;
|
||||
let (mut psbt, _details) = {
|
||||
let mut builder = wallet.build_tx();
|
||||
builder
|
||||
.drain_wallet()
|
||||
.drain_to(return_address.script_pubkey())
|
||||
.enable_rbf()
|
||||
.fee_rate(FeeRate::from_sat_per_vb(5.0));
|
||||
builder.finish()?
|
||||
};
|
||||
|
||||
// `sign` will call the hardware wallet asking for a signature
|
||||
assert!(
|
||||
wallet.sign(&mut psbt, SignOptions::default())?,
|
||||
"The hardware wallet couldn't finalize the transaction :("
|
||||
);
|
||||
|
||||
println!("Let's broadcast your tx...");
|
||||
let raw_transaction = psbt.extract_tx();
|
||||
let txid = raw_transaction.txid();
|
||||
|
||||
blockchain.broadcast(&raw_transaction)?;
|
||||
println!("Transaction broadcasted! TXID: {txid}.\nExplorer URL: https://mempool.space/testnet/tx/{txid}", txid = txid);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -6,8 +6,8 @@
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use bdk::bitcoin::bip32::DerivationPath;
|
||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||
use bdk::bitcoin::util::bip32::DerivationPath;
|
||||
use bdk::bitcoin::Network;
|
||||
use bdk::descriptor;
|
||||
use bdk::descriptor::IntoWalletDescriptor;
|
||||
121
examples/psbt_signer.rs
Normal file
121
examples/psbt_signer.rs
Normal file
@@ -0,0 +1,121 @@
|
||||
// Copyright (c) 2020-2022 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||
use bdk::database::MemoryDatabase;
|
||||
use bdk::wallet::AddressIndex;
|
||||
use bdk::{descriptor, SyncOptions};
|
||||
use bdk::{FeeRate, SignOptions, Wallet};
|
||||
use bitcoin::secp256k1::Secp256k1;
|
||||
use bitcoin::{Address, Network};
|
||||
use electrum_client::Client;
|
||||
use miniscript::descriptor::DescriptorSecretKey;
|
||||
use std::error::Error;
|
||||
use std::str::FromStr;
|
||||
|
||||
/// This example shows how to sign and broadcast the transaction for a PSBT (Partially Signed
|
||||
/// Bitcoin Transaction) for a single key, witness public key hash (WPKH) based descriptor wallet.
|
||||
/// The electrum protocol is used to sync blockchain data from the testnet bitcoin network and
|
||||
/// wallet data is stored in an ephemeral in-memory database. The process steps are:
|
||||
/// 1. Create a "signing" wallet and a "watch-only" wallet based on the same private keys.
|
||||
/// 2. Deposit testnet funds into the watch only wallet.
|
||||
/// 3. Sync the watch only wallet and create a spending transaction to return all funds to the testnet faucet.
|
||||
/// 4. Sync the signing wallet and sign and finalize the PSBT created by the watch only wallet.
|
||||
/// 5. Broadcast the transactions from the finalized PSBT.
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
// test key created with `bdk-cli key generate` and `bdk-cli key derive` commands
|
||||
let external_secret_xkey = DescriptorSecretKey::from_str("[e9824965/84'/1'/0']tprv8fvem7qWxY3SGCQczQpRpqTKg455wf1zgixn6MZ4ze8gRfHjov5gXBQTadNfDgqs9ERbZZ3Bi1PNYrCCusFLucT39K525MWLpeURjHwUsfX/0/*").unwrap();
|
||||
let internal_secret_xkey = DescriptorSecretKey::from_str("[e9824965/84'/1'/0']tprv8fvem7qWxY3SGCQczQpRpqTKg455wf1zgixn6MZ4ze8gRfHjov5gXBQTadNfDgqs9ERbZZ3Bi1PNYrCCusFLucT39K525MWLpeURjHwUsfX/1/*").unwrap();
|
||||
|
||||
let secp = Secp256k1::new();
|
||||
let external_public_xkey = external_secret_xkey.to_public(&secp).unwrap();
|
||||
let internal_public_xkey = internal_secret_xkey.to_public(&secp).unwrap();
|
||||
|
||||
let signing_external_descriptor = descriptor!(wpkh(external_secret_xkey)).unwrap();
|
||||
let signing_internal_descriptor = descriptor!(wpkh(internal_secret_xkey)).unwrap();
|
||||
|
||||
let watch_only_external_descriptor = descriptor!(wpkh(external_public_xkey)).unwrap();
|
||||
let watch_only_internal_descriptor = descriptor!(wpkh(internal_public_xkey)).unwrap();
|
||||
|
||||
// create client for Blockstream's testnet electrum server
|
||||
let blockchain =
|
||||
ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
||||
|
||||
// create watch only wallet
|
||||
let watch_only_wallet: Wallet<MemoryDatabase> = Wallet::new(
|
||||
watch_only_external_descriptor,
|
||||
Some(watch_only_internal_descriptor),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
// create signing wallet
|
||||
let signing_wallet: Wallet<MemoryDatabase> = Wallet::new(
|
||||
signing_external_descriptor,
|
||||
Some(signing_internal_descriptor),
|
||||
Network::Testnet,
|
||||
MemoryDatabase::default(),
|
||||
)?;
|
||||
|
||||
println!("Syncing watch only wallet.");
|
||||
watch_only_wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
// get deposit address
|
||||
let deposit_address = watch_only_wallet.get_address(AddressIndex::New)?;
|
||||
|
||||
let balance = watch_only_wallet.get_balance()?;
|
||||
println!("Watch only wallet balances in SATs: {}", balance);
|
||||
|
||||
if balance.get_total() < 10000 {
|
||||
println!(
|
||||
"Send at least 10000 SATs (0.0001 BTC) from the u01.net testnet faucet to address '{addr}'.\nFaucet URL: https://bitcoinfaucet.uo1.net/?to={addr}",
|
||||
addr = deposit_address.address
|
||||
);
|
||||
} else if balance.get_spendable() < 10000 {
|
||||
println!(
|
||||
"Wait for at least 10000 SATs of your wallet transactions to be confirmed...\nBe patient, this could take 10 mins or longer depending on how testnet is behaving."
|
||||
);
|
||||
for tx_details in watch_only_wallet
|
||||
.list_transactions(false)?
|
||||
.iter()
|
||||
.filter(|txd| txd.received > 0 && txd.confirmation_time.is_none())
|
||||
{
|
||||
println!(
|
||||
"See unconfirmed tx for {} SATs: https://mempool.space/testnet/tx/{}",
|
||||
tx_details.received, tx_details.txid
|
||||
);
|
||||
}
|
||||
} else {
|
||||
println!("Creating a PSBT sending 9800 SATs plus fee to the u01.net testnet faucet return address 'tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt'.");
|
||||
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?
|
||||
.require_network(Network::Testnet)?;
|
||||
let mut builder = watch_only_wallet.build_tx();
|
||||
builder
|
||||
.add_recipient(return_address.script_pubkey(), 9_800)
|
||||
.enable_rbf()
|
||||
.fee_rate(FeeRate::from_sat_per_vb(1.0));
|
||||
|
||||
let (mut psbt, details) = builder.finish()?;
|
||||
println!("Transaction details: {:#?}", details);
|
||||
println!("Unsigned PSBT: {}", psbt);
|
||||
|
||||
// Sign and finalize the PSBT with the signing wallet
|
||||
let finalized = signing_wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized, "The PSBT was not finalized!");
|
||||
println!("The PSBT has been signed and finalized.");
|
||||
|
||||
// Broadcast the transaction
|
||||
let raw_transaction = psbt.extract_tx();
|
||||
let txid = raw_transaction.txid();
|
||||
|
||||
blockchain.broadcast(&raw_transaction)?;
|
||||
println!("Transaction broadcast! TXID: {txid}.\nExplorer URL: https://mempool.space/testnet/tx/{txid}", txid = txid);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
232
examples/rpcwallet.rs
Normal file
232
examples/rpcwallet.rs
Normal file
@@ -0,0 +1,232 @@
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||
use bdk::bitcoin::Amount;
|
||||
use bdk::bitcoin::Network;
|
||||
use bdk::bitcoincore_rpc::RpcApi;
|
||||
|
||||
use bdk::blockchain::rpc::{Auth, RpcBlockchain, RpcConfig};
|
||||
use bdk::blockchain::ConfigurableBlockchain;
|
||||
|
||||
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
||||
use bdk::keys::{DerivableKey, GeneratableKey, GeneratedKey};
|
||||
|
||||
use bdk::miniscript::miniscript::Segwitv0;
|
||||
|
||||
use bdk::sled;
|
||||
use bdk::template::Bip84;
|
||||
use bdk::wallet::{signer::SignOptions, wallet_name_from_descriptor, AddressIndex, SyncOptions};
|
||||
use bdk::KeychainKind;
|
||||
use bdk::Wallet;
|
||||
|
||||
use bdk::blockchain::Blockchain;
|
||||
|
||||
use electrsd;
|
||||
|
||||
use std::error::Error;
|
||||
use std::path::PathBuf;
|
||||
use std::str::FromStr;
|
||||
|
||||
/// This example demonstrates a typical way to create a wallet and work with bdk.
|
||||
///
|
||||
/// This example bdk wallet is connected to a bitcoin core rpc regtest node,
|
||||
/// and will attempt to receive, create and broadcast transactions.
|
||||
///
|
||||
/// To start a bitcoind regtest node programmatically, this example uses
|
||||
/// `electrsd` library, which is also a bdk dev-dependency.
|
||||
///
|
||||
/// But you can start your own bitcoind backend, and the rest of the example should work fine.
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
// -- Setting up background bitcoind process
|
||||
|
||||
println!(">> Setting up bitcoind");
|
||||
|
||||
// Start the bitcoind process
|
||||
let bitcoind_conf = electrsd::bitcoind::Conf::default();
|
||||
|
||||
// electrsd will automatically download the bitcoin core binaries
|
||||
let bitcoind_exe =
|
||||
electrsd::bitcoind::downloaded_exe_path().expect("We should always have downloaded path");
|
||||
|
||||
// Launch bitcoind and gather authentication access
|
||||
let bitcoind = electrsd::bitcoind::BitcoinD::with_conf(bitcoind_exe, &bitcoind_conf).unwrap();
|
||||
let bitcoind_auth = Auth::Cookie {
|
||||
file: bitcoind.params.cookie_file.clone(),
|
||||
};
|
||||
|
||||
// Get a new core address
|
||||
let core_address = bitcoind
|
||||
.client
|
||||
.get_new_address(None, None)?
|
||||
.require_network(Network::Regtest)?;
|
||||
|
||||
// Generate 101 blocks and use the above address as coinbase
|
||||
bitcoind.client.generate_to_address(101, &core_address)?;
|
||||
|
||||
println!(">> bitcoind setup complete");
|
||||
println!(
|
||||
"Available coins in Core wallet : {}",
|
||||
bitcoind.client.get_balance(None, None)?
|
||||
);
|
||||
|
||||
// -- Setting up the Wallet
|
||||
|
||||
println!("\n>> Setting up BDK wallet");
|
||||
|
||||
// Get a random private key
|
||||
let xprv = generate_random_ext_privkey()?;
|
||||
|
||||
// Use the derived descriptors from the privatekey to
|
||||
// create unique wallet name.
|
||||
// This is a special utility function exposed via `bdk::wallet_name_from_descriptor()`
|
||||
let wallet_name = wallet_name_from_descriptor(
|
||||
Bip84(xprv.clone(), KeychainKind::External),
|
||||
Some(Bip84(xprv.clone(), KeychainKind::Internal)),
|
||||
Network::Regtest,
|
||||
&Secp256k1::new(),
|
||||
)?;
|
||||
|
||||
// Create a database (using default sled type) to store wallet data
|
||||
let mut datadir = PathBuf::from_str("/tmp/")?;
|
||||
datadir.push(".bdk-example");
|
||||
let database = sled::open(datadir)?;
|
||||
let database = database.open_tree(wallet_name.clone())?;
|
||||
|
||||
// Create a RPC configuration of the running bitcoind backend we created in last step
|
||||
// Note: If you are using custom regtest node, use the appropriate url and auth
|
||||
let rpc_config = RpcConfig {
|
||||
url: bitcoind.params.rpc_socket.to_string(),
|
||||
auth: bitcoind_auth,
|
||||
network: Network::Regtest,
|
||||
wallet_name,
|
||||
sync_params: None,
|
||||
};
|
||||
|
||||
// Use the above configuration to create a RPC blockchain backend
|
||||
let blockchain = RpcBlockchain::from_config(&rpc_config)?;
|
||||
|
||||
// Combine Database + Descriptor to create the final wallet
|
||||
let wallet = Wallet::new(
|
||||
Bip84(xprv.clone(), KeychainKind::External),
|
||||
Some(Bip84(xprv.clone(), KeychainKind::Internal)),
|
||||
Network::Regtest,
|
||||
database,
|
||||
)?;
|
||||
|
||||
// The `wallet` and the `blockchain` are independent structs.
|
||||
// The wallet will be used to do all wallet level actions
|
||||
// The blockchain can be used to do all blockchain level actions.
|
||||
// For certain actions (like sync) the wallet will ask for a blockchain.
|
||||
|
||||
// Sync the wallet
|
||||
// The first sync is important as this will instantiate the
|
||||
// wallet files.
|
||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
println!(">> BDK wallet setup complete.");
|
||||
println!(
|
||||
"Available initial coins in BDK wallet : {} sats",
|
||||
wallet.get_balance()?
|
||||
);
|
||||
|
||||
// -- Wallet transaction demonstration
|
||||
|
||||
println!("\n>> Sending coins: Core --> BDK, 10 BTC");
|
||||
// Get a new address to receive coins
|
||||
let bdk_new_addr = wallet.get_address(AddressIndex::New)?.address;
|
||||
|
||||
// Send 10 BTC from core wallet to bdk wallet
|
||||
bitcoind.client.send_to_address(
|
||||
&bdk_new_addr,
|
||||
Amount::from_btc(10.0)?,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
)?;
|
||||
|
||||
// Confirm transaction by generating 1 block
|
||||
bitcoind.client.generate_to_address(1, &core_address)?;
|
||||
|
||||
// Sync the BDK wallet
|
||||
// This time the sync will fetch the new transaction and update it in
|
||||
// wallet database
|
||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
println!(">> Received coins in BDK wallet");
|
||||
println!(
|
||||
"Available balance in BDK wallet: {} sats",
|
||||
wallet.get_balance()?
|
||||
);
|
||||
|
||||
println!("\n>> Sending coins: BDK --> Core, 5 BTC");
|
||||
// Attempt to send back 5.0 BTC to core address by creating a transaction
|
||||
//
|
||||
// Transactions are created using a `TxBuilder`.
|
||||
// This helps us to systematically build a transaction with all
|
||||
// required customization.
|
||||
// A full list of APIs offered by `TxBuilder` can be found at
|
||||
// https://docs.rs/bdk/latest/bdk/wallet/tx_builder/struct.TxBuilder.html
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
|
||||
// For a regular transaction, just set the recipient and amount
|
||||
tx_builder.set_recipients(vec![(core_address.script_pubkey(), 500000000)]);
|
||||
|
||||
// Finalize the transaction and extract the PSBT
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
|
||||
// Set signing option
|
||||
let signopt = SignOptions {
|
||||
assume_height: None,
|
||||
..Default::default()
|
||||
};
|
||||
|
||||
// Sign the psbt
|
||||
wallet.sign(&mut psbt, signopt)?;
|
||||
|
||||
// Extract the signed transaction
|
||||
let tx = psbt.extract_tx();
|
||||
|
||||
// Broadcast the transaction
|
||||
blockchain.broadcast(&tx)?;
|
||||
|
||||
// Confirm transaction by generating some blocks
|
||||
bitcoind.client.generate_to_address(1, &core_address)?;
|
||||
|
||||
// Sync the BDK wallet
|
||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
||||
|
||||
println!(">> Coins sent to Core wallet");
|
||||
println!(
|
||||
"Remaining BDK wallet balance: {} sats",
|
||||
wallet.get_balance()?
|
||||
);
|
||||
println!("\nCongrats!! you made your first test transaction with bdk and bitcoin core.");
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// Helper function demonstrating privatekey extraction using bip39 mnemonic
|
||||
// The mnemonic can be shown to user to safekeeping and the same wallet
|
||||
// private descriptors can be recreated from it.
|
||||
fn generate_random_ext_privkey() -> Result<impl DerivableKey<Segwitv0> + Clone, Box<dyn Error>> {
|
||||
// a Bip39 passphrase can be set optionally
|
||||
let password = Some("random password".to_string());
|
||||
|
||||
// Generate a random mnemonic, and use that to create a "DerivableKey"
|
||||
let mnemonic: GeneratedKey<_, _> = Mnemonic::generate((WordCount::Words12, Language::English))
|
||||
.map_err(|e| e.expect("Unknown Error"))?;
|
||||
|
||||
// `Ok(mnemonic)` would also work if there's no passphrase and it would
|
||||
// yield the same result as this construct with `password` = `None`.
|
||||
Ok((mnemonic, password))
|
||||
}
|
||||
33
examples/utils/mod.rs
Normal file
33
examples/utils/mod.rs
Normal file
@@ -0,0 +1,33 @@
|
||||
pub(crate) mod tx {
|
||||
|
||||
use std::str::FromStr;
|
||||
|
||||
use bdk::{database::BatchDatabase, SignOptions, Wallet};
|
||||
use bitcoin::{Address, Transaction};
|
||||
|
||||
pub fn build_signed_tx<D: BatchDatabase>(
|
||||
wallet: &Wallet<D>,
|
||||
recipient_address: &str,
|
||||
amount: u64,
|
||||
) -> Transaction {
|
||||
// Create a transaction builder
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
|
||||
let to_address = Address::from_str(recipient_address)
|
||||
.unwrap()
|
||||
.require_network(wallet.network())
|
||||
.unwrap();
|
||||
|
||||
// Set recipient of the transaction
|
||||
tx_builder.set_recipients(vec![(to_address.script_pubkey(), amount)]);
|
||||
|
||||
// Finalise the transaction and extract PSBT
|
||||
let (mut psbt, _) = tx_builder.finish().unwrap();
|
||||
|
||||
// Sign the above psbt with signing option
|
||||
wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||
|
||||
// Extract the final transaction
|
||||
psbt.extract_tx()
|
||||
}
|
||||
}
|
||||
24
macros/Cargo.toml
Normal file
24
macros/Cargo.toml
Normal file
@@ -0,0 +1,24 @@
|
||||
[package]
|
||||
name = "bdk-macros"
|
||||
version = "0.6.0"
|
||||
authors = ["Alekos Filini <alekos.filini@gmail.com>"]
|
||||
edition = "2018"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk-macros"
|
||||
description = "Supporting macros for `bdk`"
|
||||
keywords = ["bdk"]
|
||||
license = "MIT OR Apache-2.0"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
syn = { version = "1.0", features = ["parsing", "full"] }
|
||||
proc-macro2 = "1.0"
|
||||
quote = "1.0"
|
||||
|
||||
[features]
|
||||
debug = ["syn/extra-traits"]
|
||||
|
||||
[lib]
|
||||
proc-macro = true
|
||||
146
macros/src/lib.rs
Normal file
146
macros/src/lib.rs
Normal file
@@ -0,0 +1,146 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
#[macro_use]
|
||||
extern crate quote;
|
||||
|
||||
use proc_macro::TokenStream;
|
||||
|
||||
use syn::spanned::Spanned;
|
||||
use syn::{parse, ImplItemMethod, ItemImpl, ItemTrait, Token};
|
||||
|
||||
fn add_async_trait(mut parsed: ItemTrait) -> TokenStream {
|
||||
let output = quote! {
|
||||
#[cfg(not(feature = "async-interface"))]
|
||||
#parsed
|
||||
};
|
||||
|
||||
for mut item in &mut parsed.items {
|
||||
if let syn::TraitItem::Method(m) = &mut item {
|
||||
m.sig.asyncness = Some(Token));
|
||||
}
|
||||
}
|
||||
|
||||
let output = quote! {
|
||||
#output
|
||||
|
||||
#[cfg(feature = "async-interface")]
|
||||
#[async_trait(?Send)]
|
||||
#parsed
|
||||
};
|
||||
|
||||
output.into()
|
||||
}
|
||||
|
||||
fn add_async_method(mut parsed: ImplItemMethod) -> TokenStream {
|
||||
let output = quote! {
|
||||
#[cfg(not(feature = "async-interface"))]
|
||||
#parsed
|
||||
};
|
||||
|
||||
parsed.sig.asyncness = Some(Token));
|
||||
|
||||
let output = quote! {
|
||||
#output
|
||||
|
||||
#[cfg(feature = "async-interface")]
|
||||
#parsed
|
||||
};
|
||||
|
||||
output.into()
|
||||
}
|
||||
|
||||
fn add_async_impl_trait(mut parsed: ItemImpl) -> TokenStream {
|
||||
let output = quote! {
|
||||
#[cfg(not(feature = "async-interface"))]
|
||||
#parsed
|
||||
};
|
||||
|
||||
for mut item in &mut parsed.items {
|
||||
if let syn::ImplItem::Method(m) = &mut item {
|
||||
m.sig.asyncness = Some(Token));
|
||||
}
|
||||
}
|
||||
|
||||
let output = quote! {
|
||||
#output
|
||||
|
||||
#[cfg(feature = "async-interface")]
|
||||
#[async_trait(?Send)]
|
||||
#parsed
|
||||
};
|
||||
|
||||
output.into()
|
||||
}
|
||||
|
||||
/// Makes a method or every method of a trait `async`, if the `async-interface` feature is enabled.
|
||||
///
|
||||
/// Requires the `async-trait` crate as a dependency whenever this attribute is used on a trait
|
||||
/// definition or trait implementation.
|
||||
#[proc_macro_attribute]
|
||||
pub fn maybe_async(_attr: TokenStream, item: TokenStream) -> TokenStream {
|
||||
if let Ok(parsed) = parse(item.clone()) {
|
||||
add_async_trait(parsed)
|
||||
} else if let Ok(parsed) = parse(item.clone()) {
|
||||
add_async_method(parsed)
|
||||
} else if let Ok(parsed) = parse(item) {
|
||||
add_async_impl_trait(parsed)
|
||||
} else {
|
||||
(quote! {
|
||||
compile_error!("#[maybe_async] can only be used on methods, trait or trait impl blocks")
|
||||
})
|
||||
.into()
|
||||
}
|
||||
}
|
||||
|
||||
/// Awaits, if the `async-interface` feature is enabled.
|
||||
#[proc_macro]
|
||||
pub fn maybe_await(expr: TokenStream) -> TokenStream {
|
||||
let expr: proc_macro2::TokenStream = expr.into();
|
||||
let quoted = quote! {
|
||||
{
|
||||
#[cfg(not(feature = "async-interface"))]
|
||||
{
|
||||
#expr
|
||||
}
|
||||
|
||||
#[cfg(feature = "async-interface")]
|
||||
{
|
||||
#expr.await
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
quoted.into()
|
||||
}
|
||||
|
||||
/// Awaits, if the `async-interface` feature is enabled, uses `tokio::Runtime::block_on()` otherwise
|
||||
///
|
||||
/// Requires the `tokio` crate as a dependecy with `rt-core` or `rt-threaded` to build.
|
||||
#[proc_macro]
|
||||
pub fn await_or_block(expr: TokenStream) -> TokenStream {
|
||||
let expr: proc_macro2::TokenStream = expr.into();
|
||||
let quoted = quote! {
|
||||
{
|
||||
#[cfg(not(feature = "async-interface"))]
|
||||
{
|
||||
tokio::runtime::Builder::new_current_thread().enable_all().build().unwrap().block_on(#expr)
|
||||
}
|
||||
|
||||
#[cfg(feature = "async-interface")]
|
||||
{
|
||||
#expr.await
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
quoted.into()
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
# Bitcoin Dev Kit Nursery
|
||||
|
||||
This is a directory for crates that are experimental and have not been released yet.
|
||||
Keep in mind that they may never be released.
|
||||
Things in `/example-crates` may use them to demonsrate how things might look in the future.
|
||||
@@ -1,11 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_coin_select"
|
||||
version = "0.0.1"
|
||||
authors = [ "LLFourn <lloyd.fourn@gmail.com>" ]
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../crates/chain" }
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = []
|
||||
@@ -1,645 +0,0 @@
|
||||
use super::*;
|
||||
|
||||
/// Strategy in which we should branch.
|
||||
pub enum BranchStrategy {
|
||||
/// We continue exploring subtrees of this node, starting with the inclusion branch.
|
||||
Continue,
|
||||
/// We continue exploring ONLY the omission branch of this node, skipping the inclusion branch.
|
||||
SkipInclusion,
|
||||
/// We skip both the inclusion and omission branches of this node.
|
||||
SkipBoth,
|
||||
}
|
||||
|
||||
impl BranchStrategy {
|
||||
pub fn will_continue(&self) -> bool {
|
||||
matches!(self, Self::Continue | Self::SkipInclusion)
|
||||
}
|
||||
}
|
||||
|
||||
/// Closure to decide the branching strategy, alongside a score (if the current selection is a
|
||||
/// candidate solution).
|
||||
pub type DecideStrategy<'c, S> = dyn Fn(&Bnb<'c, S>) -> (BranchStrategy, Option<S>);
|
||||
|
||||
/// [`Bnb`] represents the current state of the BnB algorithm.
|
||||
pub struct Bnb<'c, S> {
|
||||
pub pool: Vec<(usize, &'c WeightedValue)>,
|
||||
pub pool_pos: usize,
|
||||
pub best_score: S,
|
||||
|
||||
pub selection: CoinSelector<'c>,
|
||||
pub rem_abs: u64,
|
||||
pub rem_eff: i64,
|
||||
}
|
||||
|
||||
impl<'c, S: Ord> Bnb<'c, S> {
|
||||
/// Creates a new [`Bnb`].
|
||||
pub fn new(selector: CoinSelector<'c>, pool: Vec<(usize, &'c WeightedValue)>, max: S) -> Self {
|
||||
let (rem_abs, rem_eff) = pool.iter().fold((0, 0), |(abs, eff), (_, c)| {
|
||||
(
|
||||
abs + c.value,
|
||||
eff + c.effective_value(selector.opts.target_feerate),
|
||||
)
|
||||
});
|
||||
|
||||
Self {
|
||||
pool,
|
||||
pool_pos: 0,
|
||||
best_score: max,
|
||||
selection: selector,
|
||||
rem_abs,
|
||||
rem_eff,
|
||||
}
|
||||
}
|
||||
|
||||
/// Turns our [`Bnb`] state into an iterator.
|
||||
///
|
||||
/// `strategy` should assess our current selection/node and determine the branching strategy and
|
||||
/// whether this selection is a candidate solution (if so, return the selection score).
|
||||
pub fn into_iter<'f>(self, strategy: &'f DecideStrategy<'c, S>) -> BnbIter<'c, 'f, S> {
|
||||
BnbIter {
|
||||
state: self,
|
||||
done: false,
|
||||
strategy,
|
||||
}
|
||||
}
|
||||
|
||||
/// Attempt to backtrack to the previously selected node's omission branch, return false
|
||||
/// otherwise (no more solutions).
|
||||
pub fn backtrack(&mut self) -> bool {
|
||||
(0..self.pool_pos).rev().any(|pos| {
|
||||
let (index, candidate) = self.pool[pos];
|
||||
|
||||
if self.selection.is_selected(index) {
|
||||
// deselect the last `pos`, so the next round will check the omission branch
|
||||
self.pool_pos = pos;
|
||||
self.selection.deselect(index);
|
||||
true
|
||||
} else {
|
||||
self.rem_abs += candidate.value;
|
||||
self.rem_eff += candidate.effective_value(self.selection.opts.target_feerate);
|
||||
false
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
/// Continue down this branch and skip the inclusion branch if specified.
|
||||
pub fn forward(&mut self, skip: bool) {
|
||||
let (index, candidate) = self.pool[self.pool_pos];
|
||||
self.rem_abs -= candidate.value;
|
||||
self.rem_eff -= candidate.effective_value(self.selection.opts.target_feerate);
|
||||
|
||||
if !skip {
|
||||
self.selection.select(index);
|
||||
}
|
||||
}
|
||||
|
||||
/// Compare the advertised score with the current best. The new best will be the smaller value. Return true
|
||||
/// if best is replaced.
|
||||
pub fn advertise_new_score(&mut self, score: S) -> bool {
|
||||
if score <= self.best_score {
|
||||
self.best_score = score;
|
||||
return true;
|
||||
}
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
pub struct BnbIter<'c, 'f, S> {
|
||||
state: Bnb<'c, S>,
|
||||
done: bool,
|
||||
|
||||
/// Check our current selection (node) and returns the branching strategy alongside a score
|
||||
/// (if the current selection is a candidate solution).
|
||||
strategy: &'f DecideStrategy<'c, S>,
|
||||
}
|
||||
|
||||
impl<'c, 'f, S: Ord + Copy + Display> Iterator for BnbIter<'c, 'f, S> {
|
||||
type Item = Option<CoinSelector<'c>>;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
if self.done {
|
||||
return None;
|
||||
}
|
||||
|
||||
let (strategy, score) = (self.strategy)(&self.state);
|
||||
|
||||
let mut found_best = Option::<CoinSelector>::None;
|
||||
|
||||
if let Some(score) = score {
|
||||
if self.state.advertise_new_score(score) {
|
||||
found_best = Some(self.state.selection.clone());
|
||||
}
|
||||
}
|
||||
|
||||
debug_assert!(
|
||||
!strategy.will_continue() || self.state.pool_pos < self.state.pool.len(),
|
||||
"Faulty strategy implementation! Strategy suggested that we continue traversing, however, we have already reached the end of the candidates pool! pool_len={}, pool_pos={}",
|
||||
self.state.pool.len(), self.state.pool_pos,
|
||||
);
|
||||
|
||||
match strategy {
|
||||
BranchStrategy::Continue => {
|
||||
self.state.forward(false);
|
||||
}
|
||||
BranchStrategy::SkipInclusion => {
|
||||
self.state.forward(true);
|
||||
}
|
||||
BranchStrategy::SkipBoth => {
|
||||
if !self.state.backtrack() {
|
||||
self.done = true;
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
// increment selection pool position for next round
|
||||
self.state.pool_pos += 1;
|
||||
|
||||
if found_best.is_some() || !self.done {
|
||||
Some(found_best)
|
||||
} else {
|
||||
// we have traversed all branches
|
||||
None
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Determines how we should limit rounds of branch and bound.
|
||||
pub enum BnbLimit {
|
||||
Rounds(usize),
|
||||
#[cfg(feature = "std")]
|
||||
Duration(core::time::Duration),
|
||||
}
|
||||
|
||||
impl From<usize> for BnbLimit {
|
||||
fn from(v: usize) -> Self {
|
||||
Self::Rounds(v)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl From<core::time::Duration> for BnbLimit {
|
||||
fn from(v: core::time::Duration) -> Self {
|
||||
Self::Duration(v)
|
||||
}
|
||||
}
|
||||
|
||||
/// This is a variation of the Branch and Bound Coin Selection algorithm designed by Murch (as seen
|
||||
/// in Bitcoin Core).
|
||||
///
|
||||
/// The differences are as follows:
|
||||
/// * In addition to working with effective values, we also work with absolute values.
|
||||
/// This way, we can use bounds of the absolute values to enforce `min_absolute_fee` (which is used by
|
||||
/// RBF), and `max_extra_target` (which can be used to increase the possible solution set, given
|
||||
/// that the sender is okay with sending extra to the receiver).
|
||||
///
|
||||
/// Murch's Master Thesis: <https://murch.one/wp-content/uploads/2016/11/erhardt2016coinselection.pdf>
|
||||
/// Bitcoin Core Implementation: <https://github.com/bitcoin/bitcoin/blob/23.x/src/wallet/coinselection.cpp#L65>
|
||||
///
|
||||
/// TODO: Another optimization we could do is figure out candidates with the smallest waste, and
|
||||
/// if we find a result with waste equal to this, we can just break.
|
||||
pub fn coin_select_bnb<L>(limit: L, selector: CoinSelector) -> Option<CoinSelector>
|
||||
where
|
||||
L: Into<BnbLimit>,
|
||||
{
|
||||
let opts = selector.opts;
|
||||
|
||||
// prepare the pool of candidates to select from:
|
||||
// * filter out candidates with negative/zero effective values
|
||||
// * sort candidates by descending effective value
|
||||
let pool = {
|
||||
let mut pool = selector
|
||||
.unselected()
|
||||
.filter(|(_, c)| c.effective_value(opts.target_feerate) > 0)
|
||||
.collect::<Vec<_>>();
|
||||
pool.sort_unstable_by(|(_, a), (_, b)| {
|
||||
let a = a.effective_value(opts.target_feerate);
|
||||
let b = b.effective_value(opts.target_feerate);
|
||||
b.cmp(&a)
|
||||
});
|
||||
pool
|
||||
};
|
||||
|
||||
let feerate_decreases = opts.target_feerate > opts.long_term_feerate();
|
||||
|
||||
let target_abs = opts.target_value.unwrap_or(0) + opts.min_absolute_fee;
|
||||
let target_eff = selector.effective_target();
|
||||
|
||||
let upper_bound_abs = target_abs + (opts.drain_weight as f32 * opts.target_feerate) as u64;
|
||||
let upper_bound_eff = target_eff + opts.drain_waste();
|
||||
|
||||
let strategy = move |bnb: &Bnb<i64>| -> (BranchStrategy, Option<i64>) {
|
||||
let selected_abs = bnb.selection.selected_absolute_value();
|
||||
let selected_eff = bnb.selection.selected_effective_value();
|
||||
|
||||
// backtrack if the remaining value is not enough to reach the target
|
||||
if selected_abs + bnb.rem_abs < target_abs || selected_eff + bnb.rem_eff < target_eff {
|
||||
return (BranchStrategy::SkipBoth, None);
|
||||
}
|
||||
|
||||
// backtrack if the selected value has already surpassed upper bounds
|
||||
if selected_abs > upper_bound_abs && selected_eff > upper_bound_eff {
|
||||
return (BranchStrategy::SkipBoth, None);
|
||||
}
|
||||
|
||||
let selected_waste = bnb.selection.selected_waste();
|
||||
|
||||
// when feerate decreases, waste without excess is guaranteed to increase with each
|
||||
// selection. So if we have already surpassed the best score, we can backtrack.
|
||||
if feerate_decreases && selected_waste > bnb.best_score {
|
||||
return (BranchStrategy::SkipBoth, None);
|
||||
}
|
||||
|
||||
// solution?
|
||||
if selected_abs >= target_abs && selected_eff >= target_eff {
|
||||
let waste = selected_waste + bnb.selection.current_excess();
|
||||
return (BranchStrategy::SkipBoth, Some(waste));
|
||||
}
|
||||
|
||||
// early bailout optimization:
|
||||
// If the candidate at the previous position is NOT selected and has the same weight and
|
||||
// value as the current candidate, we can skip selecting the current candidate.
|
||||
if bnb.pool_pos > 0 && !bnb.selection.is_empty() {
|
||||
let (_, candidate) = bnb.pool[bnb.pool_pos];
|
||||
let (prev_index, prev_candidate) = bnb.pool[bnb.pool_pos - 1];
|
||||
|
||||
if !bnb.selection.is_selected(prev_index)
|
||||
&& candidate.value == prev_candidate.value
|
||||
&& candidate.weight == prev_candidate.weight
|
||||
{
|
||||
return (BranchStrategy::SkipInclusion, None);
|
||||
}
|
||||
}
|
||||
|
||||
// check out the inclusion branch first
|
||||
(BranchStrategy::Continue, None)
|
||||
};
|
||||
|
||||
// determine the sum of absolute and effective values for the current selection
|
||||
let (selected_abs, selected_eff) = selector.selected().fold((0, 0), |(abs, eff), (_, c)| {
|
||||
(
|
||||
abs + c.value,
|
||||
eff + c.effective_value(selector.opts.target_feerate),
|
||||
)
|
||||
});
|
||||
|
||||
let bnb = Bnb::new(selector, pool, i64::MAX);
|
||||
|
||||
// not enough to select anyway
|
||||
if selected_abs + bnb.rem_abs < target_abs || selected_eff + bnb.rem_eff < target_eff {
|
||||
return None;
|
||||
}
|
||||
|
||||
match limit.into() {
|
||||
BnbLimit::Rounds(rounds) => {
|
||||
bnb.into_iter(&strategy)
|
||||
.take(rounds)
|
||||
.reduce(|b, c| if c.is_some() { c } else { b })
|
||||
}
|
||||
#[cfg(feature = "std")]
|
||||
BnbLimit::Duration(duration) => {
|
||||
let start = std::time::SystemTime::now();
|
||||
bnb.into_iter(&strategy)
|
||||
.take_while(|_| start.elapsed().expect("failed to get system time") <= duration)
|
||||
.reduce(|b, c| if c.is_some() { c } else { b })
|
||||
}
|
||||
}?
|
||||
}
|
||||
|
||||
#[cfg(all(test, feature = "miniscript"))]
|
||||
mod test {
|
||||
use bitcoin::secp256k1::Secp256k1;
|
||||
|
||||
use crate::coin_select::{evaluate_cs::evaluate, ExcessStrategyKind};
|
||||
|
||||
use super::{
|
||||
coin_select_bnb,
|
||||
evaluate_cs::{Evaluation, EvaluationError},
|
||||
tester::Tester,
|
||||
CoinSelector, CoinSelectorOpt, Vec, WeightedValue,
|
||||
};
|
||||
|
||||
fn tester() -> Tester {
|
||||
const DESC_STR: &str = "tr(xprv9uBuvtdjghkz8D1qzsSXS9Vs64mqrUnXqzNccj2xcvnCHPpXKYE1U2Gbh9CDHk8UPyF2VuXpVkDA7fk5ZP4Hd9KnhUmTscKmhee9Dp5sBMK)";
|
||||
Tester::new(&Secp256k1::default(), DESC_STR)
|
||||
}
|
||||
|
||||
fn evaluate_bnb(
|
||||
initial_selector: CoinSelector,
|
||||
max_tries: usize,
|
||||
) -> Result<Evaluation, EvaluationError> {
|
||||
evaluate(initial_selector, |cs| {
|
||||
coin_select_bnb(max_tries, cs.clone()).map_or(false, |new_cs| {
|
||||
*cs = new_cs;
|
||||
true
|
||||
})
|
||||
})
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn not_enough_coins() {
|
||||
let t = tester();
|
||||
let candidates: Vec<WeightedValue> = vec![
|
||||
t.gen_candidate(0, 100_000).into(),
|
||||
t.gen_candidate(1, 100_000).into(),
|
||||
];
|
||||
let opts = t.gen_opts(200_000);
|
||||
let selector = CoinSelector::new(&candidates, &opts);
|
||||
assert!(!coin_select_bnb(10_000, selector).is_some());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn exactly_enough_coins_preselected() {
|
||||
let t = tester();
|
||||
let candidates: Vec<WeightedValue> = vec![
|
||||
t.gen_candidate(0, 100_000).into(), // to preselect
|
||||
t.gen_candidate(1, 100_000).into(), // to preselect
|
||||
t.gen_candidate(2, 100_000).into(),
|
||||
];
|
||||
let opts = CoinSelectorOpt {
|
||||
target_feerate: 0.0,
|
||||
..t.gen_opts(200_000)
|
||||
};
|
||||
let selector = {
|
||||
let mut selector = CoinSelector::new(&candidates, &opts);
|
||||
selector.select(0); // preselect
|
||||
selector.select(1); // preselect
|
||||
selector
|
||||
};
|
||||
|
||||
let evaluation = evaluate_bnb(selector, 10_000).expect("eval failed");
|
||||
println!("{}", evaluation);
|
||||
assert_eq!(evaluation.solution.selected, (0..=1).collect());
|
||||
assert_eq!(evaluation.solution.excess_strategies.len(), 1);
|
||||
assert_eq!(
|
||||
evaluation.feerate_offset(ExcessStrategyKind::ToFee).floor(),
|
||||
0.0
|
||||
);
|
||||
}
|
||||
|
||||
/// `cost_of_change` acts as the upper-bound in Bnb; we check whether these boundaries are
|
||||
/// enforced in code
|
||||
#[test]
|
||||
fn cost_of_change() {
|
||||
let t = tester();
|
||||
let candidates: Vec<WeightedValue> = vec![
|
||||
t.gen_candidate(0, 200_000).into(),
|
||||
t.gen_candidate(1, 200_000).into(),
|
||||
t.gen_candidate(2, 200_000).into(),
|
||||
];
|
||||
|
||||
// lowest and highest possible `recipient_value` opts for derived `drain_waste`, assuming
|
||||
// that we want 2 candidates selected
|
||||
let (lowest_opts, highest_opts) = {
|
||||
let opts = t.gen_opts(0);
|
||||
|
||||
let fee_from_inputs =
|
||||
(candidates[0].weight as f32 * opts.target_feerate).ceil() as u64 * 2;
|
||||
let fee_from_template =
|
||||
((opts.base_weight + 2) as f32 * opts.target_feerate).ceil() as u64;
|
||||
|
||||
let lowest_opts = CoinSelectorOpt {
|
||||
target_value: Some(
|
||||
400_000 - fee_from_inputs - fee_from_template - opts.drain_waste() as u64,
|
||||
),
|
||||
..opts
|
||||
};
|
||||
|
||||
let highest_opts = CoinSelectorOpt {
|
||||
target_value: Some(400_000 - fee_from_inputs - fee_from_template),
|
||||
..opts
|
||||
};
|
||||
|
||||
(lowest_opts, highest_opts)
|
||||
};
|
||||
|
||||
// test lowest possible target we can select
|
||||
let lowest_eval = evaluate_bnb(CoinSelector::new(&candidates, &lowest_opts), 10_000);
|
||||
assert!(lowest_eval.is_ok());
|
||||
let lowest_eval = lowest_eval.unwrap();
|
||||
println!("LB {}", lowest_eval);
|
||||
assert_eq!(lowest_eval.solution.selected.len(), 2);
|
||||
assert_eq!(lowest_eval.solution.excess_strategies.len(), 1);
|
||||
assert_eq!(
|
||||
lowest_eval
|
||||
.feerate_offset(ExcessStrategyKind::ToFee)
|
||||
.floor(),
|
||||
0.0
|
||||
);
|
||||
|
||||
// test the highest possible target we can select
|
||||
let highest_eval = evaluate_bnb(CoinSelector::new(&candidates, &highest_opts), 10_000);
|
||||
assert!(highest_eval.is_ok());
|
||||
let highest_eval = highest_eval.unwrap();
|
||||
println!("UB {}", highest_eval);
|
||||
assert_eq!(highest_eval.solution.selected.len(), 2);
|
||||
assert_eq!(highest_eval.solution.excess_strategies.len(), 1);
|
||||
assert_eq!(
|
||||
highest_eval
|
||||
.feerate_offset(ExcessStrategyKind::ToFee)
|
||||
.floor(),
|
||||
0.0
|
||||
);
|
||||
|
||||
// test lower out of bounds
|
||||
let loob_opts = CoinSelectorOpt {
|
||||
target_value: lowest_opts.target_value.map(|v| v - 1),
|
||||
..lowest_opts
|
||||
};
|
||||
let loob_eval = evaluate_bnb(CoinSelector::new(&candidates, &loob_opts), 10_000);
|
||||
assert!(loob_eval.is_err());
|
||||
println!("Lower OOB: {}", loob_eval.unwrap_err());
|
||||
|
||||
// test upper out of bounds
|
||||
let uoob_opts = CoinSelectorOpt {
|
||||
target_value: highest_opts.target_value.map(|v| v + 1),
|
||||
..highest_opts
|
||||
};
|
||||
let uoob_eval = evaluate_bnb(CoinSelector::new(&candidates, &uoob_opts), 10_000);
|
||||
assert!(uoob_eval.is_err());
|
||||
println!("Upper OOB: {}", uoob_eval.unwrap_err());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn try_select() {
|
||||
let t = tester();
|
||||
let candidates: Vec<WeightedValue> = vec![
|
||||
t.gen_candidate(0, 300_000).into(),
|
||||
t.gen_candidate(1, 300_000).into(),
|
||||
t.gen_candidate(2, 300_000).into(),
|
||||
t.gen_candidate(3, 200_000).into(),
|
||||
t.gen_candidate(4, 200_000).into(),
|
||||
];
|
||||
let make_opts = |v: u64| -> CoinSelectorOpt {
|
||||
CoinSelectorOpt {
|
||||
target_feerate: 0.0,
|
||||
..t.gen_opts(v)
|
||||
}
|
||||
};
|
||||
|
||||
let test_cases = vec![
|
||||
(make_opts(100_000), false, 0),
|
||||
(make_opts(200_000), true, 1),
|
||||
(make_opts(300_000), true, 1),
|
||||
(make_opts(500_000), true, 2),
|
||||
(make_opts(1_000_000), true, 4),
|
||||
(make_opts(1_200_000), false, 0),
|
||||
(make_opts(1_300_000), true, 5),
|
||||
(make_opts(1_400_000), false, 0),
|
||||
];
|
||||
|
||||
for (opts, expect_solution, expect_selected) in test_cases {
|
||||
let res = evaluate_bnb(CoinSelector::new(&candidates, &opts), 10_000);
|
||||
assert_eq!(res.is_ok(), expect_solution);
|
||||
|
||||
match res {
|
||||
Ok(eval) => {
|
||||
println!("{}", eval);
|
||||
assert_eq!(eval.feerate_offset(ExcessStrategyKind::ToFee), 0.0);
|
||||
assert_eq!(eval.solution.selected.len(), expect_selected as _);
|
||||
}
|
||||
Err(err) => println!("expected failure: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn early_bailout_optimization() {
|
||||
let t = tester();
|
||||
|
||||
// target: 300_000
|
||||
// candidates: 2x of 125_000, 1000x of 100_000, 1x of 50_000
|
||||
// expected solution: 2x 125_000, 1x 50_000
|
||||
// set bnb max tries: 1100, should succeed
|
||||
let candidates = {
|
||||
let mut candidates: Vec<WeightedValue> = vec![
|
||||
t.gen_candidate(0, 125_000).into(),
|
||||
t.gen_candidate(1, 125_000).into(),
|
||||
t.gen_candidate(2, 50_000).into(),
|
||||
];
|
||||
(3..3 + 1000_u32)
|
||||
.for_each(|index| candidates.push(t.gen_candidate(index, 100_000).into()));
|
||||
candidates
|
||||
};
|
||||
let opts = CoinSelectorOpt {
|
||||
target_feerate: 0.0,
|
||||
..t.gen_opts(300_000)
|
||||
};
|
||||
|
||||
let result = evaluate_bnb(CoinSelector::new(&candidates, &opts), 1100);
|
||||
assert!(result.is_ok());
|
||||
|
||||
let eval = result.unwrap();
|
||||
println!("{}", eval);
|
||||
assert_eq!(eval.solution.selected, (0..=2).collect());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn should_exhaust_iteration() {
|
||||
static MAX_TRIES: usize = 1000;
|
||||
let t = tester();
|
||||
let candidates = (0..MAX_TRIES + 1)
|
||||
.map(|index| t.gen_candidate(index as _, 10_000).into())
|
||||
.collect::<Vec<WeightedValue>>();
|
||||
let opts = t.gen_opts(10_001 * MAX_TRIES as u64);
|
||||
let result = evaluate_bnb(CoinSelector::new(&candidates, &opts), MAX_TRIES);
|
||||
assert!(result.is_err());
|
||||
println!("error as expected: {}", result.unwrap_err());
|
||||
}
|
||||
|
||||
/// Solution should have fee >= min_absolute_fee (or no solution at all)
|
||||
#[test]
|
||||
fn min_absolute_fee() {
|
||||
let t = tester();
|
||||
let candidates = {
|
||||
let mut candidates = Vec::new();
|
||||
t.gen_weighted_values(&mut candidates, 5, 10_000);
|
||||
t.gen_weighted_values(&mut candidates, 5, 20_000);
|
||||
t.gen_weighted_values(&mut candidates, 5, 30_000);
|
||||
t.gen_weighted_values(&mut candidates, 10, 10_300);
|
||||
t.gen_weighted_values(&mut candidates, 10, 10_500);
|
||||
t.gen_weighted_values(&mut candidates, 10, 10_700);
|
||||
t.gen_weighted_values(&mut candidates, 10, 10_900);
|
||||
t.gen_weighted_values(&mut candidates, 10, 11_000);
|
||||
t.gen_weighted_values(&mut candidates, 10, 12_000);
|
||||
t.gen_weighted_values(&mut candidates, 10, 13_000);
|
||||
candidates
|
||||
};
|
||||
let mut opts = CoinSelectorOpt {
|
||||
min_absolute_fee: 1,
|
||||
..t.gen_opts(100_000)
|
||||
};
|
||||
|
||||
(1..=120_u64).for_each(|fee_factor| {
|
||||
opts.min_absolute_fee = fee_factor * 31;
|
||||
|
||||
let result = evaluate_bnb(CoinSelector::new(&candidates, &opts), 21_000);
|
||||
match result {
|
||||
Ok(result) => {
|
||||
println!("Solution {}", result);
|
||||
let fee = result.solution.excess_strategies[&ExcessStrategyKind::ToFee].fee;
|
||||
assert!(fee >= opts.min_absolute_fee);
|
||||
assert_eq!(result.solution.excess_strategies.len(), 1);
|
||||
}
|
||||
Err(err) => {
|
||||
println!("No Solution: {}", err);
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
/// For a decreasing feerate (long-term feerate is lower than effective feerate), we should
|
||||
/// select less. For increasing feerate (long-term feerate is higher than effective feerate), we
|
||||
/// should select more.
|
||||
#[test]
|
||||
fn feerate_difference() {
|
||||
let t = tester();
|
||||
let candidates = {
|
||||
let mut candidates = Vec::new();
|
||||
t.gen_weighted_values(&mut candidates, 10, 2_000);
|
||||
t.gen_weighted_values(&mut candidates, 10, 5_000);
|
||||
t.gen_weighted_values(&mut candidates, 10, 20_000);
|
||||
candidates
|
||||
};
|
||||
|
||||
let decreasing_feerate_opts = CoinSelectorOpt {
|
||||
target_feerate: 1.25,
|
||||
long_term_feerate: Some(0.25),
|
||||
..t.gen_opts(100_000)
|
||||
};
|
||||
|
||||
let increasing_feerate_opts = CoinSelectorOpt {
|
||||
target_feerate: 0.25,
|
||||
long_term_feerate: Some(1.25),
|
||||
..t.gen_opts(100_000)
|
||||
};
|
||||
|
||||
let decreasing_res = evaluate_bnb(
|
||||
CoinSelector::new(&candidates, &decreasing_feerate_opts),
|
||||
21_000,
|
||||
)
|
||||
.expect("no result");
|
||||
let decreasing_len = decreasing_res.solution.selected.len();
|
||||
|
||||
let increasing_res = evaluate_bnb(
|
||||
CoinSelector::new(&candidates, &increasing_feerate_opts),
|
||||
21_000,
|
||||
)
|
||||
.expect("no result");
|
||||
let increasing_len = increasing_res.solution.selected.len();
|
||||
|
||||
println!("decreasing_len: {}", decreasing_len);
|
||||
println!("increasing_len: {}", increasing_len);
|
||||
assert!(decreasing_len < increasing_len);
|
||||
}
|
||||
|
||||
/// TODO: UNIMPLEMENTED TESTS:
|
||||
/// * Excess strategies:
|
||||
/// * We should always have `ExcessStrategy::ToFee`.
|
||||
/// * We should only have `ExcessStrategy::ToRecipient` when `max_extra_target > 0`.
|
||||
/// * We should only have `ExcessStrategy::ToDrain` when `drain_value >= min_drain_value`.
|
||||
/// * Fuzz
|
||||
/// * Solution feerate should never be lower than target feerate
|
||||
/// * Solution fee should never be lower than `min_absolute_fee`.
|
||||
/// * Preselected should always remain selected
|
||||
fn _todo() {}
|
||||
}
|
||||
@@ -1,615 +0,0 @@
|
||||
use super::*;
|
||||
|
||||
/// A [`WeightedValue`] represents an input candidate for [`CoinSelector`]. This can either be a
|
||||
/// single UTXO, or a group of UTXOs that should be spent together.
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
pub struct WeightedValue {
|
||||
/// Total value of the UTXO(s) that this [`WeightedValue`] represents.
|
||||
pub value: u64,
|
||||
/// Total weight of including this/these UTXO(s).
|
||||
/// `txin` fields: `prevout`, `nSequence`, `scriptSigLen`, `scriptSig`, `scriptWitnessLen`,
|
||||
/// `scriptWitness` should all be included.
|
||||
pub weight: u32,
|
||||
/// The total number of inputs; so we can calculate extra `varint` weight due to `vin` length changes.
|
||||
pub input_count: usize,
|
||||
/// Whether this [`WeightedValue`] contains at least one segwit spend.
|
||||
pub is_segwit: bool,
|
||||
}
|
||||
|
||||
impl WeightedValue {
|
||||
/// Create a new [`WeightedValue`] that represents a single input.
|
||||
///
|
||||
/// `satisfaction_weight` is the weight of `scriptSigLen + scriptSig + scriptWitnessLen +
|
||||
/// scriptWitness`.
|
||||
pub fn new(value: u64, satisfaction_weight: u32, is_segwit: bool) -> WeightedValue {
|
||||
let weight = TXIN_BASE_WEIGHT + satisfaction_weight;
|
||||
WeightedValue {
|
||||
value,
|
||||
weight,
|
||||
input_count: 1,
|
||||
is_segwit,
|
||||
}
|
||||
}
|
||||
|
||||
/// Effective value of this input candidate: `actual_value - input_weight * feerate (sats/wu)`.
|
||||
pub fn effective_value(&self, effective_feerate: f32) -> i64 {
|
||||
// We prefer undershooting the candidate's effective value (so we over-estimate the fee of a
|
||||
// candidate). If we overshoot the candidate's effective value, it may be possible to find a
|
||||
// solution which does not meet the target feerate.
|
||||
self.value as i64 - (self.weight as f32 * effective_feerate).ceil() as i64
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug, Clone, Copy)]
|
||||
pub struct CoinSelectorOpt {
|
||||
/// The value we need to select.
|
||||
/// If the value is `None`, then the selection will be complete if it can pay for the drain
|
||||
/// output and satisfy the other constraints (e.g., minimum fees).
|
||||
pub target_value: Option<u64>,
|
||||
/// Additional leeway for the target value.
|
||||
pub max_extra_target: u64, // TODO: Maybe out of scope here?
|
||||
|
||||
/// The feerate we should try and achieve in sats per weight unit.
|
||||
pub target_feerate: f32,
|
||||
/// The feerate
|
||||
pub long_term_feerate: Option<f32>, // TODO: Maybe out of scope? (waste)
|
||||
/// The minimum absolute fee. I.e., needed for RBF.
|
||||
pub min_absolute_fee: u64,
|
||||
|
||||
/// The weight of the template transaction, including fixed fields and outputs.
|
||||
pub base_weight: u32,
|
||||
/// Additional weight if we include the drain (change) output.
|
||||
pub drain_weight: u32,
|
||||
/// Weight of spending the drain (change) output in the future.
|
||||
pub spend_drain_weight: u32, // TODO: Maybe out of scope? (waste)
|
||||
|
||||
/// Minimum value allowed for a drain (change) output.
|
||||
pub min_drain_value: u64,
|
||||
}
|
||||
|
||||
impl CoinSelectorOpt {
|
||||
fn from_weights(base_weight: u32, drain_weight: u32, spend_drain_weight: u32) -> Self {
|
||||
// 0.25 sats/wu == 1 sat/vb
|
||||
let target_feerate = 0.25_f32;
|
||||
|
||||
// set `min_drain_value` to dust limit
|
||||
let min_drain_value =
|
||||
3 * ((drain_weight + spend_drain_weight) as f32 * target_feerate) as u64;
|
||||
|
||||
Self {
|
||||
target_value: None,
|
||||
max_extra_target: 0,
|
||||
target_feerate,
|
||||
long_term_feerate: None,
|
||||
min_absolute_fee: 0,
|
||||
base_weight,
|
||||
drain_weight,
|
||||
spend_drain_weight,
|
||||
min_drain_value,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn fund_outputs(
|
||||
txouts: &[TxOut],
|
||||
drain_output: &TxOut,
|
||||
drain_satisfaction_weight: u32,
|
||||
) -> Self {
|
||||
let mut tx = Transaction {
|
||||
input: vec![],
|
||||
version: 1,
|
||||
lock_time: LockTime::ZERO.into(),
|
||||
output: txouts.to_vec(),
|
||||
};
|
||||
let base_weight = tx.weight();
|
||||
// this awkward calculation is necessary since TxOut doesn't have \.weight()
|
||||
let drain_weight = {
|
||||
tx.output.push(drain_output.clone());
|
||||
tx.weight() - base_weight
|
||||
};
|
||||
Self {
|
||||
target_value: if txouts.is_empty() {
|
||||
None
|
||||
} else {
|
||||
Some(txouts.iter().map(|txout| txout.value).sum())
|
||||
},
|
||||
..Self::from_weights(
|
||||
base_weight as u32,
|
||||
drain_weight as u32,
|
||||
TXIN_BASE_WEIGHT + drain_satisfaction_weight,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
pub fn long_term_feerate(&self) -> f32 {
|
||||
self.long_term_feerate.unwrap_or(self.target_feerate)
|
||||
}
|
||||
|
||||
pub fn drain_waste(&self) -> i64 {
|
||||
(self.drain_weight as f32 * self.target_feerate
|
||||
+ self.spend_drain_weight as f32 * self.long_term_feerate()) as i64
|
||||
}
|
||||
}
|
||||
|
||||
/// [`CoinSelector`] selects and deselects from a set of candidates.
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct CoinSelector<'a> {
|
||||
pub opts: &'a CoinSelectorOpt,
|
||||
pub candidates: &'a Vec<WeightedValue>,
|
||||
selected: BTreeSet<usize>,
|
||||
}
|
||||
|
||||
impl<'a> CoinSelector<'a> {
|
||||
pub fn candidate(&self, index: usize) -> &WeightedValue {
|
||||
&self.candidates[index]
|
||||
}
|
||||
|
||||
pub fn new(candidates: &'a Vec<WeightedValue>, opts: &'a CoinSelectorOpt) -> Self {
|
||||
Self {
|
||||
candidates,
|
||||
selected: Default::default(),
|
||||
opts,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn select(&mut self, index: usize) -> bool {
|
||||
assert!(index < self.candidates.len());
|
||||
self.selected.insert(index)
|
||||
}
|
||||
|
||||
pub fn deselect(&mut self, index: usize) -> bool {
|
||||
self.selected.remove(&index)
|
||||
}
|
||||
|
||||
pub fn is_selected(&self, index: usize) -> bool {
|
||||
self.selected.contains(&index)
|
||||
}
|
||||
|
||||
pub fn is_empty(&self) -> bool {
|
||||
self.selected.is_empty()
|
||||
}
|
||||
|
||||
/// Weight sum of all selected inputs.
|
||||
pub fn selected_weight(&self) -> u32 {
|
||||
self.selected
|
||||
.iter()
|
||||
.map(|&index| self.candidates[index].weight)
|
||||
.sum()
|
||||
}
|
||||
|
||||
/// Effective value sum of all selected inputs.
|
||||
pub fn selected_effective_value(&self) -> i64 {
|
||||
self.selected
|
||||
.iter()
|
||||
.map(|&index| self.candidates[index].effective_value(self.opts.target_feerate))
|
||||
.sum()
|
||||
}
|
||||
|
||||
/// Absolute value sum of all selected inputs.
|
||||
pub fn selected_absolute_value(&self) -> u64 {
|
||||
self.selected
|
||||
.iter()
|
||||
.map(|&index| self.candidates[index].value)
|
||||
.sum()
|
||||
}
|
||||
|
||||
/// Waste sum of all selected inputs.
|
||||
pub fn selected_waste(&self) -> i64 {
|
||||
(self.selected_weight() as f32 * (self.opts.target_feerate - self.opts.long_term_feerate()))
|
||||
as i64
|
||||
}
|
||||
|
||||
/// Current weight of template tx + selected inputs.
|
||||
pub fn current_weight(&self) -> u32 {
|
||||
let witness_header_extra_weight = self
|
||||
.selected()
|
||||
.find(|(_, wv)| wv.is_segwit)
|
||||
.map(|_| 2)
|
||||
.unwrap_or(0);
|
||||
let vin_count_varint_extra_weight = {
|
||||
let input_count = self.selected().map(|(_, wv)| wv.input_count).sum::<usize>();
|
||||
(varint_size(input_count) - 1) * 4
|
||||
};
|
||||
self.opts.base_weight
|
||||
+ self.selected_weight()
|
||||
+ witness_header_extra_weight
|
||||
+ vin_count_varint_extra_weight
|
||||
}
|
||||
|
||||
/// Current excess.
|
||||
pub fn current_excess(&self) -> i64 {
|
||||
self.selected_effective_value() - self.effective_target()
|
||||
}
|
||||
|
||||
/// This is the effective target value.
|
||||
pub fn effective_target(&self) -> i64 {
|
||||
let (has_segwit, max_input_count) = self
|
||||
.candidates
|
||||
.iter()
|
||||
.fold((false, 0_usize), |(is_segwit, input_count), c| {
|
||||
(is_segwit || c.is_segwit, input_count + c.input_count)
|
||||
});
|
||||
|
||||
let effective_base_weight = self.opts.base_weight
|
||||
+ if has_segwit { 2_u32 } else { 0_u32 }
|
||||
+ (varint_size(max_input_count) - 1) * 4;
|
||||
|
||||
self.opts.target_value.unwrap_or(0) as i64
|
||||
+ (effective_base_weight as f32 * self.opts.target_feerate).ceil() as i64
|
||||
}
|
||||
|
||||
pub fn selected_count(&self) -> usize {
|
||||
self.selected.len()
|
||||
}
|
||||
|
||||
pub fn selected(&self) -> impl Iterator<Item = (usize, &'a WeightedValue)> + '_ {
|
||||
self.selected
|
||||
.iter()
|
||||
.map(move |&index| (index, &self.candidates[index]))
|
||||
}
|
||||
|
||||
pub fn unselected(&self) -> impl Iterator<Item = (usize, &'a WeightedValue)> + '_ {
|
||||
self.candidates
|
||||
.iter()
|
||||
.enumerate()
|
||||
.filter(move |(index, _)| !self.selected.contains(index))
|
||||
}
|
||||
|
||||
pub fn selected_indexes(&self) -> impl Iterator<Item = usize> + '_ {
|
||||
self.selected.iter().cloned()
|
||||
}
|
||||
|
||||
pub fn unselected_indexes(&self) -> impl Iterator<Item = usize> + '_ {
|
||||
(0..self.candidates.len()).filter(move |index| !self.selected.contains(index))
|
||||
}
|
||||
|
||||
pub fn all_selected(&self) -> bool {
|
||||
self.selected.len() == self.candidates.len()
|
||||
}
|
||||
|
||||
pub fn select_all(&mut self) {
|
||||
self.selected = (0..self.candidates.len()).collect();
|
||||
}
|
||||
|
||||
pub fn select_until_finished(&mut self) -> Result<Selection, SelectionError> {
|
||||
let mut selection = self.finish();
|
||||
|
||||
if selection.is_ok() {
|
||||
return selection;
|
||||
}
|
||||
|
||||
let unselected = self.unselected_indexes().collect::<Vec<_>>();
|
||||
|
||||
for index in unselected {
|
||||
self.select(index);
|
||||
selection = self.finish();
|
||||
|
||||
if selection.is_ok() {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
selection
|
||||
}
|
||||
|
||||
pub fn finish(&self) -> Result<Selection, SelectionError> {
|
||||
let weight_without_drain = self.current_weight();
|
||||
let weight_with_drain = weight_without_drain + self.opts.drain_weight;
|
||||
|
||||
let fee_without_drain =
|
||||
(weight_without_drain as f32 * self.opts.target_feerate).ceil() as u64;
|
||||
let fee_with_drain = (weight_with_drain as f32 * self.opts.target_feerate).ceil() as u64;
|
||||
|
||||
let inputs_minus_outputs = {
|
||||
let target_value = self.opts.target_value.unwrap_or(0);
|
||||
let selected = self.selected_absolute_value();
|
||||
|
||||
// find the largest unsatisfied constraint (if any), and return the error of that constraint
|
||||
// "selected" should always be greater than or equal to these selected values
|
||||
[
|
||||
(
|
||||
SelectionConstraint::TargetValue,
|
||||
target_value.saturating_sub(selected),
|
||||
),
|
||||
(
|
||||
SelectionConstraint::TargetFee,
|
||||
(target_value + fee_without_drain).saturating_sub(selected),
|
||||
),
|
||||
(
|
||||
SelectionConstraint::MinAbsoluteFee,
|
||||
(target_value + self.opts.min_absolute_fee).saturating_sub(selected),
|
||||
),
|
||||
(
|
||||
SelectionConstraint::MinDrainValue,
|
||||
// when we have no target value (hence no recipient txouts), we need to ensure
|
||||
// the selected amount can satisfy requirements for a drain output (so we at least have one txout)
|
||||
if self.opts.target_value.is_none() {
|
||||
(fee_with_drain + self.opts.min_drain_value).saturating_sub(selected)
|
||||
} else {
|
||||
0
|
||||
},
|
||||
),
|
||||
]
|
||||
.iter()
|
||||
.filter(|&(_, v)| v > &0)
|
||||
.max_by_key(|&(_, v)| v)
|
||||
.map_or(Ok(()), |(constraint, missing)| {
|
||||
Err(SelectionError {
|
||||
selected,
|
||||
missing: *missing,
|
||||
constraint: *constraint,
|
||||
})
|
||||
})?;
|
||||
|
||||
selected - target_value
|
||||
};
|
||||
|
||||
let fee_without_drain = fee_without_drain.max(self.opts.min_absolute_fee);
|
||||
let fee_with_drain = fee_with_drain.max(self.opts.min_absolute_fee);
|
||||
|
||||
let excess_without_drain = inputs_minus_outputs - fee_without_drain;
|
||||
let input_waste = self.selected_waste();
|
||||
|
||||
// begin preparing excess strategies for final selection
|
||||
let mut excess_strategies = HashMap::new();
|
||||
|
||||
// only allow `ToFee` and `ToRecipient` excess strategies when we have a `target_value`,
|
||||
// otherwise, we will result in a result with no txouts, or attempt to add value to an output
|
||||
// that does not exist.
|
||||
if self.opts.target_value.is_some() {
|
||||
// no drain, excess to fee
|
||||
excess_strategies.insert(
|
||||
ExcessStrategyKind::ToFee,
|
||||
ExcessStrategy {
|
||||
recipient_value: self.opts.target_value,
|
||||
drain_value: None,
|
||||
fee: fee_without_drain + excess_without_drain,
|
||||
weight: weight_without_drain,
|
||||
waste: input_waste + excess_without_drain as i64,
|
||||
},
|
||||
);
|
||||
|
||||
// no drain, send the excess to the recipient
|
||||
// if `excess == 0`, this result will be the same as the previous, so don't consider it
|
||||
// if `max_extra_target == 0`, there is no leeway for this strategy
|
||||
if excess_without_drain > 0 && self.opts.max_extra_target > 0 {
|
||||
let extra_recipient_value =
|
||||
core::cmp::min(self.opts.max_extra_target, excess_without_drain);
|
||||
let extra_fee = excess_without_drain - extra_recipient_value;
|
||||
excess_strategies.insert(
|
||||
ExcessStrategyKind::ToRecipient,
|
||||
ExcessStrategy {
|
||||
recipient_value: self.opts.target_value.map(|v| v + extra_recipient_value),
|
||||
drain_value: None,
|
||||
fee: fee_without_drain + extra_fee,
|
||||
weight: weight_without_drain,
|
||||
waste: input_waste + extra_fee as i64,
|
||||
},
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
// with drain
|
||||
if fee_with_drain >= self.opts.min_absolute_fee
|
||||
&& inputs_minus_outputs >= fee_with_drain + self.opts.min_drain_value
|
||||
{
|
||||
excess_strategies.insert(
|
||||
ExcessStrategyKind::ToDrain,
|
||||
ExcessStrategy {
|
||||
recipient_value: self.opts.target_value,
|
||||
drain_value: Some(inputs_minus_outputs.saturating_sub(fee_with_drain)),
|
||||
fee: fee_with_drain,
|
||||
weight: weight_with_drain,
|
||||
waste: input_waste + self.opts.drain_waste(),
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
debug_assert!(
|
||||
!excess_strategies.is_empty(),
|
||||
"should have at least one excess strategy."
|
||||
);
|
||||
|
||||
Ok(Selection {
|
||||
selected: self.selected.clone(),
|
||||
excess: excess_without_drain,
|
||||
excess_strategies,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct SelectionError {
|
||||
selected: u64,
|
||||
missing: u64,
|
||||
constraint: SelectionConstraint,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for SelectionError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
let SelectionError {
|
||||
selected,
|
||||
missing,
|
||||
constraint,
|
||||
} = self;
|
||||
write!(
|
||||
f,
|
||||
"insufficient coins selected; selected={}, missing={}, unsatisfied_constraint={:?}",
|
||||
selected, missing, constraint
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for SelectionError {}
|
||||
|
||||
#[derive(Clone, Copy, Debug, PartialEq, Eq)]
|
||||
pub enum SelectionConstraint {
|
||||
/// The target is not met
|
||||
TargetValue,
|
||||
/// The target fee (given the feerate) is not met
|
||||
TargetFee,
|
||||
/// Min absolute fee is not met
|
||||
MinAbsoluteFee,
|
||||
/// Min drain value is not met
|
||||
MinDrainValue,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for SelectionConstraint {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
SelectionConstraint::TargetValue => core::write!(f, "target_value"),
|
||||
SelectionConstraint::TargetFee => core::write!(f, "target_fee"),
|
||||
SelectionConstraint::MinAbsoluteFee => core::write!(f, "min_absolute_fee"),
|
||||
SelectionConstraint::MinDrainValue => core::write!(f, "min_drain_value"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct Selection {
|
||||
pub selected: BTreeSet<usize>,
|
||||
pub excess: u64,
|
||||
pub excess_strategies: HashMap<ExcessStrategyKind, ExcessStrategy>,
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy, Debug, PartialEq, Eq, PartialOrd, Ord, core::hash::Hash)]
|
||||
pub enum ExcessStrategyKind {
|
||||
ToFee,
|
||||
ToRecipient,
|
||||
ToDrain,
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
pub struct ExcessStrategy {
|
||||
pub recipient_value: Option<u64>,
|
||||
pub drain_value: Option<u64>,
|
||||
pub fee: u64,
|
||||
pub weight: u32,
|
||||
pub waste: i64,
|
||||
}
|
||||
|
||||
impl Selection {
|
||||
pub fn apply_selection<'a, T>(
|
||||
&'a self,
|
||||
candidates: &'a [T],
|
||||
) -> impl Iterator<Item = &'a T> + 'a {
|
||||
self.selected.iter().map(move |i| &candidates[*i])
|
||||
}
|
||||
|
||||
/// Returns the [`ExcessStrategy`] that results in the least waste.
|
||||
pub fn best_strategy(&self) -> (&ExcessStrategyKind, &ExcessStrategy) {
|
||||
self.excess_strategies
|
||||
.iter()
|
||||
.min_by_key(|&(_, a)| a.waste)
|
||||
.expect("selection has no excess strategy")
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for ExcessStrategyKind {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
ExcessStrategyKind::ToFee => core::write!(f, "to_fee"),
|
||||
ExcessStrategyKind::ToRecipient => core::write!(f, "to_recipient"),
|
||||
ExcessStrategyKind::ToDrain => core::write!(f, "to_drain"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl ExcessStrategy {
|
||||
/// Returns feerate in sats/wu.
|
||||
pub fn feerate(&self) -> f32 {
|
||||
self.fee as f32 / self.weight as f32
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use crate::{ExcessStrategyKind, SelectionConstraint};
|
||||
|
||||
use super::{CoinSelector, CoinSelectorOpt, WeightedValue};
|
||||
|
||||
/// Ensure `target_value` is respected. Can't have any disrespect.
|
||||
#[test]
|
||||
fn target_value_respected() {
|
||||
let target_value = 1000_u64;
|
||||
|
||||
let candidates = (500..1500_u64)
|
||||
.map(|value| WeightedValue {
|
||||
value,
|
||||
weight: 100,
|
||||
input_count: 1,
|
||||
is_segwit: false,
|
||||
})
|
||||
.collect::<super::Vec<_>>();
|
||||
|
||||
let opts = CoinSelectorOpt {
|
||||
target_value: Some(target_value),
|
||||
max_extra_target: 0,
|
||||
target_feerate: 0.00,
|
||||
long_term_feerate: None,
|
||||
min_absolute_fee: 0,
|
||||
base_weight: 10,
|
||||
drain_weight: 10,
|
||||
spend_drain_weight: 10,
|
||||
min_drain_value: 10,
|
||||
};
|
||||
|
||||
for (index, v) in candidates.iter().enumerate() {
|
||||
let mut selector = CoinSelector::new(&candidates, &opts);
|
||||
assert!(selector.select(index));
|
||||
|
||||
let res = selector.finish();
|
||||
if v.value < opts.target_value.unwrap_or(0) {
|
||||
let err = res.expect_err("should have failed");
|
||||
assert_eq!(err.selected, v.value);
|
||||
assert_eq!(err.missing, target_value - v.value);
|
||||
assert_eq!(err.constraint, SelectionConstraint::MinAbsoluteFee);
|
||||
} else {
|
||||
let sel = res.expect("should have succeeded");
|
||||
assert_eq!(sel.excess, v.value - opts.target_value.unwrap_or(0));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn drain_all() {
|
||||
let candidates = (0..100)
|
||||
.map(|_| WeightedValue {
|
||||
value: 666,
|
||||
weight: 166,
|
||||
input_count: 1,
|
||||
is_segwit: false,
|
||||
})
|
||||
.collect::<super::Vec<_>>();
|
||||
|
||||
let opts = CoinSelectorOpt {
|
||||
target_value: None,
|
||||
max_extra_target: 0,
|
||||
target_feerate: 0.25,
|
||||
long_term_feerate: None,
|
||||
min_absolute_fee: 0,
|
||||
base_weight: 10,
|
||||
drain_weight: 100,
|
||||
spend_drain_weight: 66,
|
||||
min_drain_value: 1000,
|
||||
};
|
||||
|
||||
let selection = CoinSelector::new(&candidates, &opts)
|
||||
.select_until_finished()
|
||||
.expect("should succeed");
|
||||
|
||||
assert!(selection.selected.len() > 1);
|
||||
assert_eq!(selection.excess_strategies.len(), 1);
|
||||
|
||||
let (kind, strategy) = selection.best_strategy();
|
||||
assert_eq!(*kind, ExcessStrategyKind::ToDrain);
|
||||
assert!(strategy.recipient_value.is_none());
|
||||
assert!(strategy.drain_value.is_some());
|
||||
}
|
||||
|
||||
/// TODO: Tests to add:
|
||||
/// * `finish` should ensure at least `target_value` is selected.
|
||||
/// * actual feerate should be equal or higher than `target_feerate`.
|
||||
/// * actual drain value should be equal to or higher than `min_drain_value` (or else no drain).
|
||||
fn _todo() {}
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
#![no_std]
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
extern crate std;
|
||||
|
||||
#[macro_use]
|
||||
extern crate alloc;
|
||||
extern crate bdk_chain;
|
||||
|
||||
use alloc::vec::Vec;
|
||||
use bdk_chain::{
|
||||
bitcoin,
|
||||
collections::{BTreeSet, HashMap},
|
||||
};
|
||||
use bitcoin::{LockTime, Transaction, TxOut};
|
||||
use core::fmt::{Debug, Display};
|
||||
|
||||
mod coin_selector;
|
||||
pub use coin_selector::*;
|
||||
|
||||
mod bnb;
|
||||
pub use bnb::*;
|
||||
|
||||
/// Txin "base" fields include `outpoint` (32+4) and `nSequence` (4). This does not include
|
||||
/// `scriptSigLen` or `scriptSig`.
|
||||
pub const TXIN_BASE_WEIGHT: u32 = (32 + 4 + 4) * 4;
|
||||
|
||||
/// Helper to calculate varint size. `v` is the value the varint represents.
|
||||
// Shamelessly copied from
|
||||
// https://github.com/rust-bitcoin/rust-miniscript/blob/d5615acda1a7fdc4041a11c1736af139b8c7ebe8/src/util.rs#L8
|
||||
pub(crate) fn varint_size(v: usize) -> u32 {
|
||||
bitcoin::VarInt(v as u64).len() as u32
|
||||
}
|
||||
@@ -1,13 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_tmp_plan"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../crates/chain", features = ["miniscript"] }
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = []
|
||||
@@ -1,3 +0,0 @@
|
||||
# Temporary planning module
|
||||
|
||||
A temporary place to hold the planning module until https://github.com/rust-bitcoin/rust-miniscript/pull/481 is merged and released
|
||||
@@ -1,13 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_tmp_plan"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../../crates/chain", version = "0.3.1", features = ["miniscript"] }
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = []
|
||||
@@ -1,3 +0,0 @@
|
||||
# Temporary planning module
|
||||
|
||||
A temporary place to hold the planning module until https://github.com/rust-bitcoin/rust-miniscript/pull/481 is merged and released
|
||||
@@ -1,436 +0,0 @@
|
||||
#![allow(unused)]
|
||||
#![allow(missing_docs)]
|
||||
//! A spending plan or *plan* for short is a representation of a particular spending path on a
|
||||
//! descriptor. This allows us to analayze a choice of spending path without producing any
|
||||
//! signatures or other witness data for it.
|
||||
//!
|
||||
//! To make a plan you provide the descriptor with "assets" like which keys you are able to use, hash
|
||||
//! pre-images you have access to, the current block height etc.
|
||||
//!
|
||||
//! Once you've got a plan it can tell you its expected satisfaction weight which can be useful for
|
||||
//! doing coin selection. Furthermore it provides which subset of those keys and hash pre-images you
|
||||
//! will actually need as well as what locktime or sequence number you need to set.
|
||||
//!
|
||||
//! Once you've obstained signatures, hash pre-images etc required by the plan, it can create a
|
||||
//! witness/script_sig for the input.
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use bitcoin::{
|
||||
blockdata::{locktime::LockTime, transaction::Sequence},
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
secp256k1::Secp256k1,
|
||||
util::{
|
||||
address::WitnessVersion,
|
||||
bip32::{DerivationPath, Fingerprint, KeySource},
|
||||
taproot::{LeafVersion, TapBranchHash, TapLeafHash},
|
||||
},
|
||||
EcdsaSig, SchnorrSig, Script, TxIn, Witness,
|
||||
};
|
||||
use miniscript::{
|
||||
descriptor::{InnerXKey, Tr},
|
||||
hash256, DefiniteDescriptorKey, Descriptor, DescriptorPublicKey, ScriptContext, ToPublicKey,
|
||||
};
|
||||
|
||||
pub(crate) fn varint_len(v: usize) -> usize {
|
||||
bitcoin::VarInt(v as u64).len() as usize
|
||||
}
|
||||
|
||||
mod plan_impls;
|
||||
mod requirements;
|
||||
mod template;
|
||||
pub use requirements::*;
|
||||
pub use template::PlanKey;
|
||||
use template::TemplateItem;
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum TrSpend {
|
||||
KeySpend,
|
||||
LeafSpend {
|
||||
script: Script,
|
||||
leaf_version: LeafVersion,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum Target {
|
||||
Legacy,
|
||||
Segwitv0 {
|
||||
script_code: Script,
|
||||
},
|
||||
Segwitv1 {
|
||||
tr: Tr<DefiniteDescriptorKey>,
|
||||
tr_plan: TrSpend,
|
||||
},
|
||||
}
|
||||
|
||||
impl Target {}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
/// A plan represents a particular spending path for a descriptor.
|
||||
///
|
||||
/// See the module level documentation for more info.
|
||||
pub struct Plan<AK> {
|
||||
template: Vec<TemplateItem<AK>>,
|
||||
target: Target,
|
||||
set_locktime: Option<LockTime>,
|
||||
set_sequence: Option<Sequence>,
|
||||
}
|
||||
|
||||
impl Default for Target {
|
||||
fn default() -> Self {
|
||||
Target::Legacy
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug, Default)]
|
||||
/// Signatures and hash pre-images that can be used to complete a plan.
|
||||
pub struct SatisfactionMaterial {
|
||||
/// Schnorr signautres under their keys
|
||||
pub schnorr_sigs: BTreeMap<DefiniteDescriptorKey, SchnorrSig>,
|
||||
/// ECDSA signatures under their keys
|
||||
pub ecdsa_sigs: BTreeMap<DefiniteDescriptorKey, EcdsaSig>,
|
||||
/// SHA256 pre-images under their images
|
||||
pub sha256_preimages: BTreeMap<sha256::Hash, Vec<u8>>,
|
||||
/// hash160 pre-images under their images
|
||||
pub hash160_preimages: BTreeMap<hash160::Hash, Vec<u8>>,
|
||||
/// hash256 pre-images under their images
|
||||
pub hash256_preimages: BTreeMap<hash256::Hash, Vec<u8>>,
|
||||
/// ripemd160 pre-images under their images
|
||||
pub ripemd160_preimages: BTreeMap<ripemd160::Hash, Vec<u8>>,
|
||||
}
|
||||
|
||||
impl<Ak> Plan<Ak>
|
||||
where
|
||||
Ak: Clone,
|
||||
{
|
||||
/// The expected satisfaction weight for the plan if it is completed.
|
||||
pub fn expected_weight(&self) -> usize {
|
||||
let script_sig_size = match self.target {
|
||||
Target::Legacy => unimplemented!(), // self
|
||||
// .template
|
||||
// .iter()
|
||||
// .map(|step| {
|
||||
// let size = step.expected_size();
|
||||
// size + push_opcode_size(size)
|
||||
// })
|
||||
// .sum()
|
||||
Target::Segwitv0 { .. } | Target::Segwitv1 { .. } => 1,
|
||||
};
|
||||
let witness_elem_sizes: Option<Vec<usize>> = match &self.target {
|
||||
Target::Legacy => None,
|
||||
Target::Segwitv0 { .. } => Some(
|
||||
self.template
|
||||
.iter()
|
||||
.map(|step| step.expected_size())
|
||||
.collect(),
|
||||
),
|
||||
Target::Segwitv1 { tr, tr_plan } => {
|
||||
let mut witness_elems = self
|
||||
.template
|
||||
.iter()
|
||||
.map(|step| step.expected_size())
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
if let TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
} = tr_plan
|
||||
{
|
||||
let control_block = tr
|
||||
.spend_info()
|
||||
.control_block(&(script.clone(), *leaf_version))
|
||||
.expect("must exist");
|
||||
witness_elems.push(script.len());
|
||||
witness_elems.push(control_block.size());
|
||||
}
|
||||
|
||||
Some(witness_elems)
|
||||
}
|
||||
};
|
||||
|
||||
let witness_size: usize = match witness_elem_sizes {
|
||||
Some(elems) => {
|
||||
varint_len(elems.len())
|
||||
+ elems
|
||||
.into_iter()
|
||||
.map(|elem| varint_len(elem) + elem)
|
||||
.sum::<usize>()
|
||||
}
|
||||
None => 0,
|
||||
};
|
||||
|
||||
script_sig_size * 4 + witness_size
|
||||
}
|
||||
|
||||
pub fn requirements(&self) -> Requirements<Ak> {
|
||||
match self.try_complete(&SatisfactionMaterial::default()) {
|
||||
PlanState::Complete { .. } => Requirements::default(),
|
||||
PlanState::Incomplete(requirements) => requirements,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn try_complete(&self, auth_data: &SatisfactionMaterial) -> PlanState<Ak> {
|
||||
let unsatisfied_items = self
|
||||
.template
|
||||
.iter()
|
||||
.filter(|step| match step {
|
||||
TemplateItem::Sign(key) => {
|
||||
!auth_data.schnorr_sigs.contains_key(&key.descriptor_key)
|
||||
}
|
||||
TemplateItem::Hash160(image) => !auth_data.hash160_preimages.contains_key(image),
|
||||
TemplateItem::Hash256(image) => !auth_data.hash256_preimages.contains_key(image),
|
||||
TemplateItem::Sha256(image) => !auth_data.sha256_preimages.contains_key(image),
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
!auth_data.ripemd160_preimages.contains_key(image)
|
||||
}
|
||||
TemplateItem::Pk { .. } | TemplateItem::One | TemplateItem::Zero => false,
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
if unsatisfied_items.is_empty() {
|
||||
let mut witness = self
|
||||
.template
|
||||
.iter()
|
||||
.flat_map(|step| step.to_witness_stack(&auth_data))
|
||||
.collect::<Vec<_>>();
|
||||
match &self.target {
|
||||
Target::Segwitv0 { .. } => todo!(),
|
||||
Target::Legacy => todo!(),
|
||||
Target::Segwitv1 {
|
||||
tr_plan: TrSpend::KeySpend,
|
||||
..
|
||||
} => PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
},
|
||||
Target::Segwitv1 {
|
||||
tr,
|
||||
tr_plan:
|
||||
TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
},
|
||||
} => {
|
||||
let spend_info = tr.spend_info();
|
||||
let control_block = spend_info
|
||||
.control_block(&(script.clone(), *leaf_version))
|
||||
.expect("must exist");
|
||||
witness.push(script.clone().into_bytes());
|
||||
witness.push(control_block.serialize());
|
||||
|
||||
PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
let mut requirements = Requirements::default();
|
||||
|
||||
match &self.target {
|
||||
Target::Legacy => {
|
||||
todo!()
|
||||
}
|
||||
Target::Segwitv0 { .. } => {
|
||||
todo!()
|
||||
}
|
||||
Target::Segwitv1 { tr, tr_plan } => {
|
||||
let spend_info = tr.spend_info();
|
||||
match tr_plan {
|
||||
TrSpend::KeySpend => match &self.template[..] {
|
||||
[TemplateItem::Sign(ref plan_key)] => {
|
||||
requirements.signatures = RequiredSignatures::TapKey {
|
||||
merkle_root: spend_info.merkle_root(),
|
||||
plan_key: plan_key.clone(),
|
||||
};
|
||||
}
|
||||
_ => unreachable!("tapkey spend will always have only one sign step"),
|
||||
},
|
||||
TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
} => {
|
||||
let leaf_hash = TapLeafHash::from_script(&script, *leaf_version);
|
||||
requirements.signatures = RequiredSignatures::TapScript {
|
||||
leaf_hash,
|
||||
plan_keys: vec![],
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let required_signatures = match requirements.signatures {
|
||||
RequiredSignatures::Legacy { .. } => todo!(),
|
||||
RequiredSignatures::Segwitv0 { .. } => todo!(),
|
||||
RequiredSignatures::TapKey { .. } => return PlanState::Incomplete(requirements),
|
||||
RequiredSignatures::TapScript {
|
||||
plan_keys: ref mut keys,
|
||||
..
|
||||
} => keys,
|
||||
};
|
||||
|
||||
for step in unsatisfied_items {
|
||||
match step {
|
||||
TemplateItem::Sign(plan_key) => {
|
||||
required_signatures.push(plan_key.clone());
|
||||
}
|
||||
TemplateItem::Hash160(image) => {
|
||||
requirements.hash160_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Hash256(image) => {
|
||||
requirements.hash256_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Sha256(image) => {
|
||||
requirements.sha256_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
requirements.ripemd160_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Pk { .. } | TemplateItem::One | TemplateItem::Zero => { /* no requirements */
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
PlanState::Incomplete(requirements)
|
||||
}
|
||||
}
|
||||
|
||||
/// Witness version for the plan
|
||||
pub fn witness_version(&self) -> Option<WitnessVersion> {
|
||||
match self.target {
|
||||
Target::Legacy => None,
|
||||
Target::Segwitv0 { .. } => Some(WitnessVersion::V0),
|
||||
Target::Segwitv1 { .. } => Some(WitnessVersion::V1),
|
||||
}
|
||||
}
|
||||
|
||||
/// The minimum required locktime height or time on the transaction using the plan.
|
||||
pub fn required_locktime(&self) -> Option<LockTime> {
|
||||
self.set_locktime.clone()
|
||||
}
|
||||
|
||||
/// The minimum required sequence (height or time) on the input to satisfy the plan
|
||||
pub fn required_sequence(&self) -> Option<Sequence> {
|
||||
self.set_sequence.clone()
|
||||
}
|
||||
|
||||
/// The minmum required transaction version required on the transaction using the plan.
|
||||
pub fn min_version(&self) -> Option<u32> {
|
||||
if let Some(_) = self.set_sequence {
|
||||
Some(2)
|
||||
} else {
|
||||
Some(1)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// The returned value from [`Plan::try_complete`].
|
||||
pub enum PlanState<Ak> {
|
||||
/// The plan is complete
|
||||
Complete {
|
||||
/// The script sig that should be set on the input
|
||||
final_script_sig: Option<Script>,
|
||||
/// The witness that should be set on the input
|
||||
final_script_witness: Option<Witness>,
|
||||
},
|
||||
Incomplete(Requirements<Ak>),
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct Assets<K> {
|
||||
pub keys: Vec<K>,
|
||||
pub txo_age: Option<Sequence>,
|
||||
pub max_locktime: Option<LockTime>,
|
||||
pub sha256: Vec<sha256::Hash>,
|
||||
pub hash256: Vec<hash256::Hash>,
|
||||
pub ripemd160: Vec<ripemd160::Hash>,
|
||||
pub hash160: Vec<hash160::Hash>,
|
||||
}
|
||||
|
||||
impl<K> Default for Assets<K> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
keys: Default::default(),
|
||||
txo_age: Default::default(),
|
||||
max_locktime: Default::default(),
|
||||
sha256: Default::default(),
|
||||
hash256: Default::default(),
|
||||
ripemd160: Default::default(),
|
||||
hash160: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub trait CanDerive {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath>;
|
||||
}
|
||||
|
||||
impl CanDerive for KeySource {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath> {
|
||||
match DescriptorPublicKey::from(key.clone()) {
|
||||
DescriptorPublicKey::Single(single_pub) => {
|
||||
path_to_child(self, single_pub.origin.as_ref()?, None)
|
||||
}
|
||||
DescriptorPublicKey::XPub(dxk) => {
|
||||
let origin = dxk.origin.clone().unwrap_or_else(|| {
|
||||
let secp = Secp256k1::signing_only();
|
||||
(dxk.xkey.xkey_fingerprint(&secp), DerivationPath::master())
|
||||
});
|
||||
|
||||
path_to_child(self, &origin, Some(&dxk.derivation_path))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl CanDerive for DescriptorPublicKey {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath> {
|
||||
match (self, DescriptorPublicKey::from(key.clone())) {
|
||||
(parent, child) if parent == &child => Some(DerivationPath::master()),
|
||||
(DescriptorPublicKey::XPub(parent), _) => {
|
||||
let origin = parent.origin.clone().unwrap_or_else(|| {
|
||||
let secp = Secp256k1::signing_only();
|
||||
(
|
||||
parent.xkey.xkey_fingerprint(&secp),
|
||||
DerivationPath::master(),
|
||||
)
|
||||
});
|
||||
KeySource::from(origin).can_derive(key)
|
||||
}
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn path_to_child(
|
||||
parent: &KeySource,
|
||||
child_origin: &(Fingerprint, DerivationPath),
|
||||
child_derivation: Option<&DerivationPath>,
|
||||
) -> Option<DerivationPath> {
|
||||
if parent.0 == child_origin.0 {
|
||||
let mut remaining_derivation =
|
||||
DerivationPath::from(child_origin.1[..].strip_prefix(&parent.1[..])?);
|
||||
remaining_derivation =
|
||||
remaining_derivation.extend(child_derivation.unwrap_or(&DerivationPath::master()));
|
||||
Some(remaining_derivation)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
pub fn plan_satisfaction<Ak>(
|
||||
desc: &Descriptor<DefiniteDescriptorKey>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<Plan<Ak>>
|
||||
where
|
||||
Ak: CanDerive + Clone,
|
||||
{
|
||||
match desc {
|
||||
Descriptor::Bare(_) => todo!(),
|
||||
Descriptor::Pkh(_) => todo!(),
|
||||
Descriptor::Wpkh(_) => todo!(),
|
||||
Descriptor::Sh(_) => todo!(),
|
||||
Descriptor::Wsh(_) => todo!(),
|
||||
Descriptor::Tr(tr) => crate::plan_impls::plan_satisfaction_tr(tr, assets),
|
||||
}
|
||||
}
|
||||
@@ -1,323 +0,0 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::locktime::{Height, Time};
|
||||
use miniscript::Terminal;
|
||||
|
||||
use super::*;
|
||||
|
||||
impl<Ak> TermPlan<Ak> {
|
||||
fn combine(self, other: Self) -> Option<Self> {
|
||||
let min_locktime = {
|
||||
match (self.min_locktime, other.min_locktime) {
|
||||
(Some(lhs), Some(rhs)) => {
|
||||
if lhs.is_same_unit(rhs) {
|
||||
Some(if lhs.to_consensus_u32() > rhs.to_consensus_u32() {
|
||||
lhs
|
||||
} else {
|
||||
rhs
|
||||
})
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
_ => self.min_locktime.or(other.min_locktime),
|
||||
}
|
||||
};
|
||||
|
||||
let min_sequence = {
|
||||
match (self.min_sequence, other.min_sequence) {
|
||||
(Some(lhs), Some(rhs)) => {
|
||||
if lhs.is_height_locked() == rhs.is_height_locked() {
|
||||
Some(if lhs.to_consensus_u32() > rhs.to_consensus_u32() {
|
||||
lhs
|
||||
} else {
|
||||
rhs
|
||||
})
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
_ => self.min_sequence.or(other.min_sequence),
|
||||
}
|
||||
};
|
||||
|
||||
let mut template = self.template;
|
||||
template.extend(other.template);
|
||||
|
||||
Some(Self {
|
||||
min_locktime,
|
||||
min_sequence,
|
||||
template,
|
||||
})
|
||||
}
|
||||
|
||||
pub(crate) fn expected_size(&self) -> usize {
|
||||
self.template.iter().map(|step| step.expected_size()).sum()
|
||||
}
|
||||
}
|
||||
|
||||
// impl crate::descriptor::Pkh<DefiniteDescriptorKey> {
|
||||
// pub(crate) fn plan_satisfaction<Ak>(&self, assets: &Assets<Ak>) -> Option<Plan<Ak>>
|
||||
// where
|
||||
// Ak: CanDerive + Clone,
|
||||
// {
|
||||
// let (asset_key, derivation_hint) = assets.keys.iter().find_map(|asset_key| {
|
||||
// let derivation_hint = asset_key.can_derive(self.as_inner())?;
|
||||
// Some((asset_key, derivation_hint))
|
||||
// })?;
|
||||
|
||||
// Some(Plan {
|
||||
// template: vec![TemplateItem::Sign(PlanKey {
|
||||
// asset_key: asset_key.clone(),
|
||||
// descriptor_key: self.as_inner().clone(),
|
||||
// derivation_hint,
|
||||
// })],
|
||||
// target: Target::Legacy,
|
||||
// set_locktime: None,
|
||||
// set_sequence: None,
|
||||
// })
|
||||
// }
|
||||
// }
|
||||
|
||||
// impl crate::descriptor::Wpkh<DefiniteDescriptorKey> {
|
||||
// pub(crate) fn plan_satisfaction<Ak>(&self, assets: &Assets<Ak>) -> Option<Plan<Ak>>
|
||||
// where
|
||||
// Ak: CanDerive + Clone,
|
||||
// {
|
||||
// let (asset_key, derivation_hint) = assets.keys.iter().find_map(|asset_key| {
|
||||
// let derivation_hint = asset_key.can_derive(self.as_inner())?;
|
||||
// Some((asset_key, derivation_hint))
|
||||
// })?;
|
||||
|
||||
// Some(Plan {
|
||||
// template: vec![TemplateItem::Sign(PlanKey {
|
||||
// asset_key: asset_key.clone(),
|
||||
// descriptor_key: self.as_inner().clone(),
|
||||
// derivation_hint,
|
||||
// })],
|
||||
// target: Target::Segwitv0,
|
||||
// set_locktime: None,
|
||||
// set_sequence: None,
|
||||
// })
|
||||
// }
|
||||
// }
|
||||
|
||||
pub(crate) fn plan_satisfaction_tr<Ak>(
|
||||
tr: &miniscript::descriptor::Tr<DefiniteDescriptorKey>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<Plan<Ak>>
|
||||
where
|
||||
Ak: CanDerive + Clone,
|
||||
{
|
||||
let key_path_spend = assets.keys.iter().find_map(|asset_key| {
|
||||
let derivation_hint = asset_key.can_derive(tr.internal_key())?;
|
||||
Some((asset_key, derivation_hint))
|
||||
});
|
||||
|
||||
if let Some((asset_key, derivation_hint)) = key_path_spend {
|
||||
return Some(Plan {
|
||||
template: vec![TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
descriptor_key: tr.internal_key().clone(),
|
||||
derivation_hint,
|
||||
})],
|
||||
target: Target::Segwitv1 {
|
||||
tr: tr.clone(),
|
||||
tr_plan: TrSpend::KeySpend,
|
||||
},
|
||||
set_locktime: None,
|
||||
set_sequence: None,
|
||||
});
|
||||
}
|
||||
|
||||
let mut plans = tr
|
||||
.iter_scripts()
|
||||
.filter_map(|(_, ms)| Some((ms, (plan_steps(&ms.node, assets)?))))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
plans.sort_by_cached_key(|(_, plan)| plan.expected_size());
|
||||
|
||||
let (script, best_plan) = plans.into_iter().next()?;
|
||||
|
||||
Some(Plan {
|
||||
target: Target::Segwitv1 {
|
||||
tr: tr.clone(),
|
||||
tr_plan: TrSpend::LeafSpend {
|
||||
script: script.encode(),
|
||||
leaf_version: LeafVersion::TapScript,
|
||||
},
|
||||
},
|
||||
set_locktime: best_plan.min_locktime.clone(),
|
||||
set_sequence: best_plan.min_sequence.clone(),
|
||||
template: best_plan.template,
|
||||
})
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
struct TermPlan<Ak> {
|
||||
pub min_locktime: Option<LockTime>,
|
||||
pub min_sequence: Option<Sequence>,
|
||||
pub template: Vec<TemplateItem<Ak>>,
|
||||
}
|
||||
|
||||
impl<Ak> TermPlan<Ak> {
|
||||
fn new(template: Vec<TemplateItem<Ak>>) -> Self {
|
||||
TermPlan {
|
||||
template,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Default for TermPlan<Ak> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
min_locktime: Default::default(),
|
||||
min_sequence: Default::default(),
|
||||
template: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn plan_steps<Ak: Clone + CanDerive, Ctx: ScriptContext>(
|
||||
term: &Terminal<DefiniteDescriptorKey, Ctx>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<TermPlan<Ak>> {
|
||||
match term {
|
||||
Terminal::True => Some(TermPlan::new(vec![])),
|
||||
Terminal::False => return None,
|
||||
Terminal::PkH(key) => {
|
||||
let (asset_key, derivation_hint) = assets
|
||||
.keys
|
||||
.iter()
|
||||
.find_map(|asset_key| Some((asset_key, asset_key.can_derive(key)?)))?;
|
||||
Some(TermPlan::new(vec![
|
||||
TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
derivation_hint,
|
||||
descriptor_key: key.clone(),
|
||||
}),
|
||||
TemplateItem::Pk { key: key.clone() },
|
||||
]))
|
||||
}
|
||||
Terminal::PkK(key) => {
|
||||
let (asset_key, derivation_hint) = assets
|
||||
.keys
|
||||
.iter()
|
||||
.find_map(|asset_key| Some((asset_key, asset_key.can_derive(key)?)))?;
|
||||
Some(TermPlan::new(vec![TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
derivation_hint,
|
||||
descriptor_key: key.clone(),
|
||||
})]))
|
||||
}
|
||||
Terminal::RawPkH(_pk_hash) => {
|
||||
/* TODO */
|
||||
None
|
||||
}
|
||||
Terminal::After(locktime) => {
|
||||
let max_locktime = assets.max_locktime?;
|
||||
let locktime = LockTime::from(locktime);
|
||||
let (height, time) = match max_locktime {
|
||||
LockTime::Blocks(height) => (height, Time::from_consensus(0).unwrap()),
|
||||
LockTime::Seconds(seconds) => (Height::from_consensus(0).unwrap(), seconds),
|
||||
};
|
||||
if max_locktime.is_satisfied_by(height, time) {
|
||||
Some(TermPlan {
|
||||
min_locktime: Some(locktime),
|
||||
..Default::default()
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Older(older) => {
|
||||
// FIXME: older should be a height or time not a sequence.
|
||||
let max_sequence = assets.txo_age?;
|
||||
//TODO: this whole thing is probably wrong but upstream should provide a way of
|
||||
// doing it properly.
|
||||
if max_sequence.is_height_locked() == older.is_height_locked() {
|
||||
if max_sequence.to_consensus_u32() >= older.to_consensus_u32() {
|
||||
Some(TermPlan {
|
||||
min_sequence: Some(*older),
|
||||
..Default::default()
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Sha256(image) => {
|
||||
if assets.sha256.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Sha256(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Hash256(image) => {
|
||||
if assets.hash256.contains(image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Hash256(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Ripemd160(image) => {
|
||||
if assets.ripemd160.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Ripemd160(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Hash160(image) => {
|
||||
if assets.hash160.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Hash160(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Alt(ms)
|
||||
| Terminal::Swap(ms)
|
||||
| Terminal::Check(ms)
|
||||
| Terminal::Verify(ms)
|
||||
| Terminal::NonZero(ms)
|
||||
| Terminal::ZeroNotEqual(ms) => plan_steps(&ms.node, assets),
|
||||
Terminal::DupIf(ms) => {
|
||||
let mut plan = plan_steps(&ms.node, assets)?;
|
||||
plan.template.push(TemplateItem::One);
|
||||
Some(plan)
|
||||
}
|
||||
Terminal::AndV(l, r) | Terminal::AndB(l, r) => {
|
||||
let lhs = plan_steps(&l.node, assets)?;
|
||||
let rhs = plan_steps(&r.node, assets)?;
|
||||
lhs.combine(rhs)
|
||||
}
|
||||
Terminal::AndOr(_, _, _) => todo!(),
|
||||
Terminal::OrB(_, _) => todo!(),
|
||||
Terminal::OrD(_, _) => todo!(),
|
||||
Terminal::OrC(_, _) => todo!(),
|
||||
Terminal::OrI(lhs, rhs) => {
|
||||
let lplan = plan_steps(&lhs.node, assets).map(|mut plan| {
|
||||
plan.template.push(TemplateItem::One);
|
||||
plan
|
||||
});
|
||||
let rplan = plan_steps(&rhs.node, assets).map(|mut plan| {
|
||||
plan.template.push(TemplateItem::Zero);
|
||||
plan
|
||||
});
|
||||
match (lplan, rplan) {
|
||||
(Some(lplan), Some(rplan)) => {
|
||||
if lplan.expected_size() <= rplan.expected_size() {
|
||||
Some(lplan)
|
||||
} else {
|
||||
Some(rplan)
|
||||
}
|
||||
}
|
||||
(lplan, rplan) => lplan.or(rplan),
|
||||
}
|
||||
}
|
||||
Terminal::Thresh(_, _) => todo!(),
|
||||
Terminal::Multi(_, _) => todo!(),
|
||||
Terminal::MultiA(_, _) => todo!(),
|
||||
}
|
||||
}
|
||||
@@ -1,218 +0,0 @@
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use core::ops::Deref;
|
||||
|
||||
use bitcoin::{
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
psbt::Prevouts,
|
||||
secp256k1::{KeyPair, Message, PublicKey, Signing, Verification},
|
||||
util::{bip32, sighash, sighash::SighashCache, taproot},
|
||||
EcdsaSighashType, SchnorrSighashType, Transaction, TxOut, XOnlyPublicKey,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
use miniscript::{
|
||||
descriptor::{DescriptorSecretKey, KeyMap},
|
||||
hash256,
|
||||
};
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
/// Signatures and hash pre-images that must be provided to complete the plan.
|
||||
pub struct Requirements<Ak> {
|
||||
/// required signatures
|
||||
pub signatures: RequiredSignatures<Ak>,
|
||||
/// required sha256 pre-images
|
||||
pub sha256_images: HashSet<sha256::Hash>,
|
||||
/// required hash160 pre-images
|
||||
pub hash160_images: HashSet<hash160::Hash>,
|
||||
/// required hash256 pre-images
|
||||
pub hash256_images: HashSet<hash256::Hash>,
|
||||
/// required ripemd160 pre-images
|
||||
pub ripemd160_images: HashSet<ripemd160::Hash>,
|
||||
}
|
||||
|
||||
impl<Ak> Default for RequiredSignatures<Ak> {
|
||||
fn default() -> Self {
|
||||
RequiredSignatures::Legacy {
|
||||
keys: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Default for Requirements<Ak> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
signatures: Default::default(),
|
||||
sha256_images: Default::default(),
|
||||
hash160_images: Default::default(),
|
||||
hash256_images: Default::default(),
|
||||
ripemd160_images: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Requirements<Ak> {
|
||||
/// Whether any hash pre-images are required in the plan
|
||||
pub fn requires_hash_preimages(&self) -> bool {
|
||||
!(self.sha256_images.is_empty()
|
||||
&& self.hash160_images.is_empty()
|
||||
&& self.hash256_images.is_empty()
|
||||
&& self.ripemd160_images.is_empty())
|
||||
}
|
||||
}
|
||||
|
||||
/// The signatures required to complete the plan
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum RequiredSignatures<Ak> {
|
||||
/// Legacy ECDSA signatures are required
|
||||
Legacy { keys: Vec<PlanKey<Ak>> },
|
||||
/// Segwitv0 ECDSA signatures are required
|
||||
Segwitv0 { keys: Vec<PlanKey<Ak>> },
|
||||
/// A Taproot key spend signature is required
|
||||
TapKey {
|
||||
/// the internal key
|
||||
plan_key: PlanKey<Ak>,
|
||||
/// The merkle root of the taproot output
|
||||
merkle_root: Option<TapBranchHash>,
|
||||
},
|
||||
/// Taproot script path signatures are required
|
||||
TapScript {
|
||||
/// The leaf hash of the script being used
|
||||
leaf_hash: TapLeafHash,
|
||||
/// The keys in the script that require signatures
|
||||
plan_keys: Vec<PlanKey<Ak>>,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum SigningError {
|
||||
SigHashError(sighash::Error),
|
||||
DerivationError(bip32::Error),
|
||||
}
|
||||
|
||||
impl From<sighash::Error> for SigningError {
|
||||
fn from(e: sighash::Error) -> Self {
|
||||
Self::SigHashError(e)
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for SigningError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
SigningError::SigHashError(e) => e.fmt(f),
|
||||
SigningError::DerivationError(e) => e.fmt(f),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bip32::Error> for SigningError {
|
||||
fn from(e: bip32::Error) -> Self {
|
||||
Self::DerivationError(e)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for SigningError {}
|
||||
|
||||
impl RequiredSignatures<DescriptorPublicKey> {
|
||||
pub fn sign_with_keymap<T: Deref<Target = Transaction>>(
|
||||
&self,
|
||||
input_index: usize,
|
||||
keymap: &KeyMap,
|
||||
prevouts: &Prevouts<'_, impl core::borrow::Borrow<TxOut>>,
|
||||
schnorr_sighashty: Option<SchnorrSighashType>,
|
||||
_ecdsa_sighashty: Option<EcdsaSighashType>,
|
||||
sighash_cache: &mut SighashCache<T>,
|
||||
auth_data: &mut SatisfactionMaterial,
|
||||
secp: &Secp256k1<impl Signing + Verification>,
|
||||
) -> Result<bool, SigningError> {
|
||||
match self {
|
||||
RequiredSignatures::Legacy { .. } | RequiredSignatures::Segwitv0 { .. } => todo!(),
|
||||
RequiredSignatures::TapKey {
|
||||
plan_key,
|
||||
merkle_root,
|
||||
} => {
|
||||
let schnorr_sighashty = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_key_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
schnorr_sighashty,
|
||||
)?;
|
||||
let secret_key = match keymap.get(&plan_key.asset_key) {
|
||||
Some(secret_key) => secret_key,
|
||||
None => return Ok(false),
|
||||
};
|
||||
let secret_key = match secret_key {
|
||||
DescriptorSecretKey::Single(single) => single.key.inner,
|
||||
DescriptorSecretKey::XPrv(xprv) => {
|
||||
xprv.xkey
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
};
|
||||
|
||||
let pubkey = PublicKey::from_secret_key(&secp, &secret_key);
|
||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey);
|
||||
|
||||
let tweak =
|
||||
taproot::TapTweakHash::from_key_and_tweak(x_only_pubkey, merkle_root.clone());
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone())
|
||||
.add_xonly_tweak(&secp, &tweak.to_scalar())
|
||||
.unwrap();
|
||||
|
||||
let msg = Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
sig,
|
||||
hash_ty: schnorr_sighashty,
|
||||
};
|
||||
|
||||
auth_data
|
||||
.schnorr_sigs
|
||||
.insert(plan_key.descriptor_key.clone(), bitcoin_sig);
|
||||
Ok(true)
|
||||
}
|
||||
RequiredSignatures::TapScript {
|
||||
leaf_hash,
|
||||
plan_keys,
|
||||
} => {
|
||||
let sighash_type = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_script_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
*leaf_hash,
|
||||
sighash_type,
|
||||
)?;
|
||||
|
||||
let mut modified = false;
|
||||
|
||||
for plan_key in plan_keys {
|
||||
if let Some(secret_key) = keymap.get(&plan_key.asset_key) {
|
||||
let secret_key = match secret_key {
|
||||
DescriptorSecretKey::Single(single) => single.key.inner,
|
||||
DescriptorSecretKey::XPrv(xprv) => {
|
||||
xprv.xkey
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
};
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone());
|
||||
let msg =
|
||||
Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
sig,
|
||||
hash_ty: sighash_type,
|
||||
};
|
||||
|
||||
auth_data
|
||||
.schnorr_sigs
|
||||
.insert(plan_key.descriptor_key.clone(), bitcoin_sig);
|
||||
modified = true;
|
||||
}
|
||||
}
|
||||
Ok(modified)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,76 +0,0 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::{
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
util::bip32::DerivationPath,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
use crate::{hash256, varint_len, DefiniteDescriptorKey};
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub(crate) enum TemplateItem<Ak> {
|
||||
Sign(PlanKey<Ak>),
|
||||
Pk { key: DefiniteDescriptorKey },
|
||||
One,
|
||||
Zero,
|
||||
Sha256(sha256::Hash),
|
||||
Hash256(hash256::Hash),
|
||||
Ripemd160(ripemd160::Hash),
|
||||
Hash160(hash160::Hash),
|
||||
}
|
||||
|
||||
/// A plan key contains the asset key originally provided along with key in the descriptor it
|
||||
/// purports to be able to derive for along with a "hint" on how to derive it.
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct PlanKey<Ak> {
|
||||
/// The key the planner will sign with
|
||||
pub asset_key: Ak,
|
||||
/// A hint from how to get from the asset key to the concrete key we need to sign with.
|
||||
pub derivation_hint: DerivationPath,
|
||||
/// The key that was in the descriptor that we are satisfying with the signature from the asset
|
||||
/// key.
|
||||
pub descriptor_key: DefiniteDescriptorKey,
|
||||
}
|
||||
|
||||
impl<Ak> TemplateItem<Ak> {
|
||||
pub fn expected_size(&self) -> usize {
|
||||
match self {
|
||||
TemplateItem::Sign { .. } => 64, /*size of sig TODO: take into consideration sighash falg*/
|
||||
TemplateItem::Pk { .. } => 32,
|
||||
TemplateItem::One => varint_len(1),
|
||||
TemplateItem::Zero => 0, /* zero means an empty witness element */
|
||||
// I'm not sure if it should be 32 here (it's a 20 byte hash) but that's what other
|
||||
// parts of the code were doing.
|
||||
TemplateItem::Hash160(_) | TemplateItem::Ripemd160(_) => 32,
|
||||
TemplateItem::Sha256(_) | TemplateItem::Hash256(_) => 32,
|
||||
}
|
||||
}
|
||||
|
||||
// this can only be called if we are sure that auth_data has what we need
|
||||
pub(super) fn to_witness_stack(&self, auth_data: &SatisfactionMaterial) -> Vec<Vec<u8>> {
|
||||
match self {
|
||||
TemplateItem::Sign(plan_key) => {
|
||||
vec![auth_data
|
||||
.schnorr_sigs
|
||||
.get(&plan_key.descriptor_key)
|
||||
.unwrap()
|
||||
.to_vec()]
|
||||
}
|
||||
TemplateItem::One => vec![vec![1]],
|
||||
TemplateItem::Zero => vec![vec![]],
|
||||
TemplateItem::Sha256(image) => {
|
||||
vec![auth_data.sha256_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Hash160(image) => {
|
||||
vec![auth_data.hash160_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
vec![auth_data.ripemd160_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Hash256(image) => {
|
||||
vec![auth_data.hash256_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Pk { key } => vec![key.to_public_key().to_bytes()],
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,437 +0,0 @@
|
||||
#![allow(unused)]
|
||||
#![allow(missing_docs)]
|
||||
#![allow(clippy::all)] // FIXME
|
||||
//! A spending plan or *plan* for short is a representation of a particular spending path on a
|
||||
//! descriptor. This allows us to analayze a choice of spending path without producing any
|
||||
//! signatures or other witness data for it.
|
||||
//!
|
||||
//! To make a plan you provide the descriptor with "assets" like which keys you are able to use, hash
|
||||
//! pre-images you have access to, the current block height etc.
|
||||
//!
|
||||
//! Once you've got a plan it can tell you its expected satisfaction weight which can be useful for
|
||||
//! doing coin selection. Furthermore it provides which subset of those keys and hash pre-images you
|
||||
//! will actually need as well as what locktime or sequence number you need to set.
|
||||
//!
|
||||
//! Once you've obstained signatures, hash pre-images etc required by the plan, it can create a
|
||||
//! witness/script_sig for the input.
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use bitcoin::{
|
||||
blockdata::{locktime::LockTime, transaction::Sequence},
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
secp256k1::Secp256k1,
|
||||
util::{
|
||||
address::WitnessVersion,
|
||||
bip32::{DerivationPath, Fingerprint, KeySource},
|
||||
taproot::{LeafVersion, TapBranchHash, TapLeafHash},
|
||||
},
|
||||
EcdsaSig, SchnorrSig, Script, TxIn, Witness,
|
||||
};
|
||||
use miniscript::{
|
||||
descriptor::{InnerXKey, Tr},
|
||||
hash256, DefiniteDescriptorKey, Descriptor, DescriptorPublicKey, ScriptContext, ToPublicKey,
|
||||
};
|
||||
|
||||
pub(crate) fn varint_len(v: usize) -> usize {
|
||||
bitcoin::VarInt(v as u64).len() as usize
|
||||
}
|
||||
|
||||
mod plan_impls;
|
||||
mod requirements;
|
||||
mod template;
|
||||
pub use requirements::*;
|
||||
pub use template::PlanKey;
|
||||
use template::TemplateItem;
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum TrSpend {
|
||||
KeySpend,
|
||||
LeafSpend {
|
||||
script: Script,
|
||||
leaf_version: LeafVersion,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum Target {
|
||||
Legacy,
|
||||
Segwitv0 {
|
||||
script_code: Script,
|
||||
},
|
||||
Segwitv1 {
|
||||
tr: Tr<DefiniteDescriptorKey>,
|
||||
tr_plan: TrSpend,
|
||||
},
|
||||
}
|
||||
|
||||
impl Target {}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
/// A plan represents a particular spending path for a descriptor.
|
||||
///
|
||||
/// See the module level documentation for more info.
|
||||
pub struct Plan<AK> {
|
||||
template: Vec<TemplateItem<AK>>,
|
||||
target: Target,
|
||||
set_locktime: Option<LockTime>,
|
||||
set_sequence: Option<Sequence>,
|
||||
}
|
||||
|
||||
impl Default for Target {
|
||||
fn default() -> Self {
|
||||
Target::Legacy
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug, Default)]
|
||||
/// Signatures and hash pre-images that can be used to complete a plan.
|
||||
pub struct SatisfactionMaterial {
|
||||
/// Schnorr signautres under their keys
|
||||
pub schnorr_sigs: BTreeMap<DefiniteDescriptorKey, SchnorrSig>,
|
||||
/// ECDSA signatures under their keys
|
||||
pub ecdsa_sigs: BTreeMap<DefiniteDescriptorKey, EcdsaSig>,
|
||||
/// SHA256 pre-images under their images
|
||||
pub sha256_preimages: BTreeMap<sha256::Hash, Vec<u8>>,
|
||||
/// hash160 pre-images under their images
|
||||
pub hash160_preimages: BTreeMap<hash160::Hash, Vec<u8>>,
|
||||
/// hash256 pre-images under their images
|
||||
pub hash256_preimages: BTreeMap<hash256::Hash, Vec<u8>>,
|
||||
/// ripemd160 pre-images under their images
|
||||
pub ripemd160_preimages: BTreeMap<ripemd160::Hash, Vec<u8>>,
|
||||
}
|
||||
|
||||
impl<Ak> Plan<Ak>
|
||||
where
|
||||
Ak: Clone,
|
||||
{
|
||||
/// The expected satisfaction weight for the plan if it is completed.
|
||||
pub fn expected_weight(&self) -> usize {
|
||||
let script_sig_size = match self.target {
|
||||
Target::Legacy => unimplemented!(), // self
|
||||
// .template
|
||||
// .iter()
|
||||
// .map(|step| {
|
||||
// let size = step.expected_size();
|
||||
// size + push_opcode_size(size)
|
||||
// })
|
||||
// .sum()
|
||||
Target::Segwitv0 { .. } | Target::Segwitv1 { .. } => 1,
|
||||
};
|
||||
let witness_elem_sizes: Option<Vec<usize>> = match &self.target {
|
||||
Target::Legacy => None,
|
||||
Target::Segwitv0 { .. } => Some(
|
||||
self.template
|
||||
.iter()
|
||||
.map(|step| step.expected_size())
|
||||
.collect(),
|
||||
),
|
||||
Target::Segwitv1 { tr, tr_plan } => {
|
||||
let mut witness_elems = self
|
||||
.template
|
||||
.iter()
|
||||
.map(|step| step.expected_size())
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
if let TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
} = tr_plan
|
||||
{
|
||||
let control_block = tr
|
||||
.spend_info()
|
||||
.control_block(&(script.clone(), *leaf_version))
|
||||
.expect("must exist");
|
||||
witness_elems.push(script.len());
|
||||
witness_elems.push(control_block.size());
|
||||
}
|
||||
|
||||
Some(witness_elems)
|
||||
}
|
||||
};
|
||||
|
||||
let witness_size: usize = match witness_elem_sizes {
|
||||
Some(elems) => {
|
||||
varint_len(elems.len())
|
||||
+ elems
|
||||
.into_iter()
|
||||
.map(|elem| varint_len(elem) + elem)
|
||||
.sum::<usize>()
|
||||
}
|
||||
None => 0,
|
||||
};
|
||||
|
||||
script_sig_size * 4 + witness_size
|
||||
}
|
||||
|
||||
pub fn requirements(&self) -> Requirements<Ak> {
|
||||
match self.try_complete(&SatisfactionMaterial::default()) {
|
||||
PlanState::Complete { .. } => Requirements::default(),
|
||||
PlanState::Incomplete(requirements) => requirements,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn try_complete(&self, auth_data: &SatisfactionMaterial) -> PlanState<Ak> {
|
||||
let unsatisfied_items = self
|
||||
.template
|
||||
.iter()
|
||||
.filter(|step| match step {
|
||||
TemplateItem::Sign(key) => {
|
||||
!auth_data.schnorr_sigs.contains_key(&key.descriptor_key)
|
||||
}
|
||||
TemplateItem::Hash160(image) => !auth_data.hash160_preimages.contains_key(image),
|
||||
TemplateItem::Hash256(image) => !auth_data.hash256_preimages.contains_key(image),
|
||||
TemplateItem::Sha256(image) => !auth_data.sha256_preimages.contains_key(image),
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
!auth_data.ripemd160_preimages.contains_key(image)
|
||||
}
|
||||
TemplateItem::Pk { .. } | TemplateItem::One | TemplateItem::Zero => false,
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
if unsatisfied_items.is_empty() {
|
||||
let mut witness = self
|
||||
.template
|
||||
.iter()
|
||||
.flat_map(|step| step.to_witness_stack(&auth_data))
|
||||
.collect::<Vec<_>>();
|
||||
match &self.target {
|
||||
Target::Segwitv0 { .. } => todo!(),
|
||||
Target::Legacy => todo!(),
|
||||
Target::Segwitv1 {
|
||||
tr_plan: TrSpend::KeySpend,
|
||||
..
|
||||
} => PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
},
|
||||
Target::Segwitv1 {
|
||||
tr,
|
||||
tr_plan:
|
||||
TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
},
|
||||
} => {
|
||||
let spend_info = tr.spend_info();
|
||||
let control_block = spend_info
|
||||
.control_block(&(script.clone(), *leaf_version))
|
||||
.expect("must exist");
|
||||
witness.push(script.clone().into_bytes());
|
||||
witness.push(control_block.serialize());
|
||||
|
||||
PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
let mut requirements = Requirements::default();
|
||||
|
||||
match &self.target {
|
||||
Target::Legacy => {
|
||||
todo!()
|
||||
}
|
||||
Target::Segwitv0 { .. } => {
|
||||
todo!()
|
||||
}
|
||||
Target::Segwitv1 { tr, tr_plan } => {
|
||||
let spend_info = tr.spend_info();
|
||||
match tr_plan {
|
||||
TrSpend::KeySpend => match &self.template[..] {
|
||||
[TemplateItem::Sign(ref plan_key)] => {
|
||||
requirements.signatures = RequiredSignatures::TapKey {
|
||||
merkle_root: spend_info.merkle_root(),
|
||||
plan_key: plan_key.clone(),
|
||||
};
|
||||
}
|
||||
_ => unreachable!("tapkey spend will always have only one sign step"),
|
||||
},
|
||||
TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
} => {
|
||||
let leaf_hash = TapLeafHash::from_script(&script, *leaf_version);
|
||||
requirements.signatures = RequiredSignatures::TapScript {
|
||||
leaf_hash,
|
||||
plan_keys: vec![],
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let required_signatures = match requirements.signatures {
|
||||
RequiredSignatures::Legacy { .. } => todo!(),
|
||||
RequiredSignatures::Segwitv0 { .. } => todo!(),
|
||||
RequiredSignatures::TapKey { .. } => return PlanState::Incomplete(requirements),
|
||||
RequiredSignatures::TapScript {
|
||||
plan_keys: ref mut keys,
|
||||
..
|
||||
} => keys,
|
||||
};
|
||||
|
||||
for step in unsatisfied_items {
|
||||
match step {
|
||||
TemplateItem::Sign(plan_key) => {
|
||||
required_signatures.push(plan_key.clone());
|
||||
}
|
||||
TemplateItem::Hash160(image) => {
|
||||
requirements.hash160_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Hash256(image) => {
|
||||
requirements.hash256_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Sha256(image) => {
|
||||
requirements.sha256_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
requirements.ripemd160_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Pk { .. } | TemplateItem::One | TemplateItem::Zero => { /* no requirements */
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
PlanState::Incomplete(requirements)
|
||||
}
|
||||
}
|
||||
|
||||
/// Witness version for the plan
|
||||
pub fn witness_version(&self) -> Option<WitnessVersion> {
|
||||
match self.target {
|
||||
Target::Legacy => None,
|
||||
Target::Segwitv0 { .. } => Some(WitnessVersion::V0),
|
||||
Target::Segwitv1 { .. } => Some(WitnessVersion::V1),
|
||||
}
|
||||
}
|
||||
|
||||
/// The minimum required locktime height or time on the transaction using the plan.
|
||||
pub fn required_locktime(&self) -> Option<LockTime> {
|
||||
self.set_locktime.clone()
|
||||
}
|
||||
|
||||
/// The minimum required sequence (height or time) on the input to satisfy the plan
|
||||
pub fn required_sequence(&self) -> Option<Sequence> {
|
||||
self.set_sequence.clone()
|
||||
}
|
||||
|
||||
/// The minmum required transaction version required on the transaction using the plan.
|
||||
pub fn min_version(&self) -> Option<u32> {
|
||||
if let Some(_) = self.set_sequence {
|
||||
Some(2)
|
||||
} else {
|
||||
Some(1)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// The returned value from [`Plan::try_complete`].
|
||||
pub enum PlanState<Ak> {
|
||||
/// The plan is complete
|
||||
Complete {
|
||||
/// The script sig that should be set on the input
|
||||
final_script_sig: Option<Script>,
|
||||
/// The witness that should be set on the input
|
||||
final_script_witness: Option<Witness>,
|
||||
},
|
||||
Incomplete(Requirements<Ak>),
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct Assets<K> {
|
||||
pub keys: Vec<K>,
|
||||
pub txo_age: Option<Sequence>,
|
||||
pub max_locktime: Option<LockTime>,
|
||||
pub sha256: Vec<sha256::Hash>,
|
||||
pub hash256: Vec<hash256::Hash>,
|
||||
pub ripemd160: Vec<ripemd160::Hash>,
|
||||
pub hash160: Vec<hash160::Hash>,
|
||||
}
|
||||
|
||||
impl<K> Default for Assets<K> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
keys: Default::default(),
|
||||
txo_age: Default::default(),
|
||||
max_locktime: Default::default(),
|
||||
sha256: Default::default(),
|
||||
hash256: Default::default(),
|
||||
ripemd160: Default::default(),
|
||||
hash160: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub trait CanDerive {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath>;
|
||||
}
|
||||
|
||||
impl CanDerive for KeySource {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath> {
|
||||
match DescriptorPublicKey::from(key.clone()) {
|
||||
DescriptorPublicKey::Single(single_pub) => {
|
||||
path_to_child(self, single_pub.origin.as_ref()?, None)
|
||||
}
|
||||
DescriptorPublicKey::XPub(dxk) => {
|
||||
let origin = dxk.origin.clone().unwrap_or_else(|| {
|
||||
let secp = Secp256k1::signing_only();
|
||||
(dxk.xkey.xkey_fingerprint(&secp), DerivationPath::master())
|
||||
});
|
||||
|
||||
path_to_child(self, &origin, Some(&dxk.derivation_path))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl CanDerive for DescriptorPublicKey {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath> {
|
||||
match (self, DescriptorPublicKey::from(key.clone())) {
|
||||
(parent, child) if parent == &child => Some(DerivationPath::master()),
|
||||
(DescriptorPublicKey::XPub(parent), _) => {
|
||||
let origin = parent.origin.clone().unwrap_or_else(|| {
|
||||
let secp = Secp256k1::signing_only();
|
||||
(
|
||||
parent.xkey.xkey_fingerprint(&secp),
|
||||
DerivationPath::master(),
|
||||
)
|
||||
});
|
||||
KeySource::from(origin).can_derive(key)
|
||||
}
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn path_to_child(
|
||||
parent: &KeySource,
|
||||
child_origin: &(Fingerprint, DerivationPath),
|
||||
child_derivation: Option<&DerivationPath>,
|
||||
) -> Option<DerivationPath> {
|
||||
if parent.0 == child_origin.0 {
|
||||
let mut remaining_derivation =
|
||||
DerivationPath::from(child_origin.1[..].strip_prefix(&parent.1[..])?);
|
||||
remaining_derivation =
|
||||
remaining_derivation.extend(child_derivation.unwrap_or(&DerivationPath::master()));
|
||||
Some(remaining_derivation)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
pub fn plan_satisfaction<Ak>(
|
||||
desc: &Descriptor<DefiniteDescriptorKey>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<Plan<Ak>>
|
||||
where
|
||||
Ak: CanDerive + Clone,
|
||||
{
|
||||
match desc {
|
||||
Descriptor::Bare(_) => todo!(),
|
||||
Descriptor::Pkh(_) => todo!(),
|
||||
Descriptor::Wpkh(_) => todo!(),
|
||||
Descriptor::Sh(_) => todo!(),
|
||||
Descriptor::Wsh(_) => todo!(),
|
||||
Descriptor::Tr(tr) => crate::plan_impls::plan_satisfaction_tr(tr, assets),
|
||||
}
|
||||
}
|
||||
@@ -1,323 +0,0 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::locktime::{Height, Time};
|
||||
use miniscript::Terminal;
|
||||
|
||||
use super::*;
|
||||
|
||||
impl<Ak> TermPlan<Ak> {
|
||||
fn combine(self, other: Self) -> Option<Self> {
|
||||
let min_locktime = {
|
||||
match (self.min_locktime, other.min_locktime) {
|
||||
(Some(lhs), Some(rhs)) => {
|
||||
if lhs.is_same_unit(rhs) {
|
||||
Some(if lhs.to_consensus_u32() > rhs.to_consensus_u32() {
|
||||
lhs
|
||||
} else {
|
||||
rhs
|
||||
})
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
_ => self.min_locktime.or(other.min_locktime),
|
||||
}
|
||||
};
|
||||
|
||||
let min_sequence = {
|
||||
match (self.min_sequence, other.min_sequence) {
|
||||
(Some(lhs), Some(rhs)) => {
|
||||
if lhs.is_height_locked() == rhs.is_height_locked() {
|
||||
Some(if lhs.to_consensus_u32() > rhs.to_consensus_u32() {
|
||||
lhs
|
||||
} else {
|
||||
rhs
|
||||
})
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
_ => self.min_sequence.or(other.min_sequence),
|
||||
}
|
||||
};
|
||||
|
||||
let mut template = self.template;
|
||||
template.extend(other.template);
|
||||
|
||||
Some(Self {
|
||||
min_locktime,
|
||||
min_sequence,
|
||||
template,
|
||||
})
|
||||
}
|
||||
|
||||
pub(crate) fn expected_size(&self) -> usize {
|
||||
self.template.iter().map(|step| step.expected_size()).sum()
|
||||
}
|
||||
}
|
||||
|
||||
// impl crate::descriptor::Pkh<DefiniteDescriptorKey> {
|
||||
// pub(crate) fn plan_satisfaction<Ak>(&self, assets: &Assets<Ak>) -> Option<Plan<Ak>>
|
||||
// where
|
||||
// Ak: CanDerive + Clone,
|
||||
// {
|
||||
// let (asset_key, derivation_hint) = assets.keys.iter().find_map(|asset_key| {
|
||||
// let derivation_hint = asset_key.can_derive(self.as_inner())?;
|
||||
// Some((asset_key, derivation_hint))
|
||||
// })?;
|
||||
|
||||
// Some(Plan {
|
||||
// template: vec![TemplateItem::Sign(PlanKey {
|
||||
// asset_key: asset_key.clone(),
|
||||
// descriptor_key: self.as_inner().clone(),
|
||||
// derivation_hint,
|
||||
// })],
|
||||
// target: Target::Legacy,
|
||||
// set_locktime: None,
|
||||
// set_sequence: None,
|
||||
// })
|
||||
// }
|
||||
// }
|
||||
|
||||
// impl crate::descriptor::Wpkh<DefiniteDescriptorKey> {
|
||||
// pub(crate) fn plan_satisfaction<Ak>(&self, assets: &Assets<Ak>) -> Option<Plan<Ak>>
|
||||
// where
|
||||
// Ak: CanDerive + Clone,
|
||||
// {
|
||||
// let (asset_key, derivation_hint) = assets.keys.iter().find_map(|asset_key| {
|
||||
// let derivation_hint = asset_key.can_derive(self.as_inner())?;
|
||||
// Some((asset_key, derivation_hint))
|
||||
// })?;
|
||||
|
||||
// Some(Plan {
|
||||
// template: vec![TemplateItem::Sign(PlanKey {
|
||||
// asset_key: asset_key.clone(),
|
||||
// descriptor_key: self.as_inner().clone(),
|
||||
// derivation_hint,
|
||||
// })],
|
||||
// target: Target::Segwitv0,
|
||||
// set_locktime: None,
|
||||
// set_sequence: None,
|
||||
// })
|
||||
// }
|
||||
// }
|
||||
|
||||
pub(crate) fn plan_satisfaction_tr<Ak>(
|
||||
tr: &miniscript::descriptor::Tr<DefiniteDescriptorKey>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<Plan<Ak>>
|
||||
where
|
||||
Ak: CanDerive + Clone,
|
||||
{
|
||||
let key_path_spend = assets.keys.iter().find_map(|asset_key| {
|
||||
let derivation_hint = asset_key.can_derive(tr.internal_key())?;
|
||||
Some((asset_key, derivation_hint))
|
||||
});
|
||||
|
||||
if let Some((asset_key, derivation_hint)) = key_path_spend {
|
||||
return Some(Plan {
|
||||
template: vec![TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
descriptor_key: tr.internal_key().clone(),
|
||||
derivation_hint,
|
||||
})],
|
||||
target: Target::Segwitv1 {
|
||||
tr: tr.clone(),
|
||||
tr_plan: TrSpend::KeySpend,
|
||||
},
|
||||
set_locktime: None,
|
||||
set_sequence: None,
|
||||
});
|
||||
}
|
||||
|
||||
let mut plans = tr
|
||||
.iter_scripts()
|
||||
.filter_map(|(_, ms)| Some((ms, (plan_steps(&ms.node, assets)?))))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
plans.sort_by_cached_key(|(_, plan)| plan.expected_size());
|
||||
|
||||
let (script, best_plan) = plans.into_iter().next()?;
|
||||
|
||||
Some(Plan {
|
||||
target: Target::Segwitv1 {
|
||||
tr: tr.clone(),
|
||||
tr_plan: TrSpend::LeafSpend {
|
||||
script: script.encode(),
|
||||
leaf_version: LeafVersion::TapScript,
|
||||
},
|
||||
},
|
||||
set_locktime: best_plan.min_locktime.clone(),
|
||||
set_sequence: best_plan.min_sequence.clone(),
|
||||
template: best_plan.template,
|
||||
})
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
struct TermPlan<Ak> {
|
||||
pub min_locktime: Option<LockTime>,
|
||||
pub min_sequence: Option<Sequence>,
|
||||
pub template: Vec<TemplateItem<Ak>>,
|
||||
}
|
||||
|
||||
impl<Ak> TermPlan<Ak> {
|
||||
fn new(template: Vec<TemplateItem<Ak>>) -> Self {
|
||||
TermPlan {
|
||||
template,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Default for TermPlan<Ak> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
min_locktime: Default::default(),
|
||||
min_sequence: Default::default(),
|
||||
template: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn plan_steps<Ak: Clone + CanDerive, Ctx: ScriptContext>(
|
||||
term: &Terminal<DefiniteDescriptorKey, Ctx>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<TermPlan<Ak>> {
|
||||
match term {
|
||||
Terminal::True => Some(TermPlan::new(vec![])),
|
||||
Terminal::False => return None,
|
||||
Terminal::PkH(key) => {
|
||||
let (asset_key, derivation_hint) = assets
|
||||
.keys
|
||||
.iter()
|
||||
.find_map(|asset_key| Some((asset_key, asset_key.can_derive(key)?)))?;
|
||||
Some(TermPlan::new(vec![
|
||||
TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
derivation_hint,
|
||||
descriptor_key: key.clone(),
|
||||
}),
|
||||
TemplateItem::Pk { key: key.clone() },
|
||||
]))
|
||||
}
|
||||
Terminal::PkK(key) => {
|
||||
let (asset_key, derivation_hint) = assets
|
||||
.keys
|
||||
.iter()
|
||||
.find_map(|asset_key| Some((asset_key, asset_key.can_derive(key)?)))?;
|
||||
Some(TermPlan::new(vec![TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
derivation_hint,
|
||||
descriptor_key: key.clone(),
|
||||
})]))
|
||||
}
|
||||
Terminal::RawPkH(_pk_hash) => {
|
||||
/* TODO */
|
||||
None
|
||||
}
|
||||
Terminal::After(locktime) => {
|
||||
let max_locktime = assets.max_locktime?;
|
||||
let locktime = LockTime::from(locktime);
|
||||
let (height, time) = match max_locktime {
|
||||
LockTime::Blocks(height) => (height, Time::from_consensus(0).unwrap()),
|
||||
LockTime::Seconds(seconds) => (Height::from_consensus(0).unwrap(), seconds),
|
||||
};
|
||||
if max_locktime.is_satisfied_by(height, time) {
|
||||
Some(TermPlan {
|
||||
min_locktime: Some(locktime),
|
||||
..Default::default()
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Older(older) => {
|
||||
// FIXME: older should be a height or time not a sequence.
|
||||
let max_sequence = assets.txo_age?;
|
||||
//TODO: this whole thing is probably wrong but upstream should provide a way of
|
||||
// doing it properly.
|
||||
if max_sequence.is_height_locked() == older.is_height_locked() {
|
||||
if max_sequence.to_consensus_u32() >= older.to_consensus_u32() {
|
||||
Some(TermPlan {
|
||||
min_sequence: Some(*older),
|
||||
..Default::default()
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Sha256(image) => {
|
||||
if assets.sha256.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Sha256(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Hash256(image) => {
|
||||
if assets.hash256.contains(image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Hash256(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Ripemd160(image) => {
|
||||
if assets.ripemd160.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Ripemd160(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Hash160(image) => {
|
||||
if assets.hash160.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Hash160(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Alt(ms)
|
||||
| Terminal::Swap(ms)
|
||||
| Terminal::Check(ms)
|
||||
| Terminal::Verify(ms)
|
||||
| Terminal::NonZero(ms)
|
||||
| Terminal::ZeroNotEqual(ms) => plan_steps(&ms.node, assets),
|
||||
Terminal::DupIf(ms) => {
|
||||
let mut plan = plan_steps(&ms.node, assets)?;
|
||||
plan.template.push(TemplateItem::One);
|
||||
Some(plan)
|
||||
}
|
||||
Terminal::AndV(l, r) | Terminal::AndB(l, r) => {
|
||||
let lhs = plan_steps(&l.node, assets)?;
|
||||
let rhs = plan_steps(&r.node, assets)?;
|
||||
lhs.combine(rhs)
|
||||
}
|
||||
Terminal::AndOr(_, _, _) => todo!(),
|
||||
Terminal::OrB(_, _) => todo!(),
|
||||
Terminal::OrD(_, _) => todo!(),
|
||||
Terminal::OrC(_, _) => todo!(),
|
||||
Terminal::OrI(lhs, rhs) => {
|
||||
let lplan = plan_steps(&lhs.node, assets).map(|mut plan| {
|
||||
plan.template.push(TemplateItem::One);
|
||||
plan
|
||||
});
|
||||
let rplan = plan_steps(&rhs.node, assets).map(|mut plan| {
|
||||
plan.template.push(TemplateItem::Zero);
|
||||
plan
|
||||
});
|
||||
match (lplan, rplan) {
|
||||
(Some(lplan), Some(rplan)) => {
|
||||
if lplan.expected_size() <= rplan.expected_size() {
|
||||
Some(lplan)
|
||||
} else {
|
||||
Some(rplan)
|
||||
}
|
||||
}
|
||||
(lplan, rplan) => lplan.or(rplan),
|
||||
}
|
||||
}
|
||||
Terminal::Thresh(_, _) => todo!(),
|
||||
Terminal::Multi(_, _) => todo!(),
|
||||
Terminal::MultiA(_, _) => todo!(),
|
||||
}
|
||||
}
|
||||
@@ -1,218 +0,0 @@
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use core::ops::Deref;
|
||||
|
||||
use bitcoin::{
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
psbt::Prevouts,
|
||||
secp256k1::{KeyPair, Message, PublicKey, Signing, Verification},
|
||||
util::{bip32, sighash, sighash::SighashCache, taproot},
|
||||
EcdsaSighashType, SchnorrSighashType, Transaction, TxOut, XOnlyPublicKey,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
use miniscript::{
|
||||
descriptor::{DescriptorSecretKey, KeyMap},
|
||||
hash256,
|
||||
};
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
/// Signatures and hash pre-images that must be provided to complete the plan.
|
||||
pub struct Requirements<Ak> {
|
||||
/// required signatures
|
||||
pub signatures: RequiredSignatures<Ak>,
|
||||
/// required sha256 pre-images
|
||||
pub sha256_images: HashSet<sha256::Hash>,
|
||||
/// required hash160 pre-images
|
||||
pub hash160_images: HashSet<hash160::Hash>,
|
||||
/// required hash256 pre-images
|
||||
pub hash256_images: HashSet<hash256::Hash>,
|
||||
/// required ripemd160 pre-images
|
||||
pub ripemd160_images: HashSet<ripemd160::Hash>,
|
||||
}
|
||||
|
||||
impl<Ak> Default for RequiredSignatures<Ak> {
|
||||
fn default() -> Self {
|
||||
RequiredSignatures::Legacy {
|
||||
keys: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Default for Requirements<Ak> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
signatures: Default::default(),
|
||||
sha256_images: Default::default(),
|
||||
hash160_images: Default::default(),
|
||||
hash256_images: Default::default(),
|
||||
ripemd160_images: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Requirements<Ak> {
|
||||
/// Whether any hash pre-images are required in the plan
|
||||
pub fn requires_hash_preimages(&self) -> bool {
|
||||
!(self.sha256_images.is_empty()
|
||||
&& self.hash160_images.is_empty()
|
||||
&& self.hash256_images.is_empty()
|
||||
&& self.ripemd160_images.is_empty())
|
||||
}
|
||||
}
|
||||
|
||||
/// The signatures required to complete the plan
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum RequiredSignatures<Ak> {
|
||||
/// Legacy ECDSA signatures are required
|
||||
Legacy { keys: Vec<PlanKey<Ak>> },
|
||||
/// Segwitv0 ECDSA signatures are required
|
||||
Segwitv0 { keys: Vec<PlanKey<Ak>> },
|
||||
/// A Taproot key spend signature is required
|
||||
TapKey {
|
||||
/// the internal key
|
||||
plan_key: PlanKey<Ak>,
|
||||
/// The merkle root of the taproot output
|
||||
merkle_root: Option<TapBranchHash>,
|
||||
},
|
||||
/// Taproot script path signatures are required
|
||||
TapScript {
|
||||
/// The leaf hash of the script being used
|
||||
leaf_hash: TapLeafHash,
|
||||
/// The keys in the script that require signatures
|
||||
plan_keys: Vec<PlanKey<Ak>>,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum SigningError {
|
||||
SigHashError(sighash::Error),
|
||||
DerivationError(bip32::Error),
|
||||
}
|
||||
|
||||
impl From<sighash::Error> for SigningError {
|
||||
fn from(e: sighash::Error) -> Self {
|
||||
Self::SigHashError(e)
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for SigningError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
SigningError::SigHashError(e) => e.fmt(f),
|
||||
SigningError::DerivationError(e) => e.fmt(f),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bip32::Error> for SigningError {
|
||||
fn from(e: bip32::Error) -> Self {
|
||||
Self::DerivationError(e)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for SigningError {}
|
||||
|
||||
impl RequiredSignatures<DescriptorPublicKey> {
|
||||
pub fn sign_with_keymap<T: Deref<Target = Transaction>>(
|
||||
&self,
|
||||
input_index: usize,
|
||||
keymap: &KeyMap,
|
||||
prevouts: &Prevouts<'_, impl core::borrow::Borrow<TxOut>>,
|
||||
schnorr_sighashty: Option<SchnorrSighashType>,
|
||||
_ecdsa_sighashty: Option<EcdsaSighashType>,
|
||||
sighash_cache: &mut SighashCache<T>,
|
||||
auth_data: &mut SatisfactionMaterial,
|
||||
secp: &Secp256k1<impl Signing + Verification>,
|
||||
) -> Result<bool, SigningError> {
|
||||
match self {
|
||||
RequiredSignatures::Legacy { .. } | RequiredSignatures::Segwitv0 { .. } => todo!(),
|
||||
RequiredSignatures::TapKey {
|
||||
plan_key,
|
||||
merkle_root,
|
||||
} => {
|
||||
let schnorr_sighashty = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_key_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
schnorr_sighashty,
|
||||
)?;
|
||||
let secret_key = match keymap.get(&plan_key.asset_key) {
|
||||
Some(secret_key) => secret_key,
|
||||
None => return Ok(false),
|
||||
};
|
||||
let secret_key = match secret_key {
|
||||
DescriptorSecretKey::Single(single) => single.key.inner,
|
||||
DescriptorSecretKey::XPrv(xprv) => {
|
||||
xprv.xkey
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
};
|
||||
|
||||
let pubkey = PublicKey::from_secret_key(&secp, &secret_key);
|
||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey);
|
||||
|
||||
let tweak =
|
||||
taproot::TapTweakHash::from_key_and_tweak(x_only_pubkey, merkle_root.clone());
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone())
|
||||
.add_xonly_tweak(&secp, &tweak.to_scalar())
|
||||
.unwrap();
|
||||
|
||||
let msg = Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
sig,
|
||||
hash_ty: schnorr_sighashty,
|
||||
};
|
||||
|
||||
auth_data
|
||||
.schnorr_sigs
|
||||
.insert(plan_key.descriptor_key.clone(), bitcoin_sig);
|
||||
Ok(true)
|
||||
}
|
||||
RequiredSignatures::TapScript {
|
||||
leaf_hash,
|
||||
plan_keys,
|
||||
} => {
|
||||
let sighash_type = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_script_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
*leaf_hash,
|
||||
sighash_type,
|
||||
)?;
|
||||
|
||||
let mut modified = false;
|
||||
|
||||
for plan_key in plan_keys {
|
||||
if let Some(secret_key) = keymap.get(&plan_key.asset_key) {
|
||||
let secret_key = match secret_key {
|
||||
DescriptorSecretKey::Single(single) => single.key.inner,
|
||||
DescriptorSecretKey::XPrv(xprv) => {
|
||||
xprv.xkey
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
};
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone());
|
||||
let msg =
|
||||
Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
sig,
|
||||
hash_ty: sighash_type,
|
||||
};
|
||||
|
||||
auth_data
|
||||
.schnorr_sigs
|
||||
.insert(plan_key.descriptor_key.clone(), bitcoin_sig);
|
||||
modified = true;
|
||||
}
|
||||
}
|
||||
Ok(modified)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,76 +0,0 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::{
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
util::bip32::DerivationPath,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
use crate::{hash256, varint_len, DefiniteDescriptorKey};
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub(crate) enum TemplateItem<Ak> {
|
||||
Sign(PlanKey<Ak>),
|
||||
Pk { key: DefiniteDescriptorKey },
|
||||
One,
|
||||
Zero,
|
||||
Sha256(sha256::Hash),
|
||||
Hash256(hash256::Hash),
|
||||
Ripemd160(ripemd160::Hash),
|
||||
Hash160(hash160::Hash),
|
||||
}
|
||||
|
||||
/// A plan key contains the asset key originally provided along with key in the descriptor it
|
||||
/// purports to be able to derive for along with a "hint" on how to derive it.
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct PlanKey<Ak> {
|
||||
/// The key the planner will sign with
|
||||
pub asset_key: Ak,
|
||||
/// A hint from how to get from the asset key to the concrete key we need to sign with.
|
||||
pub derivation_hint: DerivationPath,
|
||||
/// The key that was in the descriptor that we are satisfying with the signature from the asset
|
||||
/// key.
|
||||
pub descriptor_key: DefiniteDescriptorKey,
|
||||
}
|
||||
|
||||
impl<Ak> TemplateItem<Ak> {
|
||||
pub fn expected_size(&self) -> usize {
|
||||
match self {
|
||||
TemplateItem::Sign { .. } => 64, /* size of sig TODO: take into consideration sighash falg */
|
||||
TemplateItem::Pk { .. } => 32,
|
||||
TemplateItem::One => varint_len(1),
|
||||
TemplateItem::Zero => 0, /* zero means an empty witness element */
|
||||
// I'm not sure if it should be 32 here (it's a 20 byte hash) but that's what other
|
||||
// parts of the code were doing.
|
||||
TemplateItem::Hash160(_) | TemplateItem::Ripemd160(_) => 32,
|
||||
TemplateItem::Sha256(_) | TemplateItem::Hash256(_) => 32,
|
||||
}
|
||||
}
|
||||
|
||||
// this can only be called if we are sure that auth_data has what we need
|
||||
pub(super) fn to_witness_stack(&self, auth_data: &SatisfactionMaterial) -> Vec<Vec<u8>> {
|
||||
match self {
|
||||
TemplateItem::Sign(plan_key) => {
|
||||
vec![auth_data
|
||||
.schnorr_sigs
|
||||
.get(&plan_key.descriptor_key)
|
||||
.unwrap()
|
||||
.to_vec()]
|
||||
}
|
||||
TemplateItem::One => vec![vec![1]],
|
||||
TemplateItem::Zero => vec![vec![]],
|
||||
TemplateItem::Sha256(image) => {
|
||||
vec![auth_data.sha256_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Hash160(image) => {
|
||||
vec![auth_data.hash160_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
vec![auth_data.ripemd160_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Hash256(image) => {
|
||||
vec![auth_data.hash256_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Pk { key } => vec![key.to_public_key().to_bytes()],
|
||||
}
|
||||
}
|
||||
}
|
||||
248
src/blockchain/any.rs
Normal file
248
src/blockchain/any.rs
Normal file
@@ -0,0 +1,248 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
//! Runtime-checked blockchain types
|
||||
//!
|
||||
//! This module provides the implementation of [`AnyBlockchain`] which allows switching the
|
||||
//! inner [`Blockchain`] type at runtime.
|
||||
//!
|
||||
//! ## Example
|
||||
//!
|
||||
//! When paired with the use of [`ConfigurableBlockchain`], it allows creating any
|
||||
//! blockchain type supported using a single line of code:
|
||||
//!
|
||||
//! ```no_run
|
||||
//! # use bitcoin::Network;
|
||||
//! # use bdk::blockchain::*;
|
||||
//! # #[cfg(all(feature = "esplora", feature = "ureq"))]
|
||||
//! # {
|
||||
//! let config = serde_json::from_str("...")?;
|
||||
//! let blockchain = AnyBlockchain::from_config(&config)?;
|
||||
//! let height = blockchain.get_height();
|
||||
//! # }
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! ```
|
||||
|
||||
use super::*;
|
||||
|
||||
macro_rules! impl_from {
|
||||
( boxed $from:ty, $to:ty, $variant:ident, $( $cfg:tt )* ) => {
|
||||
$( $cfg )*
|
||||
impl From<$from> for $to {
|
||||
fn from(inner: $from) -> Self {
|
||||
<$to>::$variant(Box::new(inner))
|
||||
}
|
||||
}
|
||||
};
|
||||
( $from:ty, $to:ty, $variant:ident, $( $cfg:tt )* ) => {
|
||||
$( $cfg )*
|
||||
impl From<$from> for $to {
|
||||
fn from(inner: $from) -> Self {
|
||||
<$to>::$variant(inner)
|
||||
}
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
macro_rules! impl_inner_method {
|
||||
( $self:expr, $name:ident $(, $args:expr)* ) => {
|
||||
match $self {
|
||||
#[cfg(feature = "electrum")]
|
||||
AnyBlockchain::Electrum(inner) => inner.$name( $($args, )* ),
|
||||
#[cfg(feature = "esplora")]
|
||||
AnyBlockchain::Esplora(inner) => inner.$name( $($args, )* ),
|
||||
#[cfg(feature = "compact_filters")]
|
||||
AnyBlockchain::CompactFilters(inner) => inner.$name( $($args, )* ),
|
||||
#[cfg(feature = "rpc")]
|
||||
AnyBlockchain::Rpc(inner) => inner.$name( $($args, )* ),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Type that can contain any of the [`Blockchain`] types defined by the library
|
||||
///
|
||||
/// It allows switching backend at runtime
|
||||
///
|
||||
/// See [this module](crate::blockchain::any)'s documentation for a usage example.
|
||||
pub enum AnyBlockchain {
|
||||
#[cfg(feature = "electrum")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "electrum")))]
|
||||
/// Electrum client
|
||||
Electrum(Box<electrum::ElectrumBlockchain>),
|
||||
#[cfg(feature = "esplora")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "esplora")))]
|
||||
/// Esplora client
|
||||
Esplora(Box<esplora::EsploraBlockchain>),
|
||||
#[cfg(feature = "compact_filters")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "compact_filters")))]
|
||||
/// Compact filters client
|
||||
CompactFilters(Box<compact_filters::CompactFiltersBlockchain>),
|
||||
#[cfg(feature = "rpc")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "rpc")))]
|
||||
/// RPC client
|
||||
Rpc(Box<rpc::RpcBlockchain>),
|
||||
}
|
||||
|
||||
#[maybe_async]
|
||||
impl Blockchain for AnyBlockchain {
|
||||
fn get_capabilities(&self) -> HashSet<Capability> {
|
||||
maybe_await!(impl_inner_method!(self, get_capabilities))
|
||||
}
|
||||
|
||||
fn broadcast(&self, tx: &Transaction) -> Result<(), Error> {
|
||||
maybe_await!(impl_inner_method!(self, broadcast, tx))
|
||||
}
|
||||
|
||||
fn estimate_fee(&self, target: usize) -> Result<FeeRate, Error> {
|
||||
maybe_await!(impl_inner_method!(self, estimate_fee, target))
|
||||
}
|
||||
}
|
||||
|
||||
#[maybe_async]
|
||||
impl GetHeight for AnyBlockchain {
|
||||
fn get_height(&self) -> Result<u32, Error> {
|
||||
maybe_await!(impl_inner_method!(self, get_height))
|
||||
}
|
||||
}
|
||||
|
||||
#[maybe_async]
|
||||
impl GetTx for AnyBlockchain {
|
||||
fn get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||
maybe_await!(impl_inner_method!(self, get_tx, txid))
|
||||
}
|
||||
}
|
||||
|
||||
#[maybe_async]
|
||||
impl GetBlockHash for AnyBlockchain {
|
||||
fn get_block_hash(&self, height: u64) -> Result<BlockHash, Error> {
|
||||
maybe_await!(impl_inner_method!(self, get_block_hash, height))
|
||||
}
|
||||
}
|
||||
|
||||
#[maybe_async]
|
||||
impl WalletSync for AnyBlockchain {
|
||||
fn wallet_sync<D: BatchDatabase>(
|
||||
&self,
|
||||
database: &RefCell<D>,
|
||||
progress_update: Box<dyn Progress>,
|
||||
) -> Result<(), Error> {
|
||||
maybe_await!(impl_inner_method!(
|
||||
self,
|
||||
wallet_sync,
|
||||
database,
|
||||
progress_update
|
||||
))
|
||||
}
|
||||
|
||||
fn wallet_setup<D: BatchDatabase>(
|
||||
&self,
|
||||
database: &RefCell<D>,
|
||||
progress_update: Box<dyn Progress>,
|
||||
) -> Result<(), Error> {
|
||||
maybe_await!(impl_inner_method!(
|
||||
self,
|
||||
wallet_setup,
|
||||
database,
|
||||
progress_update
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
impl_from!(boxed electrum::ElectrumBlockchain, AnyBlockchain, Electrum, #[cfg(feature = "electrum")]);
|
||||
impl_from!(boxed esplora::EsploraBlockchain, AnyBlockchain, Esplora, #[cfg(feature = "esplora")]);
|
||||
impl_from!(boxed compact_filters::CompactFiltersBlockchain, AnyBlockchain, CompactFilters, #[cfg(feature = "compact_filters")]);
|
||||
impl_from!(boxed rpc::RpcBlockchain, AnyBlockchain, Rpc, #[cfg(feature = "rpc")]);
|
||||
|
||||
/// Type that can contain any of the blockchain configurations defined by the library
|
||||
///
|
||||
/// This allows storing a single configuration that can be loaded into an [`AnyBlockchain`]
|
||||
/// instance. Wallets that plan to offer users the ability to switch blockchain backend at runtime
|
||||
/// will find this particularly useful.
|
||||
///
|
||||
/// This type can be serialized from a JSON object like:
|
||||
///
|
||||
/// ```
|
||||
/// # #[cfg(feature = "electrum")]
|
||||
/// # {
|
||||
/// use bdk::blockchain::{electrum::ElectrumBlockchainConfig, AnyBlockchainConfig};
|
||||
/// let config: AnyBlockchainConfig = serde_json::from_str(
|
||||
/// r#"{
|
||||
/// "type" : "electrum",
|
||||
/// "url" : "ssl://electrum.blockstream.info:50002",
|
||||
/// "retry": 2,
|
||||
/// "stop_gap": 20,
|
||||
/// "validate_domain": true
|
||||
/// }"#,
|
||||
/// )
|
||||
/// .unwrap();
|
||||
/// assert_eq!(
|
||||
/// config,
|
||||
/// AnyBlockchainConfig::Electrum(ElectrumBlockchainConfig {
|
||||
/// url: "ssl://electrum.blockstream.info:50002".into(),
|
||||
/// retry: 2,
|
||||
/// socks5: None,
|
||||
/// timeout: None,
|
||||
/// stop_gap: 20,
|
||||
/// validate_domain: true,
|
||||
/// })
|
||||
/// );
|
||||
/// # }
|
||||
/// ```
|
||||
#[derive(Debug, serde::Serialize, serde::Deserialize, Clone, PartialEq, Eq)]
|
||||
#[serde(tag = "type", rename_all = "snake_case")]
|
||||
pub enum AnyBlockchainConfig {
|
||||
#[cfg(feature = "electrum")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "electrum")))]
|
||||
/// Electrum client
|
||||
Electrum(electrum::ElectrumBlockchainConfig),
|
||||
#[cfg(feature = "esplora")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "esplora")))]
|
||||
/// Esplora client
|
||||
Esplora(esplora::EsploraBlockchainConfig),
|
||||
#[cfg(feature = "compact_filters")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "compact_filters")))]
|
||||
/// Compact filters client
|
||||
CompactFilters(compact_filters::CompactFiltersBlockchainConfig),
|
||||
#[cfg(feature = "rpc")]
|
||||
#[cfg_attr(docsrs, doc(cfg(feature = "rpc")))]
|
||||
/// RPC client configuration
|
||||
Rpc(rpc::RpcConfig),
|
||||
}
|
||||
|
||||
impl ConfigurableBlockchain for AnyBlockchain {
|
||||
type Config = AnyBlockchainConfig;
|
||||
|
||||
fn from_config(config: &Self::Config) -> Result<Self, Error> {
|
||||
Ok(match config {
|
||||
#[cfg(feature = "electrum")]
|
||||
AnyBlockchainConfig::Electrum(inner) => {
|
||||
AnyBlockchain::Electrum(Box::new(electrum::ElectrumBlockchain::from_config(inner)?))
|
||||
}
|
||||
#[cfg(feature = "esplora")]
|
||||
AnyBlockchainConfig::Esplora(inner) => {
|
||||
AnyBlockchain::Esplora(Box::new(esplora::EsploraBlockchain::from_config(inner)?))
|
||||
}
|
||||
#[cfg(feature = "compact_filters")]
|
||||
AnyBlockchainConfig::CompactFilters(inner) => AnyBlockchain::CompactFilters(Box::new(
|
||||
compact_filters::CompactFiltersBlockchain::from_config(inner)?,
|
||||
)),
|
||||
#[cfg(feature = "rpc")]
|
||||
AnyBlockchainConfig::Rpc(inner) => {
|
||||
AnyBlockchain::Rpc(Box::new(rpc::RpcBlockchain::from_config(inner)?))
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
impl_from!(electrum::ElectrumBlockchainConfig, AnyBlockchainConfig, Electrum, #[cfg(feature = "electrum")]);
|
||||
impl_from!(esplora::EsploraBlockchainConfig, AnyBlockchainConfig, Esplora, #[cfg(feature = "esplora")]);
|
||||
impl_from!(compact_filters::CompactFiltersBlockchainConfig, AnyBlockchainConfig, CompactFilters, #[cfg(feature = "compact_filters")]);
|
||||
impl_from!(rpc::RpcConfig, AnyBlockchainConfig, Rpc, #[cfg(feature = "rpc")]);
|
||||
618
src/blockchain/compact_filters/mod.rs
Normal file
618
src/blockchain/compact_filters/mod.rs
Normal file
@@ -0,0 +1,618 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
//! Compact Filters
|
||||
//!
|
||||
//! This module contains a multithreaded implementation of an [`Blockchain`] backend that
|
||||
//! uses BIP157 (aka "Neutrino") to populate the wallet's [database](crate::database::Database)
|
||||
//! by downloading compact filters from the P2P network.
|
||||
//!
|
||||
//! Since there are currently very few peers "in the wild" that advertise the required service
|
||||
//! flag, this implementation requires that one or more known peers are provided by the user.
|
||||
//! No dns or other kinds of peer discovery are done internally.
|
||||
//!
|
||||
//! Moreover, this module doesn't currently support detecting and resolving conflicts between
|
||||
//! messages received by different peers. Thus, it's recommended to use this module by only
|
||||
//! connecting to a single peer at a time, optionally by opening multiple connections if it's
|
||||
//! desirable to use multiple threads at once to sync in parallel.
|
||||
//!
|
||||
//! This is an **EXPERIMENTAL** feature, API and other major changes are expected.
|
||||
//!
|
||||
//! ## Example
|
||||
//!
|
||||
//! ```no_run
|
||||
//! # use std::sync::Arc;
|
||||
//! # use bitcoin::*;
|
||||
//! # use bdk::*;
|
||||
//! # use bdk::blockchain::compact_filters::*;
|
||||
//! let num_threads = 4;
|
||||
//!
|
||||
//! let mempool = Arc::new(Mempool::default());
|
||||
//! let peers = (0..num_threads)
|
||||
//! .map(|_| {
|
||||
//! Peer::connect(
|
||||
//! "btcd-mainnet.lightning.computer:8333",
|
||||
//! Arc::clone(&mempool),
|
||||
//! Network::Bitcoin,
|
||||
//! )
|
||||
//! })
|
||||
//! .collect::<Result<_, _>>()?;
|
||||
//! let blockchain = CompactFiltersBlockchain::new(peers, "./wallet-filters", Some(500_000))?;
|
||||
//! # Ok::<(), CompactFiltersError>(())
|
||||
//! ```
|
||||
|
||||
use std::collections::HashSet;
|
||||
use std::fmt;
|
||||
use std::ops::DerefMut;
|
||||
use std::path::Path;
|
||||
use std::sync::atomic::{AtomicUsize, Ordering};
|
||||
use std::sync::{Arc, Mutex};
|
||||
|
||||
#[allow(unused_imports)]
|
||||
use log::{debug, error, info, trace};
|
||||
|
||||
use bitcoin::network::message_blockdata::Inventory;
|
||||
use bitcoin::{Network, OutPoint, Transaction, Txid};
|
||||
|
||||
use rocksdb::{Options, SliceTransform, DB};
|
||||
|
||||
mod peer;
|
||||
mod store;
|
||||
mod sync;
|
||||
|
||||
use crate::blockchain::*;
|
||||
use crate::database::{BatchDatabase, BatchOperations, DatabaseUtils};
|
||||
use crate::error::Error;
|
||||
use crate::types::{KeychainKind, LocalUtxo, TransactionDetails};
|
||||
use crate::{BlockTime, FeeRate};
|
||||
|
||||
use peer::*;
|
||||
use store::*;
|
||||
use sync::*;
|
||||
|
||||
pub use peer::{Mempool, Peer};
|
||||
|
||||
const SYNC_HEADERS_COST: f32 = 1.0;
|
||||
const SYNC_FILTERS_COST: f32 = 11.6 * 1_000.0;
|
||||
const PROCESS_BLOCKS_COST: f32 = 20_000.0;
|
||||
|
||||
/// Structure implementing the required blockchain traits
|
||||
///
|
||||
/// ## Example
|
||||
/// See the [`blockchain::compact_filters`](crate::blockchain::compact_filters) module for a usage example.
|
||||
#[derive(Debug)]
|
||||
pub struct CompactFiltersBlockchain {
|
||||
peers: Vec<Arc<Peer>>,
|
||||
headers: Arc<ChainStore<Full>>,
|
||||
skip_blocks: Option<usize>,
|
||||
}
|
||||
|
||||
impl CompactFiltersBlockchain {
|
||||
/// Construct a new instance given a list of peers, a path to store headers and block
|
||||
/// filters downloaded during the sync and optionally a number of blocks to ignore starting
|
||||
/// from the genesis while scanning for the wallet's outputs.
|
||||
///
|
||||
/// For each [`Peer`] specified a new thread will be spawned to download and verify the filters
|
||||
/// in parallel. It's currently recommended to only connect to a single peer to avoid
|
||||
/// inconsistencies in the data returned, optionally with multiple connections in parallel to
|
||||
/// speed-up the sync process.
|
||||
pub fn new<P: AsRef<Path>>(
|
||||
peers: Vec<Peer>,
|
||||
storage_dir: P,
|
||||
skip_blocks: Option<usize>,
|
||||
) -> Result<Self, CompactFiltersError> {
|
||||
if peers.is_empty() {
|
||||
return Err(CompactFiltersError::NoPeers);
|
||||
}
|
||||
|
||||
let mut opts = Options::default();
|
||||
opts.create_if_missing(true);
|
||||
opts.set_prefix_extractor(SliceTransform::create_fixed_prefix(16));
|
||||
|
||||
let network = peers[0].get_network();
|
||||
|
||||
let cfs = DB::list_cf(&opts, &storage_dir).unwrap_or_else(|_| vec!["default".to_string()]);
|
||||
let db = DB::open_cf(&opts, &storage_dir, &cfs)?;
|
||||
let headers = Arc::new(ChainStore::new(db, network)?);
|
||||
|
||||
// try to recover partial snapshots
|
||||
for cf_name in &cfs {
|
||||
if !cf_name.starts_with("_headers:") {
|
||||
continue;
|
||||
}
|
||||
|
||||
info!("Trying to recover: {:?}", cf_name);
|
||||
headers.recover_snapshot(cf_name)?;
|
||||
}
|
||||
|
||||
Ok(CompactFiltersBlockchain {
|
||||
peers: peers.into_iter().map(Arc::new).collect(),
|
||||
headers,
|
||||
skip_blocks,
|
||||
})
|
||||
}
|
||||
|
||||
/// Process a transaction by looking for inputs that spend from a UTXO in the database or
|
||||
/// outputs that send funds to a know script_pubkey.
|
||||
fn process_tx<D: BatchDatabase>(
|
||||
&self,
|
||||
database: &mut D,
|
||||
tx: &Transaction,
|
||||
height: Option<u32>,
|
||||
timestamp: Option<u64>,
|
||||
internal_max_deriv: &mut Option<u32>,
|
||||
external_max_deriv: &mut Option<u32>,
|
||||
) -> Result<(), Error> {
|
||||
let mut updates = database.begin_batch();
|
||||
|
||||
let mut incoming: u64 = 0;
|
||||
let mut outgoing: u64 = 0;
|
||||
|
||||
let mut inputs_sum: u64 = 0;
|
||||
let mut outputs_sum: u64 = 0;
|
||||
|
||||
// look for our own inputs
|
||||
for (i, input) in tx.input.iter().enumerate() {
|
||||
if let Some(previous_output) = database.get_previous_output(&input.previous_output)? {
|
||||
inputs_sum += previous_output.value;
|
||||
|
||||
// this output is ours, we have a path to derive it
|
||||
if let Some((keychain, _)) =
|
||||
database.get_path_from_script_pubkey(&previous_output.script_pubkey)?
|
||||
{
|
||||
outgoing += previous_output.value;
|
||||
|
||||
debug!("{} input #{} is mine, setting utxo as spent", tx.txid(), i);
|
||||
updates.set_utxo(&LocalUtxo {
|
||||
outpoint: input.previous_output,
|
||||
txout: previous_output.clone(),
|
||||
keychain,
|
||||
is_spent: true,
|
||||
})?;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for (i, output) in tx.output.iter().enumerate() {
|
||||
// to compute the fees later
|
||||
outputs_sum += output.value;
|
||||
|
||||
// this output is ours, we have a path to derive it
|
||||
if let Some((keychain, child)) =
|
||||
database.get_path_from_script_pubkey(&output.script_pubkey)?
|
||||
{
|
||||
debug!("{} output #{} is mine, adding utxo", tx.txid(), i);
|
||||
updates.set_utxo(&LocalUtxo {
|
||||
outpoint: OutPoint::new(tx.txid(), i as u32),
|
||||
txout: output.clone(),
|
||||
keychain,
|
||||
is_spent: false,
|
||||
})?;
|
||||
incoming += output.value;
|
||||
|
||||
if keychain == KeychainKind::Internal
|
||||
&& (internal_max_deriv.is_none() || child > internal_max_deriv.unwrap_or(0))
|
||||
{
|
||||
*internal_max_deriv = Some(child);
|
||||
} else if keychain == KeychainKind::External
|
||||
&& (external_max_deriv.is_none() || child > external_max_deriv.unwrap_or(0))
|
||||
{
|
||||
*external_max_deriv = Some(child);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if incoming > 0 || outgoing > 0 {
|
||||
let tx = TransactionDetails {
|
||||
txid: tx.txid(),
|
||||
transaction: Some(tx.clone()),
|
||||
received: incoming,
|
||||
sent: outgoing,
|
||||
confirmation_time: BlockTime::new(height, timestamp),
|
||||
fee: Some(inputs_sum.saturating_sub(outputs_sum)),
|
||||
};
|
||||
|
||||
info!("Saving tx {}", tx.txid);
|
||||
updates.set_tx(&tx)?;
|
||||
}
|
||||
|
||||
database.commit_batch(updates)?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl Blockchain for CompactFiltersBlockchain {
|
||||
fn get_capabilities(&self) -> HashSet<Capability> {
|
||||
vec![Capability::FullHistory].into_iter().collect()
|
||||
}
|
||||
|
||||
fn broadcast(&self, tx: &Transaction) -> Result<(), Error> {
|
||||
self.peers[0].broadcast_tx(tx.clone())?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn estimate_fee(&self, _target: usize) -> Result<FeeRate, Error> {
|
||||
// TODO
|
||||
Ok(FeeRate::default())
|
||||
}
|
||||
}
|
||||
|
||||
impl GetHeight for CompactFiltersBlockchain {
|
||||
fn get_height(&self) -> Result<u32, Error> {
|
||||
Ok(self.headers.get_height()? as u32)
|
||||
}
|
||||
}
|
||||
|
||||
impl GetTx for CompactFiltersBlockchain {
|
||||
fn get_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||
Ok(self.peers[0]
|
||||
.get_mempool()
|
||||
.get_tx(&Inventory::Transaction(*txid)))
|
||||
}
|
||||
}
|
||||
|
||||
impl GetBlockHash for CompactFiltersBlockchain {
|
||||
fn get_block_hash(&self, height: u64) -> Result<BlockHash, Error> {
|
||||
self.headers
|
||||
.get_block_hash(height as usize)?
|
||||
.ok_or(Error::CompactFilters(
|
||||
CompactFiltersError::BlockHashNotFound,
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
impl WalletSync for CompactFiltersBlockchain {
|
||||
#[allow(clippy::mutex_atomic)] // Mutex is easier to understand than a CAS loop.
|
||||
fn wallet_setup<D: BatchDatabase>(
|
||||
&self,
|
||||
database: &RefCell<D>,
|
||||
progress_update: Box<dyn Progress>,
|
||||
) -> Result<(), Error> {
|
||||
let first_peer = &self.peers[0];
|
||||
|
||||
let skip_blocks = self.skip_blocks.unwrap_or(0);
|
||||
|
||||
let cf_sync = Arc::new(CfSync::new(Arc::clone(&self.headers), skip_blocks, 0x00)?);
|
||||
|
||||
let initial_height = self.headers.get_height()?;
|
||||
let total_bundles = (first_peer.get_version().start_height as usize)
|
||||
.checked_sub(skip_blocks)
|
||||
.map(|x| x / 1000)
|
||||
.unwrap_or(0)
|
||||
+ 1;
|
||||
let expected_bundles_to_sync = total_bundles.saturating_sub(cf_sync.pruned_bundles()?);
|
||||
|
||||
let headers_cost = (first_peer.get_version().start_height as usize)
|
||||
.saturating_sub(initial_height) as f32
|
||||
* SYNC_HEADERS_COST;
|
||||
let filters_cost = expected_bundles_to_sync as f32 * SYNC_FILTERS_COST;
|
||||
|
||||
let total_cost = headers_cost + filters_cost + PROCESS_BLOCKS_COST;
|
||||
|
||||
if let Some(snapshot) = sync::sync_headers(
|
||||
Arc::clone(first_peer),
|
||||
Arc::clone(&self.headers),
|
||||
|new_height| {
|
||||
let local_headers_cost =
|
||||
new_height.saturating_sub(initial_height) as f32 * SYNC_HEADERS_COST;
|
||||
progress_update.update(
|
||||
local_headers_cost / total_cost * 100.0,
|
||||
Some(format!("Synced headers to {}", new_height)),
|
||||
)
|
||||
},
|
||||
)? {
|
||||
if snapshot.work()? > self.headers.work()? {
|
||||
info!("Applying snapshot with work: {}", snapshot.work()?);
|
||||
self.headers.apply_snapshot(snapshot)?;
|
||||
}
|
||||
}
|
||||
|
||||
let synced_height = self.headers.get_height()?;
|
||||
let buried_height = synced_height.saturating_sub(sync::BURIED_CONFIRMATIONS);
|
||||
info!("Synced headers to height: {}", synced_height);
|
||||
|
||||
cf_sync.prepare_sync(Arc::clone(first_peer))?;
|
||||
|
||||
let mut database = database.borrow_mut();
|
||||
let database = database.deref_mut();
|
||||
|
||||
let all_scripts = Arc::new(
|
||||
database
|
||||
.iter_script_pubkeys(None)?
|
||||
.into_iter()
|
||||
.map(|s| s.to_bytes())
|
||||
.collect::<Vec<_>>(),
|
||||
);
|
||||
|
||||
#[allow(clippy::mutex_atomic)]
|
||||
let last_synced_block = Arc::new(Mutex::new(synced_height));
|
||||
|
||||
let synced_bundles = Arc::new(AtomicUsize::new(0));
|
||||
let progress_update = Arc::new(Mutex::new(progress_update));
|
||||
|
||||
let mut threads = Vec::with_capacity(self.peers.len());
|
||||
for peer in &self.peers {
|
||||
let cf_sync = Arc::clone(&cf_sync);
|
||||
let peer = Arc::clone(peer);
|
||||
let headers = Arc::clone(&self.headers);
|
||||
let all_scripts = Arc::clone(&all_scripts);
|
||||
let last_synced_block = Arc::clone(&last_synced_block);
|
||||
let progress_update = Arc::clone(&progress_update);
|
||||
let synced_bundles = Arc::clone(&synced_bundles);
|
||||
|
||||
let thread = std::thread::spawn(move || {
|
||||
cf_sync.capture_thread_for_sync(
|
||||
peer,
|
||||
|block_hash, filter| {
|
||||
if !filter
|
||||
.match_any(block_hash, all_scripts.iter().map(|s| s.as_slice()))?
|
||||
{
|
||||
return Ok(false);
|
||||
}
|
||||
|
||||
let block_height = headers.get_height_for(block_hash)?.unwrap_or(0);
|
||||
let saved_correct_block = matches!(headers.get_full_block(block_height)?, Some(block) if &block.block_hash() == block_hash);
|
||||
|
||||
if saved_correct_block {
|
||||
Ok(false)
|
||||
} else {
|
||||
let mut last_synced_block = last_synced_block.lock().unwrap();
|
||||
|
||||
// If we download a block older than `last_synced_block`, we update it so that
|
||||
// we know to delete and re-process all txs starting from that height
|
||||
if block_height < *last_synced_block {
|
||||
*last_synced_block = block_height;
|
||||
}
|
||||
|
||||
Ok(true)
|
||||
}
|
||||
},
|
||||
|index| {
|
||||
let synced_bundles = synced_bundles.fetch_add(1, Ordering::SeqCst);
|
||||
let local_filters_cost = synced_bundles as f32 * SYNC_FILTERS_COST;
|
||||
progress_update.lock().unwrap().update(
|
||||
(headers_cost + local_filters_cost) / total_cost * 100.0,
|
||||
Some(format!(
|
||||
"Synced filters {} - {}",
|
||||
index * 1000 + 1,
|
||||
(index + 1) * 1000
|
||||
)),
|
||||
)
|
||||
},
|
||||
)
|
||||
});
|
||||
|
||||
threads.push(thread);
|
||||
}
|
||||
|
||||
for t in threads {
|
||||
t.join().unwrap()?;
|
||||
}
|
||||
|
||||
progress_update.lock().unwrap().update(
|
||||
(headers_cost + filters_cost) / total_cost * 100.0,
|
||||
Some("Processing downloaded blocks and mempool".into()),
|
||||
)?;
|
||||
|
||||
// delete all txs newer than last_synced_block
|
||||
let last_synced_block = *last_synced_block.lock().unwrap();
|
||||
log::debug!(
|
||||
"Dropping transactions newer than `last_synced_block` = {}",
|
||||
last_synced_block
|
||||
);
|
||||
let mut updates = database.begin_batch();
|
||||
for details in database.iter_txs(false)? {
|
||||
match details.confirmation_time {
|
||||
Some(c) if (c.height as usize) < last_synced_block => continue,
|
||||
_ => updates.del_tx(&details.txid, false)?,
|
||||
};
|
||||
}
|
||||
database.commit_batch(updates)?;
|
||||
|
||||
match first_peer.ask_for_mempool() {
|
||||
Err(CompactFiltersError::PeerBloomDisabled) => {
|
||||
log::warn!("Peer has BLOOM disabled, we can't ask for the mempool")
|
||||
}
|
||||
e => e?,
|
||||
};
|
||||
|
||||
let mut internal_max_deriv = None;
|
||||
let mut external_max_deriv = None;
|
||||
|
||||
for (height, block) in self.headers.iter_full_blocks()? {
|
||||
for tx in &block.txdata {
|
||||
self.process_tx(
|
||||
database,
|
||||
tx,
|
||||
Some(height as u32),
|
||||
None,
|
||||
&mut internal_max_deriv,
|
||||
&mut external_max_deriv,
|
||||
)?;
|
||||
}
|
||||
}
|
||||
for tx in first_peer.get_mempool().iter_txs().iter() {
|
||||
self.process_tx(
|
||||
database,
|
||||
tx,
|
||||
None,
|
||||
None,
|
||||
&mut internal_max_deriv,
|
||||
&mut external_max_deriv,
|
||||
)?;
|
||||
}
|
||||
|
||||
let current_ext = database
|
||||
.get_last_index(KeychainKind::External)?
|
||||
.unwrap_or(0);
|
||||
let first_ext_new = external_max_deriv.map(|x| x + 1).unwrap_or(0);
|
||||
if first_ext_new > current_ext {
|
||||
info!("Setting external index to {}", first_ext_new);
|
||||
database.set_last_index(KeychainKind::External, first_ext_new)?;
|
||||
}
|
||||
|
||||
let current_int = database
|
||||
.get_last_index(KeychainKind::Internal)?
|
||||
.unwrap_or(0);
|
||||
let first_int_new = internal_max_deriv.map(|x| x + 1).unwrap_or(0);
|
||||
if first_int_new > current_int {
|
||||
info!("Setting internal index to {}", first_int_new);
|
||||
database.set_last_index(KeychainKind::Internal, first_int_new)?;
|
||||
}
|
||||
|
||||
info!("Dropping blocks until {}", buried_height);
|
||||
self.headers.delete_blocks_until(buried_height)?;
|
||||
|
||||
progress_update
|
||||
.lock()
|
||||
.unwrap()
|
||||
.update(100.0, Some("Done".into()))?;
|
||||
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// Data to connect to a Bitcoin P2P peer
|
||||
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq, Eq)]
|
||||
pub struct BitcoinPeerConfig {
|
||||
/// Peer address such as 127.0.0.1:18333
|
||||
pub address: String,
|
||||
/// Optional socks5 proxy
|
||||
pub socks5: Option<String>,
|
||||
/// Optional socks5 proxy credentials
|
||||
pub socks5_credentials: Option<(String, String)>,
|
||||
}
|
||||
|
||||
/// Configuration for a [`CompactFiltersBlockchain`]
|
||||
#[derive(Debug, serde::Deserialize, serde::Serialize, Clone, PartialEq, Eq)]
|
||||
pub struct CompactFiltersBlockchainConfig {
|
||||
/// List of peers to try to connect to for asking headers and filters
|
||||
pub peers: Vec<BitcoinPeerConfig>,
|
||||
/// Network used
|
||||
pub network: Network,
|
||||
/// Storage dir to save partially downloaded headers and full blocks. Should be a separate directory per descriptor. Consider using [crate::wallet::wallet_name_from_descriptor] for this.
|
||||
pub storage_dir: String,
|
||||
/// Optionally skip initial `skip_blocks` blocks (default: 0)
|
||||
pub skip_blocks: Option<usize>,
|
||||
}
|
||||
|
||||
impl ConfigurableBlockchain for CompactFiltersBlockchain {
|
||||
type Config = CompactFiltersBlockchainConfig;
|
||||
|
||||
fn from_config(config: &Self::Config) -> Result<Self, Error> {
|
||||
let mempool = Arc::new(Mempool::default());
|
||||
let peers = config
|
||||
.peers
|
||||
.iter()
|
||||
.map(|peer_conf| match &peer_conf.socks5 {
|
||||
None => Peer::connect(&peer_conf.address, Arc::clone(&mempool), config.network),
|
||||
Some(proxy) => Peer::connect_proxy(
|
||||
peer_conf.address.as_str(),
|
||||
proxy,
|
||||
peer_conf
|
||||
.socks5_credentials
|
||||
.as_ref()
|
||||
.map(|(a, b)| (a.as_str(), b.as_str())),
|
||||
Arc::clone(&mempool),
|
||||
config.network,
|
||||
),
|
||||
})
|
||||
.collect::<Result<_, _>>()?;
|
||||
|
||||
Ok(CompactFiltersBlockchain::new(
|
||||
peers,
|
||||
&config.storage_dir,
|
||||
config.skip_blocks,
|
||||
)?)
|
||||
}
|
||||
}
|
||||
|
||||
/// An error that can occur during sync with a [`CompactFiltersBlockchain`]
|
||||
#[derive(Debug)]
|
||||
pub enum CompactFiltersError {
|
||||
/// A peer sent an invalid or unexpected response
|
||||
InvalidResponse,
|
||||
/// The headers returned are invalid
|
||||
InvalidHeaders,
|
||||
/// The compact filter headers returned are invalid
|
||||
InvalidFilterHeader,
|
||||
/// The compact filter returned is invalid
|
||||
InvalidFilter,
|
||||
/// The peer is missing a block in the valid chain
|
||||
MissingBlock,
|
||||
/// Block hash at specified height not found
|
||||
BlockHashNotFound,
|
||||
/// The data stored in the block filters storage are corrupted
|
||||
DataCorruption,
|
||||
|
||||
/// A peer is not connected
|
||||
NotConnected,
|
||||
/// A peer took too long to reply to one of our messages
|
||||
Timeout,
|
||||
/// The peer doesn't advertise the [`BLOOM`](bitcoin::network::constants::ServiceFlags::BLOOM) service flag
|
||||
PeerBloomDisabled,
|
||||
|
||||
/// No peers have been specified
|
||||
NoPeers,
|
||||
|
||||
/// Internal database error
|
||||
Db(rocksdb::Error),
|
||||
/// Internal I/O error
|
||||
Io(std::io::Error),
|
||||
/// Invalid BIP158 filter
|
||||
Bip158(bitcoin::bip158::Error),
|
||||
/// Internal system time error
|
||||
Time(std::time::SystemTimeError),
|
||||
|
||||
/// Wrapper for [`crate::error::Error`]
|
||||
Global(Box<crate::error::Error>),
|
||||
}
|
||||
|
||||
impl fmt::Display for CompactFiltersError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::InvalidResponse => write!(f, "A peer sent an invalid or unexpected response"),
|
||||
Self::InvalidHeaders => write!(f, "Invalid headers"),
|
||||
Self::InvalidFilterHeader => write!(f, "Invalid filter header"),
|
||||
Self::InvalidFilter => write!(f, "Invalid filters"),
|
||||
Self::MissingBlock => write!(f, "The peer is missing a block in the valid chain"),
|
||||
Self::BlockHashNotFound => write!(f, "Block hash not found"),
|
||||
Self::DataCorruption => write!(
|
||||
f,
|
||||
"The data stored in the block filters storage are corrupted"
|
||||
),
|
||||
Self::NotConnected => write!(f, "A peer is not connected"),
|
||||
Self::Timeout => write!(f, "A peer took too long to reply to one of our messages"),
|
||||
Self::PeerBloomDisabled => write!(f, "Peer doesn't advertise the BLOOM service flag"),
|
||||
Self::NoPeers => write!(f, "No peers have been specified"),
|
||||
Self::Db(err) => write!(f, "Internal database error: {}", err),
|
||||
Self::Io(err) => write!(f, "Internal I/O error: {}", err),
|
||||
Self::Bip158(err) => write!(f, "Invalid BIP158 filter: {}", err),
|
||||
Self::Time(err) => write!(f, "Invalid system time: {}", err),
|
||||
Self::Global(err) => write!(f, "Generic error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl std::error::Error for CompactFiltersError {}
|
||||
|
||||
impl_error!(rocksdb::Error, Db, CompactFiltersError);
|
||||
impl_error!(std::io::Error, Io, CompactFiltersError);
|
||||
impl_error!(bitcoin::bip158::Error, Bip158, CompactFiltersError);
|
||||
impl_error!(std::time::SystemTimeError, Time, CompactFiltersError);
|
||||
|
||||
impl From<crate::error::Error> for CompactFiltersError {
|
||||
fn from(err: crate::error::Error) -> Self {
|
||||
CompactFiltersError::Global(Box::new(err))
|
||||
}
|
||||
}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user