Compare commits
188 Commits
v1.0.0-alp
...
dependabot
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
4d040b7057 | ||
|
|
f741122ffb | ||
|
|
959b4f8172 | ||
|
|
55b680c194 | ||
|
|
43aed386bc | ||
|
|
cb713e5b8c | ||
|
|
2c4e90a76f | ||
|
|
18bd329617 | ||
|
|
9e681b39fb | ||
|
|
6817ca9bcb | ||
|
|
73862be3ba | ||
|
|
02fa340896 | ||
|
|
4ee41dbc40 | ||
|
|
278210bb89 | ||
|
|
6fb45d8a73 | ||
|
|
e803ee9010 | ||
|
|
82632897aa | ||
|
|
46d39beb2c | ||
|
|
00ec19ef2d | ||
|
|
77f9977c02 | ||
|
|
9e7d99e3bf | ||
|
|
cc552c5f91 | ||
|
|
27a63abd1e | ||
|
|
bc8d6a396b | ||
|
|
f1b112e8f9 | ||
|
|
9a250baf62 | ||
|
|
79b84bed0e | ||
|
|
06a956ad20 | ||
|
|
c3265e2514 | ||
|
|
96f1d94e2c | ||
|
|
1886dc4fe7 | ||
|
|
24994a3ed4 | ||
|
|
d294e2e318 | ||
|
|
7c6cbc4d9f | ||
|
|
6cf3963c6c | ||
|
|
7d5f31f6cc | ||
|
|
5998a22819 | ||
|
|
d6a0cf0795 | ||
|
|
6e27e66738 | ||
|
|
f382fa9230 | ||
|
|
e71770f93e | ||
|
|
298f6cb1e8 | ||
|
|
3fdab87ee7 | ||
|
|
855c61a6ab | ||
|
|
0112c67b60 | ||
|
|
1010efd8d6 | ||
|
|
991cb77b6f | ||
|
|
e553231eae | ||
|
|
0a7b60f0f7 | ||
|
|
0ecc0280c0 | ||
|
|
afbf83c8b0 | ||
|
|
2f2f138595 | ||
|
|
95250fc44e | ||
|
|
f17df1e133 | ||
|
|
3569acca0b | ||
|
|
2e4bc3c5e2 | ||
|
|
6ebdd195e2 | ||
|
|
d5c87c49a8 | ||
|
|
009408d243 | ||
|
|
38d69c947c | ||
|
|
67eec36db4 | ||
|
|
85c62532a5 | ||
|
|
b69c13ddf6 | ||
|
|
5f34df8489 | ||
|
|
57590e0a1f | ||
|
|
6d4b33ef91 | ||
|
|
4f5695d43a | ||
|
|
150d6f8ab6 | ||
|
|
4f10463d9e | ||
|
|
a73dac2d91 | ||
|
|
bb7424d11d | ||
|
|
240657b167 | ||
|
|
43bc813c64 | ||
|
|
b3db5ca9df | ||
|
|
f795a43cc7 | ||
|
|
b1461f05d0 | ||
|
|
77cde96229 | ||
|
|
1db3f87a48 | ||
|
|
4a65a12c4f | ||
|
|
4ee11aae12 | ||
|
|
a7dbc22df1 | ||
|
|
6d601a7e88 | ||
|
|
48ca95b541 | ||
|
|
59a2403e28 | ||
|
|
6e511473a5 | ||
|
|
62de55f12d | ||
|
|
5e79b81a6a | ||
|
|
a3e8480ad9 | ||
|
|
4742d88ea3 | ||
|
|
2f26eca607 | ||
|
|
486e0e1437 | ||
|
|
9bd528607a | ||
|
|
f28e665c7d | ||
|
|
417963f168 | ||
|
|
edfd4c236d | ||
|
|
fe654310d7 | ||
|
|
37d5e5319f | ||
|
|
ea6411c685 | ||
|
|
4a1b96dcc4 | ||
|
|
bf9a425849 | ||
|
|
d35668e76a | ||
|
|
31d52e12c9 | ||
|
|
6a5c9d7a00 | ||
|
|
4d1a9fd47a | ||
|
|
f95506ba6a | ||
|
|
e6519e3a52 | ||
|
|
43fb0b20df | ||
|
|
94f8fa530b | ||
|
|
c20a4da9fc | ||
|
|
1ff806c67f | ||
|
|
d43ae0231f | ||
|
|
59fc1b341b | ||
|
|
20900218ce | ||
|
|
e89cf5a16a | ||
|
|
4104206980 | ||
|
|
c56728ff13 | ||
|
|
32c40ac939 | ||
|
|
a28748c339 | ||
|
|
f42f8b8ff1 | ||
|
|
68572bfd2e | ||
|
|
2392e50fd9 | ||
|
|
7c12dc9942 | ||
|
|
6bcbb93233 | ||
|
|
2867e88b64 | ||
|
|
e48b911c8d | ||
|
|
a7a1d9b2fb | ||
|
|
8321aaa5c7 | ||
|
|
cc1a43c495 | ||
|
|
f41cc1cb37 | ||
|
|
da8cfd39e9 | ||
|
|
93e8eaf7ee | ||
|
|
5fb5061645 | ||
|
|
dd5b8d7599 | ||
|
|
465d53cc88 | ||
|
|
036299803f | ||
|
|
d443fe7f66 | ||
|
|
b4c31cd5ba | ||
|
|
e5fb1ec7ff | ||
|
|
18e8da3937 | ||
|
|
8f978f86b8 | ||
|
|
21206fe773 | ||
|
|
381c560c10 | ||
|
|
c753584379 | ||
|
|
6125062a5b | ||
|
|
2263a58448 | ||
|
|
11ac26f6b2 | ||
|
|
fb5cfa3c25 | ||
|
|
fa0bead024 | ||
|
|
8c4eeb56c0 | ||
|
|
3b5b829086 | ||
|
|
4f37b2a293 | ||
|
|
2d543475e2 | ||
|
|
d6bcd9b725 | ||
|
|
62f253103c | ||
|
|
80f5ecf3be | ||
|
|
ea50b6a932 | ||
|
|
480c2730de | ||
|
|
0cd2348166 | ||
|
|
b0b91b7418 | ||
|
|
feafaaca31 | ||
|
|
1da3b304bb | ||
|
|
792b39fa92 | ||
|
|
b73385dbd2 | ||
|
|
3dac3f9bba | ||
|
|
2949bdc7b8 | ||
|
|
468d2a0a3b | ||
|
|
b8ac16d03c | ||
|
|
6c29e53ee8 | ||
|
|
6eb079576f | ||
|
|
91b0f0ba29 | ||
|
|
f4e3ba3265 | ||
|
|
853d361751 | ||
|
|
d73669e8fa | ||
|
|
933056706c | ||
|
|
b206a985cf | ||
|
|
bea8e5aff4 | ||
|
|
db15e03bdc | ||
|
|
95312d4d05 | ||
|
|
8bf7a997f7 | ||
|
|
315e7e0b4b | ||
|
|
af705da1a8 | ||
|
|
eabeb6ccb1 | ||
|
|
8f38e96e45 | ||
|
|
ffb7c795e1 | ||
|
|
56b8eea643 | ||
|
|
cb626e9fc8 | ||
|
|
e17f03e755 | ||
|
|
f5074ee3ae |
8
.github/dependabot.yml
vendored
Normal file
8
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,8 @@
|
||||
# Set update schedule for GitHub Actions
|
||||
version: 2
|
||||
updates:
|
||||
- package-ecosystem: "github-actions"
|
||||
directory: "/"
|
||||
schedule:
|
||||
# Check for updates to GitHub Actions every week
|
||||
interval: "weekly"
|
||||
5
.github/workflows/code_coverage.yml
vendored
5
.github/workflows/code_coverage.yml
vendored
@@ -19,7 +19,7 @@ jobs:
|
||||
- name: Install Rust toolchain
|
||||
uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
toolchain: "1.65.0"
|
||||
toolchain: stable
|
||||
override: true
|
||||
profile: minimal
|
||||
components: llvm-tools-preview
|
||||
@@ -27,12 +27,13 @@ jobs:
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Install grcov
|
||||
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
||||
# TODO: re-enable the hwi tests
|
||||
- name: Build simulator image
|
||||
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||
- name: Run simulator image
|
||||
run: docker run --name simulator --network=host hwi/ledger_emulator &
|
||||
- name: Install Python
|
||||
uses: actions/setup-python@v4
|
||||
uses: actions/setup-python@v5
|
||||
with:
|
||||
python-version: '3.9'
|
||||
- name: Install python dependencies
|
||||
|
||||
24
.github/workflows/cont_integration.yml
vendored
24
.github/workflows/cont_integration.yml
vendored
@@ -27,6 +27,29 @@ jobs:
|
||||
profile: minimal
|
||||
- name: Rust Cache
|
||||
uses: Swatinem/rust-cache@v2.2.1
|
||||
- name: Pin dependencies for MSRV
|
||||
if: matrix.rust.version == '1.57.0'
|
||||
run: |
|
||||
cargo update -p log --precise "0.4.18"
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
cargo update -p hyper-rustls --precise 0.24.0
|
||||
cargo update -p rustls:0.21.9 --precise "0.21.1"
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
cargo update -p tokio --precise "1.29.1"
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
cargo update -p flate2 --precise "1.0.26"
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
cargo update -p rustls-webpki:0.101.7 --precise "0.101.1"
|
||||
cargo update -p zip --precise "0.6.2"
|
||||
cargo update -p time --precise "0.3.13"
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
cargo update -p os_str_bytes --precise 6.5.1
|
||||
cargo update -p sct --precise 0.7.0
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
cargo update -p jobserver --precise "0.1.26"
|
||||
- name: Build
|
||||
run: cargo build ${{ matrix.features }}
|
||||
- name: Test
|
||||
@@ -71,7 +94,6 @@ jobs:
|
||||
uses: actions/checkout@v2
|
||||
# Install a recent version of clang that supports wasm32
|
||||
- run: wget -O - https://apt.llvm.org/llvm-snapshot.gpg.key | sudo apt-key add - || exit 1
|
||||
- run: sudo apt-add-repository "deb http://apt.llvm.org/focal/ llvm-toolchain-focal-10 main" || exit 1
|
||||
- run: sudo apt-get update || exit 1
|
||||
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
||||
- name: Install Rust toolchain
|
||||
|
||||
3
.gitignore
vendored
3
.gitignore
vendored
@@ -4,3 +4,6 @@ Cargo.lock
|
||||
|
||||
*.swp
|
||||
.idea
|
||||
|
||||
# Example persisted files.
|
||||
*.db
|
||||
|
||||
10
CHANGELOG.md
10
CHANGELOG.md
@@ -158,7 +158,7 @@ BDK and LDK together.
|
||||
- Add the ability to specify which leaves to sign in a taproot transaction through `TapLeavesOptions` in `SignOptions`
|
||||
- Add the ability to specify whether a taproot transaction should be signed using the internal key or not, using `sign_with_tap_internal_key` in `SignOptions`
|
||||
- Consolidate params `fee_amount` and `amount_needed` in `target_amount` in `CoinSelectionAlgorithm::coin_select` signature.
|
||||
- Change the meaning of the `fee_amount` field inside `CoinSelectionResult`: from now on the `fee_amount` will represent only the fees asociated with the utxos in the `selected` field of `CoinSelectionResult`.
|
||||
- Change the meaning of the `fee_amount` field inside `CoinSelectionResult`: from now on the `fee_amount` will represent only the fees associated with the utxos in the `selected` field of `CoinSelectionResult`.
|
||||
- New `RpcBlockchain` implementation with various fixes.
|
||||
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
||||
|
||||
@@ -449,7 +449,7 @@ final transaction is created by calling `finish` on the builder.
|
||||
#### Changed
|
||||
- Simplify the architecture of blockchain traits
|
||||
- Improve sync
|
||||
- Remove unused varaint HeaderParseFail
|
||||
- Remove unused variant `HeaderParseFail`
|
||||
|
||||
### CLI
|
||||
#### Added
|
||||
@@ -517,7 +517,7 @@ final transaction is created by calling `finish` on the builder.
|
||||
- Default to SIGHASH_ALL if not specified
|
||||
- Replace ChangeSpendPolicy::filter_utxos with a predicate
|
||||
- Make 'unspendable' into a HashSet
|
||||
- Stop implicitly enforcing manaul selection by .add_utxo
|
||||
- Stop implicitly enforcing manual selection by .add_utxo
|
||||
- Rename DumbCS to LargestFirstCoinSelection
|
||||
- Rename must_use_utxos to required_utxos
|
||||
- Rename may_use_utxos to optional_uxtos
|
||||
@@ -529,7 +529,7 @@ final transaction is created by calling `finish` on the builder.
|
||||
- Use TXIN_DEFAULT_WEIGHT constant in coin selection
|
||||
- Replace `must_use` with `required` in coin selection
|
||||
- Take both spending policies into account in create_tx
|
||||
- Check last derivation in cache to avoid recomputation
|
||||
- Check last derivation in cache to avoid recomputing
|
||||
- Use the branch-and-bound cs by default
|
||||
- Make coin_select return UTXOs instead of TxIns
|
||||
- Build output lookup inside complete transaction
|
||||
@@ -550,7 +550,7 @@ final transaction is created by calling `finish` on the builder.
|
||||
- Require esplora feature for repl example
|
||||
|
||||
#### Security
|
||||
- Use dirs-next instead of dirs since the latter is unmantained
|
||||
- Use dirs-next instead of dirs since the latter is unmaintained
|
||||
|
||||
## [0.1.0-beta.1] - 2020-09-08
|
||||
|
||||
|
||||
@@ -46,15 +46,15 @@ Every new feature should be covered by functional tests where possible.
|
||||
When refactoring, structure your PR to make it easy to review and don't
|
||||
hesitate to split it into multiple small, focused PRs.
|
||||
|
||||
The Minimal Supported Rust Version is 1.46 (enforced by our CI).
|
||||
The Minimal Supported Rust Version is **1.57.0** (enforced by our CI).
|
||||
|
||||
Commits should cover both the issue fixed and the solution's rationale.
|
||||
These [guidelines](https://chris.beams.io/posts/git-commit/) should be kept in mind.
|
||||
These [guidelines](https://chris.beams.io/posts/git-commit/) should be kept in mind. Commit messages should follow the ["Conventional Commits 1.0.0"](https://www.conventionalcommits.org/en/v1.0.0/) to make commit histories easier to read by humans and automated tools.
|
||||
|
||||
To facilitate communication with other contributors, the project is making use
|
||||
of GitHub's "assignee" field. First check that no one is assigned and then
|
||||
comment suggesting that you're working on it. If someone is already assigned,
|
||||
don't hesitate to ask if the assigned party or previous commenters are still
|
||||
don't hesitate to ask if the assigned party or previous commenter are still
|
||||
working on it if it has been awhile.
|
||||
|
||||
Deprecation policy
|
||||
@@ -91,7 +91,7 @@ This is also enforced by the CI.
|
||||
Security
|
||||
--------
|
||||
|
||||
Security is a high priority of BDK; disclosure of security vulnerabilites helps
|
||||
Security is a high priority of BDK; disclosure of security vulnerabilities helps
|
||||
prevent user loss of funds.
|
||||
|
||||
Note that BDK is currently considered "pre-production" during this time, there
|
||||
|
||||
@@ -1,14 +1,18 @@
|
||||
[workspace]
|
||||
resolver = "2"
|
||||
members = [
|
||||
"crates/bdk",
|
||||
"crates/chain",
|
||||
"crates/file_store",
|
||||
"crates/electrum",
|
||||
"crates/esplora",
|
||||
"crates/bitcoind_rpc",
|
||||
"example-crates/example_cli",
|
||||
"example-crates/example_electrum",
|
||||
"example-crates/example_esplora",
|
||||
"example-crates/example_bitcoind_rpc_polling",
|
||||
"example-crates/wallet_electrum",
|
||||
"example-crates/wallet_esplora",
|
||||
"example-crates/wallet_esplora_blocking",
|
||||
"example-crates/wallet_esplora_async",
|
||||
"nursery/tmp_plan",
|
||||
"nursery/coin_select"
|
||||
|
||||
80
README.md
80
README.md
@@ -33,7 +33,7 @@ It is built upon the excellent [`rust-bitcoin`] and [`rust-miniscript`] crates.
|
||||
|
||||
> ⚠ The Bitcoin Dev Kit developers are in the process of releasing a `v1.0` which is a fundamental re-write of how the library works.
|
||||
> See for some background on this project: https://bitcoindevkit.org/blog/road-to-bdk-1/ (ignore the timeline 😁)
|
||||
> For a release timeline see the [`bdk_core_staging`] repo where a lot of the component work is being done. The plan is that everything in the `bdk_core_staging` repo will be moved into the `crates` directory here.
|
||||
> For a release timeline see the [`BDK 1.0 project page`].
|
||||
|
||||
## Architecture
|
||||
|
||||
@@ -45,10 +45,80 @@ The project is split up into several crates in the `/crates` directory:
|
||||
- [`esplora`](./crates/esplora): Extends the [`esplora-client`] crate with methods to fetch chain data from an esplora HTTP server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||
- [`electrum`](./crates/electrum): Extends the [`electrum-client`] crate with methods to fetch chain data from an electrum server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||
|
||||
Fully working examples of how to use these components are in `/example-crates`
|
||||
Fully working examples of how to use these components are in `/example-crates`:
|
||||
- [`example_cli`](./example-crates/example_cli): Library used by the `example_*` crates. Provides utilities for syncing, showing the balance, generating addresses and creating transactions without using the bdk `Wallet`.
|
||||
- [`example_electrum`](./example-crates/example_electrum): A command line Bitcoin wallet application built on top of `example_cli` and the `electrum` crate. It shows the power of the bdk tools (`chain` + `file_store` + `electrum`), without depending on the main `bdk` library.
|
||||
- [`wallet_esplora_blocking`](./example-crates/wallet_esplora_blocking): Uses the `Wallet` to sync and spend using the Esplora blocking interface.
|
||||
- [`wallet_esplora_async`](./example-crates/wallet_esplora_async): Uses the `Wallet` to sync and spend using the Esplora asynchronous interface.
|
||||
- [`wallet_electrum`](./example-crates/wallet_electrum): Uses the `Wallet` to sync and spend using Electrum.
|
||||
|
||||
[`bdk_core_staging`]: https://github.com/LLFourn/bdk_core_staging
|
||||
[`BDK 1.0 project page`]: https://github.com/orgs/bitcoindevkit/projects/14
|
||||
[`rust-miniscript`]: https://github.com/rust-bitcoin/rust-miniscript
|
||||
[`rust-bitcoin`]: https://github.com/rust-bitcoin/rust-bitcoin
|
||||
[`esplora-client`]: https://docs.rs/esplora-client/0.3.0/esplora_client/
|
||||
[`electrum-client`]: https://docs.rs/electrum-client/0.13.0/electrum_client/
|
||||
[`esplora-client`]: https://docs.rs/esplora-client/
|
||||
[`electrum-client`]: https://docs.rs/electrum-client/
|
||||
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||
|
||||
## Minimum Supported Rust Version (MSRV)
|
||||
This library should compile with any combination of features with Rust 1.57.0.
|
||||
|
||||
To build with the MSRV you will need to pin dependencies as follows:
|
||||
|
||||
```shell
|
||||
# log 0.4.19 has MSRV 1.60.0+
|
||||
cargo update -p log --precise "0.4.18"
|
||||
# tempfile 3.7.0 has MSRV 1.63.0+
|
||||
cargo update -p tempfile --precise "3.6.0"
|
||||
# reqwest 0.11.19 has MSRV 1.63.0+
|
||||
cargo update -p reqwest --precise "0.11.18"
|
||||
# hyper-rustls 0.24.1 has MSRV 1.60.0+
|
||||
cargo update -p hyper-rustls --precise 0.24.0
|
||||
# rustls 0.21.7 has MSRV 1.60.0+
|
||||
cargo update -p rustls:0.21.9 --precise "0.21.1"
|
||||
# rustls 0.20.9 has MSRV 1.60.0+
|
||||
cargo update -p rustls:0.20.9 --precise "0.20.8"
|
||||
# tokio 1.33 has MSRV 1.63.0+
|
||||
cargo update -p tokio --precise "1.29.1"
|
||||
# tokio-util 0.7.9 doesn't build with MSRV 1.57.0
|
||||
cargo update -p tokio-util --precise "0.7.8"
|
||||
# flate2 1.0.27 has MSRV 1.63.0+
|
||||
cargo update -p flate2 --precise "1.0.26"
|
||||
# h2 0.3.21 has MSRV 1.63.0+
|
||||
cargo update -p h2 --precise "0.3.20"
|
||||
# rustls-webpki 0.100.3 has MSRV 1.60.0+
|
||||
cargo update -p rustls-webpki:0.100.3 --precise "0.100.1"
|
||||
# rustls-webpki 0.101.2 has MSRV 1.60.0+
|
||||
cargo update -p rustls-webpki:0.101.7 --precise "0.101.1"
|
||||
# zip 0.6.6 has MSRV 1.59.0+
|
||||
cargo update -p zip --precise "0.6.2"
|
||||
# time 0.3.14 has MSRV 1.59.0+
|
||||
cargo update -p time --precise "0.3.13"
|
||||
# byteorder 1.5.0 has MSRV 1.60.0+
|
||||
cargo update -p byteorder --precise "1.4.3"
|
||||
# webpki 0.22.4 requires `ring:0.17.2` which has MSRV 1.61.0+
|
||||
cargo update -p webpki --precise "0.22.2"
|
||||
# os_str_bytes 6.6.0 has MSRV 1.61.0+
|
||||
cargo update -p os_str_bytes --precise 6.5.1
|
||||
# sct 0.7.1 has MSRV 1.61.0+
|
||||
cargo update -p sct --precise 0.7.0
|
||||
# cc 1.0.82 has MSRV 1.61.0+
|
||||
cargo update -p cc --precise "1.0.81"
|
||||
# jobserver 0.1.27 has MSRV 1.66.0+
|
||||
cargo update -p jobserver --precise "0.1.26"
|
||||
```
|
||||
|
||||
## License
|
||||
|
||||
Licensed under either of
|
||||
|
||||
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||
* MIT license ([LICENSE-MIT](LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||
|
||||
at your option.
|
||||
|
||||
### Contribution
|
||||
|
||||
Unless you explicitly state otherwise, any contribution intentionally
|
||||
submitted for inclusion in the work by you, as defined in the Apache-2.0
|
||||
license, shall be dual licensed as above, without any additional terms or
|
||||
conditions.
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
[package]
|
||||
name = "bdk"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
version = "1.0.0-alpha.1"
|
||||
version = "1.0.0-alpha.2"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk"
|
||||
description = "A modern, lightweight, descriptor-based wallet library"
|
||||
@@ -13,16 +13,15 @@ edition = "2021"
|
||||
rust-version = "1.57"
|
||||
|
||||
[dependencies]
|
||||
log = "=0.4.18"
|
||||
rand = "^0.8"
|
||||
miniscript = { version = "9", features = ["serde"], default-features = false }
|
||||
bitcoin = { version = "0.29", features = ["serde", "base64", "rand"], default-features = false }
|
||||
miniscript = { version = "10.0.0", features = ["serde"], default-features = false }
|
||||
bitcoin = { version = "0.30.0", features = ["serde", "base64", "rand-std"], default-features = false }
|
||||
serde = { version = "^1.0", features = ["derive"] }
|
||||
serde_json = { version = "^1.0" }
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", features = ["miniscript", "serde"], default-features = false }
|
||||
bdk_chain = { path = "../chain", version = "0.6.0", features = ["miniscript", "serde"], default-features = false }
|
||||
|
||||
# Optional dependencies
|
||||
hwi = { version = "0.5", optional = true, features = [ "use-miniscript"] }
|
||||
hwi = { version = "0.7.0", optional = true, features = [ "miniscript"] }
|
||||
bip39 = { version = "1.0.1", optional = true }
|
||||
|
||||
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
||||
@@ -45,10 +44,10 @@ dev-getrandom-wasm = ["getrandom/js"]
|
||||
|
||||
[dev-dependencies]
|
||||
lazy_static = "1.4"
|
||||
env_logger = "0.7"
|
||||
# Move back to importing from rust-bitcoin once https://github.com/rust-bitcoin/rust-bitcoin/pull/1342 is released
|
||||
base64 = "^0.13"
|
||||
assert_matches = "1.5.0"
|
||||
tempfile = "3"
|
||||
bdk_file_store = { path = "../file_store" }
|
||||
anyhow = "1"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
|
||||
@@ -137,7 +137,7 @@ fn main() {
|
||||
<!-- use bdk::electrum_client::Client; -->
|
||||
<!-- use bdk::wallet::AddressIndex::New; -->
|
||||
|
||||
<!-- use base64; -->
|
||||
<!-- use bitcoin::base64; -->
|
||||
<!-- use bdk::bitcoin::consensus::serialize; -->
|
||||
<!-- use bdk::bitcoin::Network; -->
|
||||
|
||||
@@ -174,7 +174,7 @@ fn main() {
|
||||
<!-- ```rust,no_run -->
|
||||
<!-- use bdk::{Wallet, SignOptions}; -->
|
||||
|
||||
<!-- use base64; -->
|
||||
<!-- use bitcoin::base64; -->
|
||||
<!-- use bdk::bitcoin::consensus::deserialize; -->
|
||||
<!-- use bdk::bitcoin::Network; -->
|
||||
|
||||
@@ -206,18 +206,17 @@ cargo test
|
||||
|
||||
Licensed under either of
|
||||
|
||||
* Apache License, Version 2.0
|
||||
([LICENSE-APACHE](LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||
* MIT license
|
||||
([LICENSE-MIT](LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||
* Apache License, Version 2.0, ([LICENSE-APACHE](../../LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||
* MIT license ([LICENSE-MIT](../../LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||
|
||||
at your option.
|
||||
|
||||
## Contribution
|
||||
### Contribution
|
||||
|
||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
||||
dual licensed as above, without any additional terms or conditions.
|
||||
Unless you explicitly state otherwise, any contribution intentionally
|
||||
submitted for inclusion in the work by you, as defined in the Apache-2.0
|
||||
license, shall be dual licensed as above, without any additional terms or
|
||||
conditions.
|
||||
|
||||
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
||||
[`bdk_file_store`]: https://docs.rs/bdk_file_store/latest
|
||||
|
||||
@@ -11,15 +11,12 @@
|
||||
|
||||
extern crate bdk;
|
||||
extern crate bitcoin;
|
||||
extern crate log;
|
||||
extern crate miniscript;
|
||||
extern crate serde_json;
|
||||
|
||||
use std::error::Error;
|
||||
use std::str::FromStr;
|
||||
|
||||
use log::info;
|
||||
|
||||
use bitcoin::Network;
|
||||
use miniscript::policy::Concrete;
|
||||
use miniscript::Descriptor;
|
||||
@@ -36,13 +33,9 @@ use bdk::{KeychainKind, Wallet};
|
||||
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
env_logger::init_from_env(
|
||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
||||
);
|
||||
|
||||
// We start with a generic miniscript policy string
|
||||
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
||||
info!("Compiling policy: \n{}", policy_str);
|
||||
println!("Compiling policy: \n{}", policy_str);
|
||||
|
||||
// Parse the string as a [`Concrete`] type miniscript policy.
|
||||
let policy = Concrete::<String>::from_str(policy_str)?;
|
||||
@@ -51,12 +44,12 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// `policy.compile()` returns the resulting miniscript from the policy.
|
||||
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
||||
|
||||
info!("Compiled into following Descriptor: \n{}", descriptor);
|
||||
println!("Compiled into following Descriptor: \n{}", descriptor);
|
||||
|
||||
// Create a new wallet from this descriptor
|
||||
let mut wallet = Wallet::new_no_persist(&format!("{}", descriptor), None, Network::Regtest)?;
|
||||
|
||||
info!(
|
||||
println!(
|
||||
"First derived address from the descriptor: \n{}",
|
||||
wallet.get_address(New)
|
||||
);
|
||||
@@ -64,7 +57,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
||||
// human readable json format.
|
||||
let spending_policy = wallet.policies(KeychainKind::External)?;
|
||||
info!(
|
||||
println!(
|
||||
"The BDK spending policy: \n{}",
|
||||
serde_json::to_string_pretty(&spending_policy)?
|
||||
);
|
||||
|
||||
@@ -6,21 +6,20 @@
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use anyhow::anyhow;
|
||||
use bdk::bitcoin::bip32::DerivationPath;
|
||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||
use bdk::bitcoin::util::bip32::DerivationPath;
|
||||
use bdk::bitcoin::Network;
|
||||
use bdk::descriptor;
|
||||
use bdk::descriptor::IntoWalletDescriptor;
|
||||
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
||||
use bdk::keys::{GeneratableKey, GeneratedKey};
|
||||
use bdk::miniscript::Tap;
|
||||
use bdk::Error as BDK_Error;
|
||||
use std::error::Error;
|
||||
use std::str::FromStr;
|
||||
|
||||
/// This example demonstrates how to generate a mnemonic phrase
|
||||
/// using BDK and use that to generate a descriptor string.
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
fn main() -> Result<(), anyhow::Error> {
|
||||
let secp = Secp256k1::new();
|
||||
|
||||
// In this example we are generating a 12 words mnemonic phrase
|
||||
@@ -28,7 +27,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// using their respective `WordCount` variant.
|
||||
let mnemonic: GeneratedKey<_, Tap> =
|
||||
Mnemonic::generate((WordCount::Words12, Language::English))
|
||||
.map_err(|_| BDK_Error::Generic("Mnemonic generation error".to_string()))?;
|
||||
.map_err(|_| anyhow!("Mnemonic generation error"))?;
|
||||
|
||||
println!("Mnemonic phrase: {}", *mnemonic);
|
||||
let mnemonic_with_passphrase = (mnemonic, None);
|
||||
|
||||
@@ -10,8 +10,6 @@
|
||||
// licenses.
|
||||
|
||||
extern crate bdk;
|
||||
extern crate env_logger;
|
||||
extern crate log;
|
||||
use std::error::Error;
|
||||
|
||||
use bdk::bitcoin::Network;
|
||||
@@ -29,10 +27,6 @@ use bdk::wallet::signer::SignersContainer;
|
||||
/// one of the Extend Private key.
|
||||
|
||||
fn main() -> Result<(), Box<dyn Error>> {
|
||||
env_logger::init_from_env(
|
||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
||||
);
|
||||
|
||||
let secp = bitcoin::secp256k1::Secp256k1::new();
|
||||
|
||||
// The descriptor used in the example
|
||||
@@ -48,7 +42,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
// But they can be used as independent tools also.
|
||||
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||
|
||||
log::info!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||
println!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||
|
||||
// Create the signer with the keymap and descriptor.
|
||||
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
||||
@@ -60,7 +54,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
||||
.expect("We expect a policy");
|
||||
|
||||
log::info!("Derived Policy for the descriptor {:#?}", policy);
|
||||
println!("Derived Policy for the descriptor {:#?}", policy);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
@@ -516,13 +516,14 @@ macro_rules! descriptor {
|
||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||
|
||||
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
||||
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
||||
});
|
||||
( wpkh ( $key:expr ) ) => ({
|
||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||
|
||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
||||
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
||||
});
|
||||
( sh ( wpkh ( $key:expr ) ) ) => ({
|
||||
@@ -532,7 +533,7 @@ macro_rules! descriptor {
|
||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
||||
|
||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
||||
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
||||
});
|
||||
( sh ( $( $minisc:tt )* ) ) => ({
|
||||
@@ -702,7 +703,7 @@ macro_rules! fragment {
|
||||
$crate::keys::make_pkh($key, &secp)
|
||||
});
|
||||
( after ( $value:expr ) ) => ({
|
||||
$crate::impl_leaf_opcode_value!(After, $crate::bitcoin::PackedLockTime($value)) // TODO!! https://github.com/rust-bitcoin/rust-bitcoin/issues/1302
|
||||
$crate::impl_leaf_opcode_value!(After, $crate::miniscript::AbsLockTime::from_consensus($value))
|
||||
});
|
||||
( older ( $value:expr ) ) => ({
|
||||
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
||||
@@ -796,7 +797,6 @@ macro_rules! fragment {
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use alloc::string::ToString;
|
||||
use bitcoin::hashes::hex::ToHex;
|
||||
use bitcoin::secp256k1::Secp256k1;
|
||||
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||
use miniscript::{Descriptor, Legacy, Segwitv0};
|
||||
@@ -805,8 +805,8 @@ mod test {
|
||||
|
||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
||||
use bitcoin::bip32;
|
||||
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::PrivateKey;
|
||||
|
||||
// test the descriptor!() macro
|
||||
@@ -822,18 +822,15 @@ mod test {
|
||||
assert_eq!(desc.is_witness(), is_witness);
|
||||
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||
for i in 0..expected.len() {
|
||||
let index = i as u32;
|
||||
let child_desc = if !desc.has_wildcard() {
|
||||
desc.at_derivation_index(0)
|
||||
} else {
|
||||
desc.at_derivation_index(index)
|
||||
};
|
||||
let child_desc = desc
|
||||
.at_derivation_index(i as u32)
|
||||
.expect("i is not hardened");
|
||||
let address = child_desc.address(Regtest);
|
||||
if let Ok(address) = address {
|
||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||
} else {
|
||||
let script = child_desc.script_pubkey();
|
||||
assert_eq!(script.to_hex().as_str(), *expected.get(i).unwrap());
|
||||
assert_eq!(script.to_hex_string(), *expected.get(i).unwrap());
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1178,9 +1175,7 @@ mod test {
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[should_panic(
|
||||
expected = "Miniscript(ContextError(CompressedOnly(\"04b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a87378ec38ff91d43e8c2092ebda601780485263da089465619e0358a5c1be7ac91f4\")))"
|
||||
)]
|
||||
#[should_panic(expected = "Miniscript(ContextError(UncompressedKeysNotAllowed))")]
|
||||
fn test_dsl_miniscript_checks() {
|
||||
let mut uncompressed_pk =
|
||||
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
||||
|
||||
@@ -10,7 +10,6 @@
|
||||
// licenses.
|
||||
|
||||
//! Descriptor errors
|
||||
|
||||
use core::fmt;
|
||||
|
||||
/// Errors related to the parsing and usage of descriptors
|
||||
@@ -22,6 +21,8 @@ pub enum Error {
|
||||
InvalidDescriptorChecksum,
|
||||
/// The descriptor contains hardened derivation steps on public extended keys
|
||||
HardenedDerivationXpub,
|
||||
/// The descriptor contains multipath keys
|
||||
MultiPath,
|
||||
|
||||
/// Error thrown while working with [`keys`](crate::keys)
|
||||
Key(crate::keys::KeyError),
|
||||
@@ -32,11 +33,11 @@ pub enum Error {
|
||||
InvalidDescriptorCharacter(u8),
|
||||
|
||||
/// BIP32 error
|
||||
Bip32(bitcoin::util::bip32::Error),
|
||||
Bip32(bitcoin::bip32::Error),
|
||||
/// Error during base58 decoding
|
||||
Base58(bitcoin::util::base58::Error),
|
||||
Base58(bitcoin::base58::Error),
|
||||
/// Key-related error
|
||||
Pk(bitcoin::util::key::Error),
|
||||
Pk(bitcoin::key::Error),
|
||||
/// Miniscript error
|
||||
Miniscript(miniscript::Error),
|
||||
/// Hex decoding error
|
||||
@@ -64,6 +65,10 @@ impl fmt::Display for Error {
|
||||
f,
|
||||
"The descriptor contains hardened derivation steps on public extended keys"
|
||||
),
|
||||
Self::MultiPath => write!(
|
||||
f,
|
||||
"The descriptor contains multipath keys, which are not supported yet"
|
||||
),
|
||||
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||
Self::Policy(err) => write!(f, "Policy error: {}", err),
|
||||
Self::InvalidDescriptorCharacter(char) => {
|
||||
@@ -81,9 +86,38 @@ impl fmt::Display for Error {
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for Error {}
|
||||
|
||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
||||
impl_error!(bitcoin::util::base58::Error, Base58);
|
||||
impl_error!(bitcoin::util::key::Error, Pk);
|
||||
impl_error!(miniscript::Error, Miniscript);
|
||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
||||
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
||||
impl From<bitcoin::bip32::Error> for Error {
|
||||
fn from(err: bitcoin::bip32::Error) -> Self {
|
||||
Error::Bip32(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bitcoin::base58::Error> for Error {
|
||||
fn from(err: bitcoin::base58::Error) -> Self {
|
||||
Error::Base58(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bitcoin::key::Error> for Error {
|
||||
fn from(err: bitcoin::key::Error) -> Self {
|
||||
Error::Pk(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<miniscript::Error> for Error {
|
||||
fn from(err: miniscript::Error) -> Self {
|
||||
Error::Miniscript(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bitcoin::hashes::hex::Error> for Error {
|
||||
fn from(err: bitcoin::hashes::hex::Error) -> Self {
|
||||
Error::Hex(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<crate::descriptor::policy::PolicyError> for Error {
|
||||
fn from(err: crate::descriptor::policy::PolicyError) -> Self {
|
||||
Error::Policy(err)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -18,17 +18,17 @@ use crate::collections::BTreeMap;
|
||||
use alloc::string::String;
|
||||
use alloc::vec::Vec;
|
||||
|
||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
||||
use bitcoin::util::{psbt, taproot};
|
||||
use bitcoin::{secp256k1, PublicKey, XOnlyPublicKey};
|
||||
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
||||
use bitcoin::{key::XOnlyPublicKey, secp256k1, PublicKey};
|
||||
use bitcoin::{psbt, taproot};
|
||||
use bitcoin::{Network, TxOut};
|
||||
|
||||
use miniscript::descriptor::{
|
||||
DefiniteDescriptorKey, DescriptorSecretKey, DescriptorType, InnerXKey, SinglePubKey,
|
||||
DefiniteDescriptorKey, DescriptorMultiXKey, DescriptorSecretKey, DescriptorType,
|
||||
DescriptorXKey, InnerXKey, KeyMap, SinglePubKey, Wildcard,
|
||||
};
|
||||
pub use miniscript::{
|
||||
descriptor::DescriptorXKey, descriptor::KeyMap, descriptor::Wildcard, Descriptor,
|
||||
DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
||||
Descriptor, DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
||||
};
|
||||
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
||||
|
||||
@@ -59,16 +59,16 @@ pub type DerivedDescriptor = Descriptor<DefiniteDescriptorKey>;
|
||||
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
||||
/// [`psbt::Output`]
|
||||
///
|
||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
||||
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
||||
|
||||
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
||||
/// [`psbt::Output`]
|
||||
///
|
||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
||||
pub type TapKeyOrigins = BTreeMap<bitcoin::XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
||||
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||
pub type TapKeyOrigins = BTreeMap<XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
||||
|
||||
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
||||
pub trait IntoWalletDescriptor {
|
||||
@@ -136,14 +136,10 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
||||
network: Network,
|
||||
}
|
||||
|
||||
impl<'s, 'd>
|
||||
miniscript::Translator<DescriptorPublicKey, miniscript::DummyKey, DescriptorError>
|
||||
impl<'s, 'd> miniscript::Translator<DescriptorPublicKey, String, DescriptorError>
|
||||
for Translator<'s, 'd>
|
||||
{
|
||||
fn pk(
|
||||
&mut self,
|
||||
pk: &DescriptorPublicKey,
|
||||
) -> Result<miniscript::DummyKey, DescriptorError> {
|
||||
fn pk(&mut self, pk: &DescriptorPublicKey) -> Result<String, DescriptorError> {
|
||||
let secp = &self.secp;
|
||||
|
||||
let (_, _, networks) = if self.descriptor.is_taproot() {
|
||||
@@ -161,7 +157,7 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
||||
};
|
||||
|
||||
if networks.contains(&self.network) {
|
||||
Ok(miniscript::DummyKey)
|
||||
Ok(Default::default())
|
||||
} else {
|
||||
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
||||
}
|
||||
@@ -169,35 +165,40 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
||||
fn sha256(
|
||||
&mut self,
|
||||
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
||||
) -> Result<miniscript::DummySha256Hash, DescriptorError> {
|
||||
) -> Result<String, DescriptorError> {
|
||||
Ok(Default::default())
|
||||
}
|
||||
fn hash256(
|
||||
&mut self,
|
||||
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
||||
) -> Result<miniscript::DummyHash256Hash, DescriptorError> {
|
||||
) -> Result<String, DescriptorError> {
|
||||
Ok(Default::default())
|
||||
}
|
||||
fn ripemd160(
|
||||
&mut self,
|
||||
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
||||
) -> Result<miniscript::DummyRipemd160Hash, DescriptorError> {
|
||||
) -> Result<String, DescriptorError> {
|
||||
Ok(Default::default())
|
||||
}
|
||||
fn hash160(
|
||||
&mut self,
|
||||
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
||||
) -> Result<miniscript::DummyHash160Hash, DescriptorError> {
|
||||
) -> Result<String, DescriptorError> {
|
||||
Ok(Default::default())
|
||||
}
|
||||
}
|
||||
|
||||
// check the network for the keys
|
||||
self.0.translate_pk(&mut Translator {
|
||||
use miniscript::TranslateErr;
|
||||
match self.0.translate_pk(&mut Translator {
|
||||
secp,
|
||||
network,
|
||||
descriptor: &self.0,
|
||||
})?;
|
||||
}) {
|
||||
Ok(_) => {}
|
||||
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||
}
|
||||
|
||||
Ok(self)
|
||||
}
|
||||
@@ -251,7 +252,12 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
||||
}
|
||||
|
||||
// fixup the network for keys that need it in the descriptor
|
||||
let translated = desc.translate_pk(&mut Translator { network })?;
|
||||
use miniscript::TranslateErr;
|
||||
let translated = match desc.translate_pk(&mut Translator { network }) {
|
||||
Ok(descriptor) => descriptor,
|
||||
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||
};
|
||||
// ...and in the key map
|
||||
let fixed_keymap = keymap
|
||||
.into_iter()
|
||||
@@ -302,6 +308,10 @@ pub(crate) fn into_wallet_descriptor_checked<T: IntoWalletDescriptor>(
|
||||
return Err(DescriptorError::HardenedDerivationXpub);
|
||||
}
|
||||
|
||||
if descriptor.is_multipath() {
|
||||
return Err(DescriptorError::MultiPath);
|
||||
}
|
||||
|
||||
// Run miniscript's sanity check, which will look for duplicated keys and other potential
|
||||
// issues
|
||||
descriptor.sanity_check()?;
|
||||
@@ -340,6 +350,18 @@ pub(crate) trait XKeyUtils {
|
||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
||||
}
|
||||
|
||||
impl<T> XKeyUtils for DescriptorMultiXKey<T>
|
||||
where
|
||||
T: InnerXKey,
|
||||
{
|
||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
||||
match self.origin {
|
||||
Some((fingerprint, _)) => fingerprint,
|
||||
None => self.xkey.xkey_fingerprint(secp),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T> XKeyUtils for DescriptorXKey<T>
|
||||
where
|
||||
T: InnerXKey,
|
||||
@@ -466,11 +488,6 @@ impl DescriptorMeta for ExtendedDescriptor {
|
||||
) {
|
||||
Some(derive_path)
|
||||
} else {
|
||||
log::debug!(
|
||||
"Key `{}` derived with {} yields an unexpected key",
|
||||
root_fingerprint,
|
||||
derive_path
|
||||
);
|
||||
None
|
||||
}
|
||||
});
|
||||
@@ -494,7 +511,10 @@ impl DescriptorMeta for ExtendedDescriptor {
|
||||
false
|
||||
});
|
||||
|
||||
path_found.map(|path| self.at_derivation_index(path))
|
||||
path_found.map(|path| {
|
||||
self.at_derivation_index(path)
|
||||
.expect("We ignore hardened wildcards")
|
||||
})
|
||||
}
|
||||
|
||||
fn derive_from_hd_keypaths(
|
||||
@@ -545,7 +565,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
||||
return None;
|
||||
}
|
||||
|
||||
let descriptor = self.at_derivation_index(0);
|
||||
let descriptor = self.at_derivation_index(0).expect("0 is not hardened");
|
||||
match descriptor.desc_type() {
|
||||
// TODO: add pk() here
|
||||
DescriptorType::Pkh
|
||||
@@ -585,11 +605,10 @@ mod test {
|
||||
use core::str::FromStr;
|
||||
|
||||
use assert_matches::assert_matches;
|
||||
use bitcoin::consensus::encode::deserialize;
|
||||
use bitcoin::hashes::hex::FromHex;
|
||||
use bitcoin::secp256k1::Secp256k1;
|
||||
use bitcoin::util::{bip32, psbt};
|
||||
use bitcoin::Script;
|
||||
use bitcoin::ScriptBuf;
|
||||
use bitcoin::{bip32, psbt::Psbt};
|
||||
|
||||
use super::*;
|
||||
use crate::psbt::PsbtUtils;
|
||||
@@ -600,7 +619,7 @@ mod test {
|
||||
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
||||
)
|
||||
.unwrap();
|
||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
||||
let psbt = Psbt::deserialize(
|
||||
&Vec::<u8>::from_hex(
|
||||
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
||||
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
||||
@@ -623,7 +642,7 @@ mod test {
|
||||
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
||||
)
|
||||
.unwrap();
|
||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
||||
let psbt = Psbt::deserialize(
|
||||
&Vec::<u8>::from_hex(
|
||||
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
||||
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
||||
@@ -654,7 +673,7 @@ mod test {
|
||||
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
||||
)
|
||||
.unwrap();
|
||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
||||
let psbt = Psbt::deserialize(
|
||||
&Vec::<u8>::from_hex(
|
||||
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
||||
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
||||
@@ -678,7 +697,7 @@ mod test {
|
||||
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
||||
)
|
||||
.unwrap();
|
||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
||||
let psbt = Psbt::deserialize(
|
||||
&Vec::<u8>::from_hex(
|
||||
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
||||
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
||||
@@ -845,6 +864,12 @@ mod test {
|
||||
|
||||
assert_matches!(result, Err(DescriptorError::HardenedDerivationXpub));
|
||||
|
||||
let descriptor = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/<0;1>/*)";
|
||||
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||
|
||||
assert_matches!(result, Err(DescriptorError::MultiPath));
|
||||
|
||||
// repeated pubkeys
|
||||
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*))";
|
||||
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||
|
||||
@@ -861,9 +886,9 @@ mod test {
|
||||
let (descriptor, _) =
|
||||
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
||||
|
||||
let descriptor = descriptor.at_derivation_index(0);
|
||||
let descriptor = descriptor.at_derivation_index(0).unwrap();
|
||||
|
||||
let script = Script::from_str("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
||||
let script = ScriptBuf::from_hex("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
||||
|
||||
let mut psbt_input = psbt::Input::default();
|
||||
psbt_input
|
||||
|
||||
@@ -33,21 +33,22 @@
|
||||
//! let signers = Arc::new(SignersContainer::build(key_map, &extended_desc, &secp));
|
||||
//! let policy = extended_desc.extract_policy(&signers, BuildSatisfaction::None, &secp)?;
|
||||
//! println!("policy: {}", serde_json::to_string(&policy).unwrap());
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! # Ok::<(), anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::collections::{BTreeMap, HashSet, VecDeque};
|
||||
use alloc::string::String;
|
||||
use alloc::vec::Vec;
|
||||
use core::cmp::max;
|
||||
|
||||
use core::fmt;
|
||||
|
||||
use serde::ser::SerializeMap;
|
||||
use serde::{Serialize, Serializer};
|
||||
|
||||
use bitcoin::bip32::Fingerprint;
|
||||
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
||||
use bitcoin::util::bip32::Fingerprint;
|
||||
use bitcoin::{LockTime, PublicKey, Sequence, XOnlyPublicKey};
|
||||
use bitcoin::{absolute, key::XOnlyPublicKey, PublicKey, Sequence};
|
||||
|
||||
use miniscript::descriptor::{
|
||||
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
||||
@@ -57,9 +58,6 @@ use miniscript::{
|
||||
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
||||
};
|
||||
|
||||
#[allow(unused_imports)]
|
||||
use log::{debug, error, info, trace};
|
||||
|
||||
use crate::descriptor::ExtractPolicy;
|
||||
use crate::keys::ExtScriptContext;
|
||||
use crate::wallet::signer::{SignerId, SignersContainer};
|
||||
@@ -68,7 +66,7 @@ use crate::wallet::utils::{After, Older, SecpCtx};
|
||||
use super::checksum::calc_checksum;
|
||||
use super::error::Error;
|
||||
use super::XKeyUtils;
|
||||
use bitcoin::util::psbt::{Input as PsbtInput, PartiallySignedTransaction as Psbt};
|
||||
use bitcoin::psbt::{self, Psbt};
|
||||
use miniscript::psbt::PsbtInputSatisfier;
|
||||
|
||||
/// A unique identifier for a key
|
||||
@@ -95,6 +93,9 @@ impl PkOrF {
|
||||
..
|
||||
}) => PkOrF::XOnlyPubkey(*pk),
|
||||
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
||||
DescriptorPublicKey::MultiXPub(multi) => {
|
||||
PkOrF::Fingerprint(multi.root_fingerprint(secp))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -131,7 +132,7 @@ pub enum SatisfiableItem {
|
||||
/// Absolute timeclock timestamp
|
||||
AbsoluteTimelock {
|
||||
/// The timelock value
|
||||
value: LockTime,
|
||||
value: absolute::LockTime,
|
||||
},
|
||||
/// Relative timelock locktime
|
||||
RelativeTimelock {
|
||||
@@ -451,11 +452,14 @@ pub struct Condition {
|
||||
pub csv: Option<Sequence>,
|
||||
/// Optional timelock condition
|
||||
#[serde(skip_serializing_if = "Option::is_none")]
|
||||
pub timelock: Option<LockTime>,
|
||||
pub timelock: Option<absolute::LockTime>,
|
||||
}
|
||||
|
||||
impl Condition {
|
||||
fn merge_nlocktime(a: LockTime, b: LockTime) -> Result<LockTime, PolicyError> {
|
||||
fn merge_nlocktime(
|
||||
a: absolute::LockTime,
|
||||
b: absolute::LockTime,
|
||||
) -> Result<absolute::LockTime, PolicyError> {
|
||||
if !a.is_same_unit(b) {
|
||||
Err(PolicyError::MixedTimelockUnits)
|
||||
} else if a > b {
|
||||
@@ -515,7 +519,7 @@ pub enum PolicyError {
|
||||
impl fmt::Display for PolicyError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::NotEnoughItemsSelected(err) => write!(f, "Not enought items selected: {}", err),
|
||||
Self::NotEnoughItemsSelected(err) => write!(f, "Not enough items selected: {}", err),
|
||||
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
||||
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
||||
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
||||
@@ -749,6 +753,7 @@ fn signer_id(key: &DescriptorPublicKey, secp: &SecpCtx) -> SignerId {
|
||||
..
|
||||
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
||||
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||
DescriptorPublicKey::MultiXPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||
}
|
||||
}
|
||||
|
||||
@@ -786,9 +791,9 @@ fn make_generic_signature<M: Fn() -> SatisfiableItem, F: Fn(&Psbt) -> bool>(
|
||||
fn generic_sig_in_psbt<
|
||||
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
||||
// for a specific key
|
||||
C: Fn(&PsbtInput, &SinglePubKey) -> bool,
|
||||
C: Fn(&psbt::Input, &SinglePubKey) -> bool,
|
||||
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
||||
E: Fn(&PsbtInput, Fingerprint) -> Option<SinglePubKey>,
|
||||
E: Fn(&psbt::Input, Fingerprint) -> Option<SinglePubKey>,
|
||||
>(
|
||||
psbt: &Psbt,
|
||||
key: &DescriptorPublicKey,
|
||||
@@ -806,6 +811,13 @@ fn generic_sig_in_psbt<
|
||||
None => false,
|
||||
}
|
||||
}
|
||||
DescriptorPublicKey::MultiXPub(xpub) => {
|
||||
//TODO check actual derivation matches
|
||||
match extract(input, xpub.root_fingerprint(secp)) {
|
||||
Some(pubkey) => check(input, &pubkey),
|
||||
None => false,
|
||||
}
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
@@ -911,12 +923,12 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
||||
}
|
||||
Terminal::After(value) => {
|
||||
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
||||
value: value.into(),
|
||||
value: (*value).into(),
|
||||
}
|
||||
.into();
|
||||
policy.contribution = Satisfaction::Complete {
|
||||
condition: Condition {
|
||||
timelock: Some(value.into()),
|
||||
timelock: Some((*value).into()),
|
||||
csv: None,
|
||||
},
|
||||
};
|
||||
@@ -928,9 +940,9 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
||||
{
|
||||
let after = After::new(Some(current_height), false);
|
||||
let after_sat =
|
||||
Satisfier::<bitcoin::PublicKey>::check_after(&after, value.into());
|
||||
Satisfier::<bitcoin::PublicKey>::check_after(&after, (*value).into());
|
||||
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
||||
Satisfier::<bitcoin::PublicKey>::check_after(&sat, value.into())
|
||||
Satisfier::<bitcoin::PublicKey>::check_after(&sat, (*value).into())
|
||||
});
|
||||
if after_sat && inputs_sat {
|
||||
policy.satisfaction = policy.contribution.clone();
|
||||
@@ -1156,8 +1168,8 @@ mod test {
|
||||
use crate::wallet::signer::SignersContainer;
|
||||
use alloc::{string::ToString, sync::Arc};
|
||||
use assert_matches::assert_matches;
|
||||
use bitcoin::bip32;
|
||||
use bitcoin::secp256k1::Secp256k1;
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::Network;
|
||||
use core::str::FromStr;
|
||||
|
||||
@@ -1575,6 +1587,7 @@ mod test {
|
||||
|
||||
let addr = wallet_desc
|
||||
.at_derivation_index(0)
|
||||
.unwrap()
|
||||
.address(Network::Testnet)
|
||||
.unwrap();
|
||||
assert_eq!(
|
||||
@@ -1641,6 +1654,7 @@ mod test {
|
||||
|
||||
let addr = wallet_desc
|
||||
.at_derivation_index(0)
|
||||
.unwrap()
|
||||
.address(Network::Testnet)
|
||||
.unwrap();
|
||||
assert_eq!(
|
||||
|
||||
@@ -14,7 +14,7 @@
|
||||
//! This module contains the definition of various common script templates that are ready to be
|
||||
//! used. See the documentation of each template for an example.
|
||||
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::bip32;
|
||||
use bitcoin::Network;
|
||||
|
||||
use miniscript::{Legacy, Segwitv0, Tap};
|
||||
@@ -195,7 +195,7 @@ impl<K: IntoDescriptorKey<Tap>> DescriptorTemplate for P2TR<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip44;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip44(key.clone(), KeychainKind::External),
|
||||
/// Some(Bip44(key, KeychainKind::Internal)),
|
||||
@@ -232,8 +232,8 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip44Public;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
||||
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
||||
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
||||
@@ -270,7 +270,7 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip49;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip49(key.clone(), KeychainKind::External),
|
||||
/// Some(Bip49(key, KeychainKind::Internal)),
|
||||
@@ -307,8 +307,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip49Public;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
||||
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
||||
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
||||
@@ -345,7 +345,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip84;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip84(key.clone(), KeychainKind::External),
|
||||
/// Some(Bip84(key, KeychainKind::Internal)),
|
||||
@@ -382,8 +382,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip84Public;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
||||
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
||||
@@ -420,7 +420,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84Public<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip86;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip86(key.clone(), KeychainKind::External),
|
||||
/// Some(Bip86(key, KeychainKind::Internal)),
|
||||
@@ -457,8 +457,8 @@ impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86<K> {
|
||||
/// # use bdk::wallet::AddressIndex::New;
|
||||
/// use bdk::template::Bip86Public;
|
||||
///
|
||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||
/// let mut wallet = Wallet::new_no_persist(
|
||||
/// Bip86Public(key.clone(), fingerprint, KeychainKind::External),
|
||||
/// Some(Bip86Public(key, fingerprint, KeychainKind::Internal)),
|
||||
@@ -565,30 +565,30 @@ mod test {
|
||||
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||
#[test]
|
||||
fn test_bip44_template_cointype() {
|
||||
use bitcoin::util::bip32::ChildNumber::{self, Hardened};
|
||||
use bitcoin::bip32::ChildNumber::{self, Hardened};
|
||||
|
||||
let xprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
||||
let xprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
||||
assert_eq!(Network::Bitcoin, xprvkey.network);
|
||||
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
||||
.build(Network::Bitcoin)
|
||||
.unwrap();
|
||||
|
||||
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||
let purpose = path.get(0).unwrap();
|
||||
assert_matches!(purpose, Hardened { index: 44 });
|
||||
let coin_type = path.get(1).unwrap();
|
||||
assert_matches!(coin_type, Hardened { index: 0 });
|
||||
}
|
||||
|
||||
let tprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
let tprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
assert_eq!(Network::Testnet, tprvkey.network);
|
||||
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
||||
.build(Network::Testnet)
|
||||
.unwrap();
|
||||
|
||||
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||
let purpose = path.get(0).unwrap();
|
||||
assert_matches!(purpose, Hardened { index: 44 });
|
||||
let coin_type = path.get(1).unwrap();
|
||||
@@ -612,9 +612,9 @@ mod test {
|
||||
for i in 0..expected.len() {
|
||||
let index = i as u32;
|
||||
let child_desc = if !desc.has_wildcard() {
|
||||
desc.at_derivation_index(0)
|
||||
desc.at_derivation_index(0).unwrap()
|
||||
} else {
|
||||
desc.at_derivation_index(index)
|
||||
desc.at_derivation_index(index).unwrap()
|
||||
};
|
||||
let address = child_desc.address(network).unwrap();
|
||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||
@@ -740,7 +740,7 @@ mod test {
|
||||
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
||||
#[test]
|
||||
fn test_bip44_template() {
|
||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
check(
|
||||
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||
false,
|
||||
@@ -770,8 +770,8 @@ mod test {
|
||||
// BIP44 public `pkh(key/{0,1}/*)`
|
||||
#[test]
|
||||
fn test_bip44_public_template() {
|
||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
||||
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||
check(
|
||||
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||
false,
|
||||
@@ -801,7 +801,7 @@ mod test {
|
||||
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
||||
#[test]
|
||||
fn test_bip49_template() {
|
||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
check(
|
||||
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||
true,
|
||||
@@ -831,8 +831,8 @@ mod test {
|
||||
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
||||
#[test]
|
||||
fn test_bip49_public_template() {
|
||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
||||
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||
check(
|
||||
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||
true,
|
||||
@@ -862,7 +862,7 @@ mod test {
|
||||
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
||||
#[test]
|
||||
fn test_bip84_template() {
|
||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||
check(
|
||||
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||
true,
|
||||
@@ -892,8 +892,8 @@ mod test {
|
||||
// BIP84 public `wpkh(key/{0,1}/*)`
|
||||
#[test]
|
||||
fn test_bip84_public_template() {
|
||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
||||
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||
check(
|
||||
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||
true,
|
||||
@@ -924,7 +924,7 @@ mod test {
|
||||
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||
#[test]
|
||||
fn test_bip86_template() {
|
||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
||||
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
||||
check(
|
||||
Bip86(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||
false,
|
||||
@@ -955,8 +955,8 @@ mod test {
|
||||
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||
#[test]
|
||||
fn test_bip86_public_template() {
|
||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
||||
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
||||
let fingerprint = bitcoin::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
||||
check(
|
||||
Bip86Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||
false,
|
||||
|
||||
@@ -1,201 +0,0 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
use crate::bitcoin::Network;
|
||||
use crate::{descriptor, wallet};
|
||||
use alloc::{string::String, vec::Vec};
|
||||
use bitcoin::{OutPoint, Txid};
|
||||
use core::fmt;
|
||||
|
||||
/// Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||
#[derive(Debug)]
|
||||
pub enum Error {
|
||||
/// Generic error
|
||||
Generic(String),
|
||||
/// Cannot build a tx without recipients
|
||||
NoRecipients,
|
||||
/// `manually_selected_only` option is selected but no utxo has been passed
|
||||
NoUtxosSelected,
|
||||
/// Output created is under the dust limit, 546 satoshis
|
||||
OutputBelowDustLimit(usize),
|
||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||
InsufficientFunds {
|
||||
/// Sats needed for some transaction
|
||||
needed: u64,
|
||||
/// Sats available for spending
|
||||
available: u64,
|
||||
},
|
||||
/// Branch and bound coin selection possible attempts with sufficiently big UTXO set could grow
|
||||
/// exponentially, thus a limit is set, and when hit, this error is thrown
|
||||
BnBTotalTriesExceeded,
|
||||
/// Branch and bound coin selection tries to avoid needing a change by finding the right inputs for
|
||||
/// the desired outputs plus fee, if there is not such combination this error is thrown
|
||||
BnBNoExactMatch,
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo,
|
||||
/// Thrown when a tx is not found in the internal database
|
||||
TransactionNotFound,
|
||||
/// Happens when trying to bump a transaction that is already confirmed
|
||||
TransactionConfirmed,
|
||||
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
||||
IrreplaceableTransaction,
|
||||
/// When bumping a tx the fee rate requested is lower than required
|
||||
FeeRateTooLow {
|
||||
/// Required fee rate (satoshi/vbyte)
|
||||
required: crate::types::FeeRate,
|
||||
},
|
||||
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
||||
FeeTooLow {
|
||||
/// Required fee absolute value (satoshi)
|
||||
required: u64,
|
||||
},
|
||||
/// Node doesn't have data to estimate a fee rate
|
||||
FeeRateUnavailable,
|
||||
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
||||
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
||||
/// explicit origin provided
|
||||
///
|
||||
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
||||
MissingKeyOrigin(String),
|
||||
/// Error while working with [`keys`](crate::keys)
|
||||
Key(crate::keys::KeyError),
|
||||
/// Descriptor checksum mismatch
|
||||
ChecksumMismatch,
|
||||
/// Spending policy is not compatible with this [`KeychainKind`](crate::types::KeychainKind)
|
||||
SpendingPolicyRequired(crate::types::KeychainKind),
|
||||
/// Error while extracting and manipulating policies
|
||||
InvalidPolicyPathError(crate::descriptor::policy::PolicyError),
|
||||
/// Signing error
|
||||
Signer(crate::wallet::signer::SignerError),
|
||||
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
||||
InvalidOutpoint(OutPoint),
|
||||
/// Error related to the parsing and usage of descriptors
|
||||
Descriptor(crate::descriptor::error::Error),
|
||||
/// Miniscript error
|
||||
Miniscript(miniscript::Error),
|
||||
/// Miniscript PSBT error
|
||||
MiniscriptPsbt(MiniscriptPsbtError),
|
||||
/// BIP32 error
|
||||
Bip32(bitcoin::util::bip32::Error),
|
||||
/// Partially signed bitcoin transaction error
|
||||
Psbt(bitcoin::util::psbt::Error),
|
||||
}
|
||||
|
||||
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||
#[derive(Debug, Clone)]
|
||||
pub enum MiniscriptPsbtError {
|
||||
Conversion(miniscript::descriptor::ConversionError),
|
||||
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||
}
|
||||
|
||||
impl fmt::Display for MiniscriptPsbtError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for MiniscriptPsbtError {}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl fmt::Display for Error {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Generic(err) => write!(f, "Generic error: {}", err),
|
||||
Self::NoRecipients => write!(f, "Cannot build tx without recipients"),
|
||||
Self::NoUtxosSelected => write!(f, "No UTXO selected"),
|
||||
Self::OutputBelowDustLimit(limit) => {
|
||||
write!(f, "Output below the dust limit: {}", limit)
|
||||
}
|
||||
Self::InsufficientFunds { needed, available } => write!(
|
||||
f,
|
||||
"Insufficient funds: {} sat available of {} sat needed",
|
||||
available, needed
|
||||
),
|
||||
Self::BnBTotalTriesExceeded => {
|
||||
write!(f, "Branch and bound coin selection: total tries exceeded")
|
||||
}
|
||||
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
||||
Self::UnknownUtxo => write!(f, "UTXO not found in the internal database"),
|
||||
Self::TransactionNotFound => {
|
||||
write!(f, "Transaction not found in the internal database")
|
||||
}
|
||||
Self::TransactionConfirmed => write!(f, "Transaction already confirmed"),
|
||||
Self::IrreplaceableTransaction => write!(f, "Transaction can't be replaced"),
|
||||
Self::FeeRateTooLow { required } => write!(
|
||||
f,
|
||||
"Fee rate too low: required {} sat/vbyte",
|
||||
required.as_sat_per_vb()
|
||||
),
|
||||
Self::FeeTooLow { required } => write!(f, "Fee to low: required {} sat", required),
|
||||
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||
Self::MissingKeyOrigin(err) => write!(f, "Missing key origin: {}", err),
|
||||
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||
Self::ChecksumMismatch => write!(f, "Descriptor checksum mismatch"),
|
||||
Self::SpendingPolicyRequired(keychain_kind) => {
|
||||
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||
}
|
||||
Self::InvalidPolicyPathError(err) => write!(f, "Invalid policy path: {}", err),
|
||||
Self::Signer(err) => write!(f, "Signer error: {}", err),
|
||||
Self::InvalidOutpoint(outpoint) => write!(
|
||||
f,
|
||||
"Requested outpoint doesn't exist in the tx: {}",
|
||||
outpoint
|
||||
),
|
||||
Self::Descriptor(err) => write!(f, "Descriptor error: {}", err),
|
||||
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
||||
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
||||
Self::Psbt(err) => write!(f, "PSBT error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for Error {}
|
||||
|
||||
macro_rules! impl_error {
|
||||
( $from:ty, $to:ident ) => {
|
||||
impl_error!($from, $to, Error);
|
||||
};
|
||||
( $from:ty, $to:ident, $impl_for:ty ) => {
|
||||
impl core::convert::From<$from> for $impl_for {
|
||||
fn from(err: $from) -> Self {
|
||||
<$impl_for>::$to(err)
|
||||
}
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
impl_error!(descriptor::error::Error, Descriptor);
|
||||
impl_error!(descriptor::policy::PolicyError, InvalidPolicyPathError);
|
||||
impl_error!(wallet::signer::SignerError, Signer);
|
||||
|
||||
impl From<crate::keys::KeyError> for Error {
|
||||
fn from(key_error: crate::keys::KeyError) -> Error {
|
||||
match key_error {
|
||||
crate::keys::KeyError::Miniscript(inner) => Error::Miniscript(inner),
|
||||
crate::keys::KeyError::Bip32(inner) => Error::Bip32(inner),
|
||||
crate::keys::KeyError::InvalidChecksum => Error::ChecksumMismatch,
|
||||
e => Error::Key(e),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl_error!(miniscript::Error, Miniscript);
|
||||
impl_error!(MiniscriptPsbtError, MiniscriptPsbt);
|
||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
||||
impl_error!(bitcoin::util::psbt::Error, Psbt);
|
||||
@@ -15,7 +15,7 @@
|
||||
// something that should be fairly simple to re-implement.
|
||||
|
||||
use alloc::string::String;
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::bip32;
|
||||
use bitcoin::Network;
|
||||
|
||||
use miniscript::ScriptContext;
|
||||
@@ -142,7 +142,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
||||
(word_count, language): Self::Options,
|
||||
entropy: Self::Entropy,
|
||||
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
||||
let entropy = &entropy.as_ref()[..(word_count as usize / 8)];
|
||||
let entropy = &entropy[..(word_count as usize / 8)];
|
||||
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
||||
|
||||
Ok(GeneratedKey::new(mnemonic, any_network()))
|
||||
@@ -154,7 +154,7 @@ mod test {
|
||||
use alloc::string::ToString;
|
||||
use core::str::FromStr;
|
||||
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::bip32;
|
||||
|
||||
use bip39::{Language, Mnemonic};
|
||||
|
||||
|
||||
@@ -22,8 +22,8 @@ use core::str::FromStr;
|
||||
|
||||
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
||||
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::{Network, PrivateKey, PublicKey, XOnlyPublicKey};
|
||||
use bitcoin::bip32;
|
||||
use bitcoin::{key::XOnlyPublicKey, Network, PrivateKey, PublicKey};
|
||||
|
||||
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
||||
pub use miniscript::descriptor::{
|
||||
@@ -388,12 +388,12 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
||||
///
|
||||
/// ```
|
||||
/// use bdk::bitcoin;
|
||||
/// use bdk::bitcoin::util::bip32;
|
||||
/// use bdk::bitcoin::bip32;
|
||||
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
||||
///
|
||||
/// struct MyCustomKeyType {
|
||||
/// key_data: bitcoin::PrivateKey,
|
||||
/// chain_code: Vec<u8>,
|
||||
/// chain_code: [u8; 32],
|
||||
/// network: bitcoin::Network,
|
||||
/// }
|
||||
///
|
||||
@@ -404,7 +404,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
||||
/// depth: 0,
|
||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||
/// private_key: self.key_data.inner,
|
||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
||||
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||
/// };
|
||||
///
|
||||
@@ -413,20 +413,20 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
||||
/// }
|
||||
/// ```
|
||||
///
|
||||
/// Types that don't internally encode the [`Network`](bitcoin::Network) in which they are valid need some extra
|
||||
/// Types that don't internally encode the [`Network`] in which they are valid need some extra
|
||||
/// steps to override the set of valid networks, otherwise only the network specified in the
|
||||
/// [`ExtendedPrivKey`] or [`ExtendedPubKey`] will be considered valid.
|
||||
///
|
||||
/// ```
|
||||
/// use bdk::bitcoin;
|
||||
/// use bdk::bitcoin::util::bip32;
|
||||
/// use bdk::bitcoin::bip32;
|
||||
/// use bdk::keys::{
|
||||
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
||||
/// };
|
||||
///
|
||||
/// struct MyCustomKeyType {
|
||||
/// key_data: bitcoin::PrivateKey,
|
||||
/// chain_code: Vec<u8>,
|
||||
/// chain_code: [u8; 32],
|
||||
/// }
|
||||
///
|
||||
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
||||
@@ -436,7 +436,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
||||
/// depth: 0,
|
||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||
/// private_key: self.key_data.inner,
|
||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
||||
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||
/// };
|
||||
///
|
||||
@@ -754,7 +754,7 @@ fn expand_multi_keys<Pk: IntoDescriptorKey<Ctx>, Ctx: ScriptContext>(
|
||||
let (key_map, valid_networks) = key_maps_networks.into_iter().fold(
|
||||
(KeyMap::default(), any_network()),
|
||||
|(mut keys_acc, net_acc), (key, net)| {
|
||||
keys_acc.extend(key.into_iter());
|
||||
keys_acc.extend(key);
|
||||
let net_acc = merge_networks(&net_acc, &net);
|
||||
|
||||
(keys_acc, net_acc)
|
||||
@@ -927,13 +927,22 @@ pub enum KeyError {
|
||||
Message(String),
|
||||
|
||||
/// BIP32 error
|
||||
Bip32(bitcoin::util::bip32::Error),
|
||||
Bip32(bitcoin::bip32::Error),
|
||||
/// Miniscript error
|
||||
Miniscript(miniscript::Error),
|
||||
}
|
||||
|
||||
impl_error!(miniscript::Error, Miniscript, KeyError);
|
||||
impl_error!(bitcoin::util::bip32::Error, Bip32, KeyError);
|
||||
impl From<miniscript::Error> for KeyError {
|
||||
fn from(err: miniscript::Error) -> Self {
|
||||
KeyError::Miniscript(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bip32::Error> for KeyError {
|
||||
fn from(err: bip32::Error) -> Self {
|
||||
KeyError::Bip32(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl fmt::Display for KeyError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
@@ -953,7 +962,7 @@ impl std::error::Error for KeyError {}
|
||||
|
||||
#[cfg(test)]
|
||||
pub mod test {
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::bip32;
|
||||
|
||||
use super::*;
|
||||
|
||||
|
||||
@@ -19,7 +19,6 @@ pub extern crate alloc;
|
||||
pub extern crate bitcoin;
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
pub extern crate hwi;
|
||||
extern crate log;
|
||||
pub extern crate miniscript;
|
||||
extern crate serde;
|
||||
extern crate serde_json;
|
||||
@@ -27,9 +26,6 @@ extern crate serde_json;
|
||||
#[cfg(feature = "keys-bip39")]
|
||||
extern crate bip39;
|
||||
|
||||
#[allow(unused_imports)]
|
||||
#[macro_use]
|
||||
pub(crate) mod error;
|
||||
pub mod descriptor;
|
||||
pub mod keys;
|
||||
pub mod psbt;
|
||||
@@ -38,7 +34,6 @@ pub mod wallet;
|
||||
|
||||
pub use descriptor::template;
|
||||
pub use descriptor::HdKeyPaths;
|
||||
pub use error::Error;
|
||||
pub use types::*;
|
||||
pub use wallet::signer;
|
||||
pub use wallet::signer::SignOptions;
|
||||
|
||||
@@ -13,7 +13,7 @@
|
||||
|
||||
use crate::FeeRate;
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
||||
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||
use bitcoin::TxOut;
|
||||
|
||||
// TODO upstream the functions here to `rust-bitcoin`?
|
||||
|
||||
@@ -14,8 +14,8 @@ use core::convert::AsRef;
|
||||
use core::ops::Sub;
|
||||
|
||||
use bdk_chain::ConfirmationTime;
|
||||
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
||||
use bitcoin::{hash_types::Txid, util::psbt};
|
||||
use bitcoin::blockdata::transaction::{OutPoint, TxOut};
|
||||
use bitcoin::{psbt, Weight};
|
||||
|
||||
use serde::{Deserialize, Serialize};
|
||||
|
||||
@@ -99,8 +99,8 @@ impl FeeRate {
|
||||
}
|
||||
|
||||
/// Calculate fee rate from `fee` and weight units (`wu`).
|
||||
pub fn from_wu(fee: u64, wu: usize) -> FeeRate {
|
||||
Self::from_vb(fee, wu.vbytes())
|
||||
pub fn from_wu(fee: u64, wu: Weight) -> FeeRate {
|
||||
Self::from_vb(fee, wu.to_vbytes_ceil() as usize)
|
||||
}
|
||||
|
||||
/// Calculate fee rate from `fee` and `vbytes`.
|
||||
@@ -120,8 +120,8 @@ impl FeeRate {
|
||||
}
|
||||
|
||||
/// Calculate absolute fee in Satoshis using size in weight units.
|
||||
pub fn fee_wu(&self, wu: usize) -> u64 {
|
||||
self.fee_vb(wu.vbytes())
|
||||
pub fn fee_wu(&self, wu: Weight) -> u64 {
|
||||
self.fee_vb(wu.to_vbytes_ceil() as usize)
|
||||
}
|
||||
|
||||
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
||||
@@ -161,7 +161,7 @@ impl Vbytes for usize {
|
||||
///
|
||||
/// [`Wallet`]: crate::Wallet
|
||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)]
|
||||
pub struct LocalUtxo {
|
||||
pub struct LocalOutput {
|
||||
/// Reference to a transaction output
|
||||
pub outpoint: OutPoint,
|
||||
/// Transaction output
|
||||
@@ -192,7 +192,7 @@ pub struct WeightedUtxo {
|
||||
/// An unspent transaction output (UTXO).
|
||||
pub enum Utxo {
|
||||
/// A UTXO owned by the local wallet.
|
||||
Local(LocalUtxo),
|
||||
Local(LocalOutput),
|
||||
/// A UTXO owned by another wallet.
|
||||
Foreign {
|
||||
/// The location of the output.
|
||||
@@ -234,40 +234,6 @@ impl Utxo {
|
||||
}
|
||||
}
|
||||
|
||||
/// A wallet transaction
|
||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq)]
|
||||
pub struct TransactionDetails {
|
||||
/// Optional transaction
|
||||
pub transaction: Option<Transaction>,
|
||||
/// Transaction id
|
||||
pub txid: Txid,
|
||||
/// Received value (sats)
|
||||
/// Sum of owned outputs of this transaction.
|
||||
pub received: u64,
|
||||
/// Sent value (sats)
|
||||
/// Sum of owned inputs of this transaction.
|
||||
pub sent: u64,
|
||||
/// Fee value in sats if it was available.
|
||||
pub fee: Option<u64>,
|
||||
/// If the transaction is confirmed, contains height and Unix timestamp of the block containing the
|
||||
/// transaction, unconfirmed transaction contains `None`.
|
||||
pub confirmation_time: ConfirmationTime,
|
||||
}
|
||||
|
||||
impl PartialOrd for TransactionDetails {
|
||||
fn partial_cmp(&self, other: &Self) -> Option<core::cmp::Ordering> {
|
||||
Some(self.cmp(other))
|
||||
}
|
||||
}
|
||||
|
||||
impl Ord for TransactionDetails {
|
||||
fn cmp(&self, other: &Self) -> core::cmp::Ordering {
|
||||
self.confirmation_time
|
||||
.cmp(&other.confirmation_time)
|
||||
.then_with(|| self.txid.cmp(&other.txid))
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
use super::*;
|
||||
|
||||
@@ -26,9 +26,12 @@
|
||||
//! ```
|
||||
//! # use std::str::FromStr;
|
||||
//! # use bitcoin::*;
|
||||
//! # use bdk::wallet::{self, coin_selection::*};
|
||||
//! # use bdk::wallet::{self, ChangeSet, coin_selection::*, coin_selection};
|
||||
//! # use bdk::wallet::error::CreateTxError;
|
||||
//! # use bdk_chain::PersistBackend;
|
||||
//! # use bdk::*;
|
||||
//! # use bdk::wallet::coin_selection::decide_change;
|
||||
//! # use anyhow::Error;
|
||||
//! # const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
||||
//! #[derive(Debug)]
|
||||
//! struct AlwaysSpendEverything;
|
||||
@@ -38,12 +41,12 @@
|
||||
//! &self,
|
||||
//! required_utxos: Vec<WeightedUtxo>,
|
||||
//! optional_utxos: Vec<WeightedUtxo>,
|
||||
//! fee_rate: FeeRate,
|
||||
//! fee_rate: bdk::FeeRate,
|
||||
//! target_amount: u64,
|
||||
//! drain_script: &Script,
|
||||
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
||||
//! ) -> Result<CoinSelectionResult, coin_selection::Error> {
|
||||
//! let mut selected_amount = 0;
|
||||
//! let mut additional_weight = 0;
|
||||
//! let mut additional_weight = Weight::ZERO;
|
||||
//! let all_utxos_selected = required_utxos
|
||||
//! .into_iter()
|
||||
//! .chain(optional_utxos)
|
||||
@@ -51,7 +54,9 @@
|
||||
//! (&mut selected_amount, &mut additional_weight),
|
||||
//! |(selected_amount, additional_weight), weighted_utxo| {
|
||||
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
||||
//! **additional_weight += TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight;
|
||||
//! **additional_weight += Weight::from_wu(
|
||||
//! (TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||
//! );
|
||||
//! Some(weighted_utxo.utxo)
|
||||
//! },
|
||||
//! )
|
||||
@@ -59,7 +64,7 @@
|
||||
//! let additional_fees = fee_rate.fee_wu(additional_weight);
|
||||
//! let amount_needed_with_fees = additional_fees + target_amount;
|
||||
//! if selected_amount < amount_needed_with_fees {
|
||||
//! return Err(bdk::Error::InsufficientFunds {
|
||||
//! return Err(coin_selection::Error::InsufficientFunds {
|
||||
//! needed: amount_needed_with_fees,
|
||||
//! available: selected_amount,
|
||||
//! });
|
||||
@@ -80,8 +85,11 @@
|
||||
//! # let mut wallet = doctest_wallet!();
|
||||
//! // create wallet, sync, ...
|
||||
//!
|
||||
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
||||
//! let (psbt, details) = {
|
||||
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||
//! .unwrap()
|
||||
//! .require_network(Network::Testnet)
|
||||
//! .unwrap();
|
||||
//! let psbt = {
|
||||
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
||||
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
||||
//! builder.finish()?
|
||||
@@ -89,19 +97,20 @@
|
||||
//!
|
||||
//! // inspect, sign, broadcast, ...
|
||||
//!
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! # Ok::<(), anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::types::FeeRate;
|
||||
use crate::wallet::utils::IsDust;
|
||||
use crate::Utxo;
|
||||
use crate::WeightedUtxo;
|
||||
use crate::{error::Error, Utxo};
|
||||
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::consensus::encode::serialize;
|
||||
use bitcoin::Script;
|
||||
use bitcoin::{Script, Weight};
|
||||
|
||||
use core::convert::TryInto;
|
||||
use core::fmt::{self, Formatter};
|
||||
use rand::seq::SliceRandom;
|
||||
|
||||
/// Default coin selection algorithm used by [`TxBuilder`](super::tx_builder::TxBuilder) if not
|
||||
@@ -112,6 +121,43 @@ pub type DefaultCoinSelectionAlgorithm = BranchAndBoundCoinSelection;
|
||||
// prev_txid (32 bytes) + prev_vout (4 bytes) + sequence (4 bytes)
|
||||
pub(crate) const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
||||
|
||||
/// Errors that can be thrown by the [`coin_selection`](crate::wallet::coin_selection) module
|
||||
#[derive(Debug)]
|
||||
pub enum Error {
|
||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||
InsufficientFunds {
|
||||
/// Sats needed for some transaction
|
||||
needed: u64,
|
||||
/// Sats available for spending
|
||||
available: u64,
|
||||
},
|
||||
/// Branch and bound coin selection tries to avoid needing a change by finding the right inputs for
|
||||
/// the desired outputs plus fee, if there is not such combination this error is thrown
|
||||
BnBNoExactMatch,
|
||||
/// Branch and bound coin selection possible attempts with sufficiently big UTXO set could grow
|
||||
/// exponentially, thus a limit is set, and when hit, this error is thrown
|
||||
BnBTotalTriesExceeded,
|
||||
}
|
||||
|
||||
impl fmt::Display for Error {
|
||||
fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::InsufficientFunds { needed, available } => write!(
|
||||
f,
|
||||
"Insufficient funds: {} sat available of {} sat needed",
|
||||
available, needed
|
||||
),
|
||||
Self::BnBTotalTriesExceeded => {
|
||||
write!(f, "Branch and bound coin selection: total tries exceeded")
|
||||
}
|
||||
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for Error {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Remaining amount after performing coin selection
|
||||
pub enum Excess {
|
||||
@@ -208,12 +254,6 @@ impl CoinSelectionAlgorithm for LargestFirstCoinSelection {
|
||||
target_amount: u64,
|
||||
drain_script: &Script,
|
||||
) -> Result<CoinSelectionResult, Error> {
|
||||
log::debug!(
|
||||
"target_amount = `{}`, fee_rate = `{:?}`",
|
||||
target_amount,
|
||||
fee_rate
|
||||
);
|
||||
|
||||
// We put the "required UTXOs" first and make sure the optional UTXOs are sorted,
|
||||
// initially smallest to largest, before being reversed with `.rev()`.
|
||||
let utxos = {
|
||||
@@ -302,16 +342,10 @@ fn select_sorted_utxos(
|
||||
(&mut selected_amount, &mut fee_amount),
|
||||
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
||||
if must_use || **selected_amount < target_amount + **fee_amount {
|
||||
**fee_amount +=
|
||||
fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
||||
**fee_amount += fee_rate.fee_wu(Weight::from_wu(
|
||||
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||
));
|
||||
**selected_amount += weighted_utxo.utxo.txout().value;
|
||||
|
||||
log::debug!(
|
||||
"Selected {}, updated fee_amount = `{}`",
|
||||
weighted_utxo.utxo.outpoint(),
|
||||
fee_amount
|
||||
);
|
||||
|
||||
Some(weighted_utxo.utxo)
|
||||
} else {
|
||||
None
|
||||
@@ -351,7 +385,9 @@ struct OutputGroup {
|
||||
|
||||
impl OutputGroup {
|
||||
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
||||
let fee = fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
||||
let fee = fee_rate.fee_wu(Weight::from_wu(
|
||||
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||
));
|
||||
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
||||
OutputGroup {
|
||||
weighted_utxo,
|
||||
@@ -681,7 +717,7 @@ mod test {
|
||||
use core::str::FromStr;
|
||||
|
||||
use bdk_chain::ConfirmationTime;
|
||||
use bitcoin::{OutPoint, Script, TxOut};
|
||||
use bitcoin::{OutPoint, ScriptBuf, TxOut};
|
||||
|
||||
use super::*;
|
||||
use crate::types::*;
|
||||
@@ -706,11 +742,11 @@ mod test {
|
||||
.unwrap();
|
||||
WeightedUtxo {
|
||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||
utxo: Utxo::Local(LocalUtxo {
|
||||
utxo: Utxo::Local(LocalOutput {
|
||||
outpoint,
|
||||
txout: TxOut {
|
||||
value,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
keychain: KeychainKind::External,
|
||||
is_spent: false,
|
||||
@@ -766,14 +802,14 @@ mod test {
|
||||
for _ in 0..utxos_number {
|
||||
res.push(WeightedUtxo {
|
||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||
utxo: Utxo::Local(LocalUtxo {
|
||||
utxo: Utxo::Local(LocalOutput {
|
||||
outpoint: OutPoint::from_str(
|
||||
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:0",
|
||||
)
|
||||
.unwrap(),
|
||||
txout: TxOut {
|
||||
value: rng.gen_range(0..200000000),
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
keychain: KeychainKind::External,
|
||||
is_spent: false,
|
||||
@@ -795,14 +831,14 @@ mod test {
|
||||
fn generate_same_value_utxos(utxos_value: u64, utxos_number: usize) -> Vec<WeightedUtxo> {
|
||||
let utxo = WeightedUtxo {
|
||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||
utxo: Utxo::Local(LocalUtxo {
|
||||
utxo: Utxo::Local(LocalOutput {
|
||||
outpoint: OutPoint::from_str(
|
||||
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:0",
|
||||
)
|
||||
.unwrap(),
|
||||
txout: TxOut {
|
||||
value: utxos_value,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
keychain: KeychainKind::External,
|
||||
is_spent: false,
|
||||
@@ -825,10 +861,10 @@ mod test {
|
||||
#[test]
|
||||
fn test_largest_first_coin_selection_success() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 250_000 + FEE_AMOUNT;
|
||||
|
||||
let result = LargestFirstCoinSelection::default()
|
||||
let result = LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
utxos,
|
||||
vec![],
|
||||
@@ -846,10 +882,10 @@ mod test {
|
||||
#[test]
|
||||
fn test_largest_first_coin_selection_use_all() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = LargestFirstCoinSelection::default()
|
||||
let result = LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
utxos,
|
||||
vec![],
|
||||
@@ -867,10 +903,10 @@ mod test {
|
||||
#[test]
|
||||
fn test_largest_first_coin_selection_use_only_necessary() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = LargestFirstCoinSelection::default()
|
||||
let result = LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -889,10 +925,10 @@ mod test {
|
||||
#[should_panic(expected = "InsufficientFunds")]
|
||||
fn test_largest_first_coin_selection_insufficient_funds() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 500_000 + FEE_AMOUNT;
|
||||
|
||||
LargestFirstCoinSelection::default()
|
||||
LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -907,10 +943,10 @@ mod test {
|
||||
#[should_panic(expected = "InsufficientFunds")]
|
||||
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 250_000 + FEE_AMOUNT;
|
||||
|
||||
LargestFirstCoinSelection::default()
|
||||
LargestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -924,10 +960,10 @@ mod test {
|
||||
#[test]
|
||||
fn test_oldest_first_coin_selection_success() {
|
||||
let utxos = get_oldest_first_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 180_000 + FEE_AMOUNT;
|
||||
|
||||
let result = OldestFirstCoinSelection::default()
|
||||
let result = OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -945,10 +981,10 @@ mod test {
|
||||
#[test]
|
||||
fn test_oldest_first_coin_selection_use_all() {
|
||||
let utxos = get_oldest_first_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = OldestFirstCoinSelection::default()
|
||||
let result = OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
utxos,
|
||||
vec![],
|
||||
@@ -966,10 +1002,10 @@ mod test {
|
||||
#[test]
|
||||
fn test_oldest_first_coin_selection_use_only_necessary() {
|
||||
let utxos = get_oldest_first_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = OldestFirstCoinSelection::default()
|
||||
let result = OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -988,10 +1024,10 @@ mod test {
|
||||
#[should_panic(expected = "InsufficientFunds")]
|
||||
fn test_oldest_first_coin_selection_insufficient_funds() {
|
||||
let utxos = get_oldest_first_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 600_000 + FEE_AMOUNT;
|
||||
|
||||
OldestFirstCoinSelection::default()
|
||||
OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -1008,9 +1044,9 @@ mod test {
|
||||
let utxos = get_oldest_first_test_utxos();
|
||||
|
||||
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
OldestFirstCoinSelection::default()
|
||||
OldestFirstCoinSelection
|
||||
.coin_select(
|
||||
vec![],
|
||||
utxos,
|
||||
@@ -1027,7 +1063,7 @@ mod test {
|
||||
// select three outputs
|
||||
let utxos = generate_same_value_utxos(100_000, 20);
|
||||
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let target_amount = 250_000 + FEE_AMOUNT;
|
||||
|
||||
@@ -1049,7 +1085,7 @@ mod test {
|
||||
#[test]
|
||||
fn test_bnb_coin_selection_required_are_enough() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let result = BranchAndBoundCoinSelection::default()
|
||||
@@ -1070,7 +1106,7 @@ mod test {
|
||||
#[test]
|
||||
fn test_bnb_coin_selection_optional_are_enough() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 299756 + FEE_AMOUNT;
|
||||
|
||||
let result = BranchAndBoundCoinSelection::default()
|
||||
@@ -1106,7 +1142,7 @@ mod test {
|
||||
assert_eq!(amount, 100_000);
|
||||
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
||||
assert!(amount > 150_000);
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let target_amount = 150_000 + FEE_AMOUNT;
|
||||
|
||||
@@ -1129,7 +1165,7 @@ mod test {
|
||||
#[should_panic(expected = "InsufficientFunds")]
|
||||
fn test_bnb_coin_selection_insufficient_funds() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 500_000 + FEE_AMOUNT;
|
||||
|
||||
BranchAndBoundCoinSelection::default()
|
||||
@@ -1147,7 +1183,7 @@ mod test {
|
||||
#[should_panic(expected = "InsufficientFunds")]
|
||||
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 250_000 + FEE_AMOUNT;
|
||||
|
||||
BranchAndBoundCoinSelection::default()
|
||||
@@ -1164,7 +1200,7 @@ mod test {
|
||||
#[test]
|
||||
fn test_bnb_coin_selection_check_fee_rate() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 99932; // first utxo's effective value
|
||||
|
||||
let result = BranchAndBoundCoinSelection::new(0)
|
||||
@@ -1192,7 +1228,7 @@ mod test {
|
||||
for _i in 0..200 {
|
||||
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
||||
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let result = BranchAndBoundCoinSelection::new(0)
|
||||
.coin_select(
|
||||
vec![],
|
||||
@@ -1220,7 +1256,7 @@ mod test {
|
||||
let size_of_change = 31;
|
||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
BranchAndBoundCoinSelection::new(size_of_change)
|
||||
.bnb(
|
||||
@@ -1251,7 +1287,7 @@ mod test {
|
||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||
let target_amount = 20_000 + FEE_AMOUNT;
|
||||
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
BranchAndBoundCoinSelection::new(size_of_change)
|
||||
.bnb(
|
||||
@@ -1287,7 +1323,7 @@ mod test {
|
||||
// cost_of_change + 5.
|
||||
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
||||
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
||||
.bnb(
|
||||
@@ -1327,7 +1363,7 @@ mod test {
|
||||
let target_amount =
|
||||
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
||||
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let result = BranchAndBoundCoinSelection::new(0)
|
||||
.bnb(
|
||||
@@ -1358,7 +1394,7 @@ mod test {
|
||||
.map(|u| OutputGroup::new(u, fee_rate))
|
||||
.collect();
|
||||
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
||||
vec![],
|
||||
@@ -1376,7 +1412,7 @@ mod test {
|
||||
#[test]
|
||||
fn test_bnb_exclude_negative_effective_value() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||
vec![],
|
||||
@@ -1398,7 +1434,7 @@ mod test {
|
||||
#[test]
|
||||
fn test_bnb_include_negative_effective_value_when_required() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let (required, optional) = utxos
|
||||
.into_iter()
|
||||
@@ -1424,7 +1460,7 @@ mod test {
|
||||
#[test]
|
||||
fn test_bnb_sum_of_effective_value_negative() {
|
||||
let utxos = get_test_utxos();
|
||||
let drain_script = Script::default();
|
||||
let drain_script = ScriptBuf::default();
|
||||
|
||||
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||
utxos,
|
||||
|
||||
292
crates/bdk/src/wallet/error.rs
Normal file
292
crates/bdk/src/wallet/error.rs
Normal file
@@ -0,0 +1,292 @@
|
||||
// Bitcoin Dev Kit
|
||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||
//
|
||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||
//
|
||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||
// You may not use this file except in accordance with one or both of these
|
||||
// licenses.
|
||||
|
||||
//! Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||
|
||||
use crate::descriptor::policy::PolicyError;
|
||||
use crate::descriptor::DescriptorError;
|
||||
use crate::wallet::coin_selection;
|
||||
use crate::{descriptor, FeeRate, KeychainKind};
|
||||
use alloc::string::String;
|
||||
use bitcoin::{absolute, psbt, OutPoint, Sequence, Txid};
|
||||
use core::fmt;
|
||||
|
||||
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||
#[derive(Debug, Clone)]
|
||||
pub enum MiniscriptPsbtError {
|
||||
/// Descriptor key conversion error
|
||||
Conversion(miniscript::descriptor::ConversionError),
|
||||
/// Return error type for PsbtExt::update_input_with_descriptor
|
||||
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||
/// Return error type for PsbtExt::update_output_with_descriptor
|
||||
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||
}
|
||||
|
||||
impl fmt::Display for MiniscriptPsbtError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for MiniscriptPsbtError {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::finish`]
|
||||
///
|
||||
/// [`TxBuilder::finish`]: crate::wallet::tx_builder::TxBuilder::finish
|
||||
pub enum CreateTxError<P> {
|
||||
/// There was a problem with the descriptors passed in
|
||||
Descriptor(DescriptorError),
|
||||
/// We were unable to write wallet data to the persistence backend
|
||||
Persist(P),
|
||||
/// There was a problem while extracting and manipulating policies
|
||||
Policy(PolicyError),
|
||||
/// Spending policy is not compatible with this [`KeychainKind`]
|
||||
SpendingPolicyRequired(KeychainKind),
|
||||
/// Requested invalid transaction version '0'
|
||||
Version0,
|
||||
/// Requested transaction version `1`, but at least `2` is needed to use OP_CSV
|
||||
Version1Csv,
|
||||
/// Requested `LockTime` is less than is required to spend from this script
|
||||
LockTime {
|
||||
/// Requested `LockTime`
|
||||
requested: absolute::LockTime,
|
||||
/// Required `LockTime`
|
||||
required: absolute::LockTime,
|
||||
},
|
||||
/// Cannot enable RBF with a `Sequence` >= 0xFFFFFFFE
|
||||
RbfSequence,
|
||||
/// Cannot enable RBF with `Sequence` given a required OP_CSV
|
||||
RbfSequenceCsv {
|
||||
/// Given RBF `Sequence`
|
||||
rbf: Sequence,
|
||||
/// Required OP_CSV `Sequence`
|
||||
csv: Sequence,
|
||||
},
|
||||
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
||||
FeeTooLow {
|
||||
/// Required fee absolute value (satoshi)
|
||||
required: u64,
|
||||
},
|
||||
/// When bumping a tx the fee rate requested is lower than required
|
||||
FeeRateTooLow {
|
||||
/// Required fee rate (satoshi/vbyte)
|
||||
required: FeeRate,
|
||||
},
|
||||
/// `manually_selected_only` option is selected but no utxo has been passed
|
||||
NoUtxosSelected,
|
||||
/// Output created is under the dust limit, 546 satoshis
|
||||
OutputBelowDustLimit(usize),
|
||||
/// The `change_policy` was set but the wallet does not have a change_descriptor
|
||||
ChangePolicyDescriptor,
|
||||
/// There was an error with coin selection
|
||||
CoinSelection(coin_selection::Error),
|
||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||
InsufficientFunds {
|
||||
/// Sats needed for some transaction
|
||||
needed: u64,
|
||||
/// Sats available for spending
|
||||
available: u64,
|
||||
},
|
||||
/// Cannot build a tx without recipients
|
||||
NoRecipients,
|
||||
/// Partially signed bitcoin transaction error
|
||||
Psbt(psbt::Error),
|
||||
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
||||
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
||||
/// explicit origin provided
|
||||
///
|
||||
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
||||
MissingKeyOrigin(String),
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo,
|
||||
/// Missing non_witness_utxo on foreign utxo for given `OutPoint`
|
||||
MissingNonWitnessUtxo(OutPoint),
|
||||
/// Miniscript PSBT error
|
||||
MiniscriptPsbt(MiniscriptPsbtError),
|
||||
}
|
||||
|
||||
impl<P> fmt::Display for CreateTxError<P>
|
||||
where
|
||||
P: fmt::Display,
|
||||
{
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::Descriptor(e) => e.fmt(f),
|
||||
Self::Persist(e) => {
|
||||
write!(
|
||||
f,
|
||||
"failed to write wallet data to persistence backend: {}",
|
||||
e
|
||||
)
|
||||
}
|
||||
Self::Policy(e) => e.fmt(f),
|
||||
CreateTxError::SpendingPolicyRequired(keychain_kind) => {
|
||||
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||
}
|
||||
CreateTxError::Version0 => {
|
||||
write!(f, "Invalid version `0`")
|
||||
}
|
||||
CreateTxError::Version1Csv => {
|
||||
write!(
|
||||
f,
|
||||
"TxBuilder requested version `1`, but at least `2` is needed to use OP_CSV"
|
||||
)
|
||||
}
|
||||
CreateTxError::LockTime {
|
||||
requested,
|
||||
required,
|
||||
} => {
|
||||
write!(f, "TxBuilder requested timelock of `{:?}`, but at least `{:?}` is required to spend from this script", required, requested)
|
||||
}
|
||||
CreateTxError::RbfSequence => {
|
||||
write!(f, "Cannot enable RBF with a nSequence >= 0xFFFFFFFE")
|
||||
}
|
||||
CreateTxError::RbfSequenceCsv { rbf, csv } => {
|
||||
write!(
|
||||
f,
|
||||
"Cannot enable RBF with nSequence `{:?}` given a required OP_CSV of `{:?}`",
|
||||
rbf, csv
|
||||
)
|
||||
}
|
||||
CreateTxError::FeeTooLow { required } => {
|
||||
write!(f, "Fee to low: required {} sat", required)
|
||||
}
|
||||
CreateTxError::FeeRateTooLow { required } => {
|
||||
write!(
|
||||
f,
|
||||
"Fee rate too low: required {} sat/vbyte",
|
||||
required.as_sat_per_vb()
|
||||
)
|
||||
}
|
||||
CreateTxError::NoUtxosSelected => {
|
||||
write!(f, "No UTXO selected")
|
||||
}
|
||||
CreateTxError::OutputBelowDustLimit(limit) => {
|
||||
write!(f, "Output below the dust limit: {}", limit)
|
||||
}
|
||||
CreateTxError::ChangePolicyDescriptor => {
|
||||
write!(
|
||||
f,
|
||||
"The `change_policy` can be set only if the wallet has a change_descriptor"
|
||||
)
|
||||
}
|
||||
CreateTxError::CoinSelection(e) => e.fmt(f),
|
||||
CreateTxError::InsufficientFunds { needed, available } => {
|
||||
write!(
|
||||
f,
|
||||
"Insufficient funds: {} sat available of {} sat needed",
|
||||
available, needed
|
||||
)
|
||||
}
|
||||
CreateTxError::NoRecipients => {
|
||||
write!(f, "Cannot build tx without recipients")
|
||||
}
|
||||
CreateTxError::Psbt(e) => e.fmt(f),
|
||||
CreateTxError::MissingKeyOrigin(err) => {
|
||||
write!(f, "Missing key origin: {}", err)
|
||||
}
|
||||
CreateTxError::UnknownUtxo => {
|
||||
write!(f, "UTXO not found in the internal database")
|
||||
}
|
||||
CreateTxError::MissingNonWitnessUtxo(outpoint) => {
|
||||
write!(f, "Missing non_witness_utxo on foreign utxo {}", outpoint)
|
||||
}
|
||||
CreateTxError::MiniscriptPsbt(err) => {
|
||||
write!(f, "Miniscript PSBT error: {}", err)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<descriptor::error::Error> for CreateTxError<P> {
|
||||
fn from(err: descriptor::error::Error) -> Self {
|
||||
CreateTxError::Descriptor(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<PolicyError> for CreateTxError<P> {
|
||||
fn from(err: PolicyError) -> Self {
|
||||
CreateTxError::Policy(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<MiniscriptPsbtError> for CreateTxError<P> {
|
||||
fn from(err: MiniscriptPsbtError) -> Self {
|
||||
CreateTxError::MiniscriptPsbt(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<psbt::Error> for CreateTxError<P> {
|
||||
fn from(err: psbt::Error) -> Self {
|
||||
CreateTxError::Psbt(err)
|
||||
}
|
||||
}
|
||||
|
||||
impl<P> From<coin_selection::Error> for CreateTxError<P> {
|
||||
fn from(err: coin_selection::Error) -> Self {
|
||||
CreateTxError::CoinSelection(err)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl<P: core::fmt::Display + core::fmt::Debug> std::error::Error for CreateTxError<P> {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`Wallet::build_fee_bump`]
|
||||
///
|
||||
/// [`Wallet::build_fee_bump`]: super::Wallet::build_fee_bump
|
||||
pub enum BuildFeeBumpError {
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo(OutPoint),
|
||||
/// Thrown when a tx is not found in the internal database
|
||||
TransactionNotFound(Txid),
|
||||
/// Happens when trying to bump a transaction that is already confirmed
|
||||
TransactionConfirmed(Txid),
|
||||
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
||||
IrreplaceableTransaction(Txid),
|
||||
/// Node doesn't have data to estimate a fee rate
|
||||
FeeRateUnavailable,
|
||||
}
|
||||
|
||||
impl fmt::Display for BuildFeeBumpError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::UnknownUtxo(outpoint) => write!(
|
||||
f,
|
||||
"UTXO not found in the internal database with txid: {}, vout: {}",
|
||||
outpoint.txid, outpoint.vout
|
||||
),
|
||||
Self::TransactionNotFound(txid) => {
|
||||
write!(
|
||||
f,
|
||||
"Transaction not found in the internal database with txid: {}",
|
||||
txid
|
||||
)
|
||||
}
|
||||
Self::TransactionConfirmed(txid) => {
|
||||
write!(f, "Transaction already confirmed with txid: {}", txid)
|
||||
}
|
||||
Self::IrreplaceableTransaction(txid) => {
|
||||
write!(f, "Transaction can't be replaced with txid: {}", txid)
|
||||
}
|
||||
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for BuildFeeBumpError {}
|
||||
@@ -126,12 +126,11 @@ impl FullyNodedExport {
|
||||
Self::is_compatible_with_core(&descriptor)?;
|
||||
|
||||
let blockheight = if include_blockheight {
|
||||
wallet
|
||||
.transactions()
|
||||
.next()
|
||||
.map_or(0, |canonical_tx| match canonical_tx.observed_as {
|
||||
wallet.transactions().next().map_or(0, |canonical_tx| {
|
||||
match canonical_tx.chain_position {
|
||||
bdk_chain::ChainPosition::Confirmed(a) => a.confirmation_height,
|
||||
bdk_chain::ChainPosition::Unconfirmed(_) => 0,
|
||||
}
|
||||
})
|
||||
} else {
|
||||
0
|
||||
@@ -232,7 +231,7 @@ mod test {
|
||||
input: vec![],
|
||||
output: vec![],
|
||||
version: 0,
|
||||
lock_time: bitcoin::PackedLockTime::ZERO,
|
||||
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||
};
|
||||
wallet
|
||||
.insert_checkpoint(BlockId {
|
||||
|
||||
@@ -19,7 +19,7 @@
|
||||
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
||||
//! # use bdk::wallet::AddressIndex::New;
|
||||
//! # use bdk::{FeeRate, KeychainKind, SignOptions, Wallet};
|
||||
//! # use hwi::{types::HWIChain, HWIClient};
|
||||
//! # use hwi::HWIClient;
|
||||
//! # use std::sync::Arc;
|
||||
//! #
|
||||
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
@@ -28,7 +28,7 @@
|
||||
//! panic!("No devices found!");
|
||||
//! }
|
||||
//! let first_device = devices.remove(0)?;
|
||||
//! let custom_signer = HWISigner::from_device(&first_device, HWIChain::Test)?;
|
||||
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||
//!
|
||||
//! # let mut wallet = Wallet::new_no_persist(
|
||||
//! # "",
|
||||
@@ -47,9 +47,9 @@
|
||||
//! # }
|
||||
//! ```
|
||||
|
||||
use bitcoin::bip32::Fingerprint;
|
||||
use bitcoin::psbt::PartiallySignedTransaction;
|
||||
use bitcoin::secp256k1::{All, Secp256k1};
|
||||
use bitcoin::util::bip32::Fingerprint;
|
||||
|
||||
use hwi::error::Error;
|
||||
use hwi::types::{HWIChain, HWIDevice};
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -19,7 +19,7 @@
|
||||
//! # use core::str::FromStr;
|
||||
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
||||
//! # use bitcoin::*;
|
||||
//! # use bitcoin::util::psbt;
|
||||
//! # use bitcoin::psbt;
|
||||
//! # use bdk::signer::*;
|
||||
//! # use bdk::*;
|
||||
//! # #[derive(Debug)]
|
||||
@@ -76,7 +76,7 @@
|
||||
//! Arc::new(custom_signer)
|
||||
//! );
|
||||
//!
|
||||
//! # Ok::<_, bdk::Error>(())
|
||||
//! # Ok::<_, anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::collections::BTreeMap;
|
||||
@@ -86,24 +86,24 @@ use core::cmp::Ordering;
|
||||
use core::fmt;
|
||||
use core::ops::{Bound::Included, Deref};
|
||||
|
||||
use bitcoin::blockdata::opcodes;
|
||||
use bitcoin::blockdata::script::Builder as ScriptBuilder;
|
||||
use bitcoin::hashes::{hash160, Hash};
|
||||
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
||||
use bitcoin::hashes::hash160;
|
||||
use bitcoin::secp256k1::Message;
|
||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
||||
use bitcoin::util::{ecdsa, psbt, schnorr, sighash, taproot};
|
||||
use bitcoin::{secp256k1, XOnlyPublicKey};
|
||||
use bitcoin::{EcdsaSighashType, PrivateKey, PublicKey, SchnorrSighashType, Script};
|
||||
use bitcoin::sighash::{EcdsaSighashType, TapSighash, TapSighashType};
|
||||
use bitcoin::{ecdsa, psbt, sighash, taproot};
|
||||
use bitcoin::{key::TapTweak, key::XOnlyPublicKey, secp256k1};
|
||||
use bitcoin::{PrivateKey, PublicKey};
|
||||
|
||||
use miniscript::descriptor::{
|
||||
Descriptor, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey, KeyMap, SinglePriv,
|
||||
SinglePubKey,
|
||||
Descriptor, DescriptorMultiXKey, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey,
|
||||
InnerXKey, KeyMap, SinglePriv, SinglePubKey,
|
||||
};
|
||||
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
||||
|
||||
use super::utils::SecpCtx;
|
||||
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
||||
use crate::psbt::PsbtUtils;
|
||||
use crate::wallet::error::MiniscriptPsbtError;
|
||||
|
||||
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
||||
/// multiple of them
|
||||
@@ -130,7 +130,7 @@ impl From<Fingerprint> for SignerId {
|
||||
}
|
||||
|
||||
/// Signing error
|
||||
#[derive(Debug, PartialEq, Eq, Clone)]
|
||||
#[derive(Debug)]
|
||||
pub enum SignerError {
|
||||
/// The private key is missing for the required public key
|
||||
MissingKey,
|
||||
@@ -160,6 +160,8 @@ pub enum SignerError {
|
||||
InvalidSighash,
|
||||
/// Error while computing the hash to sign
|
||||
SighashError(sighash::Error),
|
||||
/// Miniscript PSBT error
|
||||
MiniscriptPsbt(MiniscriptPsbtError),
|
||||
/// Error while signing using hardware wallets
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
HWIError(hwi::error::Error),
|
||||
@@ -193,6 +195,7 @@ impl fmt::Display for SignerError {
|
||||
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
||||
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
||||
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
||||
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||
#[cfg(feature = "hardware-signer")]
|
||||
Self::HWIError(err) => write!(f, "Error while signing using hardware wallets: {}", err),
|
||||
}
|
||||
@@ -383,6 +386,48 @@ impl InputSigner for SignerWrapper<DescriptorXKey<ExtendedPrivKey>> {
|
||||
}
|
||||
}
|
||||
|
||||
fn multikey_to_xkeys<K: InnerXKey + Clone>(
|
||||
multikey: DescriptorMultiXKey<K>,
|
||||
) -> Vec<DescriptorXKey<K>> {
|
||||
multikey
|
||||
.derivation_paths
|
||||
.into_paths()
|
||||
.into_iter()
|
||||
.map(|derivation_path| DescriptorXKey {
|
||||
origin: multikey.origin.clone(),
|
||||
xkey: multikey.xkey.clone(),
|
||||
derivation_path,
|
||||
wildcard: multikey.wildcard,
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
impl SignerCommon for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||
SignerId::from(self.root_fingerprint(secp))
|
||||
}
|
||||
|
||||
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
||||
Some(DescriptorSecretKey::MultiXPrv(self.signer.clone()))
|
||||
}
|
||||
}
|
||||
|
||||
impl InputSigner for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||
fn sign_input(
|
||||
&self,
|
||||
psbt: &mut psbt::PartiallySignedTransaction,
|
||||
input_index: usize,
|
||||
sign_options: &SignOptions,
|
||||
secp: &SecpCtx,
|
||||
) -> Result<(), SignerError> {
|
||||
let xkeys = multikey_to_xkeys(self.signer.clone());
|
||||
for xkey in xkeys {
|
||||
SignerWrapper::new(xkey, self.ctx).sign_input(psbt, input_index, sign_options, secp)?
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
impl SignerCommon for SignerWrapper<PrivateKey> {
|
||||
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
||||
@@ -418,9 +463,11 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey.inner);
|
||||
|
||||
if let SignerContext::Tap { is_internal_key } = self.ctx {
|
||||
if let Some(psbt_internal_key) = psbt.inputs[input_index].tap_internal_key {
|
||||
if is_internal_key
|
||||
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
||||
&& sign_options.sign_with_tap_internal_key
|
||||
&& x_only_pubkey == psbt_internal_key
|
||||
{
|
||||
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
||||
sign_psbt_schnorr(
|
||||
@@ -433,6 +480,7 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
||||
secp,
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
if let Some((leaf_hashes, _)) =
|
||||
psbt.inputs[input_index].tap_key_origins.get(&x_only_pubkey)
|
||||
@@ -477,8 +525,16 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
||||
}
|
||||
|
||||
let (hash, hash_ty) = match self.ctx {
|
||||
SignerContext::Segwitv0 => Segwitv0::sighash(psbt, input_index, ())?,
|
||||
SignerContext::Legacy => Legacy::sighash(psbt, input_index, ())?,
|
||||
SignerContext::Segwitv0 => {
|
||||
let (h, t) = Segwitv0::sighash(psbt, input_index, ())?;
|
||||
let h = h.to_raw_hash();
|
||||
(h, t)
|
||||
}
|
||||
SignerContext::Legacy => {
|
||||
let (h, t) = Legacy::sighash(psbt, input_index, ())?;
|
||||
let h = h.to_raw_hash();
|
||||
(h, t)
|
||||
}
|
||||
_ => return Ok(()), // handled above
|
||||
};
|
||||
sign_psbt_ecdsa(
|
||||
@@ -499,12 +555,12 @@ fn sign_psbt_ecdsa(
|
||||
secret_key: &secp256k1::SecretKey,
|
||||
pubkey: PublicKey,
|
||||
psbt_input: &mut psbt::Input,
|
||||
hash: bitcoin::Sighash,
|
||||
hash: impl bitcoin::hashes::Hash + bitcoin::secp256k1::ThirtyTwoByteHash,
|
||||
hash_ty: EcdsaSighashType,
|
||||
secp: &SecpCtx,
|
||||
allow_grinding: bool,
|
||||
) {
|
||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
||||
let msg = &Message::from(hash);
|
||||
let sig = if allow_grinding {
|
||||
secp.sign_ecdsa_low_r(msg, secret_key)
|
||||
} else {
|
||||
@@ -513,7 +569,7 @@ fn sign_psbt_ecdsa(
|
||||
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
||||
.expect("invalid or corrupted ecdsa signature");
|
||||
|
||||
let final_signature = ecdsa::EcdsaSig { sig, hash_ty };
|
||||
let final_signature = ecdsa::Signature { sig, hash_ty };
|
||||
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
||||
}
|
||||
|
||||
@@ -523,12 +579,10 @@ fn sign_psbt_schnorr(
|
||||
pubkey: XOnlyPublicKey,
|
||||
leaf_hash: Option<taproot::TapLeafHash>,
|
||||
psbt_input: &mut psbt::Input,
|
||||
hash: taproot::TapSighashHash,
|
||||
hash_ty: SchnorrSighashType,
|
||||
hash: TapSighash,
|
||||
hash_ty: TapSighashType,
|
||||
secp: &SecpCtx,
|
||||
) {
|
||||
use schnorr::TapTweak;
|
||||
|
||||
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
||||
let keypair = match leaf_hash {
|
||||
None => keypair
|
||||
@@ -537,12 +591,12 @@ fn sign_psbt_schnorr(
|
||||
Some(_) => keypair, // no tweak for script spend
|
||||
};
|
||||
|
||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
||||
let msg = &Message::from(hash);
|
||||
let sig = secp.sign_schnorr(msg, &keypair);
|
||||
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
||||
.expect("invalid or corrupted schnorr signature");
|
||||
|
||||
let final_signature = schnorr::SchnorrSig { sig, hash_ty };
|
||||
let final_signature = taproot::Signature { sig, hash_ty };
|
||||
|
||||
if let Some(lh) = leaf_hash {
|
||||
psbt_input
|
||||
@@ -632,6 +686,11 @@ impl SignersContainer {
|
||||
SignerOrdering::default(),
|
||||
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||
),
|
||||
DescriptorSecretKey::MultiXPrv(xprv) => container.add_external(
|
||||
SignerId::from(xprv.root_fingerprint(secp)),
|
||||
SignerOrdering::default(),
|
||||
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||
),
|
||||
};
|
||||
}
|
||||
|
||||
@@ -699,7 +758,7 @@ pub struct SignOptions {
|
||||
/// Whether the signer should trust the `witness_utxo`, if the `non_witness_utxo` hasn't been
|
||||
/// provided
|
||||
///
|
||||
/// Defaults to `false` to mitigate the "SegWit bug" which chould trick the wallet into
|
||||
/// Defaults to `false` to mitigate the "SegWit bug" which should trick the wallet into
|
||||
/// paying a fee larger than expected.
|
||||
///
|
||||
/// Some wallets, especially if relatively old, might not provide the `non_witness_utxo` for
|
||||
@@ -802,7 +861,7 @@ pub(crate) trait ComputeSighash {
|
||||
|
||||
impl ComputeSighash for Legacy {
|
||||
type Extra = ();
|
||||
type Sighash = bitcoin::Sighash;
|
||||
type Sighash = sighash::LegacySighash;
|
||||
type SighashType = EcdsaSighashType;
|
||||
|
||||
fn sighash(
|
||||
@@ -849,19 +908,9 @@ impl ComputeSighash for Legacy {
|
||||
}
|
||||
}
|
||||
|
||||
fn p2wpkh_script_code(script: &Script) -> Script {
|
||||
ScriptBuilder::new()
|
||||
.push_opcode(opcodes::all::OP_DUP)
|
||||
.push_opcode(opcodes::all::OP_HASH160)
|
||||
.push_slice(&script[2..])
|
||||
.push_opcode(opcodes::all::OP_EQUALVERIFY)
|
||||
.push_opcode(opcodes::all::OP_CHECKSIG)
|
||||
.into_script()
|
||||
}
|
||||
|
||||
impl ComputeSighash for Segwitv0 {
|
||||
type Extra = ();
|
||||
type Sighash = bitcoin::Sighash;
|
||||
type Sighash = sighash::SegwitV0Sighash;
|
||||
type SighashType = EcdsaSighashType;
|
||||
|
||||
fn sighash(
|
||||
@@ -908,14 +957,21 @@ impl ComputeSighash for Segwitv0 {
|
||||
Some(ref witness_script) => witness_script.clone(),
|
||||
None => {
|
||||
if utxo.script_pubkey.is_v0_p2wpkh() {
|
||||
p2wpkh_script_code(&utxo.script_pubkey)
|
||||
utxo.script_pubkey
|
||||
.p2wpkh_script_code()
|
||||
.expect("We check above that the spk is a p2wpkh")
|
||||
} else if psbt_input
|
||||
.redeem_script
|
||||
.as_ref()
|
||||
.map(Script::is_v0_p2wpkh)
|
||||
.map(|s| s.is_v0_p2wpkh())
|
||||
.unwrap_or(false)
|
||||
{
|
||||
p2wpkh_script_code(psbt_input.redeem_script.as_ref().unwrap())
|
||||
psbt_input
|
||||
.redeem_script
|
||||
.as_ref()
|
||||
.unwrap()
|
||||
.p2wpkh_script_code()
|
||||
.expect("We check above that the spk is a p2wpkh")
|
||||
} else {
|
||||
return Err(SignerError::MissingWitnessScript);
|
||||
}
|
||||
@@ -936,14 +992,14 @@ impl ComputeSighash for Segwitv0 {
|
||||
|
||||
impl ComputeSighash for Tap {
|
||||
type Extra = Option<taproot::TapLeafHash>;
|
||||
type Sighash = taproot::TapSighashHash;
|
||||
type SighashType = SchnorrSighashType;
|
||||
type Sighash = TapSighash;
|
||||
type SighashType = TapSighashType;
|
||||
|
||||
fn sighash(
|
||||
psbt: &psbt::PartiallySignedTransaction,
|
||||
input_index: usize,
|
||||
extra: Self::Extra,
|
||||
) -> Result<(Self::Sighash, SchnorrSighashType), SignerError> {
|
||||
) -> Result<(Self::Sighash, TapSighashType), SignerError> {
|
||||
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
||||
return Err(SignerError::InputIndexOutOfRange);
|
||||
}
|
||||
@@ -952,8 +1008,8 @@ impl ComputeSighash for Tap {
|
||||
|
||||
let sighash_type = psbt_input
|
||||
.sighash_type
|
||||
.unwrap_or_else(|| SchnorrSighashType::Default.into())
|
||||
.schnorr_hash_ty()
|
||||
.unwrap_or_else(|| TapSighashType::Default.into())
|
||||
.taproot_hash_ty()
|
||||
.map_err(|_| SignerError::InvalidSighash)?;
|
||||
let witness_utxos = (0..psbt.inputs.len())
|
||||
.map(|i| psbt.get_utxo_for(i))
|
||||
@@ -1015,8 +1071,8 @@ mod signers_container_tests {
|
||||
use crate::descriptor::IntoWalletDescriptor;
|
||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||
use assert_matches::assert_matches;
|
||||
use bitcoin::bip32;
|
||||
use bitcoin::secp256k1::{All, Secp256k1};
|
||||
use bitcoin::util::bip32;
|
||||
use bitcoin::Network;
|
||||
use core::str::FromStr;
|
||||
use miniscript::ScriptContext;
|
||||
|
||||
@@ -17,8 +17,12 @@
|
||||
//! # use std::str::FromStr;
|
||||
//! # use bitcoin::*;
|
||||
//! # use bdk::*;
|
||||
//! # use bdk::wallet::ChangeSet;
|
||||
//! # use bdk::wallet::error::CreateTxError;
|
||||
//! # use bdk::wallet::tx_builder::CreateTx;
|
||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
||||
//! # use bdk_chain::PersistBackend;
|
||||
//! # use anyhow::Error;
|
||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||
//! # let mut wallet = doctest_wallet!();
|
||||
//! // create a TxBuilder from a wallet
|
||||
//! let mut tx_builder = wallet.build_tx();
|
||||
@@ -27,13 +31,13 @@
|
||||
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
||||
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
||||
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
||||
//! .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
||||
//! .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||
//! // Only spend non-change outputs
|
||||
//! .do_not_spend_change()
|
||||
//! // Turn on RBF signaling
|
||||
//! .enable_rbf();
|
||||
//! let (psbt, tx_details) = tx_builder.finish()?;
|
||||
//! # Ok::<(), bdk::Error>(())
|
||||
//! let psbt = tx_builder.finish()?;
|
||||
//! # Ok::<(), anyhow::Error>(())
|
||||
//! ```
|
||||
|
||||
use crate::collections::BTreeMap;
|
||||
@@ -41,18 +45,18 @@ use crate::collections::HashSet;
|
||||
use alloc::{boxed::Box, rc::Rc, string::String, vec::Vec};
|
||||
use bdk_chain::PersistBackend;
|
||||
use core::cell::RefCell;
|
||||
use core::fmt;
|
||||
use core::marker::PhantomData;
|
||||
|
||||
use bitcoin::util::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||
use bitcoin::{LockTime, OutPoint, Script, Sequence, Transaction};
|
||||
use bitcoin::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction, Txid};
|
||||
|
||||
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
||||
use super::ChangeSet;
|
||||
use crate::{
|
||||
types::{FeeRate, KeychainKind, LocalUtxo, WeightedUtxo},
|
||||
TransactionDetails,
|
||||
};
|
||||
use crate::{Error, Utxo, Wallet};
|
||||
use crate::types::{FeeRate, KeychainKind, LocalOutput, WeightedUtxo};
|
||||
use crate::wallet::CreateTxError;
|
||||
use crate::{Utxo, Wallet};
|
||||
|
||||
/// Context in which the [`TxBuilder`] is valid
|
||||
pub trait TxBuilderContext: core::fmt::Debug + Default + Clone {}
|
||||
|
||||
@@ -81,11 +85,15 @@ impl TxBuilderContext for BumpFee {}
|
||||
/// # use bdk::wallet::tx_builder::*;
|
||||
/// # use bitcoin::*;
|
||||
/// # use core::str::FromStr;
|
||||
/// # use bdk::wallet::ChangeSet;
|
||||
/// # use bdk::wallet::error::CreateTxError;
|
||||
/// # use bdk_chain::PersistBackend;
|
||||
/// # use anyhow::Error;
|
||||
/// # let mut wallet = doctest_wallet!();
|
||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||
/// # let addr2 = addr1.clone();
|
||||
/// // chaining
|
||||
/// let (psbt1, details) = {
|
||||
/// let psbt1 = {
|
||||
/// let mut builder = wallet.build_tx();
|
||||
/// builder
|
||||
/// .ordering(TxOrdering::Untouched)
|
||||
@@ -95,7 +103,7 @@ impl TxBuilderContext for BumpFee {}
|
||||
/// };
|
||||
///
|
||||
/// // non-chaining
|
||||
/// let (psbt2, details) = {
|
||||
/// let psbt2 = {
|
||||
/// let mut builder = wallet.build_tx();
|
||||
/// builder.ordering(TxOrdering::Untouched);
|
||||
/// for addr in &[addr1, addr2] {
|
||||
@@ -105,7 +113,7 @@ impl TxBuilderContext for BumpFee {}
|
||||
/// };
|
||||
///
|
||||
/// assert_eq!(psbt1.unsigned_tx.output[..2], psbt2.unsigned_tx.output[..2]);
|
||||
/// # Ok::<(), bdk::Error>(())
|
||||
/// # Ok::<(), anyhow::Error>(())
|
||||
/// ```
|
||||
///
|
||||
/// At the moment [`coin_selection`] is an exception to the rule as it consumes `self`.
|
||||
@@ -129,9 +137,9 @@ pub struct TxBuilder<'a, D, Cs, Ctx> {
|
||||
//TODO: TxParams should eventually be exposed publicly.
|
||||
#[derive(Default, Debug, Clone)]
|
||||
pub(crate) struct TxParams {
|
||||
pub(crate) recipients: Vec<(Script, u64)>,
|
||||
pub(crate) recipients: Vec<(ScriptBuf, u64)>,
|
||||
pub(crate) drain_wallet: bool,
|
||||
pub(crate) drain_to: Option<Script>,
|
||||
pub(crate) drain_to: Option<ScriptBuf>,
|
||||
pub(crate) fee_policy: Option<FeePolicy>,
|
||||
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||
@@ -140,7 +148,7 @@ pub(crate) struct TxParams {
|
||||
pub(crate) manually_selected_only: bool,
|
||||
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
||||
pub(crate) ordering: TxOrdering,
|
||||
pub(crate) locktime: Option<LockTime>,
|
||||
pub(crate) locktime: Option<absolute::LockTime>,
|
||||
pub(crate) rbf: Option<RbfValue>,
|
||||
pub(crate) version: Option<Version>,
|
||||
pub(crate) change_policy: ChangeSpendPolicy,
|
||||
@@ -148,7 +156,7 @@ pub(crate) struct TxParams {
|
||||
pub(crate) add_global_xpubs: bool,
|
||||
pub(crate) include_output_redeem_witness_script: bool,
|
||||
pub(crate) bumping_fee: Option<PreviousFee>,
|
||||
pub(crate) current_height: Option<LockTime>,
|
||||
pub(crate) current_height: Option<absolute::LockTime>,
|
||||
pub(crate) allow_dust: bool,
|
||||
}
|
||||
|
||||
@@ -184,6 +192,17 @@ impl<'a, D, Cs: Clone, Ctx> Clone for TxBuilder<'a, D, Cs, Ctx> {
|
||||
// methods supported by both contexts, for any CoinSelectionAlgorithm
|
||||
impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D, Cs, Ctx> {
|
||||
/// Set a custom fee rate
|
||||
/// The fee_rate method sets the mining fee paid by the transaction as a rate on its size.
|
||||
/// This means that the total fee paid is equal to this rate * size of the transaction in virtual Bytes (vB) or Weight Unit (wu).
|
||||
/// This rate is internally expressed in satoshis-per-virtual-bytes (sats/vB) using FeeRate::from_sat_per_vb, but can also be set by:
|
||||
/// * sats/kvB (1000 sats/kvB == 1 sats/vB) using FeeRate::from_sat_per_kvb
|
||||
/// * btc/kvB (0.00001000 btc/kvB == 1 sats/vB) using FeeRate::from_btc_per_kvb
|
||||
/// * sats/kwu (250 sats/kwu == 1 sats/vB) using FeeRate::from_sat_per_kwu
|
||||
/// Default is 1 sat/vB (see min_relay_fee)
|
||||
///
|
||||
/// Note that this is really a minimum feerate -- it's possible to
|
||||
/// overshoot it slightly since adding a change output to drain the remaining
|
||||
/// excess might not be viable.
|
||||
pub fn fee_rate(&mut self, fee_rate: FeeRate) -> &mut Self {
|
||||
self.params.fee_policy = Some(FeePolicy::FeeRate(fee_rate));
|
||||
self
|
||||
@@ -192,7 +211,12 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
/// Set an absolute fee
|
||||
/// The fee_absolute method refers to the absolute transaction fee in satoshis (sats).
|
||||
/// If anyone sets both the fee_absolute method and the fee_rate method,
|
||||
/// the fee_absolute value will take precedence over the fee_rate.
|
||||
/// the FeePolicy enum will be set by whichever method was called last,
|
||||
/// as the FeeRate and FeeAmount are mutually exclusive.
|
||||
///
|
||||
/// Note that this is really a minimum absolute fee -- it's possible to
|
||||
/// overshoot it slightly since adding a change output to drain the remaining
|
||||
/// excess might not be viable.
|
||||
pub fn fee_absolute(&mut self, fee_amount: u64) -> &mut Self {
|
||||
self.params.fee_policy = Some(FeePolicy::FeeAmount(fee_amount));
|
||||
self
|
||||
@@ -245,7 +269,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
/// # use std::collections::BTreeMap;
|
||||
/// # use bitcoin::*;
|
||||
/// # use bdk::*;
|
||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
||||
/// # let to_address =
|
||||
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||
/// .unwrap()
|
||||
/// .assume_checked();
|
||||
/// # let mut wallet = doctest_wallet!();
|
||||
/// let mut path = BTreeMap::new();
|
||||
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
||||
@@ -255,7 +282,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
/// .add_recipient(to_address.script_pubkey(), 50_000)
|
||||
/// .policy_path(path, KeychainKind::External);
|
||||
///
|
||||
/// # Ok::<(), bdk::Error>(())
|
||||
/// # Ok::<(), anyhow::Error>(())
|
||||
/// ```
|
||||
pub fn policy_path(
|
||||
&mut self,
|
||||
@@ -277,16 +304,21 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
///
|
||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, Error> {
|
||||
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, AddUtxoError> {
|
||||
{
|
||||
let wallet = self.wallet.borrow();
|
||||
let utxos = outpoints
|
||||
.iter()
|
||||
.map(|outpoint| wallet.get_utxo(*outpoint).ok_or(Error::UnknownUtxo))
|
||||
.map(|outpoint| {
|
||||
wallet
|
||||
.get_utxo(*outpoint)
|
||||
.ok_or(AddUtxoError::UnknownUtxo(*outpoint))
|
||||
})
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
for utxo in utxos {
|
||||
let descriptor = wallet.get_descriptor_for_keychain(utxo.keychain);
|
||||
#[allow(deprecated)]
|
||||
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
||||
self.params.utxos.push(WeightedUtxo {
|
||||
satisfaction_weight,
|
||||
@@ -302,7 +334,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
///
|
||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, Error> {
|
||||
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, AddUtxoError> {
|
||||
self.add_utxos(&[outpoint])
|
||||
}
|
||||
|
||||
@@ -334,6 +366,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
///
|
||||
/// This is an **EXPERIMENTAL** feature, API and other major changes are expected.
|
||||
///
|
||||
/// In order to use [`Wallet::calculate_fee`] or [`Wallet::calculate_fee_rate`] for a transaction
|
||||
/// created with foreign UTXO(s) you must manually insert the corresponding TxOut(s) into the tx
|
||||
/// graph using the [`Wallet::insert_txout`] function.
|
||||
///
|
||||
/// # Errors
|
||||
///
|
||||
/// This method returns errors in the following circumstances:
|
||||
@@ -353,23 +389,22 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
outpoint: OutPoint,
|
||||
psbt_input: psbt::Input,
|
||||
satisfaction_weight: usize,
|
||||
) -> Result<&mut Self, Error> {
|
||||
) -> Result<&mut Self, AddForeignUtxoError> {
|
||||
if psbt_input.witness_utxo.is_none() {
|
||||
match psbt_input.non_witness_utxo.as_ref() {
|
||||
Some(tx) => {
|
||||
if tx.txid() != outpoint.txid {
|
||||
return Err(Error::Generic(
|
||||
"Foreign utxo outpoint does not match PSBT input".into(),
|
||||
));
|
||||
return Err(AddForeignUtxoError::InvalidTxid {
|
||||
input_txid: tx.txid(),
|
||||
foreign_utxo: outpoint,
|
||||
});
|
||||
}
|
||||
if tx.output.len() <= outpoint.vout as usize {
|
||||
return Err(Error::InvalidOutpoint(outpoint));
|
||||
return Err(AddForeignUtxoError::InvalidOutpoint(outpoint));
|
||||
}
|
||||
}
|
||||
None => {
|
||||
return Err(Error::Generic(
|
||||
"Foreign utxo missing witness_utxo or non_witness_utxo".into(),
|
||||
))
|
||||
return Err(AddForeignUtxoError::MissingUtxo);
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -431,7 +466,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
/// Use a specific nLockTime while creating the transaction
|
||||
///
|
||||
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
||||
pub fn nlocktime(&mut self, locktime: LockTime) -> &mut Self {
|
||||
pub fn nlocktime(&mut self, locktime: absolute::LockTime) -> &mut Self {
|
||||
self.params.locktime = Some(locktime);
|
||||
self
|
||||
}
|
||||
@@ -470,7 +505,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
self
|
||||
}
|
||||
|
||||
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::util::psbt::Input::witness_utxo) field when spending from
|
||||
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::psbt::Input::witness_utxo) field when spending from
|
||||
/// SegWit descriptors.
|
||||
///
|
||||
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
||||
@@ -480,8 +515,8 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
self
|
||||
}
|
||||
|
||||
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::util::psbt::Output::redeem_script) and
|
||||
/// [`psbt::Output::witness_script`](bitcoin::util::psbt::Output::witness_script) fields.
|
||||
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::psbt::Output::redeem_script) and
|
||||
/// [`psbt::Output::witness_script`](bitcoin::psbt::Output::witness_script) fields.
|
||||
///
|
||||
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
||||
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
||||
@@ -507,7 +542,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
|
||||
/// Choose the coin selection algorithm
|
||||
///
|
||||
/// Overrides the [`DefaultCoinSelectionAlgorithm`](super::coin_selection::DefaultCoinSelectionAlgorithm).
|
||||
/// Overrides the [`DefaultCoinSelectionAlgorithm`].
|
||||
///
|
||||
/// Note that this function consumes the builder and returns it so it is usually best to put this as the first call on the builder.
|
||||
pub fn coin_selection<P: CoinSelectionAlgorithm>(
|
||||
@@ -524,10 +559,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
|
||||
/// Finish building the transaction.
|
||||
///
|
||||
/// Returns the [`BIP174`] "PSBT" and summary details about the transaction.
|
||||
/// Returns a new [`Psbt`] per [`BIP174`].
|
||||
///
|
||||
/// [`BIP174`]: https://github.com/bitcoin/bips/blob/master/bip-0174.mediawiki
|
||||
pub fn finish(self) -> Result<(Psbt, TransactionDetails), Error>
|
||||
pub fn finish(self) -> Result<Psbt, CreateTxError<D::WriteError>>
|
||||
where
|
||||
D: PersistBackend<ChangeSet>,
|
||||
{
|
||||
@@ -568,7 +603,8 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
///
|
||||
/// In both cases, if you don't provide a current height, we use the last sync height.
|
||||
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
||||
self.params.current_height = Some(LockTime::from_height(height).expect("Invalid height"));
|
||||
self.params.current_height =
|
||||
Some(absolute::LockTime::from_height(height).expect("Invalid height"));
|
||||
self
|
||||
}
|
||||
|
||||
@@ -581,22 +617,106 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::add_utxo`] and [`TxBuilder::add_utxos`]
|
||||
pub enum AddUtxoError {
|
||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||
UnknownUtxo(OutPoint),
|
||||
}
|
||||
|
||||
impl fmt::Display for AddUtxoError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::UnknownUtxo(outpoint) => write!(
|
||||
f,
|
||||
"UTXO not found in the internal database for txid: {} with vout: {}",
|
||||
outpoint.txid, outpoint.vout
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AddUtxoError {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::add_foreign_utxo`].
|
||||
pub enum AddForeignUtxoError {
|
||||
/// Foreign utxo outpoint txid does not match PSBT input txid
|
||||
InvalidTxid {
|
||||
/// PSBT input txid
|
||||
input_txid: Txid,
|
||||
/// Foreign UTXO outpoint
|
||||
foreign_utxo: OutPoint,
|
||||
},
|
||||
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
||||
InvalidOutpoint(OutPoint),
|
||||
/// Foreign utxo missing witness_utxo or non_witness_utxo
|
||||
MissingUtxo,
|
||||
}
|
||||
|
||||
impl fmt::Display for AddForeignUtxoError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::InvalidTxid {
|
||||
input_txid,
|
||||
foreign_utxo,
|
||||
} => write!(
|
||||
f,
|
||||
"Foreign UTXO outpoint txid: {} does not match PSBT input txid: {}",
|
||||
foreign_utxo.txid, input_txid,
|
||||
),
|
||||
Self::InvalidOutpoint(outpoint) => write!(
|
||||
f,
|
||||
"Requested outpoint doesn't exist for txid: {} with vout: {}",
|
||||
outpoint.txid, outpoint.vout,
|
||||
),
|
||||
Self::MissingUtxo => write!(f, "Foreign utxo missing witness_utxo or non_witness_utxo"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AddForeignUtxoError {}
|
||||
|
||||
#[derive(Debug)]
|
||||
/// Error returned from [`TxBuilder::allow_shrinking`]
|
||||
pub enum AllowShrinkingError {
|
||||
/// Script/PubKey was not in the original transaction
|
||||
MissingScriptPubKey(ScriptBuf),
|
||||
}
|
||||
|
||||
impl fmt::Display for AllowShrinkingError {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
Self::MissingScriptPubKey(script_buf) => write!(
|
||||
f,
|
||||
"Script/PubKey was not in the original transaction: {}",
|
||||
script_buf,
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AllowShrinkingError {}
|
||||
|
||||
impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||
/// Replace the recipients already added with a new list
|
||||
pub fn set_recipients(&mut self, recipients: Vec<(Script, u64)>) -> &mut Self {
|
||||
pub fn set_recipients(&mut self, recipients: Vec<(ScriptBuf, u64)>) -> &mut Self {
|
||||
self.params.recipients = recipients;
|
||||
self
|
||||
}
|
||||
|
||||
/// Add a recipient to the internal list
|
||||
pub fn add_recipient(&mut self, script_pubkey: Script, amount: u64) -> &mut Self {
|
||||
pub fn add_recipient(&mut self, script_pubkey: ScriptBuf, amount: u64) -> &mut Self {
|
||||
self.params.recipients.push((script_pubkey, amount));
|
||||
self
|
||||
}
|
||||
|
||||
/// Add data as an output, using OP_RETURN
|
||||
pub fn add_data(&mut self, data: &[u8]) -> &mut Self {
|
||||
let script = Script::new_op_return(data);
|
||||
pub fn add_data<T: AsRef<PushBytes>>(&mut self, data: &T) -> &mut Self {
|
||||
let script = ScriptBuf::new_op_return(data);
|
||||
self.add_recipient(script, 0u64);
|
||||
self
|
||||
}
|
||||
@@ -625,8 +745,15 @@ impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||
/// # use std::str::FromStr;
|
||||
/// # use bitcoin::*;
|
||||
/// # use bdk::*;
|
||||
/// # use bdk::wallet::ChangeSet;
|
||||
/// # use bdk::wallet::error::CreateTxError;
|
||||
/// # use bdk::wallet::tx_builder::CreateTx;
|
||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
||||
/// # use bdk_chain::PersistBackend;
|
||||
/// # use anyhow::Error;
|
||||
/// # let to_address =
|
||||
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||
/// .unwrap()
|
||||
/// .assume_checked();
|
||||
/// # let mut wallet = doctest_wallet!();
|
||||
/// let mut tx_builder = wallet.build_tx();
|
||||
///
|
||||
@@ -635,17 +762,17 @@ impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||
/// .drain_wallet()
|
||||
/// // Send the excess (which is all the coins minus the fee) to this address.
|
||||
/// .drain_to(to_address.script_pubkey())
|
||||
/// .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
||||
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||
/// .enable_rbf();
|
||||
/// let (psbt, tx_details) = tx_builder.finish()?;
|
||||
/// # Ok::<(), bdk::Error>(())
|
||||
/// let psbt = tx_builder.finish()?;
|
||||
/// # Ok::<(), anyhow::Error>(())
|
||||
/// ```
|
||||
///
|
||||
/// [`allow_shrinking`]: Self::allow_shrinking
|
||||
/// [`add_recipient`]: Self::add_recipient
|
||||
/// [`add_utxos`]: Self::add_utxos
|
||||
/// [`drain_wallet`]: Self::drain_wallet
|
||||
pub fn drain_to(&mut self, script_pubkey: Script) -> &mut Self {
|
||||
pub fn drain_to(&mut self, script_pubkey: ScriptBuf) -> &mut Self {
|
||||
self.params.drain_to = Some(script_pubkey);
|
||||
self
|
||||
}
|
||||
@@ -663,7 +790,10 @@ impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
||||
///
|
||||
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
||||
/// transaction we are bumping.
|
||||
pub fn allow_shrinking(&mut self, script_pubkey: Script) -> Result<&mut Self, Error> {
|
||||
pub fn allow_shrinking(
|
||||
&mut self,
|
||||
script_pubkey: ScriptBuf,
|
||||
) -> Result<&mut Self, AllowShrinkingError> {
|
||||
match self
|
||||
.params
|
||||
.recipients
|
||||
@@ -675,10 +805,7 @@ impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
||||
self.params.drain_to = Some(script_pubkey);
|
||||
Ok(self)
|
||||
}
|
||||
None => Err(Error::Generic(format!(
|
||||
"{} was not in the original transaction",
|
||||
script_pubkey
|
||||
))),
|
||||
None => Err(AllowShrinkingError::MissingScriptPubKey(script_pubkey)),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -770,7 +897,7 @@ impl Default for ChangeSpendPolicy {
|
||||
}
|
||||
|
||||
impl ChangeSpendPolicy {
|
||||
pub(crate) fn is_satisfied_by(&self, utxo: &LocalUtxo) -> bool {
|
||||
pub(crate) fn is_satisfied_by(&self, utxo: &LocalOutput) -> bool {
|
||||
match self {
|
||||
ChangeSpendPolicy::ChangeAllowed => true,
|
||||
ChangeSpendPolicy::OnlyChange => utxo.keychain == KeychainKind::Internal,
|
||||
@@ -868,17 +995,20 @@ mod test {
|
||||
);
|
||||
|
||||
assert_eq!(tx.output[0].value, 800);
|
||||
assert_eq!(tx.output[1].script_pubkey, From::from(vec![0xAA]));
|
||||
assert_eq!(tx.output[2].script_pubkey, From::from(vec![0xAA, 0xEE]));
|
||||
assert_eq!(tx.output[1].script_pubkey, ScriptBuf::from(vec![0xAA]));
|
||||
assert_eq!(
|
||||
tx.output[2].script_pubkey,
|
||||
ScriptBuf::from(vec![0xAA, 0xEE])
|
||||
);
|
||||
}
|
||||
|
||||
fn get_test_utxos() -> Vec<LocalUtxo> {
|
||||
fn get_test_utxos() -> Vec<LocalOutput> {
|
||||
use bitcoin::hashes::Hash;
|
||||
|
||||
vec![
|
||||
LocalUtxo {
|
||||
LocalOutput {
|
||||
outpoint: OutPoint {
|
||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
||||
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||
vout: 0,
|
||||
},
|
||||
txout: Default::default(),
|
||||
@@ -887,9 +1017,9 @@ mod test {
|
||||
confirmation_time: ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||
derivation_index: 0,
|
||||
},
|
||||
LocalUtxo {
|
||||
LocalOutput {
|
||||
outpoint: OutPoint {
|
||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
||||
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||
vout: 1,
|
||||
},
|
||||
txout: Default::default(),
|
||||
|
||||
@@ -10,7 +10,7 @@
|
||||
// licenses.
|
||||
|
||||
use bitcoin::secp256k1::{All, Secp256k1};
|
||||
use bitcoin::{LockTime, Script, Sequence};
|
||||
use bitcoin::{absolute, Script, Sequence};
|
||||
|
||||
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
||||
|
||||
@@ -65,7 +65,7 @@ pub(crate) fn check_nsequence_rbf(rbf: Sequence, csv: Sequence) -> bool {
|
||||
}
|
||||
|
||||
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
||||
fn check_after(&self, n: LockTime) -> bool {
|
||||
fn check_after(&self, n: absolute::LockTime) -> bool {
|
||||
if let Some(current_height) = self.current_height {
|
||||
current_height >= n.to_consensus_u32()
|
||||
} else {
|
||||
@@ -119,12 +119,14 @@ mod test {
|
||||
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
||||
|
||||
use super::{check_nsequence_rbf, IsDust};
|
||||
use crate::bitcoin::{Address, Sequence};
|
||||
use crate::bitcoin::{Address, Network, Sequence};
|
||||
use core::str::FromStr;
|
||||
|
||||
#[test]
|
||||
fn test_is_dust() {
|
||||
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
||||
.unwrap()
|
||||
.require_network(Network::Bitcoin)
|
||||
.unwrap()
|
||||
.script_pubkey();
|
||||
assert!(script_p2pkh.is_p2pkh());
|
||||
@@ -132,6 +134,8 @@ mod test {
|
||||
assert!(!546.is_dust(&script_p2pkh));
|
||||
|
||||
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
||||
.unwrap()
|
||||
.require_network(Network::Bitcoin)
|
||||
.unwrap()
|
||||
.script_pubkey();
|
||||
assert!(script_p2wpkh.is_v0_p2wpkh());
|
||||
|
||||
@@ -1,25 +1,68 @@
|
||||
#![allow(unused)]
|
||||
use bdk::{wallet::AddressIndex, Wallet};
|
||||
|
||||
use bdk::{wallet::AddressIndex, KeychainKind, LocalOutput, Wallet};
|
||||
use bdk_chain::indexed_tx_graph::Indexer;
|
||||
use bdk_chain::{BlockId, ConfirmationTime};
|
||||
use bitcoin::hashes::Hash;
|
||||
use bitcoin::{BlockHash, Network, Transaction, TxOut};
|
||||
use bitcoin::{Address, BlockHash, Network, OutPoint, Transaction, TxIn, TxOut, Txid};
|
||||
use std::str::FromStr;
|
||||
|
||||
/// Return a fake wallet that appears to be funded for testing.
|
||||
// Return a fake wallet that appears to be funded for testing.
|
||||
//
|
||||
// The funded wallet containing a tx with a 76_000 sats input and two outputs, one spending 25_000
|
||||
// to a foreign address and one returning 50_000 back to the wallet as change. The remaining 1000
|
||||
// sats are the transaction fee.
|
||||
pub fn get_funded_wallet_with_change(
|
||||
descriptor: &str,
|
||||
change: Option<&str>,
|
||||
) -> (Wallet, bitcoin::Txid) {
|
||||
let mut wallet = Wallet::new_no_persist(descriptor, change, Network::Regtest).unwrap();
|
||||
let address = wallet.get_address(AddressIndex::New).address;
|
||||
let change_address = wallet.get_address(AddressIndex::New).address;
|
||||
let sendto_address = Address::from_str("bcrt1q3qtze4ys45tgdvguj66zrk4fu6hq3a3v9pfly5")
|
||||
.expect("address")
|
||||
.require_network(Network::Regtest)
|
||||
.unwrap();
|
||||
|
||||
let tx = Transaction {
|
||||
let tx0 = Transaction {
|
||||
version: 1,
|
||||
lock_time: bitcoin::PackedLockTime(0),
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 50_000,
|
||||
script_pubkey: address.script_pubkey(),
|
||||
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: Txid::all_zeros(),
|
||||
vout: 0,
|
||||
},
|
||||
script_sig: Default::default(),
|
||||
sequence: Default::default(),
|
||||
witness: Default::default(),
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 76_000,
|
||||
script_pubkey: change_address.script_pubkey(),
|
||||
}],
|
||||
};
|
||||
|
||||
let tx1 = Transaction {
|
||||
version: 1,
|
||||
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: tx0.txid(),
|
||||
vout: 0,
|
||||
},
|
||||
script_sig: Default::default(),
|
||||
sequence: Default::default(),
|
||||
witness: Default::default(),
|
||||
}],
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 50_000,
|
||||
script_pubkey: change_address.script_pubkey(),
|
||||
},
|
||||
TxOut {
|
||||
value: 25_000,
|
||||
script_pubkey: sendto_address.script_pubkey(),
|
||||
},
|
||||
],
|
||||
};
|
||||
|
||||
wallet
|
||||
@@ -28,19 +71,39 @@ pub fn get_funded_wallet_with_change(
|
||||
hash: BlockHash::all_zeros(),
|
||||
})
|
||||
.unwrap();
|
||||
wallet
|
||||
.insert_checkpoint(BlockId {
|
||||
height: 2_000,
|
||||
hash: BlockHash::all_zeros(),
|
||||
})
|
||||
.unwrap();
|
||||
wallet
|
||||
.insert_tx(
|
||||
tx.clone(),
|
||||
tx0,
|
||||
ConfirmationTime::Confirmed {
|
||||
height: 1_000,
|
||||
time: 100,
|
||||
},
|
||||
)
|
||||
.unwrap();
|
||||
wallet
|
||||
.insert_tx(
|
||||
tx1.clone(),
|
||||
ConfirmationTime::Confirmed {
|
||||
height: 2_000,
|
||||
time: 200,
|
||||
},
|
||||
)
|
||||
.unwrap();
|
||||
|
||||
(wallet, tx.txid())
|
||||
(wallet, tx1.txid())
|
||||
}
|
||||
|
||||
// Return a fake wallet that appears to be funded for testing.
|
||||
//
|
||||
// The funded wallet containing a tx with a 76_000 sats input and two outputs, one spending 25_000
|
||||
// to a foreign address and one returning 50_000 back to the wallet as change. The remaining 1000
|
||||
// sats are the transaction fee.
|
||||
pub fn get_funded_wallet(descriptor: &str) -> (Wallet, bitcoin::Txid) {
|
||||
get_funded_wallet_with_change(descriptor, None)
|
||||
}
|
||||
|
||||
@@ -2,7 +2,7 @@ use bdk::bitcoin::TxIn;
|
||||
use bdk::wallet::AddressIndex;
|
||||
use bdk::wallet::AddressIndex::New;
|
||||
use bdk::{psbt, FeeRate, SignOptions};
|
||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
||||
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||
use core::str::FromStr;
|
||||
mod common;
|
||||
use common::*;
|
||||
@@ -18,7 +18,7 @@ fn test_psbt_malformed_psbt_input_legacy() {
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||
let options = SignOptions {
|
||||
trust_witness_utxo: true,
|
||||
@@ -35,7 +35,7 @@ fn test_psbt_malformed_psbt_input_segwit() {
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
psbt.inputs.push(psbt_bip.inputs[1].clone());
|
||||
let options = SignOptions {
|
||||
trust_witness_utxo: true,
|
||||
@@ -51,7 +51,7 @@ fn test_psbt_malformed_tx_input() {
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
psbt.unsigned_tx.input.push(TxIn::default());
|
||||
let options = SignOptions {
|
||||
trust_witness_utxo: true,
|
||||
@@ -67,7 +67,7 @@ fn test_psbt_sign_with_finalized() {
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
|
||||
// add a finalized input
|
||||
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||
@@ -89,7 +89,7 @@ fn test_psbt_fee_rate_with_witness_utxo() {
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
let fee_amount = psbt.fee_amount();
|
||||
assert!(fee_amount.is_some());
|
||||
|
||||
@@ -114,7 +114,7 @@ fn test_psbt_fee_rate_with_nonwitness_utxo() {
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut psbt, _) = builder.finish().unwrap();
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
let fee_amount = psbt.fee_amount();
|
||||
assert!(fee_amount.is_some());
|
||||
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||
@@ -138,7 +138,7 @@ fn test_psbt_fee_rate_with_missing_txout() {
|
||||
let mut builder = wpkh_wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut wpkh_psbt, _) = builder.finish().unwrap();
|
||||
let mut wpkh_psbt = builder.finish().unwrap();
|
||||
|
||||
wpkh_psbt.inputs[0].witness_utxo = None;
|
||||
wpkh_psbt.inputs[0].non_witness_utxo = None;
|
||||
@@ -150,9 +150,43 @@ fn test_psbt_fee_rate_with_missing_txout() {
|
||||
let mut builder = pkh_wallet.build_tx();
|
||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||
let (mut pkh_psbt, _) = builder.finish().unwrap();
|
||||
let mut pkh_psbt = builder.finish().unwrap();
|
||||
|
||||
pkh_psbt.inputs[0].non_witness_utxo = None;
|
||||
assert!(pkh_psbt.fee_amount().is_none());
|
||||
assert!(pkh_psbt.fee_rate().is_none());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_psbt_multiple_internalkey_signers() {
|
||||
use bdk::signer::{SignerContext, SignerOrdering, SignerWrapper};
|
||||
use bdk::KeychainKind;
|
||||
use bitcoin::{secp256k1::Secp256k1, PrivateKey};
|
||||
use miniscript::psbt::PsbtExt;
|
||||
use std::sync::Arc;
|
||||
|
||||
let secp = Secp256k1::new();
|
||||
let (mut wallet, _) = get_funded_wallet(get_test_tr_single_sig());
|
||||
let send_to = wallet.get_address(AddressIndex::New);
|
||||
let mut builder = wallet.build_tx();
|
||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||
let mut psbt = builder.finish().unwrap();
|
||||
// Adds a signer for the wrong internal key, bdk should not use this key to sign
|
||||
wallet.add_signer(
|
||||
KeychainKind::External,
|
||||
// A signerordering lower than 100, bdk will use this signer first
|
||||
SignerOrdering(0),
|
||||
Arc::new(SignerWrapper::new(
|
||||
PrivateKey::from_wif("5J5PZqvCe1uThJ3FZeUUFLCh2FuK9pZhtEK4MzhNmugqTmxCdwE").unwrap(),
|
||||
SignerContext::Tap {
|
||||
is_internal_key: true,
|
||||
},
|
||||
)),
|
||||
);
|
||||
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||
// Checks that we signed using the right key
|
||||
assert!(
|
||||
psbt.finalize_mut(&secp).is_ok(),
|
||||
"The wrong internal key was used"
|
||||
);
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
28
crates/bitcoind_rpc/Cargo.toml
Normal file
28
crates/bitcoind_rpc/Cargo.toml
Normal file
@@ -0,0 +1,28 @@
|
||||
[package]
|
||||
name = "bdk_bitcoind_rpc"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
documentation = "https://docs.rs/bdk_bitcoind_rpc"
|
||||
description = "This crate is used for emitting blockchain data from the `bitcoind` RPC interface."
|
||||
license = "MIT OR Apache-2.0"
|
||||
readme = "README.md"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
# For no-std, remember to enable the bitcoin/no-std feature
|
||||
bitcoin = { version = "0.30", default-features = false }
|
||||
bitcoincore-rpc = { version = "0.17" }
|
||||
bdk_chain = { path = "../chain", version = "0.6", default-features = false }
|
||||
|
||||
[dev-dependencies]
|
||||
bitcoind = { version = "0.33", features = ["25_0"] }
|
||||
anyhow = { version = "1" }
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = ["bitcoin/std", "bdk_chain/std"]
|
||||
serde = ["bitcoin/serde", "bdk_chain/serde"]
|
||||
3
crates/bitcoind_rpc/README.md
Normal file
3
crates/bitcoind_rpc/README.md
Normal file
@@ -0,0 +1,3 @@
|
||||
# BDK Bitcoind RPC
|
||||
|
||||
This crate is used for emitting blockchain data from the `bitcoind` RPC interface.
|
||||
280
crates/bitcoind_rpc/src/lib.rs
Normal file
280
crates/bitcoind_rpc/src/lib.rs
Normal file
@@ -0,0 +1,280 @@
|
||||
//! This crate is used for emitting blockchain data from the `bitcoind` RPC interface. It does not
|
||||
//! use the wallet RPC API, so this crate can be used with wallet-disabled Bitcoin Core nodes.
|
||||
//!
|
||||
//! [`Emitter`] is the main structure which sources blockchain data from [`bitcoincore_rpc::Client`].
|
||||
//!
|
||||
//! To only get block updates (exclude mempool transactions), the caller can use
|
||||
//! [`Emitter::next_block`] or/and [`Emitter::next_header`] until it returns `Ok(None)` (which means
|
||||
//! the chain tip is reached). A separate method, [`Emitter::mempool`] can be used to emit the whole
|
||||
//! mempool.
|
||||
#![warn(missing_docs)]
|
||||
|
||||
use bdk_chain::{local_chain::CheckPoint, BlockId};
|
||||
use bitcoin::{block::Header, Block, BlockHash, Transaction};
|
||||
pub use bitcoincore_rpc;
|
||||
use bitcoincore_rpc::bitcoincore_rpc_json;
|
||||
|
||||
/// A structure that emits data sourced from [`bitcoincore_rpc::Client`].
|
||||
///
|
||||
/// Refer to [module-level documentation] for more.
|
||||
///
|
||||
/// [module-level documentation]: crate
|
||||
pub struct Emitter<'c, C> {
|
||||
client: &'c C,
|
||||
start_height: u32,
|
||||
|
||||
/// The checkpoint of the last-emitted block that is in the best chain. If it is later found
|
||||
/// that the block is no longer in the best chain, it will be popped off from here.
|
||||
last_cp: CheckPoint,
|
||||
|
||||
/// The block result returned from rpc of the last-emitted block. As this result contains the
|
||||
/// next block's block hash (which we use to fetch the next block), we set this to `None`
|
||||
/// whenever there are no more blocks, or the next block is no longer in the best chain. This
|
||||
/// gives us an opportunity to re-fetch this result.
|
||||
last_block: Option<bitcoincore_rpc_json::GetBlockResult>,
|
||||
|
||||
/// The latest first-seen epoch of emitted mempool transactions. This is used to determine
|
||||
/// whether a mempool transaction is already emitted.
|
||||
last_mempool_time: usize,
|
||||
|
||||
/// The last emitted block during our last mempool emission. This is used to determine whether
|
||||
/// there has been a reorg since our last mempool emission.
|
||||
last_mempool_tip: Option<u32>,
|
||||
}
|
||||
|
||||
impl<'c, C: bitcoincore_rpc::RpcApi> Emitter<'c, C> {
|
||||
/// Construct a new [`Emitter`] with the given RPC `client`, `last_cp` and `start_height`.
|
||||
///
|
||||
/// * `last_cp` is the check point used to find the latest block which is still part of the best
|
||||
/// chain.
|
||||
/// * `start_height` is the block height to start emitting blocks from.
|
||||
pub fn new(client: &'c C, last_cp: CheckPoint, start_height: u32) -> Self {
|
||||
Self {
|
||||
client,
|
||||
start_height,
|
||||
last_cp,
|
||||
last_block: None,
|
||||
last_mempool_time: 0,
|
||||
last_mempool_tip: None,
|
||||
}
|
||||
}
|
||||
|
||||
/// Emit mempool transactions, alongside their first-seen unix timestamps.
|
||||
///
|
||||
/// This method emits each transaction only once, unless we cannot guarantee the transaction's
|
||||
/// ancestors are already emitted.
|
||||
///
|
||||
/// To understand why, consider a receiver which filters transactions based on whether it
|
||||
/// alters the UTXO set of tracked script pubkeys. If an emitted mempool transaction spends a
|
||||
/// tracked UTXO which is confirmed at height `h`, but the receiver has only seen up to block
|
||||
/// of height `h-1`, we want to re-emit this transaction until the receiver has seen the block
|
||||
/// at height `h`.
|
||||
pub fn mempool(&mut self) -> Result<Vec<(Transaction, u64)>, bitcoincore_rpc::Error> {
|
||||
let client = self.client;
|
||||
|
||||
// This is the emitted tip height during the last mempool emission.
|
||||
let prev_mempool_tip = self
|
||||
.last_mempool_tip
|
||||
// We use `start_height - 1` as we cannot guarantee that the block at
|
||||
// `start_height` has been emitted.
|
||||
.unwrap_or(self.start_height.saturating_sub(1));
|
||||
|
||||
// Mempool txs come with a timestamp of when the tx is introduced to the mempool. We keep
|
||||
// track of the latest mempool tx's timestamp to determine whether we have seen a tx
|
||||
// before. `prev_mempool_time` is the previous timestamp and `last_time` records what will
|
||||
// be the new latest timestamp.
|
||||
let prev_mempool_time = self.last_mempool_time;
|
||||
let mut latest_time = prev_mempool_time;
|
||||
|
||||
let txs_to_emit = client
|
||||
.get_raw_mempool_verbose()?
|
||||
.into_iter()
|
||||
.filter_map({
|
||||
let latest_time = &mut latest_time;
|
||||
move |(txid, tx_entry)| -> Option<Result<_, bitcoincore_rpc::Error>> {
|
||||
let tx_time = tx_entry.time as usize;
|
||||
if tx_time > *latest_time {
|
||||
*latest_time = tx_time;
|
||||
}
|
||||
|
||||
// Avoid emitting transactions that are already emitted if we can guarantee
|
||||
// blocks containing ancestors are already emitted. The bitcoind rpc interface
|
||||
// provides us with the block height that the tx is introduced to the mempool.
|
||||
// If we have already emitted the block of height, we can assume that all
|
||||
// ancestor txs have been processed by the receiver.
|
||||
let is_already_emitted = tx_time <= prev_mempool_time;
|
||||
let is_within_height = tx_entry.height <= prev_mempool_tip as _;
|
||||
if is_already_emitted && is_within_height {
|
||||
return None;
|
||||
}
|
||||
|
||||
let tx = match client.get_raw_transaction(&txid, None) {
|
||||
Ok(tx) => tx,
|
||||
// the tx is confirmed or evicted since `get_raw_mempool_verbose`
|
||||
Err(err) if err.is_not_found_error() => return None,
|
||||
Err(err) => return Some(Err(err)),
|
||||
};
|
||||
|
||||
Some(Ok((tx, tx_time as u64)))
|
||||
}
|
||||
})
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
self.last_mempool_time = latest_time;
|
||||
self.last_mempool_tip = Some(self.last_cp.height());
|
||||
|
||||
Ok(txs_to_emit)
|
||||
}
|
||||
|
||||
/// Emit the next block height and header (if any).
|
||||
pub fn next_header(&mut self) -> Result<Option<(u32, Header)>, bitcoincore_rpc::Error> {
|
||||
poll(self, |hash| self.client.get_block_header(hash))
|
||||
}
|
||||
|
||||
/// Emit the next block height and block (if any).
|
||||
pub fn next_block(&mut self) -> Result<Option<(u32, Block)>, bitcoincore_rpc::Error> {
|
||||
poll(self, |hash| self.client.get_block(hash))
|
||||
}
|
||||
}
|
||||
|
||||
enum PollResponse {
|
||||
Block(bitcoincore_rpc_json::GetBlockResult),
|
||||
NoMoreBlocks,
|
||||
/// Fetched block is not in the best chain.
|
||||
BlockNotInBestChain,
|
||||
AgreementFound(bitcoincore_rpc_json::GetBlockResult, CheckPoint),
|
||||
/// Force the genesis checkpoint down the receiver's throat.
|
||||
AgreementPointNotFound(BlockHash),
|
||||
}
|
||||
|
||||
fn poll_once<C>(emitter: &Emitter<C>) -> Result<PollResponse, bitcoincore_rpc::Error>
|
||||
where
|
||||
C: bitcoincore_rpc::RpcApi,
|
||||
{
|
||||
let client = emitter.client;
|
||||
|
||||
if let Some(last_res) = &emitter.last_block {
|
||||
let next_hash = if last_res.height < emitter.start_height as _ {
|
||||
// enforce start height
|
||||
let next_hash = client.get_block_hash(emitter.start_height as _)?;
|
||||
// make sure last emission is still in best chain
|
||||
if client.get_block_hash(last_res.height as _)? != last_res.hash {
|
||||
return Ok(PollResponse::BlockNotInBestChain);
|
||||
}
|
||||
next_hash
|
||||
} else {
|
||||
match last_res.nextblockhash {
|
||||
None => return Ok(PollResponse::NoMoreBlocks),
|
||||
Some(next_hash) => next_hash,
|
||||
}
|
||||
};
|
||||
|
||||
let res = client.get_block_info(&next_hash)?;
|
||||
if res.confirmations < 0 {
|
||||
return Ok(PollResponse::BlockNotInBestChain);
|
||||
}
|
||||
|
||||
return Ok(PollResponse::Block(res));
|
||||
}
|
||||
|
||||
for cp in emitter.last_cp.iter() {
|
||||
let res = match client.get_block_info(&cp.hash()) {
|
||||
// block not in best chain
|
||||
Ok(res) if res.confirmations < 0 => continue,
|
||||
Ok(res) => res,
|
||||
Err(e) if e.is_not_found_error() => {
|
||||
if cp.height() > 0 {
|
||||
continue;
|
||||
}
|
||||
// if we can't find genesis block, we can't create an update that connects
|
||||
break;
|
||||
}
|
||||
Err(e) => return Err(e),
|
||||
};
|
||||
|
||||
// agreement point found
|
||||
return Ok(PollResponse::AgreementFound(res, cp));
|
||||
}
|
||||
|
||||
let genesis_hash = client.get_block_hash(0)?;
|
||||
Ok(PollResponse::AgreementPointNotFound(genesis_hash))
|
||||
}
|
||||
|
||||
fn poll<C, V, F>(
|
||||
emitter: &mut Emitter<C>,
|
||||
get_item: F,
|
||||
) -> Result<Option<(u32, V)>, bitcoincore_rpc::Error>
|
||||
where
|
||||
C: bitcoincore_rpc::RpcApi,
|
||||
F: Fn(&BlockHash) -> Result<V, bitcoincore_rpc::Error>,
|
||||
{
|
||||
loop {
|
||||
match poll_once(emitter)? {
|
||||
PollResponse::Block(res) => {
|
||||
let height = res.height as u32;
|
||||
let hash = res.hash;
|
||||
let item = get_item(&hash)?;
|
||||
|
||||
emitter.last_cp = emitter
|
||||
.last_cp
|
||||
.clone()
|
||||
.push(BlockId { height, hash })
|
||||
.expect("must push");
|
||||
emitter.last_block = Some(res);
|
||||
return Ok(Some((height, item)));
|
||||
}
|
||||
PollResponse::NoMoreBlocks => {
|
||||
emitter.last_block = None;
|
||||
return Ok(None);
|
||||
}
|
||||
PollResponse::BlockNotInBestChain => {
|
||||
emitter.last_block = None;
|
||||
continue;
|
||||
}
|
||||
PollResponse::AgreementFound(res, cp) => {
|
||||
let agreement_h = res.height as u32;
|
||||
|
||||
// The tip during the last mempool emission needs to in the best chain, we reduce
|
||||
// it if it is not.
|
||||
if let Some(h) = emitter.last_mempool_tip.as_mut() {
|
||||
if *h > agreement_h {
|
||||
*h = agreement_h;
|
||||
}
|
||||
}
|
||||
|
||||
// get rid of evicted blocks
|
||||
emitter.last_cp = cp;
|
||||
emitter.last_block = Some(res);
|
||||
continue;
|
||||
}
|
||||
PollResponse::AgreementPointNotFound(genesis_hash) => {
|
||||
emitter.last_cp = CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: genesis_hash,
|
||||
});
|
||||
emitter.last_block = None;
|
||||
continue;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Extends [`bitcoincore_rpc::Error`].
|
||||
pub trait BitcoindRpcErrorExt {
|
||||
/// Returns whether the error is a "not found" error.
|
||||
///
|
||||
/// This is useful since [`Emitter`] emits [`Result<_, bitcoincore_rpc::Error>`]s as
|
||||
/// [`Iterator::Item`].
|
||||
fn is_not_found_error(&self) -> bool;
|
||||
}
|
||||
|
||||
impl BitcoindRpcErrorExt for bitcoincore_rpc::Error {
|
||||
fn is_not_found_error(&self) -> bool {
|
||||
if let bitcoincore_rpc::Error::JsonRpc(bitcoincore_rpc::jsonrpc::Error::Rpc(rpc_err)) = self
|
||||
{
|
||||
rpc_err.code == -5
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
}
|
||||
866
crates/bitcoind_rpc/tests/test_emitter.rs
Normal file
866
crates/bitcoind_rpc/tests/test_emitter.rs
Normal file
@@ -0,0 +1,866 @@
|
||||
use std::collections::{BTreeMap, BTreeSet};
|
||||
|
||||
use bdk_bitcoind_rpc::Emitter;
|
||||
use bdk_chain::{
|
||||
bitcoin::{Address, Amount, BlockHash, Txid},
|
||||
keychain::Balance,
|
||||
local_chain::{self, CheckPoint, LocalChain},
|
||||
Append, BlockId, IndexedTxGraph, SpkTxOutIndex,
|
||||
};
|
||||
use bitcoin::{
|
||||
address::NetworkChecked, block::Header, hash_types::TxMerkleNode, hashes::Hash,
|
||||
secp256k1::rand::random, Block, CompactTarget, OutPoint, ScriptBuf, ScriptHash, Transaction,
|
||||
TxIn, TxOut, WScriptHash,
|
||||
};
|
||||
use bitcoincore_rpc::{
|
||||
bitcoincore_rpc_json::{GetBlockTemplateModes, GetBlockTemplateRules},
|
||||
RpcApi,
|
||||
};
|
||||
|
||||
struct TestEnv {
|
||||
#[allow(dead_code)]
|
||||
daemon: bitcoind::BitcoinD,
|
||||
client: bitcoincore_rpc::Client,
|
||||
}
|
||||
|
||||
impl TestEnv {
|
||||
fn new() -> anyhow::Result<Self> {
|
||||
let daemon = match std::env::var_os("TEST_BITCOIND") {
|
||||
Some(bitcoind_path) => bitcoind::BitcoinD::new(bitcoind_path),
|
||||
None => bitcoind::BitcoinD::from_downloaded(),
|
||||
}?;
|
||||
let client = bitcoincore_rpc::Client::new(
|
||||
&daemon.rpc_url(),
|
||||
bitcoincore_rpc::Auth::CookieFile(daemon.params.cookie_file.clone()),
|
||||
)?;
|
||||
Ok(Self { daemon, client })
|
||||
}
|
||||
|
||||
fn mine_blocks(
|
||||
&self,
|
||||
count: usize,
|
||||
address: Option<Address>,
|
||||
) -> anyhow::Result<Vec<BlockHash>> {
|
||||
let coinbase_address = match address {
|
||||
Some(address) => address,
|
||||
None => self.client.get_new_address(None, None)?.assume_checked(),
|
||||
};
|
||||
let block_hashes = self
|
||||
.client
|
||||
.generate_to_address(count as _, &coinbase_address)?;
|
||||
Ok(block_hashes)
|
||||
}
|
||||
|
||||
fn mine_empty_block(&self) -> anyhow::Result<(usize, BlockHash)> {
|
||||
let bt = self.client.get_block_template(
|
||||
GetBlockTemplateModes::Template,
|
||||
&[GetBlockTemplateRules::SegWit],
|
||||
&[],
|
||||
)?;
|
||||
|
||||
let txdata = vec![Transaction {
|
||||
version: 1,
|
||||
lock_time: bitcoin::absolute::LockTime::from_height(0)?,
|
||||
input: vec![TxIn {
|
||||
previous_output: bitcoin::OutPoint::default(),
|
||||
script_sig: ScriptBuf::builder()
|
||||
.push_int(bt.height as _)
|
||||
// randomn number so that re-mining creates unique block
|
||||
.push_int(random())
|
||||
.into_script(),
|
||||
sequence: bitcoin::Sequence::default(),
|
||||
witness: bitcoin::Witness::new(),
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 0,
|
||||
script_pubkey: ScriptBuf::new_p2sh(&ScriptHash::all_zeros()),
|
||||
}],
|
||||
}];
|
||||
|
||||
let bits: [u8; 4] = bt
|
||||
.bits
|
||||
.clone()
|
||||
.try_into()
|
||||
.expect("rpc provided us with invalid bits");
|
||||
|
||||
let mut block = Block {
|
||||
header: Header {
|
||||
version: bitcoin::block::Version::default(),
|
||||
prev_blockhash: bt.previous_block_hash,
|
||||
merkle_root: TxMerkleNode::all_zeros(),
|
||||
time: Ord::max(bt.min_time, std::time::UNIX_EPOCH.elapsed()?.as_secs()) as u32,
|
||||
bits: CompactTarget::from_consensus(u32::from_be_bytes(bits)),
|
||||
nonce: 0,
|
||||
},
|
||||
txdata,
|
||||
};
|
||||
|
||||
block.header.merkle_root = block.compute_merkle_root().expect("must compute");
|
||||
|
||||
for nonce in 0..=u32::MAX {
|
||||
block.header.nonce = nonce;
|
||||
if block.header.target().is_met_by(block.block_hash()) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
self.client.submit_block(&block)?;
|
||||
Ok((bt.height as usize, block.block_hash()))
|
||||
}
|
||||
|
||||
fn invalidate_blocks(&self, count: usize) -> anyhow::Result<()> {
|
||||
let mut hash = self.client.get_best_block_hash()?;
|
||||
for _ in 0..count {
|
||||
let prev_hash = self.client.get_block_info(&hash)?.previousblockhash;
|
||||
self.client.invalidate_block(&hash)?;
|
||||
match prev_hash {
|
||||
Some(prev_hash) => hash = prev_hash,
|
||||
None => break,
|
||||
}
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn reorg(&self, count: usize) -> anyhow::Result<Vec<BlockHash>> {
|
||||
let start_height = self.client.get_block_count()?;
|
||||
self.invalidate_blocks(count)?;
|
||||
|
||||
let res = self.mine_blocks(count, None);
|
||||
assert_eq!(
|
||||
self.client.get_block_count()?,
|
||||
start_height,
|
||||
"reorg should not result in height change"
|
||||
);
|
||||
res
|
||||
}
|
||||
|
||||
fn reorg_empty_blocks(&self, count: usize) -> anyhow::Result<Vec<(usize, BlockHash)>> {
|
||||
let start_height = self.client.get_block_count()?;
|
||||
self.invalidate_blocks(count)?;
|
||||
|
||||
let res = (0..count)
|
||||
.map(|_| self.mine_empty_block())
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
assert_eq!(
|
||||
self.client.get_block_count()?,
|
||||
start_height,
|
||||
"reorg should not result in height change"
|
||||
);
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
fn send(&self, address: &Address<NetworkChecked>, amount: Amount) -> anyhow::Result<Txid> {
|
||||
let txid = self
|
||||
.client
|
||||
.send_to_address(address, amount, None, None, None, None, None, None)?;
|
||||
Ok(txid)
|
||||
}
|
||||
}
|
||||
|
||||
fn block_to_chain_update(block: &bitcoin::Block, height: u32) -> local_chain::Update {
|
||||
let this_id = BlockId {
|
||||
height,
|
||||
hash: block.block_hash(),
|
||||
};
|
||||
let tip = if block.header.prev_blockhash == BlockHash::all_zeros() {
|
||||
CheckPoint::new(this_id)
|
||||
} else {
|
||||
CheckPoint::new(BlockId {
|
||||
height: height - 1,
|
||||
hash: block.header.prev_blockhash,
|
||||
})
|
||||
.extend(core::iter::once(this_id))
|
||||
.expect("must construct checkpoint")
|
||||
};
|
||||
|
||||
local_chain::Update {
|
||||
tip,
|
||||
introduce_older_blocks: false,
|
||||
}
|
||||
}
|
||||
|
||||
/// Ensure that blocks are emitted in order even after reorg.
|
||||
///
|
||||
/// 1. Mine 101 blocks.
|
||||
/// 2. Emit blocks from [`Emitter`] and update the [`LocalChain`].
|
||||
/// 3. Reorg highest 6 blocks.
|
||||
/// 4. Emit blocks from [`Emitter`] and re-update the [`LocalChain`].
|
||||
#[test]
|
||||
pub fn test_sync_local_chain() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let (mut local_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||
let mut emitter = Emitter::new(&env.client, local_chain.tip(), 0);
|
||||
|
||||
// mine some blocks and returned the actual block hashes
|
||||
let exp_hashes = {
|
||||
let mut hashes = vec![env.client.get_block_hash(0)?]; // include genesis block
|
||||
hashes.extend(env.mine_blocks(101, None)?);
|
||||
hashes
|
||||
};
|
||||
|
||||
// see if the emitter outputs the right blocks
|
||||
println!("first sync:");
|
||||
while let Some((height, block)) = emitter.next_block()? {
|
||||
assert_eq!(
|
||||
block.block_hash(),
|
||||
exp_hashes[height as usize],
|
||||
"emitted block hash is unexpected"
|
||||
);
|
||||
|
||||
let chain_update = block_to_chain_update(&block, height);
|
||||
assert_eq!(
|
||||
local_chain.apply_update(chain_update)?,
|
||||
BTreeMap::from([(height, Some(block.block_hash()))]),
|
||||
"chain update changeset is unexpected",
|
||||
);
|
||||
}
|
||||
|
||||
assert_eq!(
|
||||
local_chain.blocks(),
|
||||
&exp_hashes
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, hash)| (i as u32, *hash))
|
||||
.collect(),
|
||||
"final local_chain state is unexpected",
|
||||
);
|
||||
|
||||
// perform reorg
|
||||
let reorged_blocks = env.reorg(6)?;
|
||||
let exp_hashes = exp_hashes
|
||||
.iter()
|
||||
.take(exp_hashes.len() - reorged_blocks.len())
|
||||
.chain(&reorged_blocks)
|
||||
.cloned()
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
// see if the emitter outputs the right blocks
|
||||
println!("after reorg:");
|
||||
let mut exp_height = exp_hashes.len() - reorged_blocks.len();
|
||||
while let Some((height, block)) = emitter.next_block()? {
|
||||
assert_eq!(
|
||||
height, exp_height as u32,
|
||||
"emitted block has unexpected height"
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
block.block_hash(),
|
||||
exp_hashes[height as usize],
|
||||
"emitted block is unexpected"
|
||||
);
|
||||
|
||||
let chain_update = block_to_chain_update(&block, height);
|
||||
assert_eq!(
|
||||
local_chain.apply_update(chain_update)?,
|
||||
if exp_height == exp_hashes.len() - reorged_blocks.len() {
|
||||
core::iter::once((height, Some(block.block_hash())))
|
||||
.chain((height + 1..exp_hashes.len() as u32).map(|h| (h, None)))
|
||||
.collect::<bdk_chain::local_chain::ChangeSet>()
|
||||
} else {
|
||||
BTreeMap::from([(height, Some(block.block_hash()))])
|
||||
},
|
||||
"chain update changeset is unexpected",
|
||||
);
|
||||
|
||||
exp_height += 1;
|
||||
}
|
||||
|
||||
assert_eq!(
|
||||
local_chain.blocks(),
|
||||
&exp_hashes
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, hash)| (i as u32, *hash))
|
||||
.collect(),
|
||||
"final local_chain state is unexpected after reorg",
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Ensure that [`EmittedUpdate::into_tx_graph_update`] behaves appropriately for both mempool and
|
||||
/// block updates.
|
||||
///
|
||||
/// [`EmittedUpdate::into_tx_graph_update`]: bdk_bitcoind_rpc::EmittedUpdate::into_tx_graph_update
|
||||
#[test]
|
||||
fn test_into_tx_graph() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
|
||||
println!("getting new addresses!");
|
||||
let addr_0 = env.client.get_new_address(None, None)?.assume_checked();
|
||||
let addr_1 = env.client.get_new_address(None, None)?.assume_checked();
|
||||
let addr_2 = env.client.get_new_address(None, None)?.assume_checked();
|
||||
println!("got new addresses!");
|
||||
|
||||
println!("mining block!");
|
||||
env.mine_blocks(101, None)?;
|
||||
println!("mined blocks!");
|
||||
|
||||
let (mut chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||
let mut indexed_tx_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||
let mut index = SpkTxOutIndex::<usize>::default();
|
||||
index.insert_spk(0, addr_0.script_pubkey());
|
||||
index.insert_spk(1, addr_1.script_pubkey());
|
||||
index.insert_spk(2, addr_2.script_pubkey());
|
||||
index
|
||||
});
|
||||
|
||||
let emitter = &mut Emitter::new(&env.client, chain.tip(), 0);
|
||||
|
||||
while let Some((height, block)) = emitter.next_block()? {
|
||||
let _ = chain.apply_update(block_to_chain_update(&block, height))?;
|
||||
let indexed_additions = indexed_tx_graph.apply_block_relevant(block, height);
|
||||
assert!(indexed_additions.is_empty());
|
||||
}
|
||||
|
||||
// send 3 txs to a tracked address, these txs will be in the mempool
|
||||
let exp_txids = {
|
||||
let mut txids = BTreeSet::new();
|
||||
for _ in 0..3 {
|
||||
txids.insert(env.client.send_to_address(
|
||||
&addr_0,
|
||||
Amount::from_sat(10_000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
)?);
|
||||
}
|
||||
txids
|
||||
};
|
||||
|
||||
// expect that the next block should be none and we should get 3 txs from mempool
|
||||
{
|
||||
// next block should be `None`
|
||||
assert!(emitter.next_block()?.is_none());
|
||||
|
||||
let mempool_txs = emitter.mempool()?;
|
||||
let indexed_additions = indexed_tx_graph.batch_insert_unconfirmed(mempool_txs);
|
||||
assert_eq!(
|
||||
indexed_additions
|
||||
.graph
|
||||
.txs
|
||||
.iter()
|
||||
.map(|tx| tx.txid())
|
||||
.collect::<BTreeSet<Txid>>(),
|
||||
exp_txids,
|
||||
"changeset should have the 3 mempool transactions",
|
||||
);
|
||||
assert!(indexed_additions.graph.anchors.is_empty());
|
||||
}
|
||||
|
||||
// mine a block that confirms the 3 txs
|
||||
let exp_block_hash = env.mine_blocks(1, None)?[0];
|
||||
let exp_block_height = env.client.get_block_info(&exp_block_hash)?.height as u32;
|
||||
let exp_anchors = exp_txids
|
||||
.iter()
|
||||
.map({
|
||||
let anchor = BlockId {
|
||||
height: exp_block_height,
|
||||
hash: exp_block_hash,
|
||||
};
|
||||
move |&txid| (anchor, txid)
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
|
||||
// must receive mined block which will confirm the transactions.
|
||||
{
|
||||
let (height, block) = emitter.next_block()?.expect("must get mined block");
|
||||
let _ = chain
|
||||
.apply_update(CheckPoint::from_header(&block.header, height).into_update(false))?;
|
||||
let indexed_additions = indexed_tx_graph.apply_block_relevant(block, height);
|
||||
assert!(indexed_additions.graph.txs.is_empty());
|
||||
assert!(indexed_additions.graph.txouts.is_empty());
|
||||
assert_eq!(indexed_additions.graph.anchors, exp_anchors);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Ensure next block emitted after reorg is at reorg height.
|
||||
///
|
||||
/// After a reorg, if the last-emitted block height is equal or greater than the reorg height, and
|
||||
/// the fallback height is equal to or lower than the reorg height, the next block/header emission
|
||||
/// should be at the reorg height.
|
||||
///
|
||||
/// TODO: If the reorg height is lower than the fallback height, how do we find a block height to
|
||||
/// emit that can connect with our receiver chain?
|
||||
#[test]
|
||||
fn ensure_block_emitted_after_reorg_is_at_reorg_height() -> anyhow::Result<()> {
|
||||
const EMITTER_START_HEIGHT: usize = 100;
|
||||
const CHAIN_TIP_HEIGHT: usize = 110;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
EMITTER_START_HEIGHT as _,
|
||||
);
|
||||
|
||||
env.mine_blocks(CHAIN_TIP_HEIGHT, None)?;
|
||||
while emitter.next_header()?.is_some() {}
|
||||
|
||||
for reorg_count in 1..=10 {
|
||||
let replaced_blocks = env.reorg_empty_blocks(reorg_count)?;
|
||||
let (height, next_header) = emitter.next_header()?.expect("must emit block after reorg");
|
||||
assert_eq!(
|
||||
(height as usize, next_header.block_hash()),
|
||||
replaced_blocks[0],
|
||||
"block emitted after reorg should be at the reorg height"
|
||||
);
|
||||
while emitter.next_header()?.is_some() {}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn process_block(
|
||||
recv_chain: &mut LocalChain,
|
||||
recv_graph: &mut IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||
block: Block,
|
||||
block_height: u32,
|
||||
) -> anyhow::Result<()> {
|
||||
recv_chain
|
||||
.apply_update(CheckPoint::from_header(&block.header, block_height).into_update(false))?;
|
||||
let _ = recv_graph.apply_block(block, block_height);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn sync_from_emitter<C>(
|
||||
recv_chain: &mut LocalChain,
|
||||
recv_graph: &mut IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||
emitter: &mut Emitter<C>,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
C: bitcoincore_rpc::RpcApi,
|
||||
{
|
||||
while let Some((height, block)) = emitter.next_block()? {
|
||||
process_block(recv_chain, recv_graph, block, height)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn get_balance(
|
||||
recv_chain: &LocalChain,
|
||||
recv_graph: &IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||
) -> anyhow::Result<Balance> {
|
||||
let chain_tip = recv_chain.tip().block_id();
|
||||
let outpoints = recv_graph.index.outpoints().clone();
|
||||
let balance = recv_graph
|
||||
.graph()
|
||||
.balance(recv_chain, chain_tip, outpoints, |_, _| true);
|
||||
Ok(balance)
|
||||
}
|
||||
|
||||
/// If a block is reorged out, ensure that containing transactions that do not exist in the
|
||||
/// replacement block(s) become unconfirmed.
|
||||
#[test]
|
||||
fn tx_can_become_unconfirmed_after_reorg() -> anyhow::Result<()> {
|
||||
const PREMINE_COUNT: usize = 101;
|
||||
const ADDITIONAL_COUNT: usize = 11;
|
||||
const SEND_AMOUNT: Amount = Amount::from_sat(10_000);
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// setup addresses
|
||||
let addr_to_mine = env.client.get_new_address(None, None)?.assume_checked();
|
||||
let spk_to_track = ScriptBuf::new_v0_p2wsh(&WScriptHash::all_zeros());
|
||||
let addr_to_track = Address::from_script(&spk_to_track, bitcoin::Network::Regtest)?;
|
||||
|
||||
// setup receiver
|
||||
let (mut recv_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||
let mut recv_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||
let mut recv_index = SpkTxOutIndex::default();
|
||||
recv_index.insert_spk((), spk_to_track.clone());
|
||||
recv_index
|
||||
});
|
||||
|
||||
// mine and sync receiver up to tip
|
||||
env.mine_blocks(PREMINE_COUNT, Some(addr_to_mine))?;
|
||||
|
||||
// create transactions that are tracked by our receiver
|
||||
for _ in 0..ADDITIONAL_COUNT {
|
||||
let txid = env.send(&addr_to_track, SEND_AMOUNT)?;
|
||||
|
||||
// lock outputs that send to `addr_to_track`
|
||||
let outpoints_to_lock = env
|
||||
.client
|
||||
.get_transaction(&txid, None)?
|
||||
.transaction()?
|
||||
.output
|
||||
.into_iter()
|
||||
.enumerate()
|
||||
.filter(|(_, txo)| txo.script_pubkey == spk_to_track)
|
||||
.map(|(vout, _)| OutPoint::new(txid, vout as _))
|
||||
.collect::<Vec<_>>();
|
||||
env.client.lock_unspent(&outpoints_to_lock)?;
|
||||
|
||||
let _ = env.mine_blocks(1, None)?;
|
||||
}
|
||||
|
||||
// get emitter up to tip
|
||||
sync_from_emitter(&mut recv_chain, &mut recv_graph, &mut emitter)?;
|
||||
|
||||
assert_eq!(
|
||||
get_balance(&recv_chain, &recv_graph)?,
|
||||
Balance {
|
||||
confirmed: SEND_AMOUNT.to_sat() * ADDITIONAL_COUNT as u64,
|
||||
..Balance::default()
|
||||
},
|
||||
"initial balance must be correct",
|
||||
);
|
||||
|
||||
// perform reorgs with different depths
|
||||
for reorg_count in 1..=ADDITIONAL_COUNT {
|
||||
env.reorg_empty_blocks(reorg_count)?;
|
||||
sync_from_emitter(&mut recv_chain, &mut recv_graph, &mut emitter)?;
|
||||
|
||||
assert_eq!(
|
||||
get_balance(&recv_chain, &recv_graph)?,
|
||||
Balance {
|
||||
confirmed: SEND_AMOUNT.to_sat() * (ADDITIONAL_COUNT - reorg_count) as u64,
|
||||
trusted_pending: SEND_AMOUNT.to_sat() * reorg_count as u64,
|
||||
..Balance::default()
|
||||
},
|
||||
"reorg_count: {}",
|
||||
reorg_count,
|
||||
);
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Ensure avoid-re-emission-logic is sound when [`Emitter`] is synced to tip.
|
||||
///
|
||||
/// The receiver (bdk_chain structures) is synced to the chain tip, and there is txs in the mempool.
|
||||
/// When we call Emitter::mempool multiple times, mempool txs should not be re-emitted, even if the
|
||||
/// chain tip is extended.
|
||||
#[test]
|
||||
fn mempool_avoids_re_emission() -> anyhow::Result<()> {
|
||||
const BLOCKS_TO_MINE: usize = 101;
|
||||
const MEMPOOL_TX_COUNT: usize = 2;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// mine blocks and sync up emitter
|
||||
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||
env.mine_blocks(BLOCKS_TO_MINE, Some(addr.clone()))?;
|
||||
while emitter.next_header()?.is_some() {}
|
||||
|
||||
// have some random txs in mempool
|
||||
let exp_txids = (0..MEMPOOL_TX_COUNT)
|
||||
.map(|_| env.send(&addr, Amount::from_sat(2100)))
|
||||
.collect::<Result<BTreeSet<Txid>, _>>()?;
|
||||
|
||||
// the first emission should include all transactions
|
||||
let emitted_txids = emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<Txid>>();
|
||||
assert_eq!(
|
||||
emitted_txids, exp_txids,
|
||||
"all mempool txs should be emitted"
|
||||
);
|
||||
|
||||
// second emission should be empty
|
||||
assert!(
|
||||
emitter.mempool()?.is_empty(),
|
||||
"second emission should be empty"
|
||||
);
|
||||
|
||||
// mine empty blocks + sync up our emitter -> we should still not re-emit
|
||||
for _ in 0..BLOCKS_TO_MINE {
|
||||
env.mine_empty_block()?;
|
||||
}
|
||||
while emitter.next_header()?.is_some() {}
|
||||
assert!(
|
||||
emitter.mempool()?.is_empty(),
|
||||
"third emission, after chain tip is extended, should also be empty"
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Ensure mempool tx is still re-emitted if [`Emitter`] has not reached the tx's introduction
|
||||
/// height.
|
||||
///
|
||||
/// We introduce a mempool tx after each block, where blocks are empty (does not confirm previous
|
||||
/// mempool txs). Then we emit blocks from [`Emitter`] (intertwining `mempool` calls). We check
|
||||
/// that `mempool` should always re-emit txs that have introduced at a height greater than the last
|
||||
/// emitted block height.
|
||||
#[test]
|
||||
fn mempool_re_emits_if_tx_introduction_height_not_reached() -> anyhow::Result<()> {
|
||||
const PREMINE_COUNT: usize = 101;
|
||||
const MEMPOOL_TX_COUNT: usize = 21;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// mine blocks to get initial balance, sync emitter up to tip
|
||||
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||
env.mine_blocks(PREMINE_COUNT, Some(addr.clone()))?;
|
||||
while emitter.next_header()?.is_some() {}
|
||||
|
||||
// mine blocks to introduce txs to mempool at different heights
|
||||
let tx_introductions = (0..MEMPOOL_TX_COUNT)
|
||||
.map(|_| -> anyhow::Result<_> {
|
||||
let (height, _) = env.mine_empty_block()?;
|
||||
let txid = env.send(&addr, Amount::from_sat(2100))?;
|
||||
Ok((height, txid))
|
||||
})
|
||||
.collect::<anyhow::Result<BTreeSet<_>>>()?;
|
||||
|
||||
assert_eq!(
|
||||
emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<_>>(),
|
||||
tx_introductions.iter().map(|&(_, txid)| txid).collect(),
|
||||
"first mempool emission should include all txs",
|
||||
);
|
||||
assert_eq!(
|
||||
emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<_>>(),
|
||||
tx_introductions.iter().map(|&(_, txid)| txid).collect(),
|
||||
"second mempool emission should still include all txs",
|
||||
);
|
||||
|
||||
// At this point, the emitter has seen all mempool transactions. It should only re-emit those
|
||||
// that have introduction heights less than the emitter's last-emitted block tip.
|
||||
while let Some((height, _)) = emitter.next_header()? {
|
||||
// We call `mempool()` twice.
|
||||
// The second call (at height `h`) should skip the tx introduced at height `h`.
|
||||
for try_index in 0..2 {
|
||||
let exp_txids = tx_introductions
|
||||
.range((height as usize + try_index, Txid::all_zeros())..)
|
||||
.map(|&(_, txid)| txid)
|
||||
.collect::<BTreeSet<_>>();
|
||||
let emitted_txids = emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<_>>();
|
||||
assert_eq!(
|
||||
emitted_txids, exp_txids,
|
||||
"\n emission {} (try {}) must only contain txs introduced at that height or lower: \n\t missing: {:?} \n\t extra: {:?}",
|
||||
height,
|
||||
try_index,
|
||||
exp_txids
|
||||
.difference(&emitted_txids)
|
||||
.map(|txid| (txid, tx_introductions.iter().find_map(|(h, id)| if id == txid { Some(h) } else { None }).unwrap()))
|
||||
.collect::<Vec<_>>(),
|
||||
emitted_txids
|
||||
.difference(&exp_txids)
|
||||
.map(|txid| (txid, tx_introductions.iter().find_map(|(h, id)| if id == txid { Some(h) } else { None }).unwrap()))
|
||||
.collect::<Vec<_>>(),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Ensure we force re-emit all mempool txs after reorg.
|
||||
#[test]
|
||||
fn mempool_during_reorg() -> anyhow::Result<()> {
|
||||
const TIP_DIFF: usize = 10;
|
||||
const PREMINE_COUNT: usize = 101;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
0,
|
||||
);
|
||||
|
||||
// mine blocks to get initial balance
|
||||
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||
env.mine_blocks(PREMINE_COUNT, Some(addr.clone()))?;
|
||||
|
||||
// introduce mempool tx at each block extension
|
||||
for _ in 0..TIP_DIFF {
|
||||
env.mine_empty_block()?;
|
||||
env.send(&addr, Amount::from_sat(2100))?;
|
||||
}
|
||||
|
||||
// sync emitter to tip, first mempool emission should include all txs (as we haven't emitted
|
||||
// from the mempool yet)
|
||||
while emitter.next_header()?.is_some() {}
|
||||
assert_eq!(
|
||||
emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<_>>(),
|
||||
env.client
|
||||
.get_raw_mempool()?
|
||||
.into_iter()
|
||||
.collect::<BTreeSet<_>>(),
|
||||
"first mempool emission should include all txs",
|
||||
);
|
||||
|
||||
// perform reorgs at different heights, these reorgs will not confirm transactions in the
|
||||
// mempool
|
||||
for reorg_count in 1..TIP_DIFF {
|
||||
println!("REORG COUNT: {}", reorg_count);
|
||||
env.reorg_empty_blocks(reorg_count)?;
|
||||
|
||||
// This is a map of mempool txids to tip height where the tx was introduced to the mempool
|
||||
// we recalculate this at every loop as reorgs may evict transactions from mempool. We use
|
||||
// the introduction height to determine whether we expect a tx to appear in a mempool
|
||||
// emission.
|
||||
// TODO: How can have have reorg logic in `TestEnv` NOT blacklast old blocks first?
|
||||
let tx_introductions = dbg!(env
|
||||
.client
|
||||
.get_raw_mempool_verbose()?
|
||||
.into_iter()
|
||||
.map(|(txid, entry)| (txid, entry.height as usize))
|
||||
.collect::<BTreeMap<_, _>>());
|
||||
|
||||
// `next_header` emits the replacement block of the reorg
|
||||
if let Some((height, _)) = emitter.next_header()? {
|
||||
println!("\t- replacement height: {}", height);
|
||||
|
||||
// the mempool emission (that follows the first block emission after reorg) should only
|
||||
// include mempool txs introduced at reorg height or greater
|
||||
let mempool = emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<_>>();
|
||||
let exp_mempool = tx_introductions
|
||||
.iter()
|
||||
.filter(|(_, &intro_h)| intro_h >= (height as usize))
|
||||
.map(|(&txid, _)| txid)
|
||||
.collect::<BTreeSet<_>>();
|
||||
assert_eq!(
|
||||
mempool, exp_mempool,
|
||||
"the first mempool emission after reorg should only include mempool txs introduced at reorg height or greater"
|
||||
);
|
||||
|
||||
let mempool = emitter
|
||||
.mempool()?
|
||||
.into_iter()
|
||||
.map(|(tx, _)| tx.txid())
|
||||
.collect::<BTreeSet<_>>();
|
||||
let exp_mempool = tx_introductions
|
||||
.iter()
|
||||
.filter(|&(_, &intro_height)| intro_height > (height as usize))
|
||||
.map(|(&txid, _)| txid)
|
||||
.collect::<BTreeSet<_>>();
|
||||
assert_eq!(
|
||||
mempool, exp_mempool,
|
||||
"following mempool emissions after reorg should exclude mempool introduction heights <= last emitted block height: \n\t missing: {:?} \n\t extra: {:?}",
|
||||
exp_mempool
|
||||
.difference(&mempool)
|
||||
.map(|txid| (txid, tx_introductions.get(txid).unwrap()))
|
||||
.collect::<Vec<_>>(),
|
||||
mempool
|
||||
.difference(&exp_mempool)
|
||||
.map(|txid| (txid, tx_introductions.get(txid).unwrap()))
|
||||
.collect::<Vec<_>>(),
|
||||
);
|
||||
}
|
||||
|
||||
// sync emitter to tip
|
||||
while emitter.next_header()?.is_some() {}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// If blockchain re-org includes the start height, emit new start height block
|
||||
///
|
||||
/// 1. mine 101 blocks
|
||||
/// 2. emit blocks 99a, 100a
|
||||
/// 3. invalidate blocks 99a, 100a, 101a
|
||||
/// 4. mine new blocks 99b, 100b, 101b
|
||||
/// 5. emit block 99b
|
||||
///
|
||||
/// The block hash of 99b should be different than 99a, but their previous block hashes should
|
||||
/// be the same.
|
||||
#[test]
|
||||
fn no_agreement_point() -> anyhow::Result<()> {
|
||||
const PREMINE_COUNT: usize = 101;
|
||||
|
||||
let env = TestEnv::new()?;
|
||||
|
||||
// start height is 99
|
||||
let mut emitter = Emitter::new(
|
||||
&env.client,
|
||||
CheckPoint::new(BlockId {
|
||||
height: 0,
|
||||
hash: env.client.get_block_hash(0)?,
|
||||
}),
|
||||
(PREMINE_COUNT - 2) as u32,
|
||||
);
|
||||
|
||||
// mine 101 blocks
|
||||
env.mine_blocks(PREMINE_COUNT, None)?;
|
||||
|
||||
// emit block 99a
|
||||
let (_, block_header_99a) = emitter.next_header()?.expect("block 99a header");
|
||||
let block_hash_99a = block_header_99a.block_hash();
|
||||
let block_hash_98a = block_header_99a.prev_blockhash;
|
||||
|
||||
// emit block 100a
|
||||
let (_, block_header_100a) = emitter.next_header()?.expect("block 100a header");
|
||||
let block_hash_100a = block_header_100a.block_hash();
|
||||
|
||||
// get hash for block 101a
|
||||
let block_hash_101a = env.client.get_block_hash(101)?;
|
||||
|
||||
// invalidate blocks 99a, 100a, 101a
|
||||
env.client.invalidate_block(&block_hash_99a)?;
|
||||
env.client.invalidate_block(&block_hash_100a)?;
|
||||
env.client.invalidate_block(&block_hash_101a)?;
|
||||
|
||||
// mine new blocks 99b, 100b, 101b
|
||||
env.mine_blocks(3, None)?;
|
||||
|
||||
// emit block header 99b
|
||||
let (_, block_header_99b) = emitter.next_header()?.expect("block 99b header");
|
||||
let block_hash_99b = block_header_99b.block_hash();
|
||||
let block_hash_98b = block_header_99b.prev_blockhash;
|
||||
|
||||
assert_ne!(block_hash_99a, block_hash_99b);
|
||||
assert_eq!(block_hash_98a, block_hash_98b);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -1,6 +1,6 @@
|
||||
[package]
|
||||
name = "bdk_chain"
|
||||
version = "0.5.0"
|
||||
version = "0.6.0"
|
||||
edition = "2021"
|
||||
rust-version = "1.57"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
@@ -14,13 +14,13 @@ readme = "README.md"
|
||||
|
||||
[dependencies]
|
||||
# For no-std, remember to enable the bitcoin/no-std feature
|
||||
bitcoin = { version = "0.29", default-features = false }
|
||||
bitcoin = { version = "0.30.0", default-features = false }
|
||||
serde_crate = { package = "serde", version = "1", optional = true, features = ["derive"] }
|
||||
|
||||
# Use hashbrown as a feature flag to have HashSet and HashMap from it.
|
||||
# note version 0.13 breaks outs MSRV.
|
||||
hashbrown = { version = "0.11", optional = true, features = ["serde"] }
|
||||
miniscript = { version = "9.0.0", optional = true, default-features = false }
|
||||
# note versions > 0.9.1 breaks ours 1.57.0 MSRV.
|
||||
hashbrown = { version = "0.9.1", optional = true, features = ["serde"] }
|
||||
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||
|
||||
[dev-dependencies]
|
||||
rand = "0.8"
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
use bitcoin::{hashes::Hash, BlockHash, OutPoint, TxOut, Txid};
|
||||
|
||||
use crate::{Anchor, COINBASE_MATURITY};
|
||||
use crate::{Anchor, AnchorFromBlockPosition, COINBASE_MATURITY};
|
||||
|
||||
/// Represents the observed position of some chain data.
|
||||
///
|
||||
@@ -74,8 +74,8 @@ impl ConfirmationTime {
|
||||
}
|
||||
}
|
||||
|
||||
impl From<ChainPosition<ConfirmationTimeAnchor>> for ConfirmationTime {
|
||||
fn from(observed_as: ChainPosition<ConfirmationTimeAnchor>) -> Self {
|
||||
impl From<ChainPosition<ConfirmationTimeHeightAnchor>> for ConfirmationTime {
|
||||
fn from(observed_as: ChainPosition<ConfirmationTimeHeightAnchor>) -> Self {
|
||||
match observed_as {
|
||||
ChainPosition::Confirmed(a) => Self::Confirmed {
|
||||
height: a.confirmation_height,
|
||||
@@ -87,6 +87,9 @@ impl From<ChainPosition<ConfirmationTimeAnchor>> for ConfirmationTime {
|
||||
}
|
||||
|
||||
/// A reference to a block in the canonical chain.
|
||||
///
|
||||
/// `BlockId` implements [`Anchor`]. When a transaction is anchored to `BlockId`, the confirmation
|
||||
/// block and anchor block are the same block.
|
||||
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
@@ -100,11 +103,23 @@ pub struct BlockId {
|
||||
pub hash: BlockHash,
|
||||
}
|
||||
|
||||
impl Anchor for BlockId {
|
||||
fn anchor_block(&self) -> Self {
|
||||
*self
|
||||
}
|
||||
}
|
||||
|
||||
impl AnchorFromBlockPosition for BlockId {
|
||||
fn from_block_position(_block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||
block_id
|
||||
}
|
||||
}
|
||||
|
||||
impl Default for BlockId {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
height: Default::default(),
|
||||
hash: BlockHash::from_inner([0u8; 32]),
|
||||
hash: BlockHash::all_zeros(),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -131,6 +146,8 @@ impl From<(&u32, &BlockHash)> for BlockId {
|
||||
}
|
||||
|
||||
/// An [`Anchor`] implementation that also records the exact confirmation height of the transaction.
|
||||
///
|
||||
/// Refer to [`Anchor`] for more details.
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
@@ -157,15 +174,26 @@ impl Anchor for ConfirmationHeightAnchor {
|
||||
}
|
||||
}
|
||||
|
||||
impl AnchorFromBlockPosition for ConfirmationHeightAnchor {
|
||||
fn from_block_position(_block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||
Self {
|
||||
anchor_block: block_id,
|
||||
confirmation_height: block_id.height,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// An [`Anchor`] implementation that also records the exact confirmation time and height of the
|
||||
/// transaction.
|
||||
///
|
||||
/// Refer to [`Anchor`] for more details.
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(crate = "serde_crate")
|
||||
)]
|
||||
pub struct ConfirmationTimeAnchor {
|
||||
pub struct ConfirmationTimeHeightAnchor {
|
||||
/// The anchor block.
|
||||
pub anchor_block: BlockId,
|
||||
/// The confirmation height of the chain data being anchored.
|
||||
@@ -174,7 +202,7 @@ pub struct ConfirmationTimeAnchor {
|
||||
pub confirmation_time: u64,
|
||||
}
|
||||
|
||||
impl Anchor for ConfirmationTimeAnchor {
|
||||
impl Anchor for ConfirmationTimeHeightAnchor {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
self.anchor_block
|
||||
}
|
||||
@@ -183,6 +211,17 @@ impl Anchor for ConfirmationTimeAnchor {
|
||||
self.confirmation_height
|
||||
}
|
||||
}
|
||||
|
||||
impl AnchorFromBlockPosition for ConfirmationTimeHeightAnchor {
|
||||
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||
Self {
|
||||
anchor_block: block_id,
|
||||
confirmation_height: block_id.height,
|
||||
confirmation_time: block.header.time as _,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// A `TxOut` with as much data as we can retrieve about it
|
||||
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct FullTxOut<A> {
|
||||
@@ -202,7 +241,7 @@ impl<A: Anchor> FullTxOut<A> {
|
||||
/// Whether the `txout` is considered mature.
|
||||
///
|
||||
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||
/// method may return false-negatives. In other words, interpretted confirmation count may be
|
||||
/// method may return false-negatives. In other words, interpreted confirmation count may be
|
||||
/// less than the actual value.
|
||||
///
|
||||
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||
@@ -226,10 +265,10 @@ impl<A: Anchor> FullTxOut<A> {
|
||||
|
||||
/// Whether the utxo is/was/will be spendable with chain `tip`.
|
||||
///
|
||||
/// This method does not take into account the locktime.
|
||||
/// This method does not take into account the lock time.
|
||||
///
|
||||
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||
/// method may return false-negatives. In other words, interpretted confirmation count may be
|
||||
/// method may return false-negatives. In other words, interpreted confirmation count may be
|
||||
/// less than the actual value.
|
||||
///
|
||||
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||
|
||||
@@ -21,5 +21,5 @@ pub trait ChainOracle {
|
||||
) -> Result<Option<bool>, Self::Error>;
|
||||
|
||||
/// Get the best chain's chain tip.
|
||||
fn get_chain_tip(&self) -> Result<Option<BlockId>, Self::Error>;
|
||||
fn get_chain_tip(&self) -> Result<BlockId, Self::Error>;
|
||||
}
|
||||
|
||||
@@ -3,12 +3,14 @@ use crate::miniscript::{Descriptor, DescriptorPublicKey};
|
||||
/// A trait to extend the functionality of a miniscript descriptor.
|
||||
pub trait DescriptorExt {
|
||||
/// Returns the minimum value (in satoshis) at which an output is broadcastable.
|
||||
/// Panics if the descriptor wildcard is hardened.
|
||||
fn dust_value(&self) -> u64;
|
||||
}
|
||||
|
||||
impl DescriptorExt for Descriptor<DescriptorPublicKey> {
|
||||
fn dust_value(&self) -> u64 {
|
||||
self.at_derivation_index(0)
|
||||
.expect("descriptor can't have hardened derivation")
|
||||
.script_pubkey()
|
||||
.dust_value()
|
||||
.to_sat()
|
||||
|
||||
@@ -3,12 +3,12 @@
|
||||
//! This is essentially a [`TxGraph`] combined with an indexer.
|
||||
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{OutPoint, Transaction, TxOut};
|
||||
use bitcoin::{Block, OutPoint, Transaction, TxOut, Txid};
|
||||
|
||||
use crate::{
|
||||
keychain::DerivationAdditions,
|
||||
tx_graph::{Additions, TxGraph},
|
||||
Anchor, Append,
|
||||
keychain,
|
||||
tx_graph::{self, TxGraph},
|
||||
Anchor, AnchorFromBlockPosition, Append, BlockId,
|
||||
};
|
||||
|
||||
/// A struct that combines [`TxGraph`] and an [`Indexer`] implementation.
|
||||
@@ -46,124 +46,223 @@ impl<A, I> IndexedTxGraph<A, I> {
|
||||
}
|
||||
|
||||
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I> {
|
||||
/// Applies the [`IndexedAdditions`] to the [`IndexedTxGraph`].
|
||||
pub fn apply_additions(&mut self, additions: IndexedAdditions<A, I::Additions>) {
|
||||
let IndexedAdditions {
|
||||
graph_additions,
|
||||
index_additions,
|
||||
} = additions;
|
||||
/// Applies the [`ChangeSet`] to the [`IndexedTxGraph`].
|
||||
pub fn apply_changeset(&mut self, changeset: ChangeSet<A, I::ChangeSet>) {
|
||||
self.index.apply_changeset(changeset.indexer);
|
||||
|
||||
self.index.apply_additions(index_additions);
|
||||
|
||||
for tx in &graph_additions.txs {
|
||||
for tx in &changeset.graph.txs {
|
||||
self.index.index_tx(tx);
|
||||
}
|
||||
for (&outpoint, txout) in &graph_additions.txouts {
|
||||
for (&outpoint, txout) in &changeset.graph.txouts {
|
||||
self.index.index_txout(outpoint, txout);
|
||||
}
|
||||
|
||||
self.graph.apply_additions(graph_additions);
|
||||
self.graph.apply_changeset(changeset.graph);
|
||||
}
|
||||
|
||||
/// Determines the [`ChangeSet`] between `self` and an empty [`IndexedTxGraph`].
|
||||
pub fn initial_changeset(&self) -> ChangeSet<A, I::ChangeSet> {
|
||||
let graph = self.graph.initial_changeset();
|
||||
let indexer = self.index.initial_changeset();
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||
where
|
||||
I::Additions: Default + Append,
|
||||
I::ChangeSet: Default + Append,
|
||||
{
|
||||
fn index_tx_graph_changeset(
|
||||
&mut self,
|
||||
tx_graph_changeset: &tx_graph::ChangeSet<A>,
|
||||
) -> I::ChangeSet {
|
||||
let mut changeset = I::ChangeSet::default();
|
||||
for added_tx in &tx_graph_changeset.txs {
|
||||
changeset.append(self.index.index_tx(added_tx));
|
||||
}
|
||||
for (&added_outpoint, added_txout) in &tx_graph_changeset.txouts {
|
||||
changeset.append(self.index.index_txout(added_outpoint, added_txout));
|
||||
}
|
||||
changeset
|
||||
}
|
||||
|
||||
/// Apply an `update` directly.
|
||||
///
|
||||
/// `update` is a [`TxGraph<A>`] and the resultant changes is returned as [`IndexedAdditions`].
|
||||
pub fn apply_update(&mut self, update: TxGraph<A>) -> IndexedAdditions<A, I::Additions> {
|
||||
let graph_additions = self.graph.apply_update(update);
|
||||
|
||||
let mut index_additions = I::Additions::default();
|
||||
for added_tx in &graph_additions.txs {
|
||||
index_additions.append(self.index.index_tx(added_tx));
|
||||
}
|
||||
for (&added_outpoint, added_txout) in &graph_additions.txouts {
|
||||
index_additions.append(self.index.index_txout(added_outpoint, added_txout));
|
||||
}
|
||||
|
||||
IndexedAdditions {
|
||||
graph_additions,
|
||||
index_additions,
|
||||
}
|
||||
/// `update` is a [`TxGraph<A>`] and the resultant changes is returned as [`ChangeSet`].
|
||||
pub fn apply_update(&mut self, update: TxGraph<A>) -> ChangeSet<A, I::ChangeSet> {
|
||||
let graph = self.graph.apply_update(update);
|
||||
let indexer = self.index_tx_graph_changeset(&graph);
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
|
||||
/// Insert a floating `txout` of given `outpoint`.
|
||||
pub fn insert_txout(
|
||||
&mut self,
|
||||
outpoint: OutPoint,
|
||||
txout: &TxOut,
|
||||
) -> IndexedAdditions<A, I::Additions> {
|
||||
let mut update = TxGraph::<A>::default();
|
||||
let _ = update.insert_txout(outpoint, txout.clone());
|
||||
self.apply_update(update)
|
||||
pub fn insert_txout(&mut self, outpoint: OutPoint, txout: TxOut) -> ChangeSet<A, I::ChangeSet> {
|
||||
let graph = self.graph.insert_txout(outpoint, txout);
|
||||
let indexer = self.index_tx_graph_changeset(&graph);
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
|
||||
/// Insert and index a transaction into the graph.
|
||||
pub fn insert_tx(&mut self, tx: Transaction) -> ChangeSet<A, I::ChangeSet> {
|
||||
let graph = self.graph.insert_tx(tx);
|
||||
let indexer = self.index_tx_graph_changeset(&graph);
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
|
||||
/// Insert an `anchor` for a given transaction.
|
||||
pub fn insert_anchor(&mut self, txid: Txid, anchor: A) -> ChangeSet<A, I::ChangeSet> {
|
||||
self.graph.insert_anchor(txid, anchor).into()
|
||||
}
|
||||
|
||||
/// Insert a unix timestamp of when a transaction is seen in the mempool.
|
||||
///
|
||||
/// `anchors` can be provided to anchor the transaction to various blocks. `seen_at` is a
|
||||
/// unix timestamp of when the transaction is last seen.
|
||||
pub fn insert_tx(
|
||||
&mut self,
|
||||
tx: &Transaction,
|
||||
anchors: impl IntoIterator<Item = A>,
|
||||
seen_at: Option<u64>,
|
||||
) -> IndexedAdditions<A, I::Additions> {
|
||||
let txid = tx.txid();
|
||||
|
||||
let mut update = TxGraph::<A>::default();
|
||||
if self.graph.get_tx(txid).is_none() {
|
||||
let _ = update.insert_tx(tx.clone());
|
||||
}
|
||||
for anchor in anchors.into_iter() {
|
||||
let _ = update.insert_anchor(txid, anchor);
|
||||
}
|
||||
if let Some(seen_at) = seen_at {
|
||||
let _ = update.insert_seen_at(txid, seen_at);
|
||||
/// This is used for transaction conflict resolution in [`TxGraph`] where the transaction with
|
||||
/// the later last-seen is prioritized.
|
||||
pub fn insert_seen_at(&mut self, txid: Txid, seen_at: u64) -> ChangeSet<A, I::ChangeSet> {
|
||||
self.graph.insert_seen_at(txid, seen_at).into()
|
||||
}
|
||||
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Insert relevant transactions from the given `txs` iterator.
|
||||
/// Batch insert transactions, filtering out those that are irrelevant.
|
||||
///
|
||||
/// Relevancy is determined by the [`Indexer::is_tx_relevant`] implementation of `I`. Irrelevant
|
||||
/// transactions in `txs` will be ignored. `txs` do not need to be in topological order.
|
||||
///
|
||||
/// `anchors` can be provided to anchor the transactions to blocks. `seen_at` is a unix
|
||||
/// timestamp of when the transactions are last seen.
|
||||
pub fn insert_relevant_txs<'t>(
|
||||
pub fn batch_insert_relevant<'t>(
|
||||
&mut self,
|
||||
txs: impl IntoIterator<Item = (&'t Transaction, impl IntoIterator<Item = A>)>,
|
||||
seen_at: Option<u64>,
|
||||
) -> IndexedAdditions<A, I::Additions> {
|
||||
) -> ChangeSet<A, I::ChangeSet> {
|
||||
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||
// This is achieved by:
|
||||
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||
// not store anything about them.
|
||||
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||
// returns true or not. (in a second loop).
|
||||
let mut additions = IndexedAdditions::<A, I::Additions>::default();
|
||||
let mut transactions = Vec::new();
|
||||
for (tx, anchors) in txs.into_iter() {
|
||||
additions.index_additions.append(self.index.index_tx(tx));
|
||||
transactions.push((tx, anchors));
|
||||
let txs = txs.into_iter().collect::<Vec<_>>();
|
||||
|
||||
let mut indexer = I::ChangeSet::default();
|
||||
for (tx, _) in &txs {
|
||||
indexer.append(self.index.index_tx(tx));
|
||||
}
|
||||
additions.append(
|
||||
transactions
|
||||
.into_iter()
|
||||
.filter_map(|(tx, anchors)| match self.index.is_tx_relevant(tx) {
|
||||
true => Some(self.insert_tx(tx, anchors, seen_at)),
|
||||
false => None,
|
||||
})
|
||||
.fold(Default::default(), |mut acc, other| {
|
||||
acc.append(other);
|
||||
acc
|
||||
}),
|
||||
|
||||
let mut graph = tx_graph::ChangeSet::default();
|
||||
for (tx, anchors) in txs {
|
||||
if self.index.is_tx_relevant(tx) {
|
||||
let txid = tx.txid();
|
||||
graph.append(self.graph.insert_tx(tx.clone()));
|
||||
for anchor in anchors {
|
||||
graph.append(self.graph.insert_anchor(txid, anchor));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
|
||||
/// Batch insert unconfirmed transactions, filtering out those that are irrelevant.
|
||||
///
|
||||
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||
/// Irrelevant transactions in `txs` will be ignored.
|
||||
///
|
||||
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||
/// conflict-resolution in [`TxGraph`] (refer to [`TxGraph::insert_seen_at`] for details).
|
||||
pub fn batch_insert_relevant_unconfirmed<'t>(
|
||||
&mut self,
|
||||
unconfirmed_txs: impl IntoIterator<Item = (&'t Transaction, u64)>,
|
||||
) -> ChangeSet<A, I::ChangeSet> {
|
||||
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||
// This is achieved by:
|
||||
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||
// not store anything about them.
|
||||
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||
// returns true or not. (in a second loop).
|
||||
let txs = unconfirmed_txs.into_iter().collect::<Vec<_>>();
|
||||
|
||||
let mut indexer = I::ChangeSet::default();
|
||||
for (tx, _) in &txs {
|
||||
indexer.append(self.index.index_tx(tx));
|
||||
}
|
||||
|
||||
let graph = self.graph.batch_insert_unconfirmed(
|
||||
txs.into_iter()
|
||||
.filter(|(tx, _)| self.index.is_tx_relevant(tx))
|
||||
.map(|(tx, seen_at)| (tx.clone(), seen_at)),
|
||||
);
|
||||
additions
|
||||
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
|
||||
/// Batch insert unconfirmed transactions.
|
||||
///
|
||||
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||
/// conflict-resolution in [`TxGraph`] (refer to [`TxGraph::insert_seen_at`] for details).
|
||||
///
|
||||
/// To filter out irrelevant transactions, use [`batch_insert_relevant_unconfirmed`] instead.
|
||||
///
|
||||
/// [`batch_insert_relevant_unconfirmed`]: IndexedTxGraph::batch_insert_relevant_unconfirmed
|
||||
pub fn batch_insert_unconfirmed(
|
||||
&mut self,
|
||||
txs: impl IntoIterator<Item = (Transaction, u64)>,
|
||||
) -> ChangeSet<A, I::ChangeSet> {
|
||||
let graph = self.graph.batch_insert_unconfirmed(txs);
|
||||
let indexer = self.index_tx_graph_changeset(&graph);
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
}
|
||||
|
||||
/// Methods are available if the anchor (`A`) implements [`AnchorFromBlockPosition`].
|
||||
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||
where
|
||||
I::ChangeSet: Default + Append,
|
||||
A: AnchorFromBlockPosition,
|
||||
{
|
||||
/// Batch insert all transactions of the given `block` of `height`, filtering out those that are
|
||||
/// irrelevant.
|
||||
///
|
||||
/// Each inserted transaction's anchor will be constructed from
|
||||
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||
///
|
||||
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||
/// Irrelevant transactions in `txs` will be ignored.
|
||||
pub fn apply_block_relevant(
|
||||
&mut self,
|
||||
block: Block,
|
||||
height: u32,
|
||||
) -> ChangeSet<A, I::ChangeSet> {
|
||||
let block_id = BlockId {
|
||||
hash: block.block_hash(),
|
||||
height,
|
||||
};
|
||||
let txs = block.txdata.iter().enumerate().map(|(tx_pos, tx)| {
|
||||
(
|
||||
tx,
|
||||
core::iter::once(A::from_block_position(&block, block_id, tx_pos)),
|
||||
)
|
||||
});
|
||||
self.batch_insert_relevant(txs)
|
||||
}
|
||||
|
||||
/// Batch insert all transactions of the given `block` of `height`.
|
||||
///
|
||||
/// Each inserted transaction's anchor will be constructed from
|
||||
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||
///
|
||||
/// To only insert relevant transactions, use [`apply_block_relevant`] instead.
|
||||
///
|
||||
/// [`apply_block_relevant`]: IndexedTxGraph::apply_block_relevant
|
||||
pub fn apply_block(&mut self, block: Block, height: u32) -> ChangeSet<A, I::ChangeSet> {
|
||||
let block_id = BlockId {
|
||||
hash: block.block_hash(),
|
||||
height,
|
||||
};
|
||||
let mut graph = tx_graph::ChangeSet::default();
|
||||
for (tx_pos, tx) in block.txdata.iter().enumerate() {
|
||||
let anchor = A::from_block_position(&block, block_id, tx_pos);
|
||||
graph.append(self.graph.insert_anchor(tx.txid(), anchor));
|
||||
graph.append(self.graph.insert_tx(tx.clone()));
|
||||
}
|
||||
let indexer = self.index_tx_graph_changeset(&graph);
|
||||
ChangeSet { graph, indexer }
|
||||
}
|
||||
}
|
||||
|
||||
@@ -181,64 +280,70 @@ where
|
||||
)
|
||||
)]
|
||||
#[must_use]
|
||||
pub struct IndexedAdditions<A, IA> {
|
||||
/// [`TxGraph`] additions.
|
||||
pub graph_additions: Additions<A>,
|
||||
/// [`Indexer`] additions.
|
||||
pub index_additions: IA,
|
||||
pub struct ChangeSet<A, IA> {
|
||||
/// [`TxGraph`] changeset.
|
||||
pub graph: tx_graph::ChangeSet<A>,
|
||||
/// [`Indexer`] changeset.
|
||||
pub indexer: IA,
|
||||
}
|
||||
|
||||
impl<A, IA: Default> Default for IndexedAdditions<A, IA> {
|
||||
impl<A, IA: Default> Default for ChangeSet<A, IA> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
graph_additions: Default::default(),
|
||||
index_additions: Default::default(),
|
||||
graph: Default::default(),
|
||||
indexer: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor, IA: Append> Append for IndexedAdditions<A, IA> {
|
||||
impl<A: Anchor, IA: Append> Append for ChangeSet<A, IA> {
|
||||
fn append(&mut self, other: Self) {
|
||||
self.graph_additions.append(other.graph_additions);
|
||||
self.index_additions.append(other.index_additions);
|
||||
self.graph.append(other.graph);
|
||||
self.indexer.append(other.indexer);
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
self.graph_additions.is_empty() && self.index_additions.is_empty()
|
||||
self.graph.is_empty() && self.indexer.is_empty()
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, IA: Default> From<Additions<A>> for IndexedAdditions<A, IA> {
|
||||
fn from(graph_additions: Additions<A>) -> Self {
|
||||
impl<A, IA: Default> From<tx_graph::ChangeSet<A>> for ChangeSet<A, IA> {
|
||||
fn from(graph: tx_graph::ChangeSet<A>) -> Self {
|
||||
Self {
|
||||
graph_additions,
|
||||
graph,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, K> From<DerivationAdditions<K>> for IndexedAdditions<A, DerivationAdditions<K>> {
|
||||
fn from(index_additions: DerivationAdditions<K>) -> Self {
|
||||
impl<A, K> From<keychain::ChangeSet<K>> for ChangeSet<A, keychain::ChangeSet<K>> {
|
||||
fn from(indexer: keychain::ChangeSet<K>) -> Self {
|
||||
Self {
|
||||
graph_additions: Default::default(),
|
||||
index_additions,
|
||||
graph: Default::default(),
|
||||
indexer,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Represents a structure that can index transaction data.
|
||||
/// Utilities for indexing transaction data.
|
||||
///
|
||||
/// Types which implement this trait can be used to construct an [`IndexedTxGraph`].
|
||||
/// This trait's methods should rarely be called directly.
|
||||
pub trait Indexer {
|
||||
/// The resultant "additions" when new transaction data is indexed.
|
||||
type Additions;
|
||||
/// The resultant "changeset" when new transaction data is indexed.
|
||||
type ChangeSet;
|
||||
|
||||
/// Scan and index the given `outpoint` and `txout`.
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::Additions;
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet;
|
||||
|
||||
/// Scan and index the given transaction.
|
||||
fn index_tx(&mut self, tx: &Transaction) -> Self::Additions;
|
||||
/// Scans a transaction for relevant outpoints, which are stored and indexed internally.
|
||||
fn index_tx(&mut self, tx: &Transaction) -> Self::ChangeSet;
|
||||
|
||||
/// Apply additions to itself.
|
||||
fn apply_additions(&mut self, additions: Self::Additions);
|
||||
/// Apply changeset to itself.
|
||||
fn apply_changeset(&mut self, changeset: Self::ChangeSet);
|
||||
|
||||
/// Determines the [`ChangeSet`] between `self` and an empty [`Indexer`].
|
||||
fn initial_changeset(&self) -> Self::ChangeSet;
|
||||
|
||||
/// Determines whether the transaction should be included in the index.
|
||||
fn is_tx_relevant(&self, tx: &Transaction) -> bool;
|
||||
|
||||
@@ -10,13 +10,7 @@
|
||||
//!
|
||||
//! [`SpkTxOutIndex`]: crate::SpkTxOutIndex
|
||||
|
||||
use crate::{
|
||||
collections::BTreeMap,
|
||||
indexed_tx_graph::IndexedAdditions,
|
||||
local_chain::{self, LocalChain},
|
||||
tx_graph::TxGraph,
|
||||
Anchor, Append,
|
||||
};
|
||||
use crate::{collections::BTreeMap, Append};
|
||||
|
||||
#[cfg(feature = "miniscript")]
|
||||
mod txout_index;
|
||||
@@ -24,12 +18,13 @@ mod txout_index;
|
||||
pub use txout_index::*;
|
||||
|
||||
/// Represents updates to the derivation index of a [`KeychainTxOutIndex`].
|
||||
/// It maps each keychain `K` to its last revealed index.
|
||||
///
|
||||
/// It can be applied to [`KeychainTxOutIndex`] with [`apply_additions`]. [`DerivationAdditions] are
|
||||
/// It can be applied to [`KeychainTxOutIndex`] with [`apply_changeset`]. [`ChangeSet] are
|
||||
/// monotone in that they will never decrease the revealed derivation index.
|
||||
///
|
||||
/// [`KeychainTxOutIndex`]: crate::keychain::KeychainTxOutIndex
|
||||
/// [`apply_additions`]: crate::keychain::KeychainTxOutIndex::apply_additions
|
||||
/// [`apply_changeset`]: crate::keychain::KeychainTxOutIndex::apply_changeset
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
@@ -43,22 +38,17 @@ pub use txout_index::*;
|
||||
)
|
||||
)]
|
||||
#[must_use]
|
||||
pub struct DerivationAdditions<K>(pub BTreeMap<K, u32>);
|
||||
|
||||
impl<K> DerivationAdditions<K> {
|
||||
/// Returns whether the additions are empty.
|
||||
pub fn is_empty(&self) -> bool {
|
||||
self.0.is_empty()
|
||||
}
|
||||
pub struct ChangeSet<K>(pub BTreeMap<K, u32>);
|
||||
|
||||
impl<K> ChangeSet<K> {
|
||||
/// Get the inner map of the keychain to its new derivation index.
|
||||
pub fn as_inner(&self) -> &BTreeMap<K, u32> {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Ord> Append for DerivationAdditions<K> {
|
||||
/// Append another [`DerivationAdditions`] into self.
|
||||
impl<K: Ord> Append for ChangeSet<K> {
|
||||
/// Append another [`ChangeSet`] into self.
|
||||
///
|
||||
/// If the keychain already exists, increase the index when the other's index > self's index.
|
||||
/// If the keychain did not exist, append the new keychain.
|
||||
@@ -72,106 +62,24 @@ impl<K: Ord> Append for DerivationAdditions<K> {
|
||||
self.0.append(&mut other.0);
|
||||
}
|
||||
|
||||
/// Returns whether the changeset are empty.
|
||||
fn is_empty(&self) -> bool {
|
||||
self.0.is_empty()
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> Default for DerivationAdditions<K> {
|
||||
impl<K> Default for ChangeSet<K> {
|
||||
fn default() -> Self {
|
||||
Self(Default::default())
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> AsRef<BTreeMap<K, u32>> for DerivationAdditions<K> {
|
||||
impl<K> AsRef<BTreeMap<K, u32>> for ChangeSet<K> {
|
||||
fn as_ref(&self) -> &BTreeMap<K, u32> {
|
||||
&self.0
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure to update [`KeychainTxOutIndex`], [`TxGraph`] and [`LocalChain`]
|
||||
/// atomically.
|
||||
#[derive(Debug, Clone, PartialEq)]
|
||||
pub struct LocalUpdate<K, A> {
|
||||
/// Last active derivation index per keychain (`K`).
|
||||
pub keychain: BTreeMap<K, u32>,
|
||||
/// Update for the [`TxGraph`].
|
||||
pub graph: TxGraph<A>,
|
||||
/// Update for the [`LocalChain`].
|
||||
pub chain: LocalChain,
|
||||
}
|
||||
|
||||
impl<K, A> Default for LocalUpdate<K, A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
keychain: Default::default(),
|
||||
graph: Default::default(),
|
||||
chain: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that records the corresponding changes as result of applying an [`LocalUpdate`].
|
||||
#[derive(Debug, Clone, PartialEq)]
|
||||
#[cfg_attr(
|
||||
feature = "serde",
|
||||
derive(serde::Deserialize, serde::Serialize),
|
||||
serde(
|
||||
crate = "serde_crate",
|
||||
bound(
|
||||
deserialize = "K: Ord + serde::Deserialize<'de>, A: Ord + serde::Deserialize<'de>",
|
||||
serialize = "K: Ord + serde::Serialize, A: Ord + serde::Serialize",
|
||||
)
|
||||
)
|
||||
)]
|
||||
pub struct LocalChangeSet<K, A> {
|
||||
/// Changes to the [`LocalChain`].
|
||||
pub chain_changeset: local_chain::ChangeSet,
|
||||
|
||||
/// Additions to [`IndexedTxGraph`].
|
||||
///
|
||||
/// [`IndexedTxGraph`]: crate::indexed_tx_graph::IndexedTxGraph
|
||||
pub indexed_additions: IndexedAdditions<A, DerivationAdditions<K>>,
|
||||
}
|
||||
|
||||
impl<K, A> Default for LocalChangeSet<K, A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
chain_changeset: Default::default(),
|
||||
indexed_additions: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Ord, A: Anchor> Append for LocalChangeSet<K, A> {
|
||||
fn append(&mut self, other: Self) {
|
||||
Append::append(&mut self.chain_changeset, other.chain_changeset);
|
||||
Append::append(&mut self.indexed_additions, other.indexed_additions);
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
self.chain_changeset.is_empty() && self.indexed_additions.is_empty()
|
||||
}
|
||||
}
|
||||
|
||||
impl<K, A> From<local_chain::ChangeSet> for LocalChangeSet<K, A> {
|
||||
fn from(chain_changeset: local_chain::ChangeSet) -> Self {
|
||||
Self {
|
||||
chain_changeset,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<K, A> From<IndexedAdditions<A, DerivationAdditions<K>>> for LocalChangeSet<K, A> {
|
||||
fn from(indexed_additions: IndexedAdditions<A, DerivationAdditions<K>>) -> Self {
|
||||
Self {
|
||||
indexed_additions,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Balance, differentiated into various categories.
|
||||
#[derive(Debug, PartialEq, Eq, Clone, Default)]
|
||||
#[cfg_attr(
|
||||
@@ -250,8 +158,8 @@ mod test {
|
||||
lhs_di.insert(Keychain::Three, 3);
|
||||
rhs_di.insert(Keychain::Four, 4);
|
||||
|
||||
let mut lhs = DerivationAdditions(lhs_di);
|
||||
let rhs = DerivationAdditions(rhs_di);
|
||||
let mut lhs = ChangeSet(lhs_di);
|
||||
let rhs = ChangeSet(rhs_di);
|
||||
lhs.append(rhs);
|
||||
|
||||
// Exiting index doesn't update if the new index in `other` is lower than `self`.
|
||||
|
||||
@@ -3,7 +3,7 @@ use crate::{
|
||||
indexed_tx_graph::Indexer,
|
||||
miniscript::{Descriptor, DescriptorPublicKey},
|
||||
spk_iter::BIP32_MAX_INDEX,
|
||||
ForEachTxOut, SpkIterator, SpkTxOutIndex,
|
||||
SpkIterator, SpkTxOutIndex,
|
||||
};
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{OutPoint, Script, TxOut};
|
||||
@@ -11,8 +11,6 @@ use core::{fmt::Debug, ops::Deref};
|
||||
|
||||
use crate::Append;
|
||||
|
||||
use super::DerivationAdditions;
|
||||
|
||||
/// A convenient wrapper around [`SpkTxOutIndex`] that relates script pubkeys to miniscript public
|
||||
/// [`Descriptor`]s.
|
||||
///
|
||||
@@ -23,7 +21,7 @@ use super::DerivationAdditions;
|
||||
/// revealed. In addition to revealed scripts, we have a `lookahead` parameter for each keychain,
|
||||
/// which defines the number of script pubkeys to store ahead of the last revealed index.
|
||||
///
|
||||
/// Methods that could update the last revealed index will return [`DerivationAdditions`] to report
|
||||
/// Methods that could update the last revealed index will return [`super::ChangeSet`] to report
|
||||
/// these changes. This can be persisted for future recovery.
|
||||
///
|
||||
/// ## Synopsis
|
||||
@@ -90,18 +88,29 @@ impl<K> Deref for KeychainTxOutIndex<K> {
|
||||
}
|
||||
|
||||
impl<K: Clone + Ord + Debug> Indexer for KeychainTxOutIndex<K> {
|
||||
type Additions = DerivationAdditions<K>;
|
||||
type ChangeSet = super::ChangeSet<K>;
|
||||
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::Additions {
|
||||
self.scan_txout(outpoint, txout)
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet {
|
||||
match self.inner.scan_txout(outpoint, txout).cloned() {
|
||||
Some((keychain, index)) => self.reveal_to_target(&keychain, index).1,
|
||||
None => super::ChangeSet::default(),
|
||||
}
|
||||
}
|
||||
|
||||
fn index_tx(&mut self, tx: &bitcoin::Transaction) -> Self::Additions {
|
||||
self.scan(tx)
|
||||
fn index_tx(&mut self, tx: &bitcoin::Transaction) -> Self::ChangeSet {
|
||||
let mut changeset = super::ChangeSet::<K>::default();
|
||||
for (op, txout) in tx.output.iter().enumerate() {
|
||||
changeset.append(self.index_txout(OutPoint::new(tx.txid(), op as u32), txout));
|
||||
}
|
||||
changeset
|
||||
}
|
||||
|
||||
fn apply_additions(&mut self, additions: Self::Additions) {
|
||||
self.apply_additions(additions)
|
||||
fn initial_changeset(&self) -> Self::ChangeSet {
|
||||
super::ChangeSet(self.last_revealed.clone())
|
||||
}
|
||||
|
||||
fn apply_changeset(&mut self, changeset: Self::ChangeSet) {
|
||||
self.apply_changeset(changeset)
|
||||
}
|
||||
|
||||
fn is_tx_relevant(&self, tx: &bitcoin::Transaction) -> bool {
|
||||
@@ -110,38 +119,6 @@ impl<K: Clone + Ord + Debug> Indexer for KeychainTxOutIndex<K> {
|
||||
}
|
||||
|
||||
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// Scans an object for relevant outpoints, which are stored and indexed internally.
|
||||
///
|
||||
/// If the matched script pubkey is part of the lookahead, the last stored index is updated for
|
||||
/// the script pubkey's keychain and the [`DerivationAdditions`] returned will reflect the
|
||||
/// change.
|
||||
///
|
||||
/// Typically, this method is used in two situations:
|
||||
///
|
||||
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
||||
/// your txouts.
|
||||
/// 2. When getting new data from the chain, you usually scan it before incorporating it into
|
||||
/// your chain state (i.e., `SparseChain`, `ChainGraph`).
|
||||
///
|
||||
/// See [`ForEachTxout`] for the types that support this.
|
||||
///
|
||||
/// [`ForEachTxout`]: crate::ForEachTxOut
|
||||
pub fn scan(&mut self, txouts: &impl ForEachTxOut) -> DerivationAdditions<K> {
|
||||
let mut additions = DerivationAdditions::<K>::default();
|
||||
txouts.for_each_txout(|(op, txout)| additions.append(self.scan_txout(op, txout)));
|
||||
additions
|
||||
}
|
||||
|
||||
/// Scan a single outpoint for a matching script pubkey.
|
||||
///
|
||||
/// If it matches, this will store and index it.
|
||||
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> DerivationAdditions<K> {
|
||||
match self.inner.scan_txout(op, txout).cloned() {
|
||||
Some((keychain, index)) => self.reveal_to_target(&keychain, index).1,
|
||||
None => DerivationAdditions::default(),
|
||||
}
|
||||
}
|
||||
|
||||
/// Return a reference to the internal [`SpkTxOutIndex`].
|
||||
pub fn inner(&self) -> &SpkTxOutIndex<(K, u32)> {
|
||||
&self.inner
|
||||
@@ -190,22 +167,20 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// [`set_lookahead`]: Self::set_lookahead
|
||||
pub fn set_lookahead_for_all(&mut self, lookahead: u32) {
|
||||
for keychain in &self.keychains.keys().cloned().collect::<Vec<_>>() {
|
||||
self.lookahead.insert(keychain.clone(), lookahead);
|
||||
self.replenish_lookahead(keychain);
|
||||
self.set_lookahead(keychain, lookahead);
|
||||
}
|
||||
}
|
||||
|
||||
/// Set the lookahead count for `keychain`.
|
||||
///
|
||||
/// The lookahead is the number of scripts to cache ahead of the last stored script index. This
|
||||
/// is useful during a scan via [`scan`] or [`scan_txout`].
|
||||
/// The lookahead is the number of scripts to cache ahead of the last revealed script index. This
|
||||
/// is useful to find outputs you own when processing block data that lie beyond the last revealed
|
||||
/// index. In certain situations, such as when performing an initial scan of the blockchain during
|
||||
/// wallet import, it may be uncertain or unknown what the last revealed index is.
|
||||
///
|
||||
/// # Panics
|
||||
///
|
||||
/// This will panic if the `keychain` does not exist.
|
||||
///
|
||||
/// [`scan`]: Self::scan
|
||||
/// [`scan_txout`]: Self::scan_txout
|
||||
pub fn set_lookahead(&mut self, keychain: &K, lookahead: u32) {
|
||||
self.lookahead.insert(keychain.clone(), lookahead);
|
||||
self.replenish_lookahead(keychain);
|
||||
@@ -313,7 +288,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
self.inner
|
||||
.all_spks()
|
||||
.range((keychain.clone(), u32::MIN)..(keychain.clone(), next_index))
|
||||
.map(|((_, derivation_index), spk)| (*derivation_index, spk))
|
||||
.map(|((_, derivation_index), spk)| (*derivation_index, spk.as_script()))
|
||||
}
|
||||
|
||||
/// Get the next derivation index for `keychain`. The next index is the index after the last revealed
|
||||
@@ -370,20 +345,20 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
keychains: &BTreeMap<K, u32>,
|
||||
) -> (
|
||||
BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>>,
|
||||
DerivationAdditions<K>,
|
||||
super::ChangeSet<K>,
|
||||
) {
|
||||
let mut additions = DerivationAdditions::default();
|
||||
let mut changeset = super::ChangeSet::default();
|
||||
let mut spks = BTreeMap::new();
|
||||
|
||||
for (keychain, &index) in keychains {
|
||||
let (new_spks, new_additions) = self.reveal_to_target(keychain, index);
|
||||
if !new_additions.is_empty() {
|
||||
let (new_spks, new_changeset) = self.reveal_to_target(keychain, index);
|
||||
if !new_changeset.is_empty() {
|
||||
spks.insert(keychain.clone(), new_spks);
|
||||
additions.append(new_additions.clone());
|
||||
changeset.append(new_changeset.clone());
|
||||
}
|
||||
}
|
||||
|
||||
(spks, additions)
|
||||
(spks, changeset)
|
||||
}
|
||||
|
||||
/// Reveals script pubkeys of the `keychain`'s descriptor **up to and including** the
|
||||
@@ -394,7 +369,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// reveal up to the last possible index.
|
||||
///
|
||||
/// This returns an iterator of newly revealed indices (alongside their scripts) and a
|
||||
/// [`DerivationAdditions`], which reports updates to the latest revealed index. If no new script
|
||||
/// [`super::ChangeSet`], which reports updates to the latest revealed index. If no new script
|
||||
/// pubkeys are revealed, then both of these will be empty.
|
||||
///
|
||||
/// # Panics
|
||||
@@ -406,7 +381,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
target_index: u32,
|
||||
) -> (
|
||||
SpkIterator<Descriptor<DescriptorPublicKey>>,
|
||||
DerivationAdditions<K>,
|
||||
super::ChangeSet<K>,
|
||||
) {
|
||||
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||
let has_wildcard = descriptor.has_wildcard();
|
||||
@@ -450,7 +425,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
debug_assert!(_old_index < Some(index));
|
||||
(
|
||||
SpkIterator::new_with_range(descriptor.clone(), next_reveal_index..index + 1),
|
||||
DerivationAdditions(core::iter::once((keychain.clone(), index)).collect()),
|
||||
super::ChangeSet(core::iter::once((keychain.clone(), index)).collect()),
|
||||
)
|
||||
}
|
||||
None => (
|
||||
@@ -458,7 +433,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
descriptor.clone(),
|
||||
next_reveal_index..next_reveal_index,
|
||||
),
|
||||
DerivationAdditions::default(),
|
||||
super::ChangeSet::default(),
|
||||
),
|
||||
}
|
||||
}
|
||||
@@ -466,10 +441,10 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// Attempts to reveal the next script pubkey for `keychain`.
|
||||
///
|
||||
/// Returns the derivation index of the revealed script pubkey, the revealed script pubkey and a
|
||||
/// [`DerivationAdditions`] which represents changes in the last revealed index (if any).
|
||||
/// [`super::ChangeSet`] which represents changes in the last revealed index (if any).
|
||||
///
|
||||
/// When a new script cannot be revealed, we return the last revealed script and an empty
|
||||
/// [`DerivationAdditions`]. There are two scenarios when a new script pubkey cannot be derived:
|
||||
/// [`super::ChangeSet`]. There are two scenarios when a new script pubkey cannot be derived:
|
||||
///
|
||||
/// 1. The descriptor has no wildcard and already has one script revealed.
|
||||
/// 2. The descriptor has already revealed scripts up to the numeric bound.
|
||||
@@ -477,14 +452,14 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// # Panics
|
||||
///
|
||||
/// Panics if the `keychain` does not exist.
|
||||
pub fn reveal_next_spk(&mut self, keychain: &K) -> ((u32, &Script), DerivationAdditions<K>) {
|
||||
pub fn reveal_next_spk(&mut self, keychain: &K) -> ((u32, &Script), super::ChangeSet<K>) {
|
||||
let (next_index, _) = self.next_index(keychain);
|
||||
let additions = self.reveal_to_target(keychain, next_index).1;
|
||||
let changeset = self.reveal_to_target(keychain, next_index).1;
|
||||
let script = self
|
||||
.inner
|
||||
.spk_at_index(&(keychain.clone(), next_index))
|
||||
.expect("script must already be stored");
|
||||
((next_index, script), additions)
|
||||
((next_index, script), changeset)
|
||||
}
|
||||
|
||||
/// Gets the next unused script pubkey in the keychain. I.e., the script pubkey with the lowest
|
||||
@@ -499,7 +474,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
/// # Panics
|
||||
///
|
||||
/// Panics if `keychain` has never been added to the index
|
||||
pub fn next_unused_spk(&mut self, keychain: &K) -> ((u32, &Script), DerivationAdditions<K>) {
|
||||
pub fn next_unused_spk(&mut self, keychain: &K) -> ((u32, &Script), super::ChangeSet<K>) {
|
||||
let need_new = self.unused_spks_of_keychain(keychain).next().is_none();
|
||||
// this rather strange branch is needed because of some lifetime issues
|
||||
if need_new {
|
||||
@@ -509,7 +484,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
self.unused_spks_of_keychain(keychain)
|
||||
.next()
|
||||
.expect("we already know next exists"),
|
||||
DerivationAdditions::default(),
|
||||
super::ChangeSet::default(),
|
||||
)
|
||||
}
|
||||
}
|
||||
@@ -580,9 +555,9 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||
.collect()
|
||||
}
|
||||
|
||||
/// Applies the derivation additions to the [`KeychainTxOutIndex`], extending the number of
|
||||
/// derived scripts per keychain, as specified in the `additions`.
|
||||
pub fn apply_additions(&mut self, additions: DerivationAdditions<K>) {
|
||||
let _ = self.reveal_to_target_multi(&additions.0);
|
||||
/// Applies the derivation changeset to the [`KeychainTxOutIndex`], extending the number of
|
||||
/// derived scripts per keychain, as specified in the `changeset`.
|
||||
pub fn apply_changeset(&mut self, changeset: super::ChangeSet<K>) {
|
||||
let _ = self.reveal_to_target_multi(&changeset.0);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -2,15 +2,199 @@
|
||||
|
||||
use core::convert::Infallible;
|
||||
|
||||
use alloc::collections::BTreeMap;
|
||||
use crate::collections::BTreeMap;
|
||||
use crate::{BlockId, ChainOracle};
|
||||
use alloc::sync::Arc;
|
||||
use bitcoin::BlockHash;
|
||||
|
||||
use crate::{BlockId, ChainOracle};
|
||||
/// A structure that represents changes to [`LocalChain`].
|
||||
///
|
||||
/// The key represents the block height, and the value either represents added a new [`CheckPoint`]
|
||||
/// (if [`Some`]), or removing a [`CheckPoint`] (if [`None`]).
|
||||
pub type ChangeSet = BTreeMap<u32, Option<BlockHash>>;
|
||||
|
||||
/// A [`LocalChain`] checkpoint is used to find the agreement point between two chains and as a
|
||||
/// transaction anchor.
|
||||
///
|
||||
/// Each checkpoint contains the height and hash of a block ([`BlockId`]).
|
||||
///
|
||||
/// Internally, checkpoints are nodes of a reference-counted linked-list. This allows the caller to
|
||||
/// cheaply clone a [`CheckPoint`] without copying the whole list and to view the entire chain
|
||||
/// without holding a lock on [`LocalChain`].
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct CheckPoint(Arc<CPInner>);
|
||||
|
||||
/// The internal contents of [`CheckPoint`].
|
||||
#[derive(Debug, Clone)]
|
||||
struct CPInner {
|
||||
/// Block id (hash and height).
|
||||
block: BlockId,
|
||||
/// Previous checkpoint (if any).
|
||||
prev: Option<Arc<CPInner>>,
|
||||
}
|
||||
|
||||
impl CheckPoint {
|
||||
/// Construct a new base block at the front of a linked list.
|
||||
pub fn new(block: BlockId) -> Self {
|
||||
Self(Arc::new(CPInner { block, prev: None }))
|
||||
}
|
||||
|
||||
/// Construct a checkpoint from the given `header` and block `height`.
|
||||
///
|
||||
/// If `header` is of the genesis block, the checkpoint won't have a [`prev`] node. Otherwise,
|
||||
/// we return a checkpoint linked with the previous block.
|
||||
///
|
||||
/// [`prev`]: CheckPoint::prev
|
||||
pub fn from_header(header: &bitcoin::block::Header, height: u32) -> Self {
|
||||
let hash = header.block_hash();
|
||||
let this_block_id = BlockId { height, hash };
|
||||
|
||||
let prev_height = match height.checked_sub(1) {
|
||||
Some(h) => h,
|
||||
None => return Self::new(this_block_id),
|
||||
};
|
||||
|
||||
let prev_block_id = BlockId {
|
||||
height: prev_height,
|
||||
hash: header.prev_blockhash,
|
||||
};
|
||||
|
||||
CheckPoint::new(prev_block_id)
|
||||
.push(this_block_id)
|
||||
.expect("must construct checkpoint")
|
||||
}
|
||||
|
||||
/// Convenience method to convert the [`CheckPoint`] into an [`Update`].
|
||||
///
|
||||
/// For more information, refer to [`Update`].
|
||||
pub fn into_update(self, introduce_older_blocks: bool) -> Update {
|
||||
Update {
|
||||
tip: self,
|
||||
introduce_older_blocks,
|
||||
}
|
||||
}
|
||||
|
||||
/// Puts another checkpoint onto the linked list representing the blockchain.
|
||||
///
|
||||
/// Returns an `Err(self)` if the block you are pushing on is not at a greater height that the one you
|
||||
/// are pushing on to.
|
||||
pub fn push(self, block: BlockId) -> Result<Self, Self> {
|
||||
if self.height() < block.height {
|
||||
Ok(Self(Arc::new(CPInner {
|
||||
block,
|
||||
prev: Some(self.0),
|
||||
})))
|
||||
} else {
|
||||
Err(self)
|
||||
}
|
||||
}
|
||||
|
||||
/// Extends the checkpoint linked list by a iterator of block ids.
|
||||
///
|
||||
/// Returns an `Err(self)` if there is block which does not have a greater height than the
|
||||
/// previous one.
|
||||
pub fn extend(self, blocks: impl IntoIterator<Item = BlockId>) -> Result<Self, Self> {
|
||||
let mut curr = self.clone();
|
||||
for block in blocks {
|
||||
curr = curr.push(block).map_err(|_| self.clone())?;
|
||||
}
|
||||
Ok(curr)
|
||||
}
|
||||
|
||||
/// Get the [`BlockId`] of the checkpoint.
|
||||
pub fn block_id(&self) -> BlockId {
|
||||
self.0.block
|
||||
}
|
||||
|
||||
/// Get the height of the checkpoint.
|
||||
pub fn height(&self) -> u32 {
|
||||
self.0.block.height
|
||||
}
|
||||
|
||||
/// Get the block hash of the checkpoint.
|
||||
pub fn hash(&self) -> BlockHash {
|
||||
self.0.block.hash
|
||||
}
|
||||
|
||||
/// Get the previous checkpoint in the chain
|
||||
pub fn prev(&self) -> Option<CheckPoint> {
|
||||
self.0.prev.clone().map(CheckPoint)
|
||||
}
|
||||
|
||||
/// Iterate from this checkpoint in descending height.
|
||||
pub fn iter(&self) -> CheckPointIter {
|
||||
self.clone().into_iter()
|
||||
}
|
||||
}
|
||||
|
||||
/// A structure that iterates over checkpoints backwards.
|
||||
pub struct CheckPointIter {
|
||||
current: Option<Arc<CPInner>>,
|
||||
}
|
||||
|
||||
impl Iterator for CheckPointIter {
|
||||
type Item = CheckPoint;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
let current = self.current.clone()?;
|
||||
self.current = current.prev.clone();
|
||||
Some(CheckPoint(current))
|
||||
}
|
||||
}
|
||||
|
||||
impl IntoIterator for CheckPoint {
|
||||
type Item = CheckPoint;
|
||||
type IntoIter = CheckPointIter;
|
||||
|
||||
fn into_iter(self) -> Self::IntoIter {
|
||||
CheckPointIter {
|
||||
current: Some(self.0),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// A struct to update [`LocalChain`].
|
||||
///
|
||||
/// This is used as input for [`LocalChain::apply_update`]. It contains the update's chain `tip` and
|
||||
/// a flag `introduce_older_blocks` which signals whether this update intends to introduce missing
|
||||
/// blocks to the original chain.
|
||||
///
|
||||
/// Block-by-block syncing mechanisms would typically create updates that builds upon the previous
|
||||
/// tip. In this case, `introduce_older_blocks` would be `false`.
|
||||
///
|
||||
/// Script-pubkey based syncing mechanisms may not introduce transactions in a chronological order
|
||||
/// so some updates require introducing older blocks (to anchor older transactions). For
|
||||
/// script-pubkey based syncing, `introduce_older_blocks` would typically be `true`.
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct Update {
|
||||
/// The update chain's new tip.
|
||||
pub tip: CheckPoint,
|
||||
|
||||
/// Whether the update allows for introducing older blocks.
|
||||
///
|
||||
/// Refer to [struct-level documentation] for more.
|
||||
///
|
||||
/// [struct-level documentation]: Update
|
||||
pub introduce_older_blocks: bool,
|
||||
}
|
||||
|
||||
/// This is a local implementation of [`ChainOracle`].
|
||||
#[derive(Debug, Default, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct LocalChain {
|
||||
blocks: BTreeMap<u32, BlockHash>,
|
||||
tip: CheckPoint,
|
||||
index: BTreeMap<u32, BlockHash>,
|
||||
}
|
||||
|
||||
impl PartialEq for LocalChain {
|
||||
fn eq(&self, other: &Self) -> bool {
|
||||
self.index == other.index
|
||||
}
|
||||
}
|
||||
|
||||
impl From<LocalChain> for BTreeMap<u32, BlockHash> {
|
||||
fn from(value: LocalChain) -> Self {
|
||||
value.index
|
||||
}
|
||||
}
|
||||
|
||||
impl ChainOracle for LocalChain {
|
||||
@@ -19,232 +203,439 @@ impl ChainOracle for LocalChain {
|
||||
fn is_block_in_chain(
|
||||
&self,
|
||||
block: BlockId,
|
||||
static_block: BlockId,
|
||||
chain_tip: BlockId,
|
||||
) -> Result<Option<bool>, Self::Error> {
|
||||
if block.height > static_block.height {
|
||||
if block.height > chain_tip.height {
|
||||
return Ok(None);
|
||||
}
|
||||
Ok(
|
||||
match (
|
||||
self.blocks.get(&block.height),
|
||||
self.blocks.get(&static_block.height),
|
||||
self.index.get(&block.height),
|
||||
self.index.get(&chain_tip.height),
|
||||
) {
|
||||
(Some(&hash), Some(&static_hash)) => {
|
||||
Some(hash == block.hash && static_hash == static_block.hash)
|
||||
}
|
||||
(Some(cp), Some(tip_cp)) => Some(*cp == block.hash && *tip_cp == chain_tip.hash),
|
||||
_ => None,
|
||||
},
|
||||
)
|
||||
}
|
||||
|
||||
fn get_chain_tip(&self) -> Result<Option<BlockId>, Self::Error> {
|
||||
Ok(self.tip())
|
||||
}
|
||||
}
|
||||
|
||||
impl AsRef<BTreeMap<u32, BlockHash>> for LocalChain {
|
||||
fn as_ref(&self) -> &BTreeMap<u32, BlockHash> {
|
||||
&self.blocks
|
||||
}
|
||||
}
|
||||
|
||||
impl From<LocalChain> for BTreeMap<u32, BlockHash> {
|
||||
fn from(value: LocalChain) -> Self {
|
||||
value.blocks
|
||||
}
|
||||
}
|
||||
|
||||
impl From<BTreeMap<u32, BlockHash>> for LocalChain {
|
||||
fn from(value: BTreeMap<u32, BlockHash>) -> Self {
|
||||
Self { blocks: value }
|
||||
fn get_chain_tip(&self) -> Result<BlockId, Self::Error> {
|
||||
Ok(self.tip.block_id())
|
||||
}
|
||||
}
|
||||
|
||||
impl LocalChain {
|
||||
/// Contruct a [`LocalChain`] from a list of [`BlockId`]s.
|
||||
pub fn from_blocks<B>(blocks: B) -> Self
|
||||
where
|
||||
B: IntoIterator<Item = BlockId>,
|
||||
{
|
||||
Self {
|
||||
blocks: blocks.into_iter().map(|b| (b.height, b.hash)).collect(),
|
||||
}
|
||||
/// Get the genesis hash.
|
||||
pub fn genesis_hash(&self) -> BlockHash {
|
||||
self.index.get(&0).copied().expect("must have genesis hash")
|
||||
}
|
||||
|
||||
/// Get a reference to a map of block height to hash.
|
||||
pub fn blocks(&self) -> &BTreeMap<u32, BlockHash> {
|
||||
&self.blocks
|
||||
/// Construct [`LocalChain`] from genesis `hash`.
|
||||
#[must_use]
|
||||
pub fn from_genesis_hash(hash: BlockHash) -> (Self, ChangeSet) {
|
||||
let height = 0;
|
||||
let chain = Self {
|
||||
tip: CheckPoint::new(BlockId { height, hash }),
|
||||
index: core::iter::once((height, hash)).collect(),
|
||||
};
|
||||
let changeset = chain.initial_changeset();
|
||||
(chain, changeset)
|
||||
}
|
||||
|
||||
/// Get the chain tip.
|
||||
pub fn tip(&self) -> Option<BlockId> {
|
||||
self.blocks
|
||||
.iter()
|
||||
.last()
|
||||
.map(|(&height, &hash)| BlockId { height, hash })
|
||||
}
|
||||
|
||||
/// This is like the sparsechain's logic, expect we must guarantee that all invalidated heights
|
||||
/// are to be re-filled.
|
||||
pub fn determine_changeset(&self, update: &Self) -> Result<ChangeSet, UpdateNotConnectedError> {
|
||||
let update = update.as_ref();
|
||||
let update_tip = match update.keys().last().cloned() {
|
||||
Some(tip) => tip,
|
||||
None => return Ok(ChangeSet::default()),
|
||||
/// Construct a [`LocalChain`] from an initial `changeset`.
|
||||
pub fn from_changeset(changeset: ChangeSet) -> Result<Self, MissingGenesisError> {
|
||||
let genesis_entry = changeset.get(&0).copied().flatten();
|
||||
let genesis_hash = match genesis_entry {
|
||||
Some(hash) => hash,
|
||||
None => return Err(MissingGenesisError),
|
||||
};
|
||||
|
||||
// this is the latest height where both the update and local chain has the same block hash
|
||||
let agreement_height = update
|
||||
.iter()
|
||||
.rev()
|
||||
.find(|&(u_height, u_hash)| self.blocks.get(u_height) == Some(u_hash))
|
||||
.map(|(&height, _)| height);
|
||||
let (mut chain, _) = Self::from_genesis_hash(genesis_hash);
|
||||
chain.apply_changeset(&changeset)?;
|
||||
|
||||
// the lower bound of the range to invalidate
|
||||
let invalidate_lb = match agreement_height {
|
||||
Some(height) if height == update_tip => u32::MAX,
|
||||
Some(height) => height + 1,
|
||||
None => 0,
|
||||
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||
debug_assert!(chain._check_changeset_is_applied(&changeset));
|
||||
|
||||
Ok(chain)
|
||||
}
|
||||
|
||||
/// Construct a [`LocalChain`] from a given `checkpoint` tip.
|
||||
pub fn from_tip(tip: CheckPoint) -> Result<Self, MissingGenesisError> {
|
||||
let mut chain = Self {
|
||||
tip,
|
||||
index: BTreeMap::new(),
|
||||
};
|
||||
chain.reindex(0);
|
||||
|
||||
if chain.index.get(&0).copied().is_none() {
|
||||
return Err(MissingGenesisError);
|
||||
}
|
||||
|
||||
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||
Ok(chain)
|
||||
}
|
||||
|
||||
/// Constructs a [`LocalChain`] from a [`BTreeMap`] of height to [`BlockHash`].
|
||||
///
|
||||
/// The [`BTreeMap`] enforces the height order. However, the caller must ensure the blocks are
|
||||
/// all of the same chain.
|
||||
pub fn from_blocks(blocks: BTreeMap<u32, BlockHash>) -> Result<Self, MissingGenesisError> {
|
||||
if !blocks.contains_key(&0) {
|
||||
return Err(MissingGenesisError);
|
||||
}
|
||||
|
||||
let mut tip: Option<CheckPoint> = None;
|
||||
|
||||
for block in &blocks {
|
||||
match tip {
|
||||
Some(curr) => {
|
||||
tip = Some(
|
||||
curr.push(BlockId::from(block))
|
||||
.expect("BTreeMap is ordered"),
|
||||
)
|
||||
}
|
||||
None => tip = Some(CheckPoint::new(BlockId::from(block))),
|
||||
}
|
||||
}
|
||||
|
||||
let chain = Self {
|
||||
index: blocks,
|
||||
tip: tip.expect("already checked to have genesis"),
|
||||
};
|
||||
|
||||
// the first block's height to invalidate in the local chain
|
||||
let invalidate_from_height = self.blocks.range(invalidate_lb..).next().map(|(&h, _)| h);
|
||||
|
||||
// the first block of height to invalidate (if any) should be represented in the update
|
||||
if let Some(first_invalid_height) = invalidate_from_height {
|
||||
if !update.contains_key(&first_invalid_height) {
|
||||
return Err(UpdateNotConnectedError(first_invalid_height));
|
||||
}
|
||||
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||
Ok(chain)
|
||||
}
|
||||
|
||||
let mut changeset: BTreeMap<u32, Option<BlockHash>> = match invalidate_from_height {
|
||||
Some(first_invalid_height) => {
|
||||
// the first block of height to invalidate should be represented in the update
|
||||
if !update.contains_key(&first_invalid_height) {
|
||||
return Err(UpdateNotConnectedError(first_invalid_height));
|
||||
}
|
||||
self.blocks
|
||||
.range(first_invalid_height..)
|
||||
.map(|(height, _)| (*height, None))
|
||||
.collect()
|
||||
}
|
||||
None => BTreeMap::new(),
|
||||
};
|
||||
for (height, update_hash) in update {
|
||||
let original_hash = self.blocks.get(height);
|
||||
if Some(update_hash) != original_hash {
|
||||
changeset.insert(*height, Some(*update_hash));
|
||||
}
|
||||
/// Get the highest checkpoint.
|
||||
pub fn tip(&self) -> CheckPoint {
|
||||
self.tip.clone()
|
||||
}
|
||||
|
||||
/// Applies the given `update` to the chain.
|
||||
///
|
||||
/// The method returns [`ChangeSet`] on success. This represents the applied changes to `self`.
|
||||
///
|
||||
/// There must be no ambiguity about which of the existing chain's blocks are still valid and
|
||||
/// which are now invalid. That is, the new chain must implicitly connect to a definite block in
|
||||
/// the existing chain and invalidate the block after it (if it exists) by including a block at
|
||||
/// the same height but with a different hash to explicitly exclude it as a connection point.
|
||||
///
|
||||
/// Additionally, an empty chain can be updated with any chain, and a chain with a single block
|
||||
/// can have it's block invalidated by an update chain with a block at the same height but
|
||||
/// different hash.
|
||||
///
|
||||
/// # Errors
|
||||
///
|
||||
/// An error will occur if the update does not correctly connect with `self`.
|
||||
///
|
||||
/// Refer to [`Update`] for more about the update struct.
|
||||
///
|
||||
/// [module-level documentation]: crate::local_chain
|
||||
pub fn apply_update(&mut self, update: Update) -> Result<ChangeSet, CannotConnectError> {
|
||||
let changeset = merge_chains(
|
||||
self.tip.clone(),
|
||||
update.tip.clone(),
|
||||
update.introduce_older_blocks,
|
||||
)?;
|
||||
// `._check_index_is_consistent_with_tip` and `._check_changeset_is_applied` is called in
|
||||
// `.apply_changeset`
|
||||
self.apply_changeset(&changeset)
|
||||
.map_err(|_| CannotConnectError {
|
||||
try_include_height: 0,
|
||||
})?;
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Applies the given `changeset`.
|
||||
pub fn apply_changeset(&mut self, changeset: ChangeSet) {
|
||||
for (height, blockhash) in changeset {
|
||||
match blockhash {
|
||||
Some(blockhash) => self.blocks.insert(height, blockhash),
|
||||
None => self.blocks.remove(&height),
|
||||
/// Apply the given `changeset`.
|
||||
pub fn apply_changeset(&mut self, changeset: &ChangeSet) -> Result<(), MissingGenesisError> {
|
||||
if let Some(start_height) = changeset.keys().next().cloned() {
|
||||
// changes after point of agreement
|
||||
let mut extension = BTreeMap::default();
|
||||
// point of agreement
|
||||
let mut base: Option<CheckPoint> = None;
|
||||
|
||||
for cp in self.iter_checkpoints() {
|
||||
if cp.height() >= start_height {
|
||||
extension.insert(cp.height(), cp.hash());
|
||||
} else {
|
||||
base = Some(cp);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
for (&height, &hash) in changeset {
|
||||
match hash {
|
||||
Some(hash) => {
|
||||
extension.insert(height, hash);
|
||||
}
|
||||
None => {
|
||||
extension.remove(&height);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
let new_tip = match base {
|
||||
Some(base) => base
|
||||
.extend(extension.into_iter().map(BlockId::from))
|
||||
.expect("extension is strictly greater than base"),
|
||||
None => LocalChain::from_blocks(extension)?.tip(),
|
||||
};
|
||||
self.tip = new_tip;
|
||||
self.reindex(start_height);
|
||||
|
||||
debug_assert!(self._check_index_is_consistent_with_tip());
|
||||
debug_assert!(self._check_changeset_is_applied(changeset));
|
||||
}
|
||||
|
||||
/// Updates [`LocalChain`] with an update [`LocalChain`].
|
||||
///
|
||||
/// This is equivalent to calling [`determine_changeset`] and [`apply_changeset`] in sequence.
|
||||
///
|
||||
/// [`determine_changeset`]: Self::determine_changeset
|
||||
/// [`apply_changeset`]: Self::apply_changeset
|
||||
pub fn apply_update(&mut self, update: Self) -> Result<ChangeSet, UpdateNotConnectedError> {
|
||||
let changeset = self.determine_changeset(&update)?;
|
||||
self.apply_changeset(changeset.clone());
|
||||
Ok(changeset)
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Derives a [`ChangeSet`] that assumes that there are no preceding changesets.
|
||||
/// Insert a [`BlockId`].
|
||||
///
|
||||
/// The changeset returned will record additions of all blocks included in [`Self`].
|
||||
pub fn initial_changeset(&self) -> ChangeSet {
|
||||
self.blocks
|
||||
.iter()
|
||||
.map(|(&height, &hash)| (height, Some(hash)))
|
||||
.collect()
|
||||
}
|
||||
|
||||
/// Insert a block of [`BlockId`] into the [`LocalChain`].
|
||||
/// # Errors
|
||||
///
|
||||
/// # Error
|
||||
///
|
||||
/// If the insertion height already contains a block, and the block has a different blockhash,
|
||||
/// this will result in an [`InsertBlockNotMatchingError`].
|
||||
pub fn insert_block(
|
||||
&mut self,
|
||||
block_id: BlockId,
|
||||
) -> Result<ChangeSet, InsertBlockNotMatchingError> {
|
||||
let mut update = Self::from_blocks(self.tip());
|
||||
|
||||
if let Some(original_hash) = update.blocks.insert(block_id.height, block_id.hash) {
|
||||
/// Replacing the block hash of an existing checkpoint will result in an error.
|
||||
pub fn insert_block(&mut self, block_id: BlockId) -> Result<ChangeSet, AlterCheckPointError> {
|
||||
if let Some(&original_hash) = self.index.get(&block_id.height) {
|
||||
if original_hash != block_id.hash {
|
||||
return Err(InsertBlockNotMatchingError {
|
||||
return Err(AlterCheckPointError {
|
||||
height: block_id.height,
|
||||
original_hash,
|
||||
update_hash: block_id.hash,
|
||||
update_hash: Some(block_id.hash),
|
||||
});
|
||||
} else {
|
||||
return Ok(ChangeSet::default());
|
||||
}
|
||||
}
|
||||
|
||||
let mut changeset = ChangeSet::default();
|
||||
changeset.insert(block_id.height, Some(block_id.hash));
|
||||
self.apply_changeset(&changeset)
|
||||
.map_err(|_| AlterCheckPointError {
|
||||
height: 0,
|
||||
original_hash: self.genesis_hash(),
|
||||
update_hash: changeset.get(&0).cloned().flatten(),
|
||||
})?;
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Reindex the heights in the chain from (and including) `from` height
|
||||
fn reindex(&mut self, from: u32) {
|
||||
let _ = self.index.split_off(&from);
|
||||
for cp in self.iter_checkpoints() {
|
||||
if cp.height() < from {
|
||||
break;
|
||||
}
|
||||
self.index.insert(cp.height(), cp.hash());
|
||||
}
|
||||
}
|
||||
|
||||
/// Derives an initial [`ChangeSet`], meaning that it can be applied to an empty chain to
|
||||
/// recover the current chain.
|
||||
pub fn initial_changeset(&self) -> ChangeSet {
|
||||
self.index.iter().map(|(k, v)| (*k, Some(*v))).collect()
|
||||
}
|
||||
|
||||
/// Iterate over checkpoints in descending height order.
|
||||
pub fn iter_checkpoints(&self) -> CheckPointIter {
|
||||
CheckPointIter {
|
||||
current: Some(self.tip.0.clone()),
|
||||
}
|
||||
}
|
||||
|
||||
/// Get a reference to the internal index mapping the height to block hash.
|
||||
pub fn blocks(&self) -> &BTreeMap<u32, BlockHash> {
|
||||
&self.index
|
||||
}
|
||||
|
||||
fn _check_index_is_consistent_with_tip(&self) -> bool {
|
||||
let tip_history = self
|
||||
.tip
|
||||
.iter()
|
||||
.map(|cp| (cp.height(), cp.hash()))
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
self.index == tip_history
|
||||
}
|
||||
|
||||
fn _check_changeset_is_applied(&self, changeset: &ChangeSet) -> bool {
|
||||
for (height, exp_hash) in changeset {
|
||||
if self.index.get(height) != exp_hash.as_ref() {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
true
|
||||
}
|
||||
}
|
||||
|
||||
/// An error which occurs when a [`LocalChain`] is constructed without a genesis checkpoint.
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct MissingGenesisError;
|
||||
|
||||
impl core::fmt::Display for MissingGenesisError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"cannot construct `LocalChain` without a genesis checkpoint"
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for MissingGenesisError {}
|
||||
|
||||
/// Represents a failure when trying to insert/remove a checkpoint to/from [`LocalChain`].
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct AlterCheckPointError {
|
||||
/// The checkpoint's height.
|
||||
pub height: u32,
|
||||
/// The original checkpoint's block hash which cannot be replaced/removed.
|
||||
pub original_hash: BlockHash,
|
||||
/// The attempted update to the `original_block` hash.
|
||||
pub update_hash: Option<BlockHash>,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for AlterCheckPointError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self.update_hash {
|
||||
Some(update_hash) => write!(
|
||||
f,
|
||||
"failed to insert block at height {}: original={} update={}",
|
||||
self.height, self.original_hash, update_hash
|
||||
),
|
||||
None => write!(
|
||||
f,
|
||||
"failed to remove block at height {}: original={}",
|
||||
self.height, self.original_hash
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for AlterCheckPointError {}
|
||||
|
||||
/// Occurs when an update does not have a common checkpoint with the original chain.
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct CannotConnectError {
|
||||
/// The suggested checkpoint to include to connect the two chains.
|
||||
pub try_include_height: u32,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for CannotConnectError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"introduced chain cannot connect with the original chain, try include height {}",
|
||||
self.try_include_height,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for CannotConnectError {}
|
||||
|
||||
fn merge_chains(
|
||||
original_tip: CheckPoint,
|
||||
update_tip: CheckPoint,
|
||||
introduce_older_blocks: bool,
|
||||
) -> Result<ChangeSet, CannotConnectError> {
|
||||
let mut changeset = ChangeSet::default();
|
||||
let mut orig = original_tip.into_iter();
|
||||
let mut update = update_tip.into_iter();
|
||||
let mut curr_orig = None;
|
||||
let mut curr_update = None;
|
||||
let mut prev_orig: Option<CheckPoint> = None;
|
||||
let mut prev_update: Option<CheckPoint> = None;
|
||||
let mut point_of_agreement_found = false;
|
||||
let mut prev_orig_was_invalidated = false;
|
||||
let mut potentially_invalidated_heights = vec![];
|
||||
|
||||
// To find the difference between the new chain and the original we iterate over both of them
|
||||
// from the tip backwards in tandem. We always dealing with the highest one from either chain
|
||||
// first and move to the next highest. The crucial logic is applied when they have blocks at the
|
||||
// same height.
|
||||
loop {
|
||||
if curr_orig.is_none() {
|
||||
curr_orig = orig.next();
|
||||
}
|
||||
if curr_update.is_none() {
|
||||
curr_update = update.next();
|
||||
}
|
||||
|
||||
match (curr_orig.as_ref(), curr_update.as_ref()) {
|
||||
// Update block that doesn't exist in the original chain
|
||||
(o, Some(u)) if Some(u.height()) > o.map(|o| o.height()) => {
|
||||
changeset.insert(u.height(), Some(u.hash()));
|
||||
prev_update = curr_update.take();
|
||||
}
|
||||
// Original block that isn't in the update
|
||||
(Some(o), u) if Some(o.height()) > u.map(|u| u.height()) => {
|
||||
// this block might be gone if an earlier block gets invalidated
|
||||
potentially_invalidated_heights.push(o.height());
|
||||
prev_orig_was_invalidated = false;
|
||||
prev_orig = curr_orig.take();
|
||||
|
||||
// OPTIMIZATION: we have run out of update blocks so we don't need to continue
|
||||
// iterating because there's no possibility of adding anything to changeset.
|
||||
if u.is_none() {
|
||||
break;
|
||||
}
|
||||
}
|
||||
(Some(o), Some(u)) => {
|
||||
if o.hash() == u.hash() {
|
||||
// We have found our point of agreement 🎉 -- we require that the previous (i.e.
|
||||
// higher because we are iterating backwards) block in the original chain was
|
||||
// invalidated (if it exists). This ensures that there is an unambiguous point of
|
||||
// connection to the original chain from the update chain (i.e. we know the
|
||||
// precisely which original blocks are invalid).
|
||||
if !prev_orig_was_invalidated && !point_of_agreement_found {
|
||||
if let (Some(prev_orig), Some(_prev_update)) = (&prev_orig, &prev_update) {
|
||||
return Err(CannotConnectError {
|
||||
try_include_height: prev_orig.height(),
|
||||
});
|
||||
}
|
||||
}
|
||||
point_of_agreement_found = true;
|
||||
prev_orig_was_invalidated = false;
|
||||
// OPTIMIZATION 1 -- If we know that older blocks cannot be introduced without
|
||||
// invalidation, we can break after finding the point of agreement.
|
||||
// OPTIMIZATION 2 -- if we have the same underlying pointer at this point, we
|
||||
// can guarantee that no older blocks are introduced.
|
||||
if !introduce_older_blocks || Arc::as_ptr(&o.0) == Arc::as_ptr(&u.0) {
|
||||
return Ok(changeset);
|
||||
}
|
||||
} else {
|
||||
// We have an invalidation height so we set the height to the updated hash and
|
||||
// also purge all the original chain block hashes above this block.
|
||||
changeset.insert(u.height(), Some(u.hash()));
|
||||
for invalidated_height in potentially_invalidated_heights.drain(..) {
|
||||
changeset.insert(invalidated_height, None);
|
||||
}
|
||||
prev_orig_was_invalidated = true;
|
||||
}
|
||||
prev_update = curr_update.take();
|
||||
prev_orig = curr_orig.take();
|
||||
}
|
||||
(None, None) => {
|
||||
break;
|
||||
}
|
||||
_ => {
|
||||
unreachable!("compiler cannot tell that everything has been covered")
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// When we don't have a point of agreement you can imagine it is implicitly the
|
||||
// genesis block so we need to do the final connectivity check which in this case
|
||||
// just means making sure the entire original chain was invalidated.
|
||||
if !prev_orig_was_invalidated && !point_of_agreement_found {
|
||||
if let Some(prev_orig) = prev_orig {
|
||||
return Err(CannotConnectError {
|
||||
try_include_height: prev_orig.height(),
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
Ok(self.apply_update(update).expect("should always connect"))
|
||||
}
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// This is the return value of [`determine_changeset`] and represents changes to [`LocalChain`].
|
||||
///
|
||||
/// [`determine_changeset`]: LocalChain::determine_changeset
|
||||
pub type ChangeSet = BTreeMap<u32, Option<BlockHash>>;
|
||||
|
||||
/// Represents an update failure of [`LocalChain`] due to the update not connecting to the original
|
||||
/// chain.
|
||||
///
|
||||
/// The update cannot be applied to the chain because the chain suffix it represents did not
|
||||
/// connect to the existing chain. This error case contains the checkpoint height to include so
|
||||
/// that the chains can connect.
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct UpdateNotConnectedError(pub u32);
|
||||
|
||||
impl core::fmt::Display for UpdateNotConnectedError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"the update cannot connect with the chain, try include block at height {}",
|
||||
self.0
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for UpdateNotConnectedError {}
|
||||
|
||||
/// Represents a failure when trying to insert a checkpoint into [`LocalChain`].
|
||||
#[derive(Clone, Debug, PartialEq)]
|
||||
pub struct InsertBlockNotMatchingError {
|
||||
/// The checkpoints' height.
|
||||
pub height: u32,
|
||||
/// Original checkpoint's block hash.
|
||||
pub original_hash: BlockHash,
|
||||
/// Update checkpoint's block hash.
|
||||
pub update_hash: BlockHash,
|
||||
}
|
||||
|
||||
impl core::fmt::Display for InsertBlockNotMatchingError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
write!(
|
||||
f,
|
||||
"failed to insert block at height {} as blockhashes conflict: original={}, update={}",
|
||||
self.height, self.original_hash, self.update_hash
|
||||
)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for InsertBlockNotMatchingError {}
|
||||
|
||||
@@ -27,19 +27,19 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
/// Stage a `changeset` to be commited later with [`commit`].
|
||||
/// Stage a `changeset` to be committed later with [`commit`].
|
||||
///
|
||||
/// [`commit`]: Self::commit
|
||||
pub fn stage(&mut self, changeset: C) {
|
||||
self.stage.append(changeset)
|
||||
}
|
||||
|
||||
/// Get the changes that have not been commited yet.
|
||||
/// Get the changes that have not been committed yet.
|
||||
pub fn staged(&self) -> &C {
|
||||
&self.stage
|
||||
}
|
||||
|
||||
/// Commit the staged changes to the underlying persistance backend.
|
||||
/// Commit the staged changes to the underlying persistence backend.
|
||||
///
|
||||
/// Changes that are committed (if any) are returned.
|
||||
///
|
||||
@@ -79,10 +79,10 @@ pub trait PersistBackend<C> {
|
||||
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError>;
|
||||
|
||||
/// Return the aggregate changeset `C` from persistence.
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError>;
|
||||
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError>;
|
||||
}
|
||||
|
||||
impl<C: Default> PersistBackend<C> for () {
|
||||
impl<C> PersistBackend<C> for () {
|
||||
type WriteError = Infallible;
|
||||
|
||||
type LoadError = Infallible;
|
||||
@@ -91,7 +91,7 @@ impl<C: Default> PersistBackend<C> for () {
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError> {
|
||||
Ok(C::default())
|
||||
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||
Ok(None)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
use crate::{
|
||||
bitcoin::{secp256k1::Secp256k1, Script},
|
||||
bitcoin::{secp256k1::Secp256k1, ScriptBuf},
|
||||
miniscript::{Descriptor, DescriptorPublicKey},
|
||||
};
|
||||
use core::{borrow::Borrow, ops::Bound, ops::RangeBounds};
|
||||
@@ -22,9 +22,9 @@ pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
||||
/// # use std::str::FromStr;
|
||||
/// # let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||
/// # let (descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||
/// # let external_spk_0 = descriptor.at_derivation_index(0).script_pubkey();
|
||||
/// # let external_spk_3 = descriptor.at_derivation_index(3).script_pubkey();
|
||||
/// # let external_spk_4 = descriptor.at_derivation_index(4).script_pubkey();
|
||||
/// # let external_spk_0 = descriptor.at_derivation_index(0).unwrap().script_pubkey();
|
||||
/// # let external_spk_3 = descriptor.at_derivation_index(3).unwrap().script_pubkey();
|
||||
/// # let external_spk_4 = descriptor.at_derivation_index(4).unwrap().script_pubkey();
|
||||
///
|
||||
/// // Creates a new script pubkey iterator starting at 0 from a descriptor.
|
||||
/// let mut spk_iter = SpkIterator::new(&descriptor);
|
||||
@@ -45,34 +45,43 @@ where
|
||||
{
|
||||
/// Creates a new script pubkey iterator starting at 0 from a descriptor.
|
||||
pub fn new(descriptor: D) -> Self {
|
||||
let end = if descriptor.borrow().has_wildcard() {
|
||||
BIP32_MAX_INDEX
|
||||
} else {
|
||||
0
|
||||
};
|
||||
|
||||
SpkIterator::new_with_range(descriptor, 0..=end)
|
||||
SpkIterator::new_with_range(descriptor, 0..=BIP32_MAX_INDEX)
|
||||
}
|
||||
|
||||
// Creates a new script pubkey iterator from a descriptor with a given range.
|
||||
// If the descriptor doesn't have a wildcard, we shorten whichever range you pass in
|
||||
// to have length <= 1. This means that if you pass in 0..0 or 0..1 the range will
|
||||
// remain the same, but if you pass in 0..10, we'll shorten it to 0..1
|
||||
// Also note that if the descriptor doesn't have a wildcard, passing in a range starting
|
||||
// from n > 0, will return an empty iterator.
|
||||
pub(crate) fn new_with_range<R>(descriptor: D, range: R) -> Self
|
||||
where
|
||||
R: RangeBounds<u32>,
|
||||
{
|
||||
let start = match range.start_bound() {
|
||||
Bound::Included(start) => *start,
|
||||
Bound::Excluded(start) => *start + 1,
|
||||
Bound::Unbounded => u32::MIN,
|
||||
};
|
||||
|
||||
let mut end = match range.end_bound() {
|
||||
Bound::Included(end) => *end + 1,
|
||||
Bound::Excluded(end) => *end,
|
||||
Bound::Unbounded => u32::MAX,
|
||||
};
|
||||
|
||||
// Because `end` is exclusive, we want the maximum value to be BIP32_MAX_INDEX + 1.
|
||||
end = end.min(BIP32_MAX_INDEX + 1);
|
||||
|
||||
if !descriptor.borrow().has_wildcard() {
|
||||
// The length of the range should be at most 1
|
||||
if end != start {
|
||||
end = start + 1;
|
||||
}
|
||||
}
|
||||
|
||||
Self {
|
||||
next_index: match range.start_bound() {
|
||||
Bound::Included(start) => *start,
|
||||
Bound::Excluded(start) => *start + 1,
|
||||
Bound::Unbounded => u32::MIN,
|
||||
},
|
||||
next_index: start,
|
||||
end,
|
||||
descriptor,
|
||||
secp: Secp256k1::verification_only(),
|
||||
@@ -84,7 +93,7 @@ impl<D> Iterator for SpkIterator<D>
|
||||
where
|
||||
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||
{
|
||||
type Item = (u32, Script);
|
||||
type Item = (u32, ScriptBuf);
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
// For non-wildcard descriptors, we expect the first element to be Some((0, spk)), then None after.
|
||||
@@ -93,11 +102,15 @@ where
|
||||
return None;
|
||||
}
|
||||
|
||||
// If the descriptor is non-wildcard, only index 0 will return an spk.
|
||||
if !self.descriptor.borrow().has_wildcard() && self.next_index != 0 {
|
||||
return None;
|
||||
}
|
||||
|
||||
let script = self
|
||||
.descriptor
|
||||
.borrow()
|
||||
.at_derivation_index(self.next_index)
|
||||
.derived_descriptor(&self.secp)
|
||||
.derived_descriptor(&self.secp, self.next_index)
|
||||
.expect("the descriptor cannot need hardened derivation")
|
||||
.script_pubkey();
|
||||
let output = (self.next_index, script);
|
||||
@@ -149,31 +162,30 @@ mod test {
|
||||
|
||||
#[test]
|
||||
#[allow(clippy::iter_nth_zero)]
|
||||
#[rustfmt::skip]
|
||||
fn test_spkiterator_wildcard() {
|
||||
let (_, external_desc, _) = init_txout_index();
|
||||
let external_spk_0 = external_desc.at_derivation_index(0).script_pubkey();
|
||||
let external_spk_16 = external_desc.at_derivation_index(16).script_pubkey();
|
||||
let external_spk_20 = external_desc.at_derivation_index(20).script_pubkey();
|
||||
let external_spk_21 = external_desc.at_derivation_index(21).script_pubkey();
|
||||
let external_spk_max = external_desc
|
||||
.at_derivation_index(BIP32_MAX_INDEX)
|
||||
.script_pubkey();
|
||||
let external_spk_0 = external_desc.at_derivation_index(0).unwrap().script_pubkey();
|
||||
let external_spk_16 = external_desc.at_derivation_index(16).unwrap().script_pubkey();
|
||||
let external_spk_20 = external_desc.at_derivation_index(20).unwrap().script_pubkey();
|
||||
let external_spk_21 = external_desc.at_derivation_index(21).unwrap().script_pubkey();
|
||||
let external_spk_max = external_desc.at_derivation_index(BIP32_MAX_INDEX).unwrap().script_pubkey();
|
||||
|
||||
let mut external_spk = SpkIterator::new(&external_desc);
|
||||
let max_index = BIP32_MAX_INDEX - 22;
|
||||
|
||||
assert_eq!(external_spk.next().unwrap(), (0, external_spk_0));
|
||||
assert_eq!(external_spk.nth(15).unwrap(), (16, external_spk_16));
|
||||
assert_eq!(external_spk.nth(3).unwrap(), (20, external_spk_20.clone()));
|
||||
assert_eq!(external_spk.next().unwrap(), (21, external_spk_21));
|
||||
assert_eq!(external_spk.next(), Some((0, external_spk_0)));
|
||||
assert_eq!(external_spk.nth(15), Some((16, external_spk_16)));
|
||||
assert_eq!(external_spk.nth(3), Some((20, external_spk_20.clone())));
|
||||
assert_eq!(external_spk.next(), Some((21, external_spk_21)));
|
||||
assert_eq!(
|
||||
external_spk.nth(max_index as usize).unwrap(),
|
||||
(BIP32_MAX_INDEX, external_spk_max)
|
||||
external_spk.nth(max_index as usize),
|
||||
Some((BIP32_MAX_INDEX, external_spk_max))
|
||||
);
|
||||
assert_eq!(external_spk.nth(0), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||
assert_eq!(external_spk.nth(20).unwrap(), (20, external_spk_20));
|
||||
assert_eq!(external_spk.nth(20), Some((20, external_spk_20)));
|
||||
assert_eq!(external_spk.next(), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||
@@ -187,17 +199,52 @@ mod test {
|
||||
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||
let external_spk_0 = no_wildcard_descriptor
|
||||
.at_derivation_index(0)
|
||||
.unwrap()
|
||||
.script_pubkey();
|
||||
|
||||
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||
|
||||
assert_eq!(external_spk.next().unwrap(), (0, external_spk_0.clone()));
|
||||
assert_eq!(external_spk.next(), Some((0, external_spk_0.clone())));
|
||||
assert_eq!(external_spk.next(), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||
|
||||
assert_eq!(external_spk.nth(0).unwrap(), (0, external_spk_0));
|
||||
assert_eq!(external_spk.nth(0), Some((0, external_spk_0.clone())));
|
||||
assert_eq!(external_spk.nth(0), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..0);
|
||||
|
||||
assert_eq!(external_spk.next(), None);
|
||||
|
||||
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..1);
|
||||
|
||||
assert_eq!(external_spk.nth(0), Some((0, external_spk_0.clone())));
|
||||
assert_eq!(external_spk.next(), None);
|
||||
|
||||
// We test that using new_with_range with range_len > 1 gives back an iterator with
|
||||
// range_len = 1
|
||||
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..10);
|
||||
|
||||
assert_eq!(external_spk.nth(0), Some((0, external_spk_0)));
|
||||
assert_eq!(external_spk.nth(0), None);
|
||||
|
||||
// non index-0 should NOT return an spk
|
||||
assert_eq!(
|
||||
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..1).next(),
|
||||
None
|
||||
);
|
||||
assert_eq!(
|
||||
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..=1).next(),
|
||||
None
|
||||
);
|
||||
assert_eq!(
|
||||
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..2).next(),
|
||||
None
|
||||
);
|
||||
assert_eq!(
|
||||
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..=2).next(),
|
||||
None
|
||||
);
|
||||
}
|
||||
|
||||
// The following dummy traits were created to test if SpkIterator is working properly.
|
||||
|
||||
@@ -3,15 +3,15 @@ use core::ops::RangeBounds;
|
||||
use crate::{
|
||||
collections::{hash_map::Entry, BTreeMap, BTreeSet, HashMap},
|
||||
indexed_tx_graph::Indexer,
|
||||
ForEachTxOut,
|
||||
};
|
||||
use bitcoin::{self, OutPoint, Script, Transaction, TxOut, Txid};
|
||||
use bitcoin::{self, OutPoint, Script, ScriptBuf, Transaction, TxOut, Txid};
|
||||
|
||||
/// An index storing [`TxOut`]s that have a script pubkey that matches those in a list.
|
||||
///
|
||||
/// The basic idea is that you insert script pubkeys you care about into the index with
|
||||
/// [`insert_spk`] and then when you call [`scan`], the index will look at any txouts you pass in and
|
||||
/// store and index any txouts matching one of its script pubkeys.
|
||||
/// [`insert_spk`] and then when you call [`Indexer::index_tx`] or [`Indexer::index_txout`], the
|
||||
/// index will look at any txouts you pass in and store and index any txouts matching one of its
|
||||
/// script pubkeys.
|
||||
///
|
||||
/// Each script pubkey is associated with an application-defined index script index `I`, which must be
|
||||
/// [`Ord`]. Usually, this is used to associate the derivation index of the script pubkey or even a
|
||||
@@ -25,14 +25,13 @@ use bitcoin::{self, OutPoint, Script, Transaction, TxOut, Txid};
|
||||
/// [`TxOut`]: bitcoin::TxOut
|
||||
/// [`insert_spk`]: Self::insert_spk
|
||||
/// [`Ord`]: core::cmp::Ord
|
||||
/// [`scan`]: Self::scan
|
||||
/// [`TxGraph`]: crate::tx_graph::TxGraph
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct SpkTxOutIndex<I> {
|
||||
/// script pubkeys ordered by index
|
||||
spks: BTreeMap<I, Script>,
|
||||
spks: BTreeMap<I, ScriptBuf>,
|
||||
/// A reverse lookup from spk to spk index
|
||||
spk_indices: HashMap<Script, I>,
|
||||
spk_indices: HashMap<ScriptBuf, I>,
|
||||
/// The set of unused indexes.
|
||||
unused: BTreeSet<I>,
|
||||
/// Lookup index and txout by outpoint.
|
||||
@@ -54,19 +53,21 @@ impl<I> Default for SpkTxOutIndex<I> {
|
||||
}
|
||||
|
||||
impl<I: Clone + Ord> Indexer for SpkTxOutIndex<I> {
|
||||
type Additions = ();
|
||||
type ChangeSet = ();
|
||||
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::Additions {
|
||||
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet {
|
||||
self.scan_txout(outpoint, txout);
|
||||
Default::default()
|
||||
}
|
||||
|
||||
fn index_tx(&mut self, tx: &Transaction) -> Self::Additions {
|
||||
fn index_tx(&mut self, tx: &Transaction) -> Self::ChangeSet {
|
||||
self.scan(tx);
|
||||
Default::default()
|
||||
}
|
||||
|
||||
fn apply_additions(&mut self, _additions: Self::Additions) {
|
||||
fn initial_changeset(&self) -> Self::ChangeSet {}
|
||||
|
||||
fn apply_changeset(&mut self, _changeset: Self::ChangeSet) {
|
||||
// This applies nothing.
|
||||
}
|
||||
|
||||
@@ -75,41 +76,23 @@ impl<I: Clone + Ord> Indexer for SpkTxOutIndex<I> {
|
||||
}
|
||||
}
|
||||
|
||||
/// This macro is used instead of a member function of `SpkTxOutIndex`, which would result in a
|
||||
/// compiler error[E0521]: "borrowed data escapes out of closure" when we attempt to take a
|
||||
/// reference out of the `ForEachTxOut` closure during scanning.
|
||||
macro_rules! scan_txout {
|
||||
($self:ident, $op:expr, $txout:expr) => {{
|
||||
let spk_i = $self.spk_indices.get(&$txout.script_pubkey);
|
||||
if let Some(spk_i) = spk_i {
|
||||
$self.txouts.insert($op, (spk_i.clone(), $txout.clone()));
|
||||
$self.spk_txouts.insert((spk_i.clone(), $op));
|
||||
$self.unused.remove(&spk_i);
|
||||
}
|
||||
spk_i
|
||||
}};
|
||||
}
|
||||
|
||||
impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||
/// Scans an object containing many txouts.
|
||||
/// Scans a transaction's outputs for matching script pubkeys.
|
||||
///
|
||||
/// Typically, this is used in two situations:
|
||||
///
|
||||
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
||||
/// your txouts.
|
||||
/// 2. When getting new data from the chain, you usually scan it before incorporating it into your chain state.
|
||||
///
|
||||
/// See [`ForEachTxout`] for the types that support this.
|
||||
///
|
||||
/// [`ForEachTxout`]: crate::ForEachTxOut
|
||||
pub fn scan(&mut self, txouts: &impl ForEachTxOut) -> BTreeSet<I> {
|
||||
pub fn scan(&mut self, tx: &Transaction) -> BTreeSet<I> {
|
||||
let mut scanned_indices = BTreeSet::new();
|
||||
|
||||
txouts.for_each_txout(|(op, txout)| {
|
||||
if let Some(spk_i) = scan_txout!(self, op, txout) {
|
||||
let txid = tx.txid();
|
||||
for (i, txout) in tx.output.iter().enumerate() {
|
||||
let op = OutPoint::new(txid, i as u32);
|
||||
if let Some(spk_i) = self.scan_txout(op, txout) {
|
||||
scanned_indices.insert(spk_i.clone());
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
scanned_indices
|
||||
}
|
||||
@@ -117,7 +100,13 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||
/// Scan a single `TxOut` for a matching script pubkey and returns the index that matches the
|
||||
/// script pubkey (if any).
|
||||
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> Option<&I> {
|
||||
scan_txout!(self, op, txout)
|
||||
let spk_i = self.spk_indices.get(&txout.script_pubkey);
|
||||
if let Some(spk_i) = spk_i {
|
||||
self.txouts.insert(op, (spk_i.clone(), txout.clone()));
|
||||
self.spk_txouts.insert((spk_i.clone(), op));
|
||||
self.unused.remove(spk_i);
|
||||
}
|
||||
spk_i
|
||||
}
|
||||
|
||||
/// Get a reference to the set of indexed outpoints.
|
||||
@@ -152,11 +141,11 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||
use bitcoin::hashes::Hash;
|
||||
use core::ops::Bound::*;
|
||||
let min_op = OutPoint {
|
||||
txid: Txid::from_inner([0x00; 32]),
|
||||
txid: Txid::all_zeros(),
|
||||
vout: u32::MIN,
|
||||
};
|
||||
let max_op = OutPoint {
|
||||
txid: Txid::from_inner([0xff; 32]),
|
||||
txid: Txid::from_byte_array([0xff; Txid::LEN]),
|
||||
vout: u32::MAX,
|
||||
};
|
||||
|
||||
@@ -188,18 +177,18 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||
///
|
||||
/// If that index hasn't been inserted yet, it will return `None`.
|
||||
pub fn spk_at_index(&self, index: &I) -> Option<&Script> {
|
||||
self.spks.get(index)
|
||||
self.spks.get(index).map(|s| s.as_script())
|
||||
}
|
||||
|
||||
/// The script pubkeys that are being tracked by the index.
|
||||
pub fn all_spks(&self) -> &BTreeMap<I, Script> {
|
||||
pub fn all_spks(&self) -> &BTreeMap<I, ScriptBuf> {
|
||||
&self.spks
|
||||
}
|
||||
|
||||
/// Adds a script pubkey to scan for. Returns `false` and does nothing if spk already exists in the map
|
||||
///
|
||||
/// the index will look for outputs spending to this spk whenever it scans new data.
|
||||
pub fn insert_spk(&mut self, index: I, spk: Script) -> bool {
|
||||
pub fn insert_spk(&mut self, index: I, spk: ScriptBuf) -> bool {
|
||||
match self.spk_indices.entry(spk.clone()) {
|
||||
Entry::Vacant(value) => {
|
||||
value.insert(index.clone());
|
||||
@@ -286,8 +275,8 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
||||
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
||||
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
||||
/// received just uses the transaction outputs directly, so it will be correct even if it has not
|
||||
/// been scanned.
|
||||
/// received just uses the [`Transaction`] outputs directly, so it will be correct even if it has
|
||||
/// not been scanned.
|
||||
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
||||
let mut sent = 0;
|
||||
let mut received = 0;
|
||||
|
||||
@@ -2,46 +2,67 @@ use crate::collections::BTreeMap;
|
||||
use crate::collections::BTreeSet;
|
||||
use crate::BlockId;
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{Block, OutPoint, Transaction, TxOut};
|
||||
|
||||
/// Trait to do something with every txout contained in a structure.
|
||||
///
|
||||
/// We would prefer to just work with things that can give us an `Iterator<Item=(OutPoint, &TxOut)>`
|
||||
/// here, but rust's type system makes it extremely hard to do this (without trait objects).
|
||||
pub trait ForEachTxOut {
|
||||
/// The provided closure `f` will be called with each `outpoint/txout` pair.
|
||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut)));
|
||||
}
|
||||
|
||||
impl ForEachTxOut for Block {
|
||||
fn for_each_txout(&self, mut f: impl FnMut((OutPoint, &TxOut))) {
|
||||
for tx in self.txdata.iter() {
|
||||
tx.for_each_txout(&mut f)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl ForEachTxOut for Transaction {
|
||||
fn for_each_txout(&self, mut f: impl FnMut((OutPoint, &TxOut))) {
|
||||
let txid = self.txid();
|
||||
for (i, txout) in self.output.iter().enumerate() {
|
||||
f((
|
||||
OutPoint {
|
||||
txid,
|
||||
vout: i as u32,
|
||||
},
|
||||
txout,
|
||||
))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Trait that "anchors" blockchain data to a specific block of height and hash.
|
||||
///
|
||||
/// [`Anchor`] implementations must be [`Ord`] by the anchor block's [`BlockId`] first.
|
||||
///
|
||||
/// I.e. If transaction A is anchored in block B, then if block B is in the best chain, we can
|
||||
/// assume that transaction A is also confirmed in the best chain. This does not necessarily mean
|
||||
/// that transaction A is confirmed in block B. It could also mean transaction A is confirmed in a
|
||||
/// parent block of B.
|
||||
///
|
||||
/// ```
|
||||
/// # use bdk_chain::local_chain::LocalChain;
|
||||
/// # use bdk_chain::tx_graph::TxGraph;
|
||||
/// # use bdk_chain::BlockId;
|
||||
/// # use bdk_chain::ConfirmationHeightAnchor;
|
||||
/// # use bdk_chain::example_utils::*;
|
||||
/// # use bitcoin::hashes::Hash;
|
||||
///
|
||||
/// // Initialize the local chain with two blocks.
|
||||
/// let chain = LocalChain::from_blocks(
|
||||
/// [
|
||||
/// (1, Hash::hash("first".as_bytes())),
|
||||
/// (2, Hash::hash("second".as_bytes())),
|
||||
/// ]
|
||||
/// .into_iter()
|
||||
/// .collect(),
|
||||
/// );
|
||||
///
|
||||
/// // Transaction to be inserted into `TxGraph`s with different anchor types.
|
||||
/// let tx = tx_from_hex(RAW_TX_1);
|
||||
///
|
||||
/// // Insert `tx` into a `TxGraph` that uses `BlockId` as the anchor type.
|
||||
/// // When a transaction is anchored with `BlockId`, the anchor block and the confirmation block of
|
||||
/// // the transaction is the same block.
|
||||
/// let mut graph_a = TxGraph::<BlockId>::default();
|
||||
/// let _ = graph_a.insert_tx(tx.clone());
|
||||
/// graph_a.insert_anchor(
|
||||
/// tx.txid(),
|
||||
/// BlockId {
|
||||
/// height: 1,
|
||||
/// hash: Hash::hash("first".as_bytes()),
|
||||
/// },
|
||||
/// );
|
||||
///
|
||||
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationHeightAnchor` as the anchor type.
|
||||
/// // When a transaction is anchored with `ConfirmationHeightAnchor`, the anchor block and
|
||||
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||
/// let mut graph_b = TxGraph::<ConfirmationHeightAnchor>::default();
|
||||
/// let _ = graph_b.insert_tx(tx.clone());
|
||||
/// graph_b.insert_anchor(
|
||||
/// tx.txid(),
|
||||
/// ConfirmationHeightAnchor {
|
||||
/// anchor_block: BlockId {
|
||||
/// height: 2,
|
||||
/// hash: Hash::hash("second".as_bytes()),
|
||||
/// },
|
||||
/// confirmation_height: 1,
|
||||
/// },
|
||||
/// );
|
||||
/// ```
|
||||
pub trait Anchor: core::fmt::Debug + Clone + Eq + PartialOrd + Ord + core::hash::Hash {
|
||||
/// Returns the [`BlockId`] that the associated blockchain data is "anchored" in.
|
||||
fn anchor_block(&self) -> BlockId;
|
||||
@@ -55,12 +76,19 @@ pub trait Anchor: core::fmt::Debug + Clone + Eq + PartialOrd + Ord + core::hash:
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor> Anchor for &'static A {
|
||||
impl<'a, A: Anchor> Anchor for &'a A {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
<A as Anchor>::anchor_block(self)
|
||||
}
|
||||
}
|
||||
|
||||
/// An [`Anchor`] that can be constructed from a given block, block height and transaction position
|
||||
/// within the block.
|
||||
pub trait AnchorFromBlockPosition: Anchor {
|
||||
/// Construct the anchor from a given `block`, block height and `tx_pos` within the block.
|
||||
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, tx_pos: usize) -> Self;
|
||||
}
|
||||
|
||||
/// Trait that makes an object appendable.
|
||||
pub trait Append {
|
||||
/// Append another object of the same type onto `self`.
|
||||
@@ -70,14 +98,6 @@ pub trait Append {
|
||||
fn is_empty(&self) -> bool;
|
||||
}
|
||||
|
||||
impl Append for () {
|
||||
fn append(&mut self, _other: Self) {}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
true
|
||||
}
|
||||
}
|
||||
|
||||
impl<K: Ord, V> Append for BTreeMap<K, V> {
|
||||
fn append(&mut self, mut other: Self) {
|
||||
BTreeMap::append(self, &mut other)
|
||||
@@ -108,13 +128,30 @@ impl<T> Append for Vec<T> {
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Append, B: Append> Append for (A, B) {
|
||||
fn append(&mut self, other: Self) {
|
||||
Append::append(&mut self.0, other.0);
|
||||
Append::append(&mut self.1, other.1);
|
||||
macro_rules! impl_append_for_tuple {
|
||||
($($a:ident $b:tt)*) => {
|
||||
impl<$($a),*> Append for ($($a,)*) where $($a: Append),* {
|
||||
|
||||
fn append(&mut self, _other: Self) {
|
||||
$(Append::append(&mut self.$b, _other.$b) );*
|
||||
}
|
||||
|
||||
fn is_empty(&self) -> bool {
|
||||
Append::is_empty(&self.0) && Append::is_empty(&self.1)
|
||||
$(Append::is_empty(&self.$b) && )* true
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl_append_for_tuple!();
|
||||
impl_append_for_tuple!(T0 0);
|
||||
impl_append_for_tuple!(T0 0 T1 1);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8 T9 9);
|
||||
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8 T9 9 T10 10);
|
||||
|
||||
@@ -1,17 +1,17 @@
|
||||
//! Module for structures that store and traverse transactions.
|
||||
//!
|
||||
//! [`TxGraph`] is a monotone structure that inserts transactions and indexes the spends. The
|
||||
//! [`Additions`] structure reports changes of [`TxGraph`] but can also be applied to a
|
||||
//! [`ChangeSet`] structure reports changes of [`TxGraph`] but can also be applied to a
|
||||
//! [`TxGraph`] as well. Lastly, [`TxDescendants`] is an [`Iterator`] that traverses descendants of
|
||||
//! a given transaction.
|
||||
//!
|
||||
//! Conflicting transactions are allowed to coexist within a [`TxGraph`]. This is useful for
|
||||
//! identifying and traversing conflicts and descendants of a given transaction.
|
||||
//!
|
||||
//! # Previewing and applying changes
|
||||
//! # Applying changes
|
||||
//!
|
||||
//! Methods that either preview or apply changes to [`TxGraph`] will return [`Additions`].
|
||||
//! [`Additions`] can be applied back to a [`TxGraph`] or be used to inform persistent storage
|
||||
//! Methods that apply changes to [`TxGraph`] will return [`ChangeSet`].
|
||||
//! [`ChangeSet`] can be applied back to a [`TxGraph`] or be used to inform persistent storage
|
||||
//! of the changes to [`TxGraph`].
|
||||
//!
|
||||
//! ```
|
||||
@@ -20,16 +20,14 @@
|
||||
//! # use bdk_chain::example_utils::*;
|
||||
//! # use bitcoin::Transaction;
|
||||
//! # let tx_a = tx_from_hex(RAW_TX_1);
|
||||
//! # let tx_b = tx_from_hex(RAW_TX_2);
|
||||
//! let mut graph: TxGraph = TxGraph::default();
|
||||
//! let mut another_graph: TxGraph = TxGraph::default();
|
||||
//!
|
||||
//! // preview a transaction insertion (not actually inserted)
|
||||
//! let additions = graph.insert_tx_preview(tx_a);
|
||||
//! // apply the insertion
|
||||
//! graph.apply_additions(additions);
|
||||
//! // insert a transaction
|
||||
//! let changeset = graph.insert_tx(tx_a);
|
||||
//!
|
||||
//! // you can also insert a transaction directly
|
||||
//! let already_applied_additions = graph.insert_tx(tx_b);
|
||||
//! // the resulting changeset can be applied to another tx graph
|
||||
//! another_graph.apply_changeset(changeset);
|
||||
//! ```
|
||||
//!
|
||||
//! A [`TxGraph`] can also be updated with another [`TxGraph`].
|
||||
@@ -44,23 +42,22 @@
|
||||
//! let mut graph: TxGraph = TxGraph::default();
|
||||
//! let update = TxGraph::new(vec![tx_a, tx_b]);
|
||||
//!
|
||||
//! // preview additions as the result of the update
|
||||
//! let additions = graph.determine_additions(&update);
|
||||
//! // apply the additions
|
||||
//! graph.apply_additions(additions);
|
||||
//! // apply the update graph
|
||||
//! let changeset = graph.apply_update(update.clone());
|
||||
//!
|
||||
//! // we can also apply the update graph directly
|
||||
//! // the additions will be empty as we have already applied the same update above
|
||||
//! let additions = graph.apply_update(update);
|
||||
//! assert!(additions.is_empty());
|
||||
//! // if we apply it again, the resulting changeset will be empty
|
||||
//! let changeset = graph.apply_update(update);
|
||||
//! assert!(changeset.is_empty());
|
||||
//! ```
|
||||
|
||||
use crate::{
|
||||
collections::*, keychain::Balance, Anchor, Append, BlockId, ChainOracle, ChainPosition,
|
||||
ForEachTxOut, FullTxOut,
|
||||
collections::*, keychain::Balance, local_chain::LocalChain, Anchor, Append, BlockId,
|
||||
ChainOracle, ChainPosition, FullTxOut,
|
||||
};
|
||||
use alloc::collections::vec_deque::VecDeque;
|
||||
use alloc::vec::Vec;
|
||||
use bitcoin::{OutPoint, Script, Transaction, TxOut, Txid};
|
||||
use core::fmt::{self, Formatter};
|
||||
use core::{
|
||||
convert::Infallible,
|
||||
ops::{Deref, RangeInclusive},
|
||||
@@ -135,11 +132,40 @@ impl Default for TxNodeInternal {
|
||||
#[derive(Clone, Debug, PartialEq, Eq, PartialOrd, Ord)]
|
||||
pub struct CanonicalTx<'a, T, A> {
|
||||
/// How the transaction is observed as (confirmed or unconfirmed).
|
||||
pub observed_as: ChainPosition<&'a A>,
|
||||
pub chain_position: ChainPosition<&'a A>,
|
||||
/// The transaction node (as part of the graph).
|
||||
pub node: TxNode<'a, T, A>,
|
||||
pub tx_node: TxNode<'a, T, A>,
|
||||
}
|
||||
|
||||
/// Errors returned by `TxGraph::calculate_fee`.
|
||||
#[derive(Debug, PartialEq, Eq)]
|
||||
pub enum CalculateFeeError {
|
||||
/// Missing `TxOut` for one or more of the inputs of the tx
|
||||
MissingTxOut(Vec<OutPoint>),
|
||||
/// When the transaction is invalid according to the graph it has a negative fee
|
||||
NegativeFee(i64),
|
||||
}
|
||||
|
||||
impl fmt::Display for CalculateFeeError {
|
||||
fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result {
|
||||
match self {
|
||||
CalculateFeeError::MissingTxOut(outpoints) => write!(
|
||||
f,
|
||||
"missing `TxOut` for one or more of the inputs of the tx: {:?}",
|
||||
outpoints
|
||||
),
|
||||
CalculateFeeError::NegativeFee(fee) => write!(
|
||||
f,
|
||||
"transaction is invalid according to the graph and has negative fee: {}",
|
||||
fee
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for CalculateFeeError {}
|
||||
|
||||
impl<A> TxGraph<A> {
|
||||
/// Iterate over all tx outputs known by [`TxGraph`].
|
||||
///
|
||||
@@ -241,25 +267,37 @@ impl<A> TxGraph<A> {
|
||||
}
|
||||
|
||||
/// Calculates the fee of a given transaction. Returns 0 if `tx` is a coinbase transaction.
|
||||
/// Returns `Some(_)` if we have all the `TxOut`s being spent by `tx` in the graph (either as
|
||||
/// the full transactions or individual txouts). If the returned value is negative, then the
|
||||
/// transaction is invalid according to the graph.
|
||||
/// Returns `OK(_)` if we have all the [`TxOut`]s being spent by `tx` in the graph (either as
|
||||
/// the full transactions or individual txouts).
|
||||
///
|
||||
/// Returns `None` if we're missing an input for the tx in the graph.
|
||||
/// To calculate the fee for a [`Transaction`] that depends on foreign [`TxOut`] values you must
|
||||
/// first manually insert the foreign TxOuts into the tx graph using the [`insert_txout`] function.
|
||||
/// Only insert TxOuts you trust the values for!
|
||||
///
|
||||
/// Note `tx` does not have to be in the graph for this to work.
|
||||
pub fn calculate_fee(&self, tx: &Transaction) -> Option<i64> {
|
||||
///
|
||||
/// [`insert_txout`]: Self::insert_txout
|
||||
pub fn calculate_fee(&self, tx: &Transaction) -> Result<u64, CalculateFeeError> {
|
||||
if tx.is_coin_base() {
|
||||
return Some(0);
|
||||
return Ok(0);
|
||||
}
|
||||
|
||||
let (inputs_sum, missing_outputs) = tx.input.iter().fold(
|
||||
(0_i64, Vec::new()),
|
||||
|(mut sum, mut missing_outpoints), txin| match self.get_txout(txin.previous_output) {
|
||||
None => {
|
||||
missing_outpoints.push(txin.previous_output);
|
||||
(sum, missing_outpoints)
|
||||
}
|
||||
Some(txout) => {
|
||||
sum += txout.value as i64;
|
||||
(sum, missing_outpoints)
|
||||
}
|
||||
},
|
||||
);
|
||||
if !missing_outputs.is_empty() {
|
||||
return Err(CalculateFeeError::MissingTxOut(missing_outputs));
|
||||
}
|
||||
let inputs_sum = tx
|
||||
.input
|
||||
.iter()
|
||||
.map(|txin| {
|
||||
self.get_txout(txin.previous_output)
|
||||
.map(|txout| txout.value as i64)
|
||||
})
|
||||
.sum::<Option<i64>>()?;
|
||||
|
||||
let outputs_sum = tx
|
||||
.output
|
||||
@@ -267,7 +305,12 @@ impl<A> TxGraph<A> {
|
||||
.map(|txout| txout.value as i64)
|
||||
.sum::<i64>();
|
||||
|
||||
Some(inputs_sum - outputs_sum)
|
||||
let fee = inputs_sum - outputs_sum;
|
||||
if fee < 0 {
|
||||
Err(CalculateFeeError::NegativeFee(fee))
|
||||
} else {
|
||||
Ok(fee as u64)
|
||||
}
|
||||
}
|
||||
|
||||
/// The transactions spending from this output.
|
||||
@@ -298,15 +341,39 @@ impl<A> TxGraph<A> {
|
||||
.map(|(outpoint, spends)| (outpoint.vout, spends))
|
||||
}
|
||||
|
||||
/// Creates an iterator that filters and maps ancestor transactions.
|
||||
///
|
||||
/// The iterator starts with the ancestors of the supplied `tx` (ancestor transactions of `tx`
|
||||
/// are transactions spent by `tx`). The supplied transaction is excluded from the iterator.
|
||||
///
|
||||
/// The supplied closure takes in two inputs `(depth, ancestor_tx)`:
|
||||
///
|
||||
/// * `depth` is the distance between the starting `Transaction` and the `ancestor_tx`. I.e., if
|
||||
/// the `Transaction` is spending an output of the `ancestor_tx` then `depth` will be 1.
|
||||
/// * `ancestor_tx` is the `Transaction`'s ancestor which we are considering to walk.
|
||||
///
|
||||
/// The supplied closure returns an `Option<T>`, allowing the caller to map each `Transaction`
|
||||
/// it visits and decide whether to visit ancestors.
|
||||
pub fn walk_ancestors<'g, F, O>(
|
||||
&'g self,
|
||||
tx: &'g Transaction,
|
||||
walk_map: F,
|
||||
) -> TxAncestors<'g, A, F>
|
||||
where
|
||||
F: FnMut(usize, &'g Transaction) -> Option<O> + 'g,
|
||||
{
|
||||
TxAncestors::new_exclude_root(self, tx, walk_map)
|
||||
}
|
||||
|
||||
/// Creates an iterator that filters and maps descendants from the starting `txid`.
|
||||
///
|
||||
/// The supplied closure takes in two inputs `(depth, descendant_txid)`:
|
||||
///
|
||||
/// * `depth` is the distance between the starting `txid` and the `descendant_txid`. I.e., if the
|
||||
/// descendant is spending an output of the starting `txid`; the `depth` will be 1.
|
||||
/// descendant is spending an output of the starting `txid` then `depth` will be 1.
|
||||
/// * `descendant_txid` is the descendant's txid which we are considering to walk.
|
||||
///
|
||||
/// The supplied closure returns an `Option<T>`, allowing the caller to map each node it vists
|
||||
/// The supplied closure returns an `Option<T>`, allowing the caller to map each node it visits
|
||||
/// and decide whether to visit descendants.
|
||||
pub fn walk_descendants<'g, F, O>(&'g self, txid: Txid, walk_map: F) -> TxDescendants<A, F>
|
||||
where
|
||||
@@ -327,7 +394,7 @@ impl<A> TxGraph<A> {
|
||||
where
|
||||
F: FnMut(usize, Txid) -> Option<O> + 'g,
|
||||
{
|
||||
let txids = self.direct_conflicts_of_tx(tx).map(|(_, txid)| txid);
|
||||
let txids = self.direct_conflitcs(tx).map(|(_, txid)| txid);
|
||||
TxDescendants::from_multiple_include_root(self, txids, walk_map)
|
||||
}
|
||||
|
||||
@@ -335,9 +402,10 @@ impl<A> TxGraph<A> {
|
||||
/// transaction's inputs (spends). The conflicting txids are returned with the given
|
||||
/// transaction's vin (in which it conflicts).
|
||||
///
|
||||
/// Note that this only returns directly conflicting txids and does not include descendants of
|
||||
/// those txids (which are technically also conflicting).
|
||||
pub fn direct_conflicts_of_tx<'g>(
|
||||
/// Note that this only returns directly conflicting txids and won't include:
|
||||
/// - descendants of conflicting transactions (which are technically also conflicting)
|
||||
/// - transactions conflicting with the given transaction's ancestors
|
||||
pub fn direct_conflitcs<'g>(
|
||||
&'g self,
|
||||
tx: &'g Transaction,
|
||||
) -> impl Iterator<Item = (usize, Txid)> + '_ {
|
||||
@@ -371,15 +439,16 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
new
|
||||
}
|
||||
|
||||
/// Returns the resultant [`Additions`] if the given `txout` is inserted at `outpoint`. Does not
|
||||
/// mutate `self`.
|
||||
/// Inserts the given [`TxOut`] at [`OutPoint`].
|
||||
///
|
||||
/// Inserting floating txouts are useful for determining fee/feerate of transactions we care
|
||||
/// about.
|
||||
///
|
||||
/// The [`Additions`] result will be empty if the `outpoint` (or a full transaction containing
|
||||
/// The [`ChangeSet`] result will be empty if the `outpoint` (or a full transaction containing
|
||||
/// the `outpoint`) already existed in `self`.
|
||||
pub fn insert_txout_preview(&self, outpoint: OutPoint, txout: TxOut) -> Additions<A> {
|
||||
///
|
||||
/// [`apply_changeset`]: Self::apply_changeset
|
||||
pub fn insert_txout(&mut self, outpoint: OutPoint, txout: TxOut) -> ChangeSet<A> {
|
||||
let mut update = Self::default();
|
||||
update.txs.insert(
|
||||
outpoint.txid,
|
||||
@@ -389,100 +458,76 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
0,
|
||||
),
|
||||
);
|
||||
self.determine_additions(&update)
|
||||
}
|
||||
|
||||
/// Inserts the given [`TxOut`] at [`OutPoint`].
|
||||
///
|
||||
/// This is equivalent to calling [`insert_txout_preview`] and [`apply_additions`] in sequence.
|
||||
///
|
||||
/// [`insert_txout_preview`]: Self::insert_txout_preview
|
||||
/// [`apply_additions`]: Self::apply_additions
|
||||
pub fn insert_txout(&mut self, outpoint: OutPoint, txout: TxOut) -> Additions<A> {
|
||||
let additions = self.insert_txout_preview(outpoint, txout);
|
||||
self.apply_additions(additions.clone());
|
||||
additions
|
||||
}
|
||||
|
||||
/// Returns the resultant [`Additions`] if the given transaction is inserted. Does not actually
|
||||
/// mutate [`Self`].
|
||||
///
|
||||
/// The [`Additions`] result will be empty if `tx` already exists in `self`.
|
||||
pub fn insert_tx_preview(&self, tx: Transaction) -> Additions<A> {
|
||||
let mut update = Self::default();
|
||||
update
|
||||
.txs
|
||||
.insert(tx.txid(), (TxNodeInternal::Whole(tx), BTreeSet::new(), 0));
|
||||
self.determine_additions(&update)
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Inserts the given transaction into [`TxGraph`].
|
||||
///
|
||||
/// The [`Additions`] returned will be empty if `tx` already exists.
|
||||
pub fn insert_tx(&mut self, tx: Transaction) -> Additions<A> {
|
||||
let additions = self.insert_tx_preview(tx);
|
||||
self.apply_additions(additions.clone());
|
||||
additions
|
||||
/// The [`ChangeSet`] returned will be empty if `tx` already exists.
|
||||
pub fn insert_tx(&mut self, tx: Transaction) -> ChangeSet<A> {
|
||||
let mut update = Self::default();
|
||||
update
|
||||
.txs
|
||||
.insert(tx.txid(), (TxNodeInternal::Whole(tx), BTreeSet::new(), 0));
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Returns the resultant [`Additions`] if the `txid` is set in `anchor`.
|
||||
pub fn insert_anchor_preview(&self, txid: Txid, anchor: A) -> Additions<A> {
|
||||
let mut update = Self::default();
|
||||
update.anchors.insert((anchor, txid));
|
||||
self.determine_additions(&update)
|
||||
/// Batch insert unconfirmed transactions.
|
||||
///
|
||||
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||
/// conflict-resolution (refer to [`TxGraph::insert_seen_at`] for details).
|
||||
pub fn batch_insert_unconfirmed(
|
||||
&mut self,
|
||||
txs: impl IntoIterator<Item = (Transaction, u64)>,
|
||||
) -> ChangeSet<A> {
|
||||
let mut changeset = ChangeSet::<A>::default();
|
||||
for (tx, seen_at) in txs {
|
||||
changeset.append(self.insert_seen_at(tx.txid(), seen_at));
|
||||
changeset.append(self.insert_tx(tx));
|
||||
}
|
||||
changeset
|
||||
}
|
||||
|
||||
/// Inserts the given `anchor` into [`TxGraph`].
|
||||
///
|
||||
/// This is equivalent to calling [`insert_anchor_preview`] and [`apply_additions`] in sequence.
|
||||
/// The [`Additions`] returned will be empty if graph already knows that `txid` exists in
|
||||
/// The [`ChangeSet`] returned will be empty if graph already knows that `txid` exists in
|
||||
/// `anchor`.
|
||||
///
|
||||
/// [`insert_anchor_preview`]: Self::insert_anchor_preview
|
||||
/// [`apply_additions`]: Self::apply_additions
|
||||
pub fn insert_anchor(&mut self, txid: Txid, anchor: A) -> Additions<A> {
|
||||
let additions = self.insert_anchor_preview(txid, anchor);
|
||||
self.apply_additions(additions.clone());
|
||||
additions
|
||||
pub fn insert_anchor(&mut self, txid: Txid, anchor: A) -> ChangeSet<A> {
|
||||
let mut update = Self::default();
|
||||
update.anchors.insert((anchor, txid));
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Returns the resultant [`Additions`] if the `txid` is set to `seen_at`.
|
||||
/// Inserts the given `seen_at` for `txid` into [`TxGraph`].
|
||||
///
|
||||
/// Note that [`TxGraph`] only keeps track of the lastest `seen_at`.
|
||||
pub fn insert_seen_at_preview(&self, txid: Txid, seen_at: u64) -> Additions<A> {
|
||||
/// Note that [`TxGraph`] only keeps track of the latest `seen_at`.
|
||||
pub fn insert_seen_at(&mut self, txid: Txid, seen_at: u64) -> ChangeSet<A> {
|
||||
let mut update = Self::default();
|
||||
let (_, _, update_last_seen) = update.txs.entry(txid).or_default();
|
||||
*update_last_seen = seen_at;
|
||||
self.determine_additions(&update)
|
||||
}
|
||||
|
||||
/// Inserts the given `seen_at` into [`TxGraph`].
|
||||
///
|
||||
/// This is equivalent to calling [`insert_seen_at_preview`] and [`apply_additions`] in
|
||||
/// sequence.
|
||||
///
|
||||
/// [`insert_seen_at_preview`]: Self::insert_seen_at_preview
|
||||
/// [`apply_additions`]: Self::apply_additions
|
||||
pub fn insert_seen_at(&mut self, txid: Txid, seen_at: u64) -> Additions<A> {
|
||||
let additions = self.insert_seen_at_preview(txid, seen_at);
|
||||
self.apply_additions(additions.clone());
|
||||
additions
|
||||
self.apply_update(update)
|
||||
}
|
||||
|
||||
/// Extends this graph with another so that `self` becomes the union of the two sets of
|
||||
/// transactions.
|
||||
///
|
||||
/// The returned [`Additions`] is the set difference between `update` and `self` (transactions that
|
||||
/// The returned [`ChangeSet`] is the set difference between `update` and `self` (transactions that
|
||||
/// exist in `update` but not in `self`).
|
||||
pub fn apply_update(&mut self, update: TxGraph<A>) -> Additions<A> {
|
||||
let additions = self.determine_additions(&update);
|
||||
self.apply_additions(additions.clone());
|
||||
additions
|
||||
pub fn apply_update(&mut self, update: TxGraph<A>) -> ChangeSet<A> {
|
||||
let changeset = self.determine_changeset(update);
|
||||
self.apply_changeset(changeset.clone());
|
||||
changeset
|
||||
}
|
||||
|
||||
/// Applies [`Additions`] to [`TxGraph`].
|
||||
pub fn apply_additions(&mut self, additions: Additions<A>) {
|
||||
for tx in additions.txs {
|
||||
/// Determines the [`ChangeSet`] between `self` and an empty [`TxGraph`].
|
||||
pub fn initial_changeset(&self) -> ChangeSet<A> {
|
||||
Self::default().determine_changeset(self.clone())
|
||||
}
|
||||
|
||||
/// Applies [`ChangeSet`] to [`TxGraph`].
|
||||
pub fn apply_changeset(&mut self, changeset: ChangeSet<A>) {
|
||||
for tx in changeset.txs {
|
||||
let txid = tx.txid();
|
||||
|
||||
tx.input
|
||||
@@ -513,7 +558,7 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
for (outpoint, txout) in additions.txouts {
|
||||
for (outpoint, txout) in changeset.txouts {
|
||||
let tx_entry = self
|
||||
.txs
|
||||
.entry(outpoint.txid)
|
||||
@@ -528,14 +573,14 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
for (anchor, txid) in additions.anchors {
|
||||
for (anchor, txid) in changeset.anchors {
|
||||
if self.anchors.insert((anchor.clone(), txid)) {
|
||||
let (_, anchors, _) = self.txs.entry(txid).or_insert_with(Default::default);
|
||||
anchors.insert(anchor);
|
||||
}
|
||||
}
|
||||
|
||||
for (txid, new_last_seen) in additions.last_seen {
|
||||
for (txid, new_last_seen) in changeset.last_seen {
|
||||
let (_, _, last_seen) = self.txs.entry(txid).or_insert_with(Default::default);
|
||||
if new_last_seen > *last_seen {
|
||||
*last_seen = new_last_seen;
|
||||
@@ -543,21 +588,21 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
/// Previews the resultant [`Additions`] when [`Self`] is updated against the `update` graph.
|
||||
/// Previews the resultant [`ChangeSet`] when [`Self`] is updated against the `update` graph.
|
||||
///
|
||||
/// The [`Additions`] would be the set difference between `update` and `self` (transactions that
|
||||
/// The [`ChangeSet`] would be the set difference between `update` and `self` (transactions that
|
||||
/// exist in `update` but not in `self`).
|
||||
pub fn determine_additions(&self, update: &TxGraph<A>) -> Additions<A> {
|
||||
let mut additions = Additions::default();
|
||||
pub(crate) fn determine_changeset(&self, update: TxGraph<A>) -> ChangeSet<A> {
|
||||
let mut changeset = ChangeSet::default();
|
||||
|
||||
for (&txid, (update_tx_node, _, update_last_seen)) in &update.txs {
|
||||
let prev_last_seen: u64 = match (self.txs.get(&txid), update_tx_node) {
|
||||
(None, TxNodeInternal::Whole(update_tx)) => {
|
||||
additions.txs.insert(update_tx.clone());
|
||||
changeset.txs.insert(update_tx.clone());
|
||||
0
|
||||
}
|
||||
(None, TxNodeInternal::Partial(update_txos)) => {
|
||||
additions.txouts.extend(
|
||||
changeset.txouts.extend(
|
||||
update_txos
|
||||
.iter()
|
||||
.map(|(&vout, txo)| (OutPoint::new(txid, vout), txo.clone())),
|
||||
@@ -569,14 +614,14 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
Some((TxNodeInternal::Partial(_), _, last_seen)),
|
||||
TxNodeInternal::Whole(update_tx),
|
||||
) => {
|
||||
additions.txs.insert(update_tx.clone());
|
||||
changeset.txs.insert(update_tx.clone());
|
||||
*last_seen
|
||||
}
|
||||
(
|
||||
Some((TxNodeInternal::Partial(txos), _, last_seen)),
|
||||
TxNodeInternal::Partial(update_txos),
|
||||
) => {
|
||||
additions.txouts.extend(
|
||||
changeset.txouts.extend(
|
||||
update_txos
|
||||
.iter()
|
||||
.filter(|(vout, _)| !txos.contains_key(*vout))
|
||||
@@ -587,17 +632,80 @@ impl<A: Clone + Ord> TxGraph<A> {
|
||||
};
|
||||
|
||||
if *update_last_seen > prev_last_seen {
|
||||
additions.last_seen.insert(txid, *update_last_seen);
|
||||
changeset.last_seen.insert(txid, *update_last_seen);
|
||||
}
|
||||
}
|
||||
|
||||
additions.anchors = update.anchors.difference(&self.anchors).cloned().collect();
|
||||
changeset.anchors = update.anchors.difference(&self.anchors).cloned().collect();
|
||||
|
||||
additions
|
||||
changeset
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Anchor> TxGraph<A> {
|
||||
/// Find missing block heights of `chain`.
|
||||
///
|
||||
/// This works by scanning through anchors, and seeing whether the anchor block of the anchor
|
||||
/// exists in the [`LocalChain`]. The returned iterator does not output duplicate heights.
|
||||
pub fn missing_heights<'a>(&'a self, chain: &'a LocalChain) -> impl Iterator<Item = u32> + 'a {
|
||||
// Map of txids to skip.
|
||||
//
|
||||
// Usually, if a height of a tx anchor is missing from the chain, we would want to return
|
||||
// this height in the iterator. The exception is when the tx is confirmed in chain. All the
|
||||
// other missing-height anchors of this tx can be skipped.
|
||||
//
|
||||
// * Some(true) => skip all anchors of this txid
|
||||
// * Some(false) => do not skip anchors of this txid
|
||||
// * None => we do not know whether we can skip this txid
|
||||
let mut txids_to_skip = HashMap::<Txid, bool>::new();
|
||||
|
||||
// Keeps track of the last height emitted so we don't double up.
|
||||
let mut last_height_emitted = Option::<u32>::None;
|
||||
|
||||
self.anchors
|
||||
.iter()
|
||||
.filter(move |(_, txid)| {
|
||||
let skip = *txids_to_skip.entry(*txid).or_insert_with(|| {
|
||||
let tx_anchors = match self.txs.get(txid) {
|
||||
Some((_, anchors, _)) => anchors,
|
||||
None => return true,
|
||||
};
|
||||
let mut has_missing_height = false;
|
||||
for anchor_block in tx_anchors.iter().map(Anchor::anchor_block) {
|
||||
match chain.blocks().get(&anchor_block.height) {
|
||||
None => {
|
||||
has_missing_height = true;
|
||||
continue;
|
||||
}
|
||||
Some(chain_hash) => {
|
||||
if chain_hash == &anchor_block.hash {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
!has_missing_height
|
||||
});
|
||||
#[cfg(feature = "std")]
|
||||
debug_assert!({
|
||||
println!("txid={} skip={}", txid, skip);
|
||||
true
|
||||
});
|
||||
!skip
|
||||
})
|
||||
.filter_map(move |(a, _)| {
|
||||
let anchor_block = a.anchor_block();
|
||||
if Some(anchor_block.height) != last_height_emitted
|
||||
&& !chain.blocks().contains_key(&anchor_block.height)
|
||||
{
|
||||
last_height_emitted = Some(anchor_block.height);
|
||||
Some(anchor_block.height)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
/// Get the position of the transaction in `chain` with tip `chain_tip`.
|
||||
///
|
||||
/// If the given transaction of `txid` does not exist in the chain of `chain_tip`, `None` is
|
||||
@@ -627,28 +735,95 @@ impl<A: Anchor> TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
// The tx is not anchored to a block which is in the best chain, let's check whether we can
|
||||
// ignore it by checking conflicts!
|
||||
// The tx is not anchored to a block which is in the best chain, which means that it
|
||||
// might be in mempool, or it might have been dropped already.
|
||||
// Let's check conflicts to find out!
|
||||
let tx = match tx_node {
|
||||
TxNodeInternal::Whole(tx) => tx,
|
||||
TxNodeInternal::Whole(tx) => {
|
||||
// A coinbase tx that is not anchored in the best chain cannot be unconfirmed and
|
||||
// should always be filtered out.
|
||||
if tx.is_coin_base() {
|
||||
return Ok(None);
|
||||
}
|
||||
tx
|
||||
}
|
||||
TxNodeInternal::Partial(_) => {
|
||||
// Partial transactions (outputs only) cannot have conflicts.
|
||||
return Ok(None);
|
||||
}
|
||||
};
|
||||
|
||||
// If a conflicting tx is in the best chain, or has `last_seen` higher than this tx, then
|
||||
// We want to retrieve all the transactions that conflict with us, plus all the
|
||||
// transactions that conflict with our unconfirmed ancestors, since they conflict with us
|
||||
// as well.
|
||||
// We only traverse unconfirmed ancestors since conflicts of confirmed transactions
|
||||
// cannot be in the best chain.
|
||||
|
||||
// First of all, we retrieve all our ancestors. Since we're using `new_include_root`, the
|
||||
// resulting array will also include `tx`
|
||||
let unconfirmed_ancestor_txs =
|
||||
TxAncestors::new_include_root(self, tx, |_, ancestor_tx: &Transaction| {
|
||||
let tx_node = self.get_tx_node(ancestor_tx.txid())?;
|
||||
// We're filtering the ancestors to keep only the unconfirmed ones (= no anchors in
|
||||
// the best chain)
|
||||
for block in tx_node.anchors {
|
||||
match chain.is_block_in_chain(block.anchor_block(), chain_tip) {
|
||||
Ok(Some(true)) => return None,
|
||||
Err(e) => return Some(Err(e)),
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
Some(Ok(tx_node))
|
||||
})
|
||||
.collect::<Result<Vec<_>, C::Error>>()?;
|
||||
|
||||
// We determine our tx's last seen, which is the max between our last seen,
|
||||
// and our unconf descendants' last seen.
|
||||
let unconfirmed_descendants_txs =
|
||||
TxDescendants::new_include_root(self, tx.txid(), |_, descendant_txid: Txid| {
|
||||
let tx_node = self.get_tx_node(descendant_txid)?;
|
||||
// We're filtering the ancestors to keep only the unconfirmed ones (= no anchors in
|
||||
// the best chain)
|
||||
for block in tx_node.anchors {
|
||||
match chain.is_block_in_chain(block.anchor_block(), chain_tip) {
|
||||
Ok(Some(true)) => return None,
|
||||
Err(e) => return Some(Err(e)),
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
Some(Ok(tx_node))
|
||||
})
|
||||
.collect::<Result<Vec<_>, C::Error>>()?;
|
||||
|
||||
let tx_last_seen = unconfirmed_descendants_txs
|
||||
.iter()
|
||||
.max_by_key(|tx| tx.last_seen_unconfirmed)
|
||||
.map(|tx| tx.last_seen_unconfirmed)
|
||||
.expect("descendants always includes at least one transaction (the root tx");
|
||||
|
||||
// Now we traverse our ancestors and consider all their conflicts
|
||||
for tx_node in unconfirmed_ancestor_txs {
|
||||
// We retrieve all the transactions conflicting with this specific ancestor
|
||||
let conflicting_txs = self.walk_conflicts(tx_node.tx, |_, txid| self.get_tx_node(txid));
|
||||
|
||||
// If a conflicting tx is in the best chain, or has `last_seen` higher than this ancestor, then
|
||||
// this tx cannot exist in the best chain
|
||||
for conflicting_tx in self.walk_conflicts(tx, |_, txid| self.get_tx_node(txid)) {
|
||||
for block in conflicting_tx.anchors.iter().map(A::anchor_block) {
|
||||
if chain.is_block_in_chain(block, chain_tip)? == Some(true) {
|
||||
// conflicting tx is in best chain, so the current tx cannot be in best chain!
|
||||
for conflicting_tx in conflicting_txs {
|
||||
for block in conflicting_tx.anchors {
|
||||
if chain.is_block_in_chain(block.anchor_block(), chain_tip)? == Some(true) {
|
||||
return Ok(None);
|
||||
}
|
||||
}
|
||||
if conflicting_tx.last_seen_unconfirmed > *last_seen {
|
||||
if conflicting_tx.last_seen_unconfirmed > tx_last_seen {
|
||||
return Ok(None);
|
||||
}
|
||||
if conflicting_tx.last_seen_unconfirmed == *last_seen
|
||||
&& conflicting_tx.txid() > tx.txid()
|
||||
{
|
||||
// Conflicting tx has priority if txid of conflicting tx > txid of original tx
|
||||
return Ok(None);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Ok(Some(ChainPosition::Unconfirmed(*last_seen)))
|
||||
@@ -741,8 +916,8 @@ impl<A: Anchor> TxGraph<A> {
|
||||
self.try_get_chain_position(chain, chain_tip, tx.txid)
|
||||
.map(|v| {
|
||||
v.map(|observed_in| CanonicalTx {
|
||||
observed_as: observed_in,
|
||||
node: tx,
|
||||
chain_position: observed_in,
|
||||
tx_node: tx,
|
||||
})
|
||||
})
|
||||
.transpose()
|
||||
@@ -963,7 +1138,7 @@ impl<A: Anchor> TxGraph<A> {
|
||||
|
||||
/// A structure that represents changes to a [`TxGraph`].
|
||||
///
|
||||
/// It is named "additions" because [`TxGraph`] is monotone, so transactions can only be added and
|
||||
/// Since [`TxGraph`] is monotone "changeset" can only contain transactions to be added and
|
||||
/// not removed.
|
||||
///
|
||||
/// Refer to [module-level documentation] for more.
|
||||
@@ -982,7 +1157,7 @@ impl<A: Anchor> TxGraph<A> {
|
||||
)
|
||||
)]
|
||||
#[must_use]
|
||||
pub struct Additions<A = ()> {
|
||||
pub struct ChangeSet<A = ()> {
|
||||
/// Added transactions.
|
||||
pub txs: BTreeSet<Transaction>,
|
||||
/// Added txouts.
|
||||
@@ -993,7 +1168,7 @@ pub struct Additions<A = ()> {
|
||||
pub last_seen: BTreeMap<Txid, u64>,
|
||||
}
|
||||
|
||||
impl<A> Default for Additions<A> {
|
||||
impl<A> Default for ChangeSet<A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
txs: Default::default(),
|
||||
@@ -1004,13 +1179,13 @@ impl<A> Default for Additions<A> {
|
||||
}
|
||||
}
|
||||
|
||||
impl<A> Additions<A> {
|
||||
/// Returns true if the [`Additions`] is empty (no transactions or txouts).
|
||||
impl<A> ChangeSet<A> {
|
||||
/// Returns true if the [`ChangeSet`] is empty (no transactions or txouts).
|
||||
pub fn is_empty(&self) -> bool {
|
||||
self.txs.is_empty() && self.txouts.is_empty()
|
||||
}
|
||||
|
||||
/// Iterates over all outpoints contained within [`Additions`].
|
||||
/// Iterates over all outpoints contained within [`ChangeSet`].
|
||||
pub fn txouts(&self) -> impl Iterator<Item = (OutPoint, &TxOut)> {
|
||||
self.txs
|
||||
.iter()
|
||||
@@ -1022,9 +1197,48 @@ impl<A> Additions<A> {
|
||||
})
|
||||
.chain(self.txouts.iter().map(|(op, txout)| (*op, txout)))
|
||||
}
|
||||
|
||||
/// Iterates over the heights of that the new transaction anchors in this changeset.
|
||||
///
|
||||
/// This is useful if you want to find which heights you need to fetch data about in order to
|
||||
/// confirm or exclude these anchors.
|
||||
///
|
||||
/// See also: [`TxGraph::missing_heights`]
|
||||
pub fn anchor_heights(&self) -> impl Iterator<Item = u32> + '_
|
||||
where
|
||||
A: Anchor,
|
||||
{
|
||||
let mut dedup = None;
|
||||
self.anchors
|
||||
.iter()
|
||||
.map(|(a, _)| a.anchor_block().height)
|
||||
.filter(move |height| {
|
||||
let duplicate = dedup == Some(*height);
|
||||
dedup = Some(*height);
|
||||
!duplicate
|
||||
})
|
||||
}
|
||||
|
||||
/// Returns an iterator for the [`anchor_heights`] in this changeset that are not included in
|
||||
/// `local_chain`. This tells you which heights you need to include in `local_chain` in order
|
||||
/// for it to conclusively act as a [`ChainOracle`] for the transaction anchors this changeset
|
||||
/// will add.
|
||||
///
|
||||
/// [`ChainOracle`]: crate::ChainOracle
|
||||
/// [`anchor_heights`]: Self::anchor_heights
|
||||
pub fn missing_heights_from<'a>(
|
||||
&'a self,
|
||||
local_chain: &'a LocalChain,
|
||||
) -> impl Iterator<Item = u32> + 'a
|
||||
where
|
||||
A: Anchor,
|
||||
{
|
||||
self.anchor_heights()
|
||||
.filter(move |height| !local_chain.blocks().contains_key(height))
|
||||
}
|
||||
}
|
||||
|
||||
impl<A: Ord> Append for Additions<A> {
|
||||
impl<A: Ord> Append for ChangeSet<A> {
|
||||
fn append(&mut self, mut other: Self) {
|
||||
self.txs.append(&mut other.txs);
|
||||
self.txouts.append(&mut other.txouts);
|
||||
@@ -1054,15 +1268,123 @@ impl<A> AsRef<TxGraph<A>> for TxGraph<A> {
|
||||
}
|
||||
}
|
||||
|
||||
impl<A> ForEachTxOut for Additions<A> {
|
||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut))) {
|
||||
self.txouts().for_each(f)
|
||||
/// An iterator that traverses ancestors of a given root transaction.
|
||||
///
|
||||
/// The iterator excludes partial transactions.
|
||||
///
|
||||
/// This `struct` is created by the [`walk_ancestors`] method of [`TxGraph`].
|
||||
///
|
||||
/// [`walk_ancestors`]: TxGraph::walk_ancestors
|
||||
pub struct TxAncestors<'g, A, F> {
|
||||
graph: &'g TxGraph<A>,
|
||||
visited: HashSet<Txid>,
|
||||
queue: VecDeque<(usize, &'g Transaction)>,
|
||||
filter_map: F,
|
||||
}
|
||||
|
||||
impl<'g, A, F> TxAncestors<'g, A, F> {
|
||||
/// Creates a `TxAncestors` that includes the starting `Transaction` when iterating.
|
||||
pub(crate) fn new_include_root(
|
||||
graph: &'g TxGraph<A>,
|
||||
tx: &'g Transaction,
|
||||
filter_map: F,
|
||||
) -> Self {
|
||||
Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
queue: [(0, tx)].into(),
|
||||
filter_map,
|
||||
}
|
||||
}
|
||||
|
||||
/// Creates a `TxAncestors` that excludes the starting `Transaction` when iterating.
|
||||
pub(crate) fn new_exclude_root(
|
||||
graph: &'g TxGraph<A>,
|
||||
tx: &'g Transaction,
|
||||
filter_map: F,
|
||||
) -> Self {
|
||||
let mut ancestors = Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
queue: Default::default(),
|
||||
filter_map,
|
||||
};
|
||||
ancestors.populate_queue(1, tx);
|
||||
ancestors
|
||||
}
|
||||
|
||||
/// Creates a `TxAncestors` from multiple starting `Transaction`s that includes the starting
|
||||
/// `Transaction`s when iterating.
|
||||
#[allow(unused)]
|
||||
pub(crate) fn from_multiple_include_root<I>(
|
||||
graph: &'g TxGraph<A>,
|
||||
txs: I,
|
||||
filter_map: F,
|
||||
) -> Self
|
||||
where
|
||||
I: IntoIterator<Item = &'g Transaction>,
|
||||
{
|
||||
Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
queue: txs.into_iter().map(|tx| (0, tx)).collect(),
|
||||
filter_map,
|
||||
}
|
||||
}
|
||||
|
||||
/// Creates a `TxAncestors` from multiple starting `Transaction`s that excludes the starting
|
||||
/// `Transaction`s when iterating.
|
||||
#[allow(unused)]
|
||||
pub(crate) fn from_multiple_exclude_root<I>(
|
||||
graph: &'g TxGraph<A>,
|
||||
txs: I,
|
||||
filter_map: F,
|
||||
) -> Self
|
||||
where
|
||||
I: IntoIterator<Item = &'g Transaction>,
|
||||
{
|
||||
let mut ancestors = Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
queue: Default::default(),
|
||||
filter_map,
|
||||
};
|
||||
for tx in txs {
|
||||
ancestors.populate_queue(1, tx);
|
||||
}
|
||||
ancestors
|
||||
}
|
||||
|
||||
fn populate_queue(&mut self, depth: usize, tx: &'g Transaction) {
|
||||
let ancestors = tx
|
||||
.input
|
||||
.iter()
|
||||
.map(|txin| txin.previous_output.txid)
|
||||
.filter(|&prev_txid| self.visited.insert(prev_txid))
|
||||
.filter_map(|prev_txid| self.graph.get_tx(prev_txid))
|
||||
.map(|tx| (depth, tx));
|
||||
self.queue.extend(ancestors);
|
||||
}
|
||||
}
|
||||
|
||||
impl<A> ForEachTxOut for TxGraph<A> {
|
||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut))) {
|
||||
self.all_txouts().for_each(f)
|
||||
impl<'g, A, F, O> Iterator for TxAncestors<'g, A, F>
|
||||
where
|
||||
F: FnMut(usize, &'g Transaction) -> Option<O>,
|
||||
{
|
||||
type Item = O;
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
loop {
|
||||
// we have exhausted all paths when queue is empty
|
||||
let (ancestor_depth, tx) = self.queue.pop_front()?;
|
||||
// ignore paths when user filters them out
|
||||
let item = match (self.filter_map)(ancestor_depth, tx) {
|
||||
Some(item) => item,
|
||||
None => continue,
|
||||
};
|
||||
self.populate_queue(ancestor_depth + 1, tx);
|
||||
return Some(item);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1074,7 +1396,7 @@ impl<A> ForEachTxOut for TxGraph<A> {
|
||||
pub struct TxDescendants<'g, A, F> {
|
||||
graph: &'g TxGraph<A>,
|
||||
visited: HashSet<Txid>,
|
||||
stack: Vec<(usize, Txid)>,
|
||||
queue: VecDeque<(usize, Txid)>,
|
||||
filter_map: F,
|
||||
}
|
||||
|
||||
@@ -1085,7 +1407,7 @@ impl<'g, A, F> TxDescendants<'g, A, F> {
|
||||
Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
stack: [(0, txid)].into(),
|
||||
queue: [(0, txid)].into(),
|
||||
filter_map,
|
||||
}
|
||||
}
|
||||
@@ -1095,14 +1417,14 @@ impl<'g, A, F> TxDescendants<'g, A, F> {
|
||||
let mut descendants = Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
stack: Default::default(),
|
||||
queue: Default::default(),
|
||||
filter_map,
|
||||
};
|
||||
descendants.populate_stack(1, txid);
|
||||
descendants.populate_queue(1, txid);
|
||||
descendants
|
||||
}
|
||||
|
||||
/// Creates a `TxDescendants` from multiple starting transactions that include the starting
|
||||
/// Creates a `TxDescendants` from multiple starting transactions that includes the starting
|
||||
/// `txid`s when iterating.
|
||||
pub(crate) fn from_multiple_include_root<I>(
|
||||
graph: &'g TxGraph<A>,
|
||||
@@ -1115,7 +1437,7 @@ impl<'g, A, F> TxDescendants<'g, A, F> {
|
||||
Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
stack: txids.into_iter().map(|txid| (0, txid)).collect(),
|
||||
queue: txids.into_iter().map(|txid| (0, txid)).collect(),
|
||||
filter_map,
|
||||
}
|
||||
}
|
||||
@@ -1134,25 +1456,25 @@ impl<'g, A, F> TxDescendants<'g, A, F> {
|
||||
let mut descendants = Self {
|
||||
graph,
|
||||
visited: Default::default(),
|
||||
stack: Default::default(),
|
||||
queue: Default::default(),
|
||||
filter_map,
|
||||
};
|
||||
for txid in txids {
|
||||
descendants.populate_stack(1, txid);
|
||||
descendants.populate_queue(1, txid);
|
||||
}
|
||||
descendants
|
||||
}
|
||||
}
|
||||
|
||||
impl<'g, A, F> TxDescendants<'g, A, F> {
|
||||
fn populate_stack(&mut self, depth: usize, txid: Txid) {
|
||||
fn populate_queue(&mut self, depth: usize, txid: Txid) {
|
||||
let spend_paths = self
|
||||
.graph
|
||||
.spends
|
||||
.range(tx_outpoint_range(txid))
|
||||
.flat_map(|(_, spends)| spends)
|
||||
.map(|&txid| (depth, txid));
|
||||
self.stack.extend(spend_paths);
|
||||
self.queue.extend(spend_paths);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1164,8 +1486,8 @@ where
|
||||
|
||||
fn next(&mut self) -> Option<Self::Item> {
|
||||
let (op_spends, txid, item) = loop {
|
||||
// we have exhausted all paths when stack is empty
|
||||
let (op_spends, txid) = self.stack.pop()?;
|
||||
// we have exhausted all paths when queue is empty
|
||||
let (op_spends, txid) = self.queue.pop_front()?;
|
||||
// we do not want to visit the same transaction twice
|
||||
if self.visited.insert(txid) {
|
||||
// ignore paths when user filters them out
|
||||
@@ -1175,7 +1497,7 @@ where
|
||||
}
|
||||
};
|
||||
|
||||
self.populate_stack(op_spends + 1, txid);
|
||||
self.populate_queue(op_spends + 1, txid);
|
||||
Some(item)
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,3 +1,16 @@
|
||||
mod tx_template;
|
||||
pub use tx_template::*;
|
||||
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! block_id {
|
||||
($height:expr, $hash:literal) => {{
|
||||
bdk_chain::BlockId {
|
||||
height: $height,
|
||||
hash: bitcoin::hashes::Hash::hash($hash.as_bytes()),
|
||||
}
|
||||
}};
|
||||
}
|
||||
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! h {
|
||||
($index:literal) => {{
|
||||
@@ -9,25 +22,21 @@ macro_rules! h {
|
||||
macro_rules! local_chain {
|
||||
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||
#[allow(unused_mut)]
|
||||
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*])
|
||||
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*].into_iter().collect())
|
||||
.expect("chain must have genesis block")
|
||||
}};
|
||||
}
|
||||
|
||||
#[allow(unused_macros)]
|
||||
macro_rules! chain {
|
||||
($([$($tt:tt)*]),*) => { chain!( checkpoints: [$([$($tt)*]),*] ) };
|
||||
(checkpoints: $($tail:tt)*) => { chain!( index: TxHeight, checkpoints: $($tail)*) };
|
||||
(index: $ind:ty, checkpoints: [ $([$height:expr, $block_hash:expr]),* ] $(,txids: [$(($txid:expr, $tx_height:expr)),*])?) => {{
|
||||
macro_rules! chain_update {
|
||||
[ $(($height:expr, $hash:expr)), * ] => {{
|
||||
#[allow(unused_mut)]
|
||||
let mut chain = bdk_chain::sparse_chain::SparseChain::<$ind>::from_checkpoints([$(($height, $block_hash).into()),*]);
|
||||
|
||||
$(
|
||||
$(
|
||||
let _ = chain.insert_tx($txid, $tx_height).expect("should succeed");
|
||||
)*
|
||||
)?
|
||||
|
||||
chain
|
||||
bdk_chain::local_chain::Update {
|
||||
tip: bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $hash).into()),*].into_iter().collect())
|
||||
.expect("chain must have genesis block")
|
||||
.tip(),
|
||||
introduce_older_blocks: true,
|
||||
}
|
||||
}};
|
||||
}
|
||||
|
||||
@@ -61,7 +70,7 @@ macro_rules! changeset {
|
||||
pub fn new_tx(lt: u32) -> bitcoin::Transaction {
|
||||
bitcoin::Transaction {
|
||||
version: 0x00,
|
||||
lock_time: bitcoin::PackedLockTime(lt),
|
||||
lock_time: bitcoin::absolute::LockTime::from_consensus(lt),
|
||||
input: vec![],
|
||||
output: vec![],
|
||||
}
|
||||
|
||||
136
crates/chain/tests/common/tx_template.rs
Normal file
136
crates/chain/tests/common/tx_template.rs
Normal file
@@ -0,0 +1,136 @@
|
||||
use rand::distributions::{Alphanumeric, DistString};
|
||||
use std::collections::HashMap;
|
||||
|
||||
use bdk_chain::{tx_graph::TxGraph, BlockId, SpkTxOutIndex};
|
||||
use bitcoin::{
|
||||
locktime::absolute::LockTime, secp256k1::Secp256k1, OutPoint, ScriptBuf, Sequence, Transaction,
|
||||
TxIn, TxOut, Txid, Witness,
|
||||
};
|
||||
use miniscript::Descriptor;
|
||||
|
||||
/// Template for creating a transaction in `TxGraph`.
|
||||
///
|
||||
/// The incentive for transaction templates is to create a transaction history in a simple manner to
|
||||
/// avoid having to explicitly hash previous transactions to form previous outpoints of later
|
||||
/// transactions.
|
||||
#[derive(Clone, Copy, Default)]
|
||||
pub struct TxTemplate<'a, A> {
|
||||
/// Uniquely identifies the transaction, before it can have a txid.
|
||||
pub tx_name: &'a str,
|
||||
pub inputs: &'a [TxInTemplate<'a>],
|
||||
pub outputs: &'a [TxOutTemplate],
|
||||
pub anchors: &'a [A],
|
||||
pub last_seen: Option<u64>,
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub enum TxInTemplate<'a> {
|
||||
/// This will give a random txid and vout.
|
||||
Bogus,
|
||||
|
||||
/// This is used for coinbase transactions because they do not have previous outputs.
|
||||
Coinbase,
|
||||
|
||||
/// Contains the `tx_name` and `vout` that we are spending. The rule is that we must only spend
|
||||
/// from tx of a previous `TxTemplate`.
|
||||
PrevTx(&'a str, usize),
|
||||
}
|
||||
|
||||
pub struct TxOutTemplate {
|
||||
pub value: u64,
|
||||
pub spk_index: Option<u32>, // some = get spk from SpkTxOutIndex, none = random spk
|
||||
}
|
||||
|
||||
#[allow(unused)]
|
||||
impl TxOutTemplate {
|
||||
pub fn new(value: u64, spk_index: Option<u32>) -> Self {
|
||||
TxOutTemplate { value, spk_index }
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub fn init_graph<'a>(
|
||||
tx_templates: impl IntoIterator<Item = &'a TxTemplate<'a, BlockId>>,
|
||||
) -> (TxGraph<BlockId>, SpkTxOutIndex<u32>, HashMap<&'a str, Txid>) {
|
||||
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/0/*)").unwrap();
|
||||
let mut graph = TxGraph::<BlockId>::default();
|
||||
let mut spk_index = SpkTxOutIndex::default();
|
||||
(0..10).for_each(|index| {
|
||||
spk_index.insert_spk(
|
||||
index,
|
||||
descriptor
|
||||
.at_derivation_index(index)
|
||||
.unwrap()
|
||||
.script_pubkey(),
|
||||
);
|
||||
});
|
||||
let mut tx_ids = HashMap::<&'a str, Txid>::new();
|
||||
|
||||
for (bogus_txin_vout, tx_tmp) in tx_templates.into_iter().enumerate() {
|
||||
let tx = Transaction {
|
||||
version: 0,
|
||||
lock_time: LockTime::ZERO,
|
||||
input: tx_tmp
|
||||
.inputs
|
||||
.iter()
|
||||
.map(|input| match input {
|
||||
TxInTemplate::Bogus => TxIn {
|
||||
previous_output: OutPoint::new(
|
||||
bitcoin::hashes::Hash::hash(
|
||||
Alphanumeric
|
||||
.sample_string(&mut rand::thread_rng(), 20)
|
||||
.as_bytes(),
|
||||
),
|
||||
bogus_txin_vout as u32,
|
||||
),
|
||||
script_sig: ScriptBuf::new(),
|
||||
sequence: Sequence::default(),
|
||||
witness: Witness::new(),
|
||||
},
|
||||
TxInTemplate::Coinbase => TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
script_sig: ScriptBuf::new(),
|
||||
sequence: Sequence::MAX,
|
||||
witness: Witness::new(),
|
||||
},
|
||||
TxInTemplate::PrevTx(prev_name, prev_vout) => {
|
||||
let prev_txid = tx_ids.get(prev_name).expect(
|
||||
"txin template must spend from tx of template that comes before",
|
||||
);
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(*prev_txid, *prev_vout as _),
|
||||
script_sig: ScriptBuf::new(),
|
||||
sequence: Sequence::default(),
|
||||
witness: Witness::new(),
|
||||
}
|
||||
}
|
||||
})
|
||||
.collect(),
|
||||
output: tx_tmp
|
||||
.outputs
|
||||
.iter()
|
||||
.map(|output| match &output.spk_index {
|
||||
None => TxOut {
|
||||
value: output.value,
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
Some(index) => TxOut {
|
||||
value: output.value,
|
||||
script_pubkey: spk_index.spk_at_index(index).unwrap().to_owned(),
|
||||
},
|
||||
})
|
||||
.collect(),
|
||||
};
|
||||
|
||||
tx_ids.insert(tx_tmp.tx_name, tx.txid());
|
||||
spk_index.scan(&tx);
|
||||
let _ = graph.insert_tx(tx.clone());
|
||||
for anchor in tx_tmp.anchors.iter() {
|
||||
let _ = graph.insert_anchor(tx.txid(), *anchor);
|
||||
}
|
||||
if let Some(seen_at) = tx_tmp.last_seen {
|
||||
let _ = graph.insert_seen_at(tx.txid(), seen_at);
|
||||
}
|
||||
}
|
||||
(graph, spk_index, tx_ids)
|
||||
}
|
||||
@@ -1,16 +1,15 @@
|
||||
#[macro_use]
|
||||
mod common;
|
||||
|
||||
use std::collections::{BTreeMap, BTreeSet};
|
||||
use std::collections::BTreeSet;
|
||||
|
||||
use bdk_chain::{
|
||||
indexed_tx_graph::{IndexedAdditions, IndexedTxGraph},
|
||||
keychain::{Balance, DerivationAdditions, KeychainTxOutIndex},
|
||||
indexed_tx_graph::{self, IndexedTxGraph},
|
||||
keychain::{self, Balance, KeychainTxOutIndex},
|
||||
local_chain::LocalChain,
|
||||
tx_graph::Additions,
|
||||
BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||
tx_graph, BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bitcoin::{secp256k1::Secp256k1, BlockHash, OutPoint, Script, Transaction, TxIn, TxOut};
|
||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, ScriptBuf, Transaction, TxIn, TxOut};
|
||||
use miniscript::Descriptor;
|
||||
|
||||
/// Ensure [`IndexedTxGraph::insert_relevant_txs`] can successfully index transactions NOT presented
|
||||
@@ -25,8 +24,8 @@ fn insert_relevant_txs() {
|
||||
const DESCRIPTOR: &str = "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)";
|
||||
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), DESCRIPTOR)
|
||||
.expect("must be valid");
|
||||
let spk_0 = descriptor.at_derivation_index(0).script_pubkey();
|
||||
let spk_1 = descriptor.at_derivation_index(9).script_pubkey();
|
||||
let spk_0 = descriptor.at_derivation_index(0).unwrap().script_pubkey();
|
||||
let spk_1 = descriptor.at_derivation_index(9).unwrap().script_pubkey();
|
||||
|
||||
let mut graph = IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<()>>::default();
|
||||
graph.index.add_keychain((), descriptor);
|
||||
@@ -64,16 +63,20 @@ fn insert_relevant_txs() {
|
||||
|
||||
let txs = [tx_c, tx_b, tx_a];
|
||||
|
||||
assert_eq!(
|
||||
graph.insert_relevant_txs(txs.iter().map(|tx| (tx, None)), None),
|
||||
IndexedAdditions {
|
||||
graph_additions: Additions {
|
||||
txs: txs.into(),
|
||||
let changeset = indexed_tx_graph::ChangeSet {
|
||||
graph: tx_graph::ChangeSet {
|
||||
txs: txs.clone().into(),
|
||||
..Default::default()
|
||||
},
|
||||
index_additions: DerivationAdditions([((), 9_u32)].into()),
|
||||
}
|
||||
)
|
||||
indexer: keychain::ChangeSet([((), 9_u32)].into()),
|
||||
};
|
||||
|
||||
assert_eq!(
|
||||
graph.batch_insert_relevant(txs.iter().map(|tx| (tx, None))),
|
||||
changeset,
|
||||
);
|
||||
|
||||
assert_eq!(graph.initial_changeset(), changeset,);
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -107,11 +110,8 @@ fn insert_relevant_txs() {
|
||||
|
||||
fn test_list_owned_txouts() {
|
||||
// Create Local chains
|
||||
|
||||
let local_chain = (0..150)
|
||||
.map(|i| (i as u32, h!("random")))
|
||||
.collect::<BTreeMap<u32, BlockHash>>();
|
||||
let local_chain = LocalChain::from(local_chain);
|
||||
let local_chain = LocalChain::from_blocks((0..150).map(|i| (i as u32, h!("random"))).collect())
|
||||
.expect("must have genesis hash");
|
||||
|
||||
// Initiate IndexedTxGraph
|
||||
|
||||
@@ -127,21 +127,21 @@ fn test_list_owned_txouts() {
|
||||
|
||||
// Get trusted and untrusted addresses
|
||||
|
||||
let mut trusted_spks = Vec::new();
|
||||
let mut untrusted_spks = Vec::new();
|
||||
let mut trusted_spks: Vec<ScriptBuf> = Vec::new();
|
||||
let mut untrusted_spks: Vec<ScriptBuf> = Vec::new();
|
||||
|
||||
{
|
||||
// we need to scope here to take immutanble reference of the graph
|
||||
for _ in 0..10 {
|
||||
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_1".to_string());
|
||||
// TODO Assert indexes
|
||||
trusted_spks.push(script.clone());
|
||||
trusted_spks.push(script.to_owned());
|
||||
}
|
||||
}
|
||||
{
|
||||
for _ in 0..10 {
|
||||
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_2".to_string());
|
||||
untrusted_spks.push(script.clone());
|
||||
untrusted_spks.push(script.to_owned());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -155,7 +155,7 @@ fn test_list_owned_txouts() {
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 70000,
|
||||
script_pubkey: trusted_spks[0].clone(),
|
||||
script_pubkey: trusted_spks[0].to_owned(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
@@ -164,7 +164,7 @@ fn test_list_owned_txouts() {
|
||||
let tx2 = Transaction {
|
||||
output: vec![TxOut {
|
||||
value: 30000,
|
||||
script_pubkey: untrusted_spks[0].clone(),
|
||||
script_pubkey: untrusted_spks[0].to_owned(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
@@ -177,7 +177,7 @@ fn test_list_owned_txouts() {
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 10000,
|
||||
script_pubkey: trusted_spks[1].clone(),
|
||||
script_pubkey: trusted_spks[1].to_owned(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
@@ -186,7 +186,7 @@ fn test_list_owned_txouts() {
|
||||
let tx4 = Transaction {
|
||||
output: vec![TxOut {
|
||||
value: 20000,
|
||||
script_pubkey: untrusted_spks[1].clone(),
|
||||
script_pubkey: untrusted_spks[1].to_owned(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
@@ -195,7 +195,7 @@ fn test_list_owned_txouts() {
|
||||
let tx5 = Transaction {
|
||||
output: vec![TxOut {
|
||||
value: 15000,
|
||||
script_pubkey: trusted_spks[2].clone(),
|
||||
script_pubkey: trusted_spks[2].to_owned(),
|
||||
}],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
@@ -206,25 +206,24 @@ fn test_list_owned_txouts() {
|
||||
// Insert transactions into graph with respective anchors
|
||||
// For unconfirmed txs we pass in `None`.
|
||||
|
||||
let _ = graph.insert_relevant_txs(
|
||||
[&tx1, &tx2, &tx3, &tx6].iter().enumerate().map(|(i, tx)| {
|
||||
let _ =
|
||||
graph.batch_insert_relevant([&tx1, &tx2, &tx3, &tx6].iter().enumerate().map(|(i, tx)| {
|
||||
let height = i as u32;
|
||||
(
|
||||
*tx,
|
||||
local_chain
|
||||
.blocks()
|
||||
.get(&height)
|
||||
.map(|&hash| BlockId { height, hash })
|
||||
.cloned()
|
||||
.map(|hash| BlockId { height, hash })
|
||||
.map(|anchor_block| ConfirmationHeightAnchor {
|
||||
anchor_block,
|
||||
confirmation_height: anchor_block.height,
|
||||
}),
|
||||
)
|
||||
}),
|
||||
None,
|
||||
);
|
||||
}));
|
||||
|
||||
let _ = graph.insert_relevant_txs([&tx4, &tx5].iter().map(|tx| (*tx, None)), Some(100));
|
||||
let _ = graph.batch_insert_relevant_unconfirmed([&tx4, &tx5].iter().map(|tx| (*tx, 100)));
|
||||
|
||||
// A helper lambda to extract and filter data from the graph.
|
||||
let fetch =
|
||||
@@ -234,7 +233,7 @@ fn test_list_owned_txouts() {
|
||||
.blocks()
|
||||
.get(&height)
|
||||
.map(|&hash| BlockId { height, hash })
|
||||
.expect("block must exist");
|
||||
.unwrap_or_else(|| panic!("block must exist at {}", height));
|
||||
let txouts = graph
|
||||
.graph()
|
||||
.filter_chain_txouts(
|
||||
@@ -257,7 +256,7 @@ fn test_list_owned_txouts() {
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|_, spk: &Script| trusted_spks.contains(spk),
|
||||
|_, spk: &Script| trusted_spks.contains(&spk.to_owned()),
|
||||
);
|
||||
|
||||
assert_eq!(txouts.len(), 5);
|
||||
|
||||
@@ -4,10 +4,12 @@
|
||||
mod common;
|
||||
use bdk_chain::{
|
||||
collections::BTreeMap,
|
||||
keychain::{DerivationAdditions, KeychainTxOutIndex},
|
||||
indexed_tx_graph::Indexer,
|
||||
keychain::{self, KeychainTxOutIndex},
|
||||
Append,
|
||||
};
|
||||
|
||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, Transaction, TxOut};
|
||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, ScriptBuf, Transaction, TxOut};
|
||||
use miniscript::{Descriptor, DescriptorPublicKey};
|
||||
|
||||
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||
@@ -33,7 +35,7 @@ fn init_txout_index() -> (
|
||||
(txout_index, external_descriptor, internal_descriptor)
|
||||
}
|
||||
|
||||
fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> Script {
|
||||
fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> ScriptBuf {
|
||||
descriptor
|
||||
.derived_descriptor(&Secp256k1::verification_only(), index)
|
||||
.expect("must derive")
|
||||
@@ -42,6 +44,8 @@ fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> Scr
|
||||
|
||||
#[test]
|
||||
fn test_set_all_derivation_indices() {
|
||||
use bdk_chain::indexed_tx_graph::Indexer;
|
||||
|
||||
let (mut txout_index, _, _) = init_txout_index();
|
||||
let derive_to: BTreeMap<_, _> =
|
||||
[(TestKeychain::External, 12), (TestKeychain::Internal, 24)].into();
|
||||
@@ -52,9 +56,10 @@ fn test_set_all_derivation_indices() {
|
||||
assert_eq!(txout_index.last_revealed_indices(), &derive_to);
|
||||
assert_eq!(
|
||||
txout_index.reveal_to_target_multi(&derive_to).1,
|
||||
DerivationAdditions::default(),
|
||||
keychain::ChangeSet::default(),
|
||||
"no changes if we set to the same thing"
|
||||
);
|
||||
assert_eq!(txout_index.initial_changeset().as_inner(), &derive_to);
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -78,14 +83,14 @@ fn test_lookahead() {
|
||||
// - scripts cached in spk_txout_index should increase correctly
|
||||
// - stored scripts of external keychain should be of expected counts
|
||||
for index in (0..20).skip_while(|i| i % 2 == 1) {
|
||||
let (revealed_spks, revealed_additions) =
|
||||
let (revealed_spks, revealed_changeset) =
|
||||
txout_index.reveal_to_target(&TestKeychain::External, index);
|
||||
assert_eq!(
|
||||
revealed_spks.collect::<Vec<_>>(),
|
||||
vec![(index, spk_at_index(&external_desc, index))],
|
||||
);
|
||||
assert_eq!(
|
||||
revealed_additions.as_inner(),
|
||||
revealed_changeset.as_inner(),
|
||||
&[(TestKeychain::External, index)].into()
|
||||
);
|
||||
|
||||
@@ -128,7 +133,7 @@ fn test_lookahead() {
|
||||
// - derivation index is set ahead of current derivation index + lookahead
|
||||
// expect:
|
||||
// - scripts cached in spk_txout_index should increase correctly, a.k.a. no scripts are skipped
|
||||
let (revealed_spks, revealed_additions) =
|
||||
let (revealed_spks, revealed_changeset) =
|
||||
txout_index.reveal_to_target(&TestKeychain::Internal, 24);
|
||||
assert_eq!(
|
||||
revealed_spks.collect::<Vec<_>>(),
|
||||
@@ -137,7 +142,7 @@ fn test_lookahead() {
|
||||
.collect::<Vec<_>>(),
|
||||
);
|
||||
assert_eq!(
|
||||
revealed_additions.as_inner(),
|
||||
revealed_changeset.as_inner(),
|
||||
&[(TestKeychain::Internal, 24)].into()
|
||||
);
|
||||
assert_eq!(
|
||||
@@ -176,19 +181,21 @@ fn test_lookahead() {
|
||||
TxOut {
|
||||
script_pubkey: external_desc
|
||||
.at_derivation_index(external_index)
|
||||
.unwrap()
|
||||
.script_pubkey(),
|
||||
value: 10_000,
|
||||
},
|
||||
TxOut {
|
||||
script_pubkey: internal_desc
|
||||
.at_derivation_index(internal_index)
|
||||
.unwrap()
|
||||
.script_pubkey(),
|
||||
value: 10_000,
|
||||
},
|
||||
],
|
||||
..common::new_tx(external_index)
|
||||
};
|
||||
assert_eq!(txout_index.scan(&tx), DerivationAdditions::default());
|
||||
assert_eq!(txout_index.index_tx(&tx), keychain::ChangeSet::default());
|
||||
assert_eq!(
|
||||
txout_index.last_revealed_index(&TestKeychain::External),
|
||||
Some(last_external_index)
|
||||
@@ -222,9 +229,17 @@ fn test_scan_with_lookahead() {
|
||||
let (mut txout_index, external_desc, _) = init_txout_index();
|
||||
txout_index.set_lookahead_for_all(10);
|
||||
|
||||
let spks: BTreeMap<u32, Script> = [0, 10, 20, 30]
|
||||
let spks: BTreeMap<u32, ScriptBuf> = [0, 10, 20, 30]
|
||||
.into_iter()
|
||||
.map(|i| (i, external_desc.at_derivation_index(i).script_pubkey()))
|
||||
.map(|i| {
|
||||
(
|
||||
i,
|
||||
external_desc
|
||||
.at_derivation_index(i)
|
||||
.unwrap()
|
||||
.script_pubkey(),
|
||||
)
|
||||
})
|
||||
.collect();
|
||||
|
||||
for (&spk_i, spk) in &spks {
|
||||
@@ -234,9 +249,9 @@ fn test_scan_with_lookahead() {
|
||||
value: 0,
|
||||
};
|
||||
|
||||
let additions = txout_index.scan_txout(op, &txout);
|
||||
let changeset = txout_index.index_txout(op, &txout);
|
||||
assert_eq!(
|
||||
additions.as_inner(),
|
||||
changeset.as_inner(),
|
||||
&[(TestKeychain::External, spk_i)].into()
|
||||
);
|
||||
assert_eq!(
|
||||
@@ -250,36 +265,40 @@ fn test_scan_with_lookahead() {
|
||||
}
|
||||
|
||||
// now try with index 41 (lookahead surpassed), we expect that the txout to not be indexed
|
||||
let spk_41 = external_desc.at_derivation_index(41).script_pubkey();
|
||||
let spk_41 = external_desc
|
||||
.at_derivation_index(41)
|
||||
.unwrap()
|
||||
.script_pubkey();
|
||||
let op = OutPoint::new(h!("fake tx"), 41);
|
||||
let txout = TxOut {
|
||||
script_pubkey: spk_41,
|
||||
value: 0,
|
||||
};
|
||||
let additions = txout_index.scan_txout(op, &txout);
|
||||
assert!(additions.is_empty());
|
||||
let changeset = txout_index.index_txout(op, &txout);
|
||||
assert!(changeset.is_empty());
|
||||
}
|
||||
|
||||
#[test]
|
||||
#[rustfmt::skip]
|
||||
fn test_wildcard_derivations() {
|
||||
let (mut txout_index, external_desc, _) = init_txout_index();
|
||||
let external_spk_0 = external_desc.at_derivation_index(0).script_pubkey();
|
||||
let external_spk_16 = external_desc.at_derivation_index(16).script_pubkey();
|
||||
let external_spk_26 = external_desc.at_derivation_index(26).script_pubkey();
|
||||
let external_spk_27 = external_desc.at_derivation_index(27).script_pubkey();
|
||||
let external_spk_0 = external_desc.at_derivation_index(0).unwrap().script_pubkey();
|
||||
let external_spk_16 = external_desc.at_derivation_index(16).unwrap().script_pubkey();
|
||||
let external_spk_26 = external_desc.at_derivation_index(26).unwrap().script_pubkey();
|
||||
let external_spk_27 = external_desc.at_derivation_index(27).unwrap().script_pubkey();
|
||||
|
||||
// - nothing is derived
|
||||
// - unused list is also empty
|
||||
//
|
||||
// - next_derivation_index() == (0, true)
|
||||
// - derive_new() == ((0, <spk>), DerivationAdditions)
|
||||
// - next_unused() == ((0, <spk>), DerivationAdditions:is_empty())
|
||||
// - derive_new() == ((0, <spk>), keychain::ChangeSet)
|
||||
// - next_unused() == ((0, <spk>), keychain::ChangeSet:is_empty())
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0_u32, &external_spk_0));
|
||||
assert_eq!(spk, (0_u32, external_spk_0.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0_u32, &external_spk_0));
|
||||
assert_eq!(spk, (0_u32, external_spk_0.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
// - derived till 25
|
||||
@@ -288,33 +307,33 @@ fn test_wildcard_derivations() {
|
||||
// - unused list: [16, 18, 19, 21, 22, 24, 25]
|
||||
|
||||
// - next_derivation_index() = (26, true)
|
||||
// - derive_new() = ((26, <spk>), DerivationAdditions)
|
||||
// - next_unused() == ((16, <spk>), DerivationAdditions::is_empty())
|
||||
// - derive_new() = ((26, <spk>), keychain::ChangeSet)
|
||||
// - next_unused() == ((16, <spk>), keychain::ChangeSet::is_empty())
|
||||
let _ = txout_index.reveal_to_target(&TestKeychain::External, 25);
|
||||
|
||||
(0..=15)
|
||||
.chain(vec![17, 20, 23].into_iter())
|
||||
.chain([17, 20, 23])
|
||||
.for_each(|index| assert!(txout_index.mark_used(&TestKeychain::External, index)));
|
||||
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (26, true));
|
||||
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (26, &external_spk_26));
|
||||
assert_eq!(spk, (26, external_spk_26.as_script()));
|
||||
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 26)].into());
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (16, &external_spk_16));
|
||||
assert_eq!(spk, (16, external_spk_16.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
// - Use all the derived till 26.
|
||||
// - next_unused() = ((27, <spk>), DerivationAdditions)
|
||||
// - next_unused() = ((27, <spk>), keychain::ChangeSet)
|
||||
(0..=26).for_each(|index| {
|
||||
txout_index.mark_used(&TestKeychain::External, index);
|
||||
});
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (27, &external_spk_27));
|
||||
assert_eq!(spk, (27, external_spk_27.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 27)].into());
|
||||
}
|
||||
|
||||
@@ -326,6 +345,7 @@ fn test_non_wildcard_derivations() {
|
||||
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||
let external_spk = no_wildcard_descriptor
|
||||
.at_derivation_index(0)
|
||||
.unwrap()
|
||||
.script_pubkey();
|
||||
|
||||
txout_index.add_keychain(TestKeychain::External, no_wildcard_descriptor);
|
||||
@@ -338,11 +358,11 @@ fn test_non_wildcard_derivations() {
|
||||
// - when we get the next unused script, script @ index 0
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(spk, (0, external_spk.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(spk, (0, external_spk.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
// given:
|
||||
@@ -350,19 +370,27 @@ fn test_non_wildcard_derivations() {
|
||||
// expect:
|
||||
// - next derivation index should not be new
|
||||
// - derive new and next unused should return the old script
|
||||
// - store_up_to should not panic and return empty additions
|
||||
// - store_up_to should not panic and return empty changeset
|
||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, false));
|
||||
txout_index.mark_used(&TestKeychain::External, 0);
|
||||
|
||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(spk, (0, external_spk.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
|
||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||
assert_eq!(spk, (0, &external_spk));
|
||||
assert_eq!(spk, (0, external_spk.as_script()));
|
||||
assert_eq!(changeset.as_inner(), &[].into());
|
||||
let (revealed_spks, revealed_additions) =
|
||||
let (revealed_spks, revealed_changeset) =
|
||||
txout_index.reveal_to_target(&TestKeychain::External, 200);
|
||||
assert_eq!(revealed_spks.count(), 0);
|
||||
assert!(revealed_additions.is_empty());
|
||||
assert!(revealed_changeset.is_empty());
|
||||
|
||||
// we check that spks_of_keychain returns a SpkIterator with just one element
|
||||
assert_eq!(
|
||||
txout_index
|
||||
.spks_of_keychain(&TestKeychain::External)
|
||||
.count(),
|
||||
1,
|
||||
);
|
||||
}
|
||||
|
||||
@@ -1,217 +1,341 @@
|
||||
use bdk_chain::local_chain::{
|
||||
ChangeSet, InsertBlockNotMatchingError, LocalChain, UpdateNotConnectedError,
|
||||
AlterCheckPointError, CannotConnectError, ChangeSet, LocalChain, Update,
|
||||
};
|
||||
use bitcoin::BlockHash;
|
||||
|
||||
#[macro_use]
|
||||
mod common;
|
||||
|
||||
#[test]
|
||||
fn add_first_tip() {
|
||||
let chain = LocalChain::default();
|
||||
#[derive(Debug)]
|
||||
struct TestLocalChain<'a> {
|
||||
name: &'static str,
|
||||
chain: LocalChain,
|
||||
update: Update,
|
||||
exp: ExpectedResult<'a>,
|
||||
}
|
||||
|
||||
#[derive(Debug, PartialEq)]
|
||||
enum ExpectedResult<'a> {
|
||||
Ok {
|
||||
changeset: &'a [(u32, Option<BlockHash>)],
|
||||
init_changeset: &'a [(u32, Option<BlockHash>)],
|
||||
},
|
||||
Err(CannotConnectError),
|
||||
}
|
||||
|
||||
impl<'a> TestLocalChain<'a> {
|
||||
fn run(mut self) {
|
||||
println!("[TestLocalChain] test: {}", self.name);
|
||||
let got_changeset = match self.chain.apply_update(self.update) {
|
||||
Ok(changeset) => changeset,
|
||||
Err(got_err) => {
|
||||
assert_eq!(
|
||||
chain.determine_changeset(&local_chain![(0, h!("A"))]),
|
||||
Ok([(0, Some(h!("A")))].into()),
|
||||
"add first tip"
|
||||
ExpectedResult::Err(got_err),
|
||||
self.exp,
|
||||
"{}: unexpected error",
|
||||
self.name
|
||||
);
|
||||
}
|
||||
return;
|
||||
}
|
||||
};
|
||||
|
||||
#[test]
|
||||
fn add_second_tip() {
|
||||
let chain = local_chain![(0, h!("A"))];
|
||||
match self.exp {
|
||||
ExpectedResult::Ok {
|
||||
changeset,
|
||||
init_changeset,
|
||||
} => {
|
||||
assert_eq!(
|
||||
chain.determine_changeset(&local_chain![(0, h!("A")), (1, h!("B"))]),
|
||||
Ok([(1, Some(h!("B")))].into())
|
||||
got_changeset,
|
||||
changeset.iter().cloned().collect(),
|
||||
"{}: unexpected changeset",
|
||||
self.name
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn two_disjoint_chains_cannot_merge() {
|
||||
let chain1 = local_chain![(0, h!("A"))];
|
||||
let chain2 = local_chain![(1, h!("B"))];
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Err(UpdateNotConnectedError(0))
|
||||
self.chain.initial_changeset(),
|
||||
init_changeset.iter().cloned().collect(),
|
||||
"{}: unexpected initial changeset",
|
||||
self.name
|
||||
);
|
||||
}
|
||||
ExpectedResult::Err(err) => panic!(
|
||||
"{}: expected error ({}), got non-error result: {:?}",
|
||||
self.name, err, got_changeset
|
||||
),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn duplicate_chains_should_merge() {
|
||||
let chain1 = local_chain![(0, h!("A"))];
|
||||
let chain2 = local_chain![(0, h!("A"))];
|
||||
assert_eq!(chain1.determine_changeset(&chain2), Ok(Default::default()));
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn can_introduce_older_checkpoints() {
|
||||
let chain1 = local_chain![(2, h!("C")), (3, h!("D"))];
|
||||
let chain2 = local_chain![(1, h!("B")), (2, h!("C"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([(1, Some(h!("B")))].into())
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn fix_blockhash_before_agreement_point() {
|
||||
let chain1 = local_chain![(0, h!("im-wrong")), (1, h!("we-agree"))];
|
||||
let chain2 = local_chain![(0, h!("fix")), (1, h!("we-agree"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([(0, Some(h!("fix")))].into())
|
||||
)
|
||||
}
|
||||
|
||||
/// B and C are in both chain and update
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | B C
|
||||
/// update | A B C D
|
||||
/// ```
|
||||
/// This should succeed with the point of agreement being C and A should be added in addition.
|
||||
#[test]
|
||||
fn two_points_of_agreement() {
|
||||
let chain1 = local_chain![(1, h!("B")), (2, h!("C"))];
|
||||
let chain2 = local_chain![(0, h!("A")), (1, h!("B")), (2, h!("C")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([(0, Some(h!("A"))), (3, Some(h!("D")))].into()),
|
||||
);
|
||||
}
|
||||
|
||||
/// Update and chain does not connect:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | B C
|
||||
/// update | A B D
|
||||
/// ```
|
||||
/// This should fail as we cannot figure out whether C & D are on the same chain
|
||||
#[test]
|
||||
fn update_and_chain_does_not_connect() {
|
||||
let chain1 = local_chain![(1, h!("B")), (2, h!("C"))];
|
||||
let chain2 = local_chain![(0, h!("A")), (1, h!("B")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Err(UpdateNotConnectedError(2)),
|
||||
);
|
||||
}
|
||||
|
||||
/// Transient invalidation:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
/// chain | A B C E
|
||||
/// update | A B' C' D
|
||||
/// ```
|
||||
/// This should succeed and invalidate B,C and E with point of agreement being A.
|
||||
#[test]
|
||||
fn transitive_invalidation_applies_to_checkpoints_higher_than_invalidation() {
|
||||
let chain1 = local_chain![(0, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))];
|
||||
let chain2 = local_chain![(0, h!("A")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([
|
||||
fn update_local_chain() {
|
||||
[
|
||||
TestLocalChain {
|
||||
name: "add first tip",
|
||||
chain: local_chain![(0, h!("A"))],
|
||||
update: chain_update![(0, h!("A"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[],
|
||||
init_changeset: &[(0, Some(h!("A")))],
|
||||
},
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "add second tip",
|
||||
chain: local_chain![(0, h!("A"))],
|
||||
update: chain_update![(0, h!("A")), (1, h!("B"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(1, Some(h!("B")))],
|
||||
init_changeset: &[(0, Some(h!("A"))), (1, Some(h!("B")))],
|
||||
},
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "two disjoint chains cannot merge",
|
||||
chain: local_chain![(0, h!("_")), (1, h!("A"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError {
|
||||
try_include_height: 1,
|
||||
}),
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "two disjoint chains cannot merge (existing chain longer)",
|
||||
chain: local_chain![(0, h!("_")), (2, h!("A"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("B"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError {
|
||||
try_include_height: 2,
|
||||
}),
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "duplicate chains should merge",
|
||||
chain: local_chain![(0, h!("A"))],
|
||||
update: chain_update![(0, h!("A"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[],
|
||||
init_changeset: &[(0, Some(h!("A")))],
|
||||
},
|
||||
},
|
||||
// Introduce an older checkpoint (B)
|
||||
// | 0 | 1 | 2 | 3
|
||||
// chain | _ C D
|
||||
// update | _ B C
|
||||
TestLocalChain {
|
||||
name: "can introduce older checkpoint",
|
||||
chain: local_chain![(0, h!("_")), (2, h!("C")), (3, h!("D"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("B")), (2, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(1, Some(h!("B")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("B"))), (2, Some(h!("C"))), (3, Some(h!("D")))],
|
||||
},
|
||||
},
|
||||
// Introduce an older checkpoint (A) that is not directly behind PoA
|
||||
// | 0 | 2 | 3 | 4
|
||||
// chain | _ B C
|
||||
// update | _ A C
|
||||
TestLocalChain {
|
||||
name: "can introduce older checkpoint 2",
|
||||
chain: local_chain![(0, h!("_")), (3, h!("B")), (4, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("A")), (4, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(2, Some(h!("A")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (2, Some(h!("A"))), (3, Some(h!("B"))), (4, Some(h!("C")))],
|
||||
}
|
||||
},
|
||||
// Introduce an older checkpoint (B) that is not the oldest checkpoint
|
||||
// | 0 | 1 | 2 | 3
|
||||
// chain | _ A C
|
||||
// update | _ B C
|
||||
TestLocalChain {
|
||||
name: "can introduce older checkpoint 3",
|
||||
chain: local_chain![(0, h!("_")), (1, h!("A")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(2, Some(h!("B")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||
}
|
||||
},
|
||||
// Introduce two older checkpoints below the PoA
|
||||
// | 0 | 1 | 2 | 3
|
||||
// chain | _ C
|
||||
// update | _ A B C
|
||||
TestLocalChain {
|
||||
name: "introduce two older checkpoints below PoA",
|
||||
chain: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(1, Some(h!("A"))), (2, Some(h!("B")))],
|
||||
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||
},
|
||||
},
|
||||
TestLocalChain {
|
||||
name: "fix blockhash before agreement point",
|
||||
chain: local_chain![(0, h!("im-wrong")), (1, h!("we-agree"))],
|
||||
update: chain_update![(0, h!("fix")), (1, h!("we-agree"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(0, Some(h!("fix")))],
|
||||
init_changeset: &[(0, Some(h!("fix"))), (1, Some(h!("we-agree")))],
|
||||
},
|
||||
},
|
||||
// B and C are in both chain and update
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | _ B C
|
||||
// update | _ A B C D
|
||||
// This should succeed with the point of agreement being C and A should be added in addition.
|
||||
TestLocalChain {
|
||||
name: "two points of agreement",
|
||||
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[(1, Some(h!("A"))), (4, Some(h!("D")))],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("_"))),
|
||||
(1, Some(h!("A"))),
|
||||
(2, Some(h!("B"))),
|
||||
(3, Some(h!("C"))),
|
||||
(4, Some(h!("D"))),
|
||||
],
|
||||
},
|
||||
},
|
||||
// Update and chain does not connect:
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | _ B C
|
||||
// update | _ A B D
|
||||
// This should fail as we cannot figure out whether C & D are on the same chain
|
||||
TestLocalChain {
|
||||
name: "update and chain does not connect",
|
||||
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError {
|
||||
try_include_height: 3,
|
||||
}),
|
||||
},
|
||||
// Transient invalidation:
|
||||
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
// chain | _ B C E
|
||||
// update | _ B' C' D
|
||||
// This should succeed and invalidate B,C and E with point of agreement being A.
|
||||
TestLocalChain {
|
||||
name: "transitive invalidation applies to checkpoints higher than invalidation",
|
||||
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[
|
||||
(2, Some(h!("B'"))),
|
||||
(3, Some(h!("C'"))),
|
||||
(4, Some(h!("D"))),
|
||||
(5, None),
|
||||
]
|
||||
.into())
|
||||
);
|
||||
}
|
||||
|
||||
/// Transient invalidation:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | B C E
|
||||
/// update | B' C' D
|
||||
/// ```
|
||||
///
|
||||
/// This should succeed and invalidate B, C and E with no point of agreement
|
||||
#[test]
|
||||
fn transitive_invalidation_applies_to_checkpoints_higher_than_invalidation_no_point_of_agreement() {
|
||||
let chain1 = local_chain![(1, h!("B")), (2, h!("C")), (4, h!("E"))];
|
||||
let chain2 = local_chain![(1, h!("B'")), (2, h!("C'")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Ok([
|
||||
],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("_"))),
|
||||
(2, Some(h!("B'"))),
|
||||
(3, Some(h!("C'"))),
|
||||
(4, Some(h!("D"))),
|
||||
],
|
||||
},
|
||||
},
|
||||
// Transient invalidation:
|
||||
// | 0 | 1 | 2 | 3 | 4
|
||||
// chain | _ B C E
|
||||
// update | _ B' C' D
|
||||
// This should succeed and invalidate B, C and E with no point of agreement
|
||||
TestLocalChain {
|
||||
name: "transitive invalidation applies to checkpoints higher than invalidation no point of agreement",
|
||||
chain: local_chain![(0, h!("_")), (1, h!("B")), (2, h!("C")), (4, h!("E"))],
|
||||
update: chain_update![(0, h!("_")), (1, h!("B'")), (2, h!("C'")), (3, h!("D"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[
|
||||
(1, Some(h!("B'"))),
|
||||
(2, Some(h!("C'"))),
|
||||
(3, Some(h!("D"))),
|
||||
(4, None)
|
||||
],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("_"))),
|
||||
(1, Some(h!("B'"))),
|
||||
(2, Some(h!("C'"))),
|
||||
(3, Some(h!("D"))),
|
||||
],
|
||||
},
|
||||
},
|
||||
// Transient invalidation:
|
||||
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
// chain | _ A B C E
|
||||
// update | _ B' C' D
|
||||
// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
||||
// A was invalid.
|
||||
TestLocalChain {
|
||||
name: "invalidation but no connection",
|
||||
chain: local_chain![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||
exp: ExpectedResult::Err(CannotConnectError { try_include_height: 1 }),
|
||||
},
|
||||
// Introduce blocks between two points of agreement
|
||||
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||
// chain | A B D E
|
||||
// update | A C E F
|
||||
TestLocalChain {
|
||||
name: "introduce blocks between two points of agreement",
|
||||
chain: local_chain![(0, h!("A")), (1, h!("B")), (3, h!("D")), (4, h!("E"))],
|
||||
update: chain_update![(0, h!("A")), (2, h!("C")), (4, h!("E")), (5, h!("F"))],
|
||||
exp: ExpectedResult::Ok {
|
||||
changeset: &[
|
||||
(2, Some(h!("C"))),
|
||||
(5, Some(h!("F"))),
|
||||
],
|
||||
init_changeset: &[
|
||||
(0, Some(h!("A"))),
|
||||
(1, Some(h!("B"))),
|
||||
(2, Some(h!("C"))),
|
||||
(3, Some(h!("D"))),
|
||||
(4, Some(h!("E"))),
|
||||
(5, Some(h!("F"))),
|
||||
],
|
||||
},
|
||||
},
|
||||
]
|
||||
.into())
|
||||
)
|
||||
}
|
||||
|
||||
/// Transient invalidation:
|
||||
/// ```
|
||||
/// | 0 | 1 | 2 | 3 | 4
|
||||
/// chain | A B C E
|
||||
/// update | B' C' D
|
||||
/// ```
|
||||
///
|
||||
/// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
||||
/// A was invalid.
|
||||
#[test]
|
||||
fn invalidation_but_no_connection() {
|
||||
let chain1 = local_chain![(0, h!("A")), (1, h!("B")), (2, h!("C")), (4, h!("E"))];
|
||||
let chain2 = local_chain![(1, h!("B'")), (2, h!("C'")), (3, h!("D"))];
|
||||
|
||||
assert_eq!(
|
||||
chain1.determine_changeset(&chain2),
|
||||
Err(UpdateNotConnectedError(0))
|
||||
)
|
||||
.into_iter()
|
||||
.for_each(TestLocalChain::run);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_block() {
|
||||
fn local_chain_insert_block() {
|
||||
struct TestCase {
|
||||
original: LocalChain,
|
||||
insert: (u32, BlockHash),
|
||||
expected_result: Result<ChangeSet, InsertBlockNotMatchingError>,
|
||||
expected_result: Result<ChangeSet, AlterCheckPointError>,
|
||||
expected_final: LocalChain,
|
||||
}
|
||||
|
||||
let test_cases = [
|
||||
TestCase {
|
||||
original: local_chain![],
|
||||
original: local_chain![(0, h!("_"))],
|
||||
insert: (5, h!("block5")),
|
||||
expected_result: Ok([(5, Some(h!("block5")))].into()),
|
||||
expected_final: local_chain![(5, h!("block5"))],
|
||||
expected_final: local_chain![(0, h!("_")), (5, h!("block5"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(3, h!("A"))],
|
||||
original: local_chain![(0, h!("_")), (3, h!("A"))],
|
||||
insert: (4, h!("B")),
|
||||
expected_result: Ok([(4, Some(h!("B")))].into()),
|
||||
expected_final: local_chain![(3, h!("A")), (4, h!("B"))],
|
||||
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(4, h!("B"))],
|
||||
original: local_chain![(0, h!("_")), (4, h!("B"))],
|
||||
insert: (3, h!("A")),
|
||||
expected_result: Ok([(3, Some(h!("A")))].into()),
|
||||
expected_final: local_chain![(3, h!("A")), (4, h!("B"))],
|
||||
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(2, h!("K"))],
|
||||
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
insert: (2, h!("K")),
|
||||
expected_result: Ok([].into()),
|
||||
expected_final: local_chain![(2, h!("K"))],
|
||||
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
},
|
||||
TestCase {
|
||||
original: local_chain![(2, h!("K"))],
|
||||
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
insert: (2, h!("J")),
|
||||
expected_result: Err(InsertBlockNotMatchingError {
|
||||
expected_result: Err(AlterCheckPointError {
|
||||
height: 2,
|
||||
original_hash: h!("K"),
|
||||
update_hash: h!("J"),
|
||||
update_hash: Some(h!("J")),
|
||||
}),
|
||||
expected_final: local_chain![(2, h!("K"))],
|
||||
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||
},
|
||||
];
|
||||
|
||||
|
||||
@@ -1,10 +1,10 @@
|
||||
use bdk_chain::SpkTxOutIndex;
|
||||
use bitcoin::{hashes::hex::FromHex, OutPoint, PackedLockTime, Script, Transaction, TxIn, TxOut};
|
||||
use bdk_chain::{indexed_tx_graph::Indexer, SpkTxOutIndex};
|
||||
use bitcoin::{absolute, OutPoint, ScriptBuf, Transaction, TxIn, TxOut};
|
||||
|
||||
#[test]
|
||||
fn spk_txout_sent_and_received() {
|
||||
let spk1 = Script::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||
let spk2 = Script::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||
let spk1 = ScriptBuf::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||
let spk2 = ScriptBuf::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||
|
||||
let mut index = SpkTxOutIndex::default();
|
||||
index.insert_spk(0, spk1.clone());
|
||||
@@ -12,7 +12,7 @@ fn spk_txout_sent_and_received() {
|
||||
|
||||
let tx1 = Transaction {
|
||||
version: 0x02,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
@@ -22,7 +22,7 @@ fn spk_txout_sent_and_received() {
|
||||
|
||||
assert_eq!(index.sent_and_received(&tx1), (0, 42_000));
|
||||
assert_eq!(index.net_value(&tx1), 42_000);
|
||||
index.scan(&tx1);
|
||||
index.index_tx(&tx1);
|
||||
assert_eq!(
|
||||
index.sent_and_received(&tx1),
|
||||
(0, 42_000),
|
||||
@@ -31,7 +31,7 @@ fn spk_txout_sent_and_received() {
|
||||
|
||||
let tx2 = Transaction {
|
||||
version: 0x1,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint {
|
||||
txid: tx1.txid(),
|
||||
@@ -57,8 +57,8 @@ fn spk_txout_sent_and_received() {
|
||||
|
||||
#[test]
|
||||
fn mark_used() {
|
||||
let spk1 = Script::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||
let spk2 = Script::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||
let spk1 = ScriptBuf::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||
let spk2 = ScriptBuf::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||
|
||||
let mut spk_index = SpkTxOutIndex::default();
|
||||
spk_index.insert_spk(1, spk1.clone());
|
||||
@@ -74,7 +74,7 @@ fn mark_used() {
|
||||
|
||||
let tx1 = Transaction {
|
||||
version: 0x02,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
@@ -82,7 +82,7 @@ fn mark_used() {
|
||||
}],
|
||||
};
|
||||
|
||||
spk_index.scan(&tx1);
|
||||
spk_index.index_tx(&tx1);
|
||||
spk_index.unmark_used(&1);
|
||||
assert!(
|
||||
spk_index.is_used(&1),
|
||||
|
||||
@@ -1,57 +1,58 @@
|
||||
#[macro_use]
|
||||
mod common;
|
||||
use bdk_chain::tx_graph::CalculateFeeError;
|
||||
use bdk_chain::{
|
||||
collections::*,
|
||||
local_chain::LocalChain,
|
||||
tx_graph::{Additions, TxGraph},
|
||||
Append, BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||
tx_graph::{ChangeSet, TxGraph},
|
||||
Anchor, Append, BlockId, ChainOracle, ChainPosition, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bitcoin::{
|
||||
hashes::Hash, BlockHash, OutPoint, PackedLockTime, Script, Transaction, TxIn, TxOut, Txid,
|
||||
absolute, hashes::Hash, BlockHash, OutPoint, ScriptBuf, Transaction, TxIn, TxOut, Txid,
|
||||
};
|
||||
use core::iter;
|
||||
use std::vec;
|
||||
|
||||
#[test]
|
||||
fn insert_txouts() {
|
||||
// 2 (Outpoint, TxOut) tupples that denotes original data in the graph, as partial transactions.
|
||||
// 2 (Outpoint, TxOut) tuples that denotes original data in the graph, as partial transactions.
|
||||
let original_ops = [
|
||||
(
|
||||
OutPoint::new(h!("tx1"), 1),
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
),
|
||||
(
|
||||
OutPoint::new(h!("tx1"), 2),
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
),
|
||||
];
|
||||
|
||||
// Another (OutPoint, TxOut) tupple to be used as update as partial transaction.
|
||||
// Another (OutPoint, TxOut) tuple to be used as update as partial transaction.
|
||||
let update_ops = [(
|
||||
OutPoint::new(h!("tx2"), 0),
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
)];
|
||||
|
||||
// One full transaction to be included in the update
|
||||
let update_txs = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
}],
|
||||
output: vec![TxOut {
|
||||
value: 30_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
}],
|
||||
};
|
||||
|
||||
@@ -70,7 +71,7 @@ fn insert_txouts() {
|
||||
for (outpoint, txout) in &original_ops {
|
||||
assert_eq!(
|
||||
graph.insert_txout(*outpoint, txout.clone()),
|
||||
Additions {
|
||||
ChangeSet {
|
||||
txouts: [(*outpoint, txout.clone())].into(),
|
||||
..Default::default()
|
||||
}
|
||||
@@ -86,7 +87,7 @@ fn insert_txouts() {
|
||||
// Insert partials transactions
|
||||
assert_eq!(
|
||||
graph.insert_txout(*outpoint, txout.clone()),
|
||||
Additions {
|
||||
ChangeSet {
|
||||
txouts: [(*outpoint, txout.clone())].into(),
|
||||
..Default::default()
|
||||
}
|
||||
@@ -94,7 +95,7 @@ fn insert_txouts() {
|
||||
// Mark them unconfirmed.
|
||||
assert_eq!(
|
||||
graph.insert_anchor(outpoint.txid, unconf_anchor),
|
||||
Additions {
|
||||
ChangeSet {
|
||||
txs: [].into(),
|
||||
txouts: [].into(),
|
||||
anchors: [(unconf_anchor, outpoint.txid)].into(),
|
||||
@@ -104,7 +105,7 @@ fn insert_txouts() {
|
||||
// Mark them last seen at.
|
||||
assert_eq!(
|
||||
graph.insert_seen_at(outpoint.txid, 1000000),
|
||||
Additions {
|
||||
ChangeSet {
|
||||
txs: [].into(),
|
||||
txouts: [].into(),
|
||||
anchors: [].into(),
|
||||
@@ -115,7 +116,7 @@ fn insert_txouts() {
|
||||
// Insert the full transaction
|
||||
assert_eq!(
|
||||
graph.insert_tx(update_txs.clone()),
|
||||
Additions {
|
||||
ChangeSet {
|
||||
txs: [update_txs.clone()].into(),
|
||||
..Default::default()
|
||||
}
|
||||
@@ -124,7 +125,7 @@ fn insert_txouts() {
|
||||
// Mark it as confirmed.
|
||||
assert_eq!(
|
||||
graph.insert_anchor(update_txs.txid(), conf_anchor),
|
||||
Additions {
|
||||
ChangeSet {
|
||||
txs: [].into(),
|
||||
txouts: [].into(),
|
||||
anchors: [(conf_anchor, update_txs.txid())].into(),
|
||||
@@ -135,20 +136,20 @@ fn insert_txouts() {
|
||||
};
|
||||
|
||||
// Check the resulting addition.
|
||||
let additions = graph.determine_additions(&update);
|
||||
let changeset = graph.apply_update(update);
|
||||
|
||||
assert_eq!(
|
||||
additions,
|
||||
Additions {
|
||||
changeset,
|
||||
ChangeSet {
|
||||
txs: [update_txs.clone()].into(),
|
||||
txouts: update_ops.into(),
|
||||
txouts: update_ops.clone().into(),
|
||||
anchors: [(conf_anchor, update_txs.txid()), (unconf_anchor, h!("tx2"))].into(),
|
||||
last_seen: [(h!("tx2"), 1000000)].into()
|
||||
}
|
||||
);
|
||||
|
||||
// Apply addition and check the new graph counts.
|
||||
graph.apply_additions(additions);
|
||||
// Apply changeset and check the new graph counts.
|
||||
graph.apply_changeset(changeset);
|
||||
assert_eq!(graph.all_txouts().count(), 4);
|
||||
assert_eq!(graph.full_txs().count(), 1);
|
||||
assert_eq!(graph.floating_txouts().count(), 3);
|
||||
@@ -161,14 +162,14 @@ fn insert_txouts() {
|
||||
1u32,
|
||||
&TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
}
|
||||
),
|
||||
(
|
||||
2u32,
|
||||
&TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
}
|
||||
)
|
||||
]
|
||||
@@ -181,18 +182,29 @@ fn insert_txouts() {
|
||||
0u32,
|
||||
&TxOut {
|
||||
value: 30_000,
|
||||
script_pubkey: Script::new()
|
||||
script_pubkey: ScriptBuf::new()
|
||||
}
|
||||
)]
|
||||
.into()
|
||||
);
|
||||
|
||||
// Check that the initial_changeset is correct
|
||||
assert_eq!(
|
||||
graph.initial_changeset(),
|
||||
ChangeSet {
|
||||
txs: [update_txs.clone()].into(),
|
||||
txouts: update_ops.into_iter().chain(original_ops).collect(),
|
||||
anchors: [(conf_anchor, update_txs.txid()), (unconf_anchor, h!("tx2"))].into(),
|
||||
last_seen: [(h!("tx2"), 1000000)].into()
|
||||
}
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn insert_tx_graph_doesnt_count_coinbase_as_spent() {
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
@@ -210,7 +222,7 @@ fn insert_tx_graph_doesnt_count_coinbase_as_spent() {
|
||||
fn insert_tx_graph_keeps_track_of_spend() {
|
||||
let tx1 = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut::default()],
|
||||
};
|
||||
@@ -222,7 +234,7 @@ fn insert_tx_graph_keeps_track_of_spend() {
|
||||
|
||||
let tx2 = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: op,
|
||||
..Default::default()
|
||||
@@ -251,7 +263,7 @@ fn insert_tx_graph_keeps_track_of_spend() {
|
||||
fn insert_tx_can_retrieve_full_tx_from_graph() {
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
@@ -269,11 +281,11 @@ fn insert_tx_displaces_txouts() {
|
||||
let mut tx_graph = TxGraph::<()>::default();
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
script_pubkey: Script::default(),
|
||||
script_pubkey: ScriptBuf::default(),
|
||||
}],
|
||||
};
|
||||
|
||||
@@ -284,7 +296,7 @@ fn insert_tx_displaces_txouts() {
|
||||
},
|
||||
TxOut {
|
||||
value: 1_337_000,
|
||||
script_pubkey: Script::default(),
|
||||
script_pubkey: ScriptBuf::default(),
|
||||
},
|
||||
);
|
||||
|
||||
@@ -295,11 +307,11 @@ fn insert_tx_displaces_txouts() {
|
||||
},
|
||||
TxOut {
|
||||
value: 1_000_000_000,
|
||||
script_pubkey: Script::default(),
|
||||
script_pubkey: ScriptBuf::default(),
|
||||
},
|
||||
);
|
||||
|
||||
let _additions = tx_graph.insert_tx(tx.clone());
|
||||
let _changeset = tx_graph.insert_tx(tx.clone());
|
||||
|
||||
assert_eq!(
|
||||
tx_graph
|
||||
@@ -325,15 +337,15 @@ fn insert_txout_does_not_displace_tx() {
|
||||
let mut tx_graph = TxGraph::<()>::default();
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 42_000,
|
||||
script_pubkey: Script::default(),
|
||||
script_pubkey: ScriptBuf::default(),
|
||||
}],
|
||||
};
|
||||
|
||||
let _additions = tx_graph.insert_tx(tx.clone());
|
||||
let _changeset = tx_graph.insert_tx(tx.clone());
|
||||
|
||||
let _ = tx_graph.insert_txout(
|
||||
OutPoint {
|
||||
@@ -342,7 +354,7 @@ fn insert_txout_does_not_displace_tx() {
|
||||
},
|
||||
TxOut {
|
||||
value: 1_337_000,
|
||||
script_pubkey: Script::default(),
|
||||
script_pubkey: ScriptBuf::default(),
|
||||
},
|
||||
);
|
||||
|
||||
@@ -353,7 +365,7 @@ fn insert_txout_does_not_displace_tx() {
|
||||
},
|
||||
TxOut {
|
||||
value: 1_000_000_000,
|
||||
script_pubkey: Script::default(),
|
||||
script_pubkey: ScriptBuf::default(),
|
||||
},
|
||||
);
|
||||
|
||||
@@ -381,7 +393,7 @@ fn test_calculate_fee() {
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let intx1 = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 100,
|
||||
@@ -390,7 +402,7 @@ fn test_calculate_fee() {
|
||||
};
|
||||
let intx2 = Transaction {
|
||||
version: 0x02,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![],
|
||||
output: vec![TxOut {
|
||||
value: 200,
|
||||
@@ -415,7 +427,7 @@ fn test_calculate_fee() {
|
||||
|
||||
let mut tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![
|
||||
TxIn {
|
||||
previous_output: OutPoint {
|
||||
@@ -442,29 +454,36 @@ fn test_calculate_fee() {
|
||||
}],
|
||||
};
|
||||
|
||||
assert_eq!(graph.calculate_fee(&tx), Some(100));
|
||||
assert_eq!(graph.calculate_fee(&tx), Ok(100));
|
||||
|
||||
tx.input.remove(2);
|
||||
|
||||
// fee would be negative
|
||||
assert_eq!(graph.calculate_fee(&tx), Some(-200));
|
||||
// fee would be negative, should return CalculateFeeError::NegativeFee
|
||||
assert_eq!(
|
||||
graph.calculate_fee(&tx),
|
||||
Err(CalculateFeeError::NegativeFee(-200))
|
||||
);
|
||||
|
||||
// If we have an unknown outpoint, fee should return None.
|
||||
tx.input.push(TxIn {
|
||||
previous_output: OutPoint {
|
||||
// If we have an unknown outpoint, fee should return CalculateFeeError::MissingTxOut.
|
||||
let outpoint = OutPoint {
|
||||
txid: h!("unknown_txid"),
|
||||
vout: 0,
|
||||
},
|
||||
};
|
||||
tx.input.push(TxIn {
|
||||
previous_output: outpoint,
|
||||
..Default::default()
|
||||
});
|
||||
assert_eq!(graph.calculate_fee(&tx), None);
|
||||
assert_eq!(
|
||||
graph.calculate_fee(&tx),
|
||||
Err(CalculateFeeError::MissingTxOut(vec!(outpoint)))
|
||||
);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_calculate_fee_on_coinbase() {
|
||||
let tx = Transaction {
|
||||
version: 0x01,
|
||||
lock_time: PackedLockTime(0),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::null(),
|
||||
..Default::default()
|
||||
@@ -474,7 +493,211 @@ fn test_calculate_fee_on_coinbase() {
|
||||
|
||||
let graph = TxGraph::<()>::default();
|
||||
|
||||
assert_eq!(graph.calculate_fee(&tx), Some(0));
|
||||
assert_eq!(graph.calculate_fee(&tx), Ok(0));
|
||||
}
|
||||
|
||||
// `test_walk_ancestors` uses the following transaction structure:
|
||||
//
|
||||
// a0
|
||||
// / \
|
||||
// b0 b1 b2
|
||||
// / \ \ /
|
||||
// c0 c1 c2 c3
|
||||
// / \ /
|
||||
// d0 d1
|
||||
// \
|
||||
// e0
|
||||
//
|
||||
// where b0 and b1 spend a0, c0 and c1 spend b0, d0 spends c1, etc.
|
||||
#[test]
|
||||
fn test_walk_ancestors() {
|
||||
let local_chain = LocalChain::from_blocks(
|
||||
(0..=20)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect(),
|
||||
)
|
||||
.expect("must contain genesis hash");
|
||||
let tip = local_chain.tip();
|
||||
|
||||
let tx_a0 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(h!("op0"), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default(), TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_b0 spends tx_a0
|
||||
let tx_b0 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_a0.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default(), TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_b1 spends tx_a0
|
||||
let tx_b1 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_a0.txid(), 1),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
let tx_b2 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(h!("op1"), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_c0 spends tx_b0
|
||||
let tx_c0 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_b0.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_c1 spends tx_b0
|
||||
let tx_c1 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_b0.txid(), 1),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_c2 spends tx_b1 and tx_b2
|
||||
let tx_c2 = Transaction {
|
||||
input: vec![
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(tx_b1.txid(), 0),
|
||||
..TxIn::default()
|
||||
},
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(tx_b2.txid(), 0),
|
||||
..TxIn::default()
|
||||
},
|
||||
],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
let tx_c3 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(h!("op2"), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_d0 spends tx_c1
|
||||
let tx_d0 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_c1.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_d1 spends tx_c2 and tx_c3
|
||||
let tx_d1 = Transaction {
|
||||
input: vec![
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(tx_c2.txid(), 0),
|
||||
..TxIn::default()
|
||||
},
|
||||
TxIn {
|
||||
previous_output: OutPoint::new(tx_c3.txid(), 0),
|
||||
..TxIn::default()
|
||||
},
|
||||
],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
// tx_e0 spends tx_d1
|
||||
let tx_e0 = Transaction {
|
||||
input: vec![TxIn {
|
||||
previous_output: OutPoint::new(tx_d1.txid(), 0),
|
||||
..TxIn::default()
|
||||
}],
|
||||
output: vec![TxOut::default()],
|
||||
..common::new_tx(0)
|
||||
};
|
||||
|
||||
let mut graph = TxGraph::<BlockId>::new(vec![
|
||||
tx_a0.clone(),
|
||||
tx_b0.clone(),
|
||||
tx_b1.clone(),
|
||||
tx_b2.clone(),
|
||||
tx_c0.clone(),
|
||||
tx_c1.clone(),
|
||||
tx_c2.clone(),
|
||||
tx_c3.clone(),
|
||||
tx_d0.clone(),
|
||||
tx_d1.clone(),
|
||||
tx_e0.clone(),
|
||||
]);
|
||||
|
||||
[&tx_a0, &tx_b1].iter().for_each(|&tx| {
|
||||
let _ = graph.insert_anchor(tx.txid(), tip.block_id());
|
||||
});
|
||||
|
||||
let ancestors = [
|
||||
graph
|
||||
.walk_ancestors(&tx_c0, |depth, tx| Some((depth, tx)))
|
||||
.collect::<Vec<_>>(),
|
||||
graph
|
||||
.walk_ancestors(&tx_d0, |depth, tx| Some((depth, tx)))
|
||||
.collect::<Vec<_>>(),
|
||||
graph
|
||||
.walk_ancestors(&tx_e0, |depth, tx| Some((depth, tx)))
|
||||
.collect::<Vec<_>>(),
|
||||
// Only traverse unconfirmed ancestors of tx_e0 this time
|
||||
graph
|
||||
.walk_ancestors(&tx_e0, |depth, tx| {
|
||||
let tx_node = graph.get_tx_node(tx.txid())?;
|
||||
for block in tx_node.anchors {
|
||||
match local_chain.is_block_in_chain(block.anchor_block(), tip.block_id()) {
|
||||
Ok(Some(true)) => return None,
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
Some((depth, tx_node.tx))
|
||||
})
|
||||
.collect::<Vec<_>>(),
|
||||
];
|
||||
|
||||
let expected_ancestors = [
|
||||
vec![(1, &tx_b0), (2, &tx_a0)],
|
||||
vec![(1, &tx_c1), (2, &tx_b0), (3, &tx_a0)],
|
||||
vec![
|
||||
(1, &tx_d1),
|
||||
(2, &tx_c2),
|
||||
(2, &tx_c3),
|
||||
(3, &tx_b1),
|
||||
(3, &tx_b2),
|
||||
(4, &tx_a0),
|
||||
],
|
||||
vec![(1, &tx_d1), (2, &tx_c2), (2, &tx_c3), (3, &tx_b2)],
|
||||
];
|
||||
|
||||
for (txids, expected_txids) in ancestors.iter().zip(expected_ancestors.iter()) {
|
||||
assert_eq!(txids, expected_txids);
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
@@ -591,7 +814,7 @@ fn test_descendants_no_repeat() {
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let mut graph = TxGraph::<()>::default();
|
||||
let mut expected_txids = BTreeSet::new();
|
||||
let mut expected_txids = Vec::new();
|
||||
|
||||
// these are NOT descendants of `tx_a`
|
||||
for tx in txs_not_connected {
|
||||
@@ -606,28 +829,25 @@ fn test_descendants_no_repeat() {
|
||||
.chain(core::iter::once(&tx_e))
|
||||
{
|
||||
let _ = graph.insert_tx(tx.clone());
|
||||
assert!(expected_txids.insert(tx.txid()));
|
||||
expected_txids.push(tx.txid());
|
||||
}
|
||||
|
||||
let descendants = graph
|
||||
.walk_descendants(tx_a.txid(), |_, txid| Some(txid))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
assert_eq!(descendants.len(), expected_txids.len());
|
||||
|
||||
for txid in descendants {
|
||||
assert!(expected_txids.remove(&txid));
|
||||
}
|
||||
assert!(expected_txids.is_empty());
|
||||
assert_eq!(descendants, expected_txids);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_chain_spends() {
|
||||
let local_chain: LocalChain = (0..=100)
|
||||
let local_chain = LocalChain::from_blocks(
|
||||
(0..=100)
|
||||
.map(|ht| (ht, BlockHash::hash(format!("Block Hash {}", ht).as_bytes())))
|
||||
.collect::<BTreeMap<u32, BlockHash>>()
|
||||
.into();
|
||||
let tip = local_chain.tip().expect("must have tip");
|
||||
.collect(),
|
||||
)
|
||||
.expect("must have genesis hash");
|
||||
let tip = local_chain.tip();
|
||||
|
||||
// The parent tx contains 2 outputs. Which are spent by one confirmed and one unconfirmed tx.
|
||||
// The parent tx is confirmed at block 95.
|
||||
@@ -636,11 +856,11 @@ fn test_chain_spends() {
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
TxOut {
|
||||
value: 20_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
@@ -655,11 +875,11 @@ fn test_chain_spends() {
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 5_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
TxOut {
|
||||
value: 5_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
@@ -674,11 +894,11 @@ fn test_chain_spends() {
|
||||
output: vec![
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
TxOut {
|
||||
value: 10_000,
|
||||
script_pubkey: Script::new(),
|
||||
script_pubkey: ScriptBuf::new(),
|
||||
},
|
||||
],
|
||||
..common::new_tx(0)
|
||||
@@ -690,25 +910,22 @@ fn test_chain_spends() {
|
||||
let _ = graph.insert_tx(tx_1.clone());
|
||||
let _ = graph.insert_tx(tx_2.clone());
|
||||
|
||||
[95, 98]
|
||||
.iter()
|
||||
.zip([&tx_0, &tx_1].into_iter())
|
||||
.for_each(|(ht, tx)| {
|
||||
for (ht, tx) in [(95, &tx_0), (98, &tx_1)] {
|
||||
let _ = graph.insert_anchor(
|
||||
tx.txid(),
|
||||
ConfirmationHeightAnchor {
|
||||
anchor_block: tip,
|
||||
confirmation_height: *ht,
|
||||
anchor_block: tip.block_id(),
|
||||
confirmation_height: ht,
|
||||
},
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
// Assert that confirmed spends are returned correctly.
|
||||
assert_eq!(
|
||||
graph.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 0)),
|
||||
graph.get_chain_spend(&local_chain, tip.block_id(), OutPoint::new(tx_0.txid(), 0)),
|
||||
Some((
|
||||
ChainPosition::Confirmed(&ConfirmationHeightAnchor {
|
||||
anchor_block: tip,
|
||||
anchor_block: tip.block_id(),
|
||||
confirmation_height: 98
|
||||
}),
|
||||
tx_1.txid(),
|
||||
@@ -717,17 +934,17 @@ fn test_chain_spends() {
|
||||
|
||||
// Check if chain position is returned correctly.
|
||||
assert_eq!(
|
||||
graph.get_chain_position(&local_chain, tip, tx_0.txid()),
|
||||
graph.get_chain_position(&local_chain, tip.block_id(), tx_0.txid()),
|
||||
// Some(ObservedAs::Confirmed(&local_chain.get_block(95).expect("block expected"))),
|
||||
Some(ChainPosition::Confirmed(&ConfirmationHeightAnchor {
|
||||
anchor_block: tip,
|
||||
anchor_block: tip.block_id(),
|
||||
confirmation_height: 95
|
||||
}))
|
||||
);
|
||||
|
||||
// Even if unconfirmed tx has a last_seen of 0, it can still be part of a chain spend.
|
||||
assert_eq!(
|
||||
graph.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 1)),
|
||||
graph.get_chain_spend(&local_chain, tip.block_id(), OutPoint::new(tx_0.txid(), 1)),
|
||||
Some((ChainPosition::Unconfirmed(0), tx_2.txid())),
|
||||
);
|
||||
|
||||
@@ -737,7 +954,7 @@ fn test_chain_spends() {
|
||||
// Check chain spend returned correctly.
|
||||
assert_eq!(
|
||||
graph
|
||||
.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 1))
|
||||
.get_chain_spend(&local_chain, tip.block_id(), OutPoint::new(tx_0.txid(), 1))
|
||||
.unwrap(),
|
||||
(ChainPosition::Unconfirmed(1234567), tx_2.txid())
|
||||
);
|
||||
@@ -754,7 +971,7 @@ fn test_chain_spends() {
|
||||
|
||||
// Because this tx conflicts with an already confirmed transaction, chain position should return none.
|
||||
assert!(graph
|
||||
.get_chain_position(&local_chain, tip, tx_1_conflict.txid())
|
||||
.get_chain_position(&local_chain, tip.block_id(), tx_1_conflict.txid())
|
||||
.is_none());
|
||||
|
||||
// Another conflicting tx that conflicts with tx_2.
|
||||
@@ -773,7 +990,7 @@ fn test_chain_spends() {
|
||||
// This should return a valid observation with correct last seen.
|
||||
assert_eq!(
|
||||
graph
|
||||
.get_chain_position(&local_chain, tip, tx_2_conflict.txid())
|
||||
.get_chain_position(&local_chain, tip.block_id(), tx_2_conflict.txid())
|
||||
.expect("position expected"),
|
||||
ChainPosition::Unconfirmed(1234568)
|
||||
);
|
||||
@@ -781,20 +998,20 @@ fn test_chain_spends() {
|
||||
// Chain_spend now catches the new transaction as the spend.
|
||||
assert_eq!(
|
||||
graph
|
||||
.get_chain_spend(&local_chain, tip, OutPoint::new(tx_0.txid(), 1))
|
||||
.get_chain_spend(&local_chain, tip.block_id(), OutPoint::new(tx_0.txid(), 1))
|
||||
.expect("expect observation"),
|
||||
(ChainPosition::Unconfirmed(1234568), tx_2_conflict.txid())
|
||||
);
|
||||
|
||||
// Chain position of the `tx_2` is now none, as it is older than `tx_2_conflict`
|
||||
assert!(graph
|
||||
.get_chain_position(&local_chain, tip, tx_2.txid())
|
||||
.get_chain_position(&local_chain, tip.block_id(), tx_2.txid())
|
||||
.is_none());
|
||||
}
|
||||
|
||||
/// Ensure that `last_seen` values only increase during [`Append::append`].
|
||||
#[test]
|
||||
fn test_additions_last_seen_append() {
|
||||
fn test_changeset_last_seen_append() {
|
||||
let txid: Txid = h!("test txid");
|
||||
|
||||
let test_cases: &[(Option<u64>, Option<u64>)] = &[
|
||||
@@ -806,11 +1023,11 @@ fn test_additions_last_seen_append() {
|
||||
];
|
||||
|
||||
for (original_ls, update_ls) in test_cases {
|
||||
let mut original = Additions::<()> {
|
||||
let mut original = ChangeSet::<()> {
|
||||
last_seen: original_ls.map(|ls| (txid, ls)).into_iter().collect(),
|
||||
..Default::default()
|
||||
};
|
||||
let update = Additions::<()> {
|
||||
let update = ChangeSet::<()> {
|
||||
last_seen: update_ls.map(|ls| (txid, ls)).into_iter().collect(),
|
||||
..Default::default()
|
||||
};
|
||||
@@ -822,3 +1039,136 @@ fn test_additions_last_seen_append() {
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_missing_blocks() {
|
||||
/// An anchor implementation for testing, made up of `(the_anchor_block, random_data)`.
|
||||
#[derive(Debug, Clone, Eq, PartialEq, PartialOrd, Ord, core::hash::Hash)]
|
||||
struct TestAnchor(BlockId);
|
||||
|
||||
impl Anchor for TestAnchor {
|
||||
fn anchor_block(&self) -> BlockId {
|
||||
self.0
|
||||
}
|
||||
}
|
||||
|
||||
struct Scenario<'a> {
|
||||
name: &'a str,
|
||||
graph: TxGraph<TestAnchor>,
|
||||
chain: LocalChain,
|
||||
exp_heights: &'a [u32],
|
||||
}
|
||||
|
||||
const fn new_anchor(height: u32, hash: BlockHash) -> TestAnchor {
|
||||
TestAnchor(BlockId { height, hash })
|
||||
}
|
||||
|
||||
fn new_scenario<'a>(
|
||||
name: &'a str,
|
||||
graph_anchors: &'a [(Txid, TestAnchor)],
|
||||
chain: &'a [(u32, BlockHash)],
|
||||
exp_heights: &'a [u32],
|
||||
) -> Scenario<'a> {
|
||||
Scenario {
|
||||
name,
|
||||
graph: {
|
||||
let mut g = TxGraph::default();
|
||||
for (txid, anchor) in graph_anchors {
|
||||
let _ = g.insert_anchor(*txid, anchor.clone());
|
||||
}
|
||||
g
|
||||
},
|
||||
chain: {
|
||||
let (mut c, _) = LocalChain::from_genesis_hash(h!("genesis"));
|
||||
for (height, hash) in chain {
|
||||
let _ = c.insert_block(BlockId {
|
||||
height: *height,
|
||||
hash: *hash,
|
||||
});
|
||||
}
|
||||
c
|
||||
},
|
||||
exp_heights,
|
||||
}
|
||||
}
|
||||
|
||||
fn run(scenarios: &[Scenario]) {
|
||||
for scenario in scenarios {
|
||||
let Scenario {
|
||||
name,
|
||||
graph,
|
||||
chain,
|
||||
exp_heights,
|
||||
} = scenario;
|
||||
|
||||
let heights = graph.missing_heights(chain).collect::<Vec<_>>();
|
||||
assert_eq!(&heights, exp_heights, "scenario: {}", name);
|
||||
}
|
||||
}
|
||||
|
||||
run(&[
|
||||
new_scenario(
|
||||
"2 txs with the same anchor (2:B) which is missing from chain",
|
||||
&[
|
||||
(h!("tx_1"), new_anchor(2, h!("B"))),
|
||||
(h!("tx_2"), new_anchor(2, h!("B"))),
|
||||
],
|
||||
&[(1, h!("A")), (3, h!("C"))],
|
||||
&[2],
|
||||
),
|
||||
new_scenario(
|
||||
"2 txs with different anchors at the same height, one of the anchors is missing",
|
||||
&[
|
||||
(h!("tx_1"), new_anchor(2, h!("B1"))),
|
||||
(h!("tx_2"), new_anchor(2, h!("B2"))),
|
||||
],
|
||||
&[(1, h!("A")), (2, h!("B1"))],
|
||||
&[],
|
||||
),
|
||||
new_scenario(
|
||||
"tx with 2 anchors of same height which are missing from the chain",
|
||||
&[
|
||||
(h!("tx"), new_anchor(3, h!("C1"))),
|
||||
(h!("tx"), new_anchor(3, h!("C2"))),
|
||||
],
|
||||
&[(1, h!("A")), (4, h!("D"))],
|
||||
&[3],
|
||||
),
|
||||
new_scenario(
|
||||
"tx with 2 anchors at the same height, chain has this height but does not match either anchor",
|
||||
&[
|
||||
(h!("tx"), new_anchor(4, h!("D1"))),
|
||||
(h!("tx"), new_anchor(4, h!("D2"))),
|
||||
],
|
||||
&[(4, h!("D3")), (5, h!("E"))],
|
||||
&[],
|
||||
),
|
||||
new_scenario(
|
||||
"tx with 2 anchors at different heights, one anchor exists in chain, should return nothing",
|
||||
&[
|
||||
(h!("tx"), new_anchor(3, h!("C"))),
|
||||
(h!("tx"), new_anchor(4, h!("D"))),
|
||||
],
|
||||
&[(4, h!("D")), (5, h!("E"))],
|
||||
&[],
|
||||
),
|
||||
new_scenario(
|
||||
"tx with 2 anchors at different heights, first height is already in chain with different hash, iterator should only return 2nd height",
|
||||
&[
|
||||
(h!("tx"), new_anchor(5, h!("E1"))),
|
||||
(h!("tx"), new_anchor(6, h!("F1"))),
|
||||
],
|
||||
&[(4, h!("D")), (5, h!("E")), (7, h!("G"))],
|
||||
&[6],
|
||||
),
|
||||
new_scenario(
|
||||
"tx with 2 anchors at different heights, neither height is in chain, both heights should be returned",
|
||||
&[
|
||||
(h!("tx"), new_anchor(3, h!("C"))),
|
||||
(h!("tx"), new_anchor(4, h!("D"))),
|
||||
],
|
||||
&[(1, h!("A")), (2, h!("B"))],
|
||||
&[3, 4],
|
||||
),
|
||||
]);
|
||||
}
|
||||
|
||||
667
crates/chain/tests/test_tx_graph_conflicts.rs
Normal file
667
crates/chain/tests/test_tx_graph_conflicts.rs
Normal file
@@ -0,0 +1,667 @@
|
||||
#[macro_use]
|
||||
mod common;
|
||||
|
||||
use std::collections::{BTreeSet, HashSet};
|
||||
|
||||
use bdk_chain::{keychain::Balance, BlockId};
|
||||
use bitcoin::{OutPoint, Script};
|
||||
use common::*;
|
||||
|
||||
#[allow(dead_code)]
|
||||
struct Scenario<'a> {
|
||||
/// Name of the test scenario
|
||||
name: &'a str,
|
||||
/// Transaction templates
|
||||
tx_templates: &'a [TxTemplate<'a, BlockId>],
|
||||
/// Names of txs that must exist in the output of `list_chain_txs`
|
||||
exp_chain_txs: HashSet<&'a str>,
|
||||
/// Outpoints that must exist in the output of `filter_chain_txouts`
|
||||
exp_chain_txouts: HashSet<(&'a str, u32)>,
|
||||
/// Outpoints of UTXOs that must exist in the output of `filter_chain_unspents`
|
||||
exp_unspents: HashSet<(&'a str, u32)>,
|
||||
/// Expected balances
|
||||
exp_balance: Balance,
|
||||
}
|
||||
|
||||
/// This test ensures that [`TxGraph`] will reliably filter out irrelevant transactions when
|
||||
/// presented with multiple conflicting transaction scenarios using the [`TxTemplate`] structure.
|
||||
/// This test also checks that [`TxGraph::list_chain_txs`], [`TxGraph::filter_chain_txouts`],
|
||||
/// [`TxGraph::filter_chain_unspents`], and [`TxGraph::balance`] return correct data.
|
||||
#[test]
|
||||
fn test_tx_conflict_handling() {
|
||||
// Create Local chains
|
||||
let local_chain = local_chain!(
|
||||
(0, h!("A")),
|
||||
(1, h!("B")),
|
||||
(2, h!("C")),
|
||||
(3, h!("D")),
|
||||
(4, h!("E")),
|
||||
(5, h!("F")),
|
||||
(6, h!("G"))
|
||||
);
|
||||
let chain_tip = local_chain.tip().block_id();
|
||||
|
||||
let scenarios = [
|
||||
Scenario {
|
||||
name: "coinbase tx cannot be in mempool and be unconfirmed",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "unconfirmed_coinbase",
|
||||
inputs: &[TxInTemplate::Coinbase],
|
||||
outputs: &[TxOutTemplate::new(5000, Some(0))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "confirmed_genesis",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(1))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "unconfirmed_conflict",
|
||||
inputs: &[
|
||||
TxInTemplate::PrevTx("confirmed_genesis", 0),
|
||||
TxInTemplate::PrevTx("unconfirmed_coinbase", 0)
|
||||
],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "confirmed_conflict",
|
||||
inputs: &[TxInTemplate::PrevTx("confirmed_genesis", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||
anchors: &[block_id!(4, "E")],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["confirmed_genesis", "confirmed_conflict"]),
|
||||
exp_chain_txouts: HashSet::from([("confirmed_genesis", 0), ("confirmed_conflict", 0)]),
|
||||
exp_unspents: HashSet::from([("confirmed_conflict", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 0,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 20000,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "2 unconfirmed txs with same last_seens conflict",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
outputs: &[TxOutTemplate::new(40000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
last_seen: Some(300),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_2",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||
last_seen: Some(300),
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_2", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "2 unconfirmed txs with different last_seens conflict",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0)), TxOutTemplate::new(10000, Some(1))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_2",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::PrevTx("tx1", 1)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||
last_seen: Some(300),
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx1", 1), ("tx_conflict_2", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "3 unconfirmed txs with different last_seens conflict",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_2",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||
last_seen: Some(300),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_3",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(40000, Some(3))],
|
||||
last_seen: Some(400),
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_3"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_3", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_conflict_3", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 40000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "unconfirmed tx conflicts with tx in orphaned block, orphaned higher last_seen",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_orphaned_conflict",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||
anchors: &[block_id!(4, "Orphaned Block")],
|
||||
last_seen: Some(300),
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_orphaned_conflict"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_orphaned_conflict", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_orphaned_conflict", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "unconfirmed tx conflicts with tx in orphaned block, orphaned lower last_seen",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_orphaned_conflict",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||
anchors: &[block_id!(4, "Orphaned Block")],
|
||||
last_seen: Some(100),
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_1"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_1", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_conflict_1", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 20000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "multiple unconfirmed txs conflict with a confirmed tx",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "tx1",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_1",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_2",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||
last_seen: Some(300),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_conflict_3",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(40000, Some(3))],
|
||||
last_seen: Some(400),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "tx_confirmed_conflict",
|
||||
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
exp_chain_txs: HashSet::from(["tx1", "tx_confirmed_conflict"]),
|
||||
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_confirmed_conflict", 0)]),
|
||||
exp_unspents: HashSet::from([("tx_confirmed_conflict", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 0,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 50000,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "B and B' spend A and conflict, C spends B, all the transactions are unconfirmed, B' has higher last_seen than B",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "A",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
last_seen: Some(22),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(23),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B'",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
last_seen: Some(24),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "C",
|
||||
inputs: &[TxInTemplate::PrevTx("B", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||
last_seen: Some(25),
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// A, B, C will appear in the list methods
|
||||
// This is because B' has a higher last seen than B, but C has a higher
|
||||
// last seen than B', so B and C are considered canonical
|
||||
exp_chain_txs: HashSet::from(["A", "B", "C"]),
|
||||
exp_chain_txouts: HashSet::from([("A", 0), ("B", 0), ("C", 0)]),
|
||||
exp_unspents: HashSet::from([("C", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "B and B' spend A and conflict, C spends B, A and B' are in best chain",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "A",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B'",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
anchors: &[block_id!(4, "E")],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "C",
|
||||
inputs: &[TxInTemplate::PrevTx("B", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// B and C should not appear in the list methods
|
||||
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||
exp_unspents: HashSet::from([("B'", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 0,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 20000,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "B and B' spend A and conflict, C spends B', A and B' are in best chain",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "A",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B'",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||
anchors: &[block_id!(4, "E")],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "C",
|
||||
inputs: &[TxInTemplate::PrevTx("B'", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// B should not appear in the list methods
|
||||
exp_chain_txs: HashSet::from(["A", "B'", "C"]),
|
||||
exp_chain_txouts: HashSet::from([
|
||||
("A", 0),
|
||||
("B'", 0),
|
||||
("C", 0),
|
||||
]),
|
||||
exp_unspents: HashSet::from([("C", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "B and B' spend A and conflict, C spends both B and B', A is in best chain",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "A",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B'",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||
last_seen: Some(300),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "C",
|
||||
inputs: &[
|
||||
TxInTemplate::PrevTx("B", 0),
|
||||
TxInTemplate::PrevTx("B'", 0),
|
||||
],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// C should not appear in the list methods
|
||||
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||
exp_unspents: HashSet::from([("B'", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 30000,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 0,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "B and B' spend A and conflict, B' is confirmed, C spends both B and B', A is in best chain",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "A",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B'",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "C",
|
||||
inputs: &[
|
||||
TxInTemplate::PrevTx("B", 0),
|
||||
TxInTemplate::PrevTx("B'", 0),
|
||||
],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(5))],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// C should not appear in the list methods
|
||||
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||
exp_unspents: HashSet::from([("B'", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 0,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 50000,
|
||||
},
|
||||
},
|
||||
Scenario {
|
||||
name: "B and B' spend A and conflict, B' is confirmed, C spends both B and B', D spends C, A is in best chain",
|
||||
tx_templates: &[
|
||||
TxTemplate {
|
||||
tx_name: "A",
|
||||
inputs: &[TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
last_seen: None,
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||
last_seen: Some(200),
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "B'",
|
||||
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||
anchors: &[block_id!(1, "B")],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "C",
|
||||
inputs: &[
|
||||
TxInTemplate::PrevTx("B", 0),
|
||||
TxInTemplate::PrevTx("B'", 0),
|
||||
],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(5))],
|
||||
..Default::default()
|
||||
},
|
||||
TxTemplate {
|
||||
tx_name: "D",
|
||||
inputs: &[TxInTemplate::PrevTx("C", 0)],
|
||||
outputs: &[TxOutTemplate::new(20000, Some(6))],
|
||||
..Default::default()
|
||||
},
|
||||
],
|
||||
// D should not appear in the list methods
|
||||
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||
exp_unspents: HashSet::from([("B'", 0)]),
|
||||
exp_balance: Balance {
|
||||
immature: 0,
|
||||
trusted_pending: 0,
|
||||
untrusted_pending: 0,
|
||||
confirmed: 50000,
|
||||
},
|
||||
},
|
||||
];
|
||||
|
||||
for scenario in scenarios {
|
||||
let (tx_graph, spk_index, exp_tx_ids) = init_graph(scenario.tx_templates.iter());
|
||||
|
||||
let txs = tx_graph
|
||||
.list_chain_txs(&local_chain, chain_tip)
|
||||
.map(|tx| tx.tx_node.txid)
|
||||
.collect::<BTreeSet<_>>();
|
||||
let exp_txs = scenario
|
||||
.exp_chain_txs
|
||||
.iter()
|
||||
.map(|txid| *exp_tx_ids.get(txid).expect("txid must exist"))
|
||||
.collect::<BTreeSet<_>>();
|
||||
assert_eq!(
|
||||
txs, exp_txs,
|
||||
"\n[{}] 'list_chain_txs' failed",
|
||||
scenario.name
|
||||
);
|
||||
|
||||
let txouts = tx_graph
|
||||
.filter_chain_txouts(
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
spk_index.outpoints().iter().cloned(),
|
||||
)
|
||||
.map(|(_, full_txout)| full_txout.outpoint)
|
||||
.collect::<BTreeSet<_>>();
|
||||
let exp_txouts = scenario
|
||||
.exp_chain_txouts
|
||||
.iter()
|
||||
.map(|(txid, vout)| OutPoint {
|
||||
txid: *exp_tx_ids.get(txid).expect("txid must exist"),
|
||||
vout: *vout,
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
assert_eq!(
|
||||
txouts, exp_txouts,
|
||||
"\n[{}] 'filter_chain_txouts' failed",
|
||||
scenario.name
|
||||
);
|
||||
|
||||
let utxos = tx_graph
|
||||
.filter_chain_unspents(
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
spk_index.outpoints().iter().cloned(),
|
||||
)
|
||||
.map(|(_, full_txout)| full_txout.outpoint)
|
||||
.collect::<BTreeSet<_>>();
|
||||
let exp_utxos = scenario
|
||||
.exp_unspents
|
||||
.iter()
|
||||
.map(|(txid, vout)| OutPoint {
|
||||
txid: *exp_tx_ids.get(txid).expect("txid must exist"),
|
||||
vout: *vout,
|
||||
})
|
||||
.collect::<BTreeSet<_>>();
|
||||
assert_eq!(
|
||||
utxos, exp_utxos,
|
||||
"\n[{}] 'filter_chain_unspents' failed",
|
||||
scenario.name
|
||||
);
|
||||
|
||||
let balance = tx_graph.balance(
|
||||
&local_chain,
|
||||
chain_tip,
|
||||
spk_index.outpoints().iter().cloned(),
|
||||
|_, spk: &Script| spk_index.index_of_spk(spk).is_some(),
|
||||
);
|
||||
assert_eq!(
|
||||
balance, scenario.exp_balance,
|
||||
"\n[{}] 'balance' failed",
|
||||
scenario.name
|
||||
);
|
||||
}
|
||||
}
|
||||
@@ -1,6 +1,6 @@
|
||||
[package]
|
||||
name = "bdk_electrum"
|
||||
version = "0.3.0"
|
||||
version = "0.4.0"
|
||||
edition = "2021"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
@@ -12,5 +12,6 @@ readme = "README.md"
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", features = ["serde", "miniscript"] }
|
||||
electrum-client = { version = "0.12" }
|
||||
bdk_chain = { path = "../chain", version = "0.6.0", default-features = false }
|
||||
electrum-client = { version = "0.18" }
|
||||
#rustls = { version = "=0.21.1", optional = true, features = ["dangerous_configuration"] }
|
||||
|
||||
@@ -1,85 +1,78 @@
|
||||
use bdk_chain::{
|
||||
bitcoin::{hashes::hex::FromHex, BlockHash, OutPoint, Script, Transaction, Txid},
|
||||
keychain::LocalUpdate,
|
||||
local_chain::LocalChain,
|
||||
bitcoin::{OutPoint, ScriptBuf, Transaction, Txid},
|
||||
local_chain::{self, CheckPoint},
|
||||
tx_graph::{self, TxGraph},
|
||||
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeAnchor,
|
||||
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeHeightAnchor,
|
||||
};
|
||||
use electrum_client::{Client, ElectrumApi, Error};
|
||||
use electrum_client::{Client, ElectrumApi, Error, HeaderNotification};
|
||||
use std::{
|
||||
collections::{BTreeMap, BTreeSet, HashMap, HashSet},
|
||||
fmt::Debug,
|
||||
str::FromStr,
|
||||
};
|
||||
|
||||
#[derive(Debug, Clone)]
|
||||
pub struct ElectrumUpdate<K, A> {
|
||||
pub graph_update: HashMap<Txid, BTreeSet<A>>,
|
||||
pub chain_update: LocalChain,
|
||||
pub keychain_update: BTreeMap<K, u32>,
|
||||
}
|
||||
/// We include a chain suffix of a certain length for the purpose of robustness.
|
||||
const CHAIN_SUFFIX_LENGTH: u32 = 8;
|
||||
|
||||
impl<K, A> Default for ElectrumUpdate<K, A> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
graph_update: Default::default(),
|
||||
chain_update: Default::default(),
|
||||
keychain_update: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
/// Represents updates fetched from an Electrum server, but excludes full transactions.
|
||||
///
|
||||
/// To provide a complete update to [`TxGraph`], you'll need to call [`Self::missing_full_txs`] to
|
||||
/// determine the full transactions missing from [`TxGraph`]. Then call [`Self::into_tx_graph`] to
|
||||
/// fetch the full transactions from Electrum and finalize the update.
|
||||
#[derive(Debug, Default, Clone)]
|
||||
pub struct RelevantTxids(HashMap<Txid, BTreeSet<ConfirmationHeightAnchor>>);
|
||||
|
||||
impl<K, A: Anchor> ElectrumUpdate<K, A> {
|
||||
pub fn missing_full_txs<A2>(&self, graph: &TxGraph<A2>) -> Vec<Txid> {
|
||||
self.graph_update
|
||||
impl RelevantTxids {
|
||||
/// Determine the full transactions that are missing from `graph`.
|
||||
///
|
||||
/// Refer to [`RelevantTxids`] for more details.
|
||||
pub fn missing_full_txs<A: Anchor>(&self, graph: &TxGraph<A>) -> Vec<Txid> {
|
||||
self.0
|
||||
.keys()
|
||||
.filter(move |&&txid| graph.as_ref().get_tx(txid).is_none())
|
||||
.cloned()
|
||||
.collect()
|
||||
}
|
||||
|
||||
pub fn finalize(
|
||||
/// Finalizes the [`TxGraph`] update by fetching `missing` txids from the `client`.
|
||||
///
|
||||
/// Refer to [`RelevantTxids`] for more details.
|
||||
pub fn into_tx_graph(
|
||||
self,
|
||||
client: &Client,
|
||||
seen_at: Option<u64>,
|
||||
missing: Vec<Txid>,
|
||||
) -> Result<LocalUpdate<K, A>, Error> {
|
||||
) -> Result<TxGraph<ConfirmationHeightAnchor>, Error> {
|
||||
let new_txs = client.batch_transaction_get(&missing)?;
|
||||
let mut graph_update = TxGraph::<A>::new(new_txs);
|
||||
for (txid, anchors) in self.graph_update {
|
||||
let mut graph = TxGraph::<ConfirmationHeightAnchor>::new(new_txs);
|
||||
for (txid, anchors) in self.0 {
|
||||
if let Some(seen_at) = seen_at {
|
||||
let _ = graph_update.insert_seen_at(txid, seen_at);
|
||||
let _ = graph.insert_seen_at(txid, seen_at);
|
||||
}
|
||||
for anchor in anchors {
|
||||
let _ = graph_update.insert_anchor(txid, anchor);
|
||||
let _ = graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
Ok(LocalUpdate {
|
||||
keychain: self.keychain_update,
|
||||
graph: graph_update,
|
||||
chain: self.chain_update,
|
||||
})
|
||||
Ok(graph)
|
||||
}
|
||||
}
|
||||
|
||||
impl<K> ElectrumUpdate<K, ConfirmationHeightAnchor> {
|
||||
/// Finalizes the [`ElectrumUpdate`] with `new_txs` and anchors of type
|
||||
/// [`ConfirmationTimeAnchor`].
|
||||
/// Finalizes [`RelevantTxids`] with `new_txs` and anchors of type
|
||||
/// [`ConfirmationTimeHeightAnchor`].
|
||||
///
|
||||
/// **Note:** The confirmation time might not be precisely correct if there has been a reorg.
|
||||
/// Electrum's API intends that we use the merkle proof API, we should change `bdk_electrum` to
|
||||
/// use it.
|
||||
pub fn finalize_as_confirmation_time(
|
||||
pub fn into_confirmation_time_tx_graph(
|
||||
self,
|
||||
client: &Client,
|
||||
seen_at: Option<u64>,
|
||||
missing: Vec<Txid>,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error> {
|
||||
let update = self.finalize(client, seen_at, missing)?;
|
||||
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||
let graph = self.into_tx_graph(client, seen_at, missing)?;
|
||||
|
||||
let relevant_heights = {
|
||||
let mut visited_heights = HashSet::new();
|
||||
update
|
||||
.graph
|
||||
graph
|
||||
.all_anchors()
|
||||
.iter()
|
||||
.map(|(a, _)| a.confirmation_height_upper_bound())
|
||||
@@ -98,19 +91,19 @@ impl<K> ElectrumUpdate<K, ConfirmationHeightAnchor> {
|
||||
)
|
||||
.collect::<HashMap<u32, u64>>();
|
||||
|
||||
let graph_additions = {
|
||||
let old_additions = TxGraph::default().determine_additions(&update.graph);
|
||||
tx_graph::Additions {
|
||||
txs: old_additions.txs,
|
||||
txouts: old_additions.txouts,
|
||||
last_seen: old_additions.last_seen,
|
||||
anchors: old_additions
|
||||
let graph_changeset = {
|
||||
let old_changeset = TxGraph::default().apply_update(graph);
|
||||
tx_graph::ChangeSet {
|
||||
txs: old_changeset.txs,
|
||||
txouts: old_changeset.txouts,
|
||||
last_seen: old_changeset.last_seen,
|
||||
anchors: old_changeset
|
||||
.anchors
|
||||
.into_iter()
|
||||
.map(|(height_anchor, txid)| {
|
||||
let confirmation_height = height_anchor.confirmation_height;
|
||||
let confirmation_time = height_to_time[&confirmation_height];
|
||||
let time_anchor = ConfirmationTimeAnchor {
|
||||
let time_anchor = ConfirmationTimeHeightAnchor {
|
||||
anchor_block: height_anchor.anchor_block,
|
||||
confirmation_height,
|
||||
confirmation_time,
|
||||
@@ -121,96 +114,111 @@ impl<K> ElectrumUpdate<K, ConfirmationHeightAnchor> {
|
||||
}
|
||||
};
|
||||
|
||||
Ok(LocalUpdate {
|
||||
keychain: update.keychain,
|
||||
graph: {
|
||||
let mut graph = TxGraph::default();
|
||||
graph.apply_additions(graph_additions);
|
||||
graph
|
||||
},
|
||||
chain: update.chain,
|
||||
})
|
||||
let mut new_graph = TxGraph::default();
|
||||
new_graph.apply_changeset(graph_changeset);
|
||||
Ok(new_graph)
|
||||
}
|
||||
}
|
||||
|
||||
pub trait ElectrumExt<A> {
|
||||
fn get_tip(&self) -> Result<(u32, BlockHash), Error>;
|
||||
/// Combination of chain and transactions updates from electrum
|
||||
///
|
||||
/// We have to update the chain and the txids at the same time since we anchor the txids to
|
||||
/// the same chain tip that we check before and after we gather the txids.
|
||||
#[derive(Debug)]
|
||||
pub struct ElectrumUpdate {
|
||||
/// Chain update
|
||||
pub chain_update: local_chain::Update,
|
||||
/// Transaction updates from electrum
|
||||
pub relevant_txids: RelevantTxids,
|
||||
}
|
||||
|
||||
/// Trait to extend [`Client`] functionality.
|
||||
pub trait ElectrumExt {
|
||||
/// Scan the blockchain (via electrum) for the data specified and returns updates for
|
||||
/// [`bdk_chain`] data structures.
|
||||
///
|
||||
/// - `prev_tip`: the most recent blockchain tip present locally
|
||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// - `txids`: transactions for which we want updated [`Anchor`]s
|
||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to included in the update
|
||||
///
|
||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||
/// transactions. `batch_size` specifies the max number of script pubkeys to request for in a
|
||||
/// single batch request.
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
prev_tip: CheckPoint,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
batch_size: usize,
|
||||
) -> Result<ElectrumUpdate<K, A>, Error>;
|
||||
) -> Result<(ElectrumUpdate, BTreeMap<K, u32>), Error>;
|
||||
|
||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
||||
///
|
||||
/// [`scan`]: ElectrumExt::scan
|
||||
fn scan_without_keychain(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
misc_spks: impl IntoIterator<Item = Script>,
|
||||
prev_tip: CheckPoint,
|
||||
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
batch_size: usize,
|
||||
) -> Result<ElectrumUpdate<(), A>, Error> {
|
||||
) -> Result<ElectrumUpdate, Error> {
|
||||
let spk_iter = misc_spks
|
||||
.into_iter()
|
||||
.enumerate()
|
||||
.map(|(i, spk)| (i as u32, spk));
|
||||
|
||||
self.scan(
|
||||
local_chain,
|
||||
let (electrum_update, _) = self.scan(
|
||||
prev_tip,
|
||||
[((), spk_iter)].into(),
|
||||
txids,
|
||||
outpoints,
|
||||
usize::MAX,
|
||||
batch_size,
|
||||
)
|
||||
)?;
|
||||
|
||||
Ok(electrum_update)
|
||||
}
|
||||
}
|
||||
|
||||
impl ElectrumExt<ConfirmationHeightAnchor> for Client {
|
||||
fn get_tip(&self) -> Result<(u32, BlockHash), Error> {
|
||||
// TODO: unsubscribe when added to the client, or is there a better call to use here?
|
||||
self.block_headers_subscribe()
|
||||
.map(|data| (data.height as u32, data.header.block_hash()))
|
||||
}
|
||||
|
||||
impl ElectrumExt for Client {
|
||||
fn scan<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
prev_tip: CheckPoint,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
batch_size: usize,
|
||||
) -> Result<ElectrumUpdate<K, ConfirmationHeightAnchor>, Error> {
|
||||
) -> Result<(ElectrumUpdate, BTreeMap<K, u32>), Error> {
|
||||
let mut request_spks = keychain_spks
|
||||
.into_iter()
|
||||
.map(|(k, s)| (k, s.into_iter()))
|
||||
.collect::<BTreeMap<K, _>>();
|
||||
let mut scanned_spks = BTreeMap::<(K, u32), (Script, bool)>::new();
|
||||
let mut scanned_spks = BTreeMap::<(K, u32), (ScriptBuf, bool)>::new();
|
||||
|
||||
let txids = txids.into_iter().collect::<Vec<_>>();
|
||||
let outpoints = outpoints.into_iter().collect::<Vec<_>>();
|
||||
|
||||
let update = loop {
|
||||
let mut update = ElectrumUpdate::<K, ConfirmationHeightAnchor> {
|
||||
chain_update: prepare_chain_update(self, local_chain)?,
|
||||
..Default::default()
|
||||
};
|
||||
let anchor_block = update
|
||||
.chain_update
|
||||
.tip()
|
||||
.expect("must have atleast one block");
|
||||
let (electrum_update, keychain_update) = loop {
|
||||
let (tip, _) = construct_update_tip(self, prev_tip.clone())?;
|
||||
let mut relevant_txids = RelevantTxids::default();
|
||||
let cps = tip
|
||||
.iter()
|
||||
.take(10)
|
||||
.map(|cp| (cp.height(), cp))
|
||||
.collect::<BTreeMap<u32, CheckPoint>>();
|
||||
|
||||
if !request_spks.is_empty() {
|
||||
if !scanned_spks.is_empty() {
|
||||
scanned_spks.append(&mut populate_with_spks(
|
||||
self,
|
||||
anchor_block,
|
||||
&mut update,
|
||||
&cps,
|
||||
&mut relevant_txids,
|
||||
&mut scanned_spks
|
||||
.iter()
|
||||
.map(|(i, (spk, _))| (i.clone(), spk.clone())),
|
||||
@@ -222,8 +230,8 @@ impl ElectrumExt<ConfirmationHeightAnchor> for Client {
|
||||
scanned_spks.extend(
|
||||
populate_with_spks(
|
||||
self,
|
||||
anchor_block,
|
||||
&mut update,
|
||||
&cps,
|
||||
&mut relevant_txids,
|
||||
keychain_spks,
|
||||
stop_gap,
|
||||
batch_size,
|
||||
@@ -234,24 +242,27 @@ impl ElectrumExt<ConfirmationHeightAnchor> for Client {
|
||||
}
|
||||
}
|
||||
|
||||
populate_with_txids(self, anchor_block, &mut update, &mut txids.iter().cloned())?;
|
||||
populate_with_txids(self, &cps, &mut relevant_txids, &mut txids.iter().cloned())?;
|
||||
|
||||
let _txs = populate_with_outpoints(
|
||||
self,
|
||||
anchor_block,
|
||||
&mut update,
|
||||
&cps,
|
||||
&mut relevant_txids,
|
||||
&mut outpoints.iter().cloned(),
|
||||
)?;
|
||||
|
||||
// check for reorgs during scan process
|
||||
let server_blockhash = self
|
||||
.block_header(anchor_block.height as usize)?
|
||||
.block_hash();
|
||||
if anchor_block.hash != server_blockhash {
|
||||
let server_blockhash = self.block_header(tip.height() as usize)?.block_hash();
|
||||
if tip.hash() != server_blockhash {
|
||||
continue; // reorg
|
||||
}
|
||||
|
||||
update.keychain_update = request_spks
|
||||
let chain_update = local_chain::Update {
|
||||
tip,
|
||||
introduce_older_blocks: true,
|
||||
};
|
||||
|
||||
let keychain_update = request_spks
|
||||
.into_keys()
|
||||
.filter_map(|k| {
|
||||
scanned_spks
|
||||
@@ -261,53 +272,98 @@ impl ElectrumExt<ConfirmationHeightAnchor> for Client {
|
||||
.map(|((_, i), _)| (k, *i))
|
||||
})
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
break update;
|
||||
|
||||
break (
|
||||
ElectrumUpdate {
|
||||
chain_update,
|
||||
relevant_txids,
|
||||
},
|
||||
keychain_update,
|
||||
);
|
||||
};
|
||||
|
||||
Ok(update)
|
||||
Ok((electrum_update, keychain_update))
|
||||
}
|
||||
}
|
||||
|
||||
/// Prepare an update "template" based on the checkpoints of the `local_chain`.
|
||||
fn prepare_chain_update(
|
||||
/// Return a [`CheckPoint`] of the latest tip, that connects with `prev_tip`.
|
||||
fn construct_update_tip(
|
||||
client: &Client,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
) -> Result<LocalChain, Error> {
|
||||
let mut update = LocalChain::default();
|
||||
prev_tip: CheckPoint,
|
||||
) -> Result<(CheckPoint, Option<u32>), Error> {
|
||||
let HeaderNotification { height, .. } = client.block_headers_subscribe()?;
|
||||
let new_tip_height = height as u32;
|
||||
|
||||
// Find the local chain block that is still there so our update can connect to the local chain.
|
||||
for (&existing_height, &existing_hash) in local_chain.iter().rev() {
|
||||
// TODO: a batch request may be safer, as a reorg that happens when we are obtaining
|
||||
// `block_header`s will result in inconsistencies
|
||||
let current_hash = client.block_header(existing_height as usize)?.block_hash();
|
||||
let _ = update
|
||||
.insert_block(BlockId {
|
||||
height: existing_height,
|
||||
hash: current_hash,
|
||||
})
|
||||
.expect("This never errors because we are working with a fresh chain");
|
||||
// If electrum returns a tip height that is lower than our previous tip, then checkpoints do
|
||||
// not need updating. We just return the previous tip and use that as the point of agreement.
|
||||
if new_tip_height < prev_tip.height() {
|
||||
return Ok((prev_tip.clone(), Some(prev_tip.height())));
|
||||
}
|
||||
|
||||
if current_hash == existing_hash {
|
||||
// Atomically fetch the latest `CHAIN_SUFFIX_LENGTH` count of blocks from Electrum. We use this
|
||||
// to construct our checkpoint update.
|
||||
let mut new_blocks = {
|
||||
let start_height = new_tip_height.saturating_sub(CHAIN_SUFFIX_LENGTH - 1);
|
||||
let hashes = client
|
||||
.block_headers(start_height as _, CHAIN_SUFFIX_LENGTH as _)?
|
||||
.headers
|
||||
.into_iter()
|
||||
.map(|h| h.block_hash());
|
||||
(start_height..).zip(hashes).collect::<BTreeMap<u32, _>>()
|
||||
};
|
||||
|
||||
// Find the "point of agreement" (if any).
|
||||
let agreement_cp = {
|
||||
let mut agreement_cp = Option::<CheckPoint>::None;
|
||||
for cp in prev_tip.iter() {
|
||||
let cp_block = cp.block_id();
|
||||
let hash = match new_blocks.get(&cp_block.height) {
|
||||
Some(&hash) => hash,
|
||||
None => {
|
||||
assert!(
|
||||
new_tip_height >= cp_block.height,
|
||||
"already checked that electrum's tip cannot be smaller"
|
||||
);
|
||||
let hash = client.block_header(cp_block.height as _)?.block_hash();
|
||||
new_blocks.insert(cp_block.height, hash);
|
||||
hash
|
||||
}
|
||||
};
|
||||
if hash == cp_block.hash {
|
||||
agreement_cp = Some(cp);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Insert the new tip so new transactions will be accepted into the sparsechain.
|
||||
let tip = {
|
||||
let (height, hash) = crate::get_tip(client)?;
|
||||
BlockId { height, hash }
|
||||
agreement_cp
|
||||
};
|
||||
if update.insert_block(tip).is_err() {
|
||||
// There has been a re-org before we even begin scanning addresses.
|
||||
// Just recursively call (this should never happen).
|
||||
return prepare_chain_update(client, local_chain);
|
||||
}
|
||||
|
||||
Ok(update)
|
||||
let agreement_height = agreement_cp.as_ref().map(CheckPoint::height);
|
||||
|
||||
let new_tip = new_blocks
|
||||
.into_iter()
|
||||
// Prune `new_blocks` to only include blocks that are actually new.
|
||||
.filter(|(height, _)| Some(*height) > agreement_height)
|
||||
.map(|(height, hash)| BlockId { height, hash })
|
||||
.fold(agreement_cp, |prev_cp, block| {
|
||||
Some(match prev_cp {
|
||||
Some(cp) => cp.push(block).expect("must extend checkpoint"),
|
||||
None => CheckPoint::new(block),
|
||||
})
|
||||
})
|
||||
.expect("must have at least one checkpoint");
|
||||
|
||||
Ok((new_tip, agreement_height))
|
||||
}
|
||||
|
||||
/// A [tx status] comprises of a concatenation of `tx_hash:height:`s. We transform a single one of
|
||||
/// these concatenations into a [`ConfirmationHeightAnchor`] if possible.
|
||||
///
|
||||
/// We use the lowest possible checkpoint as the anchor block (from `cps`). If an anchor block
|
||||
/// cannot be found, or the transaction is unconfirmed, [`None`] is returned.
|
||||
///
|
||||
/// [tx status](https://electrumx-spesmilo.readthedocs.io/en/latest/protocol-basics.html#status)
|
||||
fn determine_tx_anchor(
|
||||
anchor_block: BlockId,
|
||||
cps: &BTreeMap<u32, CheckPoint>,
|
||||
raw_height: i32,
|
||||
txid: Txid,
|
||||
) -> Option<ConfirmationHeightAnchor> {
|
||||
@@ -316,9 +372,10 @@ fn determine_tx_anchor(
|
||||
// transactions residing in the genesis block to have height 0, then interpret a height of 0 as
|
||||
// unconfirmed for all other transactions.
|
||||
if txid
|
||||
== Txid::from_hex("4a5e1e4baab89f3a32518a88c31bc87f618f76673e2cc77ab2127b7afdeda33b")
|
||||
== Txid::from_str("4a5e1e4baab89f3a32518a88c31bc87f618f76673e2cc77ab2127b7afdeda33b")
|
||||
.expect("must deserialize genesis coinbase txid")
|
||||
{
|
||||
let anchor_block = cps.values().next()?.block_id();
|
||||
return Some(ConfirmationHeightAnchor {
|
||||
anchor_block,
|
||||
confirmation_height: 0,
|
||||
@@ -331,6 +388,7 @@ fn determine_tx_anchor(
|
||||
}
|
||||
h => {
|
||||
let h = h as u32;
|
||||
let anchor_block = cps.range(h..).next().map(|(_, cp)| cp.block_id())?;
|
||||
if h > anchor_block.height {
|
||||
None
|
||||
} else {
|
||||
@@ -343,10 +401,10 @@ fn determine_tx_anchor(
|
||||
}
|
||||
}
|
||||
|
||||
fn populate_with_outpoints<K>(
|
||||
fn populate_with_outpoints(
|
||||
client: &Client,
|
||||
anchor_block: BlockId,
|
||||
update: &mut ElectrumUpdate<K, ConfirmationHeightAnchor>,
|
||||
cps: &BTreeMap<u32, CheckPoint>,
|
||||
relevant_txids: &mut RelevantTxids,
|
||||
outpoints: &mut impl Iterator<Item = OutPoint>,
|
||||
) -> Result<HashMap<Txid, Transaction>, Error> {
|
||||
let mut full_txs = HashMap::new();
|
||||
@@ -394,9 +452,8 @@ fn populate_with_outpoints<K>(
|
||||
}
|
||||
};
|
||||
|
||||
let anchor = determine_tx_anchor(anchor_block, res.height, res.tx_hash);
|
||||
|
||||
let tx_entry = update.graph_update.entry(res.tx_hash).or_default();
|
||||
let anchor = determine_tx_anchor(cps, res.height, res.tx_hash);
|
||||
let tx_entry = relevant_txids.0.entry(res.tx_hash).or_default();
|
||||
if let Some(anchor) = anchor {
|
||||
tx_entry.insert(anchor);
|
||||
}
|
||||
@@ -405,10 +462,10 @@ fn populate_with_outpoints<K>(
|
||||
Ok(full_txs)
|
||||
}
|
||||
|
||||
fn populate_with_txids<K>(
|
||||
fn populate_with_txids(
|
||||
client: &Client,
|
||||
anchor_block: BlockId,
|
||||
update: &mut ElectrumUpdate<K, ConfirmationHeightAnchor>,
|
||||
cps: &BTreeMap<u32, CheckPoint>,
|
||||
relevant_txids: &mut RelevantTxids,
|
||||
txids: &mut impl Iterator<Item = Txid>,
|
||||
) -> Result<(), Error> {
|
||||
for txid in txids {
|
||||
@@ -429,11 +486,11 @@ fn populate_with_txids<K>(
|
||||
.into_iter()
|
||||
.find(|r| r.tx_hash == txid)
|
||||
{
|
||||
Some(r) => determine_tx_anchor(anchor_block, r.height, txid),
|
||||
Some(r) => determine_tx_anchor(cps, r.height, txid),
|
||||
None => continue,
|
||||
};
|
||||
|
||||
let tx_entry = update.graph_update.entry(txid).or_default();
|
||||
let tx_entry = relevant_txids.0.entry(txid).or_default();
|
||||
if let Some(anchor) = anchor {
|
||||
tx_entry.insert(anchor);
|
||||
}
|
||||
@@ -441,14 +498,14 @@ fn populate_with_txids<K>(
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn populate_with_spks<K, I: Ord + Clone>(
|
||||
fn populate_with_spks<I: Ord + Clone>(
|
||||
client: &Client,
|
||||
anchor_block: BlockId,
|
||||
update: &mut ElectrumUpdate<K, ConfirmationHeightAnchor>,
|
||||
spks: &mut impl Iterator<Item = (I, Script)>,
|
||||
cps: &BTreeMap<u32, CheckPoint>,
|
||||
relevant_txids: &mut RelevantTxids,
|
||||
spks: &mut impl Iterator<Item = (I, ScriptBuf)>,
|
||||
stop_gap: usize,
|
||||
batch_size: usize,
|
||||
) -> Result<BTreeMap<I, (Script, bool)>, Error> {
|
||||
) -> Result<BTreeMap<I, (ScriptBuf, bool)>, Error> {
|
||||
let mut unused_spk_count = 0_usize;
|
||||
let mut scanned_spks = BTreeMap::new();
|
||||
|
||||
@@ -460,7 +517,8 @@ fn populate_with_spks<K, I: Ord + Clone>(
|
||||
return Ok(scanned_spks);
|
||||
}
|
||||
|
||||
let spk_histories = client.batch_script_get_history(spks.iter().map(|(_, s)| s))?;
|
||||
let spk_histories =
|
||||
client.batch_script_get_history(spks.iter().map(|(_, s)| s.as_script()))?;
|
||||
|
||||
for ((spk_index, spk), spk_history) in spks.into_iter().zip(spk_histories) {
|
||||
if spk_history.is_empty() {
|
||||
@@ -476,8 +534,8 @@ fn populate_with_spks<K, I: Ord + Clone>(
|
||||
}
|
||||
|
||||
for tx in spk_history {
|
||||
let tx_entry = update.graph_update.entry(tx.tx_hash).or_default();
|
||||
if let Some(anchor) = determine_tx_anchor(anchor_block, tx.height, tx.tx_hash) {
|
||||
let tx_entry = relevant_txids.0.entry(tx.tx_hash).or_default();
|
||||
if let Some(anchor) = determine_tx_anchor(cps, tx.height, tx.tx_hash) {
|
||||
tx_entry.insert(anchor);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,35 +1,30 @@
|
||||
//! This crate is used for updating structures of the [`bdk_chain`] crate with data from electrum.
|
||||
//!
|
||||
//! The star of the show is the [`ElectrumExt::scan`] method, which scans for relevant blockchain
|
||||
//! data (via electrum) and outputs an [`ElectrumUpdate`].
|
||||
//! data (via electrum) and outputs updates for [`bdk_chain`] structures as a tuple of form:
|
||||
//!
|
||||
//! An [`ElectrumUpdate`] only includes `txid`s and no full transactions. The caller is responsible
|
||||
//! for obtaining full transactions before applying. This can be done with
|
||||
//! ([`bdk_chain::local_chain::Update`], [`RelevantTxids`], `keychain_update`)
|
||||
//!
|
||||
//! An [`RelevantTxids`] only includes `txid`s and no full transactions. The caller is
|
||||
//! responsible for obtaining full transactions before applying. This can be done with
|
||||
//! these steps:
|
||||
//!
|
||||
//! 1. Determine which full transactions are missing. The method [`missing_full_txs`] of
|
||||
//! [`ElectrumUpdate`] can be used.
|
||||
//! [`RelevantTxids`] can be used.
|
||||
//!
|
||||
//! 2. Obtaining the full transactions. To do this via electrum, the method
|
||||
//! [`batch_transaction_get`] can be used.
|
||||
//!
|
||||
//! Refer to [`bdk_electrum_example`] for a complete example.
|
||||
//!
|
||||
//! [`ElectrumClient::scan`]: ElectrumClient::scan
|
||||
//! [`missing_full_txs`]: ElectrumUpdate::missing_full_txs
|
||||
//! [`batch_transaction_get`]: ElectrumApi::batch_transaction_get
|
||||
//! [`ElectrumClient::scan`]: electrum_client::ElectrumClient::scan
|
||||
//! [`missing_full_txs`]: RelevantTxids::missing_full_txs
|
||||
//! [`batch_transaction_get`]: electrum_client::ElectrumApi::batch_transaction_get
|
||||
//! [`bdk_electrum_example`]: https://github.com/LLFourn/bdk_core_staging/tree/master/bdk_electrum_example
|
||||
|
||||
use bdk_chain::bitcoin::BlockHash;
|
||||
use electrum_client::{Client, ElectrumApi, Error};
|
||||
#![warn(missing_docs)]
|
||||
|
||||
mod electrum_ext;
|
||||
pub use bdk_chain;
|
||||
pub use electrum_client;
|
||||
pub use electrum_ext::*;
|
||||
|
||||
fn get_tip(client: &Client) -> Result<(u32, BlockHash), Error> {
|
||||
// TODO: unsubscribe when added to the client, or is there a better call to use here?
|
||||
client
|
||||
.block_headers_subscribe()
|
||||
.map(|data| (data.height as u32, data.header.block_hash()))
|
||||
}
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
[package]
|
||||
name = "bdk_esplora"
|
||||
version = "0.3.0"
|
||||
version = "0.4.0"
|
||||
edition = "2021"
|
||||
homepage = "https://bitcoindevkit.org"
|
||||
repository = "https://github.com/bitcoindevkit/bdk"
|
||||
@@ -12,18 +12,23 @@ readme = "README.md"
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", default-features = false, features = ["serde", "miniscript"] }
|
||||
esplora-client = { version = "0.5", default-features = false }
|
||||
bdk_chain = { path = "../chain", version = "0.6.0", default-features = false }
|
||||
esplora-client = { version = "0.6.0", default-features = false }
|
||||
async-trait = { version = "0.1.66", optional = true }
|
||||
futures = { version = "0.3.26", optional = true }
|
||||
|
||||
# use these dependencies if you need to enable their /no-std features
|
||||
bitcoin = { version = "0.29", optional = true, default-features = false }
|
||||
miniscript = { version = "9.0.0", optional = true, default-features = false }
|
||||
bitcoin = { version = "0.30.0", optional = true, default-features = false }
|
||||
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||
|
||||
[target.'cfg(not(target_arch = "wasm32"))'.dev-dependencies]
|
||||
electrsd = { version= "0.25.0", features = ["bitcoind_25_0", "esplora_a33e97e1", "legacy"] }
|
||||
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||
|
||||
[features]
|
||||
default = ["std", "async-https", "blocking"]
|
||||
std = ["bdk_chain/std"]
|
||||
async = ["async-trait", "futures", "esplora-client/async"]
|
||||
async-https = ["async", "esplora-client/async-https"]
|
||||
async-https-rustls = ["async", "esplora-client/async-https-rustls"]
|
||||
blocking = ["esplora-client/blocking"]
|
||||
|
||||
@@ -1,6 +1,6 @@
|
||||
# BDK Esplora
|
||||
|
||||
BDK Esplora extends [`esplora_client`](crate::esplora_client) to update [`bdk_chain`] structures
|
||||
BDK Esplora extends [`esplora-client`] to update [`bdk_chain`] structures
|
||||
from an Esplora server.
|
||||
|
||||
## Usage
|
||||
@@ -31,3 +31,6 @@ use bdk_esplora::EsploraExt;
|
||||
```
|
||||
|
||||
For full examples, refer to [`example-crates/wallet_esplora`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora) (blocking) and [`example-crates/wallet_esplora_async`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_async).
|
||||
|
||||
[`esplora-client`]: https://docs.rs/esplora-client/
|
||||
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||
|
||||
@@ -1,65 +1,77 @@
|
||||
use async_trait::async_trait;
|
||||
use bdk_chain::collections::btree_map;
|
||||
use bdk_chain::{
|
||||
bitcoin::{BlockHash, OutPoint, Script, Txid},
|
||||
collections::BTreeMap,
|
||||
keychain::LocalUpdate,
|
||||
BlockId, ConfirmationTimeAnchor,
|
||||
bitcoin::{BlockHash, OutPoint, ScriptBuf, Txid},
|
||||
collections::{BTreeMap, BTreeSet},
|
||||
local_chain::{self, CheckPoint},
|
||||
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||
};
|
||||
use esplora_client::{Error, OutputStatus, TxStatus};
|
||||
use esplora_client::{Error, TxStatus};
|
||||
use futures::{stream::FuturesOrdered, TryStreamExt};
|
||||
|
||||
use crate::map_confirmation_time_anchor;
|
||||
use crate::{anchor_from_status, ASSUME_FINAL_DEPTH};
|
||||
|
||||
/// Trait to extend [`esplora_client::AsyncClient`] functionality.
|
||||
/// Trait to extend the functionality of [`esplora_client::AsyncClient`].
|
||||
///
|
||||
/// This is the async version of [`EsploraExt`]. Refer to
|
||||
/// [crate-level documentation] for more.
|
||||
/// Refer to [crate-level documentation] for more.
|
||||
///
|
||||
/// [`EsploraExt`]: crate::EsploraExt
|
||||
/// [crate-level documentation]: crate
|
||||
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||
pub trait EsploraAsyncExt {
|
||||
/// Scan the blockchain (via esplora) for the data specified and returns a
|
||||
/// [`LocalUpdate<K, ConfirmationTimeAnchor>`].
|
||||
/// Prepare an [`LocalChain`] update with blocks fetched from Esplora.
|
||||
///
|
||||
/// - `local_chain`: the most recent block hashes present locally
|
||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// - `txids`: transactions for which we want updated [`ConfirmationTimeAnchor`]s
|
||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to included in the update
|
||||
/// * `local_tip` is the previous tip of [`LocalChain::tip`].
|
||||
/// * `request_heights` is the block heights that we are interested in fetching from Esplora.
|
||||
///
|
||||
/// The result of this method can be applied to [`LocalChain::apply_update`].
|
||||
///
|
||||
/// [`LocalChain`]: bdk_chain::local_chain::LocalChain
|
||||
/// [`LocalChain::tip`]: bdk_chain::local_chain::LocalChain::tip
|
||||
/// [`LocalChain::apply_update`]: bdk_chain::local_chain::LocalChain::apply_update
|
||||
#[allow(clippy::result_large_err)]
|
||||
async fn update_local_chain(
|
||||
&self,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||
) -> Result<local_chain::Update, Error>;
|
||||
|
||||
/// Scan Esplora for the data specified and return a [`TxGraph`] and a map of last active
|
||||
/// indices.
|
||||
///
|
||||
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to include in the update
|
||||
///
|
||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||
/// parallel.
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
async fn scan<K: Ord + Clone + Send>(
|
||||
#[allow(clippy::result_large_err)]
|
||||
async fn scan_txs_with_keychains<K: Ord + Clone + Send>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<
|
||||
K,
|
||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, Script)> + Send> + Send,
|
||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, ScriptBuf)> + Send> + Send,
|
||||
>,
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error>;
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||
|
||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
||||
/// Convenience method to call [`scan_txs_with_keychains`] without requiring a keychain.
|
||||
///
|
||||
/// [`scan`]: EsploraAsyncExt::scan
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
async fn scan_without_keychain(
|
||||
/// [`scan_txs_with_keychains`]: EsploraAsyncExt::scan_txs_with_keychains
|
||||
#[allow(clippy::result_large_err)]
|
||||
async fn scan_txs(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = Script> + Send> + Send,
|
||||
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = ScriptBuf> + Send> + Send,
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<(), ConfirmationTimeAnchor>, Error> {
|
||||
self.scan(
|
||||
local_chain,
|
||||
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||
self.scan_txs_with_keychains(
|
||||
[(
|
||||
(),
|
||||
misc_spks
|
||||
@@ -74,196 +86,244 @@ pub trait EsploraAsyncExt {
|
||||
parallel_requests,
|
||||
)
|
||||
.await
|
||||
.map(|(g, _)| g)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||
impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
async fn scan<K: Ord + Clone + Send>(
|
||||
async fn update_local_chain(
|
||||
&self,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||
) -> Result<local_chain::Update, Error> {
|
||||
let request_heights = request_heights.into_iter().collect::<BTreeSet<_>>();
|
||||
let new_tip_height = self.get_height().await?;
|
||||
|
||||
// atomically fetch blocks from esplora
|
||||
let mut fetched_blocks = {
|
||||
let heights = (0..=new_tip_height).rev();
|
||||
let hashes = self
|
||||
.get_blocks(Some(new_tip_height))
|
||||
.await?
|
||||
.into_iter()
|
||||
.map(|b| b.id);
|
||||
heights.zip(hashes).collect::<BTreeMap<u32, BlockHash>>()
|
||||
};
|
||||
|
||||
// fetch heights that the caller is interested in
|
||||
for height in request_heights {
|
||||
// do not fetch blocks higher than remote tip
|
||||
if height > new_tip_height {
|
||||
continue;
|
||||
}
|
||||
// only fetch what is missing
|
||||
if let btree_map::Entry::Vacant(entry) = fetched_blocks.entry(height) {
|
||||
let hash = self.get_block_hash(height).await?;
|
||||
entry.insert(hash);
|
||||
}
|
||||
}
|
||||
|
||||
// find the earliest point of agreement between local chain and fetched chain
|
||||
let earliest_agreement_cp = {
|
||||
let mut earliest_agreement_cp = Option::<CheckPoint>::None;
|
||||
|
||||
let local_tip_height = local_tip.height();
|
||||
for local_cp in local_tip.iter() {
|
||||
let local_block = local_cp.block_id();
|
||||
|
||||
// the updated hash (block hash at this height after the update), can either be:
|
||||
// 1. a block that already existed in `fetched_blocks`
|
||||
// 2. a block that exists locally and at least has a depth of ASSUME_FINAL_DEPTH
|
||||
// 3. otherwise we can freshly fetch the block from remote, which is safe as it
|
||||
// is guaranteed that this would be at or below ASSUME_FINAL_DEPTH from the
|
||||
// remote tip
|
||||
let updated_hash = match fetched_blocks.entry(local_block.height) {
|
||||
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||
btree_map::Entry::Vacant(entry) => *entry.insert(
|
||||
if local_tip_height - local_block.height >= ASSUME_FINAL_DEPTH {
|
||||
local_block.hash
|
||||
} else {
|
||||
self.get_block_hash(local_block.height).await?
|
||||
},
|
||||
),
|
||||
};
|
||||
|
||||
// since we may introduce blocks below the point of agreement, we cannot break
|
||||
// here unconditionally - we only break if we guarantee there are no new heights
|
||||
// below our current local checkpoint
|
||||
if local_block.hash == updated_hash {
|
||||
earliest_agreement_cp = Some(local_cp);
|
||||
|
||||
let first_new_height = *fetched_blocks
|
||||
.keys()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
if first_new_height >= local_block.height {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
earliest_agreement_cp
|
||||
};
|
||||
|
||||
let tip = {
|
||||
// first checkpoint to use for the update chain
|
||||
let first_cp = match earliest_agreement_cp {
|
||||
Some(cp) => cp,
|
||||
None => {
|
||||
let (&height, &hash) = fetched_blocks
|
||||
.iter()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
CheckPoint::new(BlockId { height, hash })
|
||||
}
|
||||
};
|
||||
// transform fetched chain into the update chain
|
||||
fetched_blocks
|
||||
// we exclude anything at or below the first cp of the update chain otherwise
|
||||
// building the chain will fail
|
||||
.split_off(&(first_cp.height() + 1))
|
||||
.into_iter()
|
||||
.map(|(height, hash)| BlockId { height, hash })
|
||||
.fold(first_cp, |prev_cp, block| {
|
||||
prev_cp.push(block).expect("must extend checkpoint")
|
||||
})
|
||||
};
|
||||
|
||||
Ok(local_chain::Update {
|
||||
tip,
|
||||
introduce_older_blocks: true,
|
||||
})
|
||||
}
|
||||
|
||||
async fn scan_txs_with_keychains<K: Ord + Clone + Send>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<
|
||||
K,
|
||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, Script)> + Send> + Send,
|
||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, ScriptBuf)> + Send> + Send,
|
||||
>,
|
||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error> {
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||
|
||||
let (mut update, tip_at_start) = loop {
|
||||
let mut update = LocalUpdate::<K, ConfirmationTimeAnchor>::default();
|
||||
|
||||
for (&height, &original_hash) in local_chain.iter().rev() {
|
||||
let update_block_id = BlockId {
|
||||
height,
|
||||
hash: self.get_block_hash(height).await?,
|
||||
};
|
||||
let _ = update
|
||||
.chain
|
||||
.insert_block(update_block_id)
|
||||
.expect("cannot repeat height here");
|
||||
if update_block_id.hash == original_hash {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
let tip_at_start = BlockId {
|
||||
height: self.get_height().await?,
|
||||
hash: self.get_tip_hash().await?,
|
||||
};
|
||||
|
||||
if update.chain.insert_block(tip_at_start).is_ok() {
|
||||
break (update, tip_at_start);
|
||||
}
|
||||
};
|
||||
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||
|
||||
for (keychain, spks) in keychain_spks {
|
||||
let mut spks = spks.into_iter();
|
||||
let mut last_active_index = None;
|
||||
let mut empty_scripts = 0;
|
||||
type IndexWithTxs = (u32, Vec<esplora_client::Tx>);
|
||||
let mut last_index = Option::<u32>::None;
|
||||
let mut last_active_index = Option::<u32>::None;
|
||||
|
||||
loop {
|
||||
let futures = (0..parallel_requests)
|
||||
.filter_map(|_| {
|
||||
let (index, script) = spks.next()?;
|
||||
let handles = spks
|
||||
.by_ref()
|
||||
.take(parallel_requests)
|
||||
.map(|(spk_index, spk)| {
|
||||
let client = self.clone();
|
||||
Some(async move {
|
||||
let mut related_txs = client.scripthash_txs(&script, None).await?;
|
||||
|
||||
let n_confirmed =
|
||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
||||
// esplora pages on 25 confirmed transactions. If there are 25 or more we
|
||||
// keep requesting to see if there's more.
|
||||
if n_confirmed >= 25 {
|
||||
async move {
|
||||
let mut last_seen = None;
|
||||
let mut spk_txs = Vec::new();
|
||||
loop {
|
||||
let new_related_txs = client
|
||||
.scripthash_txs(
|
||||
&script,
|
||||
Some(related_txs.last().unwrap().txid),
|
||||
)
|
||||
.await?;
|
||||
let n = new_related_txs.len();
|
||||
related_txs.extend(new_related_txs);
|
||||
// we've reached the end
|
||||
if n < 25 {
|
||||
break;
|
||||
let txs = client.scripthash_txs(&spk, last_seen).await?;
|
||||
let tx_count = txs.len();
|
||||
last_seen = txs.last().map(|tx| tx.txid);
|
||||
spk_txs.extend(txs);
|
||||
if tx_count < 25 {
|
||||
break Result::<_, Error>::Ok((spk_index, spk_txs));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Result::<_, esplora_client::Error>::Ok((index, related_txs))
|
||||
})
|
||||
})
|
||||
.collect::<FuturesOrdered<_>>();
|
||||
|
||||
let n_futures = futures.len();
|
||||
if handles.is_empty() {
|
||||
break;
|
||||
}
|
||||
|
||||
for (index, related_txs) in futures.try_collect::<Vec<IndexWithTxs>>().await? {
|
||||
if related_txs.is_empty() {
|
||||
empty_scripts += 1;
|
||||
} else {
|
||||
for (index, txs) in handles.try_collect::<Vec<TxsOfSpkIndex>>().await? {
|
||||
last_index = Some(index);
|
||||
if !txs.is_empty() {
|
||||
last_active_index = Some(index);
|
||||
empty_scripts = 0;
|
||||
}
|
||||
for tx in related_txs {
|
||||
let anchor = map_confirmation_time_anchor(&tx.status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx.to_tx());
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(tx.txid, anchor);
|
||||
for tx in txs {
|
||||
let _ = graph.insert_tx(tx.to_tx());
|
||||
if let Some(anchor) = anchor_from_status(&tx.status) {
|
||||
let _ = graph.insert_anchor(tx.txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if n_futures == 0 || empty_scripts >= stop_gap {
|
||||
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||
let past_gap_limit = if let Some(i) = last_active_index {
|
||||
last_index > i.saturating_add(stop_gap as u32)
|
||||
} else {
|
||||
last_index >= stop_gap as u32
|
||||
};
|
||||
if past_gap_limit {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(last_active_index) = last_active_index {
|
||||
update.keychain.insert(keychain, last_active_index);
|
||||
last_active_indexes.insert(keychain, last_active_index);
|
||||
}
|
||||
}
|
||||
|
||||
for txid in txids.into_iter() {
|
||||
if update.graph.get_tx(txid).is_none() {
|
||||
match self.get_tx(&txid).await? {
|
||||
Some(tx) => {
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
let mut txids = txids.into_iter();
|
||||
loop {
|
||||
let handles = txids
|
||||
.by_ref()
|
||||
.take(parallel_requests)
|
||||
.filter(|&txid| graph.get_tx(txid).is_none())
|
||||
.map(|txid| {
|
||||
let client = self.clone();
|
||||
async move { client.get_tx_status(&txid).await.map(|s| (txid, s)) }
|
||||
})
|
||||
.collect::<FuturesOrdered<_>>();
|
||||
|
||||
if handles.is_empty() {
|
||||
break;
|
||||
}
|
||||
None => continue,
|
||||
|
||||
for (txid, status) in handles.try_collect::<Vec<(Txid, TxStatus)>>().await? {
|
||||
if let Some(anchor) = anchor_from_status(&status) {
|
||||
let _ = graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
match self.get_tx_status(&txid).await? {
|
||||
tx_status if tx_status.confirmed => {
|
||||
if let Some(anchor) = map_confirmation_time_anchor(&tx_status, tip_at_start) {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
|
||||
for op in outpoints.into_iter() {
|
||||
let mut op_txs = Vec::with_capacity(2);
|
||||
if let (
|
||||
Some(tx),
|
||||
tx_status @ TxStatus {
|
||||
confirmed: true, ..
|
||||
},
|
||||
) = (
|
||||
self.get_tx(&op.txid).await?,
|
||||
self.get_tx_status(&op.txid).await?,
|
||||
) {
|
||||
op_txs.push((tx, tx_status));
|
||||
if let Some(OutputStatus {
|
||||
txid: Some(txid),
|
||||
status: Some(spend_status),
|
||||
..
|
||||
}) = self.get_output_status(&op.txid, op.vout as _).await?
|
||||
{
|
||||
if let Some(spend_tx) = self.get_tx(&txid).await? {
|
||||
op_txs.push((spend_tx, spend_status));
|
||||
if graph.get_tx(op.txid).is_none() {
|
||||
if let Some(tx) = self.get_tx(&op.txid).await? {
|
||||
let _ = graph.insert_tx(tx);
|
||||
}
|
||||
let status = self.get_tx_status(&op.txid).await?;
|
||||
if let Some(anchor) = anchor_from_status(&status) {
|
||||
let _ = graph.insert_anchor(op.txid, anchor);
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(op_status) = self.get_output_status(&op.txid, op.vout as _).await? {
|
||||
if let Some(txid) = op_status.txid {
|
||||
if graph.get_tx(txid).is_none() {
|
||||
if let Some(tx) = self.get_tx(&txid).await? {
|
||||
let _ = graph.insert_tx(tx);
|
||||
}
|
||||
let status = self.get_tx_status(&txid).await?;
|
||||
if let Some(anchor) = anchor_from_status(&status) {
|
||||
let _ = graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for (tx, status) in op_txs {
|
||||
let txid = tx.txid();
|
||||
let anchor = map_confirmation_time_anchor(&status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if tip_at_start.hash != self.get_block_hash(tip_at_start.height).await? {
|
||||
// A reorg occurred, so let's find out where all the txids we found are now in the chain
|
||||
let txids_found = update
|
||||
.graph
|
||||
.full_txs()
|
||||
.map(|tx_node| tx_node.txid)
|
||||
.collect::<Vec<_>>();
|
||||
update.chain = EsploraAsyncExt::scan_without_keychain(
|
||||
self,
|
||||
local_chain,
|
||||
[],
|
||||
txids_found,
|
||||
[],
|
||||
parallel_requests,
|
||||
)
|
||||
.await?
|
||||
.chain;
|
||||
}
|
||||
|
||||
Ok(update)
|
||||
Ok((graph, last_active_indexes))
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,54 +1,72 @@
|
||||
use bdk_chain::bitcoin::{BlockHash, OutPoint, Script, Txid};
|
||||
use bdk_chain::collections::BTreeMap;
|
||||
use bdk_chain::BlockId;
|
||||
use bdk_chain::{keychain::LocalUpdate, ConfirmationTimeAnchor};
|
||||
use esplora_client::{Error, OutputStatus, TxStatus};
|
||||
use std::thread::JoinHandle;
|
||||
|
||||
use crate::map_confirmation_time_anchor;
|
||||
use bdk_chain::collections::btree_map;
|
||||
use bdk_chain::collections::{BTreeMap, BTreeSet};
|
||||
use bdk_chain::{
|
||||
bitcoin::{BlockHash, OutPoint, ScriptBuf, Txid},
|
||||
local_chain::{self, CheckPoint},
|
||||
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||
};
|
||||
use esplora_client::{Error, TxStatus};
|
||||
|
||||
/// Trait to extend [`esplora_client::BlockingClient`] functionality.
|
||||
use crate::{anchor_from_status, ASSUME_FINAL_DEPTH};
|
||||
|
||||
/// Trait to extend the functionality of [`esplora_client::BlockingClient`].
|
||||
///
|
||||
/// Refer to [crate-level documentation] for more.
|
||||
///
|
||||
/// [crate-level documentation]: crate
|
||||
pub trait EsploraExt {
|
||||
/// Scan the blockchain (via esplora) for the data specified and returns a
|
||||
/// [`LocalUpdate<K, ConfirmationTimeAnchor>`].
|
||||
/// Prepare an [`LocalChain`] update with blocks fetched from Esplora.
|
||||
///
|
||||
/// - `local_chain`: the most recent block hashes present locally
|
||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// - `txids`: transactions for which we want updated [`ConfirmationTimeAnchor`]s
|
||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to included in the update
|
||||
/// * `prev_tip` is the previous tip of [`LocalChain::tip`].
|
||||
/// * `get_heights` is the block heights that we are interested in fetching from Esplora.
|
||||
///
|
||||
/// The result of this method can be applied to [`LocalChain::apply_update`].
|
||||
///
|
||||
/// [`LocalChain`]: bdk_chain::local_chain::LocalChain
|
||||
/// [`LocalChain::tip`]: bdk_chain::local_chain::LocalChain::tip
|
||||
/// [`LocalChain::apply_update`]: bdk_chain::local_chain::LocalChain::apply_update
|
||||
#[allow(clippy::result_large_err)]
|
||||
fn update_local_chain(
|
||||
&self,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<Item = u32>,
|
||||
) -> Result<local_chain::Update, Error>;
|
||||
|
||||
/// Scan Esplora for the data specified and return a [`TxGraph`] and a map of last active
|
||||
/// indices.
|
||||
///
|
||||
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||
/// want to include in the update
|
||||
///
|
||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||
/// parallel.
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
fn scan<K: Ord + Clone>(
|
||||
#[allow(clippy::result_large_err)]
|
||||
fn scan_txs_with_keychains<K: Ord + Clone>(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error>;
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||
|
||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
||||
/// Convenience method to call [`scan_txs_with_keychains`] without requiring a keychain.
|
||||
///
|
||||
/// [`scan`]: EsploraExt::scan
|
||||
#[allow(clippy::result_large_err)] // FIXME
|
||||
fn scan_without_keychain(
|
||||
/// [`scan_txs_with_keychains`]: EsploraExt::scan_txs_with_keychains
|
||||
#[allow(clippy::result_large_err)]
|
||||
fn scan_txs(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
misc_spks: impl IntoIterator<Item = Script>,
|
||||
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<(), ConfirmationTimeAnchor>, Error> {
|
||||
self.scan(
|
||||
local_chain,
|
||||
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||
self.scan_txs_with_keychains(
|
||||
[(
|
||||
(),
|
||||
misc_spks
|
||||
@@ -62,190 +80,244 @@ pub trait EsploraExt {
|
||||
usize::MAX,
|
||||
parallel_requests,
|
||||
)
|
||||
.map(|(g, _)| g)
|
||||
}
|
||||
}
|
||||
|
||||
impl EsploraExt for esplora_client::BlockingClient {
|
||||
fn scan<K: Ord + Clone>(
|
||||
fn update_local_chain(
|
||||
&self,
|
||||
local_chain: &BTreeMap<u32, BlockHash>,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
||||
local_tip: CheckPoint,
|
||||
request_heights: impl IntoIterator<Item = u32>,
|
||||
) -> Result<local_chain::Update, Error> {
|
||||
let request_heights = request_heights.into_iter().collect::<BTreeSet<_>>();
|
||||
let new_tip_height = self.get_height()?;
|
||||
|
||||
// atomically fetch blocks from esplora
|
||||
let mut fetched_blocks = {
|
||||
let heights = (0..=new_tip_height).rev();
|
||||
let hashes = self
|
||||
.get_blocks(Some(new_tip_height))?
|
||||
.into_iter()
|
||||
.map(|b| b.id);
|
||||
heights.zip(hashes).collect::<BTreeMap<u32, BlockHash>>()
|
||||
};
|
||||
|
||||
// fetch heights that the caller is interested in
|
||||
for height in request_heights {
|
||||
// do not fetch blocks higher than remote tip
|
||||
if height > new_tip_height {
|
||||
continue;
|
||||
}
|
||||
// only fetch what is missing
|
||||
if let btree_map::Entry::Vacant(entry) = fetched_blocks.entry(height) {
|
||||
let hash = self.get_block_hash(height)?;
|
||||
entry.insert(hash);
|
||||
}
|
||||
}
|
||||
|
||||
// find the earliest point of agreement between local chain and fetched chain
|
||||
let earliest_agreement_cp = {
|
||||
let mut earliest_agreement_cp = Option::<CheckPoint>::None;
|
||||
|
||||
let local_tip_height = local_tip.height();
|
||||
for local_cp in local_tip.iter() {
|
||||
let local_block = local_cp.block_id();
|
||||
|
||||
// the updated hash (block hash at this height after the update), can either be:
|
||||
// 1. a block that already existed in `fetched_blocks`
|
||||
// 2. a block that exists locally and at least has a depth of ASSUME_FINAL_DEPTH
|
||||
// 3. otherwise we can freshly fetch the block from remote, which is safe as it
|
||||
// is guaranteed that this would be at or below ASSUME_FINAL_DEPTH from the
|
||||
// remote tip
|
||||
let updated_hash = match fetched_blocks.entry(local_block.height) {
|
||||
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||
btree_map::Entry::Vacant(entry) => *entry.insert(
|
||||
if local_tip_height - local_block.height >= ASSUME_FINAL_DEPTH {
|
||||
local_block.hash
|
||||
} else {
|
||||
self.get_block_hash(local_block.height)?
|
||||
},
|
||||
),
|
||||
};
|
||||
|
||||
// since we may introduce blocks below the point of agreement, we cannot break
|
||||
// here unconditionally - we only break if we guarantee there are no new heights
|
||||
// below our current local checkpoint
|
||||
if local_block.hash == updated_hash {
|
||||
earliest_agreement_cp = Some(local_cp);
|
||||
|
||||
let first_new_height = *fetched_blocks
|
||||
.keys()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
if first_new_height >= local_block.height {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
earliest_agreement_cp
|
||||
};
|
||||
|
||||
let tip = {
|
||||
// first checkpoint to use for the update chain
|
||||
let first_cp = match earliest_agreement_cp {
|
||||
Some(cp) => cp,
|
||||
None => {
|
||||
let (&height, &hash) = fetched_blocks
|
||||
.iter()
|
||||
.next()
|
||||
.expect("must have at least one new block");
|
||||
CheckPoint::new(BlockId { height, hash })
|
||||
}
|
||||
};
|
||||
// transform fetched chain into the update chain
|
||||
fetched_blocks
|
||||
// we exclude anything at or below the first cp of the update chain otherwise
|
||||
// building the chain will fail
|
||||
.split_off(&(first_cp.height() + 1))
|
||||
.into_iter()
|
||||
.map(|(height, hash)| BlockId { height, hash })
|
||||
.fold(first_cp, |prev_cp, block| {
|
||||
prev_cp.push(block).expect("must extend checkpoint")
|
||||
})
|
||||
};
|
||||
|
||||
Ok(local_chain::Update {
|
||||
tip,
|
||||
introduce_older_blocks: true,
|
||||
})
|
||||
}
|
||||
|
||||
fn scan_txs_with_keychains<K: Ord + Clone>(
|
||||
&self,
|
||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||
txids: impl IntoIterator<Item = Txid>,
|
||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||
stop_gap: usize,
|
||||
parallel_requests: usize,
|
||||
) -> Result<LocalUpdate<K, ConfirmationTimeAnchor>, Error> {
|
||||
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||
|
||||
let (mut update, tip_at_start) = loop {
|
||||
let mut update = LocalUpdate::<K, ConfirmationTimeAnchor>::default();
|
||||
|
||||
for (&height, &original_hash) in local_chain.iter().rev() {
|
||||
let update_block_id = BlockId {
|
||||
height,
|
||||
hash: self.get_block_hash(height)?,
|
||||
};
|
||||
let _ = update
|
||||
.chain
|
||||
.insert_block(update_block_id)
|
||||
.expect("cannot repeat height here");
|
||||
if update_block_id.hash == original_hash {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
let tip_at_start = BlockId {
|
||||
height: self.get_height()?,
|
||||
hash: self.get_tip_hash()?,
|
||||
};
|
||||
|
||||
if update.chain.insert_block(tip_at_start).is_ok() {
|
||||
break (update, tip_at_start);
|
||||
}
|
||||
};
|
||||
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||
|
||||
for (keychain, spks) in keychain_spks {
|
||||
let mut spks = spks.into_iter();
|
||||
let mut last_active_index = None;
|
||||
let mut empty_scripts = 0;
|
||||
type IndexWithTxs = (u32, Vec<esplora_client::Tx>);
|
||||
let mut last_index = Option::<u32>::None;
|
||||
let mut last_active_index = Option::<u32>::None;
|
||||
|
||||
loop {
|
||||
let handles = (0..parallel_requests)
|
||||
.filter_map(
|
||||
|_| -> Option<std::thread::JoinHandle<Result<IndexWithTxs, _>>> {
|
||||
let (index, script) = spks.next()?;
|
||||
let handles = spks
|
||||
.by_ref()
|
||||
.take(parallel_requests)
|
||||
.map(|(spk_index, spk)| {
|
||||
std::thread::spawn({
|
||||
let client = self.clone();
|
||||
Some(std::thread::spawn(move || {
|
||||
let mut related_txs = client.scripthash_txs(&script, None)?;
|
||||
|
||||
let n_confirmed =
|
||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
||||
// esplora pages on 25 confirmed transactions. If there are 25 or more we
|
||||
// keep requesting to see if there's more.
|
||||
if n_confirmed >= 25 {
|
||||
move || -> Result<TxsOfSpkIndex, Error> {
|
||||
let mut last_seen = None;
|
||||
let mut spk_txs = Vec::new();
|
||||
loop {
|
||||
let new_related_txs = client.scripthash_txs(
|
||||
&script,
|
||||
Some(related_txs.last().unwrap().txid),
|
||||
)?;
|
||||
let n = new_related_txs.len();
|
||||
related_txs.extend(new_related_txs);
|
||||
// we've reached the end
|
||||
if n < 25 {
|
||||
let txs = client.scripthash_txs(&spk, last_seen)?;
|
||||
let tx_count = txs.len();
|
||||
last_seen = txs.last().map(|tx| tx.txid);
|
||||
spk_txs.extend(txs);
|
||||
if tx_count < 25 {
|
||||
break Ok((spk_index, spk_txs));
|
||||
}
|
||||
}
|
||||
}
|
||||
})
|
||||
})
|
||||
.collect::<Vec<JoinHandle<Result<TxsOfSpkIndex, Error>>>>();
|
||||
|
||||
if handles.is_empty() {
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Result::<_, esplora_client::Error>::Ok((index, related_txs))
|
||||
}))
|
||||
},
|
||||
)
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let n_handles = handles.len();
|
||||
|
||||
for handle in handles {
|
||||
let (index, related_txs) = handle.join().unwrap()?; // TODO: don't unwrap
|
||||
if related_txs.is_empty() {
|
||||
empty_scripts += 1;
|
||||
} else {
|
||||
let (index, txs) = handle.join().expect("thread must not panic")?;
|
||||
last_index = Some(index);
|
||||
if !txs.is_empty() {
|
||||
last_active_index = Some(index);
|
||||
empty_scripts = 0;
|
||||
}
|
||||
for tx in related_txs {
|
||||
let anchor = map_confirmation_time_anchor(&tx.status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx.to_tx());
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(tx.txid, anchor);
|
||||
for tx in txs {
|
||||
let _ = graph.insert_tx(tx.to_tx());
|
||||
if let Some(anchor) = anchor_from_status(&tx.status) {
|
||||
let _ = graph.insert_anchor(tx.txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if n_handles == 0 || empty_scripts >= stop_gap {
|
||||
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||
let past_gap_limit = if let Some(i) = last_active_index {
|
||||
last_index > i.saturating_add(stop_gap as u32)
|
||||
} else {
|
||||
last_index >= stop_gap as u32
|
||||
};
|
||||
if past_gap_limit {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(last_active_index) = last_active_index {
|
||||
update.keychain.insert(keychain, last_active_index);
|
||||
last_active_indexes.insert(keychain, last_active_index);
|
||||
}
|
||||
}
|
||||
|
||||
for txid in txids.into_iter() {
|
||||
if update.graph.get_tx(txid).is_none() {
|
||||
match self.get_tx(&txid)? {
|
||||
Some(tx) => {
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
let mut txids = txids.into_iter();
|
||||
loop {
|
||||
let handles = txids
|
||||
.by_ref()
|
||||
.take(parallel_requests)
|
||||
.filter(|&txid| graph.get_tx(txid).is_none())
|
||||
.map(|txid| {
|
||||
std::thread::spawn({
|
||||
let client = self.clone();
|
||||
move || client.get_tx_status(&txid).map(|s| (txid, s))
|
||||
})
|
||||
})
|
||||
.collect::<Vec<JoinHandle<Result<(Txid, TxStatus), Error>>>>();
|
||||
|
||||
if handles.is_empty() {
|
||||
break;
|
||||
}
|
||||
None => continue,
|
||||
|
||||
for handle in handles {
|
||||
let (txid, status) = handle.join().expect("thread must not panic")?;
|
||||
if let Some(anchor) = anchor_from_status(&status) {
|
||||
let _ = graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
match self.get_tx_status(&txid)? {
|
||||
tx_status @ TxStatus {
|
||||
confirmed: true, ..
|
||||
} => {
|
||||
if let Some(anchor) = map_confirmation_time_anchor(&tx_status, tip_at_start) {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
_ => continue,
|
||||
}
|
||||
}
|
||||
|
||||
for op in outpoints.into_iter() {
|
||||
let mut op_txs = Vec::with_capacity(2);
|
||||
if let (
|
||||
Some(tx),
|
||||
tx_status @ TxStatus {
|
||||
confirmed: true, ..
|
||||
},
|
||||
) = (self.get_tx(&op.txid)?, self.get_tx_status(&op.txid)?)
|
||||
{
|
||||
op_txs.push((tx, tx_status));
|
||||
if let Some(OutputStatus {
|
||||
txid: Some(txid),
|
||||
status: Some(spend_status),
|
||||
..
|
||||
}) = self.get_output_status(&op.txid, op.vout as _)?
|
||||
{
|
||||
if let Some(spend_tx) = self.get_tx(&txid)? {
|
||||
op_txs.push((spend_tx, spend_status));
|
||||
if graph.get_tx(op.txid).is_none() {
|
||||
if let Some(tx) = self.get_tx(&op.txid)? {
|
||||
let _ = graph.insert_tx(tx);
|
||||
}
|
||||
let status = self.get_tx_status(&op.txid)?;
|
||||
if let Some(anchor) = anchor_from_status(&status) {
|
||||
let _ = graph.insert_anchor(op.txid, anchor);
|
||||
}
|
||||
}
|
||||
|
||||
if let Some(op_status) = self.get_output_status(&op.txid, op.vout as _)? {
|
||||
if let Some(txid) = op_status.txid {
|
||||
if graph.get_tx(txid).is_none() {
|
||||
if let Some(tx) = self.get_tx(&txid)? {
|
||||
let _ = graph.insert_tx(tx);
|
||||
}
|
||||
let status = self.get_tx_status(&txid)?;
|
||||
if let Some(anchor) = anchor_from_status(&status) {
|
||||
let _ = graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
for (tx, status) in op_txs {
|
||||
let txid = tx.txid();
|
||||
let anchor = map_confirmation_time_anchor(&status, tip_at_start);
|
||||
|
||||
let _ = update.graph.insert_tx(tx);
|
||||
if let Some(anchor) = anchor {
|
||||
let _ = update.graph.insert_anchor(txid, anchor);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if tip_at_start.hash != self.get_block_hash(tip_at_start.height)? {
|
||||
// A reorg occurred, so let's find out where all the txids we found are now in the chain
|
||||
let txids_found = update
|
||||
.graph
|
||||
.full_txs()
|
||||
.map(|tx_node| tx_node.txid)
|
||||
.collect::<Vec<_>>();
|
||||
update.chain = EsploraExt::scan_without_keychain(
|
||||
self,
|
||||
local_chain,
|
||||
[],
|
||||
txids_found,
|
||||
[],
|
||||
parallel_requests,
|
||||
)?
|
||||
.chain;
|
||||
}
|
||||
|
||||
Ok(update)
|
||||
Ok((graph, last_active_indexes))
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
#![doc = include_str!("../README.md")]
|
||||
use bdk_chain::{BlockId, ConfirmationTimeAnchor};
|
||||
use bdk_chain::{BlockId, ConfirmationTimeHeightAnchor};
|
||||
use esplora_client::TxStatus;
|
||||
|
||||
pub use esplora_client;
|
||||
@@ -14,16 +14,22 @@ mod async_ext;
|
||||
#[cfg(feature = "async")]
|
||||
pub use async_ext::*;
|
||||
|
||||
pub(crate) fn map_confirmation_time_anchor(
|
||||
tx_status: &TxStatus,
|
||||
tip_at_start: BlockId,
|
||||
) -> Option<ConfirmationTimeAnchor> {
|
||||
match (tx_status.block_time, tx_status.block_height) {
|
||||
(Some(confirmation_time), Some(confirmation_height)) => Some(ConfirmationTimeAnchor {
|
||||
anchor_block: tip_at_start,
|
||||
confirmation_height,
|
||||
confirmation_time,
|
||||
}),
|
||||
_ => None,
|
||||
const ASSUME_FINAL_DEPTH: u32 = 15;
|
||||
|
||||
fn anchor_from_status(status: &TxStatus) -> Option<ConfirmationTimeHeightAnchor> {
|
||||
if let TxStatus {
|
||||
block_height: Some(height),
|
||||
block_hash: Some(hash),
|
||||
block_time: Some(time),
|
||||
..
|
||||
} = status.clone()
|
||||
{
|
||||
Some(ConfirmationTimeHeightAnchor {
|
||||
anchor_block: BlockId { height, hash },
|
||||
confirmation_height: height,
|
||||
confirmation_time: time,
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
236
crates/esplora/tests/async_ext.rs
Normal file
236
crates/esplora/tests/async_ext.rs
Normal file
@@ -0,0 +1,236 @@
|
||||
use bdk_esplora::EsploraAsyncExt;
|
||||
use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||
use electrsd::{Conf, ElectrsD};
|
||||
use esplora_client::{self, AsyncClient, Builder};
|
||||
use std::collections::{BTreeMap, HashSet};
|
||||
use std::str::FromStr;
|
||||
use std::thread::sleep;
|
||||
use std::time::Duration;
|
||||
|
||||
use bdk_chain::bitcoin::{Address, Amount, BlockHash, Txid};
|
||||
|
||||
struct TestEnv {
|
||||
bitcoind: BitcoinD,
|
||||
#[allow(dead_code)]
|
||||
electrsd: ElectrsD,
|
||||
client: AsyncClient,
|
||||
}
|
||||
|
||||
impl TestEnv {
|
||||
fn new() -> Result<Self, anyhow::Error> {
|
||||
let bitcoind_exe =
|
||||
bitcoind::downloaded_exe_path().expect("bitcoind version feature must be enabled");
|
||||
let bitcoind = BitcoinD::new(bitcoind_exe).unwrap();
|
||||
|
||||
let mut electrs_conf = Conf::default();
|
||||
electrs_conf.http_enabled = true;
|
||||
let electrs_exe =
|
||||
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &electrs_conf)?;
|
||||
|
||||
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||
let client = Builder::new(base_url.as_str()).build_async()?;
|
||||
|
||||
Ok(Self {
|
||||
bitcoind,
|
||||
electrsd,
|
||||
client,
|
||||
})
|
||||
}
|
||||
|
||||
fn mine_blocks(
|
||||
&self,
|
||||
count: usize,
|
||||
address: Option<Address>,
|
||||
) -> anyhow::Result<Vec<BlockHash>> {
|
||||
let coinbase_address = match address {
|
||||
Some(address) => address,
|
||||
None => self
|
||||
.bitcoind
|
||||
.client
|
||||
.get_new_address(None, None)?
|
||||
.assume_checked(),
|
||||
};
|
||||
let block_hashes = self
|
||||
.bitcoind
|
||||
.client
|
||||
.generate_to_address(count as _, &coinbase_address)?;
|
||||
Ok(block_hashes)
|
||||
}
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
pub async fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let receive_address0 =
|
||||
Address::from_str("bcrt1qc6fweuf4xjvz4x3gx3t9e0fh4hvqyu2qw4wvxm")?.assume_checked();
|
||||
let receive_address1 =
|
||||
Address::from_str("bcrt1qfjg5lv3dvc9az8patec8fjddrs4aqtauadnagr")?.assume_checked();
|
||||
|
||||
let misc_spks = [
|
||||
receive_address0.script_pubkey(),
|
||||
receive_address1.script_pubkey(),
|
||||
];
|
||||
|
||||
let _block_hashes = env.mine_blocks(101, None)?;
|
||||
let txid1 = env.bitcoind.client.send_to_address(
|
||||
&receive_address1,
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let txid2 = env.bitcoind.client.send_to_address(
|
||||
&receive_address0,
|
||||
Amount::from_sat(20000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().await.unwrap() < 102 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
let graph_update = env
|
||||
.client
|
||||
.scan_txs(
|
||||
misc_spks.into_iter(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
|
||||
let mut graph_update_txids: Vec<Txid> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
graph_update_txids.sort();
|
||||
let mut expected_txids = vec![txid1, txid2];
|
||||
expected_txids.sort();
|
||||
assert_eq!(graph_update_txids, expected_txids);
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Test the bounds of the address scan depending on the gap limit.
|
||||
#[tokio::test]
|
||||
pub async fn test_async_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let _block_hashes = env.mine_blocks(101, None)?;
|
||||
|
||||
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||
let addresses = [
|
||||
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||
];
|
||||
let addresses: Vec<_> = addresses
|
||||
.into_iter()
|
||||
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||
.collect();
|
||||
let spks: Vec<_> = addresses
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||
.collect();
|
||||
let mut keychains = BTreeMap::new();
|
||||
keychains.insert(0, spks);
|
||||
|
||||
// Then receive coins on the 4th address.
|
||||
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[3],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().await.unwrap() < 103 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||
// will.
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
2,
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
assert!(graph_update.full_txs().next().is_none());
|
||||
assert!(active_indices.is_empty());
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
3,
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
|
||||
// Now receive a coin on the last address.
|
||||
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[addresses.len() - 1],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().await.unwrap() < 104 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||
// The last active indice won't be updated in the first case but will in the second one.
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
4,
|
||||
1,
|
||||
)
|
||||
.await?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 1);
|
||||
assert!(txs.contains(&txid_4th_addr));
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
let (graph_update, active_indices) = env
|
||||
.client
|
||||
.scan_txs_with_keychains(keychains, vec![].into_iter(), vec![].into_iter(), 5, 1)
|
||||
.await?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 2);
|
||||
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||
assert_eq!(active_indices[&0], 9);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
228
crates/esplora/tests/blocking_ext.rs
Normal file
228
crates/esplora/tests/blocking_ext.rs
Normal file
@@ -0,0 +1,228 @@
|
||||
use bdk_esplora::EsploraExt;
|
||||
use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||
use electrsd::{Conf, ElectrsD};
|
||||
use esplora_client::{self, BlockingClient, Builder};
|
||||
use std::collections::{BTreeMap, HashSet};
|
||||
use std::str::FromStr;
|
||||
use std::thread::sleep;
|
||||
use std::time::Duration;
|
||||
|
||||
use bdk_chain::bitcoin::{Address, Amount, BlockHash, Txid};
|
||||
|
||||
struct TestEnv {
|
||||
bitcoind: BitcoinD,
|
||||
#[allow(dead_code)]
|
||||
electrsd: ElectrsD,
|
||||
client: BlockingClient,
|
||||
}
|
||||
|
||||
impl TestEnv {
|
||||
fn new() -> Result<Self, anyhow::Error> {
|
||||
let bitcoind_exe =
|
||||
bitcoind::downloaded_exe_path().expect("bitcoind version feature must be enabled");
|
||||
let bitcoind = BitcoinD::new(bitcoind_exe).unwrap();
|
||||
|
||||
let mut electrs_conf = Conf::default();
|
||||
electrs_conf.http_enabled = true;
|
||||
let electrs_exe =
|
||||
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &electrs_conf)?;
|
||||
|
||||
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||
let client = Builder::new(base_url.as_str()).build_blocking()?;
|
||||
|
||||
Ok(Self {
|
||||
bitcoind,
|
||||
electrsd,
|
||||
client,
|
||||
})
|
||||
}
|
||||
|
||||
fn mine_blocks(
|
||||
&self,
|
||||
count: usize,
|
||||
address: Option<Address>,
|
||||
) -> anyhow::Result<Vec<BlockHash>> {
|
||||
let coinbase_address = match address {
|
||||
Some(address) => address,
|
||||
None => self
|
||||
.bitcoind
|
||||
.client
|
||||
.get_new_address(None, None)?
|
||||
.assume_checked(),
|
||||
};
|
||||
let block_hashes = self
|
||||
.bitcoind
|
||||
.client
|
||||
.generate_to_address(count as _, &coinbase_address)?;
|
||||
Ok(block_hashes)
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
pub fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let receive_address0 =
|
||||
Address::from_str("bcrt1qc6fweuf4xjvz4x3gx3t9e0fh4hvqyu2qw4wvxm")?.assume_checked();
|
||||
let receive_address1 =
|
||||
Address::from_str("bcrt1qfjg5lv3dvc9az8patec8fjddrs4aqtauadnagr")?.assume_checked();
|
||||
|
||||
let misc_spks = [
|
||||
receive_address0.script_pubkey(),
|
||||
receive_address1.script_pubkey(),
|
||||
];
|
||||
|
||||
let _block_hashes = env.mine_blocks(101, None)?;
|
||||
let txid1 = env.bitcoind.client.send_to_address(
|
||||
&receive_address1,
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let txid2 = env.bitcoind.client.send_to_address(
|
||||
&receive_address0,
|
||||
Amount::from_sat(20000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().unwrap() < 102 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
let graph_update = env.client.scan_txs(
|
||||
misc_spks.into_iter(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
1,
|
||||
)?;
|
||||
|
||||
let mut graph_update_txids: Vec<Txid> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
graph_update_txids.sort();
|
||||
let mut expected_txids = vec![txid1, txid2];
|
||||
expected_txids.sort();
|
||||
assert_eq!(graph_update_txids, expected_txids);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Test the bounds of the address scan depending on the gap limit.
|
||||
#[test]
|
||||
pub fn test_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||
let env = TestEnv::new()?;
|
||||
let _block_hashes = env.mine_blocks(101, None)?;
|
||||
|
||||
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||
let addresses = [
|
||||
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||
];
|
||||
let addresses: Vec<_> = addresses
|
||||
.into_iter()
|
||||
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||
.collect();
|
||||
let spks: Vec<_> = addresses
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||
.collect();
|
||||
let mut keychains = BTreeMap::new();
|
||||
keychains.insert(0, spks);
|
||||
|
||||
// Then receive coins on the 4th address.
|
||||
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[3],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().unwrap() < 103 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||
// will.
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
2,
|
||||
1,
|
||||
)?;
|
||||
assert!(graph_update.full_txs().next().is_none());
|
||||
assert!(active_indices.is_empty());
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
3,
|
||||
1,
|
||||
)?;
|
||||
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
|
||||
// Now receive a coin on the last address.
|
||||
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||
&addresses[addresses.len() - 1],
|
||||
Amount::from_sat(10000),
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
None,
|
||||
Some(1),
|
||||
None,
|
||||
)?;
|
||||
let _block_hashes = env.mine_blocks(1, None)?;
|
||||
while env.client.get_height().unwrap() < 104 {
|
||||
sleep(Duration::from_millis(10))
|
||||
}
|
||||
|
||||
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||
// The last active indice won't be updated in the first case but will in the second one.
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains.clone(),
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
4,
|
||||
1,
|
||||
)?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 1);
|
||||
assert!(txs.contains(&txid_4th_addr));
|
||||
assert_eq!(active_indices[&0], 3);
|
||||
let (graph_update, active_indices) = env.client.scan_txs_with_keychains(
|
||||
keychains,
|
||||
vec![].into_iter(),
|
||||
vec![].into_iter(),
|
||||
5,
|
||||
1,
|
||||
)?;
|
||||
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||
assert_eq!(txs.len(), 2);
|
||||
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||
assert_eq!(active_indices[&0], 9);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
@@ -11,7 +11,7 @@ authors = ["Bitcoin Dev Kit Developers"]
|
||||
readme = "README.md"
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../chain", version = "0.5.0", features = [ "serde", "miniscript" ] }
|
||||
bdk_chain = { path = "../chain", version = "0.6.0", features = [ "serde", "miniscript" ] }
|
||||
bincode = { version = "1" }
|
||||
serde = { version = "1", features = ["derive"] }
|
||||
|
||||
|
||||
@@ -23,7 +23,7 @@ pub struct Store<'a, C> {
|
||||
|
||||
impl<'a, C> PersistBackend<C> for Store<'a, C>
|
||||
where
|
||||
C: Default + Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
{
|
||||
type WriteError = std::io::Error;
|
||||
|
||||
@@ -33,30 +33,64 @@ where
|
||||
self.append_changeset(changeset)
|
||||
}
|
||||
|
||||
fn load_from_persistence(&mut self) -> Result<C, Self::LoadError> {
|
||||
let (changeset, result) = self.aggregate_changesets();
|
||||
result.map(|_| changeset)
|
||||
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||
self.aggregate_changesets().map_err(|e| e.iter_error)
|
||||
}
|
||||
}
|
||||
|
||||
impl<'a, C> Store<'a, C>
|
||||
where
|
||||
C: Default + Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||
{
|
||||
/// Creates a new store from a [`File`].
|
||||
/// Create a new [`Store`] file in write-only mode; error if the file exists.
|
||||
///
|
||||
/// The file must have been opened with read and write permissions.
|
||||
/// `magic` is the prefixed bytes to write to the new file. This will be checked when opening
|
||||
/// the `Store` in the future with [`open`].
|
||||
///
|
||||
/// `magic` is the expected prefixed bytes of the file. If this does not match, an error will be
|
||||
/// returned.
|
||||
/// [`open`]: Store::open
|
||||
pub fn create_new<P>(magic: &'a [u8], file_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
if file_path.as_ref().exists() {
|
||||
// `io::Error` is used instead of a variant on `FileError` because there is already a
|
||||
// nightly-only `File::create_new` method
|
||||
return Err(FileError::Io(io::Error::new(
|
||||
io::ErrorKind::Other,
|
||||
"file already exists",
|
||||
)));
|
||||
}
|
||||
let mut f = OpenOptions::new()
|
||||
.create(true)
|
||||
.read(true)
|
||||
.write(true)
|
||||
.open(file_path)?;
|
||||
f.write_all(magic)?;
|
||||
Ok(Self {
|
||||
magic,
|
||||
db_file: f,
|
||||
marker: Default::default(),
|
||||
})
|
||||
}
|
||||
|
||||
/// Open an existing [`Store`].
|
||||
///
|
||||
/// [`File`]: std::fs::File
|
||||
pub fn new(magic: &'a [u8], mut db_file: File) -> Result<Self, FileError> {
|
||||
db_file.rewind()?;
|
||||
/// Use [`create_new`] to create a new `Store`.
|
||||
///
|
||||
/// # Errors
|
||||
///
|
||||
/// If the prefixed bytes of the opened file does not match the provided `magic`, the
|
||||
/// [`FileError::InvalidMagicBytes`] error variant will be returned.
|
||||
///
|
||||
/// [`create_new`]: Store::create_new
|
||||
pub fn open<P>(magic: &'a [u8], file_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
let mut f = OpenOptions::new().read(true).write(true).open(file_path)?;
|
||||
|
||||
let mut magic_buf = vec![0_u8; magic.len()];
|
||||
db_file.read_exact(magic_buf.as_mut())?;
|
||||
|
||||
f.read_exact(&mut magic_buf)?;
|
||||
if magic_buf != magic {
|
||||
return Err(FileError::InvalidMagicBytes {
|
||||
got: magic_buf,
|
||||
@@ -66,35 +100,26 @@ where
|
||||
|
||||
Ok(Self {
|
||||
magic,
|
||||
db_file,
|
||||
db_file: f,
|
||||
marker: Default::default(),
|
||||
})
|
||||
}
|
||||
|
||||
/// Creates or loads a store from `db_path`.
|
||||
/// Attempt to open existing [`Store`] file; create it if the file is non-existant.
|
||||
///
|
||||
/// If no file exists there, it will be created.
|
||||
/// Internally, this calls either [`open`] or [`create_new`].
|
||||
///
|
||||
/// Refer to [`new`] for documentation on the `magic` input.
|
||||
///
|
||||
/// [`new`]: Self::new
|
||||
pub fn new_from_path<P>(magic: &'a [u8], db_path: P) -> Result<Self, FileError>
|
||||
/// [`open`]: Store::open
|
||||
/// [`create_new`]: Store::create_new
|
||||
pub fn open_or_create_new<P>(magic: &'a [u8], file_path: P) -> Result<Self, FileError>
|
||||
where
|
||||
P: AsRef<Path>,
|
||||
{
|
||||
let already_exists = db_path.as_ref().exists();
|
||||
|
||||
let mut db_file = OpenOptions::new()
|
||||
.read(true)
|
||||
.write(true)
|
||||
.create(true)
|
||||
.open(db_path)?;
|
||||
|
||||
if !already_exists {
|
||||
db_file.write_all(magic)?;
|
||||
if file_path.as_ref().exists() {
|
||||
Self::open(magic, file_path)
|
||||
} else {
|
||||
Self::create_new(magic, file_path)
|
||||
}
|
||||
|
||||
Self::new(magic, db_file)
|
||||
}
|
||||
|
||||
/// Iterates over the stored changeset from first to last, changing the seek position at each
|
||||
@@ -122,16 +147,24 @@ where
|
||||
///
|
||||
/// **WARNING**: This method changes the write position of the underlying file. The next
|
||||
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
||||
pub fn aggregate_changesets(&mut self) -> (C, Result<(), IterError>) {
|
||||
let mut changeset = C::default();
|
||||
let result = (|| {
|
||||
pub fn aggregate_changesets(&mut self) -> Result<Option<C>, AggregateChangesetsError<C>> {
|
||||
let mut changeset = Option::<C>::None;
|
||||
for next_changeset in self.iter_changesets() {
|
||||
changeset.append(next_changeset?);
|
||||
let next_changeset = match next_changeset {
|
||||
Ok(next_changeset) => next_changeset,
|
||||
Err(iter_error) => {
|
||||
return Err(AggregateChangesetsError {
|
||||
changeset,
|
||||
iter_error,
|
||||
})
|
||||
}
|
||||
Ok(())
|
||||
})();
|
||||
|
||||
(changeset, result)
|
||||
};
|
||||
match &mut changeset {
|
||||
Some(changeset) => changeset.append(next_changeset),
|
||||
changeset => *changeset = Some(next_changeset),
|
||||
}
|
||||
}
|
||||
Ok(changeset)
|
||||
}
|
||||
|
||||
/// Append a new changeset to the file and truncate the file to the end of the appended
|
||||
@@ -162,6 +195,24 @@ where
|
||||
}
|
||||
}
|
||||
|
||||
/// Error type for [`Store::aggregate_changesets`].
|
||||
#[derive(Debug)]
|
||||
pub struct AggregateChangesetsError<C> {
|
||||
/// The partially-aggregated changeset.
|
||||
pub changeset: Option<C>,
|
||||
|
||||
/// The error returned by [`EntryIter`].
|
||||
pub iter_error: IterError,
|
||||
}
|
||||
|
||||
impl<C> std::fmt::Display for AggregateChangesetsError<C> {
|
||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||
std::fmt::Display::fmt(&self.iter_error, f)
|
||||
}
|
||||
}
|
||||
|
||||
impl<C: std::fmt::Debug> std::error::Error for AggregateChangesetsError<C> {}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use super::*;
|
||||
@@ -182,13 +233,50 @@ mod test {
|
||||
#[derive(Debug)]
|
||||
struct TestTracker;
|
||||
|
||||
/// Check behavior of [`Store::create_new`] and [`Store::open`].
|
||||
#[test]
|
||||
fn construct_store() {
|
||||
let temp_dir = tempfile::tempdir().unwrap();
|
||||
let file_path = temp_dir.path().join("db_file");
|
||||
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect_err("must not open as file does not exist yet");
|
||||
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must create file");
|
||||
// cannot create new as file already exists
|
||||
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect_err("must fail as file already exists now");
|
||||
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must open as file exists now");
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn open_or_create_new() {
|
||||
let temp_dir = tempfile::tempdir().unwrap();
|
||||
let file_path = temp_dir.path().join("db_file");
|
||||
let changeset = vec!["hello".to_string(), "world".to_string()];
|
||||
|
||||
{
|
||||
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must create");
|
||||
assert!(file_path.exists());
|
||||
db.append_changeset(&changeset).expect("must succeed");
|
||||
}
|
||||
|
||||
{
|
||||
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||
.expect("must recover");
|
||||
let recovered_changeset = db.aggregate_changesets().expect("must succeed");
|
||||
assert_eq!(recovered_changeset, Some(changeset));
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn new_fails_if_file_is_too_short() {
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(&TEST_MAGIC_BYTES[..TEST_MAGIC_BYTES_LEN - 1])
|
||||
.expect("should write");
|
||||
|
||||
match Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap()) {
|
||||
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||
Err(FileError::Io(e)) => assert_eq!(e.kind(), std::io::ErrorKind::UnexpectedEof),
|
||||
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||
};
|
||||
@@ -202,7 +290,7 @@ mod test {
|
||||
file.write_all(invalid_magic_bytes.as_bytes())
|
||||
.expect("should write");
|
||||
|
||||
match Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap()) {
|
||||
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||
Err(FileError::InvalidMagicBytes { got, .. }) => {
|
||||
assert_eq!(got, invalid_magic_bytes.as_bytes())
|
||||
}
|
||||
@@ -221,8 +309,8 @@ mod test {
|
||||
let mut file = NamedTempFile::new().unwrap();
|
||||
file.write_all(&data).expect("should write");
|
||||
|
||||
let mut store = Store::<TestChangeSet>::new(&TEST_MAGIC_BYTES, file.reopen().unwrap())
|
||||
.expect("should open");
|
||||
let mut store =
|
||||
Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()).expect("should open");
|
||||
match store.iter_changesets().next() {
|
||||
Some(Err(IterError::Bincode(_))) => {}
|
||||
unexpected_res => panic!("unexpected result: {:?}", unexpected_res),
|
||||
|
||||
@@ -1 +0,0 @@
|
||||
|
||||
12
example-crates/example_bitcoind_rpc_polling/Cargo.toml
Normal file
12
example-crates/example_bitcoind_rpc_polling/Cargo.toml
Normal file
@@ -0,0 +1,12 @@
|
||||
[package]
|
||||
name = "example_bitcoind_rpc_polling"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||
bdk_bitcoind_rpc = { path = "../../crates/bitcoind_rpc" }
|
||||
example_cli = { path = "../example_cli" }
|
||||
ctrlc = { version = "^2" }
|
||||
380
example-crates/example_bitcoind_rpc_polling/src/main.rs
Normal file
380
example-crates/example_bitcoind_rpc_polling/src/main.rs
Normal file
@@ -0,0 +1,380 @@
|
||||
use std::{
|
||||
path::PathBuf,
|
||||
sync::{
|
||||
atomic::{AtomicBool, Ordering},
|
||||
Arc, Mutex,
|
||||
},
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
|
||||
use bdk_bitcoind_rpc::{
|
||||
bitcoincore_rpc::{Auth, Client, RpcApi},
|
||||
Emitter,
|
||||
};
|
||||
use bdk_chain::{
|
||||
bitcoin::{Block, Transaction},
|
||||
indexed_tx_graph, keychain,
|
||||
local_chain::{self, CheckPoint, LocalChain},
|
||||
ConfirmationTimeHeightAnchor, IndexedTxGraph,
|
||||
};
|
||||
use example_cli::{
|
||||
anyhow,
|
||||
clap::{self, Args, Subcommand},
|
||||
Keychain,
|
||||
};
|
||||
|
||||
const DB_MAGIC: &[u8] = b"bdk_example_rpc";
|
||||
const DB_PATH: &str = ".bdk_example_rpc.db";
|
||||
|
||||
/// The mpsc channel bound for emissions from [`Emitter`].
|
||||
const CHANNEL_BOUND: usize = 10;
|
||||
/// Delay for printing status to stdout.
|
||||
const STDOUT_PRINT_DELAY: Duration = Duration::from_secs(6);
|
||||
/// Delay between mempool emissions.
|
||||
const MEMPOOL_EMIT_DELAY: Duration = Duration::from_secs(30);
|
||||
/// Delay for committing to persistence.
|
||||
const DB_COMMIT_DELAY: Duration = Duration::from_secs(60);
|
||||
|
||||
type ChangeSet = (
|
||||
local_chain::ChangeSet,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||
);
|
||||
|
||||
#[derive(Debug)]
|
||||
enum Emission {
|
||||
Block { height: u32, block: Block },
|
||||
Mempool(Vec<(Transaction, u64)>),
|
||||
Tip(u32),
|
||||
}
|
||||
|
||||
#[derive(Args, Debug, Clone)]
|
||||
struct RpcArgs {
|
||||
/// RPC URL
|
||||
#[clap(env = "RPC_URL", long, default_value = "127.0.0.1:8332")]
|
||||
url: String,
|
||||
/// RPC auth cookie file
|
||||
#[clap(env = "RPC_COOKIE", long)]
|
||||
rpc_cookie: Option<PathBuf>,
|
||||
/// RPC auth username
|
||||
#[clap(env = "RPC_USER", long)]
|
||||
rpc_user: Option<String>,
|
||||
/// RPC auth password
|
||||
#[clap(env = "RPC_PASS", long)]
|
||||
rpc_password: Option<String>,
|
||||
/// Starting block height to fallback to if no point of agreement if found
|
||||
#[clap(env = "FALLBACK_HEIGHT", long, default_value = "0")]
|
||||
fallback_height: u32,
|
||||
/// The unused-scripts lookahead will be kept at this size
|
||||
#[clap(long, default_value = "10")]
|
||||
lookahead: u32,
|
||||
}
|
||||
|
||||
impl From<RpcArgs> for Auth {
|
||||
fn from(args: RpcArgs) -> Self {
|
||||
match (args.rpc_cookie, args.rpc_user, args.rpc_password) {
|
||||
(None, None, None) => Self::None,
|
||||
(Some(path), _, _) => Self::CookieFile(path),
|
||||
(_, Some(user), Some(pass)) => Self::UserPass(user, pass),
|
||||
(_, Some(_), None) => panic!("rpc auth: missing rpc_pass"),
|
||||
(_, None, Some(_)) => panic!("rpc auth: missing rpc_user"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl RpcArgs {
|
||||
fn new_client(&self) -> anyhow::Result<Client> {
|
||||
Ok(Client::new(
|
||||
&self.url,
|
||||
match (&self.rpc_cookie, &self.rpc_user, &self.rpc_password) {
|
||||
(None, None, None) => Auth::None,
|
||||
(Some(path), _, _) => Auth::CookieFile(path.clone()),
|
||||
(_, Some(user), Some(pass)) => Auth::UserPass(user.clone(), pass.clone()),
|
||||
(_, Some(_), None) => panic!("rpc auth: missing rpc_pass"),
|
||||
(_, None, Some(_)) => panic!("rpc auth: missing rpc_user"),
|
||||
},
|
||||
)?)
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
enum RpcCommands {
|
||||
/// Syncs local state with remote state via RPC (starting from last point of agreement) and
|
||||
/// stores/indexes relevant transactions
|
||||
Sync {
|
||||
#[clap(flatten)]
|
||||
rpc_args: RpcArgs,
|
||||
},
|
||||
/// Sync by having the emitter logic in a separate thread
|
||||
Live {
|
||||
#[clap(flatten)]
|
||||
rpc_args: RpcArgs,
|
||||
},
|
||||
}
|
||||
|
||||
fn main() -> anyhow::Result<()> {
|
||||
let start = Instant::now();
|
||||
|
||||
let (args, keymap, index, db, init_changeset) =
|
||||
example_cli::init::<RpcCommands, RpcArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||
println!(
|
||||
"[{:>10}s] loaded initial changeset from db",
|
||||
start.elapsed().as_secs_f32()
|
||||
);
|
||||
|
||||
let graph = Mutex::new({
|
||||
let mut graph = IndexedTxGraph::new(index);
|
||||
graph.apply_changeset(init_changeset.1);
|
||||
graph
|
||||
});
|
||||
println!(
|
||||
"[{:>10}s] loaded indexed tx graph from changeset",
|
||||
start.elapsed().as_secs_f32()
|
||||
);
|
||||
|
||||
let chain = Mutex::new(LocalChain::from_changeset(init_changeset.0)?);
|
||||
println!(
|
||||
"[{:>10}s] loaded local chain from changeset",
|
||||
start.elapsed().as_secs_f32()
|
||||
);
|
||||
|
||||
let rpc_cmd = match args.command {
|
||||
example_cli::Commands::ChainSpecific(rpc_cmd) => rpc_cmd,
|
||||
general_cmd => {
|
||||
let res = example_cli::handle_commands(
|
||||
&graph,
|
||||
&db,
|
||||
&chain,
|
||||
&keymap,
|
||||
args.network,
|
||||
|rpc_args, tx| {
|
||||
let client = rpc_args.new_client()?;
|
||||
client.send_raw_transaction(tx)?;
|
||||
Ok(())
|
||||
},
|
||||
general_cmd,
|
||||
);
|
||||
db.lock().unwrap().commit()?;
|
||||
return res;
|
||||
}
|
||||
};
|
||||
|
||||
match rpc_cmd {
|
||||
RpcCommands::Sync { rpc_args } => {
|
||||
let RpcArgs {
|
||||
fallback_height,
|
||||
lookahead,
|
||||
..
|
||||
} = rpc_args;
|
||||
|
||||
graph.lock().unwrap().index.set_lookahead_for_all(lookahead);
|
||||
|
||||
let chain_tip = chain.lock().unwrap().tip();
|
||||
let rpc_client = rpc_args.new_client()?;
|
||||
let mut emitter = Emitter::new(&rpc_client, chain_tip, fallback_height);
|
||||
|
||||
let mut last_db_commit = Instant::now();
|
||||
let mut last_print = Instant::now();
|
||||
|
||||
while let Some((height, block)) = emitter.next_block()? {
|
||||
let mut chain = chain.lock().unwrap();
|
||||
let mut graph = graph.lock().unwrap();
|
||||
let mut db = db.lock().unwrap();
|
||||
|
||||
let chain_update =
|
||||
CheckPoint::from_header(&block.header, height).into_update(false);
|
||||
let chain_changeset = chain
|
||||
.apply_update(chain_update)
|
||||
.expect("must always apply as we receive blocks in order from emitter");
|
||||
let graph_changeset = graph.apply_block_relevant(block, height);
|
||||
db.stage((chain_changeset, graph_changeset));
|
||||
|
||||
// commit staged db changes in intervals
|
||||
if last_db_commit.elapsed() >= DB_COMMIT_DELAY {
|
||||
last_db_commit = Instant::now();
|
||||
db.commit()?;
|
||||
println!(
|
||||
"[{:>10}s] committed to db (took {}s)",
|
||||
start.elapsed().as_secs_f32(),
|
||||
last_db_commit.elapsed().as_secs_f32()
|
||||
);
|
||||
}
|
||||
|
||||
// print synced-to height and current balance in intervals
|
||||
if last_print.elapsed() >= STDOUT_PRINT_DELAY {
|
||||
last_print = Instant::now();
|
||||
let synced_to = chain.tip();
|
||||
let balance = {
|
||||
graph.graph().balance(
|
||||
&*chain,
|
||||
synced_to.block_id(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)
|
||||
};
|
||||
println!(
|
||||
"[{:>10}s] synced to {} @ {} | total: {} sats",
|
||||
start.elapsed().as_secs_f32(),
|
||||
synced_to.hash(),
|
||||
synced_to.height(),
|
||||
balance.total()
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
let mempool_txs = emitter.mempool()?;
|
||||
let graph_changeset = graph.lock().unwrap().batch_insert_relevant_unconfirmed(
|
||||
mempool_txs.iter().map(|(tx, time)| (tx, *time)),
|
||||
);
|
||||
{
|
||||
let mut db = db.lock().unwrap();
|
||||
db.stage((local_chain::ChangeSet::default(), graph_changeset));
|
||||
db.commit()?; // commit one last time
|
||||
}
|
||||
}
|
||||
RpcCommands::Live { rpc_args } => {
|
||||
let RpcArgs {
|
||||
fallback_height,
|
||||
lookahead,
|
||||
..
|
||||
} = rpc_args;
|
||||
let sigterm_flag = start_ctrlc_handler();
|
||||
|
||||
graph.lock().unwrap().index.set_lookahead_for_all(lookahead);
|
||||
let last_cp = chain.lock().unwrap().tip();
|
||||
|
||||
println!(
|
||||
"[{:>10}s] starting emitter thread...",
|
||||
start.elapsed().as_secs_f32()
|
||||
);
|
||||
let (tx, rx) = std::sync::mpsc::sync_channel::<Emission>(CHANNEL_BOUND);
|
||||
let emission_jh = std::thread::spawn(move || -> anyhow::Result<()> {
|
||||
let rpc_client = rpc_args.new_client()?;
|
||||
let mut emitter = Emitter::new(&rpc_client, last_cp, fallback_height);
|
||||
|
||||
let mut block_count = rpc_client.get_block_count()? as u32;
|
||||
tx.send(Emission::Tip(block_count))?;
|
||||
|
||||
loop {
|
||||
match emitter.next_block()? {
|
||||
Some((height, block)) => {
|
||||
if sigterm_flag.load(Ordering::Acquire) {
|
||||
break;
|
||||
}
|
||||
if height > block_count {
|
||||
block_count = rpc_client.get_block_count()? as u32;
|
||||
tx.send(Emission::Tip(block_count))?;
|
||||
}
|
||||
tx.send(Emission::Block { height, block })?;
|
||||
}
|
||||
None => {
|
||||
if await_flag(&sigterm_flag, MEMPOOL_EMIT_DELAY) {
|
||||
break;
|
||||
}
|
||||
println!("preparing mempool emission...");
|
||||
let now = Instant::now();
|
||||
tx.send(Emission::Mempool(emitter.mempool()?))?;
|
||||
println!("mempool emission prepared in {}s", now.elapsed().as_secs());
|
||||
continue;
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
println!("emitter thread shutting down...");
|
||||
Ok(())
|
||||
});
|
||||
|
||||
let mut tip_height = 0_u32;
|
||||
let mut last_db_commit = Instant::now();
|
||||
let mut last_print = Option::<Instant>::None;
|
||||
|
||||
for emission in rx {
|
||||
let mut db = db.lock().unwrap();
|
||||
let mut graph = graph.lock().unwrap();
|
||||
let mut chain = chain.lock().unwrap();
|
||||
|
||||
let changeset = match emission {
|
||||
Emission::Block { height, block } => {
|
||||
let chain_update =
|
||||
CheckPoint::from_header(&block.header, height).into_update(false);
|
||||
let chain_changeset = chain
|
||||
.apply_update(chain_update)
|
||||
.expect("must always apply as we receive blocks in order from emitter");
|
||||
let graph_changeset = graph.apply_block_relevant(block, height);
|
||||
(chain_changeset, graph_changeset)
|
||||
}
|
||||
Emission::Mempool(mempool_txs) => {
|
||||
let graph_changeset = graph.batch_insert_relevant_unconfirmed(
|
||||
mempool_txs.iter().map(|(tx, time)| (tx, *time)),
|
||||
);
|
||||
(local_chain::ChangeSet::default(), graph_changeset)
|
||||
}
|
||||
Emission::Tip(h) => {
|
||||
tip_height = h;
|
||||
continue;
|
||||
}
|
||||
};
|
||||
|
||||
db.stage(changeset);
|
||||
|
||||
if last_db_commit.elapsed() >= DB_COMMIT_DELAY {
|
||||
last_db_commit = Instant::now();
|
||||
db.commit()?;
|
||||
println!(
|
||||
"[{:>10}s] committed to db (took {}s)",
|
||||
start.elapsed().as_secs_f32(),
|
||||
last_db_commit.elapsed().as_secs_f32()
|
||||
);
|
||||
}
|
||||
|
||||
if last_print.map_or(Duration::MAX, |i| i.elapsed()) >= STDOUT_PRINT_DELAY {
|
||||
last_print = Some(Instant::now());
|
||||
let synced_to = chain.tip();
|
||||
let balance = {
|
||||
graph.graph().balance(
|
||||
&*chain,
|
||||
synced_to.block_id(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)
|
||||
};
|
||||
println!(
|
||||
"[{:>10}s] synced to {} @ {} / {} | total: {} sats",
|
||||
start.elapsed().as_secs_f32(),
|
||||
synced_to.hash(),
|
||||
synced_to.height(),
|
||||
tip_height,
|
||||
balance.total()
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
emission_jh.join().expect("must join emitter thread")?;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
fn start_ctrlc_handler() -> Arc<AtomicBool> {
|
||||
let flag = Arc::new(AtomicBool::new(false));
|
||||
let cloned_flag = flag.clone();
|
||||
|
||||
ctrlc::set_handler(move || cloned_flag.store(true, Ordering::Release));
|
||||
|
||||
flag
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
fn await_flag(flag: &AtomicBool, duration: Duration) -> bool {
|
||||
let start = Instant::now();
|
||||
loop {
|
||||
if flag.load(Ordering::Acquire) {
|
||||
return true;
|
||||
}
|
||||
if start.elapsed() >= duration {
|
||||
return false;
|
||||
}
|
||||
std::thread::sleep(Duration::from_secs(1));
|
||||
}
|
||||
}
|
||||
@@ -7,11 +7,12 @@ use std::{cmp::Reverse, collections::HashMap, path::PathBuf, sync::Mutex, time::
|
||||
|
||||
use bdk_chain::{
|
||||
bitcoin::{
|
||||
psbt::Prevouts, secp256k1::Secp256k1, util::sighash::SighashCache, Address, LockTime,
|
||||
absolute, address, psbt::Prevouts, secp256k1::Secp256k1, sighash::SighashCache, Address,
|
||||
Network, Sequence, Transaction, TxIn, TxOut,
|
||||
},
|
||||
indexed_tx_graph::{IndexedAdditions, IndexedTxGraph},
|
||||
keychain::{DerivationAdditions, KeychainTxOutIndex},
|
||||
indexed_tx_graph::{self, IndexedTxGraph},
|
||||
keychain::{self, KeychainTxOutIndex},
|
||||
local_chain,
|
||||
miniscript::{
|
||||
descriptor::{DescriptorSecretKey, KeyMap},
|
||||
Descriptor, DescriptorPublicKey,
|
||||
@@ -24,13 +25,16 @@ pub use clap;
|
||||
use clap::{Parser, Subcommand};
|
||||
|
||||
pub type KeychainTxGraph<A> = IndexedTxGraph<A, KeychainTxOutIndex<Keychain>>;
|
||||
pub type KeychainAdditions<A> = IndexedAdditions<A, DerivationAdditions<Keychain>>;
|
||||
pub type KeychainChangeSet<A> = (
|
||||
local_chain::ChangeSet,
|
||||
indexed_tx_graph::ChangeSet<A, keychain::ChangeSet<Keychain>>,
|
||||
);
|
||||
pub type Database<'m, C> = Persist<Store<'m, C>, C>;
|
||||
|
||||
#[derive(Parser)]
|
||||
#[clap(author, version, about, long_about = None)]
|
||||
#[clap(propagate_version = true)]
|
||||
pub struct Args<S: clap::Subcommand> {
|
||||
pub struct Args<CS: clap::Subcommand, S: clap::Args> {
|
||||
#[clap(env = "DESCRIPTOR")]
|
||||
pub descriptor: String,
|
||||
#[clap(env = "CHANGE_DESCRIPTOR")]
|
||||
@@ -46,14 +50,14 @@ pub struct Args<S: clap::Subcommand> {
|
||||
pub cp_limit: usize,
|
||||
|
||||
#[clap(subcommand)]
|
||||
pub command: Commands<S>,
|
||||
pub command: Commands<CS, S>,
|
||||
}
|
||||
|
||||
#[allow(clippy::almost_swapped)]
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
pub enum Commands<S: clap::Subcommand> {
|
||||
pub enum Commands<CS: clap::Subcommand, S: clap::Args> {
|
||||
#[clap(flatten)]
|
||||
ChainSpecific(S),
|
||||
ChainSpecific(CS),
|
||||
/// Address generation and inspection.
|
||||
Address {
|
||||
#[clap(subcommand)]
|
||||
@@ -70,9 +74,11 @@ pub enum Commands<S: clap::Subcommand> {
|
||||
/// Send coins to an address.
|
||||
Send {
|
||||
value: u64,
|
||||
address: Address,
|
||||
address: Address<address::NetworkUnchecked>,
|
||||
#[clap(short, default_value = "bnb")]
|
||||
coin_select: CoinSelectionAlgo,
|
||||
#[clap(flatten)]
|
||||
chain_specific: S,
|
||||
},
|
||||
}
|
||||
|
||||
@@ -179,216 +185,6 @@ impl core::fmt::Display for Keychain {
|
||||
}
|
||||
}
|
||||
|
||||
pub fn run_address_cmd<A, C>(
|
||||
graph: &mut KeychainTxGraph<A>,
|
||||
db: &Mutex<Database<C>>,
|
||||
network: Network,
|
||||
cmd: AddressCmd,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainAdditions<A>>,
|
||||
{
|
||||
let index = &mut graph.index;
|
||||
|
||||
match cmd {
|
||||
AddressCmd::Next | AddressCmd::New => {
|
||||
let spk_chooser = match cmd {
|
||||
AddressCmd::Next => KeychainTxOutIndex::next_unused_spk,
|
||||
AddressCmd::New => KeychainTxOutIndex::reveal_next_spk,
|
||||
_ => unreachable!("only these two variants exist in match arm"),
|
||||
};
|
||||
|
||||
let ((spk_i, spk), index_additions) = spk_chooser(index, &Keychain::External);
|
||||
let db = &mut *db.lock().unwrap();
|
||||
db.stage(C::from(KeychainAdditions::from(index_additions)));
|
||||
db.commit()?;
|
||||
let addr = Address::from_script(spk, network).context("failed to derive address")?;
|
||||
println!("[address @ {}] {}", spk_i, addr);
|
||||
Ok(())
|
||||
}
|
||||
AddressCmd::Index => {
|
||||
for (keychain, derivation_index) in index.last_revealed_indices() {
|
||||
println!("{:?}: {}", keychain, derivation_index);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
AddressCmd::List { change } => {
|
||||
let target_keychain = match change {
|
||||
true => Keychain::Internal,
|
||||
false => Keychain::External,
|
||||
};
|
||||
for (spk_i, spk) in index.revealed_spks_of_keychain(&target_keychain) {
|
||||
let address = Address::from_script(spk, network)
|
||||
.expect("should always be able to derive address");
|
||||
println!(
|
||||
"{:?} {} used:{}",
|
||||
spk_i,
|
||||
address,
|
||||
index.is_used(&(target_keychain, spk_i))
|
||||
);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn run_balance_cmd<A: Anchor, O: ChainOracle>(
|
||||
graph: &KeychainTxGraph<A>,
|
||||
chain: &O,
|
||||
) -> Result<(), O::Error> {
|
||||
fn print_balances<'a>(title_str: &'a str, items: impl IntoIterator<Item = (&'a str, u64)>) {
|
||||
println!("{}:", title_str);
|
||||
for (name, amount) in items.into_iter() {
|
||||
println!(" {:<10} {:>12} sats", name, amount)
|
||||
}
|
||||
}
|
||||
|
||||
let balance = graph.graph().try_balance(
|
||||
chain,
|
||||
chain.get_chain_tip()?.unwrap_or_default(),
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)?;
|
||||
|
||||
let confirmed_total = balance.confirmed + balance.immature;
|
||||
let unconfirmed_total = balance.untrusted_pending + balance.trusted_pending;
|
||||
|
||||
print_balances(
|
||||
"confirmed",
|
||||
[
|
||||
("total", confirmed_total),
|
||||
("spendable", balance.confirmed),
|
||||
("immature", balance.immature),
|
||||
],
|
||||
);
|
||||
print_balances(
|
||||
"unconfirmed",
|
||||
[
|
||||
("total", unconfirmed_total),
|
||||
("trusted", balance.trusted_pending),
|
||||
("untrusted", balance.untrusted_pending),
|
||||
],
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn run_txo_cmd<A: Anchor, O: ChainOracle>(
|
||||
graph: &KeychainTxGraph<A>,
|
||||
chain: &O,
|
||||
network: Network,
|
||||
cmd: TxOutCmd,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
{
|
||||
let chain_tip = chain.get_chain_tip()?.unwrap_or_default();
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
|
||||
match cmd {
|
||||
TxOutCmd::List {
|
||||
spent,
|
||||
unspent,
|
||||
confirmed,
|
||||
unconfirmed,
|
||||
} => {
|
||||
let txouts = graph
|
||||
.graph()
|
||||
.try_filter_chain_txouts(chain, chain_tip, outpoints)
|
||||
.filter(|r| match r {
|
||||
Ok((_, full_txo)) => match (spent, unspent) {
|
||||
(true, false) => full_txo.spent_by.is_some(),
|
||||
(false, true) => full_txo.spent_by.is_none(),
|
||||
_ => true,
|
||||
},
|
||||
// always keep errored items
|
||||
Err(_) => true,
|
||||
})
|
||||
.filter(|r| match r {
|
||||
Ok((_, full_txo)) => match (confirmed, unconfirmed) {
|
||||
(true, false) => full_txo.chain_position.is_confirmed(),
|
||||
(false, true) => !full_txo.chain_position.is_confirmed(),
|
||||
_ => true,
|
||||
},
|
||||
// always keep errored items
|
||||
Err(_) => true,
|
||||
})
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
for (spk_i, full_txo) in txouts {
|
||||
let addr = Address::from_script(&full_txo.txout.script_pubkey, network)?;
|
||||
println!(
|
||||
"{:?} {} {} {} spent:{:?}",
|
||||
spk_i, full_txo.txout.value, full_txo.outpoint, addr, full_txo.spent_by
|
||||
)
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::too_many_arguments)]
|
||||
pub fn run_send_cmd<A: Anchor, O: ChainOracle, C>(
|
||||
graph: &Mutex<KeychainTxGraph<A>>,
|
||||
db: &Mutex<Database<'_, C>>,
|
||||
chain: &O,
|
||||
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||
cs_algorithm: CoinSelectionAlgo,
|
||||
address: Address,
|
||||
value: u64,
|
||||
broadcast: impl FnOnce(&Transaction) -> anyhow::Result<()>,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainAdditions<A>>,
|
||||
{
|
||||
let (transaction, change_index) = {
|
||||
let graph = &mut *graph.lock().unwrap();
|
||||
// take mutable ref to construct tx -- it is only open for a short time while building it.
|
||||
let (tx, change_info) = create_tx(graph, chain, keymap, cs_algorithm, address, value)?;
|
||||
|
||||
if let Some((index_additions, (change_keychain, index))) = change_info {
|
||||
// We must first persist to disk the fact that we've got a new address from the
|
||||
// change keychain so future scans will find the tx we're about to broadcast.
|
||||
// If we're unable to persist this, then we don't want to broadcast.
|
||||
{
|
||||
let db = &mut *db.lock().unwrap();
|
||||
db.stage(C::from(KeychainAdditions::from(index_additions)));
|
||||
db.commit()?;
|
||||
}
|
||||
|
||||
// We don't want other callers/threads to use this address while we're using it
|
||||
// but we also don't want to scan the tx we just created because it's not
|
||||
// technically in the blockchain yet.
|
||||
graph.index.mark_used(&change_keychain, index);
|
||||
(tx, Some((change_keychain, index)))
|
||||
} else {
|
||||
(tx, None)
|
||||
}
|
||||
};
|
||||
|
||||
match (broadcast)(&transaction) {
|
||||
Ok(_) => {
|
||||
println!("Broadcasted Tx : {}", transaction.txid());
|
||||
|
||||
let keychain_additions = graph.lock().unwrap().insert_tx(&transaction, None, None);
|
||||
|
||||
// We know the tx is at least unconfirmed now. Note if persisting here fails,
|
||||
// it's not a big deal since we can always find it again form
|
||||
// blockchain.
|
||||
db.lock().unwrap().stage(C::from(keychain_additions));
|
||||
Ok(())
|
||||
}
|
||||
Err(e) => {
|
||||
if let Some((keychain, index)) = change_index {
|
||||
// We failed to broadcast, so allow our change address to be used in the future
|
||||
graph.lock().unwrap().index.unmark_used(&keychain, index);
|
||||
}
|
||||
Err(e)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::type_complexity)]
|
||||
pub fn create_tx<A: Anchor, O: ChainOracle>(
|
||||
graph: &mut KeychainTxGraph<A>,
|
||||
@@ -399,12 +195,12 @@ pub fn create_tx<A: Anchor, O: ChainOracle>(
|
||||
value: u64,
|
||||
) -> anyhow::Result<(
|
||||
Transaction,
|
||||
Option<(DerivationAdditions<Keychain>, (Keychain, u32))>,
|
||||
Option<(keychain::ChangeSet<Keychain>, (Keychain, u32))>,
|
||||
)>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
{
|
||||
let mut additions = DerivationAdditions::default();
|
||||
let mut changeset = keychain::ChangeSet::default();
|
||||
|
||||
let assets = bdk_tmp_plan::Assets {
|
||||
keys: keymap.iter().map(|(pk, _)| pk.clone()).collect(),
|
||||
@@ -452,12 +248,12 @@ where
|
||||
Keychain::External
|
||||
};
|
||||
|
||||
let ((change_index, change_script), change_additions) =
|
||||
let ((change_index, change_script), change_changeset) =
|
||||
graph.index.next_unused_spk(&internal_keychain);
|
||||
additions.append(change_additions);
|
||||
changeset.append(change_changeset);
|
||||
|
||||
// Clone to drop the immutable reference.
|
||||
let change_script = change_script.clone();
|
||||
let change_script = change_script.into();
|
||||
|
||||
let change_plan = bdk_tmp_plan::plan_satisfaction(
|
||||
&graph
|
||||
@@ -465,7 +261,8 @@ where
|
||||
.keychains()
|
||||
.get(&internal_keychain)
|
||||
.expect("must exist")
|
||||
.at_derivation_index(change_index),
|
||||
.at_derivation_index(change_index)
|
||||
.expect("change_index can't be hardened"),
|
||||
&assets,
|
||||
)
|
||||
.expect("failed to obtain change plan");
|
||||
@@ -518,11 +315,8 @@ where
|
||||
version: 0x02,
|
||||
// because the temporary planning module does not support timelocks, we can use the chain
|
||||
// tip as the `lock_time` for anti-fee-sniping purposes
|
||||
lock_time: chain
|
||||
.get_chain_tip()?
|
||||
.and_then(|block_id| LockTime::from_height(block_id.height).ok())
|
||||
.unwrap_or(LockTime::ZERO)
|
||||
.into(),
|
||||
lock_time: absolute::LockTime::from_height(chain.get_chain_tip()?.height)
|
||||
.expect("invalid height"),
|
||||
input: selected_txos
|
||||
.iter()
|
||||
.map(|(_, utxo)| TxIn {
|
||||
@@ -594,7 +388,7 @@ where
|
||||
}
|
||||
|
||||
let change_info = if selection_meta.drain_value.is_some() {
|
||||
Some((additions, (internal_keychain, change_index)))
|
||||
Some((changeset, (internal_keychain, change_index)))
|
||||
} else {
|
||||
None
|
||||
};
|
||||
@@ -608,7 +402,7 @@ pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDeri
|
||||
chain: &O,
|
||||
assets: &bdk_tmp_plan::Assets<K>,
|
||||
) -> Result<Vec<(bdk_tmp_plan::Plan<K>, FullTxOut<A>)>, O::Error> {
|
||||
let chain_tip = chain.get_chain_tip()?.unwrap_or_default();
|
||||
let chain_tip = chain.get_chain_tip()?;
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
graph
|
||||
.graph()
|
||||
@@ -625,7 +419,8 @@ pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDeri
|
||||
.keychains()
|
||||
.get(&k)
|
||||
.expect("keychain must exist")
|
||||
.at_derivation_index(i);
|
||||
.at_derivation_index(i)
|
||||
.expect("i can't be hardened");
|
||||
let plan = bdk_tmp_plan::plan_satisfaction(&desc, assets)?;
|
||||
Some(Ok((plan, full_txo)))
|
||||
},
|
||||
@@ -633,61 +428,229 @@ pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDeri
|
||||
.collect()
|
||||
}
|
||||
|
||||
pub fn handle_commands<S: clap::Subcommand, A: Anchor, O: ChainOracle, C>(
|
||||
pub fn handle_commands<CS: clap::Subcommand, S: clap::Args, A: Anchor, O: ChainOracle, C>(
|
||||
graph: &Mutex<KeychainTxGraph<A>>,
|
||||
db: &Mutex<Database<C>>,
|
||||
chain: &Mutex<O>,
|
||||
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||
network: Network,
|
||||
broadcast: impl FnOnce(&Transaction) -> anyhow::Result<()>,
|
||||
cmd: Commands<S>,
|
||||
broadcast: impl FnOnce(S, &Transaction) -> anyhow::Result<()>,
|
||||
cmd: Commands<CS, S>,
|
||||
) -> anyhow::Result<()>
|
||||
where
|
||||
O::Error: std::error::Error + Send + Sync + 'static,
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainAdditions<A>>,
|
||||
C: Default + Append + DeserializeOwned + Serialize + From<KeychainChangeSet<A>>,
|
||||
{
|
||||
match cmd {
|
||||
Commands::ChainSpecific(_) => unreachable!("example code should handle this!"),
|
||||
Commands::Address { addr_cmd } => {
|
||||
let graph = &mut *graph.lock().unwrap();
|
||||
run_address_cmd(graph, db, network, addr_cmd)
|
||||
let index = &mut graph.index;
|
||||
|
||||
match addr_cmd {
|
||||
AddressCmd::Next | AddressCmd::New => {
|
||||
let spk_chooser = match addr_cmd {
|
||||
AddressCmd::Next => KeychainTxOutIndex::next_unused_spk,
|
||||
AddressCmd::New => KeychainTxOutIndex::reveal_next_spk,
|
||||
_ => unreachable!("only these two variants exist in match arm"),
|
||||
};
|
||||
|
||||
let ((spk_i, spk), index_changeset) = spk_chooser(index, &Keychain::External);
|
||||
let db = &mut *db.lock().unwrap();
|
||||
db.stage(C::from((
|
||||
local_chain::ChangeSet::default(),
|
||||
indexed_tx_graph::ChangeSet::from(index_changeset),
|
||||
)));
|
||||
db.commit()?;
|
||||
let addr =
|
||||
Address::from_script(spk, network).context("failed to derive address")?;
|
||||
println!("[address @ {}] {}", spk_i, addr);
|
||||
Ok(())
|
||||
}
|
||||
AddressCmd::Index => {
|
||||
for (keychain, derivation_index) in index.last_revealed_indices() {
|
||||
println!("{:?}: {}", keychain, derivation_index);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
AddressCmd::List { change } => {
|
||||
let target_keychain = match change {
|
||||
true => Keychain::Internal,
|
||||
false => Keychain::External,
|
||||
};
|
||||
for (spk_i, spk) in index.revealed_spks_of_keychain(&target_keychain) {
|
||||
let address = Address::from_script(spk, network)
|
||||
.expect("should always be able to derive address");
|
||||
println!(
|
||||
"{:?} {} used:{}",
|
||||
spk_i,
|
||||
address,
|
||||
index.is_used(&(target_keychain, spk_i))
|
||||
);
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
Commands::Balance => {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
run_balance_cmd(graph, chain).map_err(anyhow::Error::from)
|
||||
fn print_balances<'a>(
|
||||
title_str: &'a str,
|
||||
items: impl IntoIterator<Item = (&'a str, u64)>,
|
||||
) {
|
||||
println!("{}:", title_str);
|
||||
for (name, amount) in items.into_iter() {
|
||||
println!(" {:<10} {:>12} sats", name, amount)
|
||||
}
|
||||
}
|
||||
|
||||
let balance = graph.graph().try_balance(
|
||||
chain,
|
||||
chain.get_chain_tip()?,
|
||||
graph.index.outpoints().iter().cloned(),
|
||||
|(k, _), _| k == &Keychain::Internal,
|
||||
)?;
|
||||
|
||||
let confirmed_total = balance.confirmed + balance.immature;
|
||||
let unconfirmed_total = balance.untrusted_pending + balance.trusted_pending;
|
||||
|
||||
print_balances(
|
||||
"confirmed",
|
||||
[
|
||||
("total", confirmed_total),
|
||||
("spendable", balance.confirmed),
|
||||
("immature", balance.immature),
|
||||
],
|
||||
);
|
||||
print_balances(
|
||||
"unconfirmed",
|
||||
[
|
||||
("total", unconfirmed_total),
|
||||
("trusted", balance.trusted_pending),
|
||||
("untrusted", balance.untrusted_pending),
|
||||
],
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
Commands::TxOut { txout_cmd } => {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
run_txo_cmd(graph, chain, network, txout_cmd)
|
||||
let chain_tip = chain.get_chain_tip()?;
|
||||
let outpoints = graph.index.outpoints().iter().cloned();
|
||||
|
||||
match txout_cmd {
|
||||
TxOutCmd::List {
|
||||
spent,
|
||||
unspent,
|
||||
confirmed,
|
||||
unconfirmed,
|
||||
} => {
|
||||
let txouts = graph
|
||||
.graph()
|
||||
.try_filter_chain_txouts(chain, chain_tip, outpoints)
|
||||
.filter(|r| match r {
|
||||
Ok((_, full_txo)) => match (spent, unspent) {
|
||||
(true, false) => full_txo.spent_by.is_some(),
|
||||
(false, true) => full_txo.spent_by.is_none(),
|
||||
_ => true,
|
||||
},
|
||||
// always keep errored items
|
||||
Err(_) => true,
|
||||
})
|
||||
.filter(|r| match r {
|
||||
Ok((_, full_txo)) => match (confirmed, unconfirmed) {
|
||||
(true, false) => full_txo.chain_position.is_confirmed(),
|
||||
(false, true) => !full_txo.chain_position.is_confirmed(),
|
||||
_ => true,
|
||||
},
|
||||
// always keep errored items
|
||||
Err(_) => true,
|
||||
})
|
||||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
for (spk_i, full_txo) in txouts {
|
||||
let addr = Address::from_script(&full_txo.txout.script_pubkey, network)?;
|
||||
println!(
|
||||
"{:?} {} {} {} spent:{:?}",
|
||||
spk_i, full_txo.txout.value, full_txo.outpoint, addr, full_txo.spent_by
|
||||
)
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
}
|
||||
Commands::Send {
|
||||
value,
|
||||
address,
|
||||
coin_select,
|
||||
chain_specific,
|
||||
} => {
|
||||
let chain = &*chain.lock().unwrap();
|
||||
run_send_cmd(
|
||||
graph,
|
||||
db,
|
||||
chain,
|
||||
keymap,
|
||||
coin_select,
|
||||
address,
|
||||
value,
|
||||
broadcast,
|
||||
)
|
||||
let address = address.require_network(network)?;
|
||||
let (transaction, change_index) = {
|
||||
let graph = &mut *graph.lock().unwrap();
|
||||
// take mutable ref to construct tx -- it is only open for a short time while building it.
|
||||
let (tx, change_info) =
|
||||
create_tx(graph, chain, keymap, coin_select, address, value)?;
|
||||
|
||||
if let Some((index_changeset, (change_keychain, index))) = change_info {
|
||||
// We must first persist to disk the fact that we've got a new address from the
|
||||
// change keychain so future scans will find the tx we're about to broadcast.
|
||||
// If we're unable to persist this, then we don't want to broadcast.
|
||||
{
|
||||
let db = &mut *db.lock().unwrap();
|
||||
db.stage(C::from((
|
||||
local_chain::ChangeSet::default(),
|
||||
indexed_tx_graph::ChangeSet::from(index_changeset),
|
||||
)));
|
||||
db.commit()?;
|
||||
}
|
||||
|
||||
// We don't want other callers/threads to use this address while we're using it
|
||||
// but we also don't want to scan the tx we just created because it's not
|
||||
// technically in the blockchain yet.
|
||||
graph.index.mark_used(&change_keychain, index);
|
||||
(tx, Some((change_keychain, index)))
|
||||
} else {
|
||||
(tx, None)
|
||||
}
|
||||
};
|
||||
|
||||
match (broadcast)(chain_specific, &transaction) {
|
||||
Ok(_) => {
|
||||
println!("Broadcasted Tx : {}", transaction.txid());
|
||||
|
||||
let keychain_changeset = graph.lock().unwrap().insert_tx(transaction);
|
||||
|
||||
// We know the tx is at least unconfirmed now. Note if persisting here fails,
|
||||
// it's not a big deal since we can always find it again form
|
||||
// blockchain.
|
||||
db.lock().unwrap().stage(C::from((
|
||||
local_chain::ChangeSet::default(),
|
||||
keychain_changeset,
|
||||
)));
|
||||
Ok(())
|
||||
}
|
||||
Err(e) => {
|
||||
if let Some((keychain, index)) = change_index {
|
||||
// We failed to broadcast, so allow our change address to be used in the future
|
||||
graph.lock().unwrap().index.unmark_used(&keychain, index);
|
||||
}
|
||||
Err(e)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::type_complexity)]
|
||||
pub fn init<'m, S: clap::Subcommand, C>(
|
||||
pub fn init<'m, CS: clap::Subcommand, S: clap::Args, C>(
|
||||
db_magic: &'m [u8],
|
||||
db_default_path: &str,
|
||||
) -> anyhow::Result<(
|
||||
Args<S>,
|
||||
Args<CS, S>,
|
||||
KeyMap,
|
||||
KeychainTxOutIndex<Keychain>,
|
||||
Mutex<Database<'m, C>>,
|
||||
@@ -699,7 +662,7 @@ where
|
||||
if std::env::var("BDK_DB_PATH").is_err() {
|
||||
std::env::set_var("BDK_DB_PATH", db_default_path);
|
||||
}
|
||||
let args = Args::<S>::parse();
|
||||
let args = Args::<CS, S>::parse();
|
||||
let secp = Secp256k1::default();
|
||||
|
||||
let mut index = KeychainTxOutIndex::<Keychain>::default();
|
||||
@@ -718,13 +681,13 @@ where
|
||||
index.add_keychain(Keychain::Internal, internal_descriptor);
|
||||
}
|
||||
|
||||
let mut db_backend = match Store::<'m, C>::new_from_path(db_magic, &args.db_path) {
|
||||
let mut db_backend = match Store::<'m, C>::open_or_create_new(db_magic, &args.db_path) {
|
||||
Ok(db_backend) => db_backend,
|
||||
// we cannot return `err` directly as it has lifetime `'m`
|
||||
Err(err) => return Err(anyhow::anyhow!("failed to init db backend: {:?}", err)),
|
||||
};
|
||||
|
||||
let init_changeset = db_backend.load_from_persistence()?;
|
||||
let init_changeset = db_backend.load_from_persistence()?.unwrap_or_default();
|
||||
|
||||
Ok((
|
||||
args,
|
||||
|
||||
@@ -5,14 +5,14 @@ use std::{
|
||||
};
|
||||
|
||||
use bdk_chain::{
|
||||
bitcoin::{Address, BlockHash, Network, OutPoint, Txid},
|
||||
indexed_tx_graph::{IndexedAdditions, IndexedTxGraph},
|
||||
keychain::LocalChangeSet,
|
||||
local_chain::LocalChain,
|
||||
bitcoin::{Address, Network, OutPoint, ScriptBuf, Txid},
|
||||
indexed_tx_graph::{self, IndexedTxGraph},
|
||||
keychain,
|
||||
local_chain::{self, LocalChain},
|
||||
Append, ConfirmationHeightAnchor,
|
||||
};
|
||||
use bdk_electrum::{
|
||||
electrum_client::{self, ElectrumApi},
|
||||
electrum_client::{self, Client, ElectrumApi},
|
||||
ElectrumExt, ElectrumUpdate,
|
||||
};
|
||||
use example_cli::{
|
||||
@@ -22,8 +22,7 @@ use example_cli::{
|
||||
};
|
||||
|
||||
const DB_MAGIC: &[u8] = b"bdk_example_electrum";
|
||||
const DB_PATH: &str = ".bdk_electrum_example.db";
|
||||
const ASSUME_FINAL_DEPTH: usize = 10;
|
||||
const DB_PATH: &str = ".bdk_example_electrum.db";
|
||||
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
enum ElectrumCommands {
|
||||
@@ -34,6 +33,8 @@ enum ElectrumCommands {
|
||||
stop_gap: usize,
|
||||
#[clap(flatten)]
|
||||
scan_options: ScanOptions,
|
||||
#[clap(flatten)]
|
||||
electrum_args: ElectrumArgs,
|
||||
},
|
||||
/// Scans particular addresses using the electrum API.
|
||||
Sync {
|
||||
@@ -51,9 +52,44 @@ enum ElectrumCommands {
|
||||
unconfirmed: bool,
|
||||
#[clap(flatten)]
|
||||
scan_options: ScanOptions,
|
||||
#[clap(flatten)]
|
||||
electrum_args: ElectrumArgs,
|
||||
},
|
||||
}
|
||||
|
||||
impl ElectrumCommands {
|
||||
fn electrum_args(&self) -> ElectrumArgs {
|
||||
match self {
|
||||
ElectrumCommands::Scan { electrum_args, .. } => electrum_args.clone(),
|
||||
ElectrumCommands::Sync { electrum_args, .. } => electrum_args.clone(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(clap::Args, Debug, Clone)]
|
||||
pub struct ElectrumArgs {
|
||||
/// The electrum url to use to connect to. If not provided it will use a default electrum server
|
||||
/// for your chosen network.
|
||||
electrum_url: Option<String>,
|
||||
}
|
||||
|
||||
impl ElectrumArgs {
|
||||
pub fn client(&self, network: Network) -> anyhow::Result<Client> {
|
||||
let electrum_url = self.electrum_url.as_deref().unwrap_or(match network {
|
||||
Network::Bitcoin => "ssl://electrum.blockstream.info:50002",
|
||||
Network::Testnet => "ssl://electrum.blockstream.info:60002",
|
||||
Network::Regtest => "tcp://localhost:60401",
|
||||
Network::Signet => "tcp://signet-electrumx.wakiyamap.dev:50001",
|
||||
_ => panic!("Unknown network"),
|
||||
});
|
||||
let config = electrum_client::Config::builder()
|
||||
.validate_domain(matches!(network, Network::Bitcoin))
|
||||
.build();
|
||||
|
||||
Ok(electrum_client::Client::from_config(electrum_url, config)?)
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Parser, Debug, Clone, PartialEq)]
|
||||
pub struct ScanOptions {
|
||||
/// Set batch size for each script_history call to electrum client.
|
||||
@@ -61,35 +97,22 @@ pub struct ScanOptions {
|
||||
pub batch_size: usize,
|
||||
}
|
||||
|
||||
type ChangeSet = LocalChangeSet<Keychain, ConfirmationHeightAnchor>;
|
||||
type ChangeSet = (
|
||||
local_chain::ChangeSet,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||
);
|
||||
|
||||
fn main() -> anyhow::Result<()> {
|
||||
let (args, keymap, index, db, init_changeset) =
|
||||
example_cli::init::<ElectrumCommands, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||
let (args, keymap, index, db, (disk_local_chain, disk_tx_graph)) =
|
||||
example_cli::init::<ElectrumCommands, ElectrumArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||
|
||||
let graph = Mutex::new({
|
||||
let mut graph = IndexedTxGraph::new(index);
|
||||
graph.apply_additions(init_changeset.indexed_additions);
|
||||
graph.apply_changeset(disk_tx_graph);
|
||||
graph
|
||||
});
|
||||
|
||||
let chain = Mutex::new({
|
||||
let mut chain = LocalChain::default();
|
||||
chain.apply_changeset(init_changeset.chain_changeset);
|
||||
chain
|
||||
});
|
||||
|
||||
let electrum_url = match args.network {
|
||||
Network::Bitcoin => "ssl://electrum.blockstream.info:50002",
|
||||
Network::Testnet => "ssl://electrum.blockstream.info:60002",
|
||||
Network::Regtest => "tcp://localhost:60401",
|
||||
Network::Signet => "tcp://signet-electrumx.wakiyamap.dev:50001",
|
||||
};
|
||||
let config = electrum_client::Config::builder()
|
||||
.validate_domain(matches!(args.network, Network::Bitcoin))
|
||||
.build();
|
||||
|
||||
let client = electrum_client::Client::from_config(electrum_url, config)?;
|
||||
let chain = Mutex::new(LocalChain::from_changeset(disk_local_chain)?);
|
||||
|
||||
let electrum_cmd = match &args.command {
|
||||
example_cli::Commands::ChainSpecific(electrum_cmd) => electrum_cmd,
|
||||
@@ -100,11 +123,10 @@ fn main() -> anyhow::Result<()> {
|
||||
&chain,
|
||||
&keymap,
|
||||
args.network,
|
||||
|tx| {
|
||||
client
|
||||
.transaction_broadcast(tx)
|
||||
.map(|_| ())
|
||||
.map_err(anyhow::Error::from)
|
||||
|electrum_args, tx| {
|
||||
let client = electrum_args.client(args.network)?;
|
||||
client.transaction_broadcast(tx)?;
|
||||
Ok(())
|
||||
},
|
||||
general_cmd.clone(),
|
||||
);
|
||||
@@ -114,12 +136,15 @@ fn main() -> anyhow::Result<()> {
|
||||
}
|
||||
};
|
||||
|
||||
let client = electrum_cmd.electrum_args().client(args.network)?;
|
||||
|
||||
let response = match electrum_cmd.clone() {
|
||||
ElectrumCommands::Scan {
|
||||
stop_gap,
|
||||
scan_options,
|
||||
..
|
||||
} => {
|
||||
let (keychain_spks, local_chain) = {
|
||||
let (keychain_spks, tip) = {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
let chain = &*chain.lock().unwrap();
|
||||
|
||||
@@ -142,20 +167,13 @@ fn main() -> anyhow::Result<()> {
|
||||
})
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
|
||||
let c = chain
|
||||
.blocks()
|
||||
.iter()
|
||||
.rev()
|
||||
.take(ASSUME_FINAL_DEPTH)
|
||||
.map(|(k, v)| (*k, *v))
|
||||
.collect::<BTreeMap<u32, BlockHash>>();
|
||||
|
||||
(keychain_spks, c)
|
||||
let tip = chain.tip();
|
||||
(keychain_spks, tip)
|
||||
};
|
||||
|
||||
client
|
||||
.scan(
|
||||
&local_chain,
|
||||
tip,
|
||||
keychain_spks,
|
||||
core::iter::empty(),
|
||||
core::iter::empty(),
|
||||
@@ -170,11 +188,12 @@ fn main() -> anyhow::Result<()> {
|
||||
mut utxos,
|
||||
mut unconfirmed,
|
||||
scan_options,
|
||||
..
|
||||
} => {
|
||||
// Get a short lock on the tracker to get the spks we're interested in
|
||||
let graph = graph.lock().unwrap();
|
||||
let chain = chain.lock().unwrap();
|
||||
let chain_tip = chain.tip().unwrap_or_default();
|
||||
let chain_tip = chain.tip().block_id();
|
||||
|
||||
if !(all_spks || unused_spks || utxos || unconfirmed) {
|
||||
unused_spks = true;
|
||||
@@ -184,7 +203,7 @@ fn main() -> anyhow::Result<()> {
|
||||
unused_spks = false;
|
||||
}
|
||||
|
||||
let mut spks: Box<dyn Iterator<Item = bdk_chain::bitcoin::Script>> =
|
||||
let mut spks: Box<dyn Iterator<Item = bdk_chain::bitcoin::ScriptBuf>> =
|
||||
Box::new(core::iter::empty());
|
||||
if all_spks {
|
||||
let all_spks = graph
|
||||
@@ -202,7 +221,7 @@ fn main() -> anyhow::Result<()> {
|
||||
let unused_spks = graph
|
||||
.index
|
||||
.unused_spks(..)
|
||||
.map(|(k, v)| (*k, v.clone()))
|
||||
.map(|(k, v)| (*k, ScriptBuf::from(v)))
|
||||
.collect::<Vec<_>>();
|
||||
spks = Box::new(spks.chain(unused_spks.into_iter().map(|(index, script)| {
|
||||
eprintln!(
|
||||
@@ -245,8 +264,8 @@ fn main() -> anyhow::Result<()> {
|
||||
let unconfirmed_txids = graph
|
||||
.graph()
|
||||
.list_chain_txs(&*chain, chain_tip)
|
||||
.filter(|canonical_tx| !canonical_tx.observed_as.is_confirmed())
|
||||
.map(|canonical_tx| canonical_tx.node.txid)
|
||||
.filter(|canonical_tx| !canonical_tx.chain_position.is_confirmed())
|
||||
.map(|canonical_tx| canonical_tx.tx_node.txid)
|
||||
.collect::<Vec<Txid>>();
|
||||
|
||||
txids = Box::new(unconfirmed_txids.into_iter().inspect(|txid| {
|
||||
@@ -254,31 +273,29 @@ fn main() -> anyhow::Result<()> {
|
||||
}));
|
||||
}
|
||||
|
||||
let c = chain
|
||||
.blocks()
|
||||
.iter()
|
||||
.rev()
|
||||
.take(ASSUME_FINAL_DEPTH)
|
||||
.map(|(k, v)| (*k, *v))
|
||||
.collect::<BTreeMap<u32, BlockHash>>();
|
||||
let tip = chain.tip();
|
||||
|
||||
// drop lock on graph and chain
|
||||
drop((graph, chain));
|
||||
|
||||
let update = client
|
||||
.scan_without_keychain(&c, spks, txids, outpoints, scan_options.batch_size)
|
||||
let electrum_update = client
|
||||
.scan_without_keychain(tip, spks, txids, outpoints, scan_options.batch_size)
|
||||
.context("scanning the blockchain")?;
|
||||
ElectrumUpdate {
|
||||
graph_update: update.graph_update,
|
||||
chain_update: update.chain_update,
|
||||
keychain_update: BTreeMap::new(),
|
||||
}
|
||||
(electrum_update, BTreeMap::new())
|
||||
}
|
||||
};
|
||||
|
||||
let (
|
||||
ElectrumUpdate {
|
||||
chain_update,
|
||||
relevant_txids,
|
||||
},
|
||||
keychain_update,
|
||||
) = response;
|
||||
|
||||
let missing_txids = {
|
||||
let graph = &*graph.lock().unwrap();
|
||||
response.missing_full_txs(graph.graph())
|
||||
relevant_txids.missing_full_txs(graph.graph())
|
||||
};
|
||||
|
||||
let now = std::time::UNIX_EPOCH
|
||||
@@ -286,29 +303,27 @@ fn main() -> anyhow::Result<()> {
|
||||
.expect("must get time")
|
||||
.as_secs();
|
||||
|
||||
let final_update = response.finalize(&client, Some(now), missing_txids)?;
|
||||
let graph_update = relevant_txids.into_tx_graph(&client, Some(now), missing_txids)?;
|
||||
|
||||
let db_changeset = {
|
||||
let mut chain = chain.lock().unwrap();
|
||||
let mut graph = graph.lock().unwrap();
|
||||
|
||||
let chain_changeset = chain.apply_update(final_update.chain)?;
|
||||
let chain = chain.apply_update(chain_update)?;
|
||||
|
||||
let indexed_additions = {
|
||||
let mut additions = IndexedAdditions::<ConfirmationHeightAnchor, _>::default();
|
||||
let (_, index_additions) = graph.index.reveal_to_target_multi(&final_update.keychain);
|
||||
additions.append(IndexedAdditions {
|
||||
index_additions,
|
||||
let indexed_tx_graph = {
|
||||
let mut changeset =
|
||||
indexed_tx_graph::ChangeSet::<ConfirmationHeightAnchor, _>::default();
|
||||
let (_, indexer) = graph.index.reveal_to_target_multi(&keychain_update);
|
||||
changeset.append(indexed_tx_graph::ChangeSet {
|
||||
indexer,
|
||||
..Default::default()
|
||||
});
|
||||
additions.append(graph.apply_update(final_update.graph));
|
||||
additions
|
||||
changeset.append(graph.apply_update(graph_update));
|
||||
changeset
|
||||
};
|
||||
|
||||
ChangeSet {
|
||||
indexed_additions,
|
||||
chain_changeset,
|
||||
}
|
||||
(chain, indexed_tx_graph)
|
||||
};
|
||||
|
||||
let mut db = db.lock().unwrap();
|
||||
|
||||
12
example-crates/example_esplora/Cargo.toml
Normal file
12
example-crates/example_esplora/Cargo.toml
Normal file
@@ -0,0 +1,12 @@
|
||||
[package]
|
||||
name = "example_esplora"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["blocking"] }
|
||||
example_cli = { path = "../example_cli" }
|
||||
|
||||
354
example-crates/example_esplora/src/main.rs
Normal file
354
example-crates/example_esplora/src/main.rs
Normal file
@@ -0,0 +1,354 @@
|
||||
use std::{
|
||||
collections::{BTreeMap, BTreeSet},
|
||||
io::{self, Write},
|
||||
sync::Mutex,
|
||||
};
|
||||
|
||||
use bdk_chain::{
|
||||
bitcoin::{constants::genesis_block, Address, Network, OutPoint, ScriptBuf, Txid},
|
||||
indexed_tx_graph::{self, IndexedTxGraph},
|
||||
keychain,
|
||||
local_chain::{self, LocalChain},
|
||||
Append, ConfirmationTimeHeightAnchor,
|
||||
};
|
||||
|
||||
use bdk_esplora::{esplora_client, EsploraExt};
|
||||
|
||||
use example_cli::{
|
||||
anyhow::{self, Context},
|
||||
clap::{self, Parser, Subcommand},
|
||||
Keychain,
|
||||
};
|
||||
|
||||
const DB_MAGIC: &[u8] = b"bdk_example_esplora";
|
||||
const DB_PATH: &str = ".bdk_esplora_example.db";
|
||||
|
||||
type ChangeSet = (
|
||||
local_chain::ChangeSet,
|
||||
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||
);
|
||||
|
||||
#[derive(Subcommand, Debug, Clone)]
|
||||
enum EsploraCommands {
|
||||
/// Scans the addresses in the wallet using the esplora API.
|
||||
Scan {
|
||||
/// When a gap this large has been found for a keychain, it will stop.
|
||||
#[clap(long, default_value = "5")]
|
||||
stop_gap: usize,
|
||||
#[clap(flatten)]
|
||||
scan_options: ScanOptions,
|
||||
#[clap(flatten)]
|
||||
esplora_args: EsploraArgs,
|
||||
},
|
||||
/// Scan for particular addresses and unconfirmed transactions using the esplora API.
|
||||
Sync {
|
||||
/// Scan all the unused addresses.
|
||||
#[clap(long)]
|
||||
unused_spks: bool,
|
||||
/// Scan every address that you have derived.
|
||||
#[clap(long)]
|
||||
all_spks: bool,
|
||||
/// Scan unspent outpoints for spends or changes to confirmation status of residing tx.
|
||||
#[clap(long)]
|
||||
utxos: bool,
|
||||
/// Scan unconfirmed transactions for updates.
|
||||
#[clap(long)]
|
||||
unconfirmed: bool,
|
||||
#[clap(flatten)]
|
||||
scan_options: ScanOptions,
|
||||
#[clap(flatten)]
|
||||
esplora_args: EsploraArgs,
|
||||
},
|
||||
}
|
||||
impl EsploraCommands {
|
||||
fn esplora_args(&self) -> EsploraArgs {
|
||||
match self {
|
||||
EsploraCommands::Scan { esplora_args, .. } => esplora_args.clone(),
|
||||
EsploraCommands::Sync { esplora_args, .. } => esplora_args.clone(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(clap::Args, Debug, Clone)]
|
||||
pub struct EsploraArgs {
|
||||
/// The esplora url endpoint to connect to e.g. `<https://blockstream.info/api>`
|
||||
/// If not provided it'll be set to a default for the network provided
|
||||
esplora_url: Option<String>,
|
||||
}
|
||||
|
||||
impl EsploraArgs {
|
||||
pub fn client(&self, network: Network) -> anyhow::Result<esplora_client::BlockingClient> {
|
||||
let esplora_url = self.esplora_url.as_deref().unwrap_or(match network {
|
||||
Network::Bitcoin => "https://blockstream.info/api",
|
||||
Network::Testnet => "https://blockstream.info/testnet/api",
|
||||
Network::Regtest => "http://localhost:3002",
|
||||
Network::Signet => "https://mempool.space/signet/api",
|
||||
_ => panic!("unsupported network"),
|
||||
});
|
||||
|
||||
let client = esplora_client::Builder::new(esplora_url).build_blocking()?;
|
||||
Ok(client)
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Parser, Debug, Clone, PartialEq)]
|
||||
pub struct ScanOptions {
|
||||
/// Max number of concurrent esplora server requests.
|
||||
#[clap(long, default_value = "1")]
|
||||
pub parallel_requests: usize,
|
||||
}
|
||||
|
||||
fn main() -> anyhow::Result<()> {
|
||||
let (args, keymap, index, db, init_changeset) =
|
||||
example_cli::init::<EsploraCommands, EsploraArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||
|
||||
let genesis_hash = genesis_block(args.network).block_hash();
|
||||
|
||||
let (init_chain_changeset, init_indexed_tx_graph_changeset) = init_changeset;
|
||||
|
||||
// Construct `IndexedTxGraph` and `LocalChain` with our initial changeset. They are wrapped in
|
||||
// `Mutex` to display how they can be used in a multithreaded context. Technically the mutexes
|
||||
// aren't strictly needed here.
|
||||
let graph = Mutex::new({
|
||||
let mut graph = IndexedTxGraph::new(index);
|
||||
graph.apply_changeset(init_indexed_tx_graph_changeset);
|
||||
graph
|
||||
});
|
||||
let chain = Mutex::new({
|
||||
let (mut chain, _) = LocalChain::from_genesis_hash(genesis_hash);
|
||||
chain.apply_changeset(&init_chain_changeset)?;
|
||||
chain
|
||||
});
|
||||
|
||||
let esplora_cmd = match &args.command {
|
||||
// These are commands that are handled by this example (sync, scan).
|
||||
example_cli::Commands::ChainSpecific(esplora_cmd) => esplora_cmd,
|
||||
// These are general commands handled by example_cli. Execute the cmd and return.
|
||||
general_cmd => {
|
||||
let res = example_cli::handle_commands(
|
||||
&graph,
|
||||
&db,
|
||||
&chain,
|
||||
&keymap,
|
||||
args.network,
|
||||
|esplora_args, tx| {
|
||||
let client = esplora_args.client(args.network)?;
|
||||
client
|
||||
.broadcast(tx)
|
||||
.map(|_| ())
|
||||
.map_err(anyhow::Error::from)
|
||||
},
|
||||
general_cmd.clone(),
|
||||
);
|
||||
|
||||
db.lock().unwrap().commit()?;
|
||||
return res;
|
||||
}
|
||||
};
|
||||
|
||||
let client = esplora_cmd.esplora_args().client(args.network)?;
|
||||
// Prepare the `IndexedTxGraph` update based on whether we are scanning or syncing.
|
||||
// Scanning: We are iterating through spks of all keychains and scanning for transactions for
|
||||
// each spk. We start with the lowest derivation index spk and stop scanning after `stop_gap`
|
||||
// number of consecutive spks have no transaction history. A Scan is done in situations of
|
||||
// wallet restoration. It is a special case. Applications should use "sync" style updates
|
||||
// after an initial scan.
|
||||
// Syncing: We only check for specified spks, utxos and txids to update their confirmation
|
||||
// status or fetch missing transactions.
|
||||
let indexed_tx_graph_changeset = match &esplora_cmd {
|
||||
EsploraCommands::Scan {
|
||||
stop_gap,
|
||||
scan_options,
|
||||
..
|
||||
} => {
|
||||
let keychain_spks = graph
|
||||
.lock()
|
||||
.expect("mutex must not be poisoned")
|
||||
.index
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
// This `map` is purely for logging.
|
||||
.map(|(keychain, iter)| {
|
||||
let mut first = true;
|
||||
let spk_iter = iter.inspect(move |(i, _)| {
|
||||
if first {
|
||||
eprint!("\nscanning {}: ", keychain);
|
||||
first = false;
|
||||
}
|
||||
eprint!("{} ", i);
|
||||
// Flush early to ensure we print at every iteration.
|
||||
let _ = io::stderr().flush();
|
||||
});
|
||||
(keychain, spk_iter)
|
||||
})
|
||||
.collect::<BTreeMap<_, _>>();
|
||||
|
||||
// The client scans keychain spks for transaction histories, stopping after `stop_gap`
|
||||
// is reached. It returns a `TxGraph` update (`graph_update`) and a structure that
|
||||
// represents the last active spk derivation indices of keychains
|
||||
// (`keychain_indices_update`).
|
||||
let (graph_update, last_active_indices) = client
|
||||
.scan_txs_with_keychains(
|
||||
keychain_spks,
|
||||
core::iter::empty(),
|
||||
core::iter::empty(),
|
||||
*stop_gap,
|
||||
scan_options.parallel_requests,
|
||||
)
|
||||
.context("scanning for transactions")?;
|
||||
|
||||
let mut graph = graph.lock().expect("mutex must not be poisoned");
|
||||
// Because we did a stop gap based scan we are likely to have some updates to our
|
||||
// deriviation indices. Usually before a scan you are on a fresh wallet with no
|
||||
// addresses derived so we need to derive up to last active addresses the scan found
|
||||
// before adding the transactions.
|
||||
let (_, index_changeset) = graph.index.reveal_to_target_multi(&last_active_indices);
|
||||
let mut indexed_tx_graph_changeset = graph.apply_update(graph_update);
|
||||
indexed_tx_graph_changeset.append(index_changeset.into());
|
||||
indexed_tx_graph_changeset
|
||||
}
|
||||
EsploraCommands::Sync {
|
||||
mut unused_spks,
|
||||
all_spks,
|
||||
mut utxos,
|
||||
mut unconfirmed,
|
||||
scan_options,
|
||||
..
|
||||
} => {
|
||||
if !(*all_spks || unused_spks || utxos || unconfirmed) {
|
||||
// If nothing is specifically selected, we select everything (except all spks).
|
||||
unused_spks = true;
|
||||
unconfirmed = true;
|
||||
utxos = true;
|
||||
} else if *all_spks {
|
||||
// If all spks is selected, we don't need to also select unused spks (as unused spks
|
||||
// is a subset of all spks).
|
||||
unused_spks = false;
|
||||
}
|
||||
|
||||
// Spks, outpoints and txids we want updates on will be accumulated here.
|
||||
let mut spks: Box<dyn Iterator<Item = ScriptBuf>> = Box::new(core::iter::empty());
|
||||
let mut outpoints: Box<dyn Iterator<Item = OutPoint>> = Box::new(core::iter::empty());
|
||||
let mut txids: Box<dyn Iterator<Item = Txid>> = Box::new(core::iter::empty());
|
||||
|
||||
// Get a short lock on the structures to get spks, utxos, and txs that we are interested
|
||||
// in.
|
||||
{
|
||||
let graph = graph.lock().unwrap();
|
||||
let chain = chain.lock().unwrap();
|
||||
let chain_tip = chain.tip().block_id();
|
||||
|
||||
if *all_spks {
|
||||
let all_spks = graph
|
||||
.index
|
||||
.all_spks()
|
||||
.iter()
|
||||
.map(|(k, v)| (*k, v.clone()))
|
||||
.collect::<Vec<_>>();
|
||||
spks = Box::new(spks.chain(all_spks.into_iter().map(|(index, script)| {
|
||||
eprintln!("scanning {:?}", index);
|
||||
// Flush early to ensure we print at every iteration.
|
||||
let _ = io::stderr().flush();
|
||||
script
|
||||
})));
|
||||
}
|
||||
if unused_spks {
|
||||
let unused_spks = graph
|
||||
.index
|
||||
.unused_spks(..)
|
||||
.map(|(k, v)| (*k, v.to_owned()))
|
||||
.collect::<Vec<_>>();
|
||||
spks = Box::new(spks.chain(unused_spks.into_iter().map(|(index, script)| {
|
||||
eprintln!(
|
||||
"Checking if address {} {:?} has been used",
|
||||
Address::from_script(&script, args.network).unwrap(),
|
||||
index
|
||||
);
|
||||
// Flush early to ensure we print at every iteration.
|
||||
let _ = io::stderr().flush();
|
||||
script
|
||||
})));
|
||||
}
|
||||
if utxos {
|
||||
// We want to search for whether the UTXO is spent, and spent by which
|
||||
// transaction. We provide the outpoint of the UTXO to
|
||||
// `EsploraExt::update_tx_graph_without_keychain`.
|
||||
let init_outpoints = graph.index.outpoints().iter().cloned();
|
||||
let utxos = graph
|
||||
.graph()
|
||||
.filter_chain_unspents(&*chain, chain_tip, init_outpoints)
|
||||
.map(|(_, utxo)| utxo)
|
||||
.collect::<Vec<_>>();
|
||||
outpoints = Box::new(
|
||||
utxos
|
||||
.into_iter()
|
||||
.inspect(|utxo| {
|
||||
eprintln!(
|
||||
"Checking if outpoint {} (value: {}) has been spent",
|
||||
utxo.outpoint, utxo.txout.value
|
||||
);
|
||||
// Flush early to ensure we print at every iteration.
|
||||
let _ = io::stderr().flush();
|
||||
})
|
||||
.map(|utxo| utxo.outpoint),
|
||||
);
|
||||
};
|
||||
if unconfirmed {
|
||||
// We want to search for whether the unconfirmed transaction is now confirmed.
|
||||
// We provide the unconfirmed txids to
|
||||
// `EsploraExt::update_tx_graph_without_keychain`.
|
||||
let unconfirmed_txids = graph
|
||||
.graph()
|
||||
.list_chain_txs(&*chain, chain_tip)
|
||||
.filter(|canonical_tx| !canonical_tx.chain_position.is_confirmed())
|
||||
.map(|canonical_tx| canonical_tx.tx_node.txid)
|
||||
.collect::<Vec<Txid>>();
|
||||
txids = Box::new(unconfirmed_txids.into_iter().inspect(|txid| {
|
||||
eprintln!("Checking if {} is confirmed yet", txid);
|
||||
// Flush early to ensure we print at every iteration.
|
||||
let _ = io::stderr().flush();
|
||||
}));
|
||||
}
|
||||
}
|
||||
|
||||
let graph_update =
|
||||
client.scan_txs(spks, txids, outpoints, scan_options.parallel_requests)?;
|
||||
|
||||
graph.lock().unwrap().apply_update(graph_update)
|
||||
}
|
||||
};
|
||||
|
||||
println!();
|
||||
|
||||
// Now that we're done updating the `IndexedTxGraph`, it's time to update the `LocalChain`! We
|
||||
// want the `LocalChain` to have data about all the anchors in the `TxGraph` - for this reason,
|
||||
// we want retrieve the blocks at the heights of the newly added anchors that are missing from
|
||||
// our view of the chain.
|
||||
let (missing_block_heights, tip) = {
|
||||
let chain = &*chain.lock().unwrap();
|
||||
let missing_block_heights = indexed_tx_graph_changeset
|
||||
.graph
|
||||
.missing_heights_from(chain)
|
||||
.collect::<BTreeSet<_>>();
|
||||
let tip = chain.tip();
|
||||
(missing_block_heights, tip)
|
||||
};
|
||||
|
||||
println!("prev tip: {}", tip.height());
|
||||
println!("missing block heights: {:?}", missing_block_heights);
|
||||
|
||||
// Here, we actually fetch the missing blocks and create a `local_chain::Update`.
|
||||
let chain_changeset = {
|
||||
let chain_update = client
|
||||
.update_local_chain(tip, missing_block_heights)
|
||||
.context("scanning for blocks")?;
|
||||
println!("new tip: {}", chain_update.tip.height());
|
||||
chain.lock().unwrap().apply_update(chain_update)?
|
||||
};
|
||||
|
||||
// We persist the changes
|
||||
let mut db = db.lock().unwrap();
|
||||
db.stage((chain_changeset, indexed_tx_graph_changeset));
|
||||
db.commit()?;
|
||||
Ok(())
|
||||
}
|
||||
@@ -7,3 +7,4 @@ edition = "2021"
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_electrum = { path = "../../crates/electrum" }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
anyhow = "1"
|
||||
|
||||
@@ -7,26 +7,29 @@ use std::io::Write;
|
||||
use std::str::FromStr;
|
||||
|
||||
use bdk::bitcoin::Address;
|
||||
use bdk::wallet::Update;
|
||||
use bdk::SignOptions;
|
||||
use bdk::{bitcoin::Network, Wallet};
|
||||
use bdk_electrum::electrum_client::{self, ElectrumApi};
|
||||
use bdk_electrum::ElectrumExt;
|
||||
use bdk_electrum::{
|
||||
electrum_client::{self, ElectrumApi},
|
||||
ElectrumExt, ElectrumUpdate,
|
||||
};
|
||||
use bdk_file_store::Store;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
fn main() -> Result<(), anyhow::Error> {
|
||||
let db_path = std::env::temp_dir().join("bdk-electrum-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/1/*)";
|
||||
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
let mut wallet = Wallet::new_or_load(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(bdk::wallet::AddressIndex::New);
|
||||
let address = wallet.try_get_address(bdk::wallet::AddressIndex::New)?;
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
@@ -35,7 +38,7 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
print!("Syncing...");
|
||||
let client = electrum_client::Client::new("ssl://electrum.blockstream.info:60002")?;
|
||||
|
||||
let local_chain = wallet.checkpoints();
|
||||
let prev_tip = wallet.latest_checkpoint();
|
||||
let keychain_spks = wallet
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
@@ -52,15 +55,25 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
})
|
||||
.collect();
|
||||
|
||||
let electrum_update =
|
||||
client.scan(local_chain, keychain_spks, None, None, STOP_GAP, BATCH_SIZE)?;
|
||||
let (
|
||||
ElectrumUpdate {
|
||||
chain_update,
|
||||
relevant_txids,
|
||||
},
|
||||
keychain_update,
|
||||
) = client.scan(prev_tip, keychain_spks, None, None, STOP_GAP, BATCH_SIZE)?;
|
||||
|
||||
println!();
|
||||
|
||||
let missing = electrum_update.missing_full_txs(wallet.as_ref());
|
||||
let update = electrum_update.finalize_as_confirmation_time(&client, None, missing)?;
|
||||
let missing = relevant_txids.missing_full_txs(wallet.as_ref());
|
||||
let graph_update = relevant_txids.into_confirmation_time_tx_graph(&client, None, missing)?;
|
||||
|
||||
wallet.apply_update(update)?;
|
||||
let wallet_update = Update {
|
||||
last_active_indices: keychain_update,
|
||||
graph: graph_update,
|
||||
chain: Some(chain_update),
|
||||
};
|
||||
wallet.apply_update(wallet_update)?;
|
||||
wallet.commit()?;
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
@@ -74,14 +87,15 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?;
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?
|
||||
.require_network(Network::Testnet)?;
|
||||
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
tx_builder
|
||||
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||
.enable_rbf();
|
||||
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
let mut psbt = tx_builder.finish()?;
|
||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized);
|
||||
|
||||
|
||||
@@ -10,3 +10,4 @@ bdk = { path = "../../crates/bdk" }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["async-https"] }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||
anyhow = "1"
|
||||
|
||||
@@ -2,7 +2,7 @@ use std::{io::Write, str::FromStr};
|
||||
|
||||
use bdk::{
|
||||
bitcoin::{Address, Network},
|
||||
wallet::AddressIndex,
|
||||
wallet::{AddressIndex, Update},
|
||||
SignOptions, Wallet,
|
||||
};
|
||||
use bdk_esplora::{esplora_client, EsploraAsyncExt};
|
||||
@@ -14,20 +14,20 @@ const STOP_GAP: usize = 50;
|
||||
const PARALLEL_REQUESTS: usize = 5;
|
||||
|
||||
#[tokio::main]
|
||||
async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
async fn main() -> Result<(), anyhow::Error> {
|
||||
let db_path = std::env::temp_dir().join("bdk-esplora-async-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/1/*)";
|
||||
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
let mut wallet = Wallet::new_or_load(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New);
|
||||
let address = wallet.try_get_address(AddressIndex::New)?;
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
@@ -37,7 +37,7 @@ async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let client =
|
||||
esplora_client::Builder::new("https://blockstream.info/testnet/api").build_async()?;
|
||||
|
||||
let local_chain = wallet.checkpoints();
|
||||
let prev_tip = wallet.latest_checkpoint();
|
||||
let keychain_spks = wallet
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
@@ -53,19 +53,19 @@ async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
(k, k_spks)
|
||||
})
|
||||
.collect();
|
||||
let update = client
|
||||
.scan(
|
||||
local_chain,
|
||||
keychain_spks,
|
||||
[],
|
||||
[],
|
||||
STOP_GAP,
|
||||
PARALLEL_REQUESTS,
|
||||
)
|
||||
let (update_graph, last_active_indices) = client
|
||||
.scan_txs_with_keychains(keychain_spks, None, None, STOP_GAP, PARALLEL_REQUESTS)
|
||||
.await?;
|
||||
println!();
|
||||
let missing_heights = update_graph.missing_heights(wallet.local_chain());
|
||||
let chain_update = client.update_local_chain(prev_tip, missing_heights).await?;
|
||||
let update = Update {
|
||||
last_active_indices,
|
||||
graph: update_graph,
|
||||
chain: Some(chain_update),
|
||||
};
|
||||
wallet.apply_update(update)?;
|
||||
wallet.commit()?;
|
||||
println!();
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||
@@ -78,14 +78,15 @@ async fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?;
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?
|
||||
.require_network(Network::Testnet)?;
|
||||
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
tx_builder
|
||||
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||
.enable_rbf();
|
||||
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
let mut psbt = tx_builder.finish()?;
|
||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized);
|
||||
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
[package]
|
||||
name = "wallet_esplora"
|
||||
name = "wallet_esplora_blocking"
|
||||
version = "0.2.0"
|
||||
edition = "2021"
|
||||
publish = false
|
||||
@@ -10,3 +10,4 @@ publish = false
|
||||
bdk = { path = "../../crates/bdk" }
|
||||
bdk_esplora = { path = "../../crates/esplora", features = ["blocking"] }
|
||||
bdk_file_store = { path = "../../crates/file_store" }
|
||||
anyhow = "1"
|
||||
@@ -1,32 +1,32 @@
|
||||
const DB_MAGIC: &str = "bdk_wallet_esplora_example";
|
||||
const SEND_AMOUNT: u64 = 5000;
|
||||
const STOP_GAP: usize = 50;
|
||||
const PARALLEL_REQUESTS: usize = 5;
|
||||
const SEND_AMOUNT: u64 = 1000;
|
||||
const STOP_GAP: usize = 5;
|
||||
const PARALLEL_REQUESTS: usize = 1;
|
||||
|
||||
use std::{io::Write, str::FromStr};
|
||||
|
||||
use bdk::{
|
||||
bitcoin::{Address, Network},
|
||||
wallet::AddressIndex,
|
||||
wallet::{AddressIndex, Update},
|
||||
SignOptions, Wallet,
|
||||
};
|
||||
use bdk_esplora::{esplora_client, EsploraExt};
|
||||
use bdk_file_store::Store;
|
||||
|
||||
fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
fn main() -> Result<(), anyhow::Error> {
|
||||
let db_path = std::env::temp_dir().join("bdk-esplora-example");
|
||||
let db = Store::<bdk::wallet::ChangeSet>::new_from_path(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/1/*)";
|
||||
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||
|
||||
let mut wallet = Wallet::new(
|
||||
let mut wallet = Wallet::new_or_load(
|
||||
external_descriptor,
|
||||
Some(internal_descriptor),
|
||||
db,
|
||||
Network::Testnet,
|
||||
)?;
|
||||
|
||||
let address = wallet.get_address(AddressIndex::New);
|
||||
let address = wallet.try_get_address(AddressIndex::New)?;
|
||||
println!("Generated Address: {}", address);
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
@@ -36,7 +36,7 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
let client =
|
||||
esplora_client::Builder::new("https://blockstream.info/testnet/api").build_blocking()?;
|
||||
|
||||
let local_chain = wallet.checkpoints();
|
||||
let prev_tip = wallet.latest_checkpoint();
|
||||
let keychain_spks = wallet
|
||||
.spks_of_all_keychains()
|
||||
.into_iter()
|
||||
@@ -52,17 +52,20 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
(k, k_spks)
|
||||
})
|
||||
.collect();
|
||||
let update = client.scan(
|
||||
local_chain,
|
||||
keychain_spks,
|
||||
None,
|
||||
None,
|
||||
STOP_GAP,
|
||||
PARALLEL_REQUESTS,
|
||||
)?;
|
||||
println!();
|
||||
|
||||
let (update_graph, last_active_indices) =
|
||||
client.scan_txs_with_keychains(keychain_spks, None, None, STOP_GAP, PARALLEL_REQUESTS)?;
|
||||
let missing_heights = update_graph.missing_heights(wallet.local_chain());
|
||||
let chain_update = client.update_local_chain(prev_tip, missing_heights)?;
|
||||
let update = Update {
|
||||
last_active_indices,
|
||||
graph: update_graph,
|
||||
chain: Some(chain_update),
|
||||
};
|
||||
|
||||
wallet.apply_update(update)?;
|
||||
wallet.commit()?;
|
||||
println!();
|
||||
|
||||
let balance = wallet.get_balance();
|
||||
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||
@@ -75,14 +78,15 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||
std::process::exit(0);
|
||||
}
|
||||
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?;
|
||||
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?
|
||||
.require_network(Network::Testnet)?;
|
||||
|
||||
let mut tx_builder = wallet.build_tx();
|
||||
tx_builder
|
||||
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||
.enable_rbf();
|
||||
|
||||
let (mut psbt, _) = tx_builder.finish()?;
|
||||
let mut psbt = tx_builder.finish()?;
|
||||
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||
assert!(finalized);
|
||||
|
||||
@@ -2,4 +2,4 @@
|
||||
|
||||
This is a directory for crates that are experimental and have not been released yet.
|
||||
Keep in mind that they may never be released.
|
||||
Things in `/example-crates` may use them to demonsrate how things might look in the future.
|
||||
Things in `/example-crates` may use them to demonstrate how things might look in the future.
|
||||
|
||||
@@ -97,11 +97,13 @@ impl CoinSelectorOpt {
|
||||
let mut tx = Transaction {
|
||||
input: vec![],
|
||||
version: 1,
|
||||
lock_time: LockTime::ZERO.into(),
|
||||
lock_time: absolute::LockTime::ZERO,
|
||||
output: txouts.to_vec(),
|
||||
};
|
||||
let base_weight = tx.weight();
|
||||
// this awkward calculation is necessary since TxOut doesn't have \.weight()
|
||||
// Calculating drain_weight like this instead of using .weight()
|
||||
// allows us to take into account the output len varint increase that
|
||||
// might happen when adding a new output
|
||||
let drain_weight = {
|
||||
tx.output.push(drain_output.clone());
|
||||
tx.weight() - base_weight
|
||||
@@ -113,8 +115,8 @@ impl CoinSelectorOpt {
|
||||
Some(txouts.iter().map(|txout| txout.value).sum())
|
||||
},
|
||||
..Self::from_weights(
|
||||
base_weight as u32,
|
||||
drain_weight as u32,
|
||||
base_weight.to_wu() as u32,
|
||||
drain_weight.to_wu() as u32,
|
||||
TXIN_BASE_WEIGHT + drain_satisfaction_weight,
|
||||
)
|
||||
}
|
||||
|
||||
@@ -12,7 +12,7 @@ use bdk_chain::{
|
||||
bitcoin,
|
||||
collections::{BTreeSet, HashMap},
|
||||
};
|
||||
use bitcoin::{LockTime, Transaction, TxOut};
|
||||
use bitcoin::{absolute, Transaction, TxOut};
|
||||
use core::fmt::{Debug, Display};
|
||||
|
||||
mod coin_selector;
|
||||
|
||||
@@ -1,13 +0,0 @@
|
||||
[package]
|
||||
name = "bdk_tmp_plan"
|
||||
version = "0.1.0"
|
||||
edition = "2021"
|
||||
|
||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||
|
||||
[dependencies]
|
||||
bdk_chain = { path = "../../../crates/chain", version = "0.3.1", features = ["miniscript"] }
|
||||
|
||||
[features]
|
||||
default = ["std"]
|
||||
std = []
|
||||
@@ -1,3 +0,0 @@
|
||||
# Temporary planning module
|
||||
|
||||
A temporary place to hold the planning module until https://github.com/rust-bitcoin/rust-miniscript/pull/481 is merged and released
|
||||
@@ -1,436 +0,0 @@
|
||||
#![allow(unused)]
|
||||
#![allow(missing_docs)]
|
||||
//! A spending plan or *plan* for short is a representation of a particular spending path on a
|
||||
//! descriptor. This allows us to analayze a choice of spending path without producing any
|
||||
//! signatures or other witness data for it.
|
||||
//!
|
||||
//! To make a plan you provide the descriptor with "assets" like which keys you are able to use, hash
|
||||
//! pre-images you have access to, the current block height etc.
|
||||
//!
|
||||
//! Once you've got a plan it can tell you its expected satisfaction weight which can be useful for
|
||||
//! doing coin selection. Furthermore it provides which subset of those keys and hash pre-images you
|
||||
//! will actually need as well as what locktime or sequence number you need to set.
|
||||
//!
|
||||
//! Once you've obstained signatures, hash pre-images etc required by the plan, it can create a
|
||||
//! witness/script_sig for the input.
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use bitcoin::{
|
||||
blockdata::{locktime::LockTime, transaction::Sequence},
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
secp256k1::Secp256k1,
|
||||
util::{
|
||||
address::WitnessVersion,
|
||||
bip32::{DerivationPath, Fingerprint, KeySource},
|
||||
taproot::{LeafVersion, TapBranchHash, TapLeafHash},
|
||||
},
|
||||
EcdsaSig, SchnorrSig, Script, TxIn, Witness,
|
||||
};
|
||||
use miniscript::{
|
||||
descriptor::{InnerXKey, Tr},
|
||||
hash256, DefiniteDescriptorKey, Descriptor, DescriptorPublicKey, ScriptContext, ToPublicKey,
|
||||
};
|
||||
|
||||
pub(crate) fn varint_len(v: usize) -> usize {
|
||||
bitcoin::VarInt(v as u64).len() as usize
|
||||
}
|
||||
|
||||
mod plan_impls;
|
||||
mod requirements;
|
||||
mod template;
|
||||
pub use requirements::*;
|
||||
pub use template::PlanKey;
|
||||
use template::TemplateItem;
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum TrSpend {
|
||||
KeySpend,
|
||||
LeafSpend {
|
||||
script: Script,
|
||||
leaf_version: LeafVersion,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum Target {
|
||||
Legacy,
|
||||
Segwitv0 {
|
||||
script_code: Script,
|
||||
},
|
||||
Segwitv1 {
|
||||
tr: Tr<DefiniteDescriptorKey>,
|
||||
tr_plan: TrSpend,
|
||||
},
|
||||
}
|
||||
|
||||
impl Target {}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
/// A plan represents a particular spending path for a descriptor.
|
||||
///
|
||||
/// See the module level documentation for more info.
|
||||
pub struct Plan<AK> {
|
||||
template: Vec<TemplateItem<AK>>,
|
||||
target: Target,
|
||||
set_locktime: Option<LockTime>,
|
||||
set_sequence: Option<Sequence>,
|
||||
}
|
||||
|
||||
impl Default for Target {
|
||||
fn default() -> Self {
|
||||
Target::Legacy
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug, Default)]
|
||||
/// Signatures and hash pre-images that can be used to complete a plan.
|
||||
pub struct SatisfactionMaterial {
|
||||
/// Schnorr signautres under their keys
|
||||
pub schnorr_sigs: BTreeMap<DefiniteDescriptorKey, SchnorrSig>,
|
||||
/// ECDSA signatures under their keys
|
||||
pub ecdsa_sigs: BTreeMap<DefiniteDescriptorKey, EcdsaSig>,
|
||||
/// SHA256 pre-images under their images
|
||||
pub sha256_preimages: BTreeMap<sha256::Hash, Vec<u8>>,
|
||||
/// hash160 pre-images under their images
|
||||
pub hash160_preimages: BTreeMap<hash160::Hash, Vec<u8>>,
|
||||
/// hash256 pre-images under their images
|
||||
pub hash256_preimages: BTreeMap<hash256::Hash, Vec<u8>>,
|
||||
/// ripemd160 pre-images under their images
|
||||
pub ripemd160_preimages: BTreeMap<ripemd160::Hash, Vec<u8>>,
|
||||
}
|
||||
|
||||
impl<Ak> Plan<Ak>
|
||||
where
|
||||
Ak: Clone,
|
||||
{
|
||||
/// The expected satisfaction weight for the plan if it is completed.
|
||||
pub fn expected_weight(&self) -> usize {
|
||||
let script_sig_size = match self.target {
|
||||
Target::Legacy => unimplemented!(), // self
|
||||
// .template
|
||||
// .iter()
|
||||
// .map(|step| {
|
||||
// let size = step.expected_size();
|
||||
// size + push_opcode_size(size)
|
||||
// })
|
||||
// .sum()
|
||||
Target::Segwitv0 { .. } | Target::Segwitv1 { .. } => 1,
|
||||
};
|
||||
let witness_elem_sizes: Option<Vec<usize>> = match &self.target {
|
||||
Target::Legacy => None,
|
||||
Target::Segwitv0 { .. } => Some(
|
||||
self.template
|
||||
.iter()
|
||||
.map(|step| step.expected_size())
|
||||
.collect(),
|
||||
),
|
||||
Target::Segwitv1 { tr, tr_plan } => {
|
||||
let mut witness_elems = self
|
||||
.template
|
||||
.iter()
|
||||
.map(|step| step.expected_size())
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
if let TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
} = tr_plan
|
||||
{
|
||||
let control_block = tr
|
||||
.spend_info()
|
||||
.control_block(&(script.clone(), *leaf_version))
|
||||
.expect("must exist");
|
||||
witness_elems.push(script.len());
|
||||
witness_elems.push(control_block.size());
|
||||
}
|
||||
|
||||
Some(witness_elems)
|
||||
}
|
||||
};
|
||||
|
||||
let witness_size: usize = match witness_elem_sizes {
|
||||
Some(elems) => {
|
||||
varint_len(elems.len())
|
||||
+ elems
|
||||
.into_iter()
|
||||
.map(|elem| varint_len(elem) + elem)
|
||||
.sum::<usize>()
|
||||
}
|
||||
None => 0,
|
||||
};
|
||||
|
||||
script_sig_size * 4 + witness_size
|
||||
}
|
||||
|
||||
pub fn requirements(&self) -> Requirements<Ak> {
|
||||
match self.try_complete(&SatisfactionMaterial::default()) {
|
||||
PlanState::Complete { .. } => Requirements::default(),
|
||||
PlanState::Incomplete(requirements) => requirements,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn try_complete(&self, auth_data: &SatisfactionMaterial) -> PlanState<Ak> {
|
||||
let unsatisfied_items = self
|
||||
.template
|
||||
.iter()
|
||||
.filter(|step| match step {
|
||||
TemplateItem::Sign(key) => {
|
||||
!auth_data.schnorr_sigs.contains_key(&key.descriptor_key)
|
||||
}
|
||||
TemplateItem::Hash160(image) => !auth_data.hash160_preimages.contains_key(image),
|
||||
TemplateItem::Hash256(image) => !auth_data.hash256_preimages.contains_key(image),
|
||||
TemplateItem::Sha256(image) => !auth_data.sha256_preimages.contains_key(image),
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
!auth_data.ripemd160_preimages.contains_key(image)
|
||||
}
|
||||
TemplateItem::Pk { .. } | TemplateItem::One | TemplateItem::Zero => false,
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
if unsatisfied_items.is_empty() {
|
||||
let mut witness = self
|
||||
.template
|
||||
.iter()
|
||||
.flat_map(|step| step.to_witness_stack(&auth_data))
|
||||
.collect::<Vec<_>>();
|
||||
match &self.target {
|
||||
Target::Segwitv0 { .. } => todo!(),
|
||||
Target::Legacy => todo!(),
|
||||
Target::Segwitv1 {
|
||||
tr_plan: TrSpend::KeySpend,
|
||||
..
|
||||
} => PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
},
|
||||
Target::Segwitv1 {
|
||||
tr,
|
||||
tr_plan:
|
||||
TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
},
|
||||
} => {
|
||||
let spend_info = tr.spend_info();
|
||||
let control_block = spend_info
|
||||
.control_block(&(script.clone(), *leaf_version))
|
||||
.expect("must exist");
|
||||
witness.push(script.clone().into_bytes());
|
||||
witness.push(control_block.serialize());
|
||||
|
||||
PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
}
|
||||
}
|
||||
}
|
||||
} else {
|
||||
let mut requirements = Requirements::default();
|
||||
|
||||
match &self.target {
|
||||
Target::Legacy => {
|
||||
todo!()
|
||||
}
|
||||
Target::Segwitv0 { .. } => {
|
||||
todo!()
|
||||
}
|
||||
Target::Segwitv1 { tr, tr_plan } => {
|
||||
let spend_info = tr.spend_info();
|
||||
match tr_plan {
|
||||
TrSpend::KeySpend => match &self.template[..] {
|
||||
[TemplateItem::Sign(ref plan_key)] => {
|
||||
requirements.signatures = RequiredSignatures::TapKey {
|
||||
merkle_root: spend_info.merkle_root(),
|
||||
plan_key: plan_key.clone(),
|
||||
};
|
||||
}
|
||||
_ => unreachable!("tapkey spend will always have only one sign step"),
|
||||
},
|
||||
TrSpend::LeafSpend {
|
||||
script,
|
||||
leaf_version,
|
||||
} => {
|
||||
let leaf_hash = TapLeafHash::from_script(&script, *leaf_version);
|
||||
requirements.signatures = RequiredSignatures::TapScript {
|
||||
leaf_hash,
|
||||
plan_keys: vec![],
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let required_signatures = match requirements.signatures {
|
||||
RequiredSignatures::Legacy { .. } => todo!(),
|
||||
RequiredSignatures::Segwitv0 { .. } => todo!(),
|
||||
RequiredSignatures::TapKey { .. } => return PlanState::Incomplete(requirements),
|
||||
RequiredSignatures::TapScript {
|
||||
plan_keys: ref mut keys,
|
||||
..
|
||||
} => keys,
|
||||
};
|
||||
|
||||
for step in unsatisfied_items {
|
||||
match step {
|
||||
TemplateItem::Sign(plan_key) => {
|
||||
required_signatures.push(plan_key.clone());
|
||||
}
|
||||
TemplateItem::Hash160(image) => {
|
||||
requirements.hash160_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Hash256(image) => {
|
||||
requirements.hash256_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Sha256(image) => {
|
||||
requirements.sha256_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
requirements.ripemd160_images.insert(image.clone());
|
||||
}
|
||||
TemplateItem::Pk { .. } | TemplateItem::One | TemplateItem::Zero => { /* no requirements */
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
PlanState::Incomplete(requirements)
|
||||
}
|
||||
}
|
||||
|
||||
/// Witness version for the plan
|
||||
pub fn witness_version(&self) -> Option<WitnessVersion> {
|
||||
match self.target {
|
||||
Target::Legacy => None,
|
||||
Target::Segwitv0 { .. } => Some(WitnessVersion::V0),
|
||||
Target::Segwitv1 { .. } => Some(WitnessVersion::V1),
|
||||
}
|
||||
}
|
||||
|
||||
/// The minimum required locktime height or time on the transaction using the plan.
|
||||
pub fn required_locktime(&self) -> Option<LockTime> {
|
||||
self.set_locktime.clone()
|
||||
}
|
||||
|
||||
/// The minimum required sequence (height or time) on the input to satisfy the plan
|
||||
pub fn required_sequence(&self) -> Option<Sequence> {
|
||||
self.set_sequence.clone()
|
||||
}
|
||||
|
||||
/// The minmum required transaction version required on the transaction using the plan.
|
||||
pub fn min_version(&self) -> Option<u32> {
|
||||
if let Some(_) = self.set_sequence {
|
||||
Some(2)
|
||||
} else {
|
||||
Some(1)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// The returned value from [`Plan::try_complete`].
|
||||
pub enum PlanState<Ak> {
|
||||
/// The plan is complete
|
||||
Complete {
|
||||
/// The script sig that should be set on the input
|
||||
final_script_sig: Option<Script>,
|
||||
/// The witness that should be set on the input
|
||||
final_script_witness: Option<Witness>,
|
||||
},
|
||||
Incomplete(Requirements<Ak>),
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct Assets<K> {
|
||||
pub keys: Vec<K>,
|
||||
pub txo_age: Option<Sequence>,
|
||||
pub max_locktime: Option<LockTime>,
|
||||
pub sha256: Vec<sha256::Hash>,
|
||||
pub hash256: Vec<hash256::Hash>,
|
||||
pub ripemd160: Vec<ripemd160::Hash>,
|
||||
pub hash160: Vec<hash160::Hash>,
|
||||
}
|
||||
|
||||
impl<K> Default for Assets<K> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
keys: Default::default(),
|
||||
txo_age: Default::default(),
|
||||
max_locktime: Default::default(),
|
||||
sha256: Default::default(),
|
||||
hash256: Default::default(),
|
||||
ripemd160: Default::default(),
|
||||
hash160: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub trait CanDerive {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath>;
|
||||
}
|
||||
|
||||
impl CanDerive for KeySource {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath> {
|
||||
match DescriptorPublicKey::from(key.clone()) {
|
||||
DescriptorPublicKey::Single(single_pub) => {
|
||||
path_to_child(self, single_pub.origin.as_ref()?, None)
|
||||
}
|
||||
DescriptorPublicKey::XPub(dxk) => {
|
||||
let origin = dxk.origin.clone().unwrap_or_else(|| {
|
||||
let secp = Secp256k1::signing_only();
|
||||
(dxk.xkey.xkey_fingerprint(&secp), DerivationPath::master())
|
||||
});
|
||||
|
||||
path_to_child(self, &origin, Some(&dxk.derivation_path))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl CanDerive for DescriptorPublicKey {
|
||||
fn can_derive(&self, key: &DefiniteDescriptorKey) -> Option<DerivationPath> {
|
||||
match (self, DescriptorPublicKey::from(key.clone())) {
|
||||
(parent, child) if parent == &child => Some(DerivationPath::master()),
|
||||
(DescriptorPublicKey::XPub(parent), _) => {
|
||||
let origin = parent.origin.clone().unwrap_or_else(|| {
|
||||
let secp = Secp256k1::signing_only();
|
||||
(
|
||||
parent.xkey.xkey_fingerprint(&secp),
|
||||
DerivationPath::master(),
|
||||
)
|
||||
});
|
||||
KeySource::from(origin).can_derive(key)
|
||||
}
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn path_to_child(
|
||||
parent: &KeySource,
|
||||
child_origin: &(Fingerprint, DerivationPath),
|
||||
child_derivation: Option<&DerivationPath>,
|
||||
) -> Option<DerivationPath> {
|
||||
if parent.0 == child_origin.0 {
|
||||
let mut remaining_derivation =
|
||||
DerivationPath::from(child_origin.1[..].strip_prefix(&parent.1[..])?);
|
||||
remaining_derivation =
|
||||
remaining_derivation.extend(child_derivation.unwrap_or(&DerivationPath::master()));
|
||||
Some(remaining_derivation)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
|
||||
pub fn plan_satisfaction<Ak>(
|
||||
desc: &Descriptor<DefiniteDescriptorKey>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<Plan<Ak>>
|
||||
where
|
||||
Ak: CanDerive + Clone,
|
||||
{
|
||||
match desc {
|
||||
Descriptor::Bare(_) => todo!(),
|
||||
Descriptor::Pkh(_) => todo!(),
|
||||
Descriptor::Wpkh(_) => todo!(),
|
||||
Descriptor::Sh(_) => todo!(),
|
||||
Descriptor::Wsh(_) => todo!(),
|
||||
Descriptor::Tr(tr) => crate::plan_impls::plan_satisfaction_tr(tr, assets),
|
||||
}
|
||||
}
|
||||
@@ -1,323 +0,0 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::locktime::{Height, Time};
|
||||
use miniscript::Terminal;
|
||||
|
||||
use super::*;
|
||||
|
||||
impl<Ak> TermPlan<Ak> {
|
||||
fn combine(self, other: Self) -> Option<Self> {
|
||||
let min_locktime = {
|
||||
match (self.min_locktime, other.min_locktime) {
|
||||
(Some(lhs), Some(rhs)) => {
|
||||
if lhs.is_same_unit(rhs) {
|
||||
Some(if lhs.to_consensus_u32() > rhs.to_consensus_u32() {
|
||||
lhs
|
||||
} else {
|
||||
rhs
|
||||
})
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
_ => self.min_locktime.or(other.min_locktime),
|
||||
}
|
||||
};
|
||||
|
||||
let min_sequence = {
|
||||
match (self.min_sequence, other.min_sequence) {
|
||||
(Some(lhs), Some(rhs)) => {
|
||||
if lhs.is_height_locked() == rhs.is_height_locked() {
|
||||
Some(if lhs.to_consensus_u32() > rhs.to_consensus_u32() {
|
||||
lhs
|
||||
} else {
|
||||
rhs
|
||||
})
|
||||
} else {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
_ => self.min_sequence.or(other.min_sequence),
|
||||
}
|
||||
};
|
||||
|
||||
let mut template = self.template;
|
||||
template.extend(other.template);
|
||||
|
||||
Some(Self {
|
||||
min_locktime,
|
||||
min_sequence,
|
||||
template,
|
||||
})
|
||||
}
|
||||
|
||||
pub(crate) fn expected_size(&self) -> usize {
|
||||
self.template.iter().map(|step| step.expected_size()).sum()
|
||||
}
|
||||
}
|
||||
|
||||
// impl crate::descriptor::Pkh<DefiniteDescriptorKey> {
|
||||
// pub(crate) fn plan_satisfaction<Ak>(&self, assets: &Assets<Ak>) -> Option<Plan<Ak>>
|
||||
// where
|
||||
// Ak: CanDerive + Clone,
|
||||
// {
|
||||
// let (asset_key, derivation_hint) = assets.keys.iter().find_map(|asset_key| {
|
||||
// let derivation_hint = asset_key.can_derive(self.as_inner())?;
|
||||
// Some((asset_key, derivation_hint))
|
||||
// })?;
|
||||
|
||||
// Some(Plan {
|
||||
// template: vec![TemplateItem::Sign(PlanKey {
|
||||
// asset_key: asset_key.clone(),
|
||||
// descriptor_key: self.as_inner().clone(),
|
||||
// derivation_hint,
|
||||
// })],
|
||||
// target: Target::Legacy,
|
||||
// set_locktime: None,
|
||||
// set_sequence: None,
|
||||
// })
|
||||
// }
|
||||
// }
|
||||
|
||||
// impl crate::descriptor::Wpkh<DefiniteDescriptorKey> {
|
||||
// pub(crate) fn plan_satisfaction<Ak>(&self, assets: &Assets<Ak>) -> Option<Plan<Ak>>
|
||||
// where
|
||||
// Ak: CanDerive + Clone,
|
||||
// {
|
||||
// let (asset_key, derivation_hint) = assets.keys.iter().find_map(|asset_key| {
|
||||
// let derivation_hint = asset_key.can_derive(self.as_inner())?;
|
||||
// Some((asset_key, derivation_hint))
|
||||
// })?;
|
||||
|
||||
// Some(Plan {
|
||||
// template: vec![TemplateItem::Sign(PlanKey {
|
||||
// asset_key: asset_key.clone(),
|
||||
// descriptor_key: self.as_inner().clone(),
|
||||
// derivation_hint,
|
||||
// })],
|
||||
// target: Target::Segwitv0,
|
||||
// set_locktime: None,
|
||||
// set_sequence: None,
|
||||
// })
|
||||
// }
|
||||
// }
|
||||
|
||||
pub(crate) fn plan_satisfaction_tr<Ak>(
|
||||
tr: &miniscript::descriptor::Tr<DefiniteDescriptorKey>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<Plan<Ak>>
|
||||
where
|
||||
Ak: CanDerive + Clone,
|
||||
{
|
||||
let key_path_spend = assets.keys.iter().find_map(|asset_key| {
|
||||
let derivation_hint = asset_key.can_derive(tr.internal_key())?;
|
||||
Some((asset_key, derivation_hint))
|
||||
});
|
||||
|
||||
if let Some((asset_key, derivation_hint)) = key_path_spend {
|
||||
return Some(Plan {
|
||||
template: vec![TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
descriptor_key: tr.internal_key().clone(),
|
||||
derivation_hint,
|
||||
})],
|
||||
target: Target::Segwitv1 {
|
||||
tr: tr.clone(),
|
||||
tr_plan: TrSpend::KeySpend,
|
||||
},
|
||||
set_locktime: None,
|
||||
set_sequence: None,
|
||||
});
|
||||
}
|
||||
|
||||
let mut plans = tr
|
||||
.iter_scripts()
|
||||
.filter_map(|(_, ms)| Some((ms, (plan_steps(&ms.node, assets)?))))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
plans.sort_by_cached_key(|(_, plan)| plan.expected_size());
|
||||
|
||||
let (script, best_plan) = plans.into_iter().next()?;
|
||||
|
||||
Some(Plan {
|
||||
target: Target::Segwitv1 {
|
||||
tr: tr.clone(),
|
||||
tr_plan: TrSpend::LeafSpend {
|
||||
script: script.encode(),
|
||||
leaf_version: LeafVersion::TapScript,
|
||||
},
|
||||
},
|
||||
set_locktime: best_plan.min_locktime.clone(),
|
||||
set_sequence: best_plan.min_sequence.clone(),
|
||||
template: best_plan.template,
|
||||
})
|
||||
}
|
||||
|
||||
#[derive(Debug)]
|
||||
struct TermPlan<Ak> {
|
||||
pub min_locktime: Option<LockTime>,
|
||||
pub min_sequence: Option<Sequence>,
|
||||
pub template: Vec<TemplateItem<Ak>>,
|
||||
}
|
||||
|
||||
impl<Ak> TermPlan<Ak> {
|
||||
fn new(template: Vec<TemplateItem<Ak>>) -> Self {
|
||||
TermPlan {
|
||||
template,
|
||||
..Default::default()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Default for TermPlan<Ak> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
min_locktime: Default::default(),
|
||||
min_sequence: Default::default(),
|
||||
template: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn plan_steps<Ak: Clone + CanDerive, Ctx: ScriptContext>(
|
||||
term: &Terminal<DefiniteDescriptorKey, Ctx>,
|
||||
assets: &Assets<Ak>,
|
||||
) -> Option<TermPlan<Ak>> {
|
||||
match term {
|
||||
Terminal::True => Some(TermPlan::new(vec![])),
|
||||
Terminal::False => return None,
|
||||
Terminal::PkH(key) => {
|
||||
let (asset_key, derivation_hint) = assets
|
||||
.keys
|
||||
.iter()
|
||||
.find_map(|asset_key| Some((asset_key, asset_key.can_derive(key)?)))?;
|
||||
Some(TermPlan::new(vec![
|
||||
TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
derivation_hint,
|
||||
descriptor_key: key.clone(),
|
||||
}),
|
||||
TemplateItem::Pk { key: key.clone() },
|
||||
]))
|
||||
}
|
||||
Terminal::PkK(key) => {
|
||||
let (asset_key, derivation_hint) = assets
|
||||
.keys
|
||||
.iter()
|
||||
.find_map(|asset_key| Some((asset_key, asset_key.can_derive(key)?)))?;
|
||||
Some(TermPlan::new(vec![TemplateItem::Sign(PlanKey {
|
||||
asset_key: asset_key.clone(),
|
||||
derivation_hint,
|
||||
descriptor_key: key.clone(),
|
||||
})]))
|
||||
}
|
||||
Terminal::RawPkH(_pk_hash) => {
|
||||
/* TODO */
|
||||
None
|
||||
}
|
||||
Terminal::After(locktime) => {
|
||||
let max_locktime = assets.max_locktime?;
|
||||
let locktime = LockTime::from(locktime);
|
||||
let (height, time) = match max_locktime {
|
||||
LockTime::Blocks(height) => (height, Time::from_consensus(0).unwrap()),
|
||||
LockTime::Seconds(seconds) => (Height::from_consensus(0).unwrap(), seconds),
|
||||
};
|
||||
if max_locktime.is_satisfied_by(height, time) {
|
||||
Some(TermPlan {
|
||||
min_locktime: Some(locktime),
|
||||
..Default::default()
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Older(older) => {
|
||||
// FIXME: older should be a height or time not a sequence.
|
||||
let max_sequence = assets.txo_age?;
|
||||
//TODO: this whole thing is probably wrong but upstream should provide a way of
|
||||
// doing it properly.
|
||||
if max_sequence.is_height_locked() == older.is_height_locked() {
|
||||
if max_sequence.to_consensus_u32() >= older.to_consensus_u32() {
|
||||
Some(TermPlan {
|
||||
min_sequence: Some(*older),
|
||||
..Default::default()
|
||||
})
|
||||
} else {
|
||||
None
|
||||
}
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Sha256(image) => {
|
||||
if assets.sha256.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Sha256(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Hash256(image) => {
|
||||
if assets.hash256.contains(image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Hash256(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Ripemd160(image) => {
|
||||
if assets.ripemd160.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Ripemd160(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Hash160(image) => {
|
||||
if assets.hash160.contains(&image) {
|
||||
Some(TermPlan::new(vec![TemplateItem::Hash160(image.clone())]))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
}
|
||||
Terminal::Alt(ms)
|
||||
| Terminal::Swap(ms)
|
||||
| Terminal::Check(ms)
|
||||
| Terminal::Verify(ms)
|
||||
| Terminal::NonZero(ms)
|
||||
| Terminal::ZeroNotEqual(ms) => plan_steps(&ms.node, assets),
|
||||
Terminal::DupIf(ms) => {
|
||||
let mut plan = plan_steps(&ms.node, assets)?;
|
||||
plan.template.push(TemplateItem::One);
|
||||
Some(plan)
|
||||
}
|
||||
Terminal::AndV(l, r) | Terminal::AndB(l, r) => {
|
||||
let lhs = plan_steps(&l.node, assets)?;
|
||||
let rhs = plan_steps(&r.node, assets)?;
|
||||
lhs.combine(rhs)
|
||||
}
|
||||
Terminal::AndOr(_, _, _) => todo!(),
|
||||
Terminal::OrB(_, _) => todo!(),
|
||||
Terminal::OrD(_, _) => todo!(),
|
||||
Terminal::OrC(_, _) => todo!(),
|
||||
Terminal::OrI(lhs, rhs) => {
|
||||
let lplan = plan_steps(&lhs.node, assets).map(|mut plan| {
|
||||
plan.template.push(TemplateItem::One);
|
||||
plan
|
||||
});
|
||||
let rplan = plan_steps(&rhs.node, assets).map(|mut plan| {
|
||||
plan.template.push(TemplateItem::Zero);
|
||||
plan
|
||||
});
|
||||
match (lplan, rplan) {
|
||||
(Some(lplan), Some(rplan)) => {
|
||||
if lplan.expected_size() <= rplan.expected_size() {
|
||||
Some(lplan)
|
||||
} else {
|
||||
Some(rplan)
|
||||
}
|
||||
}
|
||||
(lplan, rplan) => lplan.or(rplan),
|
||||
}
|
||||
}
|
||||
Terminal::Thresh(_, _) => todo!(),
|
||||
Terminal::Multi(_, _) => todo!(),
|
||||
Terminal::MultiA(_, _) => todo!(),
|
||||
}
|
||||
}
|
||||
@@ -1,218 +0,0 @@
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use core::ops::Deref;
|
||||
|
||||
use bitcoin::{
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
psbt::Prevouts,
|
||||
secp256k1::{KeyPair, Message, PublicKey, Signing, Verification},
|
||||
util::{bip32, sighash, sighash::SighashCache, taproot},
|
||||
EcdsaSighashType, SchnorrSighashType, Transaction, TxOut, XOnlyPublicKey,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
use miniscript::{
|
||||
descriptor::{DescriptorSecretKey, KeyMap},
|
||||
hash256,
|
||||
};
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
/// Signatures and hash pre-images that must be provided to complete the plan.
|
||||
pub struct Requirements<Ak> {
|
||||
/// required signatures
|
||||
pub signatures: RequiredSignatures<Ak>,
|
||||
/// required sha256 pre-images
|
||||
pub sha256_images: HashSet<sha256::Hash>,
|
||||
/// required hash160 pre-images
|
||||
pub hash160_images: HashSet<hash160::Hash>,
|
||||
/// required hash256 pre-images
|
||||
pub hash256_images: HashSet<hash256::Hash>,
|
||||
/// required ripemd160 pre-images
|
||||
pub ripemd160_images: HashSet<ripemd160::Hash>,
|
||||
}
|
||||
|
||||
impl<Ak> Default for RequiredSignatures<Ak> {
|
||||
fn default() -> Self {
|
||||
RequiredSignatures::Legacy {
|
||||
keys: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Default for Requirements<Ak> {
|
||||
fn default() -> Self {
|
||||
Self {
|
||||
signatures: Default::default(),
|
||||
sha256_images: Default::default(),
|
||||
hash160_images: Default::default(),
|
||||
hash256_images: Default::default(),
|
||||
ripemd160_images: Default::default(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Ak> Requirements<Ak> {
|
||||
/// Whether any hash pre-images are required in the plan
|
||||
pub fn requires_hash_preimages(&self) -> bool {
|
||||
!(self.sha256_images.is_empty()
|
||||
&& self.hash160_images.is_empty()
|
||||
&& self.hash256_images.is_empty()
|
||||
&& self.ripemd160_images.is_empty())
|
||||
}
|
||||
}
|
||||
|
||||
/// The signatures required to complete the plan
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum RequiredSignatures<Ak> {
|
||||
/// Legacy ECDSA signatures are required
|
||||
Legacy { keys: Vec<PlanKey<Ak>> },
|
||||
/// Segwitv0 ECDSA signatures are required
|
||||
Segwitv0 { keys: Vec<PlanKey<Ak>> },
|
||||
/// A Taproot key spend signature is required
|
||||
TapKey {
|
||||
/// the internal key
|
||||
plan_key: PlanKey<Ak>,
|
||||
/// The merkle root of the taproot output
|
||||
merkle_root: Option<TapBranchHash>,
|
||||
},
|
||||
/// Taproot script path signatures are required
|
||||
TapScript {
|
||||
/// The leaf hash of the script being used
|
||||
leaf_hash: TapLeafHash,
|
||||
/// The keys in the script that require signatures
|
||||
plan_keys: Vec<PlanKey<Ak>>,
|
||||
},
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub enum SigningError {
|
||||
SigHashError(sighash::Error),
|
||||
DerivationError(bip32::Error),
|
||||
}
|
||||
|
||||
impl From<sighash::Error> for SigningError {
|
||||
fn from(e: sighash::Error) -> Self {
|
||||
Self::SigHashError(e)
|
||||
}
|
||||
}
|
||||
|
||||
impl core::fmt::Display for SigningError {
|
||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||
match self {
|
||||
SigningError::SigHashError(e) => e.fmt(f),
|
||||
SigningError::DerivationError(e) => e.fmt(f),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl From<bip32::Error> for SigningError {
|
||||
fn from(e: bip32::Error) -> Self {
|
||||
Self::DerivationError(e)
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
impl std::error::Error for SigningError {}
|
||||
|
||||
impl RequiredSignatures<DescriptorPublicKey> {
|
||||
pub fn sign_with_keymap<T: Deref<Target = Transaction>>(
|
||||
&self,
|
||||
input_index: usize,
|
||||
keymap: &KeyMap,
|
||||
prevouts: &Prevouts<'_, impl core::borrow::Borrow<TxOut>>,
|
||||
schnorr_sighashty: Option<SchnorrSighashType>,
|
||||
_ecdsa_sighashty: Option<EcdsaSighashType>,
|
||||
sighash_cache: &mut SighashCache<T>,
|
||||
auth_data: &mut SatisfactionMaterial,
|
||||
secp: &Secp256k1<impl Signing + Verification>,
|
||||
) -> Result<bool, SigningError> {
|
||||
match self {
|
||||
RequiredSignatures::Legacy { .. } | RequiredSignatures::Segwitv0 { .. } => todo!(),
|
||||
RequiredSignatures::TapKey {
|
||||
plan_key,
|
||||
merkle_root,
|
||||
} => {
|
||||
let schnorr_sighashty = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_key_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
schnorr_sighashty,
|
||||
)?;
|
||||
let secret_key = match keymap.get(&plan_key.asset_key) {
|
||||
Some(secret_key) => secret_key,
|
||||
None => return Ok(false),
|
||||
};
|
||||
let secret_key = match secret_key {
|
||||
DescriptorSecretKey::Single(single) => single.key.inner,
|
||||
DescriptorSecretKey::XPrv(xprv) => {
|
||||
xprv.xkey
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
};
|
||||
|
||||
let pubkey = PublicKey::from_secret_key(&secp, &secret_key);
|
||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey);
|
||||
|
||||
let tweak =
|
||||
taproot::TapTweakHash::from_key_and_tweak(x_only_pubkey, merkle_root.clone());
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone())
|
||||
.add_xonly_tweak(&secp, &tweak.to_scalar())
|
||||
.unwrap();
|
||||
|
||||
let msg = Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
sig,
|
||||
hash_ty: schnorr_sighashty,
|
||||
};
|
||||
|
||||
auth_data
|
||||
.schnorr_sigs
|
||||
.insert(plan_key.descriptor_key.clone(), bitcoin_sig);
|
||||
Ok(true)
|
||||
}
|
||||
RequiredSignatures::TapScript {
|
||||
leaf_hash,
|
||||
plan_keys,
|
||||
} => {
|
||||
let sighash_type = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_script_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
*leaf_hash,
|
||||
sighash_type,
|
||||
)?;
|
||||
|
||||
let mut modified = false;
|
||||
|
||||
for plan_key in plan_keys {
|
||||
if let Some(secret_key) = keymap.get(&plan_key.asset_key) {
|
||||
let secret_key = match secret_key {
|
||||
DescriptorSecretKey::Single(single) => single.key.inner,
|
||||
DescriptorSecretKey::XPrv(xprv) => {
|
||||
xprv.xkey
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
};
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone());
|
||||
let msg =
|
||||
Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
sig,
|
||||
hash_ty: sighash_type,
|
||||
};
|
||||
|
||||
auth_data
|
||||
.schnorr_sigs
|
||||
.insert(plan_key.descriptor_key.clone(), bitcoin_sig);
|
||||
modified = true;
|
||||
}
|
||||
}
|
||||
Ok(modified)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,76 +0,0 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::{
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
util::bip32::DerivationPath,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
use crate::{hash256, varint_len, DefiniteDescriptorKey};
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
pub(crate) enum TemplateItem<Ak> {
|
||||
Sign(PlanKey<Ak>),
|
||||
Pk { key: DefiniteDescriptorKey },
|
||||
One,
|
||||
Zero,
|
||||
Sha256(sha256::Hash),
|
||||
Hash256(hash256::Hash),
|
||||
Ripemd160(ripemd160::Hash),
|
||||
Hash160(hash160::Hash),
|
||||
}
|
||||
|
||||
/// A plan key contains the asset key originally provided along with key in the descriptor it
|
||||
/// purports to be able to derive for along with a "hint" on how to derive it.
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct PlanKey<Ak> {
|
||||
/// The key the planner will sign with
|
||||
pub asset_key: Ak,
|
||||
/// A hint from how to get from the asset key to the concrete key we need to sign with.
|
||||
pub derivation_hint: DerivationPath,
|
||||
/// The key that was in the descriptor that we are satisfying with the signature from the asset
|
||||
/// key.
|
||||
pub descriptor_key: DefiniteDescriptorKey,
|
||||
}
|
||||
|
||||
impl<Ak> TemplateItem<Ak> {
|
||||
pub fn expected_size(&self) -> usize {
|
||||
match self {
|
||||
TemplateItem::Sign { .. } => 64, /*size of sig TODO: take into consideration sighash falg*/
|
||||
TemplateItem::Pk { .. } => 32,
|
||||
TemplateItem::One => varint_len(1),
|
||||
TemplateItem::Zero => 0, /* zero means an empty witness element */
|
||||
// I'm not sure if it should be 32 here (it's a 20 byte hash) but that's what other
|
||||
// parts of the code were doing.
|
||||
TemplateItem::Hash160(_) | TemplateItem::Ripemd160(_) => 32,
|
||||
TemplateItem::Sha256(_) | TemplateItem::Hash256(_) => 32,
|
||||
}
|
||||
}
|
||||
|
||||
// this can only be called if we are sure that auth_data has what we need
|
||||
pub(super) fn to_witness_stack(&self, auth_data: &SatisfactionMaterial) -> Vec<Vec<u8>> {
|
||||
match self {
|
||||
TemplateItem::Sign(plan_key) => {
|
||||
vec![auth_data
|
||||
.schnorr_sigs
|
||||
.get(&plan_key.descriptor_key)
|
||||
.unwrap()
|
||||
.to_vec()]
|
||||
}
|
||||
TemplateItem::One => vec![vec![1]],
|
||||
TemplateItem::Zero => vec![vec![]],
|
||||
TemplateItem::Sha256(image) => {
|
||||
vec![auth_data.sha256_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Hash160(image) => {
|
||||
vec![auth_data.hash160_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Ripemd160(image) => {
|
||||
vec![auth_data.ripemd160_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Hash256(image) => {
|
||||
vec![auth_data.hash256_preimages.get(image).unwrap().to_vec()]
|
||||
}
|
||||
TemplateItem::Pk { key } => vec![key.to_public_key().to_bytes()],
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -16,15 +16,15 @@
|
||||
//! witness/script_sig for the input.
|
||||
use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use bitcoin::{
|
||||
blockdata::{locktime::LockTime, transaction::Sequence},
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
secp256k1::Secp256k1,
|
||||
util::{
|
||||
absolute,
|
||||
address::WitnessVersion,
|
||||
bip32::{DerivationPath, Fingerprint, KeySource},
|
||||
taproot::{LeafVersion, TapBranchHash, TapLeafHash},
|
||||
},
|
||||
EcdsaSig, SchnorrSig, Script, TxIn, Witness,
|
||||
blockdata::transaction::Sequence,
|
||||
ecdsa,
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
secp256k1::Secp256k1,
|
||||
taproot::{self, LeafVersion, TapLeafHash},
|
||||
ScriptBuf, TxIn, Witness,
|
||||
};
|
||||
use miniscript::{
|
||||
descriptor::{InnerXKey, Tr},
|
||||
@@ -46,7 +46,7 @@ use template::TemplateItem;
|
||||
enum TrSpend {
|
||||
KeySpend,
|
||||
LeafSpend {
|
||||
script: Script,
|
||||
script: ScriptBuf,
|
||||
leaf_version: LeafVersion,
|
||||
},
|
||||
}
|
||||
@@ -55,7 +55,7 @@ enum TrSpend {
|
||||
enum Target {
|
||||
Legacy,
|
||||
Segwitv0 {
|
||||
script_code: Script,
|
||||
script_code: ScriptBuf,
|
||||
},
|
||||
Segwitv1 {
|
||||
tr: Tr<DefiniteDescriptorKey>,
|
||||
@@ -72,7 +72,7 @@ impl Target {}
|
||||
pub struct Plan<AK> {
|
||||
template: Vec<TemplateItem<AK>>,
|
||||
target: Target,
|
||||
set_locktime: Option<LockTime>,
|
||||
set_locktime: Option<absolute::LockTime>,
|
||||
set_sequence: Option<Sequence>,
|
||||
}
|
||||
|
||||
@@ -86,9 +86,9 @@ impl Default for Target {
|
||||
/// Signatures and hash pre-images that can be used to complete a plan.
|
||||
pub struct SatisfactionMaterial {
|
||||
/// Schnorr signautres under their keys
|
||||
pub schnorr_sigs: BTreeMap<DefiniteDescriptorKey, SchnorrSig>,
|
||||
pub schnorr_sigs: BTreeMap<DefiniteDescriptorKey, taproot::Signature>,
|
||||
/// ECDSA signatures under their keys
|
||||
pub ecdsa_sigs: BTreeMap<DefiniteDescriptorKey, EcdsaSig>,
|
||||
pub ecdsa_sigs: BTreeMap<DefiniteDescriptorKey, ecdsa::Signature>,
|
||||
/// SHA256 pre-images under their images
|
||||
pub sha256_preimages: BTreeMap<sha256::Hash, Vec<u8>>,
|
||||
/// hash160 pre-images under their images
|
||||
@@ -201,7 +201,7 @@ where
|
||||
..
|
||||
} => PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
final_script_witness: Some(Witness::from(witness)),
|
||||
},
|
||||
Target::Segwitv1 {
|
||||
tr,
|
||||
@@ -220,7 +220,7 @@ where
|
||||
|
||||
PlanState::Complete {
|
||||
final_script_sig: None,
|
||||
final_script_witness: Some(Witness::from_vec(witness)),
|
||||
final_script_witness: Some(Witness::from(witness)),
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -306,7 +306,7 @@ where
|
||||
}
|
||||
|
||||
/// The minimum required locktime height or time on the transaction using the plan.
|
||||
pub fn required_locktime(&self) -> Option<LockTime> {
|
||||
pub fn required_locktime(&self) -> Option<absolute::LockTime> {
|
||||
self.set_locktime.clone()
|
||||
}
|
||||
|
||||
@@ -315,7 +315,7 @@ where
|
||||
self.set_sequence.clone()
|
||||
}
|
||||
|
||||
/// The minmum required transaction version required on the transaction using the plan.
|
||||
/// The minimum required transaction version required on the transaction using the plan.
|
||||
pub fn min_version(&self) -> Option<u32> {
|
||||
if let Some(_) = self.set_sequence {
|
||||
Some(2)
|
||||
@@ -330,7 +330,7 @@ pub enum PlanState<Ak> {
|
||||
/// The plan is complete
|
||||
Complete {
|
||||
/// The script sig that should be set on the input
|
||||
final_script_sig: Option<Script>,
|
||||
final_script_sig: Option<ScriptBuf>,
|
||||
/// The witness that should be set on the input
|
||||
final_script_witness: Option<Witness>,
|
||||
},
|
||||
@@ -341,7 +341,7 @@ pub enum PlanState<Ak> {
|
||||
pub struct Assets<K> {
|
||||
pub keys: Vec<K>,
|
||||
pub txo_age: Option<Sequence>,
|
||||
pub max_locktime: Option<LockTime>,
|
||||
pub max_locktime: Option<absolute::LockTime>,
|
||||
pub sha256: Vec<sha256::Hash>,
|
||||
pub hash256: Vec<hash256::Hash>,
|
||||
pub ripemd160: Vec<ripemd160::Hash>,
|
||||
@@ -380,6 +380,11 @@ impl CanDerive for KeySource {
|
||||
|
||||
path_to_child(self, &origin, Some(&dxk.derivation_path))
|
||||
}
|
||||
DescriptorPublicKey::MultiXPub(_) => {
|
||||
// This crate will be replaced by
|
||||
// https://github.com/rust-bitcoin/rust-miniscript/pull/481 anyways
|
||||
todo!();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,5 +1,5 @@
|
||||
use bdk_chain::{bitcoin, miniscript};
|
||||
use bitcoin::locktime::{Height, Time};
|
||||
use bitcoin::locktime::absolute;
|
||||
use miniscript::Terminal;
|
||||
|
||||
use super::*;
|
||||
@@ -154,7 +154,7 @@ where
|
||||
|
||||
#[derive(Debug)]
|
||||
struct TermPlan<Ak> {
|
||||
pub min_locktime: Option<LockTime>,
|
||||
pub min_locktime: Option<absolute::LockTime>,
|
||||
pub min_sequence: Option<Sequence>,
|
||||
pub template: Vec<TemplateItem<Ak>>,
|
||||
}
|
||||
@@ -216,10 +216,12 @@ fn plan_steps<Ak: Clone + CanDerive, Ctx: ScriptContext>(
|
||||
}
|
||||
Terminal::After(locktime) => {
|
||||
let max_locktime = assets.max_locktime?;
|
||||
let locktime = LockTime::from(locktime);
|
||||
let locktime = absolute::LockTime::from(*locktime);
|
||||
let (height, time) = match max_locktime {
|
||||
LockTime::Blocks(height) => (height, Time::from_consensus(0).unwrap()),
|
||||
LockTime::Seconds(seconds) => (Height::from_consensus(0).unwrap(), seconds),
|
||||
absolute::LockTime::Blocks(height) => {
|
||||
(height, absolute::Time::from_consensus(0).unwrap())
|
||||
}
|
||||
absolute::LockTime::Seconds(seconds) => (absolute::Height::ZERO, seconds),
|
||||
};
|
||||
if max_locktime.is_satisfied_by(height, time) {
|
||||
Some(TermPlan {
|
||||
|
||||
@@ -2,11 +2,14 @@ use bdk_chain::{bitcoin, collections::*, miniscript};
|
||||
use core::ops::Deref;
|
||||
|
||||
use bitcoin::{
|
||||
bip32,
|
||||
hashes::{hash160, ripemd160, sha256},
|
||||
key::XOnlyPublicKey,
|
||||
psbt::Prevouts,
|
||||
secp256k1::{KeyPair, Message, PublicKey, Signing, Verification},
|
||||
util::{bip32, sighash, sighash::SighashCache, taproot},
|
||||
EcdsaSighashType, SchnorrSighashType, Transaction, TxOut, XOnlyPublicKey,
|
||||
sighash,
|
||||
sighash::{EcdsaSighashType, SighashCache, TapSighashType},
|
||||
taproot, Transaction, TxOut,
|
||||
};
|
||||
|
||||
use super::*;
|
||||
@@ -72,7 +75,7 @@ pub enum RequiredSignatures<Ak> {
|
||||
/// the internal key
|
||||
plan_key: PlanKey<Ak>,
|
||||
/// The merkle root of the taproot output
|
||||
merkle_root: Option<TapBranchHash>,
|
||||
merkle_root: Option<taproot::TapNodeHash>,
|
||||
},
|
||||
/// Taproot script path signatures are required
|
||||
TapScript {
|
||||
@@ -114,12 +117,12 @@ impl From<bip32::Error> for SigningError {
|
||||
impl std::error::Error for SigningError {}
|
||||
|
||||
impl RequiredSignatures<DescriptorPublicKey> {
|
||||
pub fn sign_with_keymap<T: Deref<Target = Transaction>>(
|
||||
pub fn sign_with_keymap<T: core::borrow::Borrow<Transaction>>(
|
||||
&self,
|
||||
input_index: usize,
|
||||
keymap: &KeyMap,
|
||||
prevouts: &Prevouts<'_, impl core::borrow::Borrow<TxOut>>,
|
||||
schnorr_sighashty: Option<SchnorrSighashType>,
|
||||
schnorr_sighashty: Option<TapSighashType>,
|
||||
_ecdsa_sighashty: Option<EcdsaSighashType>,
|
||||
sighash_cache: &mut SighashCache<T>,
|
||||
auth_data: &mut SatisfactionMaterial,
|
||||
@@ -131,7 +134,7 @@ impl RequiredSignatures<DescriptorPublicKey> {
|
||||
plan_key,
|
||||
merkle_root,
|
||||
} => {
|
||||
let schnorr_sighashty = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let schnorr_sighashty = schnorr_sighashty.unwrap_or(TapSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_key_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
@@ -148,6 +151,11 @@ impl RequiredSignatures<DescriptorPublicKey> {
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
DescriptorSecretKey::MultiXPrv(_) => {
|
||||
// This crate will be replaced by
|
||||
// https://github.com/rust-bitcoin/rust-miniscript/pull/481 anyways
|
||||
todo!();
|
||||
}
|
||||
};
|
||||
|
||||
let pubkey = PublicKey::from_secret_key(&secp, &secret_key);
|
||||
@@ -162,7 +170,7 @@ impl RequiredSignatures<DescriptorPublicKey> {
|
||||
let msg = Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
let bitcoin_sig = taproot::Signature {
|
||||
sig,
|
||||
hash_ty: schnorr_sighashty,
|
||||
};
|
||||
@@ -176,7 +184,7 @@ impl RequiredSignatures<DescriptorPublicKey> {
|
||||
leaf_hash,
|
||||
plan_keys,
|
||||
} => {
|
||||
let sighash_type = schnorr_sighashty.unwrap_or(SchnorrSighashType::Default);
|
||||
let sighash_type = schnorr_sighashty.unwrap_or(TapSighashType::Default);
|
||||
let sighash = sighash_cache.taproot_script_spend_signature_hash(
|
||||
input_index,
|
||||
prevouts,
|
||||
@@ -195,12 +203,17 @@ impl RequiredSignatures<DescriptorPublicKey> {
|
||||
.derive_priv(&secp, &plan_key.derivation_hint)?
|
||||
.private_key
|
||||
}
|
||||
DescriptorSecretKey::MultiXPrv(_) => {
|
||||
// This crate will be replaced by
|
||||
// https://github.com/rust-bitcoin/rust-miniscript/pull/481 anyways
|
||||
todo!();
|
||||
}
|
||||
};
|
||||
let keypair = KeyPair::from_secret_key(&secp, &secret_key.clone());
|
||||
let msg =
|
||||
Message::from_slice(sighash.as_ref()).expect("Sighashes are 32 bytes");
|
||||
let sig = secp.sign_schnorr_no_aux_rand(&msg, &keypair);
|
||||
let bitcoin_sig = SchnorrSig {
|
||||
let bitcoin_sig = taproot::Signature {
|
||||
sig,
|
||||
hash_ty: sighash_type,
|
||||
};
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user