Compare commits
482 Commits
v0.27.0
...
v1.0.0-alp
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
ba7624781d | ||
|
|
d597f4c761 | ||
|
|
f099b42005 | ||
|
|
ce8c617c9d | ||
|
|
8ad52f720f | ||
|
|
c5afbaa95d | ||
|
|
929b5ddb0c | ||
|
|
070fffb95c | ||
|
|
216648bcfd | ||
|
|
5299db34cb | ||
|
|
8375bb8d39 | ||
|
|
63fa710319 | ||
|
|
d4276a1c32 | ||
|
|
6a03e0f209 | ||
|
|
38b728ae52 | ||
|
|
d162208d95 | ||
|
|
e687c27096 | ||
|
|
5611c9e42a | ||
|
|
07116df541 | ||
|
|
48b28e3abc | ||
|
|
51bd01b3dd | ||
|
|
285ff46a49 | ||
|
|
8305e64849 | ||
|
|
66dc34e75a | ||
|
|
fbd1d65618 | ||
|
|
c4d5f2ccd8 | ||
|
|
52c77b8451 | ||
|
|
99661be5f3 | ||
|
|
914db84824 | ||
|
|
f8f371c8d8 | ||
|
|
232a172c32 | ||
|
|
8d916d7a10 | ||
|
|
3fa44a58ec | ||
|
|
6f824cf325 | ||
|
|
f05e8502e6 | ||
|
|
25653d71b8 | ||
|
|
e6433fb2c1 | ||
|
|
0bee46e75b | ||
|
|
08b745ec9f | ||
|
|
0a2a57060b | ||
|
|
d33acc1466 | ||
|
|
d1ea0ef3d1 | ||
|
|
60abd87a32 | ||
|
|
71fff1613d | ||
|
|
b6a58d4f9b | ||
|
|
cf0c333744 | ||
|
|
7c0f4653b2 | ||
|
|
3829fc18c7 | ||
|
|
d494f63d08 | ||
|
|
83e7b7ec40 | ||
|
|
9294e30943 | ||
|
|
b74c2e2622 | ||
|
|
81aeaba48a | ||
|
|
c7b47af72f | ||
|
|
d9501187ef | ||
|
|
a4f28c079e | ||
|
|
8ec65f0b8e | ||
|
|
a7d01dc39a | ||
|
|
e0512acf94 | ||
|
|
8f2d4d9d40 | ||
|
|
9467cad55d | ||
|
|
d3e5095df1 | ||
|
|
2b61a122ff | ||
|
|
40f0765d30 | ||
|
|
bf67519768 | ||
|
|
b6422f7ffc | ||
|
|
eb1714aee0 | ||
|
|
705690ee8f | ||
|
|
c871764670 | ||
|
|
a3aa8b6682 | ||
|
|
cd602430ee | ||
|
|
264bb85efc | ||
|
|
761189ab2b | ||
|
|
5b77942993 | ||
|
|
f9dad51ae1 | ||
|
|
8f6dad76ef | ||
|
|
887e112e8f | ||
|
|
21d8875826 | ||
|
|
6e6bad9223 | ||
|
|
105d70e974 | ||
|
|
9efaead8f1 | ||
|
|
1ff9d5ce8f | ||
|
|
8694624bd5 | ||
|
|
003271117c | ||
|
|
f6418ba911 | ||
|
|
028caa9f8c | ||
|
|
d71829914a | ||
|
|
a1d34afa24 | ||
|
|
9cc03324f4 | ||
|
|
de54e710ed | ||
|
|
95d34854f4 | ||
|
|
ed91a4bdb4 | ||
|
|
179cfeff51 | ||
|
|
7eff024213 | ||
|
|
1def76f1f1 | ||
|
|
c9467dcbb2 | ||
|
|
bc796f412a | ||
|
|
4fd539b647 | ||
|
|
01698ae5ec | ||
|
|
f4863c6314 | ||
|
|
b5612f269a | ||
|
|
e7fbc8bcf3 | ||
|
|
2251b8d416 | ||
|
|
b13505c1c3 | ||
|
|
0adff9c35f | ||
|
|
908b0f9f5e | ||
|
|
169385bb5b | ||
|
|
f741122ffb | ||
|
|
959b4f8172 | ||
|
|
55b680c194 | ||
|
|
43aed386bc | ||
|
|
cb713e5b8c | ||
|
|
2c4e90a76f | ||
|
|
18bd329617 | ||
|
|
9e681b39fb | ||
|
|
6817ca9bcb | ||
|
|
73862be3ba | ||
|
|
02fa340896 | ||
|
|
4ee41dbc40 | ||
|
|
278210bb89 | ||
|
|
6fb45d8a73 | ||
|
|
e803ee9010 | ||
|
|
82632897aa | ||
|
|
46d39beb2c | ||
|
|
00ec19ef2d | ||
|
|
77f9977c02 | ||
|
|
9e7d99e3bf | ||
|
|
cc552c5f91 | ||
|
|
27a63abd1e | ||
|
|
bc8d6a396b | ||
|
|
f1b112e8f9 | ||
|
|
9a250baf62 | ||
|
|
79b84bed0e | ||
|
|
06a956ad20 | ||
|
|
c3265e2514 | ||
|
|
96f1d94e2c | ||
|
|
1886dc4fe7 | ||
|
|
24994a3ed4 | ||
|
|
d294e2e318 | ||
|
|
7c6cbc4d9f | ||
|
|
6cf3963c6c | ||
|
|
7d5f31f6cc | ||
|
|
5998a22819 | ||
|
|
d6a0cf0795 | ||
|
|
6e27e66738 | ||
|
|
f382fa9230 | ||
|
|
e71770f93e | ||
|
|
298f6cb1e8 | ||
|
|
3fdab87ee7 | ||
|
|
855c61a6ab | ||
|
|
0112c67b60 | ||
|
|
1010efd8d6 | ||
|
|
991cb77b6f | ||
|
|
e553231eae | ||
|
|
0a7b60f0f7 | ||
|
|
0ecc0280c0 | ||
|
|
afbf83c8b0 | ||
|
|
2f2f138595 | ||
|
|
95250fc44e | ||
|
|
f17df1e133 | ||
|
|
3569acca0b | ||
|
|
2e4bc3c5e2 | ||
|
|
6ebdd195e2 | ||
|
|
d5c87c49a8 | ||
|
|
009408d243 | ||
|
|
38d69c947c | ||
|
|
67eec36db4 | ||
|
|
85c62532a5 | ||
|
|
b69c13ddf6 | ||
|
|
5f34df8489 | ||
|
|
57590e0a1f | ||
|
|
6d4b33ef91 | ||
|
|
4f5695d43a | ||
|
|
150d6f8ab6 | ||
|
|
4f10463d9e | ||
|
|
a73dac2d91 | ||
|
|
bb7424d11d | ||
|
|
240657b167 | ||
|
|
43bc813c64 | ||
|
|
b3db5ca9df | ||
|
|
f795a43cc7 | ||
|
|
b1461f05d0 | ||
|
|
77cde96229 | ||
|
|
1db3f87a48 | ||
|
|
4a65a12c4f | ||
|
|
4ee11aae12 | ||
|
|
a7dbc22df1 | ||
|
|
6d601a7e88 | ||
|
|
48ca95b541 | ||
|
|
59a2403e28 | ||
|
|
6e511473a5 | ||
|
|
62de55f12d | ||
|
|
5e79b81a6a | ||
|
|
a3e8480ad9 | ||
|
|
4742d88ea3 | ||
|
|
2f26eca607 | ||
|
|
486e0e1437 | ||
|
|
9bd528607a | ||
|
|
f28e665c7d | ||
|
|
417963f168 | ||
|
|
edfd4c236d | ||
|
|
fe654310d7 | ||
|
|
37d5e5319f | ||
|
|
ea6411c685 | ||
|
|
4a1b96dcc4 | ||
|
|
bf9a425849 | ||
|
|
d35668e76a | ||
|
|
31d52e12c9 | ||
|
|
6a5c9d7a00 | ||
|
|
4d1a9fd47a | ||
|
|
f95506ba6a | ||
|
|
e6519e3a52 | ||
|
|
43fb0b20df | ||
|
|
94f8fa530b | ||
|
|
c20a4da9fc | ||
|
|
1ff806c67f | ||
|
|
d43ae0231f | ||
|
|
59fc1b341b | ||
|
|
20900218ce | ||
|
|
e89cf5a16a | ||
|
|
4104206980 | ||
|
|
c56728ff13 | ||
|
|
32c40ac939 | ||
|
|
a28748c339 | ||
|
|
f42f8b8ff1 | ||
|
|
68572bfd2e | ||
|
|
2392e50fd9 | ||
|
|
7c12dc9942 | ||
|
|
6bcbb93233 | ||
|
|
2867e88b64 | ||
|
|
e48b911c8d | ||
|
|
a7a1d9b2fb | ||
|
|
8321aaa5c7 | ||
|
|
cc1a43c495 | ||
|
|
f41cc1cb37 | ||
|
|
da8cfd39e9 | ||
|
|
93e8eaf7ee | ||
|
|
5fb5061645 | ||
|
|
dd5b8d7599 | ||
|
|
465d53cc88 | ||
|
|
036299803f | ||
|
|
d443fe7f66 | ||
|
|
b4c31cd5ba | ||
|
|
e5fb1ec7ff | ||
|
|
18e8da3937 | ||
|
|
8f978f86b8 | ||
|
|
21206fe773 | ||
|
|
381c560c10 | ||
|
|
c753584379 | ||
|
|
6125062a5b | ||
|
|
2263a58448 | ||
|
|
11ac26f6b2 | ||
|
|
fb5cfa3c25 | ||
|
|
fa0bead024 | ||
|
|
8c4eeb56c0 | ||
|
|
3b5b829086 | ||
|
|
4f37b2a293 | ||
|
|
2d543475e2 | ||
|
|
d6bcd9b725 | ||
|
|
62f253103c | ||
|
|
80f5ecf3be | ||
|
|
ea50b6a932 | ||
|
|
480c2730de | ||
|
|
0cd2348166 | ||
|
|
b0b91b7418 | ||
|
|
feafaaca31 | ||
|
|
1da3b304bb | ||
|
|
792b39fa92 | ||
|
|
b73385dbd2 | ||
|
|
3dac3f9bba | ||
|
|
2949bdc7b8 | ||
|
|
468d2a0a3b | ||
|
|
b8ac16d03c | ||
|
|
6c29e53ee8 | ||
|
|
6eb079576f | ||
|
|
91b0f0ba29 | ||
|
|
f4e3ba3265 | ||
|
|
853d361751 | ||
|
|
d73669e8fa | ||
|
|
933056706c | ||
|
|
b206a985cf | ||
|
|
bea8e5aff4 | ||
|
|
db15e03bdc | ||
|
|
95312d4d05 | ||
|
|
8bf7a997f7 | ||
|
|
315e7e0b4b | ||
|
|
af705da1a8 | ||
|
|
eabeb6ccb1 | ||
|
|
8f38e96e45 | ||
|
|
ffb7c795e1 | ||
|
|
56b8eea643 | ||
|
|
cb626e9fc8 | ||
|
|
e17f03e755 | ||
|
|
f5074ee3ae | ||
|
|
f4d2a76661 | ||
|
|
81c7613391 | ||
|
|
26ade11726 | ||
|
|
5d1f922b3b | ||
|
|
7ab84be9c7 | ||
|
|
b184e351e5 | ||
|
|
352f5b29ab | ||
|
|
fa54a2e3a5 | ||
|
|
97d542cf1c | ||
|
|
75f8b81d58 | ||
|
|
cff92111d5 | ||
|
|
a7668a2f3e | ||
|
|
ac80829caa | ||
|
|
1c3cbefa4d | ||
|
|
5860704b2d | ||
|
|
2952341e52 | ||
|
|
78a7920ba3 | ||
|
|
92709d03ce | ||
|
|
50425e979b | ||
|
|
a78967e51b | ||
|
|
6a1ac7f80a | ||
|
|
f55974a64b | ||
|
|
2e3cee4bd0 | ||
|
|
7261669c09 | ||
|
|
aba88130d9 | ||
|
|
e69fccb15f | ||
|
|
8641847e6c | ||
|
|
22b8a48842 | ||
|
|
9bc7fe855d | ||
|
|
10b4b6c665 | ||
|
|
796f433f6c | ||
|
|
ac3759254a | ||
|
|
e30919ba3a | ||
|
|
1d55943fa1 | ||
|
|
df74b23f31 | ||
|
|
725eee8c92 | ||
|
|
c7a045fa54 | ||
|
|
34d60870ac | ||
|
|
ed89de752c | ||
|
|
fb75aa94a9 | ||
|
|
96b1075132 | ||
|
|
e01d17d59b | ||
|
|
05d353c0ad | ||
|
|
4963240599 | ||
|
|
2aa08a5898 | ||
|
|
e3c137043f | ||
|
|
065c64a675 | ||
|
|
a56d289eef | ||
|
|
2ccc116eda | ||
|
|
4ae727a1fb | ||
|
|
085bf9413d | ||
|
|
e413d3e424 | ||
|
|
c61995ca97 | ||
|
|
10fe32e6f1 | ||
|
|
6bc5f33ded | ||
|
|
702fe7ac5e | ||
|
|
ce5ae3eac4 | ||
|
|
c1cffe9333 | ||
|
|
5be7c1c50d | ||
|
|
29055658a6 | ||
|
|
139e3d3802 | ||
|
|
b799a5728b | ||
|
|
8cd0328eec | ||
|
|
911af34f50 | ||
|
|
e536307e5c | ||
|
|
217ea3321a | ||
|
|
f101dde09b | ||
|
|
1b152647c5 | ||
|
|
ecc74ce4cd | ||
|
|
ac336aa32f | ||
|
|
165b874dfe | ||
|
|
f3e7b67bf1 | ||
|
|
03c128311a | ||
|
|
34a7bf5afe | ||
|
|
6c49570742 | ||
|
|
1003fe2ee6 | ||
|
|
7175a82c04 | ||
|
|
8e36a2e5f6 | ||
|
|
81436fcd72 | ||
|
|
5e026cfd03 | ||
|
|
001efdd1cb | ||
|
|
10ab77c549 | ||
|
|
7d92337b93 | ||
|
|
a7fbe0ac67 | ||
|
|
ee1060f2ff | ||
|
|
611d2e3ea2 | ||
|
|
bff80ec378 | ||
|
|
24cd8c5cc7 | ||
|
|
ddd5e951f5 | ||
|
|
da4cef044d | ||
|
|
89cfa4d78e | ||
|
|
6e59dce10b | ||
|
|
ebd6103e65 | ||
|
|
a7eaebbb77 | ||
|
|
c09cd2afce | ||
|
|
7810059ed0 | ||
|
|
a63ffe9739 | ||
|
|
a1172def7d | ||
|
|
8c906170c9 | ||
|
|
468701a129 | ||
|
|
34d0277e44 | ||
|
|
3440a05711 | ||
|
|
236c50fa7b | ||
|
|
e902c10295 | ||
|
|
313965d8c8 | ||
|
|
db7883d813 | ||
|
|
d0a2aa83be | ||
|
|
6cbb18d409 | ||
|
|
784cd34e3d | ||
|
|
43b648fee0 | ||
|
|
61a8606fbc | ||
|
|
5ae5fe30eb | ||
|
|
5a090fac90 | ||
|
|
f99eb32ac5 | ||
|
|
30c11904a7 | ||
|
|
82f9caddab | ||
|
|
3b68a7bcc0 | ||
|
|
919e74aa8d | ||
|
|
72b1e2a485 | ||
|
|
2ae69ca10b | ||
|
|
877b658787 | ||
|
|
82f5d9c81e | ||
|
|
24df03afd6 | ||
|
|
cd4945af3a | ||
|
|
bc3e05c6c6 | ||
|
|
352f95f558 | ||
|
|
2fcf9c4adb | ||
|
|
5dd4ce74cf | ||
|
|
ae9b19d84c | ||
|
|
def0c9ed39 | ||
|
|
26ab2e2d6c | ||
|
|
ab9242d10d | ||
|
|
0aaf420f6d | ||
|
|
47faa881fb | ||
|
|
9d26121dbc | ||
|
|
eddd748870 | ||
|
|
0505cd7242 | ||
|
|
de9457fce6 | ||
|
|
69cf6d7924 | ||
|
|
b3836cb308 | ||
|
|
b082932268 | ||
|
|
d267517dbd | ||
|
|
0c7a0abb19 | ||
|
|
dfcbafd6b1 | ||
|
|
0ba41c5751 | ||
|
|
a38f63359d | ||
|
|
38ef170ed1 | ||
|
|
3a5d727899 | ||
|
|
96d932c830 | ||
|
|
5708bf0c8c | ||
|
|
5acee82496 | ||
|
|
8c9bcebc71 | ||
|
|
c61b3604e1 | ||
|
|
1805bd35c0 | ||
|
|
3f5a78ae3b | ||
|
|
303a1703c9 | ||
|
|
b5559767db | ||
|
|
2e82cd8c04 | ||
|
|
c069b0fb41 | ||
|
|
949608ab1f | ||
|
|
03deafb553 | ||
|
|
37dfa77d9d | ||
|
|
f2188f9dcd | ||
|
|
1c970a9295 | ||
|
|
94a084aafd | ||
|
|
9edbdf54c9 | ||
|
|
20e45b7af0 | ||
|
|
6d05598407 | ||
|
|
b60820a7b5 | ||
|
|
22bec6d363 | ||
|
|
8a6de3aa2d | ||
|
|
fdfc9b9ede | ||
|
|
e1eb0253cf | ||
|
|
3baf9721ec | ||
|
|
b310a7afdd | ||
|
|
5985706c1a | ||
|
|
57538e53e4 | ||
|
|
a40da9ba6c | ||
|
|
aab2b12f7a | ||
|
|
544c397a38 | ||
|
|
ced2d05e64 | ||
|
|
843807b08f | ||
|
|
231a1fba61 | ||
|
|
74119e70c3 | ||
|
|
8b2943c49b | ||
|
|
a1a70a5011 | ||
|
|
2d173a17f7 | ||
|
|
5b9e0e392a |
8
.github/dependabot.yml
vendored
Normal file
8
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,8 @@
|
|||||||
|
# Set update schedule for GitHub Actions
|
||||||
|
version: 2
|
||||||
|
updates:
|
||||||
|
- package-ecosystem: "github-actions"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
# Check for updates to GitHub Actions every week
|
||||||
|
interval: "weekly"
|
||||||
54
.github/workflows/code_coverage.yml
vendored
54
.github/workflows/code_coverage.yml
vendored
@@ -9,47 +9,43 @@ jobs:
|
|||||||
env:
|
env:
|
||||||
RUSTFLAGS: "-Cinstrument-coverage"
|
RUSTFLAGS: "-Cinstrument-coverage"
|
||||||
RUSTDOCFLAGS: "-Cinstrument-coverage"
|
RUSTDOCFLAGS: "-Cinstrument-coverage"
|
||||||
LLVM_PROFILE_FILE: "report-%p-%m.profraw"
|
LLVM_PROFILE_FILE: "./target/coverage/%p-%m.profraw"
|
||||||
|
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
- name: Install lcov tools
|
- name: Install lcov tools
|
||||||
run: sudo apt-get install lcov -y
|
run: sudo apt-get install lcov -y
|
||||||
- name: Install rustup
|
- name: Install Rust toolchain
|
||||||
run: curl https://sh.rustup.rs -sSf | sh -s -- -y
|
uses: actions-rs/toolchain@v1
|
||||||
- name: Set default toolchain
|
|
||||||
run: rustup default nightly
|
|
||||||
- name: Set profile
|
|
||||||
run: rustup set profile minimal
|
|
||||||
- name: Add llvm tools
|
|
||||||
run: rustup component add llvm-tools-preview
|
|
||||||
- name: Update toolchain
|
|
||||||
run: rustup update
|
|
||||||
- name: Cache cargo
|
|
||||||
uses: actions/cache@v3
|
|
||||||
with:
|
with:
|
||||||
path: |
|
toolchain: stable
|
||||||
~/.cargo/bin/
|
override: true
|
||||||
~/.cargo/registry/index/
|
profile: minimal
|
||||||
~/.cargo/registry/cache/
|
components: llvm-tools-preview
|
||||||
~/.cargo/git/db/
|
- name: Rust Cache
|
||||||
key: ${{ runner.os }}-cargo-${{ hashFiles('**/Cargo.lock') }}
|
uses: Swatinem/rust-cache@v2.2.1
|
||||||
- name: Install grcov
|
- name: Install grcov
|
||||||
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
||||||
|
# TODO: re-enable the hwi tests
|
||||||
|
- name: Build simulator image
|
||||||
|
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||||
|
- name: Run simulator image
|
||||||
|
run: docker run --name simulator --network=host hwi/ledger_emulator &
|
||||||
|
- name: Install Python
|
||||||
|
uses: actions/setup-python@v4
|
||||||
|
with:
|
||||||
|
python-version: '3.9'
|
||||||
|
- name: Install python dependencies
|
||||||
|
run: pip install hwi==2.1.1 protobuf==3.20.1
|
||||||
- name: Test
|
- name: Test
|
||||||
# WARNING: this is not testing the following features: test-esplora, test-hardware-signer, async-interface
|
run: cargo test --all-features
|
||||||
# This is because some of our features are mutually exclusive, and generating various reports and
|
- name: Make coverage directory
|
||||||
# merging them doesn't seem to be working very well.
|
run: mkdir coverage
|
||||||
# For more info, see:
|
|
||||||
# - https://github.com/bitcoindevkit/bdk/issues/696
|
|
||||||
# - https://github.com/bitcoindevkit/bdk/pull/748#issuecomment-1242721040
|
|
||||||
run: cargo test --features all-keys,compact_filters,compiler,key-value-db,sqlite,sqlite-bundled,test-electrum,test-rpc,verify
|
|
||||||
- name: Run grcov
|
- name: Run grcov
|
||||||
run: mkdir coverage; grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --ignore '/*' -o ./coverage/lcov.info
|
run: grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --keep-only '**/crates/**' --ignore '**/tests/**' --ignore '**/examples/**' -o ./coverage/lcov.info
|
||||||
- name: Generate HTML coverage report
|
- name: Generate HTML coverage report
|
||||||
run: genhtml -o coverage-report.html ./coverage/lcov.info
|
run: genhtml -o coverage-report.html --ignore-errors source ./coverage/lcov.info
|
||||||
|
|
||||||
- name: Coveralls upload
|
- name: Coveralls upload
|
||||||
uses: coverallsapp/github-action@master
|
uses: coverallsapp/github-action@master
|
||||||
with:
|
with:
|
||||||
|
|||||||
224
.github/workflows/cont_integration.yml
vendored
224
.github/workflows/cont_integration.yml
vendored
@@ -10,118 +10,62 @@ jobs:
|
|||||||
strategy:
|
strategy:
|
||||||
matrix:
|
matrix:
|
||||||
rust:
|
rust:
|
||||||
- version: 1.65.0 # STABLE
|
- version: stable
|
||||||
clippy: true
|
clippy: true
|
||||||
- version: 1.57.0 # MSRV
|
- version: 1.63.0 # MSRV
|
||||||
features:
|
features:
|
||||||
- default
|
- --no-default-features
|
||||||
- minimal
|
- --all-features
|
||||||
- all-keys
|
|
||||||
- minimal,use-esplora-blocking
|
|
||||||
- key-value-db
|
|
||||||
- electrum
|
|
||||||
- compact_filters
|
|
||||||
- use-esplora-blocking,key-value-db,electrum
|
|
||||||
- compiler
|
|
||||||
- rpc
|
|
||||||
- verify
|
|
||||||
- async-interface
|
|
||||||
- use-esplora-async
|
|
||||||
- sqlite
|
|
||||||
- sqlite-bundled
|
|
||||||
steps:
|
steps:
|
||||||
- name: checkout
|
- name: checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
- name: Generate cache key
|
- name: Install Rust toolchain
|
||||||
run: echo "${{ matrix.rust.version }} ${{ matrix.features }}" | tee .cache_key
|
uses: actions-rs/toolchain@v1
|
||||||
- name: cache
|
|
||||||
uses: actions/cache@v2
|
|
||||||
with:
|
with:
|
||||||
path: |
|
toolchain: ${{ matrix.rust.version }}
|
||||||
~/.cargo/registry
|
override: true
|
||||||
~/.cargo/git
|
profile: minimal
|
||||||
target
|
- name: Rust Cache
|
||||||
key: ${{ runner.os }}-cargo-${{ hashFiles('.cache_key') }}-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
uses: Swatinem/rust-cache@v2.2.1
|
||||||
- name: Set default toolchain
|
- name: Pin dependencies for MSRV
|
||||||
run: rustup default ${{ matrix.rust.version }}
|
if: matrix.rust.version == '1.63.0'
|
||||||
- name: Set profile
|
run: |
|
||||||
run: rustup set profile minimal
|
cargo update -p zstd-sys --precise "2.0.8+zstd.1.5.5"
|
||||||
- name: Add clippy
|
cargo update -p time --precise "0.3.20"
|
||||||
if: ${{ matrix.rust.clippy }}
|
cargo update -p jobserver --precise "0.1.26"
|
||||||
run: rustup component add clippy
|
cargo update -p home --precise "0.5.5"
|
||||||
- name: Update toolchain
|
|
||||||
run: rustup update
|
|
||||||
- name: Build
|
- name: Build
|
||||||
run: cargo build --features ${{ matrix.features }} --no-default-features
|
run: cargo build ${{ matrix.features }}
|
||||||
- name: Clippy
|
|
||||||
if: ${{ matrix.rust.clippy }}
|
|
||||||
run: cargo clippy --all-targets --features ${{ matrix.features }} --no-default-features -- -D warnings
|
|
||||||
- name: Test
|
- name: Test
|
||||||
run: cargo test --features ${{ matrix.features }} --no-default-features
|
run: cargo test ${{ matrix.features }}
|
||||||
|
|
||||||
test-readme-examples:
|
check-no-std:
|
||||||
name: Test README.md examples
|
name: Check no_std
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
|
||||||
- name: checkout
|
|
||||||
uses: actions/checkout@v2
|
|
||||||
- name: cache
|
|
||||||
uses: actions/cache@v2
|
|
||||||
with:
|
|
||||||
path: |
|
|
||||||
~/.cargo/registry
|
|
||||||
~/.cargo/git
|
|
||||||
target
|
|
||||||
key: ${{ runner.os }}-cargo-test-md-docs-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
|
||||||
- name: Set default toolchain
|
|
||||||
run: rustup default nightly
|
|
||||||
- name: Set profile
|
|
||||||
run: rustup set profile minimal
|
|
||||||
- name: Update toolchain
|
|
||||||
run: rustup update
|
|
||||||
- name: Test
|
|
||||||
run: cargo test --features test-md-docs --no-default-features -- doctest::ReadmeDoctests
|
|
||||||
|
|
||||||
test-blockchains:
|
|
||||||
name: Blockchain ${{ matrix.blockchain.features }}
|
|
||||||
runs-on: ubuntu-20.04
|
|
||||||
strategy:
|
|
||||||
fail-fast: false
|
|
||||||
matrix:
|
|
||||||
blockchain:
|
|
||||||
- name: electrum
|
|
||||||
testprefix: blockchain::electrum::test
|
|
||||||
features: test-electrum,verify
|
|
||||||
- name: rpc
|
|
||||||
testprefix: blockchain::rpc::test
|
|
||||||
features: test-rpc
|
|
||||||
- name: rpc-legacy
|
|
||||||
testprefix: blockchain::rpc::test
|
|
||||||
features: test-rpc-legacy
|
|
||||||
- name: esplora
|
|
||||||
testprefix: esplora
|
|
||||||
features: test-esplora,use-esplora-async,verify
|
|
||||||
- name: esplora
|
|
||||||
testprefix: esplora
|
|
||||||
features: test-esplora,use-esplora-blocking,verify
|
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
- name: Cache
|
- name: Install Rust toolchain
|
||||||
uses: actions/cache@v2
|
|
||||||
with:
|
|
||||||
path: |
|
|
||||||
~/.cargo/registry
|
|
||||||
~/.cargo/git
|
|
||||||
target
|
|
||||||
key: ${{ runner.os }}-cargo-${{ github.job }}-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
|
||||||
- name: Setup rust toolchain
|
|
||||||
uses: actions-rs/toolchain@v1
|
uses: actions-rs/toolchain@v1
|
||||||
with:
|
with:
|
||||||
toolchain: stable
|
toolchain: stable
|
||||||
override: true
|
override: true
|
||||||
- name: Test
|
profile: minimal
|
||||||
run: cargo test --no-default-features --features ${{ matrix.blockchain.features }} ${{ matrix.blockchain.testprefix }}::bdk_blockchain_tests
|
# target: "thumbv6m-none-eabi"
|
||||||
|
- name: Rust Cache
|
||||||
|
uses: Swatinem/rust-cache@v2.2.1
|
||||||
|
- name: Check bdk_chain
|
||||||
|
working-directory: ./crates/chain
|
||||||
|
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||||
|
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,hashbrown
|
||||||
|
- name: Check bdk
|
||||||
|
working-directory: ./crates/bdk
|
||||||
|
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||||
|
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown
|
||||||
|
- name: Check esplora
|
||||||
|
working-directory: ./crates/esplora
|
||||||
|
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||||
|
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown
|
||||||
|
|
||||||
check-wasm:
|
check-wasm:
|
||||||
name: Check WASM
|
name: Check WASM
|
||||||
@@ -132,29 +76,25 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
- name: Cache
|
|
||||||
uses: actions/cache@v2
|
|
||||||
with:
|
|
||||||
path: |
|
|
||||||
~/.cargo/registry
|
|
||||||
~/.cargo/git
|
|
||||||
target
|
|
||||||
key: ${{ runner.os }}-cargo-${{ github.job }}-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
|
||||||
# Install a recent version of clang that supports wasm32
|
# Install a recent version of clang that supports wasm32
|
||||||
- run: wget -O - https://apt.llvm.org/llvm-snapshot.gpg.key | sudo apt-key add - || exit 1
|
- run: wget -O - https://apt.llvm.org/llvm-snapshot.gpg.key | sudo apt-key add - || exit 1
|
||||||
- run: sudo apt-add-repository "deb http://apt.llvm.org/focal/ llvm-toolchain-focal-10 main" || exit 1
|
|
||||||
- run: sudo apt-get update || exit 1
|
- run: sudo apt-get update || exit 1
|
||||||
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
||||||
- name: Set default toolchain
|
- name: Install Rust toolchain
|
||||||
run: rustup default 1.65.0 # STABLE
|
uses: actions-rs/toolchain@v1
|
||||||
- name: Set profile
|
with:
|
||||||
run: rustup set profile minimal
|
toolchain: stable
|
||||||
- name: Add target wasm32
|
override: true
|
||||||
run: rustup target add wasm32-unknown-unknown
|
profile: minimal
|
||||||
- name: Update toolchain
|
target: "wasm32-unknown-unknown"
|
||||||
run: rustup update
|
- name: Rust Cache
|
||||||
- name: Check
|
uses: Swatinem/rust-cache@v2.2.1
|
||||||
run: cargo check --target wasm32-unknown-unknown --features async-interface,use-esplora-async,dev-getrandom-wasm --no-default-features
|
- name: Check bdk
|
||||||
|
working-directory: ./crates/bdk
|
||||||
|
run: cargo check --target wasm32-unknown-unknown --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown,dev-getrandom-wasm
|
||||||
|
- name: Check esplora
|
||||||
|
working-directory: ./crates/esplora
|
||||||
|
run: cargo check --target wasm32-unknown-unknown --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown,async
|
||||||
|
|
||||||
fmt:
|
fmt:
|
||||||
name: Rust fmt
|
name: Rust fmt
|
||||||
@@ -162,42 +102,28 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
- name: Set default toolchain
|
- name: Install Rust toolchain
|
||||||
run: rustup default nightly
|
uses: actions-rs/toolchain@v1
|
||||||
- name: Set profile
|
with:
|
||||||
run: rustup set profile minimal
|
toolchain: stable
|
||||||
- name: Add rustfmt
|
override: true
|
||||||
run: rustup component add rustfmt
|
profile: minimal
|
||||||
- name: Update toolchain
|
components: rustfmt
|
||||||
run: rustup update
|
|
||||||
- name: Check fmt
|
- name: Check fmt
|
||||||
run: cargo fmt --all -- --config format_code_in_doc_comments=true --check
|
run: cargo fmt --all -- --config format_code_in_doc_comments=true --check
|
||||||
|
|
||||||
test_hardware_wallet:
|
clippy_check:
|
||||||
runs-on: ubuntu-20.04
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
|
||||||
matrix:
|
|
||||||
rust:
|
|
||||||
- version: 1.65.0 # STABLE
|
|
||||||
- version: 1.57.0 # MSRV
|
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- uses: actions/checkout@v1
|
||||||
uses: actions/checkout@v3
|
- uses: actions-rs/toolchain@v1
|
||||||
- name: Build simulator image
|
with:
|
||||||
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
toolchain: stable
|
||||||
- name: Run simulator image
|
components: clippy
|
||||||
run: docker run --name simulator --network=host hwi/ledger_emulator &
|
override: true
|
||||||
- name: Install Python
|
- name: Rust Cache
|
||||||
uses: actions/setup-python@v4
|
uses: Swatinem/rust-cache@v2.2.1
|
||||||
with:
|
- uses: actions-rs/clippy-check@v1
|
||||||
python-version: '3.9'
|
with:
|
||||||
- name: Install python dependencies
|
token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
run: pip install hwi==2.1.1 protobuf==3.20.1
|
args: --all-features --all-targets -- -D warnings
|
||||||
- name: Set default toolchain
|
|
||||||
run: rustup default ${{ matrix.rust.version }}
|
|
||||||
- name: Set profile
|
|
||||||
run: rustup set profile minimal
|
|
||||||
- name: Update toolchain
|
|
||||||
run: rustup update
|
|
||||||
- name: Test
|
|
||||||
run: cargo test --features test-hardware-signer
|
|
||||||
|
|||||||
14
.github/workflows/nightly_docs.yml
vendored
14
.github/workflows/nightly_docs.yml
vendored
@@ -9,22 +9,18 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Checkout sources
|
- name: Checkout sources
|
||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
- name: Setup cache
|
|
||||||
uses: actions/cache@v2
|
|
||||||
with:
|
|
||||||
path: |
|
|
||||||
~/.cargo/registry
|
|
||||||
~/.cargo/git
|
|
||||||
target
|
|
||||||
key: nightly-docs-${{ hashFiles('**/Cargo.toml','**/Cargo.lock') }}
|
|
||||||
- name: Set default toolchain
|
- name: Set default toolchain
|
||||||
run: rustup default nightly-2022-12-14
|
run: rustup default nightly-2022-12-14
|
||||||
- name: Set profile
|
- name: Set profile
|
||||||
run: rustup set profile minimal
|
run: rustup set profile minimal
|
||||||
- name: Update toolchain
|
- name: Update toolchain
|
||||||
run: rustup update
|
run: rustup update
|
||||||
|
- name: Rust Cache
|
||||||
|
uses: Swatinem/rust-cache@v2.2.1
|
||||||
- name: Build docs
|
- name: Build docs
|
||||||
run: cargo rustdoc --verbose --features=compiler,electrum,esplora,use-esplora-blocking,compact_filters,rpc,key-value-db,sqlite,all-keys,verify,hardware-signer -- --cfg docsrs -Dwarnings
|
run: cargo doc --no-deps
|
||||||
|
env:
|
||||||
|
RUSTDOCFLAGS: '--cfg docsrs -Dwarnings'
|
||||||
- name: Upload artifact
|
- name: Upload artifact
|
||||||
uses: actions/upload-artifact@v2
|
uses: actions/upload-artifact@v2
|
||||||
with:
|
with:
|
||||||
|
|||||||
3
.gitignore
vendored
3
.gitignore
vendored
@@ -4,3 +4,6 @@ Cargo.lock
|
|||||||
|
|
||||||
*.swp
|
*.swp
|
||||||
.idea
|
.idea
|
||||||
|
|
||||||
|
# Example persisted files.
|
||||||
|
*.db
|
||||||
|
|||||||
25
CHANGELOG.md
25
CHANGELOG.md
@@ -9,6 +9,18 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0
|
|||||||
|
|
||||||
## [Unreleased]
|
## [Unreleased]
|
||||||
|
|
||||||
|
## [v0.27.1]
|
||||||
|
|
||||||
|
### Summary
|
||||||
|
|
||||||
|
Fixes [RUSTSEC-2022-0090], this issue is only applicable if you are using the optional sqlite database feature.
|
||||||
|
|
||||||
|
[RUSTSEC-2022-0090]: https://rustsec.org/advisories/RUSTSEC-2022-0090
|
||||||
|
|
||||||
|
### Changed
|
||||||
|
|
||||||
|
- Update optional sqlite dependency from 0.27.0 to 0.28.0. #867
|
||||||
|
|
||||||
## [v0.27.0]
|
## [v0.27.0]
|
||||||
|
|
||||||
### Summary
|
### Summary
|
||||||
@@ -146,7 +158,7 @@ BDK and LDK together.
|
|||||||
- Add the ability to specify which leaves to sign in a taproot transaction through `TapLeavesOptions` in `SignOptions`
|
- Add the ability to specify which leaves to sign in a taproot transaction through `TapLeavesOptions` in `SignOptions`
|
||||||
- Add the ability to specify whether a taproot transaction should be signed using the internal key or not, using `sign_with_tap_internal_key` in `SignOptions`
|
- Add the ability to specify whether a taproot transaction should be signed using the internal key or not, using `sign_with_tap_internal_key` in `SignOptions`
|
||||||
- Consolidate params `fee_amount` and `amount_needed` in `target_amount` in `CoinSelectionAlgorithm::coin_select` signature.
|
- Consolidate params `fee_amount` and `amount_needed` in `target_amount` in `CoinSelectionAlgorithm::coin_select` signature.
|
||||||
- Change the meaning of the `fee_amount` field inside `CoinSelectionResult`: from now on the `fee_amount` will represent only the fees asociated with the utxos in the `selected` field of `CoinSelectionResult`.
|
- Change the meaning of the `fee_amount` field inside `CoinSelectionResult`: from now on the `fee_amount` will represent only the fees associated with the utxos in the `selected` field of `CoinSelectionResult`.
|
||||||
- New `RpcBlockchain` implementation with various fixes.
|
- New `RpcBlockchain` implementation with various fixes.
|
||||||
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
||||||
|
|
||||||
@@ -437,7 +449,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
#### Changed
|
#### Changed
|
||||||
- Simplify the architecture of blockchain traits
|
- Simplify the architecture of blockchain traits
|
||||||
- Improve sync
|
- Improve sync
|
||||||
- Remove unused varaint HeaderParseFail
|
- Remove unused variant `HeaderParseFail`
|
||||||
|
|
||||||
### CLI
|
### CLI
|
||||||
#### Added
|
#### Added
|
||||||
@@ -505,7 +517,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
- Default to SIGHASH_ALL if not specified
|
- Default to SIGHASH_ALL if not specified
|
||||||
- Replace ChangeSpendPolicy::filter_utxos with a predicate
|
- Replace ChangeSpendPolicy::filter_utxos with a predicate
|
||||||
- Make 'unspendable' into a HashSet
|
- Make 'unspendable' into a HashSet
|
||||||
- Stop implicitly enforcing manaul selection by .add_utxo
|
- Stop implicitly enforcing manual selection by .add_utxo
|
||||||
- Rename DumbCS to LargestFirstCoinSelection
|
- Rename DumbCS to LargestFirstCoinSelection
|
||||||
- Rename must_use_utxos to required_utxos
|
- Rename must_use_utxos to required_utxos
|
||||||
- Rename may_use_utxos to optional_uxtos
|
- Rename may_use_utxos to optional_uxtos
|
||||||
@@ -517,7 +529,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
- Use TXIN_DEFAULT_WEIGHT constant in coin selection
|
- Use TXIN_DEFAULT_WEIGHT constant in coin selection
|
||||||
- Replace `must_use` with `required` in coin selection
|
- Replace `must_use` with `required` in coin selection
|
||||||
- Take both spending policies into account in create_tx
|
- Take both spending policies into account in create_tx
|
||||||
- Check last derivation in cache to avoid recomputation
|
- Check last derivation in cache to avoid recomputing
|
||||||
- Use the branch-and-bound cs by default
|
- Use the branch-and-bound cs by default
|
||||||
- Make coin_select return UTXOs instead of TxIns
|
- Make coin_select return UTXOs instead of TxIns
|
||||||
- Build output lookup inside complete transaction
|
- Build output lookup inside complete transaction
|
||||||
@@ -538,7 +550,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
- Require esplora feature for repl example
|
- Require esplora feature for repl example
|
||||||
|
|
||||||
#### Security
|
#### Security
|
||||||
- Use dirs-next instead of dirs since the latter is unmantained
|
- Use dirs-next instead of dirs since the latter is unmaintained
|
||||||
|
|
||||||
## [0.1.0-beta.1] - 2020-09-08
|
## [0.1.0-beta.1] - 2020-09-08
|
||||||
|
|
||||||
@@ -629,4 +641,5 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
[v0.25.0]: https://github.com/bitcoindevkit/bdk/compare/v0.24.0...v0.25.0
|
[v0.25.0]: https://github.com/bitcoindevkit/bdk/compare/v0.24.0...v0.25.0
|
||||||
[v0.26.0]: https://github.com/bitcoindevkit/bdk/compare/v0.25.0...v0.26.0
|
[v0.26.0]: https://github.com/bitcoindevkit/bdk/compare/v0.25.0...v0.26.0
|
||||||
[v0.27.0]: https://github.com/bitcoindevkit/bdk/compare/v0.26.0...v0.27.0
|
[v0.27.0]: https://github.com/bitcoindevkit/bdk/compare/v0.26.0...v0.27.0
|
||||||
[Unreleased]: https://github.com/bitcoindevkit/bdk/compare/v0.27.0...HEAD
|
[v0.27.1]: https://github.com/bitcoindevkit/bdk/compare/v0.27.0...v0.27.1
|
||||||
|
[Unreleased]: https://github.com/bitcoindevkit/bdk/compare/v0.27.1...HEAD
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ The codebase is maintained using the "contributor workflow" where everyone
|
|||||||
without exception contributes patch proposals using "pull requests". This
|
without exception contributes patch proposals using "pull requests". This
|
||||||
facilitates social contribution, easy testing and peer review.
|
facilitates social contribution, easy testing and peer review.
|
||||||
|
|
||||||
To contribute a patch, the worflow is a as follows:
|
To contribute a patch, the workflow is as follows:
|
||||||
|
|
||||||
1. Fork Repository
|
1. Fork Repository
|
||||||
2. Create topic branch
|
2. Create topic branch
|
||||||
@@ -46,15 +46,15 @@ Every new feature should be covered by functional tests where possible.
|
|||||||
When refactoring, structure your PR to make it easy to review and don't
|
When refactoring, structure your PR to make it easy to review and don't
|
||||||
hesitate to split it into multiple small, focused PRs.
|
hesitate to split it into multiple small, focused PRs.
|
||||||
|
|
||||||
The Minimal Supported Rust Version is 1.46 (enforced by our CI).
|
The Minimal Supported Rust Version is **1.57.0** (enforced by our CI).
|
||||||
|
|
||||||
Commits should cover both the issue fixed and the solution's rationale.
|
Commits should cover both the issue fixed and the solution's rationale.
|
||||||
These [guidelines](https://chris.beams.io/posts/git-commit/) should be kept in mind.
|
These [guidelines](https://chris.beams.io/posts/git-commit/) should be kept in mind. Commit messages should follow the ["Conventional Commits 1.0.0"](https://www.conventionalcommits.org/en/v1.0.0/) to make commit histories easier to read by humans and automated tools.
|
||||||
|
|
||||||
To facilitate communication with other contributors, the project is making use
|
To facilitate communication with other contributors, the project is making use
|
||||||
of GitHub's "assignee" field. First check that no one is assigned and then
|
of GitHub's "assignee" field. First check that no one is assigned and then
|
||||||
comment suggesting that you're working on it. If someone is already assigned,
|
comment suggesting that you're working on it. If someone is already assigned,
|
||||||
don't hesitate to ask if the assigned party or previous commenters are still
|
don't hesitate to ask if the assigned party or previous commenter are still
|
||||||
working on it if it has been awhile.
|
working on it if it has been awhile.
|
||||||
|
|
||||||
Deprecation policy
|
Deprecation policy
|
||||||
@@ -91,7 +91,7 @@ This is also enforced by the CI.
|
|||||||
Security
|
Security
|
||||||
--------
|
--------
|
||||||
|
|
||||||
Security is a high priority of BDK; disclosure of security vulnerabilites helps
|
Security is a high priority of BDK; disclosure of security vulnerabilities helps
|
||||||
prevent user loss of funds.
|
prevent user loss of funds.
|
||||||
|
|
||||||
Note that BDK is currently considered "pre-production" during this time, there
|
Note that BDK is currently considered "pre-production" during this time, there
|
||||||
|
|||||||
191
Cargo.toml
191
Cargo.toml
@@ -1,169 +1,24 @@
|
|||||||
[package]
|
|
||||||
name = "bdk"
|
|
||||||
version = "0.27.0"
|
|
||||||
edition = "2018"
|
|
||||||
authors = ["Alekos Filini <alekos.filini@gmail.com>", "Riccardo Casatta <riccardo@casatta.it>"]
|
|
||||||
homepage = "https://bitcoindevkit.org"
|
|
||||||
repository = "https://github.com/bitcoindevkit/bdk"
|
|
||||||
documentation = "https://docs.rs/bdk"
|
|
||||||
description = "A modern, lightweight, descriptor-based wallet library"
|
|
||||||
keywords = ["bitcoin", "wallet", "descriptor", "psbt"]
|
|
||||||
readme = "README.md"
|
|
||||||
license = "MIT OR Apache-2.0"
|
|
||||||
|
|
||||||
[dependencies]
|
|
||||||
bdk-macros = "^0.6"
|
|
||||||
log = "^0.4"
|
|
||||||
miniscript = { version = "9.0", features = ["serde"] }
|
|
||||||
bitcoin = { version = "0.29.1", features = ["serde", "base64", "rand"] }
|
|
||||||
serde = { version = "^1.0", features = ["derive"] }
|
|
||||||
serde_json = { version = "^1.0" }
|
|
||||||
rand = "^0.8"
|
|
||||||
|
|
||||||
# Optional dependencies
|
|
||||||
sled = { version = "0.34", optional = true }
|
|
||||||
electrum-client = { version = "0.12", optional = true }
|
|
||||||
esplora-client = { version = "0.3", default-features = false, optional = true }
|
|
||||||
rusqlite = { version = "0.27.0", optional = true }
|
|
||||||
ahash = { version = "0.7.6", optional = true }
|
|
||||||
futures = { version = "0.3", optional = true }
|
|
||||||
async-trait = { version = "0.1", optional = true }
|
|
||||||
rocksdb = { version = "0.14", default-features = false, features = ["snappy"], optional = true }
|
|
||||||
cc = { version = ">=1.0.64", optional = true }
|
|
||||||
socks = { version = "0.3", optional = true }
|
|
||||||
hwi = { version = "0.5", optional = true, features = [ "use-miniscript"] }
|
|
||||||
|
|
||||||
bip39 = { version = "1.0.1", optional = true }
|
|
||||||
bitcoinconsensus = { version = "0.19.0-3", optional = true }
|
|
||||||
|
|
||||||
# Needed by bdk_blockchain_tests macro and the `rpc` feature
|
|
||||||
bitcoincore-rpc = { version = "0.16", optional = true }
|
|
||||||
|
|
||||||
# Platform-specific dependencies
|
|
||||||
[target.'cfg(not(target_arch = "wasm32"))'.dependencies]
|
|
||||||
tokio = { version = "1", features = ["rt", "macros"] }
|
|
||||||
|
|
||||||
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
|
||||||
getrandom = "0.2"
|
|
||||||
async-trait = "0.1"
|
|
||||||
js-sys = "0.3"
|
|
||||||
|
|
||||||
[features]
|
|
||||||
minimal = []
|
|
||||||
compiler = ["miniscript/compiler"]
|
|
||||||
verify = ["bitcoinconsensus"]
|
|
||||||
default = ["key-value-db", "electrum"]
|
|
||||||
sqlite = ["rusqlite", "ahash"]
|
|
||||||
sqlite-bundled = ["sqlite", "rusqlite/bundled"]
|
|
||||||
compact_filters = ["rocksdb", "socks", "cc"]
|
|
||||||
key-value-db = ["sled"]
|
|
||||||
all-keys = ["keys-bip39"]
|
|
||||||
keys-bip39 = ["bip39"]
|
|
||||||
rpc = ["bitcoincore-rpc"]
|
|
||||||
hardware-signer = ["hwi"]
|
|
||||||
|
|
||||||
# We currently provide mulitple implementations of `Blockchain`, all are
|
|
||||||
# blocking except for the `EsploraBlockchain` which can be either async or
|
|
||||||
# blocking, depending on the HTTP client in use.
|
|
||||||
#
|
|
||||||
# - Users wanting asynchronous HTTP calls should enable `async-interface` to get
|
|
||||||
# access to the asynchronous method implementations. Then, if Esplora is wanted,
|
|
||||||
# enable the `use-esplora-async` feature.
|
|
||||||
# - Users wanting blocking HTTP calls can use any of the other blockchain
|
|
||||||
# implementations (`compact_filters`, `electrum`, or `esplora`). Users wanting to
|
|
||||||
# use Esplora should enable the `use-esplora-blocking` feature.
|
|
||||||
#
|
|
||||||
# WARNING: Please take care with the features below, various combinations will
|
|
||||||
# fail to build. We cannot currently build `bdk` with `--all-features`.
|
|
||||||
async-interface = ["async-trait"]
|
|
||||||
electrum = ["electrum-client"]
|
|
||||||
# MUST ALSO USE `--no-default-features`.
|
|
||||||
use-esplora-async = ["esplora", "esplora-client/async", "futures"]
|
|
||||||
use-esplora-blocking = ["esplora", "esplora-client/blocking"]
|
|
||||||
# Deprecated aliases
|
|
||||||
use-esplora-reqwest = ["use-esplora-async"]
|
|
||||||
use-esplora-ureq = ["use-esplora-blocking"]
|
|
||||||
# Typical configurations will not need to use `esplora` feature directly.
|
|
||||||
esplora = []
|
|
||||||
|
|
||||||
# Use below feature with `use-esplora-async` to enable reqwest default TLS support
|
|
||||||
reqwest-default-tls = ["esplora-client/async-https"]
|
|
||||||
|
|
||||||
# Debug/Test features
|
|
||||||
test-blockchains = ["bitcoincore-rpc", "electrum-client"]
|
|
||||||
test-electrum = ["electrum", "electrsd/electrs_0_8_10", "electrsd/bitcoind_22_0", "test-blockchains"]
|
|
||||||
test-rpc = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_22_0", "test-blockchains"]
|
|
||||||
test-rpc-legacy = ["rpc", "electrsd/electrs_0_8_10", "electrsd/bitcoind_0_20_0", "test-blockchains"]
|
|
||||||
test-esplora = ["electrsd/legacy", "electrsd/esplora_a33e97e1", "electrsd/bitcoind_22_0", "test-blockchains"]
|
|
||||||
test-md-docs = ["electrum"]
|
|
||||||
test-hardware-signer = ["hardware-signer"]
|
|
||||||
|
|
||||||
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
|
||||||
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
|
||||||
# necessary for running our CI. See: https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support
|
|
||||||
dev-getrandom-wasm = ["getrandom/js"]
|
|
||||||
|
|
||||||
[dev-dependencies]
|
|
||||||
lazy_static = "1.4"
|
|
||||||
env_logger = "0.7"
|
|
||||||
electrsd = "0.22"
|
|
||||||
# Move back to importing from rust-bitcoin once https://github.com/rust-bitcoin/rust-bitcoin/pull/1342 is released
|
|
||||||
base64 = "^0.13"
|
|
||||||
assert_matches = "1.5.0"
|
|
||||||
# zip versions after 0.6.3 don't work with our MSRV 1.57.0
|
|
||||||
zip = "=0.6.3"
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "compact_filters_balance"
|
|
||||||
required-features = ["compact_filters"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "miniscriptc"
|
|
||||||
path = "examples/compiler.rs"
|
|
||||||
required-features = ["compiler"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "policy"
|
|
||||||
path = "examples/policy.rs"
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "rpcwallet"
|
|
||||||
path = "examples/rpcwallet.rs"
|
|
||||||
required-features = ["keys-bip39", "key-value-db", "rpc", "electrsd/bitcoind_22_0"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "psbt_signer"
|
|
||||||
path = "examples/psbt_signer.rs"
|
|
||||||
required-features = ["electrum"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "hardware_signer"
|
|
||||||
path = "examples/hardware_signer.rs"
|
|
||||||
required-features = ["electrum", "hardware-signer"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "electrum_backend"
|
|
||||||
path = "examples/electrum_backend.rs"
|
|
||||||
required-features = ["electrum"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "esplora_backend_synchronous"
|
|
||||||
path = "examples/esplora_backend_synchronous.rs"
|
|
||||||
required-features = ["use-esplora-ureq"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "esplora_backend_asynchronous"
|
|
||||||
path = "examples/esplora_backend_asynchronous.rs"
|
|
||||||
required-features = ["use-esplora-reqwest", "reqwest-default-tls", "async-interface"]
|
|
||||||
|
|
||||||
[[example]]
|
|
||||||
name = "mnemonic_to_descriptors"
|
|
||||||
path = "examples/mnemonic_to_descriptors.rs"
|
|
||||||
required-features = ["all-keys"]
|
|
||||||
|
|
||||||
[workspace]
|
[workspace]
|
||||||
members = ["macros"]
|
resolver = "2"
|
||||||
[package.metadata.docs.rs]
|
members = [
|
||||||
features = ["compiler", "electrum", "esplora", "use-esplora-blocking", "compact_filters", "rpc", "key-value-db", "sqlite", "all-keys", "verify", "hardware-signer"]
|
"crates/bdk",
|
||||||
# defines the configuration attribute `docsrs`
|
"crates/chain",
|
||||||
rustdoc-args = ["--cfg", "docsrs"]
|
"crates/file_store",
|
||||||
|
"crates/electrum",
|
||||||
|
"crates/esplora",
|
||||||
|
"crates/bitcoind_rpc",
|
||||||
|
"crates/hwi",
|
||||||
|
"example-crates/example_cli",
|
||||||
|
"example-crates/example_electrum",
|
||||||
|
"example-crates/example_esplora",
|
||||||
|
"example-crates/example_bitcoind_rpc_polling",
|
||||||
|
"example-crates/wallet_electrum",
|
||||||
|
"example-crates/wallet_esplora_blocking",
|
||||||
|
"example-crates/wallet_esplora_async",
|
||||||
|
"example-crates/wallet_rpc",
|
||||||
|
"nursery/tmp_plan",
|
||||||
|
"nursery/coin_select"
|
||||||
|
]
|
||||||
|
|
||||||
|
[workspace.package]
|
||||||
|
authors = ["Bitcoin Dev Kit Developers"]
|
||||||
|
|||||||
207
README.md
207
README.md
@@ -1,3 +1,5 @@
|
|||||||
|
# The Bitcoin Dev Kit
|
||||||
|
|
||||||
<div align="center">
|
<div align="center">
|
||||||
<h1>BDK</h1>
|
<h1>BDK</h1>
|
||||||
|
|
||||||
@@ -13,7 +15,7 @@
|
|||||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||||
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||||
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
<a href="https://blog.rust-lang.org/2022/08/11/Rust-1.63.0.html"><img alt="Rustc Version 1.63.0+" src="https://img.shields.io/badge/rustc-1.63.0%2B-lightgrey.svg"/></a>
|
||||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||||
</p>
|
</p>
|
||||||
|
|
||||||
@@ -26,178 +28,67 @@
|
|||||||
|
|
||||||
## About
|
## About
|
||||||
|
|
||||||
The `bdk` library aims to be the core building block for Bitcoin wallets of any kind.
|
The `bdk` libraries aims to provide well engineered and reviewed components for Bitcoin based applications.
|
||||||
|
It is built upon the excellent [`rust-bitcoin`] and [`rust-miniscript`] crates.
|
||||||
|
|
||||||
* It uses [Miniscript](https://github.com/rust-bitcoin/rust-miniscript) to support descriptors with generalized conditions. This exact same library can be used to build
|
> ⚠ The Bitcoin Dev Kit developers are in the process of releasing a `v1.0` which is a fundamental re-write of how the library works.
|
||||||
single-sig wallets, multisigs, timelocked contracts and more.
|
> See for some background on this project: https://bitcoindevkit.org/blog/road-to-bdk-1/ (ignore the timeline 😁)
|
||||||
* It supports multiple blockchain backends and databases, allowing developers to choose exactly what's right for their projects.
|
> For a release timeline see the [`BDK 1.0 project page`].
|
||||||
* It's built to be cross-platform: the core logic works on desktop, mobile, and even WebAssembly.
|
|
||||||
* It's very easy to extend: developers can implement customized logic for blockchain backends, databases, signers, coin selection, and more, without having to fork and modify this library.
|
|
||||||
|
|
||||||
## Examples
|
## Architecture
|
||||||
|
|
||||||
### Sync the balance of a descriptor
|
The project is split up into several crates in the `/crates` directory:
|
||||||
|
|
||||||
```rust,no_run
|
- [`bdk`](./crates/bdk): Contains the central high level `Wallet` type that is built from the low-level mechanisms provided by the other components
|
||||||
use bdk::Wallet;
|
- [`chain`](./crates/chain): Tools for storing and indexing chain data
|
||||||
use bdk::database::MemoryDatabase;
|
- [`file_store`](./crates/file_store): A (experimental) persistence backend for storing chain data in a single file.
|
||||||
use bdk::blockchain::ElectrumBlockchain;
|
- [`esplora`](./crates/esplora): Extends the [`esplora-client`] crate with methods to fetch chain data from an esplora HTTP server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||||
use bdk::SyncOptions;
|
- [`electrum`](./crates/electrum): Extends the [`electrum-client`] crate with methods to fetch chain data from an electrum server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||||
use bdk::electrum_client::Client;
|
|
||||||
use bdk::bitcoin::Network;
|
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
Fully working examples of how to use these components are in `/example-crates`:
|
||||||
let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
- [`example_cli`](./example-crates/example_cli): Library used by the `example_*` crates. Provides utilities for syncing, showing the balance, generating addresses and creating transactions without using the bdk `Wallet`.
|
||||||
let wallet = Wallet::new(
|
- [`example_electrum`](./example-crates/example_electrum): A command line Bitcoin wallet application built on top of `example_cli` and the `electrum` crate. It shows the power of the bdk tools (`chain` + `file_store` + `electrum`), without depending on the main `bdk` library.
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
- [`example_esplora`](./example-crates/example_esplora): A command line Bitcoin wallet application built on top of `example_cli` and the `esplora` crate. It shows the power of the bdk tools (`chain` + `file_store` + `esplora`), without depending on the main `bdk` library.
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
- [`example_bitcoind_rpc_polling`](./example-crates/example_bitcoind_rpc_polling): A command line Bitcoin wallet application built on top of `example_cli` and the `bitcoind_rpc` crate. It shows the power of the bdk tools (`chain` + `file_store` + `bitcoind_rpc`), without depending on the main `bdk` library.
|
||||||
Network::Testnet,
|
- [`wallet_esplora_blocking`](./example-crates/wallet_esplora_blocking): Uses the `Wallet` to sync and spend using the Esplora blocking interface.
|
||||||
MemoryDatabase::default(),
|
- [`wallet_esplora_async`](./example-crates/wallet_esplora_async): Uses the `Wallet` to sync and spend using the Esplora asynchronous interface.
|
||||||
)?;
|
- [`wallet_electrum`](./example-crates/wallet_electrum): Uses the `Wallet` to sync and spend using Electrum.
|
||||||
|
|
||||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
[`BDK 1.0 project page`]: https://github.com/orgs/bitcoindevkit/projects/14
|
||||||
|
[`rust-miniscript`]: https://github.com/rust-bitcoin/rust-miniscript
|
||||||
|
[`rust-bitcoin`]: https://github.com/rust-bitcoin/rust-bitcoin
|
||||||
|
[`esplora-client`]: https://docs.rs/esplora-client/
|
||||||
|
[`electrum-client`]: https://docs.rs/electrum-client/
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||||
|
|
||||||
println!("Descriptor balance: {} SAT", wallet.get_balance()?);
|
## Minimum Supported Rust Version (MSRV)
|
||||||
|
This library should compile with any combination of features with Rust 1.63.0.
|
||||||
|
|
||||||
Ok(())
|
To build with the MSRV you will need to pin dependencies as follows:
|
||||||
}
|
|
||||||
|
```shell
|
||||||
|
# zip 0.6.3 has MSRV 1.64.0
|
||||||
|
cargo update -p zip --precise "0.6.2"
|
||||||
|
# time 0.3.21 has MSRV 1.65.0
|
||||||
|
cargo update -p time --precise "0.3.20"
|
||||||
|
# jobserver 0.1.27 has MSRV 1.66.0
|
||||||
|
cargo update -p jobserver --precise "0.1.26"
|
||||||
|
# home 0.5.9 has MSRV 1.70.0
|
||||||
|
cargo update -p home --precise "0.5.5"
|
||||||
```
|
```
|
||||||
|
|
||||||
### Generate a few addresses
|
|
||||||
|
|
||||||
```rust
|
|
||||||
use bdk::{Wallet, database::MemoryDatabase};
|
|
||||||
use bdk::wallet::AddressIndex::New;
|
|
||||||
use bdk::bitcoin::Network;
|
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
|
||||||
let wallet = Wallet::new(
|
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
|
||||||
Network::Testnet,
|
|
||||||
MemoryDatabase::default(),
|
|
||||||
)?;
|
|
||||||
|
|
||||||
println!("Address #0: {}", wallet.get_address(New)?);
|
|
||||||
println!("Address #1: {}", wallet.get_address(New)?);
|
|
||||||
println!("Address #2: {}", wallet.get_address(New)?);
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
```
|
|
||||||
|
|
||||||
### Create a transaction
|
|
||||||
|
|
||||||
```rust,no_run
|
|
||||||
use bdk::{FeeRate, Wallet, SyncOptions};
|
|
||||||
use bdk::database::MemoryDatabase;
|
|
||||||
use bdk::blockchain::ElectrumBlockchain;
|
|
||||||
|
|
||||||
use bdk::electrum_client::Client;
|
|
||||||
use bdk::wallet::AddressIndex::New;
|
|
||||||
|
|
||||||
use base64;
|
|
||||||
use bdk::bitcoin::consensus::serialize;
|
|
||||||
use bdk::bitcoin::Network;
|
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
|
||||||
let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?);
|
|
||||||
let wallet = Wallet::new(
|
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)",
|
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"),
|
|
||||||
Network::Testnet,
|
|
||||||
MemoryDatabase::default(),
|
|
||||||
)?;
|
|
||||||
|
|
||||||
wallet.sync(&blockchain, SyncOptions::default())?;
|
|
||||||
|
|
||||||
let send_to = wallet.get_address(New)?;
|
|
||||||
let (psbt, details) = {
|
|
||||||
let mut builder = wallet.build_tx();
|
|
||||||
builder
|
|
||||||
.add_recipient(send_to.script_pubkey(), 50_000)
|
|
||||||
.enable_rbf()
|
|
||||||
.do_not_spend_change()
|
|
||||||
.fee_rate(FeeRate::from_sat_per_vb(5.0));
|
|
||||||
builder.finish()?
|
|
||||||
};
|
|
||||||
|
|
||||||
println!("Transaction details: {:#?}", details);
|
|
||||||
println!("Unsigned PSBT: {}", base64::encode(&serialize(&psbt)));
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
```
|
|
||||||
|
|
||||||
### Sign a transaction
|
|
||||||
|
|
||||||
```rust,no_run
|
|
||||||
use bdk::{Wallet, SignOptions, database::MemoryDatabase};
|
|
||||||
|
|
||||||
use base64;
|
|
||||||
use bdk::bitcoin::consensus::deserialize;
|
|
||||||
use bdk::bitcoin::Network;
|
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
|
||||||
let wallet = Wallet::new(
|
|
||||||
"wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/0/*)",
|
|
||||||
Some("wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/1/*)"),
|
|
||||||
Network::Testnet,
|
|
||||||
MemoryDatabase::default(),
|
|
||||||
)?;
|
|
||||||
|
|
||||||
let psbt = "...";
|
|
||||||
let mut psbt = deserialize(&base64::decode(psbt).unwrap())?;
|
|
||||||
|
|
||||||
let _finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
```
|
|
||||||
|
|
||||||
## Testing
|
|
||||||
|
|
||||||
### Unit testing
|
|
||||||
|
|
||||||
```bash
|
|
||||||
cargo test
|
|
||||||
```
|
|
||||||
|
|
||||||
### Integration testing
|
|
||||||
|
|
||||||
Integration testing require testing features, for example:
|
|
||||||
|
|
||||||
```bash
|
|
||||||
cargo test --features test-electrum
|
|
||||||
```
|
|
||||||
|
|
||||||
The other options are `test-esplora`, `test-rpc` or `test-rpc-legacy` which runs against an older version of Bitcoin Core.
|
|
||||||
Note that `electrs` and `bitcoind` binaries are automatically downloaded (on mac and linux), to specify you already have installed binaries you must use `--no-default-features` and provide `BITCOIND_EXE` and `ELECTRS_EXE` as environment variables.
|
|
||||||
|
|
||||||
## Running under WASM
|
|
||||||
|
|
||||||
If you want to run this library under WASM you will probably have to add the following lines to you `Cargo.toml`:
|
|
||||||
|
|
||||||
```toml
|
|
||||||
[dependencies]
|
|
||||||
getrandom = { version = "0.2", features = ["js"] }
|
|
||||||
```
|
|
||||||
|
|
||||||
This enables the `rand` crate to work in environments where JavaScript is available. See [this link](https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support) to learn more.
|
|
||||||
|
|
||||||
## License
|
## License
|
||||||
|
|
||||||
Licensed under either of
|
Licensed under either of
|
||||||
|
|
||||||
* Apache License, Version 2.0
|
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||||
([LICENSE-APACHE](LICENSE-APACHE) or http://www.apache.org/licenses/LICENSE-2.0)
|
* MIT license ([LICENSE-MIT](LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||||
* MIT license
|
|
||||||
([LICENSE-MIT](LICENSE-MIT) or http://opensource.org/licenses/MIT)
|
|
||||||
|
|
||||||
at your option.
|
at your option.
|
||||||
|
|
||||||
## Contribution
|
### Contribution
|
||||||
|
|
||||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
Unless you explicitly state otherwise, any contribution intentionally
|
||||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
submitted for inclusion in the work by you, as defined in the Apache-2.0
|
||||||
dual licensed as above, without any additional terms or conditions.
|
license, shall be dual licensed as above, without any additional terms or
|
||||||
|
conditions.
|
||||||
|
|||||||
@@ -6,4 +6,4 @@ RUN apt-get install wget -y
|
|||||||
RUN wget "https://github.com/LedgerHQ/speculos/blob/master/apps/nanos%23btc%232.1%231c8db8da.elf?raw=true" -O /speculos/btc.elf
|
RUN wget "https://github.com/LedgerHQ/speculos/blob/master/apps/nanos%23btc%232.1%231c8db8da.elf?raw=true" -O /speculos/btc.elf
|
||||||
ADD automation.json /speculos/automation.json
|
ADD automation.json /speculos/automation.json
|
||||||
|
|
||||||
ENTRYPOINT ["python", "./speculos.py", "--automation", "file:automation.json", "--display", "headless", "--vnc-port", "41000", "btc.elf"]
|
ENTRYPOINT ["python", "./speculos.py", "--automation", "file:automation.json", "--model", "nanos", "--display", "headless", "--vnc-port", "41000", "btc.elf"]
|
||||||
|
|||||||
1
clippy.toml
Normal file
1
clippy.toml
Normal file
@@ -0,0 +1 @@
|
|||||||
|
msrv="1.63.0"
|
||||||
61
crates/bdk/Cargo.toml
Normal file
61
crates/bdk/Cargo.toml
Normal file
@@ -0,0 +1,61 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
version = "1.0.0-alpha.5"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk"
|
||||||
|
description = "A modern, lightweight, descriptor-based wallet library"
|
||||||
|
keywords = ["bitcoin", "wallet", "descriptor", "psbt"]
|
||||||
|
readme = "README.md"
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
authors = ["Bitcoin Dev Kit Developers"]
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.63"
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
rand = "^0.8"
|
||||||
|
miniscript = { version = "10.0.0", features = ["serde"], default-features = false }
|
||||||
|
bitcoin = { version = "0.30.0", features = ["serde", "base64", "rand-std"], default-features = false }
|
||||||
|
serde = { version = "^1.0", features = ["derive"] }
|
||||||
|
serde_json = { version = "^1.0" }
|
||||||
|
bdk_chain = { path = "../chain", version = "0.9.0", features = ["miniscript", "serde"], default-features = false }
|
||||||
|
|
||||||
|
# Optional dependencies
|
||||||
|
bip39 = { version = "2.0", optional = true }
|
||||||
|
|
||||||
|
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
||||||
|
getrandom = "0.2"
|
||||||
|
js-sys = "0.3"
|
||||||
|
|
||||||
|
[features]
|
||||||
|
default = ["std"]
|
||||||
|
std = ["bitcoin/std", "miniscript/std", "bdk_chain/std"]
|
||||||
|
compiler = ["miniscript/compiler"]
|
||||||
|
all-keys = ["keys-bip39"]
|
||||||
|
keys-bip39 = ["bip39"]
|
||||||
|
|
||||||
|
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
||||||
|
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
||||||
|
# necessary for running our CI. See: https://docs.rs/getrandom/0.2.8/getrandom/#webassembly-support
|
||||||
|
dev-getrandom-wasm = ["getrandom/js"]
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
lazy_static = "1.4"
|
||||||
|
assert_matches = "1.5.0"
|
||||||
|
tempfile = "3"
|
||||||
|
bdk_file_store = { path = "../file_store" }
|
||||||
|
anyhow = "1"
|
||||||
|
|
||||||
|
[package.metadata.docs.rs]
|
||||||
|
all-features = true
|
||||||
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "mnemonic_to_descriptors"
|
||||||
|
path = "examples/mnemonic_to_descriptors.rs"
|
||||||
|
required-features = ["all-keys"]
|
||||||
|
|
||||||
|
[[example]]
|
||||||
|
name = "miniscriptc"
|
||||||
|
path = "examples/compiler.rs"
|
||||||
|
required-features = ["compiler"]
|
||||||
226
crates/bdk/README.md
Normal file
226
crates/bdk/README.md
Normal file
@@ -0,0 +1,226 @@
|
|||||||
|
<div align="center">
|
||||||
|
<h1>BDK</h1>
|
||||||
|
|
||||||
|
<img src="https://raw.githubusercontent.com/bitcoindevkit/bdk/master/static/bdk.png" width="220" />
|
||||||
|
|
||||||
|
<p>
|
||||||
|
<strong>A modern, lightweight, descriptor-based wallet library written in Rust!</strong>
|
||||||
|
</p>
|
||||||
|
|
||||||
|
<p>
|
||||||
|
<a href="https://crates.io/crates/bdk"><img alt="Crate Info" src="https://img.shields.io/crates/v/bdk.svg"/></a>
|
||||||
|
<a href="https://github.com/bitcoindevkit/bdk/blob/master/LICENSE"><img alt="MIT or Apache-2.0 Licensed" src="https://img.shields.io/badge/license-MIT%2FApache--2.0-blue.svg"/></a>
|
||||||
|
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||||
|
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||||
|
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||||
|
<a href="https://blog.rust-lang.org/2022/08/11/Rust-1.63.0.html"><img alt="Rustc Version 1.63.0+" src="https://img.shields.io/badge/rustc-1.63.0%2B-lightgrey.svg"/></a>
|
||||||
|
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||||
|
</p>
|
||||||
|
|
||||||
|
<h4>
|
||||||
|
<a href="https://bitcoindevkit.org">Project Homepage</a>
|
||||||
|
<span> | </span>
|
||||||
|
<a href="https://docs.rs/bdk">Documentation</a>
|
||||||
|
</h4>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
## `bdk`
|
||||||
|
|
||||||
|
The `bdk` crate provides the [`Wallet`](`crate::Wallet`) type which is a simple, high-level
|
||||||
|
interface built from the low-level components of [`bdk_chain`]. `Wallet` is a good starting point
|
||||||
|
for many simple applications as well as a good demonstration of how to use the other mechanisms to
|
||||||
|
construct a wallet. It has two keychains (external and internal) which are defined by
|
||||||
|
[miniscript descriptors][`rust-miniscript`] and uses them to generate addresses. When you give it
|
||||||
|
chain data it also uses the descriptors to find transaction outputs owned by them. From there, you
|
||||||
|
can create and sign transactions.
|
||||||
|
|
||||||
|
For more information, see the [`Wallet`'s documentation](https://docs.rs/bdk/latest/bdk/wallet/struct.Wallet.html).
|
||||||
|
|
||||||
|
### Blockchain data
|
||||||
|
|
||||||
|
In order to get blockchain data for `Wallet` to consume, you have to put it into particular form.
|
||||||
|
Right now this is [`KeychainScan`] which is defined in [`bdk_chain`].
|
||||||
|
|
||||||
|
This can be created manually or from blockchain-scanning crates.
|
||||||
|
|
||||||
|
**Blockchain Data Sources**
|
||||||
|
|
||||||
|
* [`bdk_esplora`]: Grabs blockchain data from Esplora for updating BDK structures.
|
||||||
|
* [`bdk_electrum`]: Grabs blockchain data from Electrum for updating BDK structures.
|
||||||
|
|
||||||
|
**Examples**
|
||||||
|
|
||||||
|
* [`example-crates/wallet_esplora`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora)
|
||||||
|
* [`example-crates/wallet_electrum`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_electrum)
|
||||||
|
|
||||||
|
### Persistence
|
||||||
|
|
||||||
|
To persist the `Wallet` on disk, `Wallet` needs to be constructed with a
|
||||||
|
[`Persist`](https://docs.rs/bdk_chain/latest/bdk_chain/keychain/struct.KeychainPersist.html) implementation.
|
||||||
|
|
||||||
|
**Implementations**
|
||||||
|
|
||||||
|
* [`bdk_file_store`]: a simple flat-file implementation of `Persist`.
|
||||||
|
|
||||||
|
**Example**
|
||||||
|
|
||||||
|
```rust
|
||||||
|
use bdk::{bitcoin::Network, wallet::{AddressIndex, Wallet}};
|
||||||
|
|
||||||
|
fn main() {
|
||||||
|
// a type that implements `Persist`
|
||||||
|
let db = ();
|
||||||
|
|
||||||
|
let descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/0'/0'/0/*)";
|
||||||
|
let mut wallet = Wallet::new(descriptor, None, db, Network::Testnet).expect("should create");
|
||||||
|
|
||||||
|
// get a new address (this increments revealed derivation index)
|
||||||
|
println!("revealed address: {}", wallet.get_address(AddressIndex::New));
|
||||||
|
println!("staged changes: {:?}", wallet.staged());
|
||||||
|
// persist changes
|
||||||
|
wallet.commit().expect("must save");
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
<!-- ### Sync the balance of a descriptor -->
|
||||||
|
|
||||||
|
<!-- ```rust,no_run -->
|
||||||
|
<!-- use bdk::Wallet; -->
|
||||||
|
<!-- use bdk::blockchain::ElectrumBlockchain; -->
|
||||||
|
<!-- use bdk::SyncOptions; -->
|
||||||
|
<!-- use bdk::electrum_client::Client; -->
|
||||||
|
<!-- use bdk::bitcoin::Network; -->
|
||||||
|
|
||||||
|
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||||
|
<!-- let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?); -->
|
||||||
|
<!-- let wallet = Wallet::new( -->
|
||||||
|
<!-- "wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)", -->
|
||||||
|
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"), -->
|
||||||
|
<!-- Network::Testnet, -->
|
||||||
|
<!-- )?; -->
|
||||||
|
|
||||||
|
<!-- wallet.sync(&blockchain, SyncOptions::default())?; -->
|
||||||
|
|
||||||
|
<!-- println!("Descriptor balance: {} SAT", wallet.get_balance()?); -->
|
||||||
|
|
||||||
|
<!-- Ok(()) -->
|
||||||
|
<!-- } -->
|
||||||
|
<!-- ``` -->
|
||||||
|
<!-- ### Generate a few addresses -->
|
||||||
|
|
||||||
|
<!-- ```rust -->
|
||||||
|
<!-- use bdk::Wallet; -->
|
||||||
|
<!-- use bdk::wallet::AddressIndex::New; -->
|
||||||
|
<!-- use bdk::bitcoin::Network; -->
|
||||||
|
|
||||||
|
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||||
|
<!-- let wallet = Wallet::new_no_persist( -->
|
||||||
|
<!-- "wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)", -->
|
||||||
|
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"), -->
|
||||||
|
<!-- Network::Testnet, -->
|
||||||
|
<!-- )?; -->
|
||||||
|
|
||||||
|
<!-- println!("Address #0: {}", wallet.get_address(New)); -->
|
||||||
|
<!-- println!("Address #1: {}", wallet.get_address(New)); -->
|
||||||
|
<!-- println!("Address #2: {}", wallet.get_address(New)); -->
|
||||||
|
|
||||||
|
<!-- Ok(()) -->
|
||||||
|
<!-- } -->
|
||||||
|
<!-- ``` -->
|
||||||
|
|
||||||
|
<!-- ### Create a transaction -->
|
||||||
|
|
||||||
|
<!-- ```rust,no_run -->
|
||||||
|
<!-- use bdk::{FeeRate, Wallet, SyncOptions}; -->
|
||||||
|
<!-- use bdk::blockchain::ElectrumBlockchain; -->
|
||||||
|
|
||||||
|
<!-- use bdk::electrum_client::Client; -->
|
||||||
|
<!-- use bdk::wallet::AddressIndex::New; -->
|
||||||
|
|
||||||
|
<!-- use bitcoin::base64; -->
|
||||||
|
<!-- use bdk::bitcoin::consensus::serialize; -->
|
||||||
|
<!-- use bdk::bitcoin::Network; -->
|
||||||
|
|
||||||
|
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||||
|
<!-- let blockchain = ElectrumBlockchain::from(Client::new("ssl://electrum.blockstream.info:60002")?); -->
|
||||||
|
<!-- let wallet = Wallet::new_no_persist( -->
|
||||||
|
<!-- "wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/0/*)", -->
|
||||||
|
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tpubDDYkZojQFQjht8Tm4jsS3iuEmKjTiEGjG6KnuFNKKJb5A6ZUCUZKdvLdSDWofKi4ToRCwb9poe1XdqfUnP4jaJjCB2Zwv11ZLgSbnZSNecE/1/*)"), -->
|
||||||
|
<!-- Network::Testnet, -->
|
||||||
|
<!-- )?; -->
|
||||||
|
|
||||||
|
<!-- wallet.sync(&blockchain, SyncOptions::default())?; -->
|
||||||
|
|
||||||
|
<!-- let send_to = wallet.get_address(New); -->
|
||||||
|
<!-- let (psbt, details) = { -->
|
||||||
|
<!-- let mut builder = wallet.build_tx(); -->
|
||||||
|
<!-- builder -->
|
||||||
|
<!-- .add_recipient(send_to.script_pubkey(), 50_000) -->
|
||||||
|
<!-- .enable_rbf() -->
|
||||||
|
<!-- .do_not_spend_change() -->
|
||||||
|
<!-- .fee_rate(FeeRate::from_sat_per_vb(5.0)); -->
|
||||||
|
<!-- builder.finish()? -->
|
||||||
|
<!-- }; -->
|
||||||
|
|
||||||
|
<!-- println!("Transaction details: {:#?}", details); -->
|
||||||
|
<!-- println!("Unsigned PSBT: {}", base64::encode(&serialize(&psbt))); -->
|
||||||
|
|
||||||
|
<!-- Ok(()) -->
|
||||||
|
<!-- } -->
|
||||||
|
<!-- ``` -->
|
||||||
|
|
||||||
|
<!-- ### Sign a transaction -->
|
||||||
|
|
||||||
|
<!-- ```rust,no_run -->
|
||||||
|
<!-- use bdk::{Wallet, SignOptions}; -->
|
||||||
|
|
||||||
|
<!-- use bitcoin::base64; -->
|
||||||
|
<!-- use bdk::bitcoin::consensus::deserialize; -->
|
||||||
|
<!-- use bdk::bitcoin::Network; -->
|
||||||
|
|
||||||
|
<!-- fn main() -> Result<(), bdk::Error> { -->
|
||||||
|
<!-- let wallet = Wallet::new_no_persist( -->
|
||||||
|
<!-- "wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/0/*)", -->
|
||||||
|
<!-- Some("wpkh([c258d2e4/84h/1h/0h]tprv8griRPhA7342zfRyB6CqeKF8CJDXYu5pgnj1cjL1u2ngKcJha5jjTRimG82ABzJQ4MQe71CV54xfn25BbhCNfEGGJZnxvCDQCd6JkbvxW6h/1/*)"), -->
|
||||||
|
<!-- Network::Testnet, -->
|
||||||
|
<!-- )?; -->
|
||||||
|
|
||||||
|
<!-- let psbt = "..."; -->
|
||||||
|
<!-- let mut psbt = deserialize(&base64::decode(psbt).unwrap())?; -->
|
||||||
|
|
||||||
|
<!-- let _finalized = wallet.sign(&mut psbt, SignOptions::default())?; -->
|
||||||
|
|
||||||
|
<!-- Ok(()) -->
|
||||||
|
<!-- } -->
|
||||||
|
<!-- ``` -->
|
||||||
|
|
||||||
|
## Testing
|
||||||
|
|
||||||
|
### Unit testing
|
||||||
|
|
||||||
|
```bash
|
||||||
|
cargo test
|
||||||
|
```
|
||||||
|
|
||||||
|
## License
|
||||||
|
|
||||||
|
Licensed under either of
|
||||||
|
|
||||||
|
* Apache License, Version 2.0, ([LICENSE-APACHE](../../LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||||
|
* MIT license ([LICENSE-MIT](../../LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||||
|
|
||||||
|
at your option.
|
||||||
|
|
||||||
|
### Contribution
|
||||||
|
|
||||||
|
Unless you explicitly state otherwise, any contribution intentionally
|
||||||
|
submitted for inclusion in the work by you, as defined in the Apache-2.0
|
||||||
|
license, shall be dual licensed as above, without any additional terms or
|
||||||
|
conditions.
|
||||||
|
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
||||||
|
[`bdk_file_store`]: https://docs.rs/bdk_file_store/latest
|
||||||
|
[`bdk_electrum`]: https://docs.rs/bdk_electrum/latest
|
||||||
|
[`bdk_esplora`]: https://docs.rs/bdk_esplora/latest
|
||||||
|
[`KeychainScan`]: https://docs.rs/bdk_chain/latest/bdk_chain/keychain/struct.KeychainScan.html
|
||||||
|
[`rust-miniscript`]: https://docs.rs/miniscript/latest/miniscript/index.html
|
||||||
@@ -11,20 +11,16 @@
|
|||||||
|
|
||||||
extern crate bdk;
|
extern crate bdk;
|
||||||
extern crate bitcoin;
|
extern crate bitcoin;
|
||||||
extern crate log;
|
|
||||||
extern crate miniscript;
|
extern crate miniscript;
|
||||||
extern crate serde_json;
|
extern crate serde_json;
|
||||||
|
|
||||||
use std::error::Error;
|
use std::error::Error;
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use log::info;
|
|
||||||
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use miniscript::policy::Concrete;
|
use miniscript::policy::Concrete;
|
||||||
use miniscript::Descriptor;
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
use bdk::database::memory::MemoryDatabase;
|
|
||||||
use bdk::wallet::AddressIndex::New;
|
use bdk::wallet::AddressIndex::New;
|
||||||
use bdk::{KeychainKind, Wallet};
|
use bdk::{KeychainKind, Wallet};
|
||||||
|
|
||||||
@@ -37,13 +33,9 @@ use bdk::{KeychainKind, Wallet};
|
|||||||
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
||||||
|
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
env_logger::init_from_env(
|
|
||||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
|
||||||
);
|
|
||||||
|
|
||||||
// We start with a generic miniscript policy string
|
// We start with a generic miniscript policy string
|
||||||
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
||||||
info!("Compiling policy: \n{}", policy_str);
|
println!("Compiling policy: \n{}", policy_str);
|
||||||
|
|
||||||
// Parse the string as a [`Concrete`] type miniscript policy.
|
// Parse the string as a [`Concrete`] type miniscript policy.
|
||||||
let policy = Concrete::<String>::from_str(policy_str)?;
|
let policy = Concrete::<String>::from_str(policy_str)?;
|
||||||
@@ -52,22 +44,20 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// `policy.compile()` returns the resulting miniscript from the policy.
|
// `policy.compile()` returns the resulting miniscript from the policy.
|
||||||
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
||||||
|
|
||||||
info!("Compiled into following Descriptor: \n{}", descriptor);
|
println!("Compiled into following Descriptor: \n{}", descriptor);
|
||||||
|
|
||||||
let database = MemoryDatabase::new();
|
|
||||||
|
|
||||||
// Create a new wallet from this descriptor
|
// Create a new wallet from this descriptor
|
||||||
let wallet = Wallet::new(&format!("{}", descriptor), None, Network::Regtest, database)?;
|
let mut wallet = Wallet::new_no_persist(&format!("{}", descriptor), None, Network::Regtest)?;
|
||||||
|
|
||||||
info!(
|
println!(
|
||||||
"First derived address from the descriptor: \n{}",
|
"First derived address from the descriptor: \n{}",
|
||||||
wallet.get_address(New)?
|
wallet.get_address(New)
|
||||||
);
|
);
|
||||||
|
|
||||||
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
||||||
// human readable json format.
|
// human readable json format.
|
||||||
let spending_policy = wallet.policies(KeychainKind::External)?;
|
let spending_policy = wallet.policies(KeychainKind::External)?;
|
||||||
info!(
|
println!(
|
||||||
"The BDK spending policy: \n{}",
|
"The BDK spending policy: \n{}",
|
||||||
serde_json::to_string_pretty(&spending_policy)?
|
serde_json::to_string_pretty(&spending_policy)?
|
||||||
);
|
);
|
||||||
@@ -6,21 +6,20 @@
|
|||||||
// You may not use this file except in accordance with one or both of these
|
// You may not use this file except in accordance with one or both of these
|
||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
|
use anyhow::anyhow;
|
||||||
|
use bdk::bitcoin::bip32::DerivationPath;
|
||||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||||
use bdk::bitcoin::util::bip32::DerivationPath;
|
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
use bdk::descriptor;
|
use bdk::descriptor;
|
||||||
use bdk::descriptor::IntoWalletDescriptor;
|
use bdk::descriptor::IntoWalletDescriptor;
|
||||||
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
||||||
use bdk::keys::{GeneratableKey, GeneratedKey};
|
use bdk::keys::{GeneratableKey, GeneratedKey};
|
||||||
use bdk::miniscript::Tap;
|
use bdk::miniscript::Tap;
|
||||||
use bdk::Error as BDK_Error;
|
|
||||||
use std::error::Error;
|
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
/// This example demonstrates how to generate a mnemonic phrase
|
/// This example demonstrates how to generate a mnemonic phrase
|
||||||
/// using BDK and use that to generate a descriptor string.
|
/// using BDK and use that to generate a descriptor string.
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), anyhow::Error> {
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
// In this example we are generating a 12 words mnemonic phrase
|
// In this example we are generating a 12 words mnemonic phrase
|
||||||
@@ -28,14 +27,14 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// using their respective `WordCount` variant.
|
// using their respective `WordCount` variant.
|
||||||
let mnemonic: GeneratedKey<_, Tap> =
|
let mnemonic: GeneratedKey<_, Tap> =
|
||||||
Mnemonic::generate((WordCount::Words12, Language::English))
|
Mnemonic::generate((WordCount::Words12, Language::English))
|
||||||
.map_err(|_| BDK_Error::Generic("Mnemonic generation error".to_string()))?;
|
.map_err(|_| anyhow!("Mnemonic generation error"))?;
|
||||||
|
|
||||||
println!("Mnemonic phrase: {}", *mnemonic);
|
println!("Mnemonic phrase: {}", *mnemonic);
|
||||||
let mnemonic_with_passphrase = (mnemonic, None);
|
let mnemonic_with_passphrase = (mnemonic, None);
|
||||||
|
|
||||||
// define external and internal derivation key path
|
// define external and internal derivation key path
|
||||||
let external_path = DerivationPath::from_str("m/86h/0h/0h/0").unwrap();
|
let external_path = DerivationPath::from_str("m/86h/1h/0h/0").unwrap();
|
||||||
let internal_path = DerivationPath::from_str("m/86h/0h/0h/1").unwrap();
|
let internal_path = DerivationPath::from_str("m/86h/1h/0h/1").unwrap();
|
||||||
|
|
||||||
// generate external and internal descriptor from mnemonic
|
// generate external and internal descriptor from mnemonic
|
||||||
let (external_descriptor, ext_keymap) =
|
let (external_descriptor, ext_keymap) =
|
||||||
@@ -10,8 +10,6 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
extern crate bdk;
|
extern crate bdk;
|
||||||
extern crate env_logger;
|
|
||||||
extern crate log;
|
|
||||||
use std::error::Error;
|
use std::error::Error;
|
||||||
|
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
@@ -29,10 +27,6 @@ use bdk::wallet::signer::SignersContainer;
|
|||||||
/// one of the Extend Private key.
|
/// one of the Extend Private key.
|
||||||
|
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
env_logger::init_from_env(
|
|
||||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
|
||||||
);
|
|
||||||
|
|
||||||
let secp = bitcoin::secp256k1::Secp256k1::new();
|
let secp = bitcoin::secp256k1::Secp256k1::new();
|
||||||
|
|
||||||
// The descriptor used in the example
|
// The descriptor used in the example
|
||||||
@@ -48,7 +42,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// But they can be used as independent tools also.
|
// But they can be used as independent tools also.
|
||||||
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||||
|
|
||||||
log::info!("Example Descriptor for policy analysis : {}", wallet_desc);
|
println!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||||
|
|
||||||
// Create the signer with the keymap and descriptor.
|
// Create the signer with the keymap and descriptor.
|
||||||
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
||||||
@@ -60,7 +54,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
||||||
.expect("We expect a policy");
|
.expect("We expect a policy");
|
||||||
|
|
||||||
log::info!("Derived Policy for the descriptor {:#?}", policy);
|
println!("Derived Policy for the descriptor {:#?}", policy);
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
@@ -15,6 +15,7 @@
|
|||||||
//! checksum of a descriptor
|
//! checksum of a descriptor
|
||||||
|
|
||||||
use crate::descriptor::DescriptorError;
|
use crate::descriptor::DescriptorError;
|
||||||
|
use alloc::string::String;
|
||||||
|
|
||||||
const INPUT_CHARSET: &[u8] = b"0123456789()[],'/*abcdefgh@:$%{}IJKLMNOPQRSTUVWXYZ&+-.;<=>?!^_|~ijklmnopqrstuvwxyzABCDEFGH`#\"\\ ";
|
const INPUT_CHARSET: &[u8] = b"0123456789()[],'/*abcdefgh@:$%{}IJKLMNOPQRSTUVWXYZ&+-.;<=>?!^_|~ijklmnopqrstuvwxyzABCDEFGH`#\"\\ ";
|
||||||
const CHECKSUM_CHARSET: &[u8] = b"qpzry9x8gf2tvdw0s3jn54khce6mua7l";
|
const CHECKSUM_CHARSET: &[u8] = b"qpzry9x8gf2tvdw0s3jn54khce6mua7l";
|
||||||
@@ -41,22 +42,16 @@ fn poly_mod(mut c: u64, val: u64) -> u64 {
|
|||||||
c
|
c
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Computes the checksum bytes of a descriptor.
|
/// Compute the checksum bytes of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
||||||
/// `exclude_hash = true` ignores all data after the first '#' (inclusive).
|
pub fn calc_checksum_bytes(mut desc: &str) -> Result<[u8; 8], DescriptorError> {
|
||||||
pub(crate) fn calc_checksum_bytes_internal(
|
|
||||||
mut desc: &str,
|
|
||||||
exclude_hash: bool,
|
|
||||||
) -> Result<[u8; 8], DescriptorError> {
|
|
||||||
let mut c = 1;
|
let mut c = 1;
|
||||||
let mut cls = 0;
|
let mut cls = 0;
|
||||||
let mut clscount = 0;
|
let mut clscount = 0;
|
||||||
|
|
||||||
let mut original_checksum = None;
|
let mut original_checksum = None;
|
||||||
if exclude_hash {
|
if let Some(split) = desc.split_once('#') {
|
||||||
if let Some(split) = desc.split_once('#') {
|
desc = split.0;
|
||||||
desc = split.0;
|
original_checksum = Some(split.1);
|
||||||
original_checksum = Some(split.1);
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
for ch in desc.as_bytes() {
|
for ch in desc.as_bytes() {
|
||||||
@@ -94,39 +89,10 @@ pub(crate) fn calc_checksum_bytes_internal(
|
|||||||
Ok(checksum)
|
Ok(checksum)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Compute the checksum bytes of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
|
||||||
pub fn calc_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
|
||||||
calc_checksum_bytes_internal(desc, true)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Compute the checksum of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
/// Compute the checksum of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
||||||
pub fn calc_checksum(desc: &str) -> Result<String, DescriptorError> {
|
pub fn calc_checksum(desc: &str) -> Result<String, DescriptorError> {
|
||||||
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
||||||
calc_checksum_bytes_internal(desc, true)
|
calc_checksum_bytes(desc).map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
||||||
.map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
|
||||||
}
|
|
||||||
|
|
||||||
// TODO in release 0.25.0, remove get_checksum_bytes and get_checksum
|
|
||||||
// TODO in release 0.25.0, consolidate calc_checksum_bytes_internal into calc_checksum_bytes
|
|
||||||
|
|
||||||
/// Compute the checksum bytes of a descriptor
|
|
||||||
#[deprecated(
|
|
||||||
since = "0.24.0",
|
|
||||||
note = "Use new `calc_checksum_bytes` function which excludes any existing checksum in the descriptor string before calculating the checksum hash bytes. See https://github.com/bitcoindevkit/bdk/pull/765."
|
|
||||||
)]
|
|
||||||
pub fn get_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
|
||||||
calc_checksum_bytes_internal(desc, false)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Compute the checksum of a descriptor
|
|
||||||
#[deprecated(
|
|
||||||
since = "0.24.0",
|
|
||||||
note = "Use new `calc_checksum` function which excludes any existing checksum in the descriptor string before calculating the checksum hash. See https://github.com/bitcoindevkit/bdk/pull/765."
|
|
||||||
)]
|
|
||||||
pub fn get_checksum(desc: &str) -> Result<String, DescriptorError> {
|
|
||||||
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
|
||||||
calc_checksum_bytes_internal(desc, false)
|
|
||||||
.map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
@@ -170,7 +136,7 @@ mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_calc_checksum_invalid_character() {
|
fn test_calc_checksum_invalid_character() {
|
||||||
let sparkle_heart = unsafe { std::str::from_utf8_unchecked(&[240, 159, 146, 150]) };
|
let sparkle_heart = unsafe { core::str::from_utf8_unchecked(&[240, 159, 146, 150]) };
|
||||||
let invalid_desc = format!("wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcL{}fjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)", sparkle_heart);
|
let invalid_desc = format!("wpkh(tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcL{}fjdi5qUvw3VDfgYiH5mNsj5izuiu2N/1/2/*)", sparkle_heart);
|
||||||
|
|
||||||
assert_matches!(
|
assert_matches!(
|
||||||
@@ -23,7 +23,7 @@ macro_rules! impl_top_level_sh {
|
|||||||
};
|
};
|
||||||
|
|
||||||
( $inner_struct:ident, $constructor:ident, $sortedmulti_constructor:ident, $ctx:ident, sortedmulti $( $inner:tt )* ) => {{
|
( $inner_struct:ident, $constructor:ident, $sortedmulti_constructor:ident, $ctx:ident, sortedmulti $( $inner:tt )* ) => {{
|
||||||
use std::marker::PhantomData;
|
use core::marker::PhantomData;
|
||||||
|
|
||||||
use $crate::miniscript::descriptor::{$inner_struct, Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{$inner_struct, Descriptor, DescriptorPublicKey};
|
||||||
use $crate::miniscript::$ctx;
|
use $crate::miniscript::$ctx;
|
||||||
@@ -35,7 +35,7 @@ macro_rules! impl_top_level_sh {
|
|||||||
$crate::impl_sortedmulti!(build_desc, sortedmulti $( $inner )*)
|
$crate::impl_sortedmulti!(build_desc, sortedmulti $( $inner )*)
|
||||||
}};
|
}};
|
||||||
( $inner_struct:ident, $constructor:ident, $sortedmulti_constructor:ident, $ctx:ident, sortedmulti_vec $( $inner:tt )* ) => {{
|
( $inner_struct:ident, $constructor:ident, $sortedmulti_constructor:ident, $ctx:ident, sortedmulti_vec $( $inner:tt )* ) => {{
|
||||||
use std::marker::PhantomData;
|
use core::marker::PhantomData;
|
||||||
|
|
||||||
use $crate::miniscript::descriptor::{$inner_struct, Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{$inner_struct, Descriptor, DescriptorPublicKey};
|
||||||
use $crate::miniscript::$ctx;
|
use $crate::miniscript::$ctx;
|
||||||
@@ -203,8 +203,8 @@ macro_rules! impl_node_opcode_two {
|
|||||||
a_keymap.extend(b_keymap.into_iter());
|
a_keymap.extend(b_keymap.into_iter());
|
||||||
|
|
||||||
let minisc = $crate::miniscript::Miniscript::from_ast($crate::miniscript::miniscript::decode::Terminal::$terminal_variant(
|
let minisc = $crate::miniscript::Miniscript::from_ast($crate::miniscript::miniscript::decode::Terminal::$terminal_variant(
|
||||||
std::sync::Arc::new(a_minisc),
|
$crate::alloc::sync::Arc::new(a_minisc),
|
||||||
std::sync::Arc::new(b_minisc),
|
$crate::alloc::sync::Arc::new(b_minisc),
|
||||||
))?;
|
))?;
|
||||||
|
|
||||||
minisc.check_miniscript()?;
|
minisc.check_miniscript()?;
|
||||||
@@ -234,9 +234,9 @@ macro_rules! impl_node_opcode_three {
|
|||||||
let networks = $crate::keys::merge_networks(&networks, &c_networks);
|
let networks = $crate::keys::merge_networks(&networks, &c_networks);
|
||||||
|
|
||||||
let minisc = $crate::miniscript::Miniscript::from_ast($crate::miniscript::miniscript::decode::Terminal::$terminal_variant(
|
let minisc = $crate::miniscript::Miniscript::from_ast($crate::miniscript::miniscript::decode::Terminal::$terminal_variant(
|
||||||
std::sync::Arc::new(a_minisc),
|
$crate::alloc::sync::Arc::new(a_minisc),
|
||||||
std::sync::Arc::new(b_minisc),
|
$crate::alloc::sync::Arc::new(b_minisc),
|
||||||
std::sync::Arc::new(c_minisc),
|
$crate::alloc::sync::Arc::new(c_minisc),
|
||||||
))?;
|
))?;
|
||||||
|
|
||||||
minisc.check_miniscript()?;
|
minisc.check_miniscript()?;
|
||||||
@@ -263,7 +263,7 @@ macro_rules! impl_sortedmulti {
|
|||||||
)*
|
)*
|
||||||
];
|
];
|
||||||
|
|
||||||
keys.into_iter().collect::<Result<Vec<_>, _>>()
|
keys.into_iter().collect::<Result<$crate::alloc::vec::Vec<_>, _>>()
|
||||||
.map_err($crate::descriptor::DescriptorError::Key)
|
.map_err($crate::descriptor::DescriptorError::Key)
|
||||||
.and_then(|keys| $crate::keys::make_sortedmulti($thresh, keys, $build_desc, &secp))
|
.and_then(|keys| $crate::keys::make_sortedmulti($thresh, keys, $build_desc, &secp))
|
||||||
});
|
});
|
||||||
@@ -274,7 +274,7 @@ macro_rules! impl_sortedmulti {
|
|||||||
#[macro_export]
|
#[macro_export]
|
||||||
macro_rules! parse_tap_tree {
|
macro_rules! parse_tap_tree {
|
||||||
( @merge $tree_a:expr, $tree_b:expr) => {{
|
( @merge $tree_a:expr, $tree_b:expr) => {{
|
||||||
use std::sync::Arc;
|
use $crate::alloc::sync::Arc;
|
||||||
use $crate::miniscript::descriptor::TapTree;
|
use $crate::miniscript::descriptor::TapTree;
|
||||||
|
|
||||||
$tree_a
|
$tree_a
|
||||||
@@ -318,7 +318,7 @@ macro_rules! parse_tap_tree {
|
|||||||
|
|
||||||
// Single leaf
|
// Single leaf
|
||||||
( $op:ident ( $( $minisc:tt )* ) ) => {{
|
( $op:ident ( $( $minisc:tt )* ) ) => {{
|
||||||
use std::sync::Arc;
|
use $crate::alloc::sync::Arc;
|
||||||
use $crate::miniscript::descriptor::TapTree;
|
use $crate::miniscript::descriptor::TapTree;
|
||||||
|
|
||||||
$crate::fragment!( $op ( $( $minisc )* ) )
|
$crate::fragment!( $op ( $( $minisc )* ) )
|
||||||
@@ -337,7 +337,7 @@ macro_rules! apply_modifier {
|
|||||||
.and_then(|(minisc, keymap, networks)| {
|
.and_then(|(minisc, keymap, networks)| {
|
||||||
let minisc = $crate::miniscript::Miniscript::from_ast(
|
let minisc = $crate::miniscript::Miniscript::from_ast(
|
||||||
$crate::miniscript::miniscript::decode::Terminal::$terminal_variant(
|
$crate::miniscript::miniscript::decode::Terminal::$terminal_variant(
|
||||||
std::sync::Arc::new(minisc),
|
$crate::alloc::sync::Arc::new(minisc),
|
||||||
),
|
),
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
@@ -374,8 +374,8 @@ macro_rules! apply_modifier {
|
|||||||
$inner.and_then(|(a_minisc, a_keymap, a_networks)| {
|
$inner.and_then(|(a_minisc, a_keymap, a_networks)| {
|
||||||
$crate::impl_leaf_opcode_value_two!(
|
$crate::impl_leaf_opcode_value_two!(
|
||||||
AndV,
|
AndV,
|
||||||
std::sync::Arc::new(a_minisc),
|
$crate::alloc::sync::Arc::new(a_minisc),
|
||||||
std::sync::Arc::new($crate::fragment!(true).unwrap().0)
|
$crate::alloc::sync::Arc::new($crate::fragment!(true).unwrap().0)
|
||||||
)
|
)
|
||||||
.map(|(minisc, _, _)| (minisc, a_keymap, a_networks))
|
.map(|(minisc, _, _)| (minisc, a_keymap, a_networks))
|
||||||
})
|
})
|
||||||
@@ -384,8 +384,8 @@ macro_rules! apply_modifier {
|
|||||||
$inner.and_then(|(a_minisc, a_keymap, a_networks)| {
|
$inner.and_then(|(a_minisc, a_keymap, a_networks)| {
|
||||||
$crate::impl_leaf_opcode_value_two!(
|
$crate::impl_leaf_opcode_value_two!(
|
||||||
OrI,
|
OrI,
|
||||||
std::sync::Arc::new($crate::fragment!(false).unwrap().0),
|
$crate::alloc::sync::Arc::new($crate::fragment!(false).unwrap().0),
|
||||||
std::sync::Arc::new(a_minisc)
|
$crate::alloc::sync::Arc::new(a_minisc)
|
||||||
)
|
)
|
||||||
.map(|(minisc, _, _)| (minisc, a_keymap, a_networks))
|
.map(|(minisc, _, _)| (minisc, a_keymap, a_networks))
|
||||||
})
|
})
|
||||||
@@ -394,8 +394,8 @@ macro_rules! apply_modifier {
|
|||||||
$inner.and_then(|(a_minisc, a_keymap, a_networks)| {
|
$inner.and_then(|(a_minisc, a_keymap, a_networks)| {
|
||||||
$crate::impl_leaf_opcode_value_two!(
|
$crate::impl_leaf_opcode_value_two!(
|
||||||
OrI,
|
OrI,
|
||||||
std::sync::Arc::new(a_minisc),
|
$crate::alloc::sync::Arc::new(a_minisc),
|
||||||
std::sync::Arc::new($crate::fragment!(false).unwrap().0)
|
$crate::alloc::sync::Arc::new($crate::fragment!(false).unwrap().0)
|
||||||
)
|
)
|
||||||
.map(|(minisc, _, _)| (minisc, a_keymap, a_networks))
|
.map(|(minisc, _, _)| (minisc, a_keymap, a_networks))
|
||||||
})
|
})
|
||||||
@@ -495,6 +495,8 @@ macro_rules! apply_modifier {
|
|||||||
/// let (descriptor, key_map, networks) = bdk::descriptor!(wpkh(my_key))?;
|
/// let (descriptor, key_map, networks) = bdk::descriptor!(wpkh(my_key))?;
|
||||||
/// # Ok::<(), Box<dyn std::error::Error>>(())
|
/// # Ok::<(), Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
|
///
|
||||||
|
/// [`Vec`]: alloc::vec::Vec
|
||||||
#[macro_export]
|
#[macro_export]
|
||||||
macro_rules! descriptor {
|
macro_rules! descriptor {
|
||||||
( bare ( $( $minisc:tt )* ) ) => ({
|
( bare ( $( $minisc:tt )* ) ) => ({
|
||||||
@@ -514,13 +516,14 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
||||||
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
||||||
});
|
});
|
||||||
( wpkh ( $key:expr ) ) => ({
|
( wpkh ( $key:expr ) ) => ({
|
||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
||||||
});
|
});
|
||||||
( sh ( wpkh ( $key:expr ) ) ) => ({
|
( sh ( wpkh ( $key:expr ) ) ) => ({
|
||||||
@@ -530,7 +533,7 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
||||||
});
|
});
|
||||||
( sh ( $( $minisc:tt )* ) ) => ({
|
( sh ( $( $minisc:tt )* ) ) => ({
|
||||||
@@ -599,7 +602,7 @@ macro_rules! group_multi_keys {
|
|||||||
)*
|
)*
|
||||||
];
|
];
|
||||||
|
|
||||||
keys.into_iter().collect::<Result<Vec<_>, _>>()
|
keys.into_iter().collect::<Result<$crate::alloc::vec::Vec<_>, _>>()
|
||||||
.map_err($crate::descriptor::DescriptorError::Key)
|
.map_err($crate::descriptor::DescriptorError::Key)
|
||||||
}};
|
}};
|
||||||
}
|
}
|
||||||
@@ -700,7 +703,7 @@ macro_rules! fragment {
|
|||||||
$crate::keys::make_pkh($key, &secp)
|
$crate::keys::make_pkh($key, &secp)
|
||||||
});
|
});
|
||||||
( after ( $value:expr ) ) => ({
|
( after ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(After, $crate::bitcoin::PackedLockTime($value)) // TODO!! https://github.com/rust-bitcoin/rust-bitcoin/issues/1302
|
$crate::impl_leaf_opcode_value!(After, $crate::miniscript::AbsLockTime::from_consensus($value))
|
||||||
});
|
});
|
||||||
( older ( $value:expr ) ) => ({
|
( older ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
||||||
@@ -744,8 +747,8 @@ macro_rules! fragment {
|
|||||||
( thresh_vec ( $thresh:expr, $items:expr ) ) => ({
|
( thresh_vec ( $thresh:expr, $items:expr ) ) => ({
|
||||||
use $crate::miniscript::descriptor::KeyMap;
|
use $crate::miniscript::descriptor::KeyMap;
|
||||||
|
|
||||||
let (items, key_maps_networks): (Vec<_>, Vec<_>) = $items.into_iter().map(|(a, b, c)| (a, (b, c))).unzip();
|
let (items, key_maps_networks): ($crate::alloc::vec::Vec<_>, $crate::alloc::vec::Vec<_>) = $items.into_iter().map(|(a, b, c)| (a, (b, c))).unzip();
|
||||||
let items = items.into_iter().map(std::sync::Arc::new).collect();
|
let items = items.into_iter().map($crate::alloc::sync::Arc::new).collect();
|
||||||
|
|
||||||
let (key_maps, valid_networks) = key_maps_networks.into_iter().fold((KeyMap::default(), $crate::keys::any_network()), |(mut keys_acc, net_acc), (key, net)| {
|
let (key_maps, valid_networks) = key_maps_networks.into_iter().fold((KeyMap::default(), $crate::keys::any_network()), |(mut keys_acc, net_acc), (key, net)| {
|
||||||
keys_acc.extend(key.into_iter());
|
keys_acc.extend(key.into_iter());
|
||||||
@@ -760,7 +763,7 @@ macro_rules! fragment {
|
|||||||
( thresh ( $thresh:expr, $( $inner:tt )* ) ) => ({
|
( thresh ( $thresh:expr, $( $inner:tt )* ) ) => ({
|
||||||
let items = $crate::fragment_internal!( @v $( $inner )* );
|
let items = $crate::fragment_internal!( @v $( $inner )* );
|
||||||
|
|
||||||
items.into_iter().collect::<Result<Vec<_>, _>>()
|
items.into_iter().collect::<Result<$crate::alloc::vec::Vec<_>, _>>()
|
||||||
.and_then(|items| $crate::fragment!(thresh_vec($thresh, items)))
|
.and_then(|items| $crate::fragment!(thresh_vec($thresh, items)))
|
||||||
});
|
});
|
||||||
( multi_vec ( $thresh:expr, $keys:expr ) ) => ({
|
( multi_vec ( $thresh:expr, $keys:expr ) ) => ({
|
||||||
@@ -793,17 +796,17 @@ macro_rules! fragment {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use bitcoin::hashes::hex::ToHex;
|
use alloc::string::ToString;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::{Descriptor, Legacy, Segwitv0};
|
use miniscript::{Descriptor, Legacy, Segwitv0};
|
||||||
|
|
||||||
use std::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::PrivateKey;
|
use bitcoin::PrivateKey;
|
||||||
|
|
||||||
// test the descriptor!() macro
|
// test the descriptor!() macro
|
||||||
@@ -819,18 +822,15 @@ mod test {
|
|||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
assert_eq!(!desc.has_wildcard(), is_fixed);
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let child_desc = desc
|
||||||
let child_desc = if !desc.has_wildcard() {
|
.at_derivation_index(i as u32)
|
||||||
desc.at_derivation_index(0)
|
.expect("i is not hardened");
|
||||||
} else {
|
|
||||||
desc.at_derivation_index(index)
|
|
||||||
};
|
|
||||||
let address = child_desc.address(Regtest);
|
let address = child_desc.address(Regtest);
|
||||||
if let Ok(address) = address {
|
if let Ok(address) = address {
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
} else {
|
} else {
|
||||||
let script = child_desc.script_pubkey();
|
let script = child_desc.script_pubkey();
|
||||||
assert_eq!(script.to_hex().as_str(), *expected.get(i).unwrap());
|
assert_eq!(script.to_hex_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1175,9 +1175,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
#[should_panic(
|
#[should_panic(expected = "Miniscript(ContextError(UncompressedKeysNotAllowed))")]
|
||||||
expected = "Miniscript(ContextError(CompressedOnly(\"04b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a87378ec38ff91d43e8c2092ebda601780485263da089465619e0358a5c1be7ac91f4\")))"
|
|
||||||
)]
|
|
||||||
fn test_dsl_miniscript_checks() {
|
fn test_dsl_miniscript_checks() {
|
||||||
let mut uncompressed_pk =
|
let mut uncompressed_pk =
|
||||||
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
||||||
@@ -10,6 +10,7 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
//! Descriptor errors
|
//! Descriptor errors
|
||||||
|
use core::fmt;
|
||||||
|
|
||||||
/// Errors related to the parsing and usage of descriptors
|
/// Errors related to the parsing and usage of descriptors
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
@@ -20,6 +21,8 @@ pub enum Error {
|
|||||||
InvalidDescriptorChecksum,
|
InvalidDescriptorChecksum,
|
||||||
/// The descriptor contains hardened derivation steps on public extended keys
|
/// The descriptor contains hardened derivation steps on public extended keys
|
||||||
HardenedDerivationXpub,
|
HardenedDerivationXpub,
|
||||||
|
/// The descriptor contains multipath keys
|
||||||
|
MultiPath,
|
||||||
|
|
||||||
/// Error thrown while working with [`keys`](crate::keys)
|
/// Error thrown while working with [`keys`](crate::keys)
|
||||||
Key(crate::keys::KeyError),
|
Key(crate::keys::KeyError),
|
||||||
@@ -30,11 +33,11 @@ pub enum Error {
|
|||||||
InvalidDescriptorCharacter(u8),
|
InvalidDescriptorCharacter(u8),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Error during base58 decoding
|
/// Error during base58 decoding
|
||||||
Base58(bitcoin::util::base58::Error),
|
Base58(bitcoin::base58::Error),
|
||||||
/// Key-related error
|
/// Key-related error
|
||||||
Pk(bitcoin::util::key::Error),
|
Pk(bitcoin::key::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
/// Hex decoding error
|
/// Hex decoding error
|
||||||
@@ -51,8 +54,8 @@ impl From<crate::keys::KeyError> for Error {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::fmt::Display for Error {
|
impl fmt::Display for Error {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::InvalidHdKeyPath => write!(f, "Invalid HD key path"),
|
Self::InvalidHdKeyPath => write!(f, "Invalid HD key path"),
|
||||||
Self::InvalidDescriptorChecksum => {
|
Self::InvalidDescriptorChecksum => {
|
||||||
@@ -62,6 +65,10 @@ impl std::fmt::Display for Error {
|
|||||||
f,
|
f,
|
||||||
"The descriptor contains hardened derivation steps on public extended keys"
|
"The descriptor contains hardened derivation steps on public extended keys"
|
||||||
),
|
),
|
||||||
|
Self::MultiPath => write!(
|
||||||
|
f,
|
||||||
|
"The descriptor contains multipath keys, which are not supported yet"
|
||||||
|
),
|
||||||
Self::Key(err) => write!(f, "Key error: {}", err),
|
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||||
Self::Policy(err) => write!(f, "Policy error: {}", err),
|
Self::Policy(err) => write!(f, "Policy error: {}", err),
|
||||||
Self::InvalidDescriptorCharacter(char) => {
|
Self::InvalidDescriptorCharacter(char) => {
|
||||||
@@ -76,11 +83,41 @@ impl std::fmt::Display for Error {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
impl std::error::Error for Error {}
|
impl std::error::Error for Error {}
|
||||||
|
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
impl From<bitcoin::bip32::Error> for Error {
|
||||||
impl_error!(bitcoin::util::base58::Error, Base58);
|
fn from(err: bitcoin::bip32::Error) -> Self {
|
||||||
impl_error!(bitcoin::util::key::Error, Pk);
|
Error::Bip32(err)
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
}
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
}
|
||||||
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
|
||||||
|
impl From<bitcoin::base58::Error> for Error {
|
||||||
|
fn from(err: bitcoin::base58::Error) -> Self {
|
||||||
|
Error::Base58(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<bitcoin::key::Error> for Error {
|
||||||
|
fn from(err: bitcoin::key::Error) -> Self {
|
||||||
|
Error::Pk(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<miniscript::Error> for Error {
|
||||||
|
fn from(err: miniscript::Error) -> Self {
|
||||||
|
Error::Miniscript(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<bitcoin::hashes::hex::Error> for Error {
|
||||||
|
fn from(err: bitcoin::hashes::hex::Error) -> Self {
|
||||||
|
Error::Hex(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<crate::descriptor::policy::PolicyError> for Error {
|
||||||
|
fn from(err: crate::descriptor::policy::PolicyError) -> Self {
|
||||||
|
Error::Policy(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -14,19 +14,21 @@
|
|||||||
//! This module contains generic utilities to work with descriptors, plus some re-exported types
|
//! This module contains generic utilities to work with descriptors, plus some re-exported types
|
||||||
//! from [`miniscript`].
|
//! from [`miniscript`].
|
||||||
|
|
||||||
use std::collections::BTreeMap;
|
use crate::collections::BTreeMap;
|
||||||
|
use alloc::string::String;
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
||||||
use bitcoin::util::{psbt, taproot};
|
use bitcoin::{key::XOnlyPublicKey, secp256k1, PublicKey};
|
||||||
use bitcoin::{secp256k1, PublicKey, XOnlyPublicKey};
|
use bitcoin::{psbt, taproot};
|
||||||
use bitcoin::{Network, TxOut};
|
use bitcoin::{Network, TxOut};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DefiniteDescriptorKey, DescriptorSecretKey, DescriptorType, InnerXKey, SinglePubKey,
|
DefiniteDescriptorKey, DescriptorMultiXKey, DescriptorSecretKey, DescriptorType,
|
||||||
|
DescriptorXKey, InnerXKey, KeyMap, SinglePubKey, Wildcard,
|
||||||
};
|
};
|
||||||
pub use miniscript::{
|
pub use miniscript::{
|
||||||
descriptor::DescriptorXKey, descriptor::KeyMap, descriptor::Wildcard, Descriptor,
|
Descriptor, DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
||||||
DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
|
||||||
};
|
};
|
||||||
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
||||||
|
|
||||||
@@ -57,16 +59,16 @@ pub type DerivedDescriptor = Descriptor<DefiniteDescriptorKey>;
|
|||||||
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
||||||
|
|
||||||
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type TapKeyOrigins = BTreeMap<bitcoin::XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
pub type TapKeyOrigins = BTreeMap<XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
||||||
|
|
||||||
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
||||||
pub trait IntoWalletDescriptor {
|
pub trait IntoWalletDescriptor {
|
||||||
@@ -134,14 +136,10 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
network: Network,
|
network: Network,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'s, 'd>
|
impl<'s, 'd> miniscript::Translator<DescriptorPublicKey, String, DescriptorError>
|
||||||
miniscript::Translator<DescriptorPublicKey, miniscript::DummyKey, DescriptorError>
|
|
||||||
for Translator<'s, 'd>
|
for Translator<'s, 'd>
|
||||||
{
|
{
|
||||||
fn pk(
|
fn pk(&mut self, pk: &DescriptorPublicKey) -> Result<String, DescriptorError> {
|
||||||
&mut self,
|
|
||||||
pk: &DescriptorPublicKey,
|
|
||||||
) -> Result<miniscript::DummyKey, DescriptorError> {
|
|
||||||
let secp = &self.secp;
|
let secp = &self.secp;
|
||||||
|
|
||||||
let (_, _, networks) = if self.descriptor.is_taproot() {
|
let (_, _, networks) = if self.descriptor.is_taproot() {
|
||||||
@@ -159,7 +157,7 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
};
|
};
|
||||||
|
|
||||||
if networks.contains(&self.network) {
|
if networks.contains(&self.network) {
|
||||||
Ok(miniscript::DummyKey)
|
Ok(Default::default())
|
||||||
} else {
|
} else {
|
||||||
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
||||||
}
|
}
|
||||||
@@ -167,35 +165,40 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
fn sha256(
|
fn sha256(
|
||||||
&mut self,
|
&mut self,
|
||||||
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
||||||
) -> Result<miniscript::DummySha256Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn hash256(
|
fn hash256(
|
||||||
&mut self,
|
&mut self,
|
||||||
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
||||||
) -> Result<miniscript::DummyHash256Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn ripemd160(
|
fn ripemd160(
|
||||||
&mut self,
|
&mut self,
|
||||||
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
||||||
) -> Result<miniscript::DummyRipemd160Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn hash160(
|
fn hash160(
|
||||||
&mut self,
|
&mut self,
|
||||||
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
||||||
) -> Result<miniscript::DummyHash160Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// check the network for the keys
|
// check the network for the keys
|
||||||
self.0.translate_pk(&mut Translator {
|
use miniscript::TranslateErr;
|
||||||
|
match self.0.translate_pk(&mut Translator {
|
||||||
secp,
|
secp,
|
||||||
network,
|
network,
|
||||||
descriptor: &self.0,
|
descriptor: &self.0,
|
||||||
})?;
|
}) {
|
||||||
|
Ok(_) => {}
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
}
|
||||||
|
|
||||||
Ok(self)
|
Ok(self)
|
||||||
}
|
}
|
||||||
@@ -249,7 +252,12 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// fixup the network for keys that need it in the descriptor
|
// fixup the network for keys that need it in the descriptor
|
||||||
let translated = desc.translate_pk(&mut Translator { network })?;
|
use miniscript::TranslateErr;
|
||||||
|
let translated = match desc.translate_pk(&mut Translator { network }) {
|
||||||
|
Ok(descriptor) => descriptor,
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
};
|
||||||
// ...and in the key map
|
// ...and in the key map
|
||||||
let fixed_keymap = keymap
|
let fixed_keymap = keymap
|
||||||
.into_iter()
|
.into_iter()
|
||||||
@@ -300,6 +308,10 @@ pub(crate) fn into_wallet_descriptor_checked<T: IntoWalletDescriptor>(
|
|||||||
return Err(DescriptorError::HardenedDerivationXpub);
|
return Err(DescriptorError::HardenedDerivationXpub);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if descriptor.is_multipath() {
|
||||||
|
return Err(DescriptorError::MultiPath);
|
||||||
|
}
|
||||||
|
|
||||||
// Run miniscript's sanity check, which will look for duplicated keys and other potential
|
// Run miniscript's sanity check, which will look for duplicated keys and other potential
|
||||||
// issues
|
// issues
|
||||||
descriptor.sanity_check()?;
|
descriptor.sanity_check()?;
|
||||||
@@ -338,6 +350,18 @@ pub(crate) trait XKeyUtils {
|
|||||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl<T> XKeyUtils for DescriptorMultiXKey<T>
|
||||||
|
where
|
||||||
|
T: InnerXKey,
|
||||||
|
{
|
||||||
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
||||||
|
match self.origin {
|
||||||
|
Some((fingerprint, _)) => fingerprint,
|
||||||
|
None => self.xkey.xkey_fingerprint(secp),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl<T> XKeyUtils for DescriptorXKey<T>
|
impl<T> XKeyUtils for DescriptorXKey<T>
|
||||||
where
|
where
|
||||||
T: InnerXKey,
|
T: InnerXKey,
|
||||||
@@ -353,27 +377,27 @@ where
|
|||||||
pub(crate) trait DescriptorMeta {
|
pub(crate) trait DescriptorMeta {
|
||||||
fn is_witness(&self) -> bool;
|
fn is_witness(&self) -> bool;
|
||||||
fn is_taproot(&self) -> bool;
|
fn is_taproot(&self) -> bool;
|
||||||
fn get_extended_keys(&self) -> Result<Vec<DescriptorXKey<ExtendedPubKey>>, DescriptorError>;
|
fn get_extended_keys(&self) -> Vec<DescriptorXKey<ExtendedPubKey>>;
|
||||||
fn derive_from_hd_keypaths<'s>(
|
fn derive_from_hd_keypaths(
|
||||||
&self,
|
&self,
|
||||||
hd_keypaths: &HdKeyPaths,
|
hd_keypaths: &HdKeyPaths,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor>;
|
) -> Option<DerivedDescriptor>;
|
||||||
fn derive_from_tap_key_origins<'s>(
|
fn derive_from_tap_key_origins(
|
||||||
&self,
|
&self,
|
||||||
tap_key_origins: &TapKeyOrigins,
|
tap_key_origins: &TapKeyOrigins,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor>;
|
) -> Option<DerivedDescriptor>;
|
||||||
fn derive_from_psbt_key_origins<'s>(
|
fn derive_from_psbt_key_origins(
|
||||||
&self,
|
&self,
|
||||||
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor>;
|
) -> Option<DerivedDescriptor>;
|
||||||
fn derive_from_psbt_input<'s>(
|
fn derive_from_psbt_input(
|
||||||
&self,
|
&self,
|
||||||
psbt_input: &psbt::Input,
|
psbt_input: &psbt::Input,
|
||||||
utxo: Option<TxOut>,
|
utxo: Option<TxOut>,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor>;
|
) -> Option<DerivedDescriptor>;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -394,7 +418,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
self.desc_type() == DescriptorType::Tr
|
self.desc_type() == DescriptorType::Tr
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_extended_keys(&self) -> Result<Vec<DescriptorXKey<ExtendedPubKey>>, DescriptorError> {
|
fn get_extended_keys(&self) -> Vec<DescriptorXKey<ExtendedPubKey>> {
|
||||||
let mut answer = Vec::new();
|
let mut answer = Vec::new();
|
||||||
|
|
||||||
self.for_each_key(|pk| {
|
self.for_each_key(|pk| {
|
||||||
@@ -405,13 +429,13 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
true
|
true
|
||||||
});
|
});
|
||||||
|
|
||||||
Ok(answer)
|
answer
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_psbt_key_origins<'s>(
|
fn derive_from_psbt_key_origins(
|
||||||
&self,
|
&self,
|
||||||
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
key_origins: BTreeMap<Fingerprint, (&DerivationPath, SinglePubKey)>,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor> {
|
) -> Option<DerivedDescriptor> {
|
||||||
// Ensure that deriving `xpub` with `path` yields `expected`
|
// Ensure that deriving `xpub` with `path` yields `expected`
|
||||||
let verify_key = |xpub: &DescriptorXKey<ExtendedPubKey>,
|
let verify_key = |xpub: &DescriptorXKey<ExtendedPubKey>,
|
||||||
@@ -464,11 +488,6 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
) {
|
) {
|
||||||
Some(derive_path)
|
Some(derive_path)
|
||||||
} else {
|
} else {
|
||||||
log::debug!(
|
|
||||||
"Key `{}` derived with {} yields an unexpected key",
|
|
||||||
root_fingerprint,
|
|
||||||
derive_path
|
|
||||||
);
|
|
||||||
None
|
None
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
@@ -492,13 +511,16 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
false
|
false
|
||||||
});
|
});
|
||||||
|
|
||||||
path_found.map(|path| self.at_derivation_index(path))
|
path_found.map(|path| {
|
||||||
|
self.at_derivation_index(path)
|
||||||
|
.expect("We ignore hardened wildcards")
|
||||||
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_hd_keypaths<'s>(
|
fn derive_from_hd_keypaths(
|
||||||
&self,
|
&self,
|
||||||
hd_keypaths: &HdKeyPaths,
|
hd_keypaths: &HdKeyPaths,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor> {
|
) -> Option<DerivedDescriptor> {
|
||||||
// "Convert" an hd_keypaths map to the format required by `derive_from_psbt_key_origins`
|
// "Convert" an hd_keypaths map to the format required by `derive_from_psbt_key_origins`
|
||||||
let key_origins = hd_keypaths
|
let key_origins = hd_keypaths
|
||||||
@@ -513,10 +535,10 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
self.derive_from_psbt_key_origins(key_origins, secp)
|
self.derive_from_psbt_key_origins(key_origins, secp)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_tap_key_origins<'s>(
|
fn derive_from_tap_key_origins(
|
||||||
&self,
|
&self,
|
||||||
tap_key_origins: &TapKeyOrigins,
|
tap_key_origins: &TapKeyOrigins,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor> {
|
) -> Option<DerivedDescriptor> {
|
||||||
// "Convert" a tap_key_origins map to the format required by `derive_from_psbt_key_origins`
|
// "Convert" a tap_key_origins map to the format required by `derive_from_psbt_key_origins`
|
||||||
let key_origins = tap_key_origins
|
let key_origins = tap_key_origins
|
||||||
@@ -526,11 +548,11 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
self.derive_from_psbt_key_origins(key_origins, secp)
|
self.derive_from_psbt_key_origins(key_origins, secp)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_psbt_input<'s>(
|
fn derive_from_psbt_input(
|
||||||
&self,
|
&self,
|
||||||
psbt_input: &psbt::Input,
|
psbt_input: &psbt::Input,
|
||||||
utxo: Option<TxOut>,
|
utxo: Option<TxOut>,
|
||||||
secp: &'s SecpCtx,
|
secp: &SecpCtx,
|
||||||
) -> Option<DerivedDescriptor> {
|
) -> Option<DerivedDescriptor> {
|
||||||
if let Some(derived) = self.derive_from_hd_keypaths(&psbt_input.bip32_derivation, secp) {
|
if let Some(derived) = self.derive_from_hd_keypaths(&psbt_input.bip32_derivation, secp) {
|
||||||
return Some(derived);
|
return Some(derived);
|
||||||
@@ -543,7 +565,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
let descriptor = self.at_derivation_index(0);
|
let descriptor = self.at_derivation_index(0).expect("0 is not hardened");
|
||||||
match descriptor.desc_type() {
|
match descriptor.desc_type() {
|
||||||
// TODO: add pk() here
|
// TODO: add pk() here
|
||||||
DescriptorType::Pkh
|
DescriptorType::Pkh
|
||||||
@@ -579,14 +601,14 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use alloc::string::ToString;
|
||||||
|
use core::str::FromStr;
|
||||||
|
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::consensus::encode::deserialize;
|
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::{bip32, psbt};
|
use bitcoin::ScriptBuf;
|
||||||
use bitcoin::Script;
|
use bitcoin::{bip32, psbt::Psbt};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::psbt::PsbtUtils;
|
use crate::psbt::PsbtUtils;
|
||||||
@@ -597,7 +619,7 @@ mod test {
|
|||||||
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
||||||
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
||||||
@@ -620,7 +642,7 @@ mod test {
|
|||||||
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
||||||
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
||||||
@@ -651,7 +673,7 @@ mod test {
|
|||||||
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
||||||
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
||||||
@@ -675,7 +697,7 @@ mod test {
|
|||||||
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
||||||
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
||||||
@@ -842,6 +864,12 @@ mod test {
|
|||||||
|
|
||||||
assert_matches!(result, Err(DescriptorError::HardenedDerivationXpub));
|
assert_matches!(result, Err(DescriptorError::HardenedDerivationXpub));
|
||||||
|
|
||||||
|
let descriptor = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/<0;1>/*)";
|
||||||
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
|
assert_matches!(result, Err(DescriptorError::MultiPath));
|
||||||
|
|
||||||
|
// repeated pubkeys
|
||||||
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*))";
|
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*))";
|
||||||
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
@@ -858,9 +886,9 @@ mod test {
|
|||||||
let (descriptor, _) =
|
let (descriptor, _) =
|
||||||
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
||||||
|
|
||||||
let descriptor = descriptor.at_derivation_index(0);
|
let descriptor = descriptor.at_derivation_index(0).unwrap();
|
||||||
|
|
||||||
let script = Script::from_str("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
let script = ScriptBuf::from_hex("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
||||||
|
|
||||||
let mut psbt_input = psbt::Input::default();
|
let mut psbt_input = psbt::Input::default();
|
||||||
psbt_input
|
psbt_input
|
||||||
@@ -32,20 +32,23 @@
|
|||||||
//!
|
//!
|
||||||
//! let signers = Arc::new(SignersContainer::build(key_map, &extended_desc, &secp));
|
//! let signers = Arc::new(SignersContainer::build(key_map, &extended_desc, &secp));
|
||||||
//! let policy = extended_desc.extract_policy(&signers, BuildSatisfaction::None, &secp)?;
|
//! let policy = extended_desc.extract_policy(&signers, BuildSatisfaction::None, &secp)?;
|
||||||
//! println!("policy: {}", serde_json::to_string(&policy)?);
|
//! println!("policy: {}", serde_json::to_string(&policy).unwrap());
|
||||||
//! # Ok::<(), bdk::Error>(())
|
//! # Ok::<(), anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use std::cmp::max;
|
use crate::collections::{BTreeMap, HashSet, VecDeque};
|
||||||
use std::collections::{BTreeMap, HashSet, VecDeque};
|
use alloc::string::String;
|
||||||
use std::fmt;
|
use alloc::vec::Vec;
|
||||||
|
use core::cmp::max;
|
||||||
|
|
||||||
|
use core::fmt;
|
||||||
|
|
||||||
use serde::ser::SerializeMap;
|
use serde::ser::SerializeMap;
|
||||||
use serde::{Serialize, Serializer};
|
use serde::{Serialize, Serializer};
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
use bitcoin::{absolute, key::XOnlyPublicKey, PublicKey, Sequence};
|
||||||
use bitcoin::{LockTime, PublicKey, Sequence, XOnlyPublicKey};
|
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
||||||
@@ -55,9 +58,6 @@ use miniscript::{
|
|||||||
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
||||||
};
|
};
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
|
||||||
use log::{debug, error, info, trace};
|
|
||||||
|
|
||||||
use crate::descriptor::ExtractPolicy;
|
use crate::descriptor::ExtractPolicy;
|
||||||
use crate::keys::ExtScriptContext;
|
use crate::keys::ExtScriptContext;
|
||||||
use crate::wallet::signer::{SignerId, SignersContainer};
|
use crate::wallet::signer::{SignerId, SignersContainer};
|
||||||
@@ -66,7 +66,7 @@ use crate::wallet::utils::{After, Older, SecpCtx};
|
|||||||
use super::checksum::calc_checksum;
|
use super::checksum::calc_checksum;
|
||||||
use super::error::Error;
|
use super::error::Error;
|
||||||
use super::XKeyUtils;
|
use super::XKeyUtils;
|
||||||
use bitcoin::util::psbt::{Input as PsbtInput, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, Psbt};
|
||||||
use miniscript::psbt::PsbtInputSatisfier;
|
use miniscript::psbt::PsbtInputSatisfier;
|
||||||
|
|
||||||
/// A unique identifier for a key
|
/// A unique identifier for a key
|
||||||
@@ -93,6 +93,9 @@ impl PkOrF {
|
|||||||
..
|
..
|
||||||
}) => PkOrF::XOnlyPubkey(*pk),
|
}) => PkOrF::XOnlyPubkey(*pk),
|
||||||
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
||||||
|
DescriptorPublicKey::MultiXPub(multi) => {
|
||||||
|
PkOrF::Fingerprint(multi.root_fingerprint(secp))
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -129,7 +132,7 @@ pub enum SatisfiableItem {
|
|||||||
/// Absolute timeclock timestamp
|
/// Absolute timeclock timestamp
|
||||||
AbsoluteTimelock {
|
AbsoluteTimelock {
|
||||||
/// The timelock value
|
/// The timelock value
|
||||||
value: LockTime,
|
value: absolute::LockTime,
|
||||||
},
|
},
|
||||||
/// Relative timelock locktime
|
/// Relative timelock locktime
|
||||||
RelativeTimelock {
|
RelativeTimelock {
|
||||||
@@ -449,11 +452,14 @@ pub struct Condition {
|
|||||||
pub csv: Option<Sequence>,
|
pub csv: Option<Sequence>,
|
||||||
/// Optional timelock condition
|
/// Optional timelock condition
|
||||||
#[serde(skip_serializing_if = "Option::is_none")]
|
#[serde(skip_serializing_if = "Option::is_none")]
|
||||||
pub timelock: Option<LockTime>,
|
pub timelock: Option<absolute::LockTime>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Condition {
|
impl Condition {
|
||||||
fn merge_nlocktime(a: LockTime, b: LockTime) -> Result<LockTime, PolicyError> {
|
fn merge_nlocktime(
|
||||||
|
a: absolute::LockTime,
|
||||||
|
b: absolute::LockTime,
|
||||||
|
) -> Result<absolute::LockTime, PolicyError> {
|
||||||
if !a.is_same_unit(b) {
|
if !a.is_same_unit(b) {
|
||||||
Err(PolicyError::MixedTimelockUnits)
|
Err(PolicyError::MixedTimelockUnits)
|
||||||
} else if a > b {
|
} else if a > b {
|
||||||
@@ -513,7 +519,7 @@ pub enum PolicyError {
|
|||||||
impl fmt::Display for PolicyError {
|
impl fmt::Display for PolicyError {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::NotEnoughItemsSelected(err) => write!(f, "Not enought items selected: {}", err),
|
Self::NotEnoughItemsSelected(err) => write!(f, "Not enough items selected: {}", err),
|
||||||
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
||||||
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
||||||
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
||||||
@@ -523,6 +529,7 @@ impl fmt::Display for PolicyError {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
impl std::error::Error for PolicyError {}
|
impl std::error::Error for PolicyError {}
|
||||||
|
|
||||||
impl Policy {
|
impl Policy {
|
||||||
@@ -659,11 +666,11 @@ impl Policy {
|
|||||||
(0..*threshold).collect()
|
(0..*threshold).collect()
|
||||||
}
|
}
|
||||||
SatisfiableItem::Multisig { keys, .. } => (0..keys.len()).collect(),
|
SatisfiableItem::Multisig { keys, .. } => (0..keys.len()).collect(),
|
||||||
_ => vec![],
|
_ => HashSet::new(),
|
||||||
};
|
};
|
||||||
let selected = match path.get(&self.id) {
|
let selected: HashSet<_> = match path.get(&self.id) {
|
||||||
Some(arr) => arr,
|
Some(arr) => arr.iter().copied().collect(),
|
||||||
_ => &default,
|
_ => default,
|
||||||
};
|
};
|
||||||
|
|
||||||
match &self.item {
|
match &self.item {
|
||||||
@@ -671,14 +678,24 @@ impl Policy {
|
|||||||
let mapped_req = items
|
let mapped_req = items
|
||||||
.iter()
|
.iter()
|
||||||
.map(|i| i.get_condition(path))
|
.map(|i| i.get_condition(path))
|
||||||
.collect::<Result<Vec<_>, _>>()?;
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// if all the requirements are null we don't care about `selected` because there
|
// if all the requirements are null we don't care about `selected` because there
|
||||||
// are no requirements
|
// are no requirements
|
||||||
if mapped_req.iter().all(Condition::is_null) {
|
if mapped_req
|
||||||
|
.iter()
|
||||||
|
.all(|cond| matches!(cond, Ok(c) if c.is_null()))
|
||||||
|
{
|
||||||
return Ok(Condition::default());
|
return Ok(Condition::default());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// make sure all the indexes in the `selected` list are within range
|
||||||
|
for index in &selected {
|
||||||
|
if *index >= items.len() {
|
||||||
|
return Err(PolicyError::IndexOutOfRange(*index));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// if we have something, make sure we have enough items. note that the user can set
|
// if we have something, make sure we have enough items. note that the user can set
|
||||||
// an empty value for this step in case of n-of-n, because `selected` is set to all
|
// an empty value for this step in case of n-of-n, because `selected` is set to all
|
||||||
// the elements above
|
// the elements above
|
||||||
@@ -687,23 +704,18 @@ impl Policy {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// check the selected items, see if there are conflicting requirements
|
// check the selected items, see if there are conflicting requirements
|
||||||
let mut requirements = Condition::default();
|
mapped_req
|
||||||
for item_index in selected {
|
.into_iter()
|
||||||
requirements = requirements.merge(
|
.enumerate()
|
||||||
mapped_req
|
.filter(|(index, _)| selected.contains(index))
|
||||||
.get(*item_index)
|
.try_fold(Condition::default(), |acc, (_, cond)| acc.merge(&cond?))
|
||||||
.ok_or(PolicyError::IndexOutOfRange(*item_index))?,
|
|
||||||
)?;
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(requirements)
|
|
||||||
}
|
}
|
||||||
SatisfiableItem::Multisig { keys, threshold } => {
|
SatisfiableItem::Multisig { keys, threshold } => {
|
||||||
if selected.len() < *threshold {
|
if selected.len() < *threshold {
|
||||||
return Err(PolicyError::NotEnoughItemsSelected(self.id.clone()));
|
return Err(PolicyError::NotEnoughItemsSelected(self.id.clone()));
|
||||||
}
|
}
|
||||||
if let Some(item) = selected.iter().find(|i| **i >= keys.len()) {
|
if let Some(item) = selected.into_iter().find(|&i| i >= keys.len()) {
|
||||||
return Err(PolicyError::IndexOutOfRange(*item));
|
return Err(PolicyError::IndexOutOfRange(item));
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(Condition::default())
|
Ok(Condition::default())
|
||||||
@@ -741,6 +753,7 @@ fn signer_id(key: &DescriptorPublicKey, secp: &SecpCtx) -> SignerId {
|
|||||||
..
|
..
|
||||||
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
||||||
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -778,9 +791,9 @@ fn make_generic_signature<M: Fn() -> SatisfiableItem, F: Fn(&Psbt) -> bool>(
|
|||||||
fn generic_sig_in_psbt<
|
fn generic_sig_in_psbt<
|
||||||
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
||||||
// for a specific key
|
// for a specific key
|
||||||
C: Fn(&PsbtInput, &SinglePubKey) -> bool,
|
C: Fn(&psbt::Input, &SinglePubKey) -> bool,
|
||||||
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
||||||
E: Fn(&PsbtInput, Fingerprint) -> Option<SinglePubKey>,
|
E: Fn(&psbt::Input, Fingerprint) -> Option<SinglePubKey>,
|
||||||
>(
|
>(
|
||||||
psbt: &Psbt,
|
psbt: &Psbt,
|
||||||
key: &DescriptorPublicKey,
|
key: &DescriptorPublicKey,
|
||||||
@@ -798,6 +811,13 @@ fn generic_sig_in_psbt<
|
|||||||
None => false,
|
None => false,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => {
|
||||||
|
//TODO check actual derivation matches
|
||||||
|
match extract(input, xpub.root_fingerprint(secp)) {
|
||||||
|
Some(pubkey) => check(input, &pubkey),
|
||||||
|
None => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -903,12 +923,12 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
}
|
}
|
||||||
Terminal::After(value) => {
|
Terminal::After(value) => {
|
||||||
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
||||||
value: value.into(),
|
value: (*value).into(),
|
||||||
}
|
}
|
||||||
.into();
|
.into();
|
||||||
policy.contribution = Satisfaction::Complete {
|
policy.contribution = Satisfaction::Complete {
|
||||||
condition: Condition {
|
condition: Condition {
|
||||||
timelock: Some(value.into()),
|
timelock: Some((*value).into()),
|
||||||
csv: None,
|
csv: None,
|
||||||
},
|
},
|
||||||
};
|
};
|
||||||
@@ -920,9 +940,9 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
{
|
{
|
||||||
let after = After::new(Some(current_height), false);
|
let after = After::new(Some(current_height), false);
|
||||||
let after_sat =
|
let after_sat =
|
||||||
Satisfier::<bitcoin::PublicKey>::check_after(&after, value.into());
|
Satisfier::<bitcoin::PublicKey>::check_after(&after, (*value).into());
|
||||||
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
||||||
Satisfier::<bitcoin::PublicKey>::check_after(&sat, value.into())
|
Satisfier::<bitcoin::PublicKey>::check_after(&sat, (*value).into())
|
||||||
});
|
});
|
||||||
if after_sat && inputs_sat {
|
if after_sat && inputs_sat {
|
||||||
policy.satisfaction = policy.contribution.clone();
|
policy.satisfaction = policy.contribution.clone();
|
||||||
@@ -1146,12 +1166,12 @@ mod test {
|
|||||||
use crate::descriptor::policy::SatisfiableItem::{EcdsaSignature, Multisig, Thresh};
|
use crate::descriptor::policy::SatisfiableItem::{EcdsaSignature, Multisig, Thresh};
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
use crate::wallet::signer::SignersContainer;
|
use crate::wallet::signer::SignersContainer;
|
||||||
|
use alloc::{string::ToString, sync::Arc};
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use std::str::FromStr;
|
use core::str::FromStr;
|
||||||
use std::sync::Arc;
|
|
||||||
|
|
||||||
const TPRV0_STR:&str = "tprv8ZgxMBicQKsPdZXrcHNLf5JAJWFAoJ2TrstMRdSKtEggz6PddbuSkvHKM9oKJyFgZV1B7rw8oChspxyYbtmEXYyg1AjfWbL3ho3XHDpHRZf";
|
const TPRV0_STR:&str = "tprv8ZgxMBicQKsPdZXrcHNLf5JAJWFAoJ2TrstMRdSKtEggz6PddbuSkvHKM9oKJyFgZV1B7rw8oChspxyYbtmEXYyg1AjfWbL3ho3XHDpHRZf";
|
||||||
const TPRV1_STR:&str = "tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N";
|
const TPRV1_STR:&str = "tprv8ZgxMBicQKsPdpkqS7Eair4YxjcuuvDPNYmKX3sCniCf16tHEVrjjiSXEkFRnUH77yXc6ZcwHHcLNfjdi5qUvw3VDfgYiH5mNsj5izuiu2N";
|
||||||
@@ -1444,12 +1464,12 @@ mod test {
|
|||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
let policy = wallet_desc
|
let _policy = wallet_desc
|
||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
println!("desc policy = {:?}", policy); // TODO remove
|
// println!("desc policy = {:?}", policy); // TODO remove
|
||||||
// TODO how should this fail with mixed timelocks?
|
// TODO how should this fail with mixed timelocks?
|
||||||
}
|
}
|
||||||
|
|
||||||
// - multiple timelocks of the same type should be correctly merged together
|
// - multiple timelocks of the same type should be correctly merged together
|
||||||
@@ -1469,12 +1489,12 @@ mod test {
|
|||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
let policy = wallet_desc
|
let _policy = wallet_desc
|
||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
println!("desc policy = {:?}", policy); // TODO remove
|
// println!("desc policy = {:?}", policy); // TODO remove
|
||||||
// TODO how should this merge timelocks?
|
// TODO how should this merge timelocks?
|
||||||
let (prvkey1, _pubkey1, _fingerprint1) = setup_keys(TPRV0_STR, PATH, &secp);
|
let (prvkey1, _pubkey1, _fingerprint1) = setup_keys(TPRV0_STR, PATH, &secp);
|
||||||
let locktime_seconds0 = 500000100;
|
let locktime_seconds0 = 500000100;
|
||||||
let locktime_seconds1 = 500000200;
|
let locktime_seconds1 = 500000200;
|
||||||
@@ -1487,12 +1507,12 @@ mod test {
|
|||||||
.into_wallet_descriptor(&secp, Network::Testnet)
|
.into_wallet_descriptor(&secp, Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
let signers_container = Arc::new(SignersContainer::build(keymap, &wallet_desc, &secp));
|
||||||
let policy = wallet_desc
|
let _policy = wallet_desc
|
||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
println!("desc policy = {:?}", policy); // TODO remove
|
// println!("desc policy = {:?}", policy); // TODO remove
|
||||||
|
|
||||||
// TODO how should this merge timelocks?
|
// TODO how should this merge timelocks?
|
||||||
}
|
}
|
||||||
@@ -1567,6 +1587,7 @@ mod test {
|
|||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -1633,6 +1654,7 @@ mod test {
|
|||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -14,10 +14,10 @@
|
|||||||
//! This module contains the definition of various common script templates that are ready to be
|
//! This module contains the definition of various common script templates that are ready to be
|
||||||
//! used. See the documentation of each template for an example.
|
//! used. See the documentation of each template for an example.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::{Legacy, Segwitv0};
|
use miniscript::{Legacy, Segwitv0, Tap};
|
||||||
|
|
||||||
use super::{ExtendedDescriptor, IntoWalletDescriptor, KeyMap};
|
use super::{ExtendedDescriptor, IntoWalletDescriptor, KeyMap};
|
||||||
use crate::descriptor::DescriptorError;
|
use crate::descriptor::DescriptorError;
|
||||||
@@ -73,22 +73,16 @@ impl<T: DescriptorTemplate> IntoWalletDescriptor for T {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet};
|
/// # use bdk::Wallet;
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::P2Pkh;
|
/// use bdk::template::P2Pkh;
|
||||||
///
|
///
|
||||||
/// let key =
|
/// let key =
|
||||||
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(P2Pkh(key), None, Network::Testnet)?;
|
||||||
/// P2Pkh(key),
|
|
||||||
/// None,
|
|
||||||
/// Network::Testnet,
|
|
||||||
/// MemoryDatabase::default(),
|
|
||||||
/// )?;
|
|
||||||
///
|
///
|
||||||
/// assert_eq!(
|
/// assert_eq!(
|
||||||
/// wallet.get_address(New)?.to_string(),
|
/// wallet.get_address(New).to_string(),
|
||||||
/// "mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"
|
/// "mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"
|
||||||
/// );
|
/// );
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
@@ -107,22 +101,16 @@ impl<K: IntoDescriptorKey<Legacy>> DescriptorTemplate for P2Pkh<K> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet};
|
/// # use bdk::Wallet;
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
|
||||||
/// use bdk::template::P2Wpkh_P2Sh;
|
/// use bdk::template::P2Wpkh_P2Sh;
|
||||||
|
/// use bdk::wallet::AddressIndex;
|
||||||
///
|
///
|
||||||
/// let key =
|
/// let key =
|
||||||
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(P2Wpkh_P2Sh(key), None, Network::Testnet)?;
|
||||||
/// P2Wpkh_P2Sh(key),
|
|
||||||
/// None,
|
|
||||||
/// Network::Testnet,
|
|
||||||
/// MemoryDatabase::default(),
|
|
||||||
/// )?;
|
|
||||||
///
|
///
|
||||||
/// assert_eq!(
|
/// assert_eq!(
|
||||||
/// wallet.get_address(New)?.to_string(),
|
/// wallet.get_address(AddressIndex::New).to_string(),
|
||||||
/// "2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"
|
/// "2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"
|
||||||
/// );
|
/// );
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
@@ -143,21 +131,15 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh_P2Sh<K> {
|
|||||||
/// ```
|
/// ```
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet};
|
/// # use bdk::{Wallet};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
|
||||||
/// use bdk::template::P2Wpkh;
|
/// use bdk::template::P2Wpkh;
|
||||||
|
/// use bdk::wallet::AddressIndex::New;
|
||||||
///
|
///
|
||||||
/// let key =
|
/// let key =
|
||||||
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(P2Wpkh(key), None, Network::Testnet)?;
|
||||||
/// P2Wpkh(key),
|
|
||||||
/// None,
|
|
||||||
/// Network::Testnet,
|
|
||||||
/// MemoryDatabase::default(),
|
|
||||||
/// )?;
|
|
||||||
///
|
///
|
||||||
/// assert_eq!(
|
/// assert_eq!(
|
||||||
/// wallet.get_address(New)?.to_string(),
|
/// wallet.get_address(New).to_string(),
|
||||||
/// "tb1q4525hmgw265tl3drrl8jjta7ayffu6jf68ltjd"
|
/// "tb1q4525hmgw265tl3drrl8jjta7ayffu6jf68ltjd"
|
||||||
/// );
|
/// );
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
@@ -170,6 +152,34 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh<K> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// P2TR template. Expands to a descriptor `tr(key)`
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::Wallet;
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::P2TR;
|
||||||
|
///
|
||||||
|
/// let key =
|
||||||
|
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
||||||
|
/// let mut wallet = Wallet::new_no_persist(P2TR(key), None, Network::Testnet)?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(
|
||||||
|
/// wallet.get_address(New).to_string(),
|
||||||
|
/// "tb1pvjf9t34fznr53u5tqhejz4nr69luzkhlvsdsdfq9pglutrpve2xq7hps46"
|
||||||
|
/// );
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct P2TR<K: IntoDescriptorKey<Tap>>(pub K);
|
||||||
|
|
||||||
|
impl<K: IntoDescriptorKey<Tap>> DescriptorTemplate for P2TR<K> {
|
||||||
|
fn build(self, _network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
descriptor!(tr(self.0))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// BIP44 template. Expands to `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
/// BIP44 template. Expands to `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
///
|
///
|
||||||
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
||||||
@@ -182,20 +192,18 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh<K> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet, KeychainKind};
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44;
|
/// use bdk::template::Bip44;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip44(key.clone(), KeychainKind::External),
|
/// Bip44(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip44(key, KeychainKind::Internal)),
|
/// Some(Bip44(key, KeychainKind::Internal)),
|
||||||
/// Network::Testnet,
|
/// Network::Testnet,
|
||||||
/// MemoryDatabase::default()
|
|
||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "mmogjc7HJEZkrLqyQYqJmxUqFaC7i4uf89");
|
/// assert_eq!(wallet.get_address(New).to_string(), "mmogjc7HJEZkrLqyQYqJmxUqFaC7i4uf89");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "pkh([c55b303f/44'/1'/0']tpubDCuorCpzvYS2LCD75BR46KHE8GdDeg1wsAgNZeNr6DaB5gQK1o14uErKwKLuFmeemkQ6N2m3rNgvctdJLyr7nwu2yia7413Hhg8WWE44cgT/0/*)#5wrnv0xt");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "pkh([c55b303f/44'/1'/0']tpubDCuorCpzvYS2LCD75BR46KHE8GdDeg1wsAgNZeNr6DaB5gQK1o14uErKwKLuFmeemkQ6N2m3rNgvctdJLyr7nwu2yia7413Hhg8WWE44cgT/0/*)#5wrnv0xt");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip44<K: DerivableKey<Legacy>>(pub K, pub KeychainKind);
|
pub struct Bip44<K: DerivableKey<Legacy>>(pub K, pub KeychainKind);
|
||||||
@@ -221,21 +229,19 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44<K> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet, KeychainKind};
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44Public;
|
/// use bdk::template::Bip44Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
/// Network::Testnet,
|
/// Network::Testnet,
|
||||||
/// MemoryDatabase::default()
|
|
||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "miNG7dJTzJqNbFS19svRdTCisC65dsubtR");
|
/// assert_eq!(wallet.get_address(New).to_string(), "miNG7dJTzJqNbFS19svRdTCisC65dsubtR");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "pkh([c55b303f/44'/1'/0']tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU/0/*)#cfhumdqz");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "pkh([c55b303f/44'/1'/0']tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU/0/*)#cfhumdqz");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip44Public<K: DerivableKey<Legacy>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
pub struct Bip44Public<K: DerivableKey<Legacy>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
@@ -261,20 +267,18 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet, KeychainKind};
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49;
|
/// use bdk::template::Bip49;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip49(key.clone(), KeychainKind::External),
|
/// Bip49(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip49(key, KeychainKind::Internal)),
|
/// Some(Bip49(key, KeychainKind::Internal)),
|
||||||
/// Network::Testnet,
|
/// Network::Testnet,
|
||||||
/// MemoryDatabase::default()
|
|
||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "2N4zkWAoGdUv4NXhSsU8DvS5MB36T8nKHEB");
|
/// assert_eq!(wallet.get_address(New).to_string(), "2N4zkWAoGdUv4NXhSsU8DvS5MB36T8nKHEB");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "sh(wpkh([c55b303f/49'/1'/0']tpubDDYr4kdnZgjjShzYNjZUZXUUtpXaofdkMaipyS8ThEh45qFmhT4hKYways7UXmg6V7het1QiFo9kf4kYUXyDvV4rHEyvSpys9pjCB3pukxi/0/*))#s9vxlc8e");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "sh(wpkh([c55b303f/49'/1'/0']tpubDDYr4kdnZgjjShzYNjZUZXUUtpXaofdkMaipyS8ThEh45qFmhT4hKYways7UXmg6V7het1QiFo9kf4kYUXyDvV4rHEyvSpys9pjCB3pukxi/0/*))#s9vxlc8e");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip49<K: DerivableKey<Segwitv0>>(pub K, pub KeychainKind);
|
pub struct Bip49<K: DerivableKey<Segwitv0>>(pub K, pub KeychainKind);
|
||||||
@@ -300,21 +304,19 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet, KeychainKind};
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49Public;
|
/// use bdk::template::Bip49Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
/// Network::Testnet,
|
/// Network::Testnet,
|
||||||
/// MemoryDatabase::default()
|
|
||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt");
|
/// assert_eq!(wallet.get_address(New).to_string(), "2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "sh(wpkh([c55b303f/49'/1'/0']tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L/0/*))#3tka9g0q");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "sh(wpkh([c55b303f/49'/1'/0']tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L/0/*))#3tka9g0q");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip49Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
pub struct Bip49Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
@@ -340,20 +342,18 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet, KeychainKind};
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84;
|
/// use bdk::template::Bip84;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip84(key.clone(), KeychainKind::External),
|
/// Bip84(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip84(key, KeychainKind::Internal)),
|
/// Some(Bip84(key, KeychainKind::Internal)),
|
||||||
/// Network::Testnet,
|
/// Network::Testnet,
|
||||||
/// MemoryDatabase::default()
|
|
||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "tb1qhl85z42h7r4su5u37rvvw0gk8j2t3n9y7zsg4n");
|
/// assert_eq!(wallet.get_address(New).to_string(), "tb1qhl85z42h7r4su5u37rvvw0gk8j2t3n9y7zsg4n");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "wpkh([c55b303f/84'/1'/0']tpubDDc5mum24DekpNw92t6fHGp8Gr2JjF9J7i4TZBtN6Vp8xpAULG5CFaKsfugWa5imhrQQUZKXe261asP5koDHo5bs3qNTmf3U3o4v9SaB8gg/0/*)#6kfecsmr");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "wpkh([c55b303f/84'/1'/0']tpubDDc5mum24DekpNw92t6fHGp8Gr2JjF9J7i4TZBtN6Vp8xpAULG5CFaKsfugWa5imhrQQUZKXe261asP5koDHo5bs3qNTmf3U3o4v9SaB8gg/0/*)#6kfecsmr");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip84<K: DerivableKey<Segwitv0>>(pub K, pub KeychainKind);
|
pub struct Bip84<K: DerivableKey<Segwitv0>>(pub K, pub KeychainKind);
|
||||||
@@ -379,21 +379,19 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bdk::bitcoin::{PrivateKey, Network};
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
/// # use bdk::{Wallet, KeychainKind};
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
/// # use bdk::database::MemoryDatabase;
|
|
||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84Public;
|
/// use bdk::template::Bip84Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
/// Network::Testnet,
|
/// Network::Testnet,
|
||||||
/// MemoryDatabase::default()
|
|
||||||
/// )?;
|
/// )?;
|
||||||
///
|
///
|
||||||
/// assert_eq!(wallet.get_address(New)?.to_string(), "tb1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2pr6y4qc7");
|
/// assert_eq!(wallet.get_address(New).to_string(), "tb1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2pr6y4qc7");
|
||||||
/// assert_eq!(wallet.public_descriptor(KeychainKind::External)?.unwrap().to_string(), "wpkh([c55b303f/84'/1'/0']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#dhu402yv");
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "wpkh([c55b303f/84'/1'/0']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#dhu402yv");
|
||||||
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub struct Bip84Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
pub struct Bip84Public<K: DerivableKey<Segwitv0>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
@@ -407,6 +405,81 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84Public<K> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// BIP86 template. Expands to `tr(key/86'/{0,1}'/0'/{0,1}/*)`
|
||||||
|
///
|
||||||
|
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
||||||
|
///
|
||||||
|
/// See [`Bip86Public`] for a template that can work with a `xpub`/`tpub`.
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::Bip86;
|
||||||
|
///
|
||||||
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
|
/// Bip86(key.clone(), KeychainKind::External),
|
||||||
|
/// Some(Bip86(key, KeychainKind::Internal)),
|
||||||
|
/// Network::Testnet,
|
||||||
|
/// )?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(wallet.get_address(New).to_string(), "tb1p5unlj09djx8xsjwe97269kqtxqpwpu2epeskgqjfk4lnf69v4tnqpp35qu");
|
||||||
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "tr([c55b303f/86'/1'/0']tpubDCiHofpEs47kx358bPdJmTZHmCDqQ8qw32upCSxHrSEdeeBs2T5Mq6QMB2ukeMqhNBiyhosBvJErteVhfURPGXPv3qLJPw5MVpHUewsbP2m/0/*)#dkgvr5hm");
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct Bip86<K: DerivableKey<Tap>>(pub K, pub KeychainKind);
|
||||||
|
|
||||||
|
impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86<K> {
|
||||||
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
P2TR(segwit_v1::make_bipxx_private(86, self.0, self.1, network)?).build(network)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// BIP86 public template. Expands to `tr(key/{0,1}/*)`
|
||||||
|
///
|
||||||
|
/// This assumes that the key used has already been derived with `m/86'/0'/0'` for Mainnet or `m/86'/1'/0'` for Testnet.
|
||||||
|
///
|
||||||
|
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
||||||
|
///
|
||||||
|
/// See [`Bip86`] for a template that does the full derivation, but requires private data
|
||||||
|
/// for the key.
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::Bip86Public;
|
||||||
|
///
|
||||||
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
|
/// Bip86Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
|
/// Some(Bip86Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
|
/// Network::Testnet,
|
||||||
|
/// )?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(wallet.get_address(New).to_string(), "tb1pwjp9f2k5n0xq73ecuu0c5njvgqr3vkh7yaylmpqvsuuaafymh0msvcmh37");
|
||||||
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "tr([c55b303f/86'/1'/0']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#2p65srku");
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct Bip86Public<K: DerivableKey<Tap>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
|
|
||||||
|
impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86Public<K> {
|
||||||
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
P2TR(segwit_v1::make_bipxx_public(
|
||||||
|
86, self.0, self.1, self.2, network,
|
||||||
|
)?)
|
||||||
|
.build(network)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
macro_rules! expand_make_bipxx {
|
macro_rules! expand_make_bipxx {
|
||||||
( $mod_name:ident, $ctx:ty ) => {
|
( $mod_name:ident, $ctx:ty ) => {
|
||||||
mod $mod_name {
|
mod $mod_name {
|
||||||
@@ -418,7 +491,7 @@ macro_rules! expand_make_bipxx {
|
|||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
network: Network,
|
network: Network,
|
||||||
) -> Result<impl IntoDescriptorKey<$ctx>, DescriptorError> {
|
) -> Result<impl IntoDescriptorKey<$ctx>, DescriptorError> {
|
||||||
let mut derivation_path = Vec::with_capacity(4);
|
let mut derivation_path = alloc::vec::Vec::with_capacity(4);
|
||||||
derivation_path.push(bip32::ChildNumber::from_hardened_idx(bip)?);
|
derivation_path.push(bip32::ChildNumber::from_hardened_idx(bip)?);
|
||||||
|
|
||||||
match network {
|
match network {
|
||||||
@@ -473,49 +546,50 @@ macro_rules! expand_make_bipxx {
|
|||||||
|
|
||||||
expand_make_bipxx!(legacy, Legacy);
|
expand_make_bipxx!(legacy, Legacy);
|
||||||
expand_make_bipxx!(segwit_v0, Segwitv0);
|
expand_make_bipxx!(segwit_v0, Segwitv0);
|
||||||
|
expand_make_bipxx!(segwit_v1, Tap);
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
// test existing descriptor templates, make sure they are expanded to the right descriptors
|
// test existing descriptor templates, make sure they are expanded to the right descriptors
|
||||||
|
|
||||||
use std::str::FromStr;
|
use alloc::{string::ToString, vec::Vec};
|
||||||
|
use core::str::FromStr;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::ValidNetworks;
|
use crate::keys::ValidNetworks;
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::network::constants::Network::Regtest;
|
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::Descriptor;
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template_cointype() {
|
fn test_bip44_template_cointype() {
|
||||||
use bitcoin::util::bip32::ChildNumber::{self, Hardened};
|
use bitcoin::bip32::ChildNumber::{self, Hardened};
|
||||||
|
|
||||||
let xprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
let xprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
||||||
assert_eq!(Network::Bitcoin, xprvkey.network);
|
assert_eq!(Network::Bitcoin, xprvkey.network);
|
||||||
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Bitcoin)
|
.build(Network::Bitcoin)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.first().unwrap();
|
||||||
assert_matches!(purpose, Hardened { index: 44 });
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert_matches!(coin_type, Hardened { index: 0 });
|
assert_matches!(coin_type, Hardened { index: 0 });
|
||||||
}
|
}
|
||||||
|
|
||||||
let tprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let tprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
assert_eq!(Network::Testnet, tprvkey.network);
|
assert_eq!(Network::Testnet, tprvkey.network);
|
||||||
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Testnet)
|
.build(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.first().unwrap();
|
||||||
assert_matches!(purpose, Hardened { index: 44 });
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert_matches!(coin_type, Hardened { index: 1 });
|
assert_matches!(coin_type, Hardened { index: 1 });
|
||||||
@@ -526,20 +600,23 @@ mod test {
|
|||||||
fn check(
|
fn check(
|
||||||
desc: Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>,
|
desc: Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>,
|
||||||
is_witness: bool,
|
is_witness: bool,
|
||||||
|
is_taproot: bool,
|
||||||
is_fixed: bool,
|
is_fixed: bool,
|
||||||
|
network: Network,
|
||||||
expected: &[&str],
|
expected: &[&str],
|
||||||
) {
|
) {
|
||||||
let (desc, _key_map, _networks) = desc.unwrap();
|
let (desc, _key_map, _networks) = desc.unwrap();
|
||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
|
assert_eq!(desc.is_taproot(), is_taproot);
|
||||||
assert_eq!(!desc.has_wildcard(), is_fixed);
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let index = i as u32;
|
||||||
let child_desc = if !desc.has_wildcard() {
|
let child_desc = if !desc.has_wildcard() {
|
||||||
desc.at_derivation_index(0)
|
desc.at_derivation_index(0).unwrap()
|
||||||
} else {
|
} else {
|
||||||
desc.at_derivation_index(index)
|
desc.at_derivation_index(index).unwrap()
|
||||||
};
|
};
|
||||||
let address = child_desc.address(Regtest).unwrap();
|
let address = child_desc.address(network).unwrap();
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -553,7 +630,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Pkh(prvkey).build(Network::Bitcoin),
|
P2Pkh(prvkey).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"],
|
&["mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -564,7 +643,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Pkh(pubkey).build(Network::Bitcoin),
|
P2Pkh(pubkey).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["muZpTpBYhxmRFuCjLc7C6BBDF32C8XVJUi"],
|
&["muZpTpBYhxmRFuCjLc7C6BBDF32C8XVJUi"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@@ -578,7 +659,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh_P2Sh(prvkey).build(Network::Bitcoin),
|
P2Wpkh_P2Sh(prvkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"],
|
&["2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -589,7 +672,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh_P2Sh(pubkey).build(Network::Bitcoin),
|
P2Wpkh_P2Sh(pubkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["2N5LiC3CqzxDamRTPG1kiNv1FpNJQ7x28sb"],
|
&["2N5LiC3CqzxDamRTPG1kiNv1FpNJQ7x28sb"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@@ -603,7 +688,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh(prvkey).build(Network::Bitcoin),
|
P2Wpkh(prvkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["bcrt1q4525hmgw265tl3drrl8jjta7ayffu6jfcwxx9y"],
|
&["bcrt1q4525hmgw265tl3drrl8jjta7ayffu6jfcwxx9y"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -614,19 +701,52 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh(pubkey).build(Network::Bitcoin),
|
P2Wpkh(pubkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["bcrt1qngw83fg8dz0k749cg7k3emc7v98wy0c7azaa6h"],
|
&["bcrt1qngw83fg8dz0k749cg7k3emc7v98wy0c7azaa6h"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// P2TR `tr(key)`
|
||||||
|
#[test]
|
||||||
|
fn test_p2tr_template() {
|
||||||
|
let prvkey =
|
||||||
|
bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")
|
||||||
|
.unwrap();
|
||||||
|
check(
|
||||||
|
P2TR(prvkey).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
true,
|
||||||
|
Network::Regtest,
|
||||||
|
&["bcrt1pvjf9t34fznr53u5tqhejz4nr69luzkhlvsdsdfq9pglutrpve2xqnwtkqq"],
|
||||||
|
);
|
||||||
|
|
||||||
|
let pubkey = bitcoin::PublicKey::from_str(
|
||||||
|
"03a34b99f22c790c4e36b2b3c2c35a36db06226e41c692fc82b8b56ac1c540c5bd",
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
check(
|
||||||
|
P2TR(pubkey).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
true,
|
||||||
|
Network::Regtest,
|
||||||
|
&["bcrt1pw74tdcrxlzn5r8z6ku2vztr86fgq0m245s72mjktf4afwzsf8ugs4evwdf"],
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template() {
|
fn test_bip44_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"n453VtnjDHPyDt2fDstKSu7A3YCJoHZ5g5",
|
"n453VtnjDHPyDt2fDstKSu7A3YCJoHZ5g5",
|
||||||
"mvfrrumXgTtwFPWDNUecBBgzuMXhYM7KRP",
|
"mvfrrumXgTtwFPWDNUecBBgzuMXhYM7KRP",
|
||||||
@@ -637,6 +757,8 @@ mod test {
|
|||||||
Bip44(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"muHF98X9KxEzdKrnFAX85KeHv96eXopaip",
|
"muHF98X9KxEzdKrnFAX85KeHv96eXopaip",
|
||||||
"n4hpyLJE5ub6B5Bymv4eqFxS5KjrewSmYR",
|
"n4hpyLJE5ub6B5Bymv4eqFxS5KjrewSmYR",
|
||||||
@@ -648,12 +770,14 @@ mod test {
|
|||||||
// BIP44 public `pkh(key/{0,1}/*)`
|
// BIP44 public `pkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_public_template() {
|
fn test_bip44_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"miNG7dJTzJqNbFS19svRdTCisC65dsubtR",
|
"miNG7dJTzJqNbFS19svRdTCisC65dsubtR",
|
||||||
"n2UqaDbCjWSFJvpC84m3FjUk5UaeibCzYg",
|
"n2UqaDbCjWSFJvpC84m3FjUk5UaeibCzYg",
|
||||||
@@ -664,6 +788,8 @@ mod test {
|
|||||||
Bip44Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"moDr3vJ8wpt5nNxSK55MPq797nXJb2Ru9H",
|
"moDr3vJ8wpt5nNxSK55MPq797nXJb2Ru9H",
|
||||||
"ms7A1Yt4uTezT2XkefW12AvLoko8WfNJMG",
|
"ms7A1Yt4uTezT2XkefW12AvLoko8WfNJMG",
|
||||||
@@ -675,11 +801,13 @@ mod test {
|
|||||||
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_template() {
|
fn test_bip49_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2N9bCAJXGm168MjVwpkBdNt6ucka3PKVoUV",
|
"2N9bCAJXGm168MjVwpkBdNt6ucka3PKVoUV",
|
||||||
"2NDckYkqrYyDMtttEav5hB3Bfw9EGAW5HtS",
|
"2NDckYkqrYyDMtttEav5hB3Bfw9EGAW5HtS",
|
||||||
@@ -690,6 +818,8 @@ mod test {
|
|||||||
Bip49(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2NB3pA8PnzJLGV8YEKNDFpbViZv3Bm1K6CG",
|
"2NB3pA8PnzJLGV8YEKNDFpbViZv3Bm1K6CG",
|
||||||
"2NBiX2Wzxngb5rPiWpUiJQ2uLVB4HBjFD4p",
|
"2NBiX2Wzxngb5rPiWpUiJQ2uLVB4HBjFD4p",
|
||||||
@@ -701,12 +831,14 @@ mod test {
|
|||||||
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_public_template() {
|
fn test_bip49_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt",
|
"2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt",
|
||||||
"2NCTQfJ1sZa3wQ3pPseYRHbaNEpC3AquEfX",
|
"2NCTQfJ1sZa3wQ3pPseYRHbaNEpC3AquEfX",
|
||||||
@@ -717,6 +849,8 @@ mod test {
|
|||||||
Bip49Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2NF2vttKibwyxigxtx95Zw8K7JhDbo5zPVJ",
|
"2NF2vttKibwyxigxtx95Zw8K7JhDbo5zPVJ",
|
||||||
"2Mtmyd8taksxNVWCJ4wVvaiss7QPZGcAJuH",
|
"2Mtmyd8taksxNVWCJ4wVvaiss7QPZGcAJuH",
|
||||||
@@ -728,11 +862,13 @@ mod test {
|
|||||||
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_template() {
|
fn test_bip84_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qkmvk2nadgplmd57ztld8nf8v2yxkzmdvwtjf8s",
|
"bcrt1qkmvk2nadgplmd57ztld8nf8v2yxkzmdvwtjf8s",
|
||||||
"bcrt1qx0v6zgfwe50m4kqc58cqzcyem7ay2sfl3gvqhp",
|
"bcrt1qx0v6zgfwe50m4kqc58cqzcyem7ay2sfl3gvqhp",
|
||||||
@@ -743,6 +879,8 @@ mod test {
|
|||||||
Bip84(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qtrwtz00wxl69e5xex7amy4xzlxkaefg3gfdkxa",
|
"bcrt1qtrwtz00wxl69e5xex7amy4xzlxkaefg3gfdkxa",
|
||||||
"bcrt1qqqasfhxpkkf7zrxqnkr2sfhn74dgsrc3e3ky45",
|
"bcrt1qqqasfhxpkkf7zrxqnkr2sfhn74dgsrc3e3ky45",
|
||||||
@@ -754,12 +892,14 @@ mod test {
|
|||||||
// BIP84 public `wpkh(key/{0,1}/*)`
|
// BIP84 public `wpkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_public_template() {
|
fn test_bip84_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2prcdvd0h",
|
"bcrt1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2prcdvd0h",
|
||||||
"bcrt1q3lncdlwq3lgcaaeyruynjnlccr0ve0kakh6ana",
|
"bcrt1q3lncdlwq3lgcaaeyruynjnlccr0ve0kakh6ana",
|
||||||
@@ -770,6 +910,8 @@ mod test {
|
|||||||
Bip84Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qm6wqukenh7guu792lj2njgw9n78cmwsy8xy3z2",
|
"bcrt1qm6wqukenh7guu792lj2njgw9n78cmwsy8xy3z2",
|
||||||
"bcrt1q694twxtjn4nnrvnyvra769j0a23rllj5c6cgwp",
|
"bcrt1q694twxtjn4nnrvnyvra769j0a23rllj5c6cgwp",
|
||||||
@@ -777,4 +919,67 @@ mod test {
|
|||||||
],
|
],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// BIP86 `tr(key/86'/0'/0'/{0,1}/*)`
|
||||||
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
|
#[test]
|
||||||
|
fn test_bip86_template() {
|
||||||
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
||||||
|
check(
|
||||||
|
Bip86(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p5cyxnuxmeuwuvkwfem96lqzszd02n6xdcjrs20cac6yqjjwudpxqkedrcr",
|
||||||
|
"bc1p4qhjn9zdvkux4e44uhx8tc55attvtyu358kutcqkudyccelu0was9fqzwh",
|
||||||
|
"bc1p0d0rhyynq0awa9m8cqrcr8f5nxqx3aw29w4ru5u9my3h0sfygnzs9khxz8",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
check(
|
||||||
|
Bip86(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p3qkhfews2uk44qtvauqyr2ttdsw7svhkl9nkm9s9c3x4ax5h60wqwruhk7",
|
||||||
|
"bc1ptdg60grjk9t3qqcqczp4tlyy3z47yrx9nhlrjsmw36q5a72lhdrs9f00nj",
|
||||||
|
"bc1pgcwgsu8naxp7xlp5p7ufzs7emtfza2las7r2e7krzjhe5qj5xz2q88kmk5",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// BIP86 public `tr(key/{0,1}/*)`
|
||||||
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
|
#[test]
|
||||||
|
fn test_bip86_public_template() {
|
||||||
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
||||||
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
||||||
|
check(
|
||||||
|
Bip86Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p5cyxnuxmeuwuvkwfem96lqzszd02n6xdcjrs20cac6yqjjwudpxqkedrcr",
|
||||||
|
"bc1p4qhjn9zdvkux4e44uhx8tc55attvtyu358kutcqkudyccelu0was9fqzwh",
|
||||||
|
"bc1p0d0rhyynq0awa9m8cqrcr8f5nxqx3aw29w4ru5u9my3h0sfygnzs9khxz8",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
check(
|
||||||
|
Bip86Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p3qkhfews2uk44qtvauqyr2ttdsw7svhkl9nkm9s9c3x4ax5h60wqwruhk7",
|
||||||
|
"bc1ptdg60grjk9t3qqcqczp4tlyy3z47yrx9nhlrjsmw36q5a72lhdrs9f00nj",
|
||||||
|
"bc1pgcwgsu8naxp7xlp5p7ufzs7emtfza2las7r2e7krzjhe5qj5xz2q88kmk5",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
@@ -14,7 +14,8 @@
|
|||||||
// TODO: maybe write our own implementation of bip39? Seems stupid to have an extra dependency for
|
// TODO: maybe write our own implementation of bip39? Seems stupid to have an extra dependency for
|
||||||
// something that should be fairly simple to re-implement.
|
// something that should be fairly simple to re-implement.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use alloc::string::String;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
@@ -141,7 +142,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
(word_count, language): Self::Options,
|
(word_count, language): Self::Options,
|
||||||
entropy: Self::Entropy,
|
entropy: Self::Entropy,
|
||||||
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
||||||
let entropy = &entropy.as_ref()[..(word_count as usize / 8)];
|
let entropy = &entropy[..(word_count as usize / 8)];
|
||||||
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
||||||
|
|
||||||
Ok(GeneratedKey::new(mnemonic, any_network()))
|
Ok(GeneratedKey::new(mnemonic, any_network()))
|
||||||
@@ -150,9 +151,10 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use alloc::string::ToString;
|
||||||
|
use core::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use bip39::{Language, Mnemonic};
|
use bip39::{Language, Mnemonic};
|
||||||
|
|
||||||
@@ -11,16 +11,19 @@
|
|||||||
|
|
||||||
//! Key formats
|
//! Key formats
|
||||||
|
|
||||||
use std::any::TypeId;
|
use crate::collections::HashSet;
|
||||||
use std::collections::HashSet;
|
use alloc::string::{String, ToString};
|
||||||
use std::marker::PhantomData;
|
use alloc::vec::Vec;
|
||||||
use std::ops::Deref;
|
use core::any::TypeId;
|
||||||
use std::str::FromStr;
|
use core::fmt;
|
||||||
|
use core::marker::PhantomData;
|
||||||
|
use core::ops::Deref;
|
||||||
|
use core::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::{Network, PrivateKey, PublicKey, XOnlyPublicKey};
|
use bitcoin::{key::XOnlyPublicKey, Network, PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
||||||
pub use miniscript::descriptor::{
|
pub use miniscript::descriptor::{
|
||||||
@@ -277,7 +280,7 @@ impl<Ctx: ScriptContext + 'static> ExtScriptContext for Ctx {
|
|||||||
///
|
///
|
||||||
/// ```compile_fail
|
/// ```compile_fail
|
||||||
/// use bdk::bitcoin::PublicKey;
|
/// use bdk::bitcoin::PublicKey;
|
||||||
/// use std::str::FromStr;
|
/// use core::str::FromStr;
|
||||||
///
|
///
|
||||||
/// use bdk::keys::{DescriptorKey, IntoDescriptorKey, KeyError};
|
/// use bdk::keys::{DescriptorKey, IntoDescriptorKey, KeyError};
|
||||||
///
|
///
|
||||||
@@ -385,12 +388,12 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// network: bitcoin::Network,
|
/// network: bitcoin::Network,
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
@@ -401,7 +404,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@@ -410,20 +413,20 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// }
|
/// }
|
||||||
/// ```
|
/// ```
|
||||||
///
|
///
|
||||||
/// Types that don't internally encode the [`Network`](bitcoin::Network) in which they are valid need some extra
|
/// Types that don't internally encode the [`Network`] in which they are valid need some extra
|
||||||
/// steps to override the set of valid networks, otherwise only the network specified in the
|
/// steps to override the set of valid networks, otherwise only the network specified in the
|
||||||
/// [`ExtendedPrivKey`] or [`ExtendedPubKey`] will be considered valid.
|
/// [`ExtendedPrivKey`] or [`ExtendedPubKey`] will be considered valid.
|
||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{
|
/// use bdk::keys::{
|
||||||
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
||||||
@@ -433,7 +436,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@@ -460,12 +463,11 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// [`ExtendedPubKey`]: (bip32::ExtendedPubKey)
|
/// [`ExtendedPubKey`]: (bip32::ExtendedPubKey)
|
||||||
pub trait DerivableKey<Ctx: ScriptContext = miniscript::Legacy>: Sized {
|
pub trait DerivableKey<Ctx: ScriptContext = miniscript::Legacy>: Sized {
|
||||||
/// Consume `self` and turn it into an [`ExtendedKey`]
|
/// Consume `self` and turn it into an [`ExtendedKey`]
|
||||||
///
|
|
||||||
/// This can be used to get direct access to `xprv`s and `xpub`s for types that implement this trait,
|
|
||||||
/// like [`Mnemonic`](bip39::Mnemonic) when the `keys-bip39` feature is enabled.
|
|
||||||
#[cfg_attr(
|
#[cfg_attr(
|
||||||
feature = "keys-bip39",
|
feature = "keys-bip39",
|
||||||
doc = r##"
|
doc = r##"
|
||||||
|
This can be used to get direct access to `xprv`s and `xpub`s for types that implement this trait,
|
||||||
|
like [`Mnemonic`](bip39::Mnemonic) when the `keys-bip39` feature is enabled.
|
||||||
```rust
|
```rust
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
use bdk::keys::{DerivableKey, ExtendedKey};
|
use bdk::keys::{DerivableKey, ExtendedKey};
|
||||||
@@ -619,7 +621,7 @@ pub trait GeneratableKey<Ctx: ScriptContext>: Sized {
|
|||||||
/// Extra options required by the `generate_with_entropy`
|
/// Extra options required by the `generate_with_entropy`
|
||||||
type Options;
|
type Options;
|
||||||
/// Returned error in case of failure
|
/// Returned error in case of failure
|
||||||
type Error: std::fmt::Debug;
|
type Error: core::fmt::Debug;
|
||||||
|
|
||||||
/// Generate a key given the extra options and the entropy
|
/// Generate a key given the extra options and the entropy
|
||||||
fn generate_with_entropy(
|
fn generate_with_entropy(
|
||||||
@@ -752,7 +754,7 @@ fn expand_multi_keys<Pk: IntoDescriptorKey<Ctx>, Ctx: ScriptContext>(
|
|||||||
let (key_map, valid_networks) = key_maps_networks.into_iter().fold(
|
let (key_map, valid_networks) = key_maps_networks.into_iter().fold(
|
||||||
(KeyMap::default(), any_network()),
|
(KeyMap::default(), any_network()),
|
||||||
|(mut keys_acc, net_acc), (key, net)| {
|
|(mut keys_acc, net_acc), (key, net)| {
|
||||||
keys_acc.extend(key.into_iter());
|
keys_acc.extend(key);
|
||||||
let net_acc = merge_networks(&net_acc, &net);
|
let net_acc = merge_networks(&net_acc, &net);
|
||||||
|
|
||||||
(keys_acc, net_acc)
|
(keys_acc, net_acc)
|
||||||
@@ -925,16 +927,25 @@ pub enum KeyError {
|
|||||||
Message(String),
|
Message(String),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl_error!(miniscript::Error, Miniscript, KeyError);
|
impl From<miniscript::Error> for KeyError {
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32, KeyError);
|
fn from(err: miniscript::Error) -> Self {
|
||||||
|
KeyError::Miniscript(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl std::fmt::Display for KeyError {
|
impl From<bip32::Error> for KeyError {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn from(err: bip32::Error) -> Self {
|
||||||
|
KeyError::Bip32(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for KeyError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::InvalidScriptContext => write!(f, "Invalid script context"),
|
Self::InvalidScriptContext => write!(f, "Invalid script context"),
|
||||||
Self::InvalidNetwork => write!(f, "Invalid network"),
|
Self::InvalidNetwork => write!(f, "Invalid network"),
|
||||||
@@ -946,11 +957,12 @@ impl std::fmt::Display for KeyError {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
impl std::error::Error for KeyError {}
|
impl std::error::Error for KeyError {}
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub mod test {
|
pub mod test {
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
47
crates/bdk/src/lib.rs
Normal file
47
crates/bdk/src/lib.rs
Normal file
@@ -0,0 +1,47 @@
|
|||||||
|
#![doc = include_str!("../README.md")]
|
||||||
|
// only enables the `doc_cfg` feature when the `docsrs` configuration attribute is defined
|
||||||
|
#![cfg_attr(docsrs, feature(doc_cfg))]
|
||||||
|
#![cfg_attr(
|
||||||
|
docsrs,
|
||||||
|
doc(html_logo_url = "https://github.com/bitcoindevkit/bdk/raw/master/static/bdk.png")
|
||||||
|
)]
|
||||||
|
#![no_std]
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
#[macro_use]
|
||||||
|
extern crate std;
|
||||||
|
|
||||||
|
#[doc(hidden)]
|
||||||
|
#[macro_use]
|
||||||
|
pub extern crate alloc;
|
||||||
|
|
||||||
|
pub extern crate bitcoin;
|
||||||
|
pub extern crate miniscript;
|
||||||
|
extern crate serde;
|
||||||
|
extern crate serde_json;
|
||||||
|
|
||||||
|
#[cfg(feature = "keys-bip39")]
|
||||||
|
extern crate bip39;
|
||||||
|
|
||||||
|
pub mod descriptor;
|
||||||
|
pub mod keys;
|
||||||
|
pub mod psbt;
|
||||||
|
pub(crate) mod types;
|
||||||
|
pub mod wallet;
|
||||||
|
|
||||||
|
pub use descriptor::template;
|
||||||
|
pub use descriptor::HdKeyPaths;
|
||||||
|
pub use types::*;
|
||||||
|
pub use wallet::signer;
|
||||||
|
pub use wallet::signer::SignOptions;
|
||||||
|
pub use wallet::tx_builder::TxBuilder;
|
||||||
|
pub use wallet::Wallet;
|
||||||
|
|
||||||
|
/// Get the version of BDK at runtime
|
||||||
|
pub fn version() -> &'static str {
|
||||||
|
env!("CARGO_PKG_VERSION", "unknown")
|
||||||
|
}
|
||||||
|
|
||||||
|
pub use bdk_chain as chain;
|
||||||
|
pub(crate) use bdk_chain::collections;
|
||||||
79
crates/bdk/src/psbt/mod.rs
Normal file
79
crates/bdk/src/psbt/mod.rs
Normal file
@@ -0,0 +1,79 @@
|
|||||||
|
// Bitcoin Dev Kit
|
||||||
|
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||||
|
//
|
||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
//! Additional functions on the `rust-bitcoin` `PartiallySignedTransaction` structure.
|
||||||
|
|
||||||
|
use crate::FeeRate;
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
|
use bitcoin::TxOut;
|
||||||
|
|
||||||
|
// TODO upstream the functions here to `rust-bitcoin`?
|
||||||
|
|
||||||
|
/// Trait to add functions to extract utxos and calculate fees.
|
||||||
|
pub trait PsbtUtils {
|
||||||
|
/// Get the `TxOut` for the specified input index, if it doesn't exist in the PSBT `None` is returned.
|
||||||
|
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut>;
|
||||||
|
|
||||||
|
/// The total transaction fee amount, sum of input amounts minus sum of output amounts, in sats.
|
||||||
|
/// If the PSBT is missing a TxOut for an input returns None.
|
||||||
|
fn fee_amount(&self) -> Option<u64>;
|
||||||
|
|
||||||
|
/// The transaction's fee rate. This value will only be accurate if calculated AFTER the
|
||||||
|
/// `PartiallySignedTransaction` is finalized and all witness/signature data is added to the
|
||||||
|
/// transaction.
|
||||||
|
/// If the PSBT is missing a TxOut for an input returns None.
|
||||||
|
fn fee_rate(&self) -> Option<FeeRate>;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl PsbtUtils for Psbt {
|
||||||
|
#[allow(clippy::all)] // We want to allow `manual_map` but it is too new.
|
||||||
|
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut> {
|
||||||
|
let tx = &self.unsigned_tx;
|
||||||
|
|
||||||
|
if input_index >= tx.input.len() {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(input) = self.inputs.get(input_index) {
|
||||||
|
if let Some(wit_utxo) = &input.witness_utxo {
|
||||||
|
Some(wit_utxo.clone())
|
||||||
|
} else if let Some(in_tx) = &input.non_witness_utxo {
|
||||||
|
Some(in_tx.output[tx.input[input_index].previous_output.vout as usize].clone())
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn fee_amount(&self) -> Option<u64> {
|
||||||
|
let tx = &self.unsigned_tx;
|
||||||
|
let utxos: Option<Vec<TxOut>> = (0..tx.input.len()).map(|i| self.get_utxo_for(i)).collect();
|
||||||
|
|
||||||
|
utxos.map(|inputs| {
|
||||||
|
let input_amount: u64 = inputs.iter().map(|i| i.value).sum();
|
||||||
|
let output_amount: u64 = self.unsigned_tx.output.iter().map(|o| o.value).sum();
|
||||||
|
input_amount
|
||||||
|
.checked_sub(output_amount)
|
||||||
|
.expect("input amount must be greater than output amount")
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn fee_rate(&self) -> Option<FeeRate> {
|
||||||
|
let fee_amount = self.fee_amount();
|
||||||
|
fee_amount.map(|fee| {
|
||||||
|
let weight = self.clone().extract_tx().weight();
|
||||||
|
FeeRate::from_wu(fee, weight)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -9,20 +9,22 @@
|
|||||||
// You may not use this file except in accordance with one or both of these
|
// You may not use this file except in accordance with one or both of these
|
||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
use std::convert::AsRef;
|
use alloc::boxed::Box;
|
||||||
use std::ops::Sub;
|
use core::convert::AsRef;
|
||||||
|
use core::ops::Sub;
|
||||||
|
|
||||||
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
use bdk_chain::ConfirmationTime;
|
||||||
use bitcoin::{hash_types::Txid, util::psbt};
|
use bitcoin::blockdata::transaction::{OutPoint, TxOut};
|
||||||
|
use bitcoin::{psbt, Weight};
|
||||||
|
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
/// Types of keychains
|
/// Types of keychains
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, Copy, PartialEq, Eq, Hash)]
|
#[derive(Serialize, Deserialize, Debug, Clone, Copy, PartialEq, Eq, Hash, Ord, PartialOrd)]
|
||||||
pub enum KeychainKind {
|
pub enum KeychainKind {
|
||||||
/// External
|
/// External keychain, used for deriving recipient addresses.
|
||||||
External = 0,
|
External = 0,
|
||||||
/// Internal, usually used for change outputs
|
/// Internal keychain, used for deriving change addresses.
|
||||||
Internal = 1,
|
Internal = 1,
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -97,8 +99,8 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and weight units (`wu`).
|
/// Calculate fee rate from `fee` and weight units (`wu`).
|
||||||
pub fn from_wu(fee: u64, wu: usize) -> FeeRate {
|
pub fn from_wu(fee: u64, wu: Weight) -> FeeRate {
|
||||||
Self::from_vb(fee, wu.vbytes())
|
Self::from_vb(fee, wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and `vbytes`.
|
/// Calculate fee rate from `fee` and `vbytes`.
|
||||||
@@ -112,9 +114,14 @@ impl FeeRate {
|
|||||||
self.0
|
self.0
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Return the value as satoshi/kwu
|
||||||
|
pub fn sat_per_kwu(&self) -> f32 {
|
||||||
|
self.0 * 250.0_f32
|
||||||
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in weight units.
|
/// Calculate absolute fee in Satoshis using size in weight units.
|
||||||
pub fn fee_wu(&self, wu: usize) -> u64 {
|
pub fn fee_wu(&self, wu: Weight) -> u64 {
|
||||||
self.fee_vb(wu.vbytes())
|
self.fee_vb(wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
||||||
@@ -123,7 +130,7 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::default::Default for FeeRate {
|
impl Default for FeeRate {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
FeeRate::default_min_relay_fee()
|
FeeRate::default_min_relay_fee()
|
||||||
}
|
}
|
||||||
@@ -154,7 +161,7 @@ impl Vbytes for usize {
|
|||||||
///
|
///
|
||||||
/// [`Wallet`]: crate::Wallet
|
/// [`Wallet`]: crate::Wallet
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)]
|
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)]
|
||||||
pub struct LocalUtxo {
|
pub struct LocalOutput {
|
||||||
/// Reference to a transaction output
|
/// Reference to a transaction output
|
||||||
pub outpoint: OutPoint,
|
pub outpoint: OutPoint,
|
||||||
/// Transaction output
|
/// Transaction output
|
||||||
@@ -163,6 +170,10 @@ pub struct LocalUtxo {
|
|||||||
pub keychain: KeychainKind,
|
pub keychain: KeychainKind,
|
||||||
/// Whether this UTXO is spent or not
|
/// Whether this UTXO is spent or not
|
||||||
pub is_spent: bool,
|
pub is_spent: bool,
|
||||||
|
/// The derivation index for the script pubkey in the wallet
|
||||||
|
pub derivation_index: u32,
|
||||||
|
/// The confirmation time for transaction containing this utxo
|
||||||
|
pub confirmation_time: ConfirmationTime,
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A [`Utxo`] with its `satisfaction_weight`.
|
/// A [`Utxo`] with its `satisfaction_weight`.
|
||||||
@@ -181,7 +192,7 @@ pub struct WeightedUtxo {
|
|||||||
/// An unspent transaction output (UTXO).
|
/// An unspent transaction output (UTXO).
|
||||||
pub enum Utxo {
|
pub enum Utxo {
|
||||||
/// A UTXO owned by the local wallet.
|
/// A UTXO owned by the local wallet.
|
||||||
Local(LocalUtxo),
|
Local(LocalOutput),
|
||||||
/// A UTXO owned by another wallet.
|
/// A UTXO owned by another wallet.
|
||||||
Foreign {
|
Foreign {
|
||||||
/// The location of the output.
|
/// The location of the output.
|
||||||
@@ -223,233 +234,9 @@ impl Utxo {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A wallet transaction
|
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq)]
|
|
||||||
pub struct TransactionDetails {
|
|
||||||
/// Optional transaction
|
|
||||||
pub transaction: Option<Transaction>,
|
|
||||||
/// Transaction id
|
|
||||||
pub txid: Txid,
|
|
||||||
/// Received value (sats)
|
|
||||||
/// Sum of owned outputs of this transaction.
|
|
||||||
pub received: u64,
|
|
||||||
/// Sent value (sats)
|
|
||||||
/// Sum of owned inputs of this transaction.
|
|
||||||
pub sent: u64,
|
|
||||||
/// Fee value (sats) if confirmed.
|
|
||||||
/// The availability of the fee depends on the backend. It's never `None` with an Electrum
|
|
||||||
/// Server backend, but it could be `None` with a Bitcoin RPC node without txindex that receive
|
|
||||||
/// funds while offline.
|
|
||||||
pub fee: Option<u64>,
|
|
||||||
/// If the transaction is confirmed, contains height and Unix timestamp of the block containing the
|
|
||||||
/// transaction, unconfirmed transaction contains `None`.
|
|
||||||
pub confirmation_time: Option<BlockTime>,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl PartialOrd for TransactionDetails {
|
|
||||||
fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> {
|
|
||||||
Some(self.cmp(other))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl Ord for TransactionDetails {
|
|
||||||
fn cmp(&self, other: &Self) -> std::cmp::Ordering {
|
|
||||||
self.confirmation_time
|
|
||||||
.cmp(&other.confirmation_time)
|
|
||||||
.then_with(|| self.txid.cmp(&other.txid))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Block height and timestamp of a block
|
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Default)]
|
|
||||||
pub struct BlockTime {
|
|
||||||
/// confirmation block height
|
|
||||||
pub height: u32,
|
|
||||||
/// confirmation block timestamp
|
|
||||||
pub timestamp: u64,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl PartialOrd for BlockTime {
|
|
||||||
fn partial_cmp(&self, other: &Self) -> Option<std::cmp::Ordering> {
|
|
||||||
Some(self.cmp(other))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl Ord for BlockTime {
|
|
||||||
fn cmp(&self, other: &Self) -> std::cmp::Ordering {
|
|
||||||
self.height
|
|
||||||
.cmp(&other.height)
|
|
||||||
.then_with(|| self.timestamp.cmp(&other.timestamp))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// **DEPRECATED**: Confirmation time of a transaction
|
|
||||||
///
|
|
||||||
/// The structure has been renamed to `BlockTime`
|
|
||||||
#[deprecated(note = "This structure has been renamed to `BlockTime`")]
|
|
||||||
pub type ConfirmationTime = BlockTime;
|
|
||||||
|
|
||||||
impl BlockTime {
|
|
||||||
/// Returns `Some` `BlockTime` if both `height` and `timestamp` are `Some`
|
|
||||||
pub fn new(height: Option<u32>, timestamp: Option<u64>) -> Option<Self> {
|
|
||||||
match (height, timestamp) {
|
|
||||||
(Some(height), Some(timestamp)) => Some(BlockTime { height, timestamp }),
|
|
||||||
_ => None,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Balance differentiated in various categories
|
|
||||||
#[derive(Serialize, Deserialize, Debug, PartialEq, Eq, Clone, Default)]
|
|
||||||
pub struct Balance {
|
|
||||||
/// All coinbase outputs not yet matured
|
|
||||||
pub immature: u64,
|
|
||||||
/// Unconfirmed UTXOs generated by a wallet tx
|
|
||||||
pub trusted_pending: u64,
|
|
||||||
/// Unconfirmed UTXOs received from an external wallet
|
|
||||||
pub untrusted_pending: u64,
|
|
||||||
/// Confirmed and immediately spendable balance
|
|
||||||
pub confirmed: u64,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl Balance {
|
|
||||||
/// Get sum of trusted_pending and confirmed coins
|
|
||||||
pub fn get_spendable(&self) -> u64 {
|
|
||||||
self.confirmed + self.trusted_pending
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Get the whole balance visible to the wallet
|
|
||||||
pub fn get_total(&self) -> u64 {
|
|
||||||
self.confirmed + self.trusted_pending + self.untrusted_pending + self.immature
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::fmt::Display for Balance {
|
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
|
||||||
write!(
|
|
||||||
f,
|
|
||||||
"{{ immature: {}, trusted_pending: {}, untrusted_pending: {}, confirmed: {} }}",
|
|
||||||
self.immature, self.trusted_pending, self.untrusted_pending, self.confirmed
|
|
||||||
)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::ops::Add for Balance {
|
|
||||||
type Output = Self;
|
|
||||||
|
|
||||||
fn add(self, other: Self) -> Self {
|
|
||||||
Self {
|
|
||||||
immature: self.immature + other.immature,
|
|
||||||
trusted_pending: self.trusted_pending + other.trusted_pending,
|
|
||||||
untrusted_pending: self.untrusted_pending + other.untrusted_pending,
|
|
||||||
confirmed: self.confirmed + other.confirmed,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::iter::Sum for Balance {
|
|
||||||
fn sum<I: Iterator<Item = Self>>(iter: I) -> Self {
|
|
||||||
iter.fold(
|
|
||||||
Balance {
|
|
||||||
..Default::default()
|
|
||||||
},
|
|
||||||
|a, b| a + b,
|
|
||||||
)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod tests {
|
mod tests {
|
||||||
use super::*;
|
use super::*;
|
||||||
use bitcoin::hashes::Hash;
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn sort_block_time() {
|
|
||||||
let block_time_a = BlockTime {
|
|
||||||
height: 100,
|
|
||||||
timestamp: 100,
|
|
||||||
};
|
|
||||||
|
|
||||||
let block_time_b = BlockTime {
|
|
||||||
height: 100,
|
|
||||||
timestamp: 110,
|
|
||||||
};
|
|
||||||
|
|
||||||
let block_time_c = BlockTime {
|
|
||||||
height: 0,
|
|
||||||
timestamp: 0,
|
|
||||||
};
|
|
||||||
|
|
||||||
let mut vec = vec![
|
|
||||||
block_time_a.clone(),
|
|
||||||
block_time_b.clone(),
|
|
||||||
block_time_c.clone(),
|
|
||||||
];
|
|
||||||
vec.sort();
|
|
||||||
let expected = vec![block_time_c, block_time_a, block_time_b];
|
|
||||||
|
|
||||||
assert_eq!(vec, expected)
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn sort_tx_details() {
|
|
||||||
let block_time_a = BlockTime {
|
|
||||||
height: 100,
|
|
||||||
timestamp: 100,
|
|
||||||
};
|
|
||||||
|
|
||||||
let block_time_b = BlockTime {
|
|
||||||
height: 0,
|
|
||||||
timestamp: 0,
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_details_a = TransactionDetails {
|
|
||||||
transaction: None,
|
|
||||||
txid: Txid::from_inner([0; 32]),
|
|
||||||
received: 0,
|
|
||||||
sent: 0,
|
|
||||||
fee: None,
|
|
||||||
confirmation_time: None,
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_details_b = TransactionDetails {
|
|
||||||
transaction: None,
|
|
||||||
txid: Txid::from_inner([0; 32]),
|
|
||||||
received: 0,
|
|
||||||
sent: 0,
|
|
||||||
fee: None,
|
|
||||||
confirmation_time: Some(block_time_a),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_details_c = TransactionDetails {
|
|
||||||
transaction: None,
|
|
||||||
txid: Txid::from_inner([0; 32]),
|
|
||||||
received: 0,
|
|
||||||
sent: 0,
|
|
||||||
fee: None,
|
|
||||||
confirmation_time: Some(block_time_b.clone()),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_details_d = TransactionDetails {
|
|
||||||
transaction: None,
|
|
||||||
txid: Txid::from_inner([1; 32]),
|
|
||||||
received: 0,
|
|
||||||
sent: 0,
|
|
||||||
fee: None,
|
|
||||||
confirmation_time: Some(block_time_b),
|
|
||||||
};
|
|
||||||
|
|
||||||
let mut vec = vec![
|
|
||||||
tx_details_a.clone(),
|
|
||||||
tx_details_b.clone(),
|
|
||||||
tx_details_c.clone(),
|
|
||||||
tx_details_d.clone(),
|
|
||||||
];
|
|
||||||
vec.sort();
|
|
||||||
let expected = vec![tx_details_a, tx_details_c, tx_details_d, tx_details_b];
|
|
||||||
|
|
||||||
assert_eq!(vec, expected)
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn can_store_feerate_in_const() {
|
fn can_store_feerate_in_const() {
|
||||||
@@ -513,5 +300,6 @@ mod tests {
|
|||||||
fn test_fee_from_sat_per_kwu() {
|
fn test_fee_from_sat_per_kwu() {
|
||||||
let fee = FeeRate::from_sat_per_kwu(250.0);
|
let fee = FeeRate::from_sat_per_kwu(250.0);
|
||||||
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
assert_eq!(fee.sat_per_kwu(), 250.0);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
File diff suppressed because it is too large
Load Diff
292
crates/bdk/src/wallet/error.rs
Normal file
292
crates/bdk/src/wallet/error.rs
Normal file
@@ -0,0 +1,292 @@
|
|||||||
|
// Bitcoin Dev Kit
|
||||||
|
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||||
|
//
|
||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
//! Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||||
|
|
||||||
|
use crate::descriptor::policy::PolicyError;
|
||||||
|
use crate::descriptor::DescriptorError;
|
||||||
|
use crate::wallet::coin_selection;
|
||||||
|
use crate::{descriptor, FeeRate, KeychainKind};
|
||||||
|
use alloc::string::String;
|
||||||
|
use bitcoin::{absolute, psbt, OutPoint, Sequence, Txid};
|
||||||
|
use core::fmt;
|
||||||
|
|
||||||
|
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub enum MiniscriptPsbtError {
|
||||||
|
/// Descriptor key conversion error
|
||||||
|
Conversion(miniscript::descriptor::ConversionError),
|
||||||
|
/// Return error type for PsbtExt::update_input_with_descriptor
|
||||||
|
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||||
|
/// Return error type for PsbtExt::update_output_with_descriptor
|
||||||
|
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for MiniscriptPsbtError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||||
|
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||||
|
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for MiniscriptPsbtError {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::finish`]
|
||||||
|
///
|
||||||
|
/// [`TxBuilder::finish`]: crate::wallet::tx_builder::TxBuilder::finish
|
||||||
|
pub enum CreateTxError<P> {
|
||||||
|
/// There was a problem with the descriptors passed in
|
||||||
|
Descriptor(DescriptorError),
|
||||||
|
/// We were unable to write wallet data to the persistence backend
|
||||||
|
Persist(P),
|
||||||
|
/// There was a problem while extracting and manipulating policies
|
||||||
|
Policy(PolicyError),
|
||||||
|
/// Spending policy is not compatible with this [`KeychainKind`]
|
||||||
|
SpendingPolicyRequired(KeychainKind),
|
||||||
|
/// Requested invalid transaction version '0'
|
||||||
|
Version0,
|
||||||
|
/// Requested transaction version `1`, but at least `2` is needed to use OP_CSV
|
||||||
|
Version1Csv,
|
||||||
|
/// Requested `LockTime` is less than is required to spend from this script
|
||||||
|
LockTime {
|
||||||
|
/// Requested `LockTime`
|
||||||
|
requested: absolute::LockTime,
|
||||||
|
/// Required `LockTime`
|
||||||
|
required: absolute::LockTime,
|
||||||
|
},
|
||||||
|
/// Cannot enable RBF with a `Sequence` >= 0xFFFFFFFE
|
||||||
|
RbfSequence,
|
||||||
|
/// Cannot enable RBF with `Sequence` given a required OP_CSV
|
||||||
|
RbfSequenceCsv {
|
||||||
|
/// Given RBF `Sequence`
|
||||||
|
rbf: Sequence,
|
||||||
|
/// Required OP_CSV `Sequence`
|
||||||
|
csv: Sequence,
|
||||||
|
},
|
||||||
|
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
||||||
|
FeeTooLow {
|
||||||
|
/// Required fee absolute value (satoshi)
|
||||||
|
required: u64,
|
||||||
|
},
|
||||||
|
/// When bumping a tx the fee rate requested is lower than required
|
||||||
|
FeeRateTooLow {
|
||||||
|
/// Required fee rate (satoshi/vbyte)
|
||||||
|
required: FeeRate,
|
||||||
|
},
|
||||||
|
/// `manually_selected_only` option is selected but no utxo has been passed
|
||||||
|
NoUtxosSelected,
|
||||||
|
/// Output created is under the dust limit, 546 satoshis
|
||||||
|
OutputBelowDustLimit(usize),
|
||||||
|
/// The `change_policy` was set but the wallet does not have a change_descriptor
|
||||||
|
ChangePolicyDescriptor,
|
||||||
|
/// There was an error with coin selection
|
||||||
|
CoinSelection(coin_selection::Error),
|
||||||
|
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||||
|
InsufficientFunds {
|
||||||
|
/// Sats needed for some transaction
|
||||||
|
needed: u64,
|
||||||
|
/// Sats available for spending
|
||||||
|
available: u64,
|
||||||
|
},
|
||||||
|
/// Cannot build a tx without recipients
|
||||||
|
NoRecipients,
|
||||||
|
/// Partially signed bitcoin transaction error
|
||||||
|
Psbt(psbt::Error),
|
||||||
|
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
||||||
|
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
||||||
|
/// explicit origin provided
|
||||||
|
///
|
||||||
|
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
||||||
|
MissingKeyOrigin(String),
|
||||||
|
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||||
|
UnknownUtxo,
|
||||||
|
/// Missing non_witness_utxo on foreign utxo for given `OutPoint`
|
||||||
|
MissingNonWitnessUtxo(OutPoint),
|
||||||
|
/// Miniscript PSBT error
|
||||||
|
MiniscriptPsbt(MiniscriptPsbtError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> fmt::Display for CreateTxError<P>
|
||||||
|
where
|
||||||
|
P: fmt::Display,
|
||||||
|
{
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Descriptor(e) => e.fmt(f),
|
||||||
|
Self::Persist(e) => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"failed to write wallet data to persistence backend: {}",
|
||||||
|
e
|
||||||
|
)
|
||||||
|
}
|
||||||
|
Self::Policy(e) => e.fmt(f),
|
||||||
|
CreateTxError::SpendingPolicyRequired(keychain_kind) => {
|
||||||
|
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||||
|
}
|
||||||
|
CreateTxError::Version0 => {
|
||||||
|
write!(f, "Invalid version `0`")
|
||||||
|
}
|
||||||
|
CreateTxError::Version1Csv => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"TxBuilder requested version `1`, but at least `2` is needed to use OP_CSV"
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::LockTime {
|
||||||
|
requested,
|
||||||
|
required,
|
||||||
|
} => {
|
||||||
|
write!(f, "TxBuilder requested timelock of `{:?}`, but at least `{:?}` is required to spend from this script", required, requested)
|
||||||
|
}
|
||||||
|
CreateTxError::RbfSequence => {
|
||||||
|
write!(f, "Cannot enable RBF with a nSequence >= 0xFFFFFFFE")
|
||||||
|
}
|
||||||
|
CreateTxError::RbfSequenceCsv { rbf, csv } => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Cannot enable RBF with nSequence `{:?}` given a required OP_CSV of `{:?}`",
|
||||||
|
rbf, csv
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::FeeTooLow { required } => {
|
||||||
|
write!(f, "Fee to low: required {} sat", required)
|
||||||
|
}
|
||||||
|
CreateTxError::FeeRateTooLow { required } => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Fee rate too low: required {} sat/vbyte",
|
||||||
|
required.as_sat_per_vb()
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::NoUtxosSelected => {
|
||||||
|
write!(f, "No UTXO selected")
|
||||||
|
}
|
||||||
|
CreateTxError::OutputBelowDustLimit(limit) => {
|
||||||
|
write!(f, "Output below the dust limit: {}", limit)
|
||||||
|
}
|
||||||
|
CreateTxError::ChangePolicyDescriptor => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"The `change_policy` can be set only if the wallet has a change_descriptor"
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::CoinSelection(e) => e.fmt(f),
|
||||||
|
CreateTxError::InsufficientFunds { needed, available } => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Insufficient funds: {} sat available of {} sat needed",
|
||||||
|
available, needed
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::NoRecipients => {
|
||||||
|
write!(f, "Cannot build tx without recipients")
|
||||||
|
}
|
||||||
|
CreateTxError::Psbt(e) => e.fmt(f),
|
||||||
|
CreateTxError::MissingKeyOrigin(err) => {
|
||||||
|
write!(f, "Missing key origin: {}", err)
|
||||||
|
}
|
||||||
|
CreateTxError::UnknownUtxo => {
|
||||||
|
write!(f, "UTXO not found in the internal database")
|
||||||
|
}
|
||||||
|
CreateTxError::MissingNonWitnessUtxo(outpoint) => {
|
||||||
|
write!(f, "Missing non_witness_utxo on foreign utxo {}", outpoint)
|
||||||
|
}
|
||||||
|
CreateTxError::MiniscriptPsbt(err) => {
|
||||||
|
write!(f, "Miniscript PSBT error: {}", err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<descriptor::error::Error> for CreateTxError<P> {
|
||||||
|
fn from(err: descriptor::error::Error) -> Self {
|
||||||
|
CreateTxError::Descriptor(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<PolicyError> for CreateTxError<P> {
|
||||||
|
fn from(err: PolicyError) -> Self {
|
||||||
|
CreateTxError::Policy(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<MiniscriptPsbtError> for CreateTxError<P> {
|
||||||
|
fn from(err: MiniscriptPsbtError) -> Self {
|
||||||
|
CreateTxError::MiniscriptPsbt(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<psbt::Error> for CreateTxError<P> {
|
||||||
|
fn from(err: psbt::Error) -> Self {
|
||||||
|
CreateTxError::Psbt(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<coin_selection::Error> for CreateTxError<P> {
|
||||||
|
fn from(err: coin_selection::Error) -> Self {
|
||||||
|
CreateTxError::CoinSelection(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl<P: core::fmt::Display + core::fmt::Debug> std::error::Error for CreateTxError<P> {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`Wallet::build_fee_bump`]
|
||||||
|
///
|
||||||
|
/// [`Wallet::build_fee_bump`]: super::Wallet::build_fee_bump
|
||||||
|
pub enum BuildFeeBumpError {
|
||||||
|
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||||
|
UnknownUtxo(OutPoint),
|
||||||
|
/// Thrown when a tx is not found in the internal database
|
||||||
|
TransactionNotFound(Txid),
|
||||||
|
/// Happens when trying to bump a transaction that is already confirmed
|
||||||
|
TransactionConfirmed(Txid),
|
||||||
|
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
||||||
|
IrreplaceableTransaction(Txid),
|
||||||
|
/// Node doesn't have data to estimate a fee rate
|
||||||
|
FeeRateUnavailable,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for BuildFeeBumpError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::UnknownUtxo(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"UTXO not found in the internal database with txid: {}, vout: {}",
|
||||||
|
outpoint.txid, outpoint.vout
|
||||||
|
),
|
||||||
|
Self::TransactionNotFound(txid) => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Transaction not found in the internal database with txid: {}",
|
||||||
|
txid
|
||||||
|
)
|
||||||
|
}
|
||||||
|
Self::TransactionConfirmed(txid) => {
|
||||||
|
write!(f, "Transaction already confirmed with txid: {}", txid)
|
||||||
|
}
|
||||||
|
Self::IrreplaceableTransaction(txid) => {
|
||||||
|
write!(f, "Transaction can't be replaced with txid: {}", txid)
|
||||||
|
}
|
||||||
|
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for BuildFeeBumpError {}
|
||||||
@@ -20,7 +20,6 @@
|
|||||||
//! ```
|
//! ```
|
||||||
//! # use std::str::FromStr;
|
//! # use std::str::FromStr;
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::database::*;
|
|
||||||
//! # use bdk::wallet::export::*;
|
//! # use bdk::wallet::export::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! let import = r#"{
|
//! let import = r#"{
|
||||||
@@ -30,43 +29,38 @@
|
|||||||
//! }"#;
|
//! }"#;
|
||||||
//!
|
//!
|
||||||
//! let import = FullyNodedExport::from_str(import)?;
|
//! let import = FullyNodedExport::from_str(import)?;
|
||||||
//! let wallet = Wallet::new(
|
//! let wallet = Wallet::new_no_persist(
|
||||||
//! &import.descriptor(),
|
//! &import.descriptor(),
|
||||||
//! import.change_descriptor().as_ref(),
|
//! import.change_descriptor().as_ref(),
|
||||||
//! Network::Testnet,
|
//! Network::Testnet,
|
||||||
//! MemoryDatabase::default(),
|
|
||||||
//! )?;
|
//! )?;
|
||||||
//! # Ok::<_, bdk::Error>(())
|
//! # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
//! ```
|
//! ```
|
||||||
//!
|
//!
|
||||||
//! ### Export a `Wallet`
|
//! ### Export a `Wallet`
|
||||||
//! ```
|
//! ```
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::database::*;
|
|
||||||
//! # use bdk::wallet::export::*;
|
//! # use bdk::wallet::export::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! let wallet = Wallet::new(
|
//! let wallet = Wallet::new_no_persist(
|
||||||
//! "wpkh([c258d2e4/84h/1h/0h]tpubDD3ynpHgJQW8VvWRzQ5WFDCrs4jqVFGHB3vLC3r49XHJSqP8bHKdK4AriuUKLccK68zfzowx7YhmDN8SiSkgCDENUFx9qVw65YyqM78vyVe/0/*)",
|
//! "wpkh([c258d2e4/84h/1h/0h]tpubDD3ynpHgJQW8VvWRzQ5WFDCrs4jqVFGHB3vLC3r49XHJSqP8bHKdK4AriuUKLccK68zfzowx7YhmDN8SiSkgCDENUFx9qVw65YyqM78vyVe/0/*)",
|
||||||
//! Some("wpkh([c258d2e4/84h/1h/0h]tpubDD3ynpHgJQW8VvWRzQ5WFDCrs4jqVFGHB3vLC3r49XHJSqP8bHKdK4AriuUKLccK68zfzowx7YhmDN8SiSkgCDENUFx9qVw65YyqM78vyVe/1/*)"),
|
//! Some("wpkh([c258d2e4/84h/1h/0h]tpubDD3ynpHgJQW8VvWRzQ5WFDCrs4jqVFGHB3vLC3r49XHJSqP8bHKdK4AriuUKLccK68zfzowx7YhmDN8SiSkgCDENUFx9qVw65YyqM78vyVe/1/*)"),
|
||||||
//! Network::Testnet,
|
//! Network::Testnet,
|
||||||
//! MemoryDatabase::default()
|
|
||||||
//! )?;
|
//! )?;
|
||||||
//! let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true)
|
//! let export = FullyNodedExport::export_wallet(&wallet, "exported wallet", true).unwrap();
|
||||||
//! .map_err(ToString::to_string)
|
|
||||||
//! .map_err(bdk::Error::Generic)?;
|
|
||||||
//!
|
//!
|
||||||
//! println!("Exported: {}", export.to_string());
|
//! println!("Exported: {}", export.to_string());
|
||||||
//! # Ok::<_, bdk::Error>(())
|
//! # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use std::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
|
use alloc::string::{String, ToString};
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
use miniscript::descriptor::{ShInner, WshInner};
|
use miniscript::descriptor::{ShInner, WshInner};
|
||||||
use miniscript::{Descriptor, ScriptContext, Terminal};
|
use miniscript::{Descriptor, ScriptContext, Terminal};
|
||||||
|
|
||||||
use crate::database::BatchDatabase;
|
|
||||||
use crate::types::KeychainKind;
|
use crate::types::KeychainKind;
|
||||||
use crate::wallet::Wallet;
|
use crate::wallet::Wallet;
|
||||||
|
|
||||||
@@ -116,7 +110,7 @@ impl FullyNodedExport {
|
|||||||
///
|
///
|
||||||
/// If the database is empty or `include_blockheight` is false, the `blockheight` field
|
/// If the database is empty or `include_blockheight` is false, the `blockheight` field
|
||||||
/// returned will be `0`.
|
/// returned will be `0`.
|
||||||
pub fn export_wallet<D: BatchDatabase>(
|
pub fn export_wallet<D>(
|
||||||
wallet: &Wallet<D>,
|
wallet: &Wallet<D>,
|
||||||
label: &str,
|
label: &str,
|
||||||
include_blockheight: bool,
|
include_blockheight: bool,
|
||||||
@@ -131,14 +125,15 @@ impl FullyNodedExport {
|
|||||||
let descriptor = remove_checksum(descriptor);
|
let descriptor = remove_checksum(descriptor);
|
||||||
Self::is_compatible_with_core(&descriptor)?;
|
Self::is_compatible_with_core(&descriptor)?;
|
||||||
|
|
||||||
let blockheight = match wallet.database.borrow().iter_txs(false) {
|
let blockheight = if include_blockheight {
|
||||||
_ if !include_blockheight => 0,
|
wallet.transactions().next().map_or(0, |canonical_tx| {
|
||||||
Err(_) => 0,
|
match canonical_tx.chain_position {
|
||||||
Ok(txs) => txs
|
bdk_chain::ChainPosition::Confirmed(a) => a.confirmation_height,
|
||||||
.into_iter()
|
bdk_chain::ChainPosition::Unconfirmed(_) => 0,
|
||||||
.filter_map(|tx| tx.confirmation_time.map(|c| c.height))
|
}
|
||||||
.min()
|
})
|
||||||
.unwrap_or(0),
|
} else {
|
||||||
|
0
|
||||||
};
|
};
|
||||||
|
|
||||||
let export = FullyNodedExport {
|
let export = FullyNodedExport {
|
||||||
@@ -147,11 +142,7 @@ impl FullyNodedExport {
|
|||||||
blockheight,
|
blockheight,
|
||||||
};
|
};
|
||||||
|
|
||||||
let change_descriptor = match wallet
|
let change_descriptor = match wallet.public_descriptor(KeychainKind::Internal).is_some() {
|
||||||
.public_descriptor(KeychainKind::Internal)
|
|
||||||
.map_err(|_| "Invalid change descriptor")?
|
|
||||||
.is_some()
|
|
||||||
{
|
|
||||||
false => None,
|
false => None,
|
||||||
true => {
|
true => {
|
||||||
let descriptor = wallet
|
let descriptor = wallet
|
||||||
@@ -221,52 +212,43 @@ impl FullyNodedExport {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::{Network, Txid};
|
use bdk_chain::{BlockId, ConfirmationTime};
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
|
use bitcoin::{BlockHash, Network, Transaction};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::database::{memory::MemoryDatabase, BatchOperations};
|
|
||||||
use crate::types::TransactionDetails;
|
|
||||||
use crate::wallet::Wallet;
|
use crate::wallet::Wallet;
|
||||||
use crate::BlockTime;
|
|
||||||
|
|
||||||
fn get_test_db() -> MemoryDatabase {
|
fn get_test_wallet(
|
||||||
let mut db = MemoryDatabase::new();
|
descriptor: &str,
|
||||||
db.set_tx(&TransactionDetails {
|
change_descriptor: Option<&str>,
|
||||||
transaction: None,
|
network: Network,
|
||||||
txid: Txid::from_str(
|
) -> Wallet<()> {
|
||||||
"4ddff1fa33af17f377f62b72357b43107c19110a8009b36fb832af505efed98a",
|
let mut wallet = Wallet::new_no_persist(descriptor, change_descriptor, network).unwrap();
|
||||||
)
|
let transaction = Transaction {
|
||||||
.unwrap(),
|
input: vec![],
|
||||||
|
output: vec![],
|
||||||
received: 100_000,
|
version: 0,
|
||||||
sent: 0,
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
fee: Some(500),
|
};
|
||||||
confirmation_time: Some(BlockTime {
|
wallet
|
||||||
timestamp: 12345678,
|
.insert_checkpoint(BlockId {
|
||||||
height: 5001,
|
height: 5001,
|
||||||
}),
|
hash: BlockHash::all_zeros(),
|
||||||
})
|
})
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
wallet
|
||||||
db.set_tx(&TransactionDetails {
|
.insert_tx(
|
||||||
transaction: None,
|
transaction,
|
||||||
txid: Txid::from_str(
|
ConfirmationTime::Confirmed {
|
||||||
"aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa",
|
height: 5000,
|
||||||
|
time: 0,
|
||||||
|
},
|
||||||
)
|
)
|
||||||
.unwrap(),
|
.unwrap();
|
||||||
received: 25_000,
|
wallet
|
||||||
sent: 0,
|
|
||||||
fee: Some(300),
|
|
||||||
confirmation_time: Some(BlockTime {
|
|
||||||
timestamp: 12345677,
|
|
||||||
height: 5000,
|
|
||||||
}),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
db
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@@ -274,13 +256,7 @@ mod test {
|
|||||||
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
||||||
let change_descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/1/*)";
|
let change_descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/1/*)";
|
||||||
|
|
||||||
let wallet = Wallet::new(
|
let wallet = get_test_wallet(descriptor, Some(change_descriptor), Network::Bitcoin);
|
||||||
descriptor,
|
|
||||||
Some(change_descriptor),
|
|
||||||
Network::Bitcoin,
|
|
||||||
get_test_db(),
|
|
||||||
)
|
|
||||||
.unwrap();
|
|
||||||
let export = FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
let export = FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
||||||
|
|
||||||
assert_eq!(export.descriptor(), descriptor);
|
assert_eq!(export.descriptor(), descriptor);
|
||||||
@@ -298,7 +274,7 @@ mod test {
|
|||||||
|
|
||||||
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
||||||
|
|
||||||
let wallet = Wallet::new(descriptor, None, Network::Bitcoin, get_test_db()).unwrap();
|
let wallet = get_test_wallet(descriptor, None, Network::Bitcoin);
|
||||||
FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -311,13 +287,7 @@ mod test {
|
|||||||
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
||||||
let change_descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/50'/0'/1/*)";
|
let change_descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/50'/0'/1/*)";
|
||||||
|
|
||||||
let wallet = Wallet::new(
|
let wallet = get_test_wallet(descriptor, Some(change_descriptor), Network::Bitcoin);
|
||||||
descriptor,
|
|
||||||
Some(change_descriptor),
|
|
||||||
Network::Bitcoin,
|
|
||||||
get_test_db(),
|
|
||||||
)
|
|
||||||
.unwrap();
|
|
||||||
FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -334,13 +304,7 @@ mod test {
|
|||||||
[c98b1535/48'/0'/0'/2']tpubDCDi5W4sP6zSnzJeowy8rQDVhBdRARaPhK1axABi8V1661wEPeanpEXj4ZLAUEoikVtoWcyK26TKKJSecSfeKxwHCcRrge9k1ybuiL71z4a/1/*\
|
[c98b1535/48'/0'/0'/2']tpubDCDi5W4sP6zSnzJeowy8rQDVhBdRARaPhK1axABi8V1661wEPeanpEXj4ZLAUEoikVtoWcyK26TKKJSecSfeKxwHCcRrge9k1ybuiL71z4a/1/*\
|
||||||
))";
|
))";
|
||||||
|
|
||||||
let wallet = Wallet::new(
|
let wallet = get_test_wallet(descriptor, Some(change_descriptor), Network::Testnet);
|
||||||
descriptor,
|
|
||||||
Some(change_descriptor),
|
|
||||||
Network::Testnet,
|
|
||||||
get_test_db(),
|
|
||||||
)
|
|
||||||
.unwrap();
|
|
||||||
let export = FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
let export = FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
||||||
|
|
||||||
assert_eq!(export.descriptor(), descriptor);
|
assert_eq!(export.descriptor(), descriptor);
|
||||||
@@ -354,13 +318,7 @@ mod test {
|
|||||||
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
let descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/0/*)";
|
||||||
let change_descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/1/*)";
|
let change_descriptor = "wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44'/0'/0'/1/*)";
|
||||||
|
|
||||||
let wallet = Wallet::new(
|
let wallet = get_test_wallet(descriptor, Some(change_descriptor), Network::Bitcoin);
|
||||||
descriptor,
|
|
||||||
Some(change_descriptor),
|
|
||||||
Network::Bitcoin,
|
|
||||||
get_test_db(),
|
|
||||||
)
|
|
||||||
.unwrap();
|
|
||||||
let export = FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
let export = FullyNodedExport::export_wallet(&wallet, "Test Label", true).unwrap();
|
||||||
|
|
||||||
assert_eq!(export.to_string(), "{\"descriptor\":\"wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44\'/0\'/0\'/0/*)\",\"blockheight\":5000,\"label\":\"Test Label\"}");
|
assert_eq!(export.to_string(), "{\"descriptor\":\"wpkh(xprv9s21ZrQH143K4CTb63EaMxja1YiTnSEWKMbn23uoEnAzxjdUJRQkazCAtzxGm4LSoTSVTptoV9RbchnKPW9HxKtZumdyxyikZFDLhogJ5Uj/44\'/0\'/0\'/0/*)\",\"blockheight\":5000,\"label\":\"Test Label\"}");
|
||||||
@@ -15,12 +15,11 @@
|
|||||||
//! used with hardware wallets.
|
//! used with hardware wallets.
|
||||||
//! ```no_run
|
//! ```no_run
|
||||||
//! # use bdk::bitcoin::Network;
|
//! # use bdk::bitcoin::Network;
|
||||||
//! # use bdk::database::MemoryDatabase;
|
|
||||||
//! # use bdk::signer::SignerOrdering;
|
//! # use bdk::signer::SignerOrdering;
|
||||||
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
||||||
//! # use bdk::wallet::AddressIndex::New;
|
//! # use bdk::wallet::AddressIndex::New;
|
||||||
//! # use bdk::{FeeRate, KeychainKind, SignOptions, SyncOptions, Wallet};
|
//! # use bdk::{FeeRate, KeychainKind, SignOptions, Wallet};
|
||||||
//! # use hwi::{types::HWIChain, HWIClient};
|
//! # use hwi::HWIClient;
|
||||||
//! # use std::sync::Arc;
|
//! # use std::sync::Arc;
|
||||||
//! #
|
//! #
|
||||||
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
@@ -29,13 +28,12 @@
|
|||||||
//! panic!("No devices found!");
|
//! panic!("No devices found!");
|
||||||
//! }
|
//! }
|
||||||
//! let first_device = devices.remove(0)?;
|
//! let first_device = devices.remove(0)?;
|
||||||
//! let custom_signer = HWISigner::from_device(&first_device, HWIChain::Test)?;
|
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
//!
|
//!
|
||||||
//! # let mut wallet = Wallet::new(
|
//! # let mut wallet = Wallet::new_no_persist(
|
||||||
//! # "",
|
//! # "",
|
||||||
//! # None,
|
//! # None,
|
||||||
//! # Network::Testnet,
|
//! # Network::Testnet,
|
||||||
//! # MemoryDatabase::default(),
|
|
||||||
//! # )?;
|
//! # )?;
|
||||||
//! #
|
//! #
|
||||||
//! // Adding the hardware signer to the BDK wallet
|
//! // Adding the hardware signer to the BDK wallet
|
||||||
@@ -49,9 +47,9 @@
|
|||||||
//! # }
|
//! # }
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::psbt::PartiallySignedTransaction;
|
use bitcoin::psbt::PartiallySignedTransaction;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
|
||||||
|
|
||||||
use hwi::error::Error;
|
use hwi::error::Error;
|
||||||
use hwi::types::{HWIChain, HWIDevice};
|
use hwi::types::{HWIChain, HWIDevice};
|
||||||
2602
crates/bdk/src/wallet/mod.rs
Normal file
2602
crates/bdk/src/wallet/mod.rs
Normal file
File diff suppressed because it is too large
Load Diff
@@ -15,13 +15,12 @@
|
|||||||
//! through the [`Wallet::add_signer`](super::Wallet::add_signer) function.
|
//! through the [`Wallet::add_signer`](super::Wallet::add_signer) function.
|
||||||
//!
|
//!
|
||||||
//! ```
|
//! ```
|
||||||
//! # use std::sync::Arc;
|
//! # use alloc::sync::Arc;
|
||||||
//! # use std::str::FromStr;
|
//! # use core::str::FromStr;
|
||||||
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bitcoin::util::psbt;
|
//! # use bitcoin::psbt;
|
||||||
//! # use bdk::signer::*;
|
//! # use bdk::signer::*;
|
||||||
//! # use bdk::database::*;
|
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! # #[derive(Debug)]
|
//! # #[derive(Debug)]
|
||||||
//! # struct CustomHSM;
|
//! # struct CustomHSM;
|
||||||
@@ -70,40 +69,42 @@
|
|||||||
//! let custom_signer = CustomSigner::connect();
|
//! let custom_signer = CustomSigner::connect();
|
||||||
//!
|
//!
|
||||||
//! let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
//! let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
||||||
//! let mut wallet = Wallet::new(descriptor, None, Network::Testnet, MemoryDatabase::default())?;
|
//! let mut wallet = Wallet::new_no_persist(descriptor, None, Network::Testnet)?;
|
||||||
//! wallet.add_signer(
|
//! wallet.add_signer(
|
||||||
//! KeychainKind::External,
|
//! KeychainKind::External,
|
||||||
//! SignerOrdering(200),
|
//! SignerOrdering(200),
|
||||||
//! Arc::new(custom_signer)
|
//! Arc::new(custom_signer)
|
||||||
//! );
|
//! );
|
||||||
//!
|
//!
|
||||||
//! # Ok::<_, bdk::Error>(())
|
//! # Ok::<_, anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use std::cmp::Ordering;
|
use crate::collections::BTreeMap;
|
||||||
use std::collections::BTreeMap;
|
use alloc::string::String;
|
||||||
use std::fmt;
|
use alloc::sync::Arc;
|
||||||
use std::ops::{Bound::Included, Deref};
|
use alloc::vec::Vec;
|
||||||
use std::sync::Arc;
|
use core::cmp::Ordering;
|
||||||
|
use core::fmt;
|
||||||
|
use core::ops::{Bound::Included, Deref};
|
||||||
|
|
||||||
use bitcoin::blockdata::opcodes;
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
||||||
use bitcoin::blockdata::script::Builder as ScriptBuilder;
|
use bitcoin::hashes::hash160;
|
||||||
use bitcoin::hashes::{hash160, Hash};
|
|
||||||
use bitcoin::secp256k1::Message;
|
use bitcoin::secp256k1::Message;
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
use bitcoin::sighash::{EcdsaSighashType, TapSighash, TapSighashType};
|
||||||
use bitcoin::util::{ecdsa, psbt, schnorr, sighash, taproot};
|
use bitcoin::{ecdsa, psbt, sighash, taproot};
|
||||||
use bitcoin::{secp256k1, XOnlyPublicKey};
|
use bitcoin::{key::TapTweak, key::XOnlyPublicKey, secp256k1};
|
||||||
use bitcoin::{EcdsaSighashType, PrivateKey, PublicKey, SchnorrSighashType, Script};
|
use bitcoin::{PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
Descriptor, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey, KeyMap, SinglePriv,
|
Descriptor, DescriptorMultiXKey, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey,
|
||||||
SinglePubKey,
|
InnerXKey, KeyMap, SinglePriv, SinglePubKey,
|
||||||
};
|
};
|
||||||
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
||||||
|
|
||||||
use super::utils::SecpCtx;
|
use super::utils::SecpCtx;
|
||||||
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
||||||
use crate::psbt::PsbtUtils;
|
use crate::psbt::PsbtUtils;
|
||||||
|
use crate::wallet::error::MiniscriptPsbtError;
|
||||||
|
|
||||||
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
||||||
/// multiple of them
|
/// multiple of them
|
||||||
@@ -130,7 +131,7 @@ impl From<Fingerprint> for SignerId {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Signing error
|
/// Signing error
|
||||||
#[derive(Debug, PartialEq, Eq, Clone)]
|
#[derive(Debug)]
|
||||||
pub enum SignerError {
|
pub enum SignerError {
|
||||||
/// The private key is missing for the required public key
|
/// The private key is missing for the required public key
|
||||||
MissingKey,
|
MissingKey,
|
||||||
@@ -160,16 +161,12 @@ pub enum SignerError {
|
|||||||
InvalidSighash,
|
InvalidSighash,
|
||||||
/// Error while computing the hash to sign
|
/// Error while computing the hash to sign
|
||||||
SighashError(sighash::Error),
|
SighashError(sighash::Error),
|
||||||
/// Error while signing using hardware wallets
|
/// Miniscript PSBT error
|
||||||
#[cfg(feature = "hardware-signer")]
|
MiniscriptPsbt(MiniscriptPsbtError),
|
||||||
HWIError(hwi::error::Error),
|
/// To be used only by external libraries implementing [`InputSigner`] or
|
||||||
}
|
/// [`TransactionSigner`], so that they can return their own custom errors, without having to
|
||||||
|
/// modify [`SignerError`] in BDK.
|
||||||
#[cfg(feature = "hardware-signer")]
|
External(String),
|
||||||
impl From<hwi::error::Error> for SignerError {
|
|
||||||
fn from(e: hwi::error::Error) -> Self {
|
|
||||||
SignerError::HWIError(e)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl From<sighash::Error> for SignerError {
|
impl From<sighash::Error> for SignerError {
|
||||||
@@ -193,12 +190,13 @@ impl fmt::Display for SignerError {
|
|||||||
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
||||||
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
||||||
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
||||||
#[cfg(feature = "hardware-signer")]
|
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||||
Self::HWIError(err) => write!(f, "Error while signing using hardware wallets: {}", err),
|
Self::External(err) => write!(f, "{}", err),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
impl std::error::Error for SignerError {}
|
impl std::error::Error for SignerError {}
|
||||||
|
|
||||||
/// Signing context
|
/// Signing context
|
||||||
@@ -217,7 +215,7 @@ pub enum SignerContext {
|
|||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Wrapper structure to pair a signer with its context
|
/// Wrapper to pair a signer with its context
|
||||||
#[derive(Debug, Clone)]
|
#[derive(Debug, Clone)]
|
||||||
pub struct SignerWrapper<S: Sized + fmt::Debug + Clone> {
|
pub struct SignerWrapper<S: Sized + fmt::Debug + Clone> {
|
||||||
signer: S,
|
signer: S,
|
||||||
@@ -382,6 +380,48 @@ impl InputSigner for SignerWrapper<DescriptorXKey<ExtendedPrivKey>> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fn multikey_to_xkeys<K: InnerXKey + Clone>(
|
||||||
|
multikey: DescriptorMultiXKey<K>,
|
||||||
|
) -> Vec<DescriptorXKey<K>> {
|
||||||
|
multikey
|
||||||
|
.derivation_paths
|
||||||
|
.into_paths()
|
||||||
|
.into_iter()
|
||||||
|
.map(|derivation_path| DescriptorXKey {
|
||||||
|
origin: multikey.origin.clone(),
|
||||||
|
xkey: multikey.xkey.clone(),
|
||||||
|
derivation_path,
|
||||||
|
wildcard: multikey.wildcard,
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
|
SignerId::from(self.root_fingerprint(secp))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
||||||
|
Some(DescriptorSecretKey::MultiXPrv(self.signer.clone()))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl InputSigner for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn sign_input(
|
||||||
|
&self,
|
||||||
|
psbt: &mut psbt::PartiallySignedTransaction,
|
||||||
|
input_index: usize,
|
||||||
|
sign_options: &SignOptions,
|
||||||
|
secp: &SecpCtx,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
let xkeys = multikey_to_xkeys(self.signer.clone());
|
||||||
|
for xkey in xkeys {
|
||||||
|
SignerWrapper::new(xkey, self.ctx).sign_input(psbt, input_index, sign_options, secp)?
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl SignerCommon for SignerWrapper<PrivateKey> {
|
impl SignerCommon for SignerWrapper<PrivateKey> {
|
||||||
fn id(&self, secp: &SecpCtx) -> SignerId {
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
||||||
@@ -417,20 +457,23 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey.inner);
|
let x_only_pubkey = XOnlyPublicKey::from(pubkey.inner);
|
||||||
|
|
||||||
if let SignerContext::Tap { is_internal_key } = self.ctx {
|
if let SignerContext::Tap { is_internal_key } = self.ctx {
|
||||||
if is_internal_key
|
if let Some(psbt_internal_key) = psbt.inputs[input_index].tap_internal_key {
|
||||||
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
if is_internal_key
|
||||||
&& sign_options.sign_with_tap_internal_key
|
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
||||||
{
|
&& sign_options.sign_with_tap_internal_key
|
||||||
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
&& x_only_pubkey == psbt_internal_key
|
||||||
sign_psbt_schnorr(
|
{
|
||||||
&self.inner,
|
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
||||||
x_only_pubkey,
|
sign_psbt_schnorr(
|
||||||
None,
|
&self.inner,
|
||||||
&mut psbt.inputs[input_index],
|
x_only_pubkey,
|
||||||
hash,
|
None,
|
||||||
hash_ty,
|
&mut psbt.inputs[input_index],
|
||||||
secp,
|
hash,
|
||||||
);
|
hash_ty,
|
||||||
|
secp,
|
||||||
|
);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if let Some((leaf_hashes, _)) =
|
if let Some((leaf_hashes, _)) =
|
||||||
@@ -476,8 +519,16 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let (hash, hash_ty) = match self.ctx {
|
let (hash, hash_ty) = match self.ctx {
|
||||||
SignerContext::Segwitv0 => Segwitv0::sighash(psbt, input_index, ())?,
|
SignerContext::Segwitv0 => {
|
||||||
SignerContext::Legacy => Legacy::sighash(psbt, input_index, ())?,
|
let (h, t) = Segwitv0::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
|
SignerContext::Legacy => {
|
||||||
|
let (h, t) = Legacy::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
_ => return Ok(()), // handled above
|
_ => return Ok(()), // handled above
|
||||||
};
|
};
|
||||||
sign_psbt_ecdsa(
|
sign_psbt_ecdsa(
|
||||||
@@ -498,12 +549,12 @@ fn sign_psbt_ecdsa(
|
|||||||
secret_key: &secp256k1::SecretKey,
|
secret_key: &secp256k1::SecretKey,
|
||||||
pubkey: PublicKey,
|
pubkey: PublicKey,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: bitcoin::Sighash,
|
hash: impl bitcoin::hashes::Hash + bitcoin::secp256k1::ThirtyTwoByteHash,
|
||||||
hash_ty: EcdsaSighashType,
|
hash_ty: EcdsaSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
allow_grinding: bool,
|
allow_grinding: bool,
|
||||||
) {
|
) {
|
||||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
let msg = &Message::from(hash);
|
||||||
let sig = if allow_grinding {
|
let sig = if allow_grinding {
|
||||||
secp.sign_ecdsa_low_r(msg, secret_key)
|
secp.sign_ecdsa_low_r(msg, secret_key)
|
||||||
} else {
|
} else {
|
||||||
@@ -512,7 +563,7 @@ fn sign_psbt_ecdsa(
|
|||||||
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
||||||
.expect("invalid or corrupted ecdsa signature");
|
.expect("invalid or corrupted ecdsa signature");
|
||||||
|
|
||||||
let final_signature = ecdsa::EcdsaSig { sig, hash_ty };
|
let final_signature = ecdsa::Signature { sig, hash_ty };
|
||||||
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -522,12 +573,10 @@ fn sign_psbt_schnorr(
|
|||||||
pubkey: XOnlyPublicKey,
|
pubkey: XOnlyPublicKey,
|
||||||
leaf_hash: Option<taproot::TapLeafHash>,
|
leaf_hash: Option<taproot::TapLeafHash>,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: taproot::TapSighashHash,
|
hash: TapSighash,
|
||||||
hash_ty: SchnorrSighashType,
|
hash_ty: TapSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
) {
|
) {
|
||||||
use schnorr::TapTweak;
|
|
||||||
|
|
||||||
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
||||||
let keypair = match leaf_hash {
|
let keypair = match leaf_hash {
|
||||||
None => keypair
|
None => keypair
|
||||||
@@ -536,12 +585,12 @@ fn sign_psbt_schnorr(
|
|||||||
Some(_) => keypair, // no tweak for script spend
|
Some(_) => keypair, // no tweak for script spend
|
||||||
};
|
};
|
||||||
|
|
||||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
let msg = &Message::from(hash);
|
||||||
let sig = secp.sign_schnorr(msg, &keypair);
|
let sig = secp.sign_schnorr(msg, &keypair);
|
||||||
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
||||||
.expect("invalid or corrupted schnorr signature");
|
.expect("invalid or corrupted schnorr signature");
|
||||||
|
|
||||||
let final_signature = schnorr::SchnorrSig { sig, hash_ty };
|
let final_signature = taproot::Signature { sig, hash_ty };
|
||||||
|
|
||||||
if let Some(lh) = leaf_hash {
|
if let Some(lh) = leaf_hash {
|
||||||
psbt_input
|
psbt_input
|
||||||
@@ -560,7 +609,7 @@ fn sign_psbt_schnorr(
|
|||||||
#[derive(Debug, Clone, PartialOrd, PartialEq, Ord, Eq)]
|
#[derive(Debug, Clone, PartialOrd, PartialEq, Ord, Eq)]
|
||||||
pub struct SignerOrdering(pub usize);
|
pub struct SignerOrdering(pub usize);
|
||||||
|
|
||||||
impl std::default::Default for SignerOrdering {
|
impl Default for SignerOrdering {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
SignerOrdering(100)
|
SignerOrdering(100)
|
||||||
}
|
}
|
||||||
@@ -631,6 +680,11 @@ impl SignersContainer {
|
|||||||
SignerOrdering::default(),
|
SignerOrdering::default(),
|
||||||
Arc::new(SignerWrapper::new(xprv, ctx)),
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
),
|
),
|
||||||
|
DescriptorSecretKey::MultiXPrv(xprv) => container.add_external(
|
||||||
|
SignerId::from(xprv.root_fingerprint(secp)),
|
||||||
|
SignerOrdering::default(),
|
||||||
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
|
),
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -698,7 +752,7 @@ pub struct SignOptions {
|
|||||||
/// Whether the signer should trust the `witness_utxo`, if the `non_witness_utxo` hasn't been
|
/// Whether the signer should trust the `witness_utxo`, if the `non_witness_utxo` hasn't been
|
||||||
/// provided
|
/// provided
|
||||||
///
|
///
|
||||||
/// Defaults to `false` to mitigate the "SegWit bug" which chould trick the wallet into
|
/// Defaults to `false` to mitigate the "SegWit bug" which should trick the wallet into
|
||||||
/// paying a fee larger than expected.
|
/// paying a fee larger than expected.
|
||||||
///
|
///
|
||||||
/// Some wallets, especially if relatively old, might not provide the `non_witness_utxo` for
|
/// Some wallets, especially if relatively old, might not provide the `non_witness_utxo` for
|
||||||
@@ -752,9 +806,10 @@ pub struct SignOptions {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Customize which taproot script-path leaves the signer should sign.
|
/// Customize which taproot script-path leaves the signer should sign.
|
||||||
#[derive(Debug, Clone, PartialEq, Eq)]
|
#[derive(Default, Debug, Clone, PartialEq, Eq)]
|
||||||
pub enum TapLeavesOptions {
|
pub enum TapLeavesOptions {
|
||||||
/// The signer will sign all the leaves it has a key for.
|
/// The signer will sign all the leaves it has a key for.
|
||||||
|
#[default]
|
||||||
All,
|
All,
|
||||||
/// The signer won't sign leaves other than the ones specified. Note that it could still ignore
|
/// The signer won't sign leaves other than the ones specified. Note that it could still ignore
|
||||||
/// some of the specified leaves, if it doesn't have the right key to sign them.
|
/// some of the specified leaves, if it doesn't have the right key to sign them.
|
||||||
@@ -765,12 +820,6 @@ pub enum TapLeavesOptions {
|
|||||||
None,
|
None,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for TapLeavesOptions {
|
|
||||||
fn default() -> Self {
|
|
||||||
TapLeavesOptions::All
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[allow(clippy::derivable_impls)]
|
#[allow(clippy::derivable_impls)]
|
||||||
impl Default for SignOptions {
|
impl Default for SignOptions {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
@@ -801,7 +850,7 @@ pub(crate) trait ComputeSighash {
|
|||||||
|
|
||||||
impl ComputeSighash for Legacy {
|
impl ComputeSighash for Legacy {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::LegacySighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@@ -848,19 +897,9 @@ impl ComputeSighash for Legacy {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn p2wpkh_script_code(script: &Script) -> Script {
|
|
||||||
ScriptBuilder::new()
|
|
||||||
.push_opcode(opcodes::all::OP_DUP)
|
|
||||||
.push_opcode(opcodes::all::OP_HASH160)
|
|
||||||
.push_slice(&script[2..])
|
|
||||||
.push_opcode(opcodes::all::OP_EQUALVERIFY)
|
|
||||||
.push_opcode(opcodes::all::OP_CHECKSIG)
|
|
||||||
.into_script()
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ComputeSighash for Segwitv0 {
|
impl ComputeSighash for Segwitv0 {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::SegwitV0Sighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@@ -907,14 +946,21 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
Some(ref witness_script) => witness_script.clone(),
|
Some(ref witness_script) => witness_script.clone(),
|
||||||
None => {
|
None => {
|
||||||
if utxo.script_pubkey.is_v0_p2wpkh() {
|
if utxo.script_pubkey.is_v0_p2wpkh() {
|
||||||
p2wpkh_script_code(&utxo.script_pubkey)
|
utxo.script_pubkey
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else if psbt_input
|
} else if psbt_input
|
||||||
.redeem_script
|
.redeem_script
|
||||||
.as_ref()
|
.as_ref()
|
||||||
.map(Script::is_v0_p2wpkh)
|
.map(|s| s.is_v0_p2wpkh())
|
||||||
.unwrap_or(false)
|
.unwrap_or(false)
|
||||||
{
|
{
|
||||||
p2wpkh_script_code(psbt_input.redeem_script.as_ref().unwrap())
|
psbt_input
|
||||||
|
.redeem_script
|
||||||
|
.as_ref()
|
||||||
|
.unwrap()
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else {
|
} else {
|
||||||
return Err(SignerError::MissingWitnessScript);
|
return Err(SignerError::MissingWitnessScript);
|
||||||
}
|
}
|
||||||
@@ -935,14 +981,14 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
|
|
||||||
impl ComputeSighash for Tap {
|
impl ComputeSighash for Tap {
|
||||||
type Extra = Option<taproot::TapLeafHash>;
|
type Extra = Option<taproot::TapLeafHash>;
|
||||||
type Sighash = taproot::TapSighashHash;
|
type Sighash = TapSighash;
|
||||||
type SighashType = SchnorrSighashType;
|
type SighashType = TapSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
psbt: &psbt::PartiallySignedTransaction,
|
psbt: &psbt::PartiallySignedTransaction,
|
||||||
input_index: usize,
|
input_index: usize,
|
||||||
extra: Self::Extra,
|
extra: Self::Extra,
|
||||||
) -> Result<(Self::Sighash, SchnorrSighashType), SignerError> {
|
) -> Result<(Self::Sighash, TapSighashType), SignerError> {
|
||||||
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
||||||
return Err(SignerError::InputIndexOutOfRange);
|
return Err(SignerError::InputIndexOutOfRange);
|
||||||
}
|
}
|
||||||
@@ -951,8 +997,8 @@ impl ComputeSighash for Tap {
|
|||||||
|
|
||||||
let sighash_type = psbt_input
|
let sighash_type = psbt_input
|
||||||
.sighash_type
|
.sighash_type
|
||||||
.unwrap_or_else(|| SchnorrSighashType::Default.into())
|
.unwrap_or_else(|| TapSighashType::Default.into())
|
||||||
.schnorr_hash_ty()
|
.taproot_hash_ty()
|
||||||
.map_err(|_| SignerError::InvalidSighash)?;
|
.map_err(|_| SignerError::InvalidSighash)?;
|
||||||
let witness_utxos = (0..psbt.inputs.len())
|
let witness_utxos = (0..psbt.inputs.len())
|
||||||
.map(|i| psbt.get_utxo_for(i))
|
.map(|i| psbt.get_utxo_for(i))
|
||||||
@@ -1014,11 +1060,11 @@ mod signers_container_tests {
|
|||||||
use crate::descriptor::IntoWalletDescriptor;
|
use crate::descriptor::IntoWalletDescriptor;
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
use core::str::FromStr;
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
fn is_equal(this: &Arc<dyn TransactionSigner>, that: &Arc<DummySigner>) -> bool {
|
fn is_equal(this: &Arc<dyn TransactionSigner>, that: &Arc<DummySigner>) -> bool {
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
@@ -17,9 +17,13 @@
|
|||||||
//! # use std::str::FromStr;
|
//! # use std::str::FromStr;
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
|
//! # use bdk::wallet::ChangeSet;
|
||||||
|
//! # use bdk::wallet::error::CreateTxError;
|
||||||
//! # use bdk::wallet::tx_builder::CreateTx;
|
//! # use bdk::wallet::tx_builder::CreateTx;
|
||||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! # use bdk_chain::PersistBackend;
|
||||||
//! # let wallet = doctest_wallet!();
|
//! # use anyhow::Error;
|
||||||
|
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
|
//! # let mut wallet = doctest_wallet!();
|
||||||
//! // create a TxBuilder from a wallet
|
//! // create a TxBuilder from a wallet
|
||||||
//! let mut tx_builder = wallet.build_tx();
|
//! let mut tx_builder = wallet.build_tx();
|
||||||
//!
|
//!
|
||||||
@@ -27,31 +31,34 @@
|
|||||||
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
||||||
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
||||||
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
||||||
//! .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
//! .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
//! // Only spend non-change outputs
|
//! // Only spend non-change outputs
|
||||||
//! .do_not_spend_change()
|
//! .do_not_spend_change()
|
||||||
//! // Turn on RBF signaling
|
//! // Turn on RBF signaling
|
||||||
//! .enable_rbf();
|
//! .enable_rbf();
|
||||||
//! let (psbt, tx_details) = tx_builder.finish()?;
|
//! let psbt = tx_builder.finish()?;
|
||||||
//! # Ok::<(), bdk::Error>(())
|
//! # Ok::<(), anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use std::collections::BTreeMap;
|
use crate::collections::BTreeMap;
|
||||||
use std::collections::HashSet;
|
use crate::collections::HashSet;
|
||||||
use std::default::Default;
|
use alloc::{boxed::Box, rc::Rc, string::String, vec::Vec};
|
||||||
use std::marker::PhantomData;
|
use bdk_chain::PersistBackend;
|
||||||
|
use core::cell::RefCell;
|
||||||
|
use core::fmt;
|
||||||
|
use core::marker::PhantomData;
|
||||||
|
|
||||||
use bitcoin::util::psbt::{self, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||||
use bitcoin::{LockTime, OutPoint, Script, Sequence, Transaction};
|
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction, Txid};
|
||||||
|
|
||||||
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
||||||
use crate::{database::BatchDatabase, Error, Utxo, Wallet};
|
use super::ChangeSet;
|
||||||
use crate::{
|
use crate::types::{FeeRate, KeychainKind, LocalOutput, WeightedUtxo};
|
||||||
types::{FeeRate, KeychainKind, LocalUtxo, WeightedUtxo},
|
use crate::wallet::CreateTxError;
|
||||||
TransactionDetails,
|
use crate::{Utxo, Wallet};
|
||||||
};
|
|
||||||
/// Context in which the [`TxBuilder`] is valid
|
/// Context in which the [`TxBuilder`] is valid
|
||||||
pub trait TxBuilderContext: std::fmt::Debug + Default + Clone {}
|
pub trait TxBuilderContext: core::fmt::Debug + Default + Clone {}
|
||||||
|
|
||||||
/// Marker type to indicate the [`TxBuilder`] is being used to create a new transaction (as opposed
|
/// Marker type to indicate the [`TxBuilder`] is being used to create a new transaction (as opposed
|
||||||
/// to bumping the fee of an existing one).
|
/// to bumping the fee of an existing one).
|
||||||
@@ -78,11 +85,15 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// # use bdk::wallet::tx_builder::*;
|
/// # use bdk::wallet::tx_builder::*;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use core::str::FromStr;
|
/// # use core::str::FromStr;
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # use bdk::wallet::ChangeSet;
|
||||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # use bdk::wallet::error::CreateTxError;
|
||||||
|
/// # use bdk_chain::PersistBackend;
|
||||||
|
/// # use anyhow::Error;
|
||||||
|
/// # let mut wallet = doctest_wallet!();
|
||||||
|
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// # let addr2 = addr1.clone();
|
/// # let addr2 = addr1.clone();
|
||||||
/// // chaining
|
/// // chaining
|
||||||
/// let (psbt1, details) = {
|
/// let psbt1 = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder
|
/// builder
|
||||||
/// .ordering(TxOrdering::Untouched)
|
/// .ordering(TxOrdering::Untouched)
|
||||||
@@ -92,7 +103,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// // non-chaining
|
/// // non-chaining
|
||||||
/// let (psbt2, details) = {
|
/// let psbt2 = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder.ordering(TxOrdering::Untouched);
|
/// builder.ordering(TxOrdering::Untouched);
|
||||||
/// for addr in &[addr1, addr2] {
|
/// for addr in &[addr1, addr2] {
|
||||||
@@ -102,7 +113,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// assert_eq!(psbt1.unsigned_tx.output[..2], psbt2.unsigned_tx.output[..2]);
|
/// assert_eq!(psbt1.unsigned_tx.output[..2], psbt2.unsigned_tx.output[..2]);
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), anyhow::Error>(())
|
||||||
/// ```
|
/// ```
|
||||||
///
|
///
|
||||||
/// At the moment [`coin_selection`] is an exception to the rule as it consumes `self`.
|
/// At the moment [`coin_selection`] is an exception to the rule as it consumes `self`.
|
||||||
@@ -116,7 +127,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// [`coin_selection`]: Self::coin_selection
|
/// [`coin_selection`]: Self::coin_selection
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
pub struct TxBuilder<'a, D, Cs, Ctx> {
|
pub struct TxBuilder<'a, D, Cs, Ctx> {
|
||||||
pub(crate) wallet: &'a Wallet<D>,
|
pub(crate) wallet: Rc<RefCell<&'a mut Wallet<D>>>,
|
||||||
pub(crate) params: TxParams,
|
pub(crate) params: TxParams,
|
||||||
pub(crate) coin_selection: Cs,
|
pub(crate) coin_selection: Cs,
|
||||||
pub(crate) phantom: PhantomData<Ctx>,
|
pub(crate) phantom: PhantomData<Ctx>,
|
||||||
@@ -126,9 +137,9 @@ pub struct TxBuilder<'a, D, Cs, Ctx> {
|
|||||||
//TODO: TxParams should eventually be exposed publicly.
|
//TODO: TxParams should eventually be exposed publicly.
|
||||||
#[derive(Default, Debug, Clone)]
|
#[derive(Default, Debug, Clone)]
|
||||||
pub(crate) struct TxParams {
|
pub(crate) struct TxParams {
|
||||||
pub(crate) recipients: Vec<(Script, u64)>,
|
pub(crate) recipients: Vec<(ScriptBuf, u64)>,
|
||||||
pub(crate) drain_wallet: bool,
|
pub(crate) drain_wallet: bool,
|
||||||
pub(crate) drain_to: Option<Script>,
|
pub(crate) drain_to: Option<ScriptBuf>,
|
||||||
pub(crate) fee_policy: Option<FeePolicy>,
|
pub(crate) fee_policy: Option<FeePolicy>,
|
||||||
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
@@ -137,7 +148,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) manually_selected_only: bool,
|
pub(crate) manually_selected_only: bool,
|
||||||
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
||||||
pub(crate) ordering: TxOrdering,
|
pub(crate) ordering: TxOrdering,
|
||||||
pub(crate) locktime: Option<LockTime>,
|
pub(crate) locktime: Option<absolute::LockTime>,
|
||||||
pub(crate) rbf: Option<RbfValue>,
|
pub(crate) rbf: Option<RbfValue>,
|
||||||
pub(crate) version: Option<Version>,
|
pub(crate) version: Option<Version>,
|
||||||
pub(crate) change_policy: ChangeSpendPolicy,
|
pub(crate) change_policy: ChangeSpendPolicy,
|
||||||
@@ -145,7 +156,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) add_global_xpubs: bool,
|
pub(crate) add_global_xpubs: bool,
|
||||||
pub(crate) include_output_redeem_witness_script: bool,
|
pub(crate) include_output_redeem_witness_script: bool,
|
||||||
pub(crate) bumping_fee: Option<PreviousFee>,
|
pub(crate) bumping_fee: Option<PreviousFee>,
|
||||||
pub(crate) current_height: Option<LockTime>,
|
pub(crate) current_height: Option<absolute::LockTime>,
|
||||||
pub(crate) allow_dust: bool,
|
pub(crate) allow_dust: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -161,16 +172,16 @@ pub(crate) enum FeePolicy {
|
|||||||
FeeAmount(u64),
|
FeeAmount(u64),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::default::Default for FeePolicy {
|
impl Default for FeePolicy {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
FeePolicy::FeeRate(FeeRate::default_min_relay_fee())
|
FeePolicy::FeeRate(FeeRate::default_min_relay_fee())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a, Cs: Clone, Ctx, D> Clone for TxBuilder<'a, D, Cs, Ctx> {
|
impl<'a, D, Cs: Clone, Ctx> Clone for TxBuilder<'a, D, Cs, Ctx> {
|
||||||
fn clone(&self) -> Self {
|
fn clone(&self) -> Self {
|
||||||
TxBuilder {
|
TxBuilder {
|
||||||
wallet: self.wallet,
|
wallet: self.wallet.clone(),
|
||||||
params: self.params.clone(),
|
params: self.params.clone(),
|
||||||
coin_selection: self.coin_selection.clone(),
|
coin_selection: self.coin_selection.clone(),
|
||||||
phantom: PhantomData,
|
phantom: PhantomData,
|
||||||
@@ -179,16 +190,33 @@ impl<'a, Cs: Clone, Ctx, D> Clone for TxBuilder<'a, D, Cs, Ctx> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// methods supported by both contexts, for any CoinSelectionAlgorithm
|
// methods supported by both contexts, for any CoinSelectionAlgorithm
|
||||||
impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D, Cs, Ctx> {
|
||||||
TxBuilder<'a, D, Cs, Ctx>
|
|
||||||
{
|
|
||||||
/// Set a custom fee rate
|
/// Set a custom fee rate
|
||||||
|
/// The fee_rate method sets the mining fee paid by the transaction as a rate on its size.
|
||||||
|
/// This means that the total fee paid is equal to this rate * size of the transaction in virtual Bytes (vB) or Weight Unit (wu).
|
||||||
|
/// This rate is internally expressed in satoshis-per-virtual-bytes (sats/vB) using FeeRate::from_sat_per_vb, but can also be set by:
|
||||||
|
/// * sats/kvB (1000 sats/kvB == 1 sats/vB) using FeeRate::from_sat_per_kvb
|
||||||
|
/// * btc/kvB (0.00001000 btc/kvB == 1 sats/vB) using FeeRate::from_btc_per_kvb
|
||||||
|
/// * sats/kwu (250 sats/kwu == 1 sats/vB) using FeeRate::from_sat_per_kwu
|
||||||
|
/// Default is 1 sat/vB (see min_relay_fee)
|
||||||
|
///
|
||||||
|
/// Note that this is really a minimum feerate -- it's possible to
|
||||||
|
/// overshoot it slightly since adding a change output to drain the remaining
|
||||||
|
/// excess might not be viable.
|
||||||
pub fn fee_rate(&mut self, fee_rate: FeeRate) -> &mut Self {
|
pub fn fee_rate(&mut self, fee_rate: FeeRate) -> &mut Self {
|
||||||
self.params.fee_policy = Some(FeePolicy::FeeRate(fee_rate));
|
self.params.fee_policy = Some(FeePolicy::FeeRate(fee_rate));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Set an absolute fee
|
/// Set an absolute fee
|
||||||
|
/// The fee_absolute method refers to the absolute transaction fee in satoshis (sats).
|
||||||
|
/// If anyone sets both the fee_absolute method and the fee_rate method,
|
||||||
|
/// the FeePolicy enum will be set by whichever method was called last,
|
||||||
|
/// as the FeeRate and FeeAmount are mutually exclusive.
|
||||||
|
///
|
||||||
|
/// Note that this is really a minimum absolute fee -- it's possible to
|
||||||
|
/// overshoot it slightly since adding a change output to drain the remaining
|
||||||
|
/// excess might not be viable.
|
||||||
pub fn fee_absolute(&mut self, fee_amount: u64) -> &mut Self {
|
pub fn fee_absolute(&mut self, fee_amount: u64) -> &mut Self {
|
||||||
self.params.fee_policy = Some(FeePolicy::FeeAmount(fee_amount));
|
self.params.fee_policy = Some(FeePolicy::FeeAmount(fee_amount));
|
||||||
self
|
self
|
||||||
@@ -241,8 +269,11 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// # use std::collections::BTreeMap;
|
/// # use std::collections::BTreeMap;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
/// # let wallet = doctest_wallet!();
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
|
/// # let mut wallet = doctest_wallet!();
|
||||||
/// let mut path = BTreeMap::new();
|
/// let mut path = BTreeMap::new();
|
||||||
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
||||||
///
|
///
|
||||||
@@ -251,7 +282,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// .add_recipient(to_address.script_pubkey(), 50_000)
|
/// .add_recipient(to_address.script_pubkey(), 50_000)
|
||||||
/// .policy_path(path, KeychainKind::External);
|
/// .policy_path(path, KeychainKind::External);
|
||||||
///
|
///
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), anyhow::Error>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub fn policy_path(
|
pub fn policy_path(
|
||||||
&mut self,
|
&mut self,
|
||||||
@@ -273,19 +304,27 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||||
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, Error> {
|
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, AddUtxoError> {
|
||||||
let utxos = outpoints
|
{
|
||||||
.iter()
|
let wallet = self.wallet.borrow();
|
||||||
.map(|outpoint| self.wallet.get_utxo(*outpoint)?.ok_or(Error::UnknownUtxo))
|
let utxos = outpoints
|
||||||
.collect::<Result<Vec<_>, _>>()?;
|
.iter()
|
||||||
|
.map(|outpoint| {
|
||||||
|
wallet
|
||||||
|
.get_utxo(*outpoint)
|
||||||
|
.ok_or(AddUtxoError::UnknownUtxo(*outpoint))
|
||||||
|
})
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
|
||||||
for utxo in utxos {
|
for utxo in utxos {
|
||||||
let descriptor = self.wallet.get_descriptor_for_keychain(utxo.keychain);
|
let descriptor = wallet.get_descriptor_for_keychain(utxo.keychain);
|
||||||
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
#[allow(deprecated)]
|
||||||
self.params.utxos.push(WeightedUtxo {
|
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
||||||
satisfaction_weight,
|
self.params.utxos.push(WeightedUtxo {
|
||||||
utxo: Utxo::Local(utxo),
|
satisfaction_weight,
|
||||||
});
|
utxo: Utxo::Local(utxo),
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(self)
|
Ok(self)
|
||||||
@@ -295,7 +334,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||||
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, Error> {
|
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, AddUtxoError> {
|
||||||
self.add_utxos(&[outpoint])
|
self.add_utxos(&[outpoint])
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -327,6 +366,10 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// This is an **EXPERIMENTAL** feature, API and other major changes are expected.
|
/// This is an **EXPERIMENTAL** feature, API and other major changes are expected.
|
||||||
///
|
///
|
||||||
|
/// In order to use [`Wallet::calculate_fee`] or [`Wallet::calculate_fee_rate`] for a transaction
|
||||||
|
/// created with foreign UTXO(s) you must manually insert the corresponding TxOut(s) into the tx
|
||||||
|
/// graph using the [`Wallet::insert_txout`] function.
|
||||||
|
///
|
||||||
/// # Errors
|
/// # Errors
|
||||||
///
|
///
|
||||||
/// This method returns errors in the following circumstances:
|
/// This method returns errors in the following circumstances:
|
||||||
@@ -346,23 +389,22 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
outpoint: OutPoint,
|
outpoint: OutPoint,
|
||||||
psbt_input: psbt::Input,
|
psbt_input: psbt::Input,
|
||||||
satisfaction_weight: usize,
|
satisfaction_weight: usize,
|
||||||
) -> Result<&mut Self, Error> {
|
) -> Result<&mut Self, AddForeignUtxoError> {
|
||||||
if psbt_input.witness_utxo.is_none() {
|
if psbt_input.witness_utxo.is_none() {
|
||||||
match psbt_input.non_witness_utxo.as_ref() {
|
match psbt_input.non_witness_utxo.as_ref() {
|
||||||
Some(tx) => {
|
Some(tx) => {
|
||||||
if tx.txid() != outpoint.txid {
|
if tx.txid() != outpoint.txid {
|
||||||
return Err(Error::Generic(
|
return Err(AddForeignUtxoError::InvalidTxid {
|
||||||
"Foreign utxo outpoint does not match PSBT input".into(),
|
input_txid: tx.txid(),
|
||||||
));
|
foreign_utxo: outpoint,
|
||||||
|
});
|
||||||
}
|
}
|
||||||
if tx.output.len() <= outpoint.vout as usize {
|
if tx.output.len() <= outpoint.vout as usize {
|
||||||
return Err(Error::InvalidOutpoint(outpoint));
|
return Err(AddForeignUtxoError::InvalidOutpoint(outpoint));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
None => {
|
None => {
|
||||||
return Err(Error::Generic(
|
return Err(AddForeignUtxoError::MissingUtxo);
|
||||||
"Foreign utxo missing witness_utxo or non_witness_utxo".into(),
|
|
||||||
))
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -424,7 +466,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// Use a specific nLockTime while creating the transaction
|
/// Use a specific nLockTime while creating the transaction
|
||||||
///
|
///
|
||||||
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
||||||
pub fn nlocktime(&mut self, locktime: LockTime) -> &mut Self {
|
pub fn nlocktime(&mut self, locktime: absolute::LockTime) -> &mut Self {
|
||||||
self.params.locktime = Some(locktime);
|
self.params.locktime = Some(locktime);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -463,7 +505,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::util::psbt::Input::witness_utxo) field when spending from
|
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::psbt::Input::witness_utxo) field when spending from
|
||||||
/// SegWit descriptors.
|
/// SegWit descriptors.
|
||||||
///
|
///
|
||||||
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
||||||
@@ -473,8 +515,8 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::util::psbt::Output::redeem_script) and
|
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::psbt::Output::redeem_script) and
|
||||||
/// [`psbt::Output::witness_script`](bitcoin::util::psbt::Output::witness_script) fields.
|
/// [`psbt::Output::witness_script`](bitcoin::psbt::Output::witness_script) fields.
|
||||||
///
|
///
|
||||||
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
||||||
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
||||||
@@ -500,10 +542,10 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
|
|
||||||
/// Choose the coin selection algorithm
|
/// Choose the coin selection algorithm
|
||||||
///
|
///
|
||||||
/// Overrides the [`DefaultCoinSelectionAlgorithm`](super::coin_selection::DefaultCoinSelectionAlgorithm).
|
/// Overrides the [`DefaultCoinSelectionAlgorithm`].
|
||||||
///
|
///
|
||||||
/// Note that this function consumes the builder and returns it so it is usually best to put this as the first call on the builder.
|
/// Note that this function consumes the builder and returns it so it is usually best to put this as the first call on the builder.
|
||||||
pub fn coin_selection<P: CoinSelectionAlgorithm<D>>(
|
pub fn coin_selection<P: CoinSelectionAlgorithm>(
|
||||||
self,
|
self,
|
||||||
coin_selection: P,
|
coin_selection: P,
|
||||||
) -> TxBuilder<'a, D, P, Ctx> {
|
) -> TxBuilder<'a, D, P, Ctx> {
|
||||||
@@ -517,11 +559,16 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
|
|
||||||
/// Finish building the transaction.
|
/// Finish building the transaction.
|
||||||
///
|
///
|
||||||
/// Returns the [`BIP174`] "PSBT" and summary details about the transaction.
|
/// Returns a new [`Psbt`] per [`BIP174`].
|
||||||
///
|
///
|
||||||
/// [`BIP174`]: https://github.com/bitcoin/bips/blob/master/bip-0174.mediawiki
|
/// [`BIP174`]: https://github.com/bitcoin/bips/blob/master/bip-0174.mediawiki
|
||||||
pub fn finish(self) -> Result<(Psbt, TransactionDetails), Error> {
|
pub fn finish(self) -> Result<Psbt, CreateTxError<D::WriteError>>
|
||||||
self.wallet.create_tx(self.coin_selection, self.params)
|
where
|
||||||
|
D: PersistBackend<ChangeSet>,
|
||||||
|
{
|
||||||
|
self.wallet
|
||||||
|
.borrow_mut()
|
||||||
|
.create_tx(self.coin_selection, self.params)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Enable signaling RBF
|
/// Enable signaling RBF
|
||||||
@@ -556,7 +603,8 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// In both cases, if you don't provide a current height, we use the last sync height.
|
/// In both cases, if you don't provide a current height, we use the last sync height.
|
||||||
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
||||||
self.params.current_height = Some(LockTime::from_height(height).expect("Invalid height"));
|
self.params.current_height =
|
||||||
|
Some(absolute::LockTime::from_height(height).expect("Invalid height"));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -569,22 +617,106 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, CreateTx> {
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::add_utxo`] and [`TxBuilder::add_utxos`]
|
||||||
|
pub enum AddUtxoError {
|
||||||
|
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||||
|
UnknownUtxo(OutPoint),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for AddUtxoError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::UnknownUtxo(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"UTXO not found in the internal database for txid: {} with vout: {}",
|
||||||
|
outpoint.txid, outpoint.vout
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AddUtxoError {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::add_foreign_utxo`].
|
||||||
|
pub enum AddForeignUtxoError {
|
||||||
|
/// Foreign utxo outpoint txid does not match PSBT input txid
|
||||||
|
InvalidTxid {
|
||||||
|
/// PSBT input txid
|
||||||
|
input_txid: Txid,
|
||||||
|
/// Foreign UTXO outpoint
|
||||||
|
foreign_utxo: OutPoint,
|
||||||
|
},
|
||||||
|
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
||||||
|
InvalidOutpoint(OutPoint),
|
||||||
|
/// Foreign utxo missing witness_utxo or non_witness_utxo
|
||||||
|
MissingUtxo,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for AddForeignUtxoError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::InvalidTxid {
|
||||||
|
input_txid,
|
||||||
|
foreign_utxo,
|
||||||
|
} => write!(
|
||||||
|
f,
|
||||||
|
"Foreign UTXO outpoint txid: {} does not match PSBT input txid: {}",
|
||||||
|
foreign_utxo.txid, input_txid,
|
||||||
|
),
|
||||||
|
Self::InvalidOutpoint(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"Requested outpoint doesn't exist for txid: {} with vout: {}",
|
||||||
|
outpoint.txid, outpoint.vout,
|
||||||
|
),
|
||||||
|
Self::MissingUtxo => write!(f, "Foreign utxo missing witness_utxo or non_witness_utxo"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AddForeignUtxoError {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::allow_shrinking`]
|
||||||
|
pub enum AllowShrinkingError {
|
||||||
|
/// Script/PubKey was not in the original transaction
|
||||||
|
MissingScriptPubKey(ScriptBuf),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for AllowShrinkingError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::MissingScriptPubKey(script_buf) => write!(
|
||||||
|
f,
|
||||||
|
"Script/PubKey was not in the original transaction: {}",
|
||||||
|
script_buf,
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AllowShrinkingError {}
|
||||||
|
|
||||||
|
impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||||
/// Replace the recipients already added with a new list
|
/// Replace the recipients already added with a new list
|
||||||
pub fn set_recipients(&mut self, recipients: Vec<(Script, u64)>) -> &mut Self {
|
pub fn set_recipients(&mut self, recipients: Vec<(ScriptBuf, u64)>) -> &mut Self {
|
||||||
self.params.recipients = recipients;
|
self.params.recipients = recipients;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add a recipient to the internal list
|
/// Add a recipient to the internal list
|
||||||
pub fn add_recipient(&mut self, script_pubkey: Script, amount: u64) -> &mut Self {
|
pub fn add_recipient(&mut self, script_pubkey: ScriptBuf, amount: u64) -> &mut Self {
|
||||||
self.params.recipients.push((script_pubkey, amount));
|
self.params.recipients.push((script_pubkey, amount));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add data as an output, using OP_RETURN
|
/// Add data as an output, using OP_RETURN
|
||||||
pub fn add_data(&mut self, data: &[u8]) -> &mut Self {
|
pub fn add_data<T: AsRef<PushBytes>>(&mut self, data: &T) -> &mut Self {
|
||||||
let script = Script::new_op_return(data);
|
let script = ScriptBuf::new_op_return(data);
|
||||||
self.add_recipient(script, 0u64);
|
self.add_recipient(script, 0u64);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -613,9 +745,16 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
|
/// # use bdk::wallet::ChangeSet;
|
||||||
|
/// # use bdk::wallet::error::CreateTxError;
|
||||||
/// # use bdk::wallet::tx_builder::CreateTx;
|
/// # use bdk::wallet::tx_builder::CreateTx;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # use bdk_chain::PersistBackend;
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # use anyhow::Error;
|
||||||
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
|
/// # let mut wallet = doctest_wallet!();
|
||||||
/// let mut tx_builder = wallet.build_tx();
|
/// let mut tx_builder = wallet.build_tx();
|
||||||
///
|
///
|
||||||
/// tx_builder
|
/// tx_builder
|
||||||
@@ -623,24 +762,24 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// .drain_wallet()
|
/// .drain_wallet()
|
||||||
/// // Send the excess (which is all the coins minus the fee) to this address.
|
/// // Send the excess (which is all the coins minus the fee) to this address.
|
||||||
/// .drain_to(to_address.script_pubkey())
|
/// .drain_to(to_address.script_pubkey())
|
||||||
/// .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
/// .enable_rbf();
|
/// .enable_rbf();
|
||||||
/// let (psbt, tx_details) = tx_builder.finish()?;
|
/// let psbt = tx_builder.finish()?;
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), anyhow::Error>(())
|
||||||
/// ```
|
/// ```
|
||||||
///
|
///
|
||||||
/// [`allow_shrinking`]: Self::allow_shrinking
|
/// [`allow_shrinking`]: Self::allow_shrinking
|
||||||
/// [`add_recipient`]: Self::add_recipient
|
/// [`add_recipient`]: Self::add_recipient
|
||||||
/// [`add_utxos`]: Self::add_utxos
|
/// [`add_utxos`]: Self::add_utxos
|
||||||
/// [`drain_wallet`]: Self::drain_wallet
|
/// [`drain_wallet`]: Self::drain_wallet
|
||||||
pub fn drain_to(&mut self, script_pubkey: Script) -> &mut Self {
|
pub fn drain_to(&mut self, script_pubkey: ScriptBuf) -> &mut Self {
|
||||||
self.params.drain_to = Some(script_pubkey);
|
self.params.drain_to = Some(script_pubkey);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// methods supported only by bump_fee
|
// methods supported only by bump_fee
|
||||||
impl<'a, D: BatchDatabase> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
||||||
/// Explicitly tells the wallet that it is allowed to reduce the amount of the output matching this
|
/// Explicitly tells the wallet that it is allowed to reduce the amount of the output matching this
|
||||||
/// `script_pubkey` in order to bump the transaction fee. Without specifying this the wallet
|
/// `script_pubkey` in order to bump the transaction fee. Without specifying this the wallet
|
||||||
/// will attempt to find a change output to shrink instead.
|
/// will attempt to find a change output to shrink instead.
|
||||||
@@ -651,7 +790,10 @@ impl<'a, D: BatchDatabase> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpF
|
|||||||
///
|
///
|
||||||
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
||||||
/// transaction we are bumping.
|
/// transaction we are bumping.
|
||||||
pub fn allow_shrinking(&mut self, script_pubkey: Script) -> Result<&mut Self, Error> {
|
pub fn allow_shrinking(
|
||||||
|
&mut self,
|
||||||
|
script_pubkey: ScriptBuf,
|
||||||
|
) -> Result<&mut Self, AllowShrinkingError> {
|
||||||
match self
|
match self
|
||||||
.params
|
.params
|
||||||
.recipients
|
.recipients
|
||||||
@@ -663,18 +805,16 @@ impl<'a, D: BatchDatabase> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpF
|
|||||||
self.params.drain_to = Some(script_pubkey);
|
self.params.drain_to = Some(script_pubkey);
|
||||||
Ok(self)
|
Ok(self)
|
||||||
}
|
}
|
||||||
None => Err(Error::Generic(format!(
|
None => Err(AllowShrinkingError::MissingScriptPubKey(script_pubkey)),
|
||||||
"{} was not in the original transaction",
|
|
||||||
script_pubkey
|
|
||||||
))),
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Ordering of the transaction's inputs and outputs
|
/// Ordering of the transaction's inputs and outputs
|
||||||
#[derive(Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
#[derive(Default, Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
||||||
pub enum TxOrdering {
|
pub enum TxOrdering {
|
||||||
/// Randomized (default)
|
/// Randomized (default)
|
||||||
|
#[default]
|
||||||
Shuffle,
|
Shuffle,
|
||||||
/// Unchanged
|
/// Unchanged
|
||||||
Untouched,
|
Untouched,
|
||||||
@@ -682,12 +822,6 @@ pub enum TxOrdering {
|
|||||||
Bip69Lexicographic,
|
Bip69Lexicographic,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for TxOrdering {
|
|
||||||
fn default() -> Self {
|
|
||||||
TxOrdering::Shuffle
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl TxOrdering {
|
impl TxOrdering {
|
||||||
/// Sort transaction inputs and outputs by [`TxOrdering`] variant
|
/// Sort transaction inputs and outputs by [`TxOrdering`] variant
|
||||||
pub fn sort_tx(&self, tx: &mut Transaction) {
|
pub fn sort_tx(&self, tx: &mut Transaction) {
|
||||||
@@ -695,14 +829,8 @@ impl TxOrdering {
|
|||||||
TxOrdering::Untouched => {}
|
TxOrdering::Untouched => {}
|
||||||
TxOrdering::Shuffle => {
|
TxOrdering::Shuffle => {
|
||||||
use rand::seq::SliceRandom;
|
use rand::seq::SliceRandom;
|
||||||
#[cfg(test)]
|
|
||||||
use rand::SeedableRng;
|
|
||||||
|
|
||||||
#[cfg(not(test))]
|
|
||||||
let mut rng = rand::thread_rng();
|
let mut rng = rand::thread_rng();
|
||||||
#[cfg(test)]
|
tx.input.shuffle(&mut rng);
|
||||||
let mut rng = rand::rngs::StdRng::seed_from_u64(12345);
|
|
||||||
|
|
||||||
tx.output.shuffle(&mut rng);
|
tx.output.shuffle(&mut rng);
|
||||||
}
|
}
|
||||||
TxOrdering::Bip69Lexicographic => {
|
TxOrdering::Bip69Lexicographic => {
|
||||||
@@ -747,9 +875,10 @@ impl RbfValue {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Policy regarding the use of change outputs when creating a transaction
|
/// Policy regarding the use of change outputs when creating a transaction
|
||||||
#[derive(Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
#[derive(Default, Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
||||||
pub enum ChangeSpendPolicy {
|
pub enum ChangeSpendPolicy {
|
||||||
/// Use both change and non-change outputs (default)
|
/// Use both change and non-change outputs (default)
|
||||||
|
#[default]
|
||||||
ChangeAllowed,
|
ChangeAllowed,
|
||||||
/// Only use change outputs (see [`TxBuilder::only_spend_change`])
|
/// Only use change outputs (see [`TxBuilder::only_spend_change`])
|
||||||
OnlyChange,
|
OnlyChange,
|
||||||
@@ -757,14 +886,8 @@ pub enum ChangeSpendPolicy {
|
|||||||
ChangeForbidden,
|
ChangeForbidden,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for ChangeSpendPolicy {
|
|
||||||
fn default() -> Self {
|
|
||||||
ChangeSpendPolicy::ChangeAllowed
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ChangeSpendPolicy {
|
impl ChangeSpendPolicy {
|
||||||
pub(crate) fn is_satisfied_by(&self, utxo: &LocalUtxo) -> bool {
|
pub(crate) fn is_satisfied_by(&self, utxo: &LocalOutput) -> bool {
|
||||||
match self {
|
match self {
|
||||||
ChangeSpendPolicy::ChangeAllowed => true,
|
ChangeSpendPolicy::ChangeAllowed => true,
|
||||||
ChangeSpendPolicy::OnlyChange => utxo.keychain == KeychainKind::Internal,
|
ChangeSpendPolicy::OnlyChange => utxo.keychain == KeychainKind::Internal,
|
||||||
@@ -788,6 +911,7 @@ mod test {
|
|||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
|
use bdk_chain::ConfirmationTime;
|
||||||
use bitcoin::consensus::deserialize;
|
use bitcoin::consensus::deserialize;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
|
|
||||||
@@ -813,15 +937,25 @@ mod test {
|
|||||||
let original_tx = ordering_test_tx!();
|
let original_tx = ordering_test_tx!();
|
||||||
let mut tx = original_tx.clone();
|
let mut tx = original_tx.clone();
|
||||||
|
|
||||||
TxOrdering::Shuffle.sort_tx(&mut tx);
|
(0..40)
|
||||||
|
.find(|_| {
|
||||||
|
TxOrdering::Shuffle.sort_tx(&mut tx);
|
||||||
|
original_tx.input != tx.input
|
||||||
|
})
|
||||||
|
.expect("it should have moved the inputs at least once");
|
||||||
|
|
||||||
assert_eq!(original_tx.input, tx.input);
|
let mut tx = original_tx.clone();
|
||||||
assert_ne!(original_tx.output, tx.output);
|
(0..40)
|
||||||
|
.find(|_| {
|
||||||
|
TxOrdering::Shuffle.sort_tx(&mut tx);
|
||||||
|
original_tx.output != tx.output
|
||||||
|
})
|
||||||
|
.expect("it should have moved the outputs at least once");
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_output_ordering_bip69() {
|
fn test_output_ordering_bip69() {
|
||||||
use std::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
let original_tx = ordering_test_tx!();
|
let original_tx = ordering_test_tx!();
|
||||||
let mut tx = original_tx;
|
let mut tx = original_tx;
|
||||||
@@ -851,31 +985,41 @@ mod test {
|
|||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(tx.output[0].value, 800);
|
assert_eq!(tx.output[0].value, 800);
|
||||||
assert_eq!(tx.output[1].script_pubkey, From::from(vec![0xAA]));
|
assert_eq!(tx.output[1].script_pubkey, ScriptBuf::from(vec![0xAA]));
|
||||||
assert_eq!(tx.output[2].script_pubkey, From::from(vec![0xAA, 0xEE]));
|
assert_eq!(
|
||||||
|
tx.output[2].script_pubkey,
|
||||||
|
ScriptBuf::from(vec![0xAA, 0xEE])
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_test_utxos() -> Vec<LocalUtxo> {
|
fn get_test_utxos() -> Vec<LocalOutput> {
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
|
|
||||||
vec![
|
vec![
|
||||||
LocalUtxo {
|
LocalOutput {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 0,
|
vout: 0,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
|
confirmation_time: ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||||
|
derivation_index: 0,
|
||||||
},
|
},
|
||||||
LocalUtxo {
|
LocalOutput {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 1,
|
vout: 1,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
keychain: KeychainKind::Internal,
|
keychain: KeychainKind::Internal,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
|
confirmation_time: ConfirmationTime::Confirmed {
|
||||||
|
height: 32,
|
||||||
|
time: 42,
|
||||||
|
},
|
||||||
|
derivation_index: 1,
|
||||||
},
|
},
|
||||||
]
|
]
|
||||||
}
|
}
|
||||||
@@ -10,7 +10,7 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::{LockTime, Script, Sequence};
|
use bitcoin::{absolute, Script, Sequence};
|
||||||
|
|
||||||
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
||||||
|
|
||||||
@@ -65,7 +65,7 @@ pub(crate) fn check_nsequence_rbf(rbf: Sequence, csv: Sequence) -> bool {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
||||||
fn check_after(&self, n: LockTime) -> bool {
|
fn check_after(&self, n: absolute::LockTime) -> bool {
|
||||||
if let Some(current_height) = self.current_height {
|
if let Some(current_height) = self.current_height {
|
||||||
current_height >= n.to_consensus_u32()
|
current_height >= n.to_consensus_u32()
|
||||||
} else {
|
} else {
|
||||||
@@ -119,12 +119,14 @@ mod test {
|
|||||||
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
||||||
|
|
||||||
use super::{check_nsequence_rbf, IsDust};
|
use super::{check_nsequence_rbf, IsDust};
|
||||||
use crate::bitcoin::{Address, Sequence};
|
use crate::bitcoin::{Address, Network, Sequence};
|
||||||
use std::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_is_dust() {
|
fn test_is_dust() {
|
||||||
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2pkh.is_p2pkh());
|
assert!(script_p2pkh.is_p2pkh());
|
||||||
@@ -132,6 +134,8 @@ mod test {
|
|||||||
assert!(!546.is_dust(&script_p2pkh));
|
assert!(!546.is_dust(&script_p2pkh));
|
||||||
|
|
||||||
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2wpkh.is_v0_p2wpkh());
|
assert!(script_p2wpkh.is_v0_p2wpkh());
|
||||||
156
crates/bdk/tests/common.rs
Normal file
156
crates/bdk/tests/common.rs
Normal file
@@ -0,0 +1,156 @@
|
|||||||
|
#![allow(unused)]
|
||||||
|
|
||||||
|
use bdk::{wallet::AddressIndex, KeychainKind, LocalOutput, Wallet};
|
||||||
|
use bdk_chain::indexed_tx_graph::Indexer;
|
||||||
|
use bdk_chain::{BlockId, ConfirmationTime};
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
|
use bitcoin::{Address, BlockHash, Network, OutPoint, Transaction, TxIn, TxOut, Txid};
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
// Return a fake wallet that appears to be funded for testing.
|
||||||
|
//
|
||||||
|
// The funded wallet containing a tx with a 76_000 sats input and two outputs, one spending 25_000
|
||||||
|
// to a foreign address and one returning 50_000 back to the wallet as change. The remaining 1000
|
||||||
|
// sats are the transaction fee.
|
||||||
|
pub fn get_funded_wallet_with_change(
|
||||||
|
descriptor: &str,
|
||||||
|
change: Option<&str>,
|
||||||
|
) -> (Wallet, bitcoin::Txid) {
|
||||||
|
let mut wallet = Wallet::new_no_persist(descriptor, change, Network::Regtest).unwrap();
|
||||||
|
let change_address = wallet.get_address(AddressIndex::New).address;
|
||||||
|
let sendto_address = Address::from_str("bcrt1q3qtze4ys45tgdvguj66zrk4fu6hq3a3v9pfly5")
|
||||||
|
.expect("address")
|
||||||
|
.require_network(Network::Regtest)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
let tx0 = Transaction {
|
||||||
|
version: 1,
|
||||||
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint {
|
||||||
|
txid: Txid::all_zeros(),
|
||||||
|
vout: 0,
|
||||||
|
},
|
||||||
|
script_sig: Default::default(),
|
||||||
|
sequence: Default::default(),
|
||||||
|
witness: Default::default(),
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 76_000,
|
||||||
|
script_pubkey: change_address.script_pubkey(),
|
||||||
|
}],
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx1 = Transaction {
|
||||||
|
version: 1,
|
||||||
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint {
|
||||||
|
txid: tx0.txid(),
|
||||||
|
vout: 0,
|
||||||
|
},
|
||||||
|
script_sig: Default::default(),
|
||||||
|
sequence: Default::default(),
|
||||||
|
witness: Default::default(),
|
||||||
|
}],
|
||||||
|
output: vec![
|
||||||
|
TxOut {
|
||||||
|
value: 50_000,
|
||||||
|
script_pubkey: change_address.script_pubkey(),
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
value: 25_000,
|
||||||
|
script_pubkey: sendto_address.script_pubkey(),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
};
|
||||||
|
|
||||||
|
wallet
|
||||||
|
.insert_checkpoint(BlockId {
|
||||||
|
height: 1_000,
|
||||||
|
hash: BlockHash::all_zeros(),
|
||||||
|
})
|
||||||
|
.unwrap();
|
||||||
|
wallet
|
||||||
|
.insert_checkpoint(BlockId {
|
||||||
|
height: 2_000,
|
||||||
|
hash: BlockHash::all_zeros(),
|
||||||
|
})
|
||||||
|
.unwrap();
|
||||||
|
wallet
|
||||||
|
.insert_tx(
|
||||||
|
tx0,
|
||||||
|
ConfirmationTime::Confirmed {
|
||||||
|
height: 1_000,
|
||||||
|
time: 100,
|
||||||
|
},
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
wallet
|
||||||
|
.insert_tx(
|
||||||
|
tx1.clone(),
|
||||||
|
ConfirmationTime::Confirmed {
|
||||||
|
height: 2_000,
|
||||||
|
time: 200,
|
||||||
|
},
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
(wallet, tx1.txid())
|
||||||
|
}
|
||||||
|
|
||||||
|
// Return a fake wallet that appears to be funded for testing.
|
||||||
|
//
|
||||||
|
// The funded wallet containing a tx with a 76_000 sats input and two outputs, one spending 25_000
|
||||||
|
// to a foreign address and one returning 50_000 back to the wallet as change. The remaining 1000
|
||||||
|
// sats are the transaction fee.
|
||||||
|
pub fn get_funded_wallet(descriptor: &str) -> (Wallet, bitcoin::Txid) {
|
||||||
|
get_funded_wallet_with_change(descriptor, None)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_wpkh() -> &'static str {
|
||||||
|
"wpkh(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW)"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_single_sig_csv() -> &'static str {
|
||||||
|
// and(pk(Alice),older(6))
|
||||||
|
"wsh(and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),older(6)))"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_a_or_b_plus_csv() -> &'static str {
|
||||||
|
// or(pk(Alice),and(pk(Bob),older(144)))
|
||||||
|
"wsh(or_d(pk(cRjo6jqfVNP33HhSS76UhXETZsGTZYx8FMFvR9kpbtCSV1PmdZdu),and_v(v:pk(cMnkdebixpXMPfkcNEjjGin7s94hiehAH4mLbYkZoh9KSiNNmqC8),older(144))))"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_single_sig_cltv() -> &'static str {
|
||||||
|
// and(pk(Alice),after(100000))
|
||||||
|
"wsh(and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),after(100000)))"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_single_sig() -> &'static str {
|
||||||
|
"tr(cNJmN3fH9DDbDt131fQNkVakkpzawJBSeybCUNmP1BovpmGQ45xG)"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_with_taptree() -> &'static str {
|
||||||
|
"tr(b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55,{pk(cPZzKuNmpuUjD1e8jUU4PVzy2b5LngbSip8mBsxf4e7rSFZVb4Uh),pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642)})"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_with_taptree_both_priv() -> &'static str {
|
||||||
|
"tr(b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55,{pk(cPZzKuNmpuUjD1e8jUU4PVzy2b5LngbSip8mBsxf4e7rSFZVb4Uh),pk(cNaQCDwmmh4dS9LzCgVtyy1e1xjCJ21GUDHe9K98nzb689JvinGV)})"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_repeated_key() -> &'static str {
|
||||||
|
"tr(b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55,{and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),after(100)),and_v(v:pk(cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW),after(200))})"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_single_sig_xprv() -> &'static str {
|
||||||
|
"tr(tprv8ZgxMBicQKsPdDArR4xSAECuVxeX1jwwSXR4ApKbkYgZiziDc4LdBy2WvJeGDfUSE4UT4hHhbgEwbdq8ajjUHiKDegkwrNU6V55CxcxonVN/*)"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_with_taptree_xprv() -> &'static str {
|
||||||
|
"tr(cNJmN3fH9DDbDt131fQNkVakkpzawJBSeybCUNmP1BovpmGQ45xG,{pk(tprv8ZgxMBicQKsPdDArR4xSAECuVxeX1jwwSXR4ApKbkYgZiziDc4LdBy2WvJeGDfUSE4UT4hHhbgEwbdq8ajjUHiKDegkwrNU6V55CxcxonVN/*),pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642)})"
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn get_test_tr_dup_keys() -> &'static str {
|
||||||
|
"tr(cNJmN3fH9DDbDt131fQNkVakkpzawJBSeybCUNmP1BovpmGQ45xG,{pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642),pk(8aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642)})"
|
||||||
|
}
|
||||||
192
crates/bdk/tests/psbt.rs
Normal file
192
crates/bdk/tests/psbt.rs
Normal file
@@ -0,0 +1,192 @@
|
|||||||
|
use bdk::bitcoin::TxIn;
|
||||||
|
use bdk::wallet::AddressIndex;
|
||||||
|
use bdk::wallet::AddressIndex::New;
|
||||||
|
use bdk::{psbt, FeeRate, SignOptions};
|
||||||
|
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
|
use core::str::FromStr;
|
||||||
|
mod common;
|
||||||
|
use common::*;
|
||||||
|
|
||||||
|
// from bip 174
|
||||||
|
const PSBT_STR: &str = "cHNidP8BAKACAAAAAqsJSaCMWvfEm4IS9Bfi8Vqz9cM9zxU4IagTn4d6W3vkAAAAAAD+////qwlJoIxa98SbghL0F+LxWrP1wz3PFTghqBOfh3pbe+QBAAAAAP7///8CYDvqCwAAAAAZdqkUdopAu9dAy+gdmI5x3ipNXHE5ax2IrI4kAAAAAAAAGXapFG9GILVT+glechue4O/p+gOcykWXiKwAAAAAAAEHakcwRAIgR1lmF5fAGwNrJZKJSGhiGDR9iYZLcZ4ff89X0eURZYcCIFMJ6r9Wqk2Ikf/REf3xM286KdqGbX+EhtdVRs7tr5MZASEDXNxh/HupccC1AaZGoqg7ECy0OIEhfKaC3Ibi1z+ogpIAAQEgAOH1BQAAAAAXqRQ1RebjO4MsRwUPJNPuuTycA5SLx4cBBBYAFIXRNTfy4mVAWjTbr6nj3aAfuCMIAAAA";
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[should_panic(expected = "InputIndexOutOfRange")]
|
||||||
|
fn test_psbt_malformed_psbt_input_legacy() {
|
||||||
|
let psbt_bip = Psbt::from_str(PSBT_STR).unwrap();
|
||||||
|
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||||
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||||
|
let options = SignOptions {
|
||||||
|
trust_witness_utxo: true,
|
||||||
|
..Default::default()
|
||||||
|
};
|
||||||
|
let _ = wallet.sign(&mut psbt, options).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[should_panic(expected = "InputIndexOutOfRange")]
|
||||||
|
fn test_psbt_malformed_psbt_input_segwit() {
|
||||||
|
let psbt_bip = Psbt::from_str(PSBT_STR).unwrap();
|
||||||
|
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||||
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
psbt.inputs.push(psbt_bip.inputs[1].clone());
|
||||||
|
let options = SignOptions {
|
||||||
|
trust_witness_utxo: true,
|
||||||
|
..Default::default()
|
||||||
|
};
|
||||||
|
let _ = wallet.sign(&mut psbt, options).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[should_panic(expected = "InputIndexOutOfRange")]
|
||||||
|
fn test_psbt_malformed_tx_input() {
|
||||||
|
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||||
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
psbt.unsigned_tx.input.push(TxIn::default());
|
||||||
|
let options = SignOptions {
|
||||||
|
trust_witness_utxo: true,
|
||||||
|
..Default::default()
|
||||||
|
};
|
||||||
|
let _ = wallet.sign(&mut psbt, options).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_sign_with_finalized() {
|
||||||
|
let psbt_bip = Psbt::from_str(PSBT_STR).unwrap();
|
||||||
|
let (mut wallet, _) = get_funded_wallet(get_test_wpkh());
|
||||||
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
|
||||||
|
// add a finalized input
|
||||||
|
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||||
|
psbt.unsigned_tx
|
||||||
|
.input
|
||||||
|
.push(psbt_bip.unsigned_tx.input[0].clone());
|
||||||
|
|
||||||
|
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_fee_rate_with_witness_utxo() {
|
||||||
|
use psbt::PsbtUtils;
|
||||||
|
|
||||||
|
let expected_fee_rate = 1.2345;
|
||||||
|
|
||||||
|
let (mut wallet, _) = get_funded_wallet("wpkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = wallet.get_address(New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
let fee_amount = psbt.fee_amount();
|
||||||
|
assert!(fee_amount.is_some());
|
||||||
|
|
||||||
|
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
|
||||||
|
let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let finalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() >= expected_fee_rate);
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() < unfinalized_fee_rate.as_sat_per_vb());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_fee_rate_with_nonwitness_utxo() {
|
||||||
|
use psbt::PsbtUtils;
|
||||||
|
|
||||||
|
let expected_fee_rate = 1.2345;
|
||||||
|
|
||||||
|
let (mut wallet, _) = get_funded_wallet("pkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = wallet.get_address(New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
let fee_amount = psbt.fee_amount();
|
||||||
|
assert!(fee_amount.is_some());
|
||||||
|
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
|
||||||
|
let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let finalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() >= expected_fee_rate);
|
||||||
|
assert!(finalized_fee_rate.as_sat_per_vb() < unfinalized_fee_rate.as_sat_per_vb());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_fee_rate_with_missing_txout() {
|
||||||
|
use psbt::PsbtUtils;
|
||||||
|
|
||||||
|
let expected_fee_rate = 1.2345;
|
||||||
|
|
||||||
|
let (mut wpkh_wallet, _) = get_funded_wallet("wpkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = wpkh_wallet.get_address(New);
|
||||||
|
let mut builder = wpkh_wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let mut wpkh_psbt = builder.finish().unwrap();
|
||||||
|
|
||||||
|
wpkh_psbt.inputs[0].witness_utxo = None;
|
||||||
|
wpkh_psbt.inputs[0].non_witness_utxo = None;
|
||||||
|
assert!(wpkh_psbt.fee_amount().is_none());
|
||||||
|
assert!(wpkh_psbt.fee_rate().is_none());
|
||||||
|
|
||||||
|
let (mut pkh_wallet, _) = get_funded_wallet("pkh(tprv8ZgxMBicQKsPd3EupYiPRhaMooHKUHJxNsTfYuScep13go8QFfHdtkG9nRkFGb7busX4isf6X9dURGCoKgitaApQ6MupRhZMcELAxTBRJgS/*)");
|
||||||
|
let addr = pkh_wallet.get_address(New);
|
||||||
|
let mut builder = pkh_wallet.build_tx();
|
||||||
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
|
let mut pkh_psbt = builder.finish().unwrap();
|
||||||
|
|
||||||
|
pkh_psbt.inputs[0].non_witness_utxo = None;
|
||||||
|
assert!(pkh_psbt.fee_amount().is_none());
|
||||||
|
assert!(pkh_psbt.fee_rate().is_none());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_multiple_internalkey_signers() {
|
||||||
|
use bdk::signer::{SignerContext, SignerOrdering, SignerWrapper};
|
||||||
|
use bdk::KeychainKind;
|
||||||
|
use bitcoin::{secp256k1::Secp256k1, PrivateKey};
|
||||||
|
use miniscript::psbt::PsbtExt;
|
||||||
|
use std::sync::Arc;
|
||||||
|
|
||||||
|
let secp = Secp256k1::new();
|
||||||
|
let (mut wallet, _) = get_funded_wallet(get_test_tr_single_sig());
|
||||||
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
// Adds a signer for the wrong internal key, bdk should not use this key to sign
|
||||||
|
wallet.add_signer(
|
||||||
|
KeychainKind::External,
|
||||||
|
// A signerordering lower than 100, bdk will use this signer first
|
||||||
|
SignerOrdering(0),
|
||||||
|
Arc::new(SignerWrapper::new(
|
||||||
|
PrivateKey::from_wif("5J5PZqvCe1uThJ3FZeUUFLCh2FuK9pZhtEK4MzhNmugqTmxCdwE").unwrap(),
|
||||||
|
SignerContext::Tap {
|
||||||
|
is_internal_key: true,
|
||||||
|
},
|
||||||
|
)),
|
||||||
|
);
|
||||||
|
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||||
|
// Checks that we signed using the right key
|
||||||
|
assert!(
|
||||||
|
psbt.finalize_mut(&secp).is_ok(),
|
||||||
|
"The wrong internal key was used"
|
||||||
|
);
|
||||||
|
}
|
||||||
3678
crates/bdk/tests/wallet.rs
Normal file
3678
crates/bdk/tests/wallet.rs
Normal file
File diff suppressed because it is too large
Load Diff
28
crates/bitcoind_rpc/Cargo.toml
Normal file
28
crates/bitcoind_rpc/Cargo.toml
Normal file
@@ -0,0 +1,28 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_bitcoind_rpc"
|
||||||
|
version = "0.4.0"
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.63"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk_bitcoind_rpc"
|
||||||
|
description = "This crate is used for emitting blockchain data from the `bitcoind` RPC interface."
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
# For no-std, remember to enable the bitcoin/no-std feature
|
||||||
|
bitcoin = { version = "0.30", default-features = false }
|
||||||
|
bitcoincore-rpc = { version = "0.17" }
|
||||||
|
bdk_chain = { path = "../chain", version = "0.9", default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
bitcoind = { version = "0.33", features = ["25_0"] }
|
||||||
|
anyhow = { version = "1" }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
default = ["std"]
|
||||||
|
std = ["bitcoin/std", "bdk_chain/std"]
|
||||||
|
serde = ["bitcoin/serde", "bdk_chain/serde"]
|
||||||
3
crates/bitcoind_rpc/README.md
Normal file
3
crates/bitcoind_rpc/README.md
Normal file
@@ -0,0 +1,3 @@
|
|||||||
|
# BDK Bitcoind RPC
|
||||||
|
|
||||||
|
This crate is used for emitting blockchain data from the `bitcoind` RPC interface.
|
||||||
328
crates/bitcoind_rpc/src/lib.rs
Normal file
328
crates/bitcoind_rpc/src/lib.rs
Normal file
@@ -0,0 +1,328 @@
|
|||||||
|
//! This crate is used for emitting blockchain data from the `bitcoind` RPC interface. It does not
|
||||||
|
//! use the wallet RPC API, so this crate can be used with wallet-disabled Bitcoin Core nodes.
|
||||||
|
//!
|
||||||
|
//! [`Emitter`] is the main structure which sources blockchain data from [`bitcoincore_rpc::Client`].
|
||||||
|
//!
|
||||||
|
//! To only get block updates (exclude mempool transactions), the caller can use
|
||||||
|
//! [`Emitter::next_block`] or/and [`Emitter::next_header`] until it returns `Ok(None)` (which means
|
||||||
|
//! the chain tip is reached). A separate method, [`Emitter::mempool`] can be used to emit the whole
|
||||||
|
//! mempool.
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
|
use bdk_chain::{local_chain::CheckPoint, BlockId};
|
||||||
|
use bitcoin::{block::Header, Block, BlockHash, Transaction};
|
||||||
|
pub use bitcoincore_rpc;
|
||||||
|
use bitcoincore_rpc::bitcoincore_rpc_json;
|
||||||
|
|
||||||
|
/// The [`Emitter`] is used to emit data sourced from [`bitcoincore_rpc::Client`].
|
||||||
|
///
|
||||||
|
/// Refer to [module-level documentation] for more.
|
||||||
|
///
|
||||||
|
/// [module-level documentation]: crate
|
||||||
|
pub struct Emitter<'c, C> {
|
||||||
|
client: &'c C,
|
||||||
|
start_height: u32,
|
||||||
|
|
||||||
|
/// The checkpoint of the last-emitted block that is in the best chain. If it is later found
|
||||||
|
/// that the block is no longer in the best chain, it will be popped off from here.
|
||||||
|
last_cp: CheckPoint,
|
||||||
|
|
||||||
|
/// The block result returned from rpc of the last-emitted block. As this result contains the
|
||||||
|
/// next block's block hash (which we use to fetch the next block), we set this to `None`
|
||||||
|
/// whenever there are no more blocks, or the next block is no longer in the best chain. This
|
||||||
|
/// gives us an opportunity to re-fetch this result.
|
||||||
|
last_block: Option<bitcoincore_rpc_json::GetBlockResult>,
|
||||||
|
|
||||||
|
/// The latest first-seen epoch of emitted mempool transactions. This is used to determine
|
||||||
|
/// whether a mempool transaction is already emitted.
|
||||||
|
last_mempool_time: usize,
|
||||||
|
|
||||||
|
/// The last emitted block during our last mempool emission. This is used to determine whether
|
||||||
|
/// there has been a reorg since our last mempool emission.
|
||||||
|
last_mempool_tip: Option<u32>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'c, C: bitcoincore_rpc::RpcApi> Emitter<'c, C> {
|
||||||
|
/// Construct a new [`Emitter`].
|
||||||
|
///
|
||||||
|
/// `last_cp` informs the emitter of the chain we are starting off with. This way, the emitter
|
||||||
|
/// can start emission from a block that connects to the original chain.
|
||||||
|
///
|
||||||
|
/// `start_height` starts emission from a given height (if there are no conflicts with the
|
||||||
|
/// original chain).
|
||||||
|
pub fn new(client: &'c C, last_cp: CheckPoint, start_height: u32) -> Self {
|
||||||
|
Self {
|
||||||
|
client,
|
||||||
|
start_height,
|
||||||
|
last_cp,
|
||||||
|
last_block: None,
|
||||||
|
last_mempool_time: 0,
|
||||||
|
last_mempool_tip: None,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Emit mempool transactions, alongside their first-seen unix timestamps.
|
||||||
|
///
|
||||||
|
/// This method emits each transaction only once, unless we cannot guarantee the transaction's
|
||||||
|
/// ancestors are already emitted.
|
||||||
|
///
|
||||||
|
/// To understand why, consider a receiver which filters transactions based on whether it
|
||||||
|
/// alters the UTXO set of tracked script pubkeys. If an emitted mempool transaction spends a
|
||||||
|
/// tracked UTXO which is confirmed at height `h`, but the receiver has only seen up to block
|
||||||
|
/// of height `h-1`, we want to re-emit this transaction until the receiver has seen the block
|
||||||
|
/// at height `h`.
|
||||||
|
pub fn mempool(&mut self) -> Result<Vec<(Transaction, u64)>, bitcoincore_rpc::Error> {
|
||||||
|
let client = self.client;
|
||||||
|
|
||||||
|
// This is the emitted tip height during the last mempool emission.
|
||||||
|
let prev_mempool_tip = self
|
||||||
|
.last_mempool_tip
|
||||||
|
// We use `start_height - 1` as we cannot guarantee that the block at
|
||||||
|
// `start_height` has been emitted.
|
||||||
|
.unwrap_or(self.start_height.saturating_sub(1));
|
||||||
|
|
||||||
|
// Mempool txs come with a timestamp of when the tx is introduced to the mempool. We keep
|
||||||
|
// track of the latest mempool tx's timestamp to determine whether we have seen a tx
|
||||||
|
// before. `prev_mempool_time` is the previous timestamp and `last_time` records what will
|
||||||
|
// be the new latest timestamp.
|
||||||
|
let prev_mempool_time = self.last_mempool_time;
|
||||||
|
let mut latest_time = prev_mempool_time;
|
||||||
|
|
||||||
|
let txs_to_emit = client
|
||||||
|
.get_raw_mempool_verbose()?
|
||||||
|
.into_iter()
|
||||||
|
.filter_map({
|
||||||
|
let latest_time = &mut latest_time;
|
||||||
|
move |(txid, tx_entry)| -> Option<Result<_, bitcoincore_rpc::Error>> {
|
||||||
|
let tx_time = tx_entry.time as usize;
|
||||||
|
if tx_time > *latest_time {
|
||||||
|
*latest_time = tx_time;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Avoid emitting transactions that are already emitted if we can guarantee
|
||||||
|
// blocks containing ancestors are already emitted. The bitcoind rpc interface
|
||||||
|
// provides us with the block height that the tx is introduced to the mempool.
|
||||||
|
// If we have already emitted the block of height, we can assume that all
|
||||||
|
// ancestor txs have been processed by the receiver.
|
||||||
|
let is_already_emitted = tx_time <= prev_mempool_time;
|
||||||
|
let is_within_height = tx_entry.height <= prev_mempool_tip as _;
|
||||||
|
if is_already_emitted && is_within_height {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
let tx = match client.get_raw_transaction(&txid, None) {
|
||||||
|
Ok(tx) => tx,
|
||||||
|
// the tx is confirmed or evicted since `get_raw_mempool_verbose`
|
||||||
|
Err(err) if err.is_not_found_error() => return None,
|
||||||
|
Err(err) => return Some(Err(err)),
|
||||||
|
};
|
||||||
|
|
||||||
|
Some(Ok((tx, tx_time as u64)))
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
|
||||||
|
self.last_mempool_time = latest_time;
|
||||||
|
self.last_mempool_tip = Some(self.last_cp.height());
|
||||||
|
|
||||||
|
Ok(txs_to_emit)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Emit the next block height and header (if any).
|
||||||
|
pub fn next_header(&mut self) -> Result<Option<BlockEvent<Header>>, bitcoincore_rpc::Error> {
|
||||||
|
Ok(poll(self, |hash| self.client.get_block_header(hash))?
|
||||||
|
.map(|(checkpoint, block)| BlockEvent { block, checkpoint }))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Emit the next block height and block (if any).
|
||||||
|
pub fn next_block(&mut self) -> Result<Option<BlockEvent<Block>>, bitcoincore_rpc::Error> {
|
||||||
|
Ok(poll(self, |hash| self.client.get_block(hash))?
|
||||||
|
.map(|(checkpoint, block)| BlockEvent { block, checkpoint }))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A newly emitted block from [`Emitter`].
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct BlockEvent<B> {
|
||||||
|
/// Either a full [`Block`] or [`Header`] of the new block.
|
||||||
|
pub block: B,
|
||||||
|
|
||||||
|
/// The checkpoint of the new block.
|
||||||
|
///
|
||||||
|
/// A [`CheckPoint`] is a node of a linked list of [`BlockId`]s. This checkpoint is linked to
|
||||||
|
/// all [`BlockId`]s originally passed in [`Emitter::new`] as well as emitted blocks since then.
|
||||||
|
/// These blocks are guaranteed to be of the same chain.
|
||||||
|
///
|
||||||
|
/// This is important as BDK structures require block-to-apply to be connected with another
|
||||||
|
/// block in the original chain.
|
||||||
|
pub checkpoint: CheckPoint,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<B> BlockEvent<B> {
|
||||||
|
/// The block height of this new block.
|
||||||
|
pub fn block_height(&self) -> u32 {
|
||||||
|
self.checkpoint.height()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The block hash of this new block.
|
||||||
|
pub fn block_hash(&self) -> BlockHash {
|
||||||
|
self.checkpoint.hash()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The [`BlockId`] of a previous block that this block connects to.
|
||||||
|
///
|
||||||
|
/// This either returns a [`BlockId`] of a previously emitted block or from the chain we started
|
||||||
|
/// with (passed in as `last_cp` in [`Emitter::new`]).
|
||||||
|
///
|
||||||
|
/// This value is derived from [`BlockEvent::checkpoint`].
|
||||||
|
pub fn connected_to(&self) -> BlockId {
|
||||||
|
match self.checkpoint.prev() {
|
||||||
|
Some(prev_cp) => prev_cp.block_id(),
|
||||||
|
// there is no previous checkpoint, so just connect with itself
|
||||||
|
None => self.checkpoint.block_id(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
enum PollResponse {
|
||||||
|
Block(bitcoincore_rpc_json::GetBlockResult),
|
||||||
|
NoMoreBlocks,
|
||||||
|
/// Fetched block is not in the best chain.
|
||||||
|
BlockNotInBestChain,
|
||||||
|
AgreementFound(bitcoincore_rpc_json::GetBlockResult, CheckPoint),
|
||||||
|
/// Force the genesis checkpoint down the receiver's throat.
|
||||||
|
AgreementPointNotFound(BlockHash),
|
||||||
|
}
|
||||||
|
|
||||||
|
fn poll_once<C>(emitter: &Emitter<C>) -> Result<PollResponse, bitcoincore_rpc::Error>
|
||||||
|
where
|
||||||
|
C: bitcoincore_rpc::RpcApi,
|
||||||
|
{
|
||||||
|
let client = emitter.client;
|
||||||
|
|
||||||
|
if let Some(last_res) = &emitter.last_block {
|
||||||
|
let next_hash = if last_res.height < emitter.start_height as _ {
|
||||||
|
// enforce start height
|
||||||
|
let next_hash = client.get_block_hash(emitter.start_height as _)?;
|
||||||
|
// make sure last emission is still in best chain
|
||||||
|
if client.get_block_hash(last_res.height as _)? != last_res.hash {
|
||||||
|
return Ok(PollResponse::BlockNotInBestChain);
|
||||||
|
}
|
||||||
|
next_hash
|
||||||
|
} else {
|
||||||
|
match last_res.nextblockhash {
|
||||||
|
None => return Ok(PollResponse::NoMoreBlocks),
|
||||||
|
Some(next_hash) => next_hash,
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let res = client.get_block_info(&next_hash)?;
|
||||||
|
if res.confirmations < 0 {
|
||||||
|
return Ok(PollResponse::BlockNotInBestChain);
|
||||||
|
}
|
||||||
|
|
||||||
|
return Ok(PollResponse::Block(res));
|
||||||
|
}
|
||||||
|
|
||||||
|
for cp in emitter.last_cp.iter() {
|
||||||
|
let res = match client.get_block_info(&cp.hash()) {
|
||||||
|
// block not in best chain
|
||||||
|
Ok(res) if res.confirmations < 0 => continue,
|
||||||
|
Ok(res) => res,
|
||||||
|
Err(e) if e.is_not_found_error() => {
|
||||||
|
if cp.height() > 0 {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// if we can't find genesis block, we can't create an update that connects
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
Err(e) => return Err(e),
|
||||||
|
};
|
||||||
|
|
||||||
|
// agreement point found
|
||||||
|
return Ok(PollResponse::AgreementFound(res, cp));
|
||||||
|
}
|
||||||
|
|
||||||
|
let genesis_hash = client.get_block_hash(0)?;
|
||||||
|
Ok(PollResponse::AgreementPointNotFound(genesis_hash))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn poll<C, V, F>(
|
||||||
|
emitter: &mut Emitter<C>,
|
||||||
|
get_item: F,
|
||||||
|
) -> Result<Option<(CheckPoint, V)>, bitcoincore_rpc::Error>
|
||||||
|
where
|
||||||
|
C: bitcoincore_rpc::RpcApi,
|
||||||
|
F: Fn(&BlockHash) -> Result<V, bitcoincore_rpc::Error>,
|
||||||
|
{
|
||||||
|
loop {
|
||||||
|
match poll_once(emitter)? {
|
||||||
|
PollResponse::Block(res) => {
|
||||||
|
let height = res.height as u32;
|
||||||
|
let hash = res.hash;
|
||||||
|
let item = get_item(&hash)?;
|
||||||
|
|
||||||
|
let new_cp = emitter
|
||||||
|
.last_cp
|
||||||
|
.clone()
|
||||||
|
.push(BlockId { height, hash })
|
||||||
|
.expect("must push");
|
||||||
|
emitter.last_cp = new_cp.clone();
|
||||||
|
emitter.last_block = Some(res);
|
||||||
|
return Ok(Some((new_cp, item)));
|
||||||
|
}
|
||||||
|
PollResponse::NoMoreBlocks => {
|
||||||
|
emitter.last_block = None;
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
PollResponse::BlockNotInBestChain => {
|
||||||
|
emitter.last_block = None;
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
PollResponse::AgreementFound(res, cp) => {
|
||||||
|
let agreement_h = res.height as u32;
|
||||||
|
|
||||||
|
// The tip during the last mempool emission needs to in the best chain, we reduce
|
||||||
|
// it if it is not.
|
||||||
|
if let Some(h) = emitter.last_mempool_tip.as_mut() {
|
||||||
|
if *h > agreement_h {
|
||||||
|
*h = agreement_h;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// get rid of evicted blocks
|
||||||
|
emitter.last_cp = cp;
|
||||||
|
emitter.last_block = Some(res);
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
PollResponse::AgreementPointNotFound(genesis_hash) => {
|
||||||
|
emitter.last_cp = CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: genesis_hash,
|
||||||
|
});
|
||||||
|
emitter.last_block = None;
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Extends [`bitcoincore_rpc::Error`].
|
||||||
|
pub trait BitcoindRpcErrorExt {
|
||||||
|
/// Returns whether the error is a "not found" error.
|
||||||
|
///
|
||||||
|
/// This is useful since [`Emitter`] emits [`Result<_, bitcoincore_rpc::Error>`]s as
|
||||||
|
/// [`Iterator::Item`].
|
||||||
|
fn is_not_found_error(&self) -> bool;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl BitcoindRpcErrorExt for bitcoincore_rpc::Error {
|
||||||
|
fn is_not_found_error(&self) -> bool {
|
||||||
|
if let bitcoincore_rpc::Error::JsonRpc(bitcoincore_rpc::jsonrpc::Error::Rpc(rpc_err)) = self
|
||||||
|
{
|
||||||
|
rpc_err.code == -5
|
||||||
|
} else {
|
||||||
|
false
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
864
crates/bitcoind_rpc/tests/test_emitter.rs
Normal file
864
crates/bitcoind_rpc/tests/test_emitter.rs
Normal file
@@ -0,0 +1,864 @@
|
|||||||
|
use std::collections::{BTreeMap, BTreeSet};
|
||||||
|
|
||||||
|
use bdk_bitcoind_rpc::Emitter;
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{Address, Amount, BlockHash, Txid},
|
||||||
|
keychain::Balance,
|
||||||
|
local_chain::{self, CheckPoint, LocalChain},
|
||||||
|
Append, BlockId, IndexedTxGraph, SpkTxOutIndex,
|
||||||
|
};
|
||||||
|
use bitcoin::{
|
||||||
|
address::NetworkChecked, block::Header, hash_types::TxMerkleNode, hashes::Hash,
|
||||||
|
secp256k1::rand::random, Block, CompactTarget, OutPoint, ScriptBuf, ScriptHash, Transaction,
|
||||||
|
TxIn, TxOut, WScriptHash,
|
||||||
|
};
|
||||||
|
use bitcoincore_rpc::{
|
||||||
|
bitcoincore_rpc_json::{GetBlockTemplateModes, GetBlockTemplateRules},
|
||||||
|
RpcApi,
|
||||||
|
};
|
||||||
|
|
||||||
|
struct TestEnv {
|
||||||
|
#[allow(dead_code)]
|
||||||
|
daemon: bitcoind::BitcoinD,
|
||||||
|
client: bitcoincore_rpc::Client,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestEnv {
|
||||||
|
fn new() -> anyhow::Result<Self> {
|
||||||
|
let daemon = match std::env::var_os("TEST_BITCOIND") {
|
||||||
|
Some(bitcoind_path) => bitcoind::BitcoinD::new(bitcoind_path),
|
||||||
|
None => bitcoind::BitcoinD::from_downloaded(),
|
||||||
|
}?;
|
||||||
|
let client = bitcoincore_rpc::Client::new(
|
||||||
|
&daemon.rpc_url(),
|
||||||
|
bitcoincore_rpc::Auth::CookieFile(daemon.params.cookie_file.clone()),
|
||||||
|
)?;
|
||||||
|
Ok(Self { daemon, client })
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_blocks(
|
||||||
|
&self,
|
||||||
|
count: usize,
|
||||||
|
address: Option<Address>,
|
||||||
|
) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let coinbase_address = match address {
|
||||||
|
Some(address) => address,
|
||||||
|
None => self.client.get_new_address(None, None)?.assume_checked(),
|
||||||
|
};
|
||||||
|
let block_hashes = self
|
||||||
|
.client
|
||||||
|
.generate_to_address(count as _, &coinbase_address)?;
|
||||||
|
Ok(block_hashes)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_empty_block(&self) -> anyhow::Result<(usize, BlockHash)> {
|
||||||
|
let bt = self.client.get_block_template(
|
||||||
|
GetBlockTemplateModes::Template,
|
||||||
|
&[GetBlockTemplateRules::SegWit],
|
||||||
|
&[],
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let txdata = vec![Transaction {
|
||||||
|
version: 1,
|
||||||
|
lock_time: bitcoin::absolute::LockTime::from_height(0)?,
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: bitcoin::OutPoint::default(),
|
||||||
|
script_sig: ScriptBuf::builder()
|
||||||
|
.push_int(bt.height as _)
|
||||||
|
// randomn number so that re-mining creates unique block
|
||||||
|
.push_int(random())
|
||||||
|
.into_script(),
|
||||||
|
sequence: bitcoin::Sequence::default(),
|
||||||
|
witness: bitcoin::Witness::new(),
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 0,
|
||||||
|
script_pubkey: ScriptBuf::new_p2sh(&ScriptHash::all_zeros()),
|
||||||
|
}],
|
||||||
|
}];
|
||||||
|
|
||||||
|
let bits: [u8; 4] = bt
|
||||||
|
.bits
|
||||||
|
.clone()
|
||||||
|
.try_into()
|
||||||
|
.expect("rpc provided us with invalid bits");
|
||||||
|
|
||||||
|
let mut block = Block {
|
||||||
|
header: Header {
|
||||||
|
version: bitcoin::block::Version::default(),
|
||||||
|
prev_blockhash: bt.previous_block_hash,
|
||||||
|
merkle_root: TxMerkleNode::all_zeros(),
|
||||||
|
time: Ord::max(bt.min_time, std::time::UNIX_EPOCH.elapsed()?.as_secs()) as u32,
|
||||||
|
bits: CompactTarget::from_consensus(u32::from_be_bytes(bits)),
|
||||||
|
nonce: 0,
|
||||||
|
},
|
||||||
|
txdata,
|
||||||
|
};
|
||||||
|
|
||||||
|
block.header.merkle_root = block.compute_merkle_root().expect("must compute");
|
||||||
|
|
||||||
|
for nonce in 0..=u32::MAX {
|
||||||
|
block.header.nonce = nonce;
|
||||||
|
if block.header.target().is_met_by(block.block_hash()) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
self.client.submit_block(&block)?;
|
||||||
|
Ok((bt.height as usize, block.block_hash()))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn invalidate_blocks(&self, count: usize) -> anyhow::Result<()> {
|
||||||
|
let mut hash = self.client.get_best_block_hash()?;
|
||||||
|
for _ in 0..count {
|
||||||
|
let prev_hash = self.client.get_block_info(&hash)?.previousblockhash;
|
||||||
|
self.client.invalidate_block(&hash)?;
|
||||||
|
match prev_hash {
|
||||||
|
Some(prev_hash) => hash = prev_hash,
|
||||||
|
None => break,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn reorg(&self, count: usize) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let start_height = self.client.get_block_count()?;
|
||||||
|
self.invalidate_blocks(count)?;
|
||||||
|
|
||||||
|
let res = self.mine_blocks(count, None);
|
||||||
|
assert_eq!(
|
||||||
|
self.client.get_block_count()?,
|
||||||
|
start_height,
|
||||||
|
"reorg should not result in height change"
|
||||||
|
);
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
fn reorg_empty_blocks(&self, count: usize) -> anyhow::Result<Vec<(usize, BlockHash)>> {
|
||||||
|
let start_height = self.client.get_block_count()?;
|
||||||
|
self.invalidate_blocks(count)?;
|
||||||
|
|
||||||
|
let res = (0..count)
|
||||||
|
.map(|_| self.mine_empty_block())
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
assert_eq!(
|
||||||
|
self.client.get_block_count()?,
|
||||||
|
start_height,
|
||||||
|
"reorg should not result in height change"
|
||||||
|
);
|
||||||
|
Ok(res)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn send(&self, address: &Address<NetworkChecked>, amount: Amount) -> anyhow::Result<Txid> {
|
||||||
|
let txid = self
|
||||||
|
.client
|
||||||
|
.send_to_address(address, amount, None, None, None, None, None, None)?;
|
||||||
|
Ok(txid)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure that blocks are emitted in order even after reorg.
|
||||||
|
///
|
||||||
|
/// 1. Mine 101 blocks.
|
||||||
|
/// 2. Emit blocks from [`Emitter`] and update the [`LocalChain`].
|
||||||
|
/// 3. Reorg highest 6 blocks.
|
||||||
|
/// 4. Emit blocks from [`Emitter`] and re-update the [`LocalChain`].
|
||||||
|
#[test]
|
||||||
|
pub fn test_sync_local_chain() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let (mut local_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||||
|
let mut emitter = Emitter::new(&env.client, local_chain.tip(), 0);
|
||||||
|
|
||||||
|
// mine some blocks and returned the actual block hashes
|
||||||
|
let exp_hashes = {
|
||||||
|
let mut hashes = vec![env.client.get_block_hash(0)?]; // include genesis block
|
||||||
|
hashes.extend(env.mine_blocks(101, None)?);
|
||||||
|
hashes
|
||||||
|
};
|
||||||
|
|
||||||
|
// see if the emitter outputs the right blocks
|
||||||
|
println!("first sync:");
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
let hash = emission.block_hash();
|
||||||
|
assert_eq!(
|
||||||
|
emission.block_hash(),
|
||||||
|
exp_hashes[height as usize],
|
||||||
|
"emitted block hash is unexpected"
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?,
|
||||||
|
BTreeMap::from([(height, Some(hash))]),
|
||||||
|
"chain update changeset is unexpected",
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.blocks(),
|
||||||
|
&exp_hashes
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, hash)| (i as u32, *hash))
|
||||||
|
.collect(),
|
||||||
|
"final local_chain state is unexpected",
|
||||||
|
);
|
||||||
|
|
||||||
|
// perform reorg
|
||||||
|
let reorged_blocks = env.reorg(6)?;
|
||||||
|
let exp_hashes = exp_hashes
|
||||||
|
.iter()
|
||||||
|
.take(exp_hashes.len() - reorged_blocks.len())
|
||||||
|
.chain(&reorged_blocks)
|
||||||
|
.cloned()
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
// see if the emitter outputs the right blocks
|
||||||
|
println!("after reorg:");
|
||||||
|
let mut exp_height = exp_hashes.len() - reorged_blocks.len();
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
let hash = emission.block_hash();
|
||||||
|
assert_eq!(
|
||||||
|
height, exp_height as u32,
|
||||||
|
"emitted block has unexpected height"
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
hash, exp_hashes[height as usize],
|
||||||
|
"emitted block is unexpected"
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?,
|
||||||
|
if exp_height == exp_hashes.len() - reorged_blocks.len() {
|
||||||
|
core::iter::once((height, Some(hash)))
|
||||||
|
.chain((height + 1..exp_hashes.len() as u32).map(|h| (h, None)))
|
||||||
|
.collect::<bdk_chain::local_chain::ChangeSet>()
|
||||||
|
} else {
|
||||||
|
BTreeMap::from([(height, Some(hash))])
|
||||||
|
},
|
||||||
|
"chain update changeset is unexpected",
|
||||||
|
);
|
||||||
|
|
||||||
|
exp_height += 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.blocks(),
|
||||||
|
&exp_hashes
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, hash)| (i as u32, *hash))
|
||||||
|
.collect(),
|
||||||
|
"final local_chain state is unexpected after reorg",
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure that [`EmittedUpdate::into_tx_graph_update`] behaves appropriately for both mempool and
|
||||||
|
/// block updates.
|
||||||
|
///
|
||||||
|
/// [`EmittedUpdate::into_tx_graph_update`]: bdk_bitcoind_rpc::EmittedUpdate::into_tx_graph_update
|
||||||
|
#[test]
|
||||||
|
fn test_into_tx_graph() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
|
||||||
|
println!("getting new addresses!");
|
||||||
|
let addr_0 = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
let addr_1 = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
let addr_2 = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
println!("got new addresses!");
|
||||||
|
|
||||||
|
println!("mining block!");
|
||||||
|
env.mine_blocks(101, None)?;
|
||||||
|
println!("mined blocks!");
|
||||||
|
|
||||||
|
let (mut chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||||
|
let mut indexed_tx_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||||
|
let mut index = SpkTxOutIndex::<usize>::default();
|
||||||
|
index.insert_spk(0, addr_0.script_pubkey());
|
||||||
|
index.insert_spk(1, addr_1.script_pubkey());
|
||||||
|
index.insert_spk(2, addr_2.script_pubkey());
|
||||||
|
index
|
||||||
|
});
|
||||||
|
|
||||||
|
let emitter = &mut Emitter::new(&env.client, chain.tip(), 0);
|
||||||
|
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
let _ = chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?;
|
||||||
|
let indexed_additions = indexed_tx_graph.apply_block_relevant(&emission.block, height);
|
||||||
|
assert!(indexed_additions.is_empty());
|
||||||
|
}
|
||||||
|
|
||||||
|
// send 3 txs to a tracked address, these txs will be in the mempool
|
||||||
|
let exp_txids = {
|
||||||
|
let mut txids = BTreeSet::new();
|
||||||
|
for _ in 0..3 {
|
||||||
|
txids.insert(env.client.send_to_address(
|
||||||
|
&addr_0,
|
||||||
|
Amount::from_sat(10_000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
)?);
|
||||||
|
}
|
||||||
|
txids
|
||||||
|
};
|
||||||
|
|
||||||
|
// expect that the next block should be none and we should get 3 txs from mempool
|
||||||
|
{
|
||||||
|
// next block should be `None`
|
||||||
|
assert!(emitter.next_block()?.is_none());
|
||||||
|
|
||||||
|
let mempool_txs = emitter.mempool()?;
|
||||||
|
let indexed_additions = indexed_tx_graph.batch_insert_unconfirmed(mempool_txs);
|
||||||
|
assert_eq!(
|
||||||
|
indexed_additions
|
||||||
|
.graph
|
||||||
|
.txs
|
||||||
|
.iter()
|
||||||
|
.map(|tx| tx.txid())
|
||||||
|
.collect::<BTreeSet<Txid>>(),
|
||||||
|
exp_txids,
|
||||||
|
"changeset should have the 3 mempool transactions",
|
||||||
|
);
|
||||||
|
assert!(indexed_additions.graph.anchors.is_empty());
|
||||||
|
}
|
||||||
|
|
||||||
|
// mine a block that confirms the 3 txs
|
||||||
|
let exp_block_hash = env.mine_blocks(1, None)?[0];
|
||||||
|
let exp_block_height = env.client.get_block_info(&exp_block_hash)?.height as u32;
|
||||||
|
let exp_anchors = exp_txids
|
||||||
|
.iter()
|
||||||
|
.map({
|
||||||
|
let anchor = BlockId {
|
||||||
|
height: exp_block_height,
|
||||||
|
hash: exp_block_hash,
|
||||||
|
};
|
||||||
|
move |&txid| (anchor, txid)
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
// must receive mined block which will confirm the transactions.
|
||||||
|
{
|
||||||
|
let emission = emitter.next_block()?.expect("must get mined block");
|
||||||
|
let height = emission.block_height();
|
||||||
|
let _ = chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?;
|
||||||
|
let indexed_additions = indexed_tx_graph.apply_block_relevant(&emission.block, height);
|
||||||
|
assert!(indexed_additions.graph.txs.is_empty());
|
||||||
|
assert!(indexed_additions.graph.txouts.is_empty());
|
||||||
|
assert_eq!(indexed_additions.graph.anchors, exp_anchors);
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure next block emitted after reorg is at reorg height.
|
||||||
|
///
|
||||||
|
/// After a reorg, if the last-emitted block height is equal or greater than the reorg height, and
|
||||||
|
/// the fallback height is equal to or lower than the reorg height, the next block/header emission
|
||||||
|
/// should be at the reorg height.
|
||||||
|
///
|
||||||
|
/// TODO: If the reorg height is lower than the fallback height, how do we find a block height to
|
||||||
|
/// emit that can connect with our receiver chain?
|
||||||
|
#[test]
|
||||||
|
fn ensure_block_emitted_after_reorg_is_at_reorg_height() -> anyhow::Result<()> {
|
||||||
|
const EMITTER_START_HEIGHT: usize = 100;
|
||||||
|
const CHAIN_TIP_HEIGHT: usize = 110;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
EMITTER_START_HEIGHT as _,
|
||||||
|
);
|
||||||
|
|
||||||
|
env.mine_blocks(CHAIN_TIP_HEIGHT, None)?;
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
|
||||||
|
for reorg_count in 1..=10 {
|
||||||
|
let replaced_blocks = env.reorg_empty_blocks(reorg_count)?;
|
||||||
|
let next_emission = emitter.next_header()?.expect("must emit block after reorg");
|
||||||
|
assert_eq!(
|
||||||
|
(
|
||||||
|
next_emission.block_height() as usize,
|
||||||
|
next_emission.block_hash()
|
||||||
|
),
|
||||||
|
replaced_blocks[0],
|
||||||
|
"block emitted after reorg should be at the reorg height"
|
||||||
|
);
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn process_block(
|
||||||
|
recv_chain: &mut LocalChain,
|
||||||
|
recv_graph: &mut IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||||
|
block: Block,
|
||||||
|
block_height: u32,
|
||||||
|
) -> anyhow::Result<()> {
|
||||||
|
recv_chain
|
||||||
|
.apply_update(CheckPoint::from_header(&block.header, block_height).into_update(false))?;
|
||||||
|
let _ = recv_graph.apply_block(block, block_height);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn sync_from_emitter<C>(
|
||||||
|
recv_chain: &mut LocalChain,
|
||||||
|
recv_graph: &mut IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||||
|
emitter: &mut Emitter<C>,
|
||||||
|
) -> anyhow::Result<()>
|
||||||
|
where
|
||||||
|
C: bitcoincore_rpc::RpcApi,
|
||||||
|
{
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
process_block(recv_chain, recv_graph, emission.block, height)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn get_balance(
|
||||||
|
recv_chain: &LocalChain,
|
||||||
|
recv_graph: &IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||||
|
) -> anyhow::Result<Balance> {
|
||||||
|
let chain_tip = recv_chain.tip().block_id();
|
||||||
|
let outpoints = recv_graph.index.outpoints().clone();
|
||||||
|
let balance = recv_graph
|
||||||
|
.graph()
|
||||||
|
.balance(recv_chain, chain_tip, outpoints, |_, _| true);
|
||||||
|
Ok(balance)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// If a block is reorged out, ensure that containing transactions that do not exist in the
|
||||||
|
/// replacement block(s) become unconfirmed.
|
||||||
|
#[test]
|
||||||
|
fn tx_can_become_unconfirmed_after_reorg() -> anyhow::Result<()> {
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
const ADDITIONAL_COUNT: usize = 11;
|
||||||
|
const SEND_AMOUNT: Amount = Amount::from_sat(10_000);
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// setup addresses
|
||||||
|
let addr_to_mine = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
let spk_to_track = ScriptBuf::new_v0_p2wsh(&WScriptHash::all_zeros());
|
||||||
|
let addr_to_track = Address::from_script(&spk_to_track, bitcoin::Network::Regtest)?;
|
||||||
|
|
||||||
|
// setup receiver
|
||||||
|
let (mut recv_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||||
|
let mut recv_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||||
|
let mut recv_index = SpkTxOutIndex::default();
|
||||||
|
recv_index.insert_spk((), spk_to_track.clone());
|
||||||
|
recv_index
|
||||||
|
});
|
||||||
|
|
||||||
|
// mine and sync receiver up to tip
|
||||||
|
env.mine_blocks(PREMINE_COUNT, Some(addr_to_mine))?;
|
||||||
|
|
||||||
|
// create transactions that are tracked by our receiver
|
||||||
|
for _ in 0..ADDITIONAL_COUNT {
|
||||||
|
let txid = env.send(&addr_to_track, SEND_AMOUNT)?;
|
||||||
|
|
||||||
|
// lock outputs that send to `addr_to_track`
|
||||||
|
let outpoints_to_lock = env
|
||||||
|
.client
|
||||||
|
.get_transaction(&txid, None)?
|
||||||
|
.transaction()?
|
||||||
|
.output
|
||||||
|
.into_iter()
|
||||||
|
.enumerate()
|
||||||
|
.filter(|(_, txo)| txo.script_pubkey == spk_to_track)
|
||||||
|
.map(|(vout, _)| OutPoint::new(txid, vout as _))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
env.client.lock_unspent(&outpoints_to_lock)?;
|
||||||
|
|
||||||
|
let _ = env.mine_blocks(1, None)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
// get emitter up to tip
|
||||||
|
sync_from_emitter(&mut recv_chain, &mut recv_graph, &mut emitter)?;
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
get_balance(&recv_chain, &recv_graph)?,
|
||||||
|
Balance {
|
||||||
|
confirmed: SEND_AMOUNT.to_sat() * ADDITIONAL_COUNT as u64,
|
||||||
|
..Balance::default()
|
||||||
|
},
|
||||||
|
"initial balance must be correct",
|
||||||
|
);
|
||||||
|
|
||||||
|
// perform reorgs with different depths
|
||||||
|
for reorg_count in 1..=ADDITIONAL_COUNT {
|
||||||
|
env.reorg_empty_blocks(reorg_count)?;
|
||||||
|
sync_from_emitter(&mut recv_chain, &mut recv_graph, &mut emitter)?;
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
get_balance(&recv_chain, &recv_graph)?,
|
||||||
|
Balance {
|
||||||
|
confirmed: SEND_AMOUNT.to_sat() * (ADDITIONAL_COUNT - reorg_count) as u64,
|
||||||
|
trusted_pending: SEND_AMOUNT.to_sat() * reorg_count as u64,
|
||||||
|
..Balance::default()
|
||||||
|
},
|
||||||
|
"reorg_count: {}",
|
||||||
|
reorg_count,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure avoid-re-emission-logic is sound when [`Emitter`] is synced to tip.
|
||||||
|
///
|
||||||
|
/// The receiver (bdk_chain structures) is synced to the chain tip, and there is txs in the mempool.
|
||||||
|
/// When we call Emitter::mempool multiple times, mempool txs should not be re-emitted, even if the
|
||||||
|
/// chain tip is extended.
|
||||||
|
#[test]
|
||||||
|
fn mempool_avoids_re_emission() -> anyhow::Result<()> {
|
||||||
|
const BLOCKS_TO_MINE: usize = 101;
|
||||||
|
const MEMPOOL_TX_COUNT: usize = 2;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine blocks and sync up emitter
|
||||||
|
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
env.mine_blocks(BLOCKS_TO_MINE, Some(addr.clone()))?;
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
|
||||||
|
// have some random txs in mempool
|
||||||
|
let exp_txids = (0..MEMPOOL_TX_COUNT)
|
||||||
|
.map(|_| env.send(&addr, Amount::from_sat(2100)))
|
||||||
|
.collect::<Result<BTreeSet<Txid>, _>>()?;
|
||||||
|
|
||||||
|
// the first emission should include all transactions
|
||||||
|
let emitted_txids = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<Txid>>();
|
||||||
|
assert_eq!(
|
||||||
|
emitted_txids, exp_txids,
|
||||||
|
"all mempool txs should be emitted"
|
||||||
|
);
|
||||||
|
|
||||||
|
// second emission should be empty
|
||||||
|
assert!(
|
||||||
|
emitter.mempool()?.is_empty(),
|
||||||
|
"second emission should be empty"
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine empty blocks + sync up our emitter -> we should still not re-emit
|
||||||
|
for _ in 0..BLOCKS_TO_MINE {
|
||||||
|
env.mine_empty_block()?;
|
||||||
|
}
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
assert!(
|
||||||
|
emitter.mempool()?.is_empty(),
|
||||||
|
"third emission, after chain tip is extended, should also be empty"
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure mempool tx is still re-emitted if [`Emitter`] has not reached the tx's introduction
|
||||||
|
/// height.
|
||||||
|
///
|
||||||
|
/// We introduce a mempool tx after each block, where blocks are empty (does not confirm previous
|
||||||
|
/// mempool txs). Then we emit blocks from [`Emitter`] (intertwining `mempool` calls). We check
|
||||||
|
/// that `mempool` should always re-emit txs that have introduced at a height greater than the last
|
||||||
|
/// emitted block height.
|
||||||
|
#[test]
|
||||||
|
fn mempool_re_emits_if_tx_introduction_height_not_reached() -> anyhow::Result<()> {
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
const MEMPOOL_TX_COUNT: usize = 21;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine blocks to get initial balance, sync emitter up to tip
|
||||||
|
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
env.mine_blocks(PREMINE_COUNT, Some(addr.clone()))?;
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
|
||||||
|
// mine blocks to introduce txs to mempool at different heights
|
||||||
|
let tx_introductions = (0..MEMPOOL_TX_COUNT)
|
||||||
|
.map(|_| -> anyhow::Result<_> {
|
||||||
|
let (height, _) = env.mine_empty_block()?;
|
||||||
|
let txid = env.send(&addr, Amount::from_sat(2100))?;
|
||||||
|
Ok((height, txid))
|
||||||
|
})
|
||||||
|
.collect::<anyhow::Result<BTreeSet<_>>>()?;
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
tx_introductions.iter().map(|&(_, txid)| txid).collect(),
|
||||||
|
"first mempool emission should include all txs",
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
tx_introductions.iter().map(|&(_, txid)| txid).collect(),
|
||||||
|
"second mempool emission should still include all txs",
|
||||||
|
);
|
||||||
|
|
||||||
|
// At this point, the emitter has seen all mempool transactions. It should only re-emit those
|
||||||
|
// that have introduction heights less than the emitter's last-emitted block tip.
|
||||||
|
while let Some(emission) = emitter.next_header()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
// We call `mempool()` twice.
|
||||||
|
// The second call (at height `h`) should skip the tx introduced at height `h`.
|
||||||
|
for try_index in 0..2 {
|
||||||
|
let exp_txids = tx_introductions
|
||||||
|
.range((height as usize + try_index, Txid::all_zeros())..)
|
||||||
|
.map(|&(_, txid)| txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let emitted_txids = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
emitted_txids, exp_txids,
|
||||||
|
"\n emission {} (try {}) must only contain txs introduced at that height or lower: \n\t missing: {:?} \n\t extra: {:?}",
|
||||||
|
height,
|
||||||
|
try_index,
|
||||||
|
exp_txids
|
||||||
|
.difference(&emitted_txids)
|
||||||
|
.map(|txid| (txid, tx_introductions.iter().find_map(|(h, id)| if id == txid { Some(h) } else { None }).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
emitted_txids
|
||||||
|
.difference(&exp_txids)
|
||||||
|
.map(|txid| (txid, tx_introductions.iter().find_map(|(h, id)| if id == txid { Some(h) } else { None }).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure we force re-emit all mempool txs after reorg.
|
||||||
|
#[test]
|
||||||
|
fn mempool_during_reorg() -> anyhow::Result<()> {
|
||||||
|
const TIP_DIFF: usize = 10;
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine blocks to get initial balance
|
||||||
|
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
env.mine_blocks(PREMINE_COUNT, Some(addr.clone()))?;
|
||||||
|
|
||||||
|
// introduce mempool tx at each block extension
|
||||||
|
for _ in 0..TIP_DIFF {
|
||||||
|
env.mine_empty_block()?;
|
||||||
|
env.send(&addr, Amount::from_sat(2100))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
// sync emitter to tip, first mempool emission should include all txs (as we haven't emitted
|
||||||
|
// from the mempool yet)
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
assert_eq!(
|
||||||
|
emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
env.client
|
||||||
|
.get_raw_mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
"first mempool emission should include all txs",
|
||||||
|
);
|
||||||
|
|
||||||
|
// perform reorgs at different heights, these reorgs will not confirm transactions in the
|
||||||
|
// mempool
|
||||||
|
for reorg_count in 1..TIP_DIFF {
|
||||||
|
println!("REORG COUNT: {}", reorg_count);
|
||||||
|
env.reorg_empty_blocks(reorg_count)?;
|
||||||
|
|
||||||
|
// This is a map of mempool txids to tip height where the tx was introduced to the mempool
|
||||||
|
// we recalculate this at every loop as reorgs may evict transactions from mempool. We use
|
||||||
|
// the introduction height to determine whether we expect a tx to appear in a mempool
|
||||||
|
// emission.
|
||||||
|
// TODO: How can have have reorg logic in `TestEnv` NOT blacklast old blocks first?
|
||||||
|
let tx_introductions = dbg!(env
|
||||||
|
.client
|
||||||
|
.get_raw_mempool_verbose()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(txid, entry)| (txid, entry.height as usize))
|
||||||
|
.collect::<BTreeMap<_, _>>());
|
||||||
|
|
||||||
|
// `next_header` emits the replacement block of the reorg
|
||||||
|
if let Some(emission) = emitter.next_header()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
println!("\t- replacement height: {}", height);
|
||||||
|
|
||||||
|
// the mempool emission (that follows the first block emission after reorg) should only
|
||||||
|
// include mempool txs introduced at reorg height or greater
|
||||||
|
let mempool = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_mempool = tx_introductions
|
||||||
|
.iter()
|
||||||
|
.filter(|(_, &intro_h)| intro_h >= (height as usize))
|
||||||
|
.map(|(&txid, _)| txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
mempool, exp_mempool,
|
||||||
|
"the first mempool emission after reorg should only include mempool txs introduced at reorg height or greater"
|
||||||
|
);
|
||||||
|
|
||||||
|
let mempool = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_mempool = tx_introductions
|
||||||
|
.iter()
|
||||||
|
.filter(|&(_, &intro_height)| intro_height > (height as usize))
|
||||||
|
.map(|(&txid, _)| txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
mempool, exp_mempool,
|
||||||
|
"following mempool emissions after reorg should exclude mempool introduction heights <= last emitted block height: \n\t missing: {:?} \n\t extra: {:?}",
|
||||||
|
exp_mempool
|
||||||
|
.difference(&mempool)
|
||||||
|
.map(|txid| (txid, tx_introductions.get(txid).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
mempool
|
||||||
|
.difference(&exp_mempool)
|
||||||
|
.map(|txid| (txid, tx_introductions.get(txid).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// sync emitter to tip
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// If blockchain re-org includes the start height, emit new start height block
|
||||||
|
///
|
||||||
|
/// 1. mine 101 blocks
|
||||||
|
/// 2. emit blocks 99a, 100a
|
||||||
|
/// 3. invalidate blocks 99a, 100a, 101a
|
||||||
|
/// 4. mine new blocks 99b, 100b, 101b
|
||||||
|
/// 5. emit block 99b
|
||||||
|
///
|
||||||
|
/// The block hash of 99b should be different than 99a, but their previous block hashes should
|
||||||
|
/// be the same.
|
||||||
|
#[test]
|
||||||
|
fn no_agreement_point() -> anyhow::Result<()> {
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
|
||||||
|
// start height is 99
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
(PREMINE_COUNT - 2) as u32,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine 101 blocks
|
||||||
|
env.mine_blocks(PREMINE_COUNT, None)?;
|
||||||
|
|
||||||
|
// emit block 99a
|
||||||
|
let block_header_99a = emitter.next_header()?.expect("block 99a header").block;
|
||||||
|
let block_hash_99a = block_header_99a.block_hash();
|
||||||
|
let block_hash_98a = block_header_99a.prev_blockhash;
|
||||||
|
|
||||||
|
// emit block 100a
|
||||||
|
let block_header_100a = emitter.next_header()?.expect("block 100a header").block;
|
||||||
|
let block_hash_100a = block_header_100a.block_hash();
|
||||||
|
|
||||||
|
// get hash for block 101a
|
||||||
|
let block_hash_101a = env.client.get_block_hash(101)?;
|
||||||
|
|
||||||
|
// invalidate blocks 99a, 100a, 101a
|
||||||
|
env.client.invalidate_block(&block_hash_99a)?;
|
||||||
|
env.client.invalidate_block(&block_hash_100a)?;
|
||||||
|
env.client.invalidate_block(&block_hash_101a)?;
|
||||||
|
|
||||||
|
// mine new blocks 99b, 100b, 101b
|
||||||
|
env.mine_blocks(3, None)?;
|
||||||
|
|
||||||
|
// emit block header 99b
|
||||||
|
let block_header_99b = emitter.next_header()?.expect("block 99b header").block;
|
||||||
|
let block_hash_99b = block_header_99b.block_hash();
|
||||||
|
let block_hash_98b = block_header_99b.prev_blockhash;
|
||||||
|
|
||||||
|
assert_ne!(block_hash_99a, block_hash_99b);
|
||||||
|
assert_eq!(block_hash_98a, block_hash_98b);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
31
crates/chain/Cargo.toml
Normal file
31
crates/chain/Cargo.toml
Normal file
@@ -0,0 +1,31 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_chain"
|
||||||
|
version = "0.9.0"
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.63"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk_chain"
|
||||||
|
description = "Collection of core structures for Bitcoin Dev Kit."
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
# For no-std, remember to enable the bitcoin/no-std feature
|
||||||
|
bitcoin = { version = "0.30.0", default-features = false }
|
||||||
|
serde_crate = { package = "serde", version = "1", optional = true, features = ["derive"] }
|
||||||
|
|
||||||
|
# Use hashbrown as a feature flag to have HashSet and HashMap from it.
|
||||||
|
# note versions > 0.9.1 breaks ours 1.57.0 MSRV.
|
||||||
|
hashbrown = { version = "0.9.1", optional = true, features = ["serde"] }
|
||||||
|
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
rand = "0.8"
|
||||||
|
|
||||||
|
[features]
|
||||||
|
default = ["std"]
|
||||||
|
std = ["bitcoin/std", "miniscript/std"]
|
||||||
|
serde = ["serde_crate", "bitcoin/serde"]
|
||||||
3
crates/chain/README.md
Normal file
3
crates/chain/README.md
Normal file
@@ -0,0 +1,3 @@
|
|||||||
|
# BDK Chain
|
||||||
|
|
||||||
|
BDK keychain tracker, tools for storing and indexing chain data.
|
||||||
301
crates/chain/src/chain_data.rs
Normal file
301
crates/chain/src/chain_data.rs
Normal file
@@ -0,0 +1,301 @@
|
|||||||
|
use bitcoin::{hashes::Hash, BlockHash, OutPoint, TxOut, Txid};
|
||||||
|
|
||||||
|
use crate::{Anchor, AnchorFromBlockPosition, COINBASE_MATURITY};
|
||||||
|
|
||||||
|
/// Represents the observed position of some chain data.
|
||||||
|
///
|
||||||
|
/// The generic `A` should be a [`Anchor`] implementation.
|
||||||
|
#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
pub enum ChainPosition<A> {
|
||||||
|
/// The chain data is seen as confirmed, and in anchored by `A`.
|
||||||
|
Confirmed(A),
|
||||||
|
/// The chain data is seen in mempool at this given timestamp.
|
||||||
|
Unconfirmed(u64),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A> ChainPosition<A> {
|
||||||
|
/// Returns whether [`ChainPosition`] is confirmed or not.
|
||||||
|
pub fn is_confirmed(&self) -> bool {
|
||||||
|
matches!(self, Self::Confirmed(_))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Clone> ChainPosition<&A> {
|
||||||
|
/// Maps a [`ChainPosition<&A>`] into a [`ChainPosition<A>`] by cloning the contents.
|
||||||
|
pub fn cloned(self) -> ChainPosition<A> {
|
||||||
|
match self {
|
||||||
|
ChainPosition::Confirmed(a) => ChainPosition::Confirmed(a.clone()),
|
||||||
|
ChainPosition::Unconfirmed(last_seen) => ChainPosition::Unconfirmed(last_seen),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor> ChainPosition<A> {
|
||||||
|
/// Determines the upper bound of the confirmation height.
|
||||||
|
pub fn confirmation_height_upper_bound(&self) -> Option<u32> {
|
||||||
|
match self {
|
||||||
|
ChainPosition::Confirmed(a) => Some(a.confirmation_height_upper_bound()),
|
||||||
|
ChainPosition::Unconfirmed(_) => None,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Block height and timestamp at which a transaction is confirmed.
|
||||||
|
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate")
|
||||||
|
)]
|
||||||
|
pub enum ConfirmationTime {
|
||||||
|
/// The confirmed variant.
|
||||||
|
Confirmed {
|
||||||
|
/// Confirmation height.
|
||||||
|
height: u32,
|
||||||
|
/// Confirmation time in unix seconds.
|
||||||
|
time: u64,
|
||||||
|
},
|
||||||
|
/// The unconfirmed variant.
|
||||||
|
Unconfirmed {
|
||||||
|
/// The last-seen timestamp in unix seconds.
|
||||||
|
last_seen: u64,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
impl ConfirmationTime {
|
||||||
|
/// Construct an unconfirmed variant using the given `last_seen` time in unix seconds.
|
||||||
|
pub fn unconfirmed(last_seen: u64) -> Self {
|
||||||
|
Self::Unconfirmed { last_seen }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns whether [`ConfirmationTime`] is the confirmed variant.
|
||||||
|
pub fn is_confirmed(&self) -> bool {
|
||||||
|
matches!(self, Self::Confirmed { .. })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<ChainPosition<ConfirmationTimeHeightAnchor>> for ConfirmationTime {
|
||||||
|
fn from(observed_as: ChainPosition<ConfirmationTimeHeightAnchor>) -> Self {
|
||||||
|
match observed_as {
|
||||||
|
ChainPosition::Confirmed(a) => Self::Confirmed {
|
||||||
|
height: a.confirmation_height,
|
||||||
|
time: a.confirmation_time,
|
||||||
|
},
|
||||||
|
ChainPosition::Unconfirmed(last_seen) => Self::Unconfirmed { last_seen },
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A reference to a block in the canonical chain.
|
||||||
|
///
|
||||||
|
/// `BlockId` implements [`Anchor`]. When a transaction is anchored to `BlockId`, the confirmation
|
||||||
|
/// block and anchor block are the same block.
|
||||||
|
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate")
|
||||||
|
)]
|
||||||
|
pub struct BlockId {
|
||||||
|
/// The height of the block.
|
||||||
|
pub height: u32,
|
||||||
|
/// The hash of the block.
|
||||||
|
pub hash: BlockHash,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Anchor for BlockId {
|
||||||
|
fn anchor_block(&self) -> Self {
|
||||||
|
*self
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AnchorFromBlockPosition for BlockId {
|
||||||
|
fn from_block_position(_block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||||
|
block_id
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Default for BlockId {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self {
|
||||||
|
height: Default::default(),
|
||||||
|
hash: BlockHash::all_zeros(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<(u32, BlockHash)> for BlockId {
|
||||||
|
fn from((height, hash): (u32, BlockHash)) -> Self {
|
||||||
|
Self { height, hash }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<BlockId> for (u32, BlockHash) {
|
||||||
|
fn from(block_id: BlockId) -> Self {
|
||||||
|
(block_id.height, block_id.hash)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<(&u32, &BlockHash)> for BlockId {
|
||||||
|
fn from((height, hash): (&u32, &BlockHash)) -> Self {
|
||||||
|
Self {
|
||||||
|
height: *height,
|
||||||
|
hash: *hash,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An [`Anchor`] implementation that also records the exact confirmation height of the transaction.
|
||||||
|
///
|
||||||
|
/// Note that the confirmation block and the anchor block can be different here.
|
||||||
|
///
|
||||||
|
/// Refer to [`Anchor`] for more details.
|
||||||
|
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate")
|
||||||
|
)]
|
||||||
|
pub struct ConfirmationHeightAnchor {
|
||||||
|
/// The anchor block.
|
||||||
|
pub anchor_block: BlockId,
|
||||||
|
|
||||||
|
/// The exact confirmation height of the transaction.
|
||||||
|
///
|
||||||
|
/// It is assumed that this value is never larger than the height of the anchor block.
|
||||||
|
pub confirmation_height: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Anchor for ConfirmationHeightAnchor {
|
||||||
|
fn anchor_block(&self) -> BlockId {
|
||||||
|
self.anchor_block
|
||||||
|
}
|
||||||
|
|
||||||
|
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||||
|
self.confirmation_height
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AnchorFromBlockPosition for ConfirmationHeightAnchor {
|
||||||
|
fn from_block_position(_block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||||
|
Self {
|
||||||
|
anchor_block: block_id,
|
||||||
|
confirmation_height: block_id.height,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An [`Anchor`] implementation that also records the exact confirmation time and height of the
|
||||||
|
/// transaction.
|
||||||
|
///
|
||||||
|
/// Note that the confirmation block and the anchor block can be different here.
|
||||||
|
///
|
||||||
|
/// Refer to [`Anchor`] for more details.
|
||||||
|
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate")
|
||||||
|
)]
|
||||||
|
pub struct ConfirmationTimeHeightAnchor {
|
||||||
|
/// The anchor block.
|
||||||
|
pub anchor_block: BlockId,
|
||||||
|
/// The confirmation height of the chain data being anchored.
|
||||||
|
pub confirmation_height: u32,
|
||||||
|
/// The confirmation time of the chain data being anchored.
|
||||||
|
pub confirmation_time: u64,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Anchor for ConfirmationTimeHeightAnchor {
|
||||||
|
fn anchor_block(&self) -> BlockId {
|
||||||
|
self.anchor_block
|
||||||
|
}
|
||||||
|
|
||||||
|
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||||
|
self.confirmation_height
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AnchorFromBlockPosition for ConfirmationTimeHeightAnchor {
|
||||||
|
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||||
|
Self {
|
||||||
|
anchor_block: block_id,
|
||||||
|
confirmation_height: block_id.height,
|
||||||
|
confirmation_time: block.header.time as _,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A `TxOut` with as much data as we can retrieve about it
|
||||||
|
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||||
|
pub struct FullTxOut<A> {
|
||||||
|
/// The location of the `TxOut`.
|
||||||
|
pub outpoint: OutPoint,
|
||||||
|
/// The `TxOut`.
|
||||||
|
pub txout: TxOut,
|
||||||
|
/// The position of the transaction in `outpoint` in the overall chain.
|
||||||
|
pub chain_position: ChainPosition<A>,
|
||||||
|
/// The txid and chain position of the transaction (if any) that has spent this output.
|
||||||
|
pub spent_by: Option<(ChainPosition<A>, Txid)>,
|
||||||
|
/// Whether this output is on a coinbase transaction.
|
||||||
|
pub is_on_coinbase: bool,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor> FullTxOut<A> {
|
||||||
|
/// Whether the `txout` is considered mature.
|
||||||
|
///
|
||||||
|
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||||
|
/// method may return false-negatives. In other words, interpreted confirmation count may be
|
||||||
|
/// less than the actual value.
|
||||||
|
///
|
||||||
|
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||||
|
pub fn is_mature(&self, tip: u32) -> bool {
|
||||||
|
if self.is_on_coinbase {
|
||||||
|
let tx_height = match &self.chain_position {
|
||||||
|
ChainPosition::Confirmed(anchor) => anchor.confirmation_height_upper_bound(),
|
||||||
|
ChainPosition::Unconfirmed(_) => {
|
||||||
|
debug_assert!(false, "coinbase tx can never be unconfirmed");
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
let age = tip.saturating_sub(tx_height);
|
||||||
|
if age + 1 < COINBASE_MATURITY {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
true
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether the utxo is/was/will be spendable with chain `tip`.
|
||||||
|
///
|
||||||
|
/// This method does not take into account the lock time.
|
||||||
|
///
|
||||||
|
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||||
|
/// method may return false-negatives. In other words, interpreted confirmation count may be
|
||||||
|
/// less than the actual value.
|
||||||
|
///
|
||||||
|
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||||
|
pub fn is_confirmed_and_spendable(&self, tip: u32) -> bool {
|
||||||
|
if !self.is_mature(tip) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let confirmation_height = match &self.chain_position {
|
||||||
|
ChainPosition::Confirmed(anchor) => anchor.confirmation_height_upper_bound(),
|
||||||
|
ChainPosition::Unconfirmed(_) => return false,
|
||||||
|
};
|
||||||
|
if confirmation_height > tip {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// if the spending tx is confirmed within tip height, the txout is no longer spendable
|
||||||
|
if let Some((ChainPosition::Confirmed(spending_anchor), _)) = &self.spent_by {
|
||||||
|
if spending_anchor.anchor_block().height <= tip {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
true
|
||||||
|
}
|
||||||
|
}
|
||||||
25
crates/chain/src/chain_oracle.rs
Normal file
25
crates/chain/src/chain_oracle.rs
Normal file
@@ -0,0 +1,25 @@
|
|||||||
|
use crate::BlockId;
|
||||||
|
|
||||||
|
/// Represents a service that tracks the blockchain.
|
||||||
|
///
|
||||||
|
/// The main method is [`is_block_in_chain`] which determines whether a given block of [`BlockId`]
|
||||||
|
/// is an ancestor of the `chain_tip`.
|
||||||
|
///
|
||||||
|
/// [`is_block_in_chain`]: Self::is_block_in_chain
|
||||||
|
pub trait ChainOracle {
|
||||||
|
/// Error type.
|
||||||
|
type Error: core::fmt::Debug;
|
||||||
|
|
||||||
|
/// Determines whether `block` of [`BlockId`] exists as an ancestor of `chain_tip`.
|
||||||
|
///
|
||||||
|
/// If `None` is returned, it means the implementation cannot determine whether `block` exists
|
||||||
|
/// under `chain_tip`.
|
||||||
|
fn is_block_in_chain(
|
||||||
|
&self,
|
||||||
|
block: BlockId,
|
||||||
|
chain_tip: BlockId,
|
||||||
|
) -> Result<Option<bool>, Self::Error>;
|
||||||
|
|
||||||
|
/// Get the best chain's chain tip.
|
||||||
|
fn get_chain_tip(&self) -> Result<BlockId, Self::Error>;
|
||||||
|
}
|
||||||
18
crates/chain/src/descriptor_ext.rs
Normal file
18
crates/chain/src/descriptor_ext.rs
Normal file
@@ -0,0 +1,18 @@
|
|||||||
|
use crate::miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
|
/// A trait to extend the functionality of a miniscript descriptor.
|
||||||
|
pub trait DescriptorExt {
|
||||||
|
/// Returns the minimum value (in satoshis) at which an output is broadcastable.
|
||||||
|
/// Panics if the descriptor wildcard is hardened.
|
||||||
|
fn dust_value(&self) -> u64;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl DescriptorExt for Descriptor<DescriptorPublicKey> {
|
||||||
|
fn dust_value(&self) -> u64 {
|
||||||
|
self.at_derivation_index(0)
|
||||||
|
.expect("descriptor can't have hardened derivation")
|
||||||
|
.script_pubkey()
|
||||||
|
.dust_value()
|
||||||
|
.to_sat()
|
||||||
|
}
|
||||||
|
}
|
||||||
30
crates/chain/src/example_utils.rs
Normal file
30
crates/chain/src/example_utils.rs
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
#![allow(unused)]
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
use bitcoin::{
|
||||||
|
consensus,
|
||||||
|
hashes::{hex::FromHex, Hash},
|
||||||
|
Transaction,
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::BlockId;
|
||||||
|
|
||||||
|
pub const RAW_TX_1: &str = "0200000000010116d6174da7183d70d0a7d4dc314d517a7d135db79ad63515028b293a76f4f9d10000000000feffffff023a21fc8350060000160014531c405e1881ef192294b8813631e258bf98ea7a1027000000000000225120a60869f0dbcf1dc659c9cecbaf8050135ea9e8cdc487053f1dc6880949dc684c024730440220591b1a172a122da49ba79a3e79f98aaa03fd7a372f9760da18890b6a327e6010022013e82319231da6c99abf8123d7c07e13cf9bd8d76e113e18dc452e5024db156d012102318a2d558b2936c52e320decd6d92a88d7f530be91b6fe0af5caf41661e77da3ef2e0100";
|
||||||
|
pub const RAW_TX_2: &str = "02000000000101a688607020cfae91a61e7c516b5ef1264d5d77f17200c3866826c6c808ebf1620000000000feffffff021027000000000000225120a60869f0dbcf1dc659c9cecbaf8050135ea9e8cdc487053f1dc6880949dc684c20fd48ff530600001600146886c525e41d4522042bd0b159dfbade2504a6bb024730440220740ff7e665cd20565d4296b549df8d26b941be3f1e3af89a0b60e50c0dbeb69a02206213ab7030cf6edc6c90d4ccf33010644261e029950a688dc0b1a9ebe6ddcc5a012102f2ac6b396a97853cb6cd62242c8ae4842024742074475023532a51e9c53194253e760100";
|
||||||
|
pub const RAW_TX_3: &str = "0200000000010135d67ee47b557e68b8c6223958f597381965ed719f1207ee2b9e20432a24a5dc0100000000feffffff021027000000000000225120a82f29944d65b86ae6b5e5cc75e294ead6c59391a1edc5e016e3498c67fc7bbb62215a5055060000160014070df7671dea67a50c4799a744b5c9be8f4bac690247304402207ebf8d29f71fd03e7e6977b3ea78ca5fcc5c49a42ae822348fc401862fdd766c02201d7e4ff0684ecb008b6142f36ead1b0b4d615524c4f58c261113d361f4427e25012103e6a75e2fab85e5ecad641afc4ffba7222f998649d9f18cac92f0fcc8618883b3ee760100";
|
||||||
|
pub const RAW_TX_4: &str = "02000000000101d00e8f76ed313e19b339ee293c0f52b0325c95e24c8f3966fa353fb2bedbcf580100000000feffffff021027000000000000225120882d74e5d0572d5a816cef0041a96b6c1de832f6f9676d9605c44d5e9a97d3dc9cda55fe53060000160014852b5864b8edd42fab4060c87f818e50780865ff0247304402201dccbb9bed7fba924b6d249c5837cc9b37470c0e3d8fbea77cb59baba3efe6fa0220700cc170916913b9bfc2bc0fefb6af776e8b542c561702f136cddc1c7aa43141012103acec3fc79dbbca745815c2a807dc4e81010c80e308e84913f59cb42a275dad97f3760100";
|
||||||
|
|
||||||
|
pub fn tx_from_hex(s: &str) -> Transaction {
|
||||||
|
let raw = Vec::from_hex(s).expect("data must be in hex");
|
||||||
|
consensus::deserialize(raw.as_slice()).expect("must deserialize")
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn new_hash<H: Hash>(s: &str) -> H {
|
||||||
|
<H as bitcoin::hashes::Hash>::hash(s.as_bytes())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn new_block_id(height: u32, hash: &str) -> BlockId {
|
||||||
|
BlockId {
|
||||||
|
height,
|
||||||
|
hash: new_hash(hash),
|
||||||
|
}
|
||||||
|
}
|
||||||
354
crates/chain/src/indexed_tx_graph.rs
Normal file
354
crates/chain/src/indexed_tx_graph.rs
Normal file
@@ -0,0 +1,354 @@
|
|||||||
|
//! Contains the [`IndexedTxGraph`] and associated types. Refer to the
|
||||||
|
//! [`IndexedTxGraph`] documentation for more.
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
use bitcoin::{Block, OutPoint, Transaction, TxOut, Txid};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
keychain,
|
||||||
|
tx_graph::{self, TxGraph},
|
||||||
|
Anchor, AnchorFromBlockPosition, Append, BlockId,
|
||||||
|
};
|
||||||
|
|
||||||
|
/// The [`IndexedTxGraph`] combines a [`TxGraph`] and an [`Indexer`] implementation.
|
||||||
|
///
|
||||||
|
/// It ensures that [`TxGraph`] and [`Indexer`] are updated atomically.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct IndexedTxGraph<A, I> {
|
||||||
|
/// Transaction index.
|
||||||
|
pub index: I,
|
||||||
|
graph: TxGraph<A>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, I: Default> Default for IndexedTxGraph<A, I> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self {
|
||||||
|
graph: Default::default(),
|
||||||
|
index: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, I> IndexedTxGraph<A, I> {
|
||||||
|
/// Construct a new [`IndexedTxGraph`] with a given `index`.
|
||||||
|
pub fn new(index: I) -> Self {
|
||||||
|
Self {
|
||||||
|
index,
|
||||||
|
graph: TxGraph::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference of the internal transaction graph.
|
||||||
|
pub fn graph(&self) -> &TxGraph<A> {
|
||||||
|
&self.graph
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I> {
|
||||||
|
/// Applies the [`ChangeSet`] to the [`IndexedTxGraph`].
|
||||||
|
pub fn apply_changeset(&mut self, changeset: ChangeSet<A, I::ChangeSet>) {
|
||||||
|
self.index.apply_changeset(changeset.indexer);
|
||||||
|
|
||||||
|
for tx in &changeset.graph.txs {
|
||||||
|
self.index.index_tx(tx);
|
||||||
|
}
|
||||||
|
for (&outpoint, txout) in &changeset.graph.txouts {
|
||||||
|
self.index.index_txout(outpoint, txout);
|
||||||
|
}
|
||||||
|
|
||||||
|
self.graph.apply_changeset(changeset.graph);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Determines the [`ChangeSet`] between `self` and an empty [`IndexedTxGraph`].
|
||||||
|
pub fn initial_changeset(&self) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.initial_changeset();
|
||||||
|
let indexer = self.index.initial_changeset();
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||||
|
where
|
||||||
|
I::ChangeSet: Default + Append,
|
||||||
|
{
|
||||||
|
fn index_tx_graph_changeset(
|
||||||
|
&mut self,
|
||||||
|
tx_graph_changeset: &tx_graph::ChangeSet<A>,
|
||||||
|
) -> I::ChangeSet {
|
||||||
|
let mut changeset = I::ChangeSet::default();
|
||||||
|
for added_tx in &tx_graph_changeset.txs {
|
||||||
|
changeset.append(self.index.index_tx(added_tx));
|
||||||
|
}
|
||||||
|
for (&added_outpoint, added_txout) in &tx_graph_changeset.txouts {
|
||||||
|
changeset.append(self.index.index_txout(added_outpoint, added_txout));
|
||||||
|
}
|
||||||
|
changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Apply an `update` directly.
|
||||||
|
///
|
||||||
|
/// `update` is a [`TxGraph<A>`] and the resultant changes is returned as [`ChangeSet`].
|
||||||
|
pub fn apply_update(&mut self, update: TxGraph<A>) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.apply_update(update);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert a floating `txout` of given `outpoint`.
|
||||||
|
pub fn insert_txout(&mut self, outpoint: OutPoint, txout: TxOut) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.insert_txout(outpoint, txout);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert and index a transaction into the graph.
|
||||||
|
pub fn insert_tx(&mut self, tx: Transaction) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.insert_tx(tx);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert an `anchor` for a given transaction.
|
||||||
|
pub fn insert_anchor(&mut self, txid: Txid, anchor: A) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
self.graph.insert_anchor(txid, anchor).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert a unix timestamp of when a transaction is seen in the mempool.
|
||||||
|
///
|
||||||
|
/// This is used for transaction conflict resolution in [`TxGraph`] where the transaction with
|
||||||
|
/// the later last-seen is prioritized.
|
||||||
|
pub fn insert_seen_at(&mut self, txid: Txid, seen_at: u64) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
self.graph.insert_seen_at(txid, seen_at).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert transactions, filtering out those that are irrelevant.
|
||||||
|
///
|
||||||
|
/// Relevancy is determined by the [`Indexer::is_tx_relevant`] implementation of `I`. Irrelevant
|
||||||
|
/// transactions in `txs` will be ignored. `txs` do not need to be in topological order.
|
||||||
|
pub fn batch_insert_relevant<'t>(
|
||||||
|
&mut self,
|
||||||
|
txs: impl IntoIterator<Item = (&'t Transaction, impl IntoIterator<Item = A>)>,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||||
|
// This is achieved by:
|
||||||
|
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||||
|
// not store anything about them.
|
||||||
|
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||||
|
// returns true or not. (in a second loop).
|
||||||
|
let txs = txs.into_iter().collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let mut indexer = I::ChangeSet::default();
|
||||||
|
for (tx, _) in &txs {
|
||||||
|
indexer.append(self.index.index_tx(tx));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut graph = tx_graph::ChangeSet::default();
|
||||||
|
for (tx, anchors) in txs {
|
||||||
|
if self.index.is_tx_relevant(tx) {
|
||||||
|
let txid = tx.txid();
|
||||||
|
graph.append(self.graph.insert_tx(tx.clone()));
|
||||||
|
for anchor in anchors {
|
||||||
|
graph.append(self.graph.insert_anchor(txid, anchor));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert unconfirmed transactions, filtering out those that are irrelevant.
|
||||||
|
///
|
||||||
|
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||||
|
/// Irrelevant transactions in `txs` will be ignored.
|
||||||
|
///
|
||||||
|
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||||
|
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||||
|
/// conflict-resolution in [`TxGraph`] (refer to [`TxGraph::insert_seen_at`] for details).
|
||||||
|
pub fn batch_insert_relevant_unconfirmed<'t>(
|
||||||
|
&mut self,
|
||||||
|
unconfirmed_txs: impl IntoIterator<Item = (&'t Transaction, u64)>,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||||
|
// This is achieved by:
|
||||||
|
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||||
|
// not store anything about them.
|
||||||
|
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||||
|
// returns true or not. (in a second loop).
|
||||||
|
let txs = unconfirmed_txs.into_iter().collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let mut indexer = I::ChangeSet::default();
|
||||||
|
for (tx, _) in &txs {
|
||||||
|
indexer.append(self.index.index_tx(tx));
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph = self.graph.batch_insert_unconfirmed(
|
||||||
|
txs.into_iter()
|
||||||
|
.filter(|(tx, _)| self.index.is_tx_relevant(tx))
|
||||||
|
.map(|(tx, seen_at)| (tx.clone(), seen_at)),
|
||||||
|
);
|
||||||
|
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert unconfirmed transactions.
|
||||||
|
///
|
||||||
|
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||||
|
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||||
|
/// conflict-resolution in [`TxGraph`] (refer to [`TxGraph::insert_seen_at`] for details).
|
||||||
|
///
|
||||||
|
/// To filter out irrelevant transactions, use [`batch_insert_relevant_unconfirmed`] instead.
|
||||||
|
///
|
||||||
|
/// [`batch_insert_relevant_unconfirmed`]: IndexedTxGraph::batch_insert_relevant_unconfirmed
|
||||||
|
pub fn batch_insert_unconfirmed(
|
||||||
|
&mut self,
|
||||||
|
txs: impl IntoIterator<Item = (Transaction, u64)>,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.batch_insert_unconfirmed(txs);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Methods are available if the anchor (`A`) implements [`AnchorFromBlockPosition`].
|
||||||
|
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||||
|
where
|
||||||
|
I::ChangeSet: Default + Append,
|
||||||
|
A: AnchorFromBlockPosition,
|
||||||
|
{
|
||||||
|
/// Batch insert all transactions of the given `block` of `height`, filtering out those that are
|
||||||
|
/// irrelevant.
|
||||||
|
///
|
||||||
|
/// Each inserted transaction's anchor will be constructed from
|
||||||
|
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||||
|
///
|
||||||
|
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||||
|
/// Irrelevant transactions in `txs` will be ignored.
|
||||||
|
pub fn apply_block_relevant(
|
||||||
|
&mut self,
|
||||||
|
block: &Block,
|
||||||
|
height: u32,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let block_id = BlockId {
|
||||||
|
hash: block.block_hash(),
|
||||||
|
height,
|
||||||
|
};
|
||||||
|
let mut changeset = ChangeSet::<A, I::ChangeSet>::default();
|
||||||
|
for (tx_pos, tx) in block.txdata.iter().enumerate() {
|
||||||
|
changeset.indexer.append(self.index.index_tx(tx));
|
||||||
|
if self.index.is_tx_relevant(tx) {
|
||||||
|
let txid = tx.txid();
|
||||||
|
let anchor = A::from_block_position(block, block_id, tx_pos);
|
||||||
|
changeset.graph.append(self.graph.insert_tx(tx.clone()));
|
||||||
|
changeset
|
||||||
|
.graph
|
||||||
|
.append(self.graph.insert_anchor(txid, anchor));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert all transactions of the given `block` of `height`.
|
||||||
|
///
|
||||||
|
/// Each inserted transaction's anchor will be constructed from
|
||||||
|
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||||
|
///
|
||||||
|
/// To only insert relevant transactions, use [`apply_block_relevant`] instead.
|
||||||
|
///
|
||||||
|
/// [`apply_block_relevant`]: IndexedTxGraph::apply_block_relevant
|
||||||
|
pub fn apply_block(&mut self, block: Block, height: u32) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let block_id = BlockId {
|
||||||
|
hash: block.block_hash(),
|
||||||
|
height,
|
||||||
|
};
|
||||||
|
let mut graph = tx_graph::ChangeSet::default();
|
||||||
|
for (tx_pos, tx) in block.txdata.iter().enumerate() {
|
||||||
|
let anchor = A::from_block_position(&block, block_id, tx_pos);
|
||||||
|
graph.append(self.graph.insert_anchor(tx.txid(), anchor));
|
||||||
|
graph.append(self.graph.insert_tx(tx.clone()));
|
||||||
|
}
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Represents changes to an [`IndexedTxGraph`].
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(
|
||||||
|
crate = "serde_crate",
|
||||||
|
bound(
|
||||||
|
deserialize = "A: Ord + serde::Deserialize<'de>, IA: serde::Deserialize<'de>",
|
||||||
|
serialize = "A: Ord + serde::Serialize, IA: serde::Serialize"
|
||||||
|
)
|
||||||
|
)
|
||||||
|
)]
|
||||||
|
#[must_use]
|
||||||
|
pub struct ChangeSet<A, IA> {
|
||||||
|
/// [`TxGraph`] changeset.
|
||||||
|
pub graph: tx_graph::ChangeSet<A>,
|
||||||
|
/// [`Indexer`] changeset.
|
||||||
|
pub indexer: IA,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, IA: Default> Default for ChangeSet<A, IA> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self {
|
||||||
|
graph: Default::default(),
|
||||||
|
indexer: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor, IA: Append> Append for ChangeSet<A, IA> {
|
||||||
|
fn append(&mut self, other: Self) {
|
||||||
|
self.graph.append(other.graph);
|
||||||
|
self.indexer.append(other.indexer);
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
self.graph.is_empty() && self.indexer.is_empty()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, IA: Default> From<tx_graph::ChangeSet<A>> for ChangeSet<A, IA> {
|
||||||
|
fn from(graph: tx_graph::ChangeSet<A>) -> Self {
|
||||||
|
Self {
|
||||||
|
graph,
|
||||||
|
..Default::default()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, K> From<keychain::ChangeSet<K>> for ChangeSet<A, keychain::ChangeSet<K>> {
|
||||||
|
fn from(indexer: keychain::ChangeSet<K>) -> Self {
|
||||||
|
Self {
|
||||||
|
graph: Default::default(),
|
||||||
|
indexer,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Utilities for indexing transaction data.
|
||||||
|
///
|
||||||
|
/// Types which implement this trait can be used to construct an [`IndexedTxGraph`].
|
||||||
|
/// This trait's methods should rarely be called directly.
|
||||||
|
pub trait Indexer {
|
||||||
|
/// The resultant "changeset" when new transaction data is indexed.
|
||||||
|
type ChangeSet;
|
||||||
|
|
||||||
|
/// Scan and index the given `outpoint` and `txout`.
|
||||||
|
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet;
|
||||||
|
|
||||||
|
/// Scans a transaction for relevant outpoints, which are stored and indexed internally.
|
||||||
|
fn index_tx(&mut self, tx: &Transaction) -> Self::ChangeSet;
|
||||||
|
|
||||||
|
/// Apply changeset to itself.
|
||||||
|
fn apply_changeset(&mut self, changeset: Self::ChangeSet);
|
||||||
|
|
||||||
|
/// Determines the [`ChangeSet`] between `self` and an empty [`Indexer`].
|
||||||
|
fn initial_changeset(&self) -> Self::ChangeSet;
|
||||||
|
|
||||||
|
/// Determines whether the transaction should be included in the index.
|
||||||
|
fn is_tx_relevant(&self, tx: &Transaction) -> bool;
|
||||||
|
}
|
||||||
175
crates/chain/src/keychain.rs
Normal file
175
crates/chain/src/keychain.rs
Normal file
@@ -0,0 +1,175 @@
|
|||||||
|
//! Module for keychain related structures.
|
||||||
|
//!
|
||||||
|
//! A keychain here is a set of application-defined indexes for a miniscript descriptor where we can
|
||||||
|
//! derive script pubkeys at a particular derivation index. The application's index is simply
|
||||||
|
//! anything that implements `Ord`.
|
||||||
|
//!
|
||||||
|
//! [`KeychainTxOutIndex`] indexes script pubkeys of keychains and scans in relevant outpoints (that
|
||||||
|
//! has a `txout` containing an indexed script pubkey). Internally, this uses [`SpkTxOutIndex`], but
|
||||||
|
//! also maintains "revealed" and "lookahead" index counts per keychain.
|
||||||
|
//!
|
||||||
|
//! [`SpkTxOutIndex`]: crate::SpkTxOutIndex
|
||||||
|
|
||||||
|
use crate::{collections::BTreeMap, Append};
|
||||||
|
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
mod txout_index;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
pub use txout_index::*;
|
||||||
|
|
||||||
|
/// Represents updates to the derivation index of a [`KeychainTxOutIndex`].
|
||||||
|
/// It maps each keychain `K` to its last revealed index.
|
||||||
|
///
|
||||||
|
/// It can be applied to [`KeychainTxOutIndex`] with [`apply_changeset`]. [`ChangeSet`]s are
|
||||||
|
/// monotone in that they will never decrease the revealed derivation index.
|
||||||
|
///
|
||||||
|
/// [`KeychainTxOutIndex`]: crate::keychain::KeychainTxOutIndex
|
||||||
|
/// [`apply_changeset`]: crate::keychain::KeychainTxOutIndex::apply_changeset
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(
|
||||||
|
crate = "serde_crate",
|
||||||
|
bound(
|
||||||
|
deserialize = "K: Ord + serde::Deserialize<'de>",
|
||||||
|
serialize = "K: Ord + serde::Serialize"
|
||||||
|
)
|
||||||
|
)
|
||||||
|
)]
|
||||||
|
#[must_use]
|
||||||
|
pub struct ChangeSet<K>(pub BTreeMap<K, u32>);
|
||||||
|
|
||||||
|
impl<K> ChangeSet<K> {
|
||||||
|
/// Get the inner map of the keychain to its new derivation index.
|
||||||
|
pub fn as_inner(&self) -> &BTreeMap<K, u32> {
|
||||||
|
&self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Ord> Append for ChangeSet<K> {
|
||||||
|
/// Append another [`ChangeSet`] into self.
|
||||||
|
///
|
||||||
|
/// If the keychain already exists, increase the index when the other's index > self's index.
|
||||||
|
/// If the keychain did not exist, append the new keychain.
|
||||||
|
fn append(&mut self, mut other: Self) {
|
||||||
|
self.0.iter_mut().for_each(|(key, index)| {
|
||||||
|
if let Some(other_index) = other.0.remove(key) {
|
||||||
|
*index = other_index.max(*index);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
// We use `extend` instead of `BTreeMap::append` due to performance issues with `append`.
|
||||||
|
// Refer to https://github.com/rust-lang/rust/issues/34666#issuecomment-675658420
|
||||||
|
self.0.extend(other.0);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns whether the changeset are empty.
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
self.0.is_empty()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K> Default for ChangeSet<K> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self(Default::default())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K> AsRef<BTreeMap<K, u32>> for ChangeSet<K> {
|
||||||
|
fn as_ref(&self) -> &BTreeMap<K, u32> {
|
||||||
|
&self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Balance, differentiated into various categories.
|
||||||
|
#[derive(Debug, PartialEq, Eq, Clone, Default)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate",)
|
||||||
|
)]
|
||||||
|
pub struct Balance {
|
||||||
|
/// All coinbase outputs not yet matured
|
||||||
|
pub immature: u64,
|
||||||
|
/// Unconfirmed UTXOs generated by a wallet tx
|
||||||
|
pub trusted_pending: u64,
|
||||||
|
/// Unconfirmed UTXOs received from an external wallet
|
||||||
|
pub untrusted_pending: u64,
|
||||||
|
/// Confirmed and immediately spendable balance
|
||||||
|
pub confirmed: u64,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Balance {
|
||||||
|
/// Get sum of trusted_pending and confirmed coins.
|
||||||
|
///
|
||||||
|
/// This is the balance you can spend right now that shouldn't get cancelled via another party
|
||||||
|
/// double spending it.
|
||||||
|
pub fn trusted_spendable(&self) -> u64 {
|
||||||
|
self.confirmed + self.trusted_pending
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the whole balance visible to the wallet.
|
||||||
|
pub fn total(&self) -> u64 {
|
||||||
|
self.confirmed + self.trusted_pending + self.untrusted_pending + self.immature
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for Balance {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"{{ immature: {}, trusted_pending: {}, untrusted_pending: {}, confirmed: {} }}",
|
||||||
|
self.immature, self.trusted_pending, self.untrusted_pending, self.confirmed
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::ops::Add for Balance {
|
||||||
|
type Output = Self;
|
||||||
|
|
||||||
|
fn add(self, other: Self) -> Self {
|
||||||
|
Self {
|
||||||
|
immature: self.immature + other.immature,
|
||||||
|
trusted_pending: self.trusted_pending + other.trusted_pending,
|
||||||
|
untrusted_pending: self.untrusted_pending + other.untrusted_pending,
|
||||||
|
confirmed: self.confirmed + other.confirmed,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod test {
|
||||||
|
use super::*;
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn append_keychain_derivation_indices() {
|
||||||
|
#[derive(Ord, PartialOrd, Eq, PartialEq, Clone, Debug)]
|
||||||
|
enum Keychain {
|
||||||
|
One,
|
||||||
|
Two,
|
||||||
|
Three,
|
||||||
|
Four,
|
||||||
|
}
|
||||||
|
let mut lhs_di = BTreeMap::<Keychain, u32>::default();
|
||||||
|
let mut rhs_di = BTreeMap::<Keychain, u32>::default();
|
||||||
|
lhs_di.insert(Keychain::One, 7);
|
||||||
|
lhs_di.insert(Keychain::Two, 0);
|
||||||
|
rhs_di.insert(Keychain::One, 3);
|
||||||
|
rhs_di.insert(Keychain::Two, 5);
|
||||||
|
lhs_di.insert(Keychain::Three, 3);
|
||||||
|
rhs_di.insert(Keychain::Four, 4);
|
||||||
|
|
||||||
|
let mut lhs = ChangeSet(lhs_di);
|
||||||
|
let rhs = ChangeSet(rhs_di);
|
||||||
|
lhs.append(rhs);
|
||||||
|
|
||||||
|
// Exiting index doesn't update if the new index in `other` is lower than `self`.
|
||||||
|
assert_eq!(lhs.0.get(&Keychain::One), Some(&7));
|
||||||
|
// Existing index updates if the new index in `other` is higher than `self`.
|
||||||
|
assert_eq!(lhs.0.get(&Keychain::Two), Some(&5));
|
||||||
|
// Existing index is unchanged if keychain doesn't exist in `other`.
|
||||||
|
assert_eq!(lhs.0.get(&Keychain::Three), Some(&3));
|
||||||
|
// New keychain gets added if the keychain is in `other` but not in `self`.
|
||||||
|
assert_eq!(lhs.0.get(&Keychain::Four), Some(&4));
|
||||||
|
}
|
||||||
|
}
|
||||||
672
crates/chain/src/keychain/txout_index.rs
Normal file
672
crates/chain/src/keychain/txout_index.rs
Normal file
@@ -0,0 +1,672 @@
|
|||||||
|
use crate::{
|
||||||
|
collections::*,
|
||||||
|
indexed_tx_graph::Indexer,
|
||||||
|
miniscript::{Descriptor, DescriptorPublicKey},
|
||||||
|
spk_iter::BIP32_MAX_INDEX,
|
||||||
|
SpkIterator, SpkTxOutIndex,
|
||||||
|
};
|
||||||
|
use bitcoin::{OutPoint, Script, Transaction, TxOut, Txid};
|
||||||
|
use core::{
|
||||||
|
fmt::Debug,
|
||||||
|
ops::{Bound, RangeBounds},
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::Append;
|
||||||
|
|
||||||
|
const DEFAULT_LOOKAHEAD: u32 = 25;
|
||||||
|
|
||||||
|
/// [`KeychainTxOutIndex`] controls how script pubkeys are revealed for multiple keychains, and
|
||||||
|
/// indexes [`TxOut`]s with them.
|
||||||
|
///
|
||||||
|
/// A single keychain is a chain of script pubkeys derived from a single [`Descriptor`]. Keychains
|
||||||
|
/// are identified using the `K` generic. Script pubkeys are identified by the keychain that they
|
||||||
|
/// are derived from `K`, as well as the derivation index `u32`.
|
||||||
|
///
|
||||||
|
/// # Revealed script pubkeys
|
||||||
|
///
|
||||||
|
/// Tracking how script pubkeys are revealed is useful for collecting chain data. For example, if
|
||||||
|
/// the user has requested 5 script pubkeys (to receive money with), we only need to use those
|
||||||
|
/// script pubkeys to scan for chain data.
|
||||||
|
///
|
||||||
|
/// Call [`reveal_to_target`] or [`reveal_next_spk`] to reveal more script pubkeys.
|
||||||
|
/// Call [`revealed_keychain_spks`] or [`revealed_spks`] to iterate through revealed script pubkeys.
|
||||||
|
///
|
||||||
|
/// # Lookahead script pubkeys
|
||||||
|
///
|
||||||
|
/// When an user first recovers a wallet (i.e. from a recovery phrase and/or descriptor), we will
|
||||||
|
/// NOT have knowledge of which script pubkeys are revealed. So when we index a transaction or
|
||||||
|
/// txout (using [`index_tx`]/[`index_txout`]) we scan the txouts against script pubkeys derived
|
||||||
|
/// above the last revealed index. These additionally-derived script pubkeys are called the
|
||||||
|
/// lookahead.
|
||||||
|
///
|
||||||
|
/// The [`KeychainTxOutIndex`] is constructed with the `lookahead` and cannot be altered. The
|
||||||
|
/// default `lookahead` count is 1000. Use [`new`] to set a custom `lookahead`.
|
||||||
|
///
|
||||||
|
/// # Unbounded script pubkey iterator
|
||||||
|
///
|
||||||
|
/// For script-pubkey-based chain sources (such as Electrum/Esplora), an initial scan is best done
|
||||||
|
/// by iterating though derived script pubkeys one by one and requesting transaction histories for
|
||||||
|
/// each script pubkey. We will stop after x-number of script pubkeys have empty histories. An
|
||||||
|
/// unbounded script pubkey iterator is useful to pass to such a chain source.
|
||||||
|
///
|
||||||
|
/// Call [`unbounded_spk_iter`] to get an unbounded script pubkey iterator for a given keychain.
|
||||||
|
/// Call [`all_unbounded_spk_iters`] to get unbounded script pubkey iterators for all keychains.
|
||||||
|
///
|
||||||
|
/// # Change sets
|
||||||
|
///
|
||||||
|
/// Methods that can update the last revealed index will return [`super::ChangeSet`] to report
|
||||||
|
/// these changes. This can be persisted for future recovery.
|
||||||
|
///
|
||||||
|
/// ## Synopsis
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// use bdk_chain::keychain::KeychainTxOutIndex;
|
||||||
|
/// # use bdk_chain::{ miniscript::{Descriptor, DescriptorPublicKey} };
|
||||||
|
/// # use core::str::FromStr;
|
||||||
|
///
|
||||||
|
/// // imagine our service has internal and external addresses but also addresses for users
|
||||||
|
/// #[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||||
|
/// enum MyKeychain {
|
||||||
|
/// External,
|
||||||
|
/// Internal,
|
||||||
|
/// MyAppUser {
|
||||||
|
/// user_id: u32
|
||||||
|
/// }
|
||||||
|
/// }
|
||||||
|
///
|
||||||
|
/// let mut txout_index = KeychainTxOutIndex::<MyKeychain>::default();
|
||||||
|
///
|
||||||
|
/// # let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
/// # let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||||
|
/// # let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||||
|
/// # let (descriptor_for_user_42, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/2/*)").unwrap();
|
||||||
|
/// txout_index.add_keychain(MyKeychain::External, external_descriptor);
|
||||||
|
/// txout_index.add_keychain(MyKeychain::Internal, internal_descriptor);
|
||||||
|
/// txout_index.add_keychain(MyKeychain::MyAppUser { user_id: 42 }, descriptor_for_user_42);
|
||||||
|
///
|
||||||
|
/// let new_spk_for_user = txout_index.reveal_next_spk(&MyKeychain::MyAppUser{ user_id: 42 });
|
||||||
|
/// ```
|
||||||
|
///
|
||||||
|
/// [`Ord`]: core::cmp::Ord
|
||||||
|
/// [`SpkTxOutIndex`]: crate::spk_txout_index::SpkTxOutIndex
|
||||||
|
/// [`Descriptor`]: crate::miniscript::Descriptor
|
||||||
|
/// [`reveal_to_target`]: KeychainTxOutIndex::reveal_to_target
|
||||||
|
/// [`reveal_next_spk`]: KeychainTxOutIndex::reveal_next_spk
|
||||||
|
/// [`revealed_keychain_spks`]: KeychainTxOutIndex::revealed_keychain_spks
|
||||||
|
/// [`revealed_spks`]: KeychainTxOutIndex::revealed_spks
|
||||||
|
/// [`index_tx`]: KeychainTxOutIndex::index_tx
|
||||||
|
/// [`index_txout`]: KeychainTxOutIndex::index_txout
|
||||||
|
/// [`new`]: KeychainTxOutIndex::new
|
||||||
|
/// [`unbounded_spk_iter`]: KeychainTxOutIndex::unbounded_spk_iter
|
||||||
|
/// [`all_unbounded_spk_iters`]: KeychainTxOutIndex::all_unbounded_spk_iters
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub struct KeychainTxOutIndex<K> {
|
||||||
|
inner: SpkTxOutIndex<(K, u32)>,
|
||||||
|
// descriptors of each keychain
|
||||||
|
keychains: BTreeMap<K, Descriptor<DescriptorPublicKey>>,
|
||||||
|
// last revealed indexes
|
||||||
|
last_revealed: BTreeMap<K, u32>,
|
||||||
|
// lookahead settings for each keychain
|
||||||
|
lookahead: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K> Default for KeychainTxOutIndex<K> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self::new(DEFAULT_LOOKAHEAD)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Clone + Ord + Debug> Indexer for KeychainTxOutIndex<K> {
|
||||||
|
type ChangeSet = super::ChangeSet<K>;
|
||||||
|
|
||||||
|
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet {
|
||||||
|
match self.inner.scan_txout(outpoint, txout).cloned() {
|
||||||
|
Some((keychain, index)) => self.reveal_to_target(&keychain, index).1,
|
||||||
|
None => super::ChangeSet::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn index_tx(&mut self, tx: &bitcoin::Transaction) -> Self::ChangeSet {
|
||||||
|
let mut changeset = super::ChangeSet::<K>::default();
|
||||||
|
for (op, txout) in tx.output.iter().enumerate() {
|
||||||
|
changeset.append(self.index_txout(OutPoint::new(tx.txid(), op as u32), txout));
|
||||||
|
}
|
||||||
|
changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
fn initial_changeset(&self) -> Self::ChangeSet {
|
||||||
|
super::ChangeSet(self.last_revealed.clone())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn apply_changeset(&mut self, changeset: Self::ChangeSet) {
|
||||||
|
self.apply_changeset(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_tx_relevant(&self, tx: &bitcoin::Transaction) -> bool {
|
||||||
|
self.inner.is_relevant(tx)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K> KeychainTxOutIndex<K> {
|
||||||
|
/// Construct a [`KeychainTxOutIndex`] with the given `lookahead`.
|
||||||
|
///
|
||||||
|
/// The `lookahead` is the number of script pubkeys to derive and cache from the internal
|
||||||
|
/// descriptors over and above the last revealed script index. Without a lookahead the index
|
||||||
|
/// will miss outputs you own when processing transactions whose output script pubkeys lie
|
||||||
|
/// beyond the last revealed index. In certain situations, such as when performing an initial
|
||||||
|
/// scan of the blockchain during wallet import, it may be uncertain or unknown what the index
|
||||||
|
/// of the last revealed script pubkey actually is.
|
||||||
|
///
|
||||||
|
/// Refer to [struct-level docs](KeychainTxOutIndex) for more about `lookahead`.
|
||||||
|
pub fn new(lookahead: u32) -> Self {
|
||||||
|
Self {
|
||||||
|
inner: SpkTxOutIndex::default(),
|
||||||
|
keychains: BTreeMap::new(),
|
||||||
|
last_revealed: BTreeMap::new(),
|
||||||
|
lookahead,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Methods that are *re-exposed* from the internal [`SpkTxOutIndex`].
|
||||||
|
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||||
|
/// Return a reference to the internal [`SpkTxOutIndex`].
|
||||||
|
///
|
||||||
|
/// **WARNING:** The internal index will contain lookahead spks. Refer to
|
||||||
|
/// [struct-level docs](KeychainTxOutIndex) for more about `lookahead`.
|
||||||
|
pub fn inner(&self) -> &SpkTxOutIndex<(K, u32)> {
|
||||||
|
&self.inner
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the set of indexed outpoints.
|
||||||
|
pub fn outpoints(&self) -> &BTreeSet<((K, u32), OutPoint)> {
|
||||||
|
self.inner.outpoints()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over known txouts that spend to tracked script pubkeys.
|
||||||
|
pub fn txouts(
|
||||||
|
&self,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (K, u32, OutPoint, &TxOut)> + ExactSizeIterator {
|
||||||
|
self.inner
|
||||||
|
.txouts()
|
||||||
|
.map(|((k, i), op, txo)| (k.clone(), *i, op, txo))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finds all txouts on a transaction that has previously been scanned and indexed.
|
||||||
|
pub fn txouts_in_tx(
|
||||||
|
&self,
|
||||||
|
txid: Txid,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (K, u32, OutPoint, &TxOut)> {
|
||||||
|
self.inner
|
||||||
|
.txouts_in_tx(txid)
|
||||||
|
.map(|((k, i), op, txo)| (k.clone(), *i, op, txo))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return the [`TxOut`] of `outpoint` if it has been indexed.
|
||||||
|
///
|
||||||
|
/// The associated keychain and keychain index of the txout's spk is also returned.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::txout`] internally.
|
||||||
|
pub fn txout(&self, outpoint: OutPoint) -> Option<(K, u32, &TxOut)> {
|
||||||
|
self.inner
|
||||||
|
.txout(outpoint)
|
||||||
|
.map(|((k, i), txo)| (k.clone(), *i, txo))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return the script that exists under the given `keychain`'s `index`.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::spk_at_index`] internally.
|
||||||
|
pub fn spk_at_index(&self, keychain: K, index: u32) -> Option<&Script> {
|
||||||
|
self.inner.spk_at_index(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the keychain and keychain index associated with the spk.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::index_of_spk`] internally.
|
||||||
|
pub fn index_of_spk(&self, script: &Script) -> Option<(K, u32)> {
|
||||||
|
self.inner.index_of_spk(script).cloned()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns whether the spk under the `keychain`'s `index` has been used.
|
||||||
|
///
|
||||||
|
/// Here, "unused" means that after the script pubkey was stored in the index, the index has
|
||||||
|
/// never scanned a transaction output with it.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::is_used`] internally.
|
||||||
|
pub fn is_used(&self, keychain: K, index: u32) -> bool {
|
||||||
|
self.inner.is_used(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Marks the script pubkey at `index` as used even though the tracker hasn't seen an output
|
||||||
|
/// with it.
|
||||||
|
///
|
||||||
|
/// This only has an effect when the `index` had been added to `self` already and was unused.
|
||||||
|
///
|
||||||
|
/// Returns whether the `index` was initially present as `unused`.
|
||||||
|
///
|
||||||
|
/// This is useful when you want to reserve a script pubkey for something but don't want to add
|
||||||
|
/// the transaction output using it to the index yet. Other callers will consider `index` on
|
||||||
|
/// `keychain` used until you call [`unmark_used`].
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::mark_used`] internally.
|
||||||
|
///
|
||||||
|
/// [`unmark_used`]: Self::unmark_used
|
||||||
|
pub fn mark_used(&mut self, keychain: K, index: u32) -> bool {
|
||||||
|
self.inner.mark_used(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Undoes the effect of [`mark_used`]. Returns whether the `index` is inserted back into
|
||||||
|
/// `unused`.
|
||||||
|
///
|
||||||
|
/// Note that if `self` has scanned an output with this script pubkey, then this will have no
|
||||||
|
/// effect.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::unmark_used`] internally.
|
||||||
|
///
|
||||||
|
/// [`mark_used`]: Self::mark_used
|
||||||
|
pub fn unmark_used(&mut self, keychain: K, index: u32) -> bool {
|
||||||
|
self.inner.unmark_used(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
||||||
|
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
||||||
|
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
||||||
|
/// received just uses the [`Transaction`] outputs directly, so it will be correct even if it has
|
||||||
|
/// not been scanned.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::sent_and_received`] internally.
|
||||||
|
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
||||||
|
self.inner.sent_and_received(tx)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Computes the net value that this transaction gives to the script pubkeys in the index and
|
||||||
|
/// *takes* from the transaction outputs in the index. Shorthand for calling
|
||||||
|
/// [`sent_and_received`] and subtracting sent from received.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::net_value`] internally.
|
||||||
|
///
|
||||||
|
/// [`sent_and_received`]: Self::sent_and_received
|
||||||
|
pub fn net_value(&self, tx: &Transaction) -> i64 {
|
||||||
|
self.inner.net_value(tx)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||||
|
/// Return a reference to the internal map of keychain to descriptors.
|
||||||
|
pub fn keychains(&self) -> &BTreeMap<K, Descriptor<DescriptorPublicKey>> {
|
||||||
|
&self.keychains
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Add a keychain to the tracker's `txout_index` with a descriptor to derive addresses.
|
||||||
|
///
|
||||||
|
/// Adding a keychain means you will be able to derive new script pubkeys under that keychain
|
||||||
|
/// and the txout index will discover transaction outputs with those script pubkeys.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// This will panic if a different `descriptor` is introduced to the same `keychain`.
|
||||||
|
pub fn add_keychain(&mut self, keychain: K, descriptor: Descriptor<DescriptorPublicKey>) {
|
||||||
|
let old_descriptor = &*self
|
||||||
|
.keychains
|
||||||
|
.entry(keychain.clone())
|
||||||
|
.or_insert_with(|| descriptor.clone());
|
||||||
|
assert_eq!(
|
||||||
|
&descriptor, old_descriptor,
|
||||||
|
"keychain already contains a different descriptor"
|
||||||
|
);
|
||||||
|
self.replenish_lookahead(&keychain, self.lookahead);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the lookahead setting.
|
||||||
|
///
|
||||||
|
/// Refer to [`new`] for more information on the `lookahead`.
|
||||||
|
///
|
||||||
|
/// [`new`]: Self::new
|
||||||
|
pub fn lookahead(&self) -> u32 {
|
||||||
|
self.lookahead
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Store lookahead scripts until `target_index`.
|
||||||
|
///
|
||||||
|
/// This does not change the `lookahead` setting.
|
||||||
|
pub fn lookahead_to_target(&mut self, keychain: &K, target_index: u32) {
|
||||||
|
let next_index = self.next_store_index(keychain);
|
||||||
|
if let Some(temp_lookahead) = target_index.checked_sub(next_index).filter(|&v| v > 0) {
|
||||||
|
self.replenish_lookahead(keychain, temp_lookahead);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn replenish_lookahead(&mut self, keychain: &K, lookahead: u32) {
|
||||||
|
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||||
|
let next_store_index = self.next_store_index(keychain);
|
||||||
|
let next_reveal_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
||||||
|
|
||||||
|
for (new_index, new_spk) in
|
||||||
|
SpkIterator::new_with_range(descriptor, next_store_index..next_reveal_index + lookahead)
|
||||||
|
{
|
||||||
|
let _inserted = self
|
||||||
|
.inner
|
||||||
|
.insert_spk((keychain.clone(), new_index), new_spk);
|
||||||
|
debug_assert!(_inserted, "replenish lookahead: must not have existing spk: keychain={:?}, lookahead={}, next_store_index={}, next_reveal_index={}", keychain, lookahead, next_store_index, next_reveal_index);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn next_store_index(&self, keychain: &K) -> u32 {
|
||||||
|
self.inner()
|
||||||
|
.all_spks()
|
||||||
|
// This range is filtering out the spks with a keychain different than
|
||||||
|
// `keychain`. We don't use filter here as range is more optimized.
|
||||||
|
.range((keychain.clone(), u32::MIN)..(keychain.clone(), u32::MAX))
|
||||||
|
.last()
|
||||||
|
.map_or(0, |((_, index), _)| *index + 1)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get an unbounded spk iterator over a given `keychain`.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// This will panic if the given `keychain`'s descriptor does not exist.
|
||||||
|
pub fn unbounded_spk_iter(&self, keychain: &K) -> SpkIterator<Descriptor<DescriptorPublicKey>> {
|
||||||
|
SpkIterator::new(
|
||||||
|
self.keychains
|
||||||
|
.get(keychain)
|
||||||
|
.expect("keychain does not exist")
|
||||||
|
.clone(),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get unbounded spk iterators for all keychains.
|
||||||
|
pub fn all_unbounded_spk_iters(
|
||||||
|
&self,
|
||||||
|
) -> BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>> {
|
||||||
|
self.keychains
|
||||||
|
.iter()
|
||||||
|
.map(|(k, descriptor)| (k.clone(), SpkIterator::new(descriptor.clone())))
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed spks of all keychains.
|
||||||
|
pub fn revealed_spks(&self) -> impl DoubleEndedIterator<Item = (K, u32, &Script)> + Clone {
|
||||||
|
self.keychains.keys().flat_map(|keychain| {
|
||||||
|
self.revealed_keychain_spks(keychain)
|
||||||
|
.map(|(i, spk)| (keychain.clone(), i, spk))
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed spks of the given `keychain`.
|
||||||
|
pub fn revealed_keychain_spks(
|
||||||
|
&self,
|
||||||
|
keychain: &K,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (u32, &Script)> + Clone {
|
||||||
|
let next_i = self.last_revealed.get(keychain).map_or(0, |&i| i + 1);
|
||||||
|
self.inner
|
||||||
|
.all_spks()
|
||||||
|
.range((keychain.clone(), u32::MIN)..(keychain.clone(), next_i))
|
||||||
|
.map(|((_, i), spk)| (*i, spk.as_script()))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed, but unused, spks of all keychains.
|
||||||
|
pub fn unused_spks(&self) -> impl DoubleEndedIterator<Item = (K, u32, &Script)> + Clone {
|
||||||
|
self.keychains.keys().flat_map(|keychain| {
|
||||||
|
self.unused_keychain_spks(keychain)
|
||||||
|
.map(|(i, spk)| (keychain.clone(), i, spk))
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed, but unused, spks of the given `keychain`.
|
||||||
|
pub fn unused_keychain_spks(
|
||||||
|
&self,
|
||||||
|
keychain: &K,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (u32, &Script)> + Clone {
|
||||||
|
let next_i = self.last_revealed.get(keychain).map_or(0, |&i| i + 1);
|
||||||
|
self.inner
|
||||||
|
.unused_spks((keychain.clone(), u32::MIN)..(keychain.clone(), next_i))
|
||||||
|
.map(|((_, i), spk)| (*i, spk))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the next derivation index for `keychain`. The next index is the index after the last revealed
|
||||||
|
/// derivation index.
|
||||||
|
///
|
||||||
|
/// The second field in the returned tuple represents whether the next derivation index is new.
|
||||||
|
/// There are two scenarios where the next derivation index is reused (not new):
|
||||||
|
///
|
||||||
|
/// 1. The keychain's descriptor has no wildcard, and a script has already been revealed.
|
||||||
|
/// 2. The number of revealed scripts has already reached 2^31 (refer to BIP-32).
|
||||||
|
///
|
||||||
|
/// Not checking the second field of the tuple may result in address reuse.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// Panics if the `keychain` does not exist.
|
||||||
|
pub fn next_index(&self, keychain: &K) -> (u32, bool) {
|
||||||
|
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||||
|
let last_index = self.last_revealed.get(keychain).cloned();
|
||||||
|
|
||||||
|
// we can only get the next index if the wildcard exists.
|
||||||
|
let has_wildcard = descriptor.has_wildcard();
|
||||||
|
|
||||||
|
match last_index {
|
||||||
|
// if there is no index, next_index is always 0.
|
||||||
|
None => (0, true),
|
||||||
|
// descriptors without wildcards can only have one index.
|
||||||
|
Some(_) if !has_wildcard => (0, false),
|
||||||
|
// derivation index must be < 2^31 (BIP-32).
|
||||||
|
Some(index) if index > BIP32_MAX_INDEX => {
|
||||||
|
unreachable!("index is out of bounds")
|
||||||
|
}
|
||||||
|
Some(index) if index == BIP32_MAX_INDEX => (index, false),
|
||||||
|
// get the next derivation index.
|
||||||
|
Some(index) => (index + 1, true),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the last derivation index that is revealed for each keychain.
|
||||||
|
///
|
||||||
|
/// Keychains with no revealed indices will not be included in the returned [`BTreeMap`].
|
||||||
|
pub fn last_revealed_indices(&self) -> &BTreeMap<K, u32> {
|
||||||
|
&self.last_revealed
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the last derivation index revealed for `keychain`.
|
||||||
|
pub fn last_revealed_index(&self, keychain: &K) -> Option<u32> {
|
||||||
|
self.last_revealed.get(keychain).cloned()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Convenience method to call [`Self::reveal_to_target`] on multiple keychains.
|
||||||
|
pub fn reveal_to_target_multi(
|
||||||
|
&mut self,
|
||||||
|
keychains: &BTreeMap<K, u32>,
|
||||||
|
) -> (
|
||||||
|
BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>>,
|
||||||
|
super::ChangeSet<K>,
|
||||||
|
) {
|
||||||
|
let mut changeset = super::ChangeSet::default();
|
||||||
|
let mut spks = BTreeMap::new();
|
||||||
|
|
||||||
|
for (keychain, &index) in keychains {
|
||||||
|
let (new_spks, new_changeset) = self.reveal_to_target(keychain, index);
|
||||||
|
if !new_changeset.is_empty() {
|
||||||
|
spks.insert(keychain.clone(), new_spks);
|
||||||
|
changeset.append(new_changeset.clone());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
(spks, changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Reveals script pubkeys of the `keychain`'s descriptor **up to and including** the
|
||||||
|
/// `target_index`.
|
||||||
|
///
|
||||||
|
/// If the `target_index` cannot be reached (due to the descriptor having no wildcard and/or
|
||||||
|
/// the `target_index` is in the hardened index range), this method will make a best-effort and
|
||||||
|
/// reveal up to the last possible index.
|
||||||
|
///
|
||||||
|
/// This returns an iterator of newly revealed indices (alongside their scripts) and a
|
||||||
|
/// [`super::ChangeSet`], which reports updates to the latest revealed index. If no new script
|
||||||
|
/// pubkeys are revealed, then both of these will be empty.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// Panics if `keychain` does not exist.
|
||||||
|
pub fn reveal_to_target(
|
||||||
|
&mut self,
|
||||||
|
keychain: &K,
|
||||||
|
target_index: u32,
|
||||||
|
) -> (
|
||||||
|
SpkIterator<Descriptor<DescriptorPublicKey>>,
|
||||||
|
super::ChangeSet<K>,
|
||||||
|
) {
|
||||||
|
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||||
|
let has_wildcard = descriptor.has_wildcard();
|
||||||
|
|
||||||
|
let target_index = if has_wildcard { target_index } else { 0 };
|
||||||
|
let next_reveal_index = self
|
||||||
|
.last_revealed
|
||||||
|
.get(keychain)
|
||||||
|
.map_or(0, |index| *index + 1);
|
||||||
|
|
||||||
|
debug_assert!(next_reveal_index + self.lookahead >= self.next_store_index(keychain));
|
||||||
|
|
||||||
|
// If the target_index is already revealed, we are done
|
||||||
|
if next_reveal_index > target_index {
|
||||||
|
return (
|
||||||
|
SpkIterator::new_with_range(
|
||||||
|
descriptor.clone(),
|
||||||
|
next_reveal_index..next_reveal_index,
|
||||||
|
),
|
||||||
|
super::ChangeSet::default(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// We range over the indexes that are not stored and insert their spks in the index.
|
||||||
|
// Indexes from next_reveal_index to next_reveal_index + lookahead are already stored (due
|
||||||
|
// to lookahead), so we only range from next_reveal_index + lookahead to target + lookahead
|
||||||
|
let range = next_reveal_index + self.lookahead..=target_index + self.lookahead;
|
||||||
|
for (new_index, new_spk) in SpkIterator::new_with_range(descriptor, range) {
|
||||||
|
let _inserted = self
|
||||||
|
.inner
|
||||||
|
.insert_spk((keychain.clone(), new_index), new_spk);
|
||||||
|
debug_assert!(_inserted, "must not have existing spk");
|
||||||
|
debug_assert!(
|
||||||
|
has_wildcard || new_index == 0,
|
||||||
|
"non-wildcard descriptors must not iterate past index 0"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
let _old_index = self.last_revealed.insert(keychain.clone(), target_index);
|
||||||
|
debug_assert!(_old_index < Some(target_index));
|
||||||
|
(
|
||||||
|
SpkIterator::new_with_range(descriptor.clone(), next_reveal_index..target_index + 1),
|
||||||
|
super::ChangeSet(core::iter::once((keychain.clone(), target_index)).collect()),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Attempts to reveal the next script pubkey for `keychain`.
|
||||||
|
///
|
||||||
|
/// Returns the derivation index of the revealed script pubkey, the revealed script pubkey and a
|
||||||
|
/// [`super::ChangeSet`] which represents changes in the last revealed index (if any).
|
||||||
|
///
|
||||||
|
/// When a new script cannot be revealed, we return the last revealed script and an empty
|
||||||
|
/// [`super::ChangeSet`]. There are two scenarios when a new script pubkey cannot be derived:
|
||||||
|
///
|
||||||
|
/// 1. The descriptor has no wildcard and already has one script revealed.
|
||||||
|
/// 2. The descriptor has already revealed scripts up to the numeric bound.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// Panics if the `keychain` does not exist.
|
||||||
|
pub fn reveal_next_spk(&mut self, keychain: &K) -> ((u32, &Script), super::ChangeSet<K>) {
|
||||||
|
let (next_index, _) = self.next_index(keychain);
|
||||||
|
let changeset = self.reveal_to_target(keychain, next_index).1;
|
||||||
|
let script = self
|
||||||
|
.inner
|
||||||
|
.spk_at_index(&(keychain.clone(), next_index))
|
||||||
|
.expect("script must already be stored");
|
||||||
|
((next_index, script), changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Gets the next unused script pubkey in the keychain. I.e., the script pubkey with the lowest
|
||||||
|
/// index that has not been used yet.
|
||||||
|
///
|
||||||
|
/// This will derive and reveal a new script pubkey if no more unused script pubkeys exist.
|
||||||
|
///
|
||||||
|
/// If the descriptor has no wildcard and already has a used script pubkey or if a descriptor
|
||||||
|
/// has used all scripts up to the derivation bounds, then the last derived script pubkey will be
|
||||||
|
/// returned.
|
||||||
|
///
|
||||||
|
/// # Panics
|
||||||
|
///
|
||||||
|
/// Panics if `keychain` has never been added to the index
|
||||||
|
pub fn next_unused_spk(&mut self, keychain: &K) -> ((u32, &Script), super::ChangeSet<K>) {
|
||||||
|
let need_new = self.unused_keychain_spks(keychain).next().is_none();
|
||||||
|
// this rather strange branch is needed because of some lifetime issues
|
||||||
|
if need_new {
|
||||||
|
self.reveal_next_spk(keychain)
|
||||||
|
} else {
|
||||||
|
(
|
||||||
|
self.unused_keychain_spks(keychain)
|
||||||
|
.next()
|
||||||
|
.expect("we already know next exists"),
|
||||||
|
super::ChangeSet::default(),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over all [`OutPoint`]s that point to `TxOut`s with script pubkeys derived from
|
||||||
|
/// `keychain`.
|
||||||
|
///
|
||||||
|
/// Use [`keychain_outpoints_in_range`](KeychainTxOutIndex::keychain_outpoints_in_range) to
|
||||||
|
/// iterate over a specific derivation range.
|
||||||
|
pub fn keychain_outpoints(
|
||||||
|
&self,
|
||||||
|
keychain: &K,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (u32, OutPoint)> + '_ {
|
||||||
|
self.keychain_outpoints_in_range(keychain, ..)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over [`OutPoint`]s that point to `TxOut`s with script pubkeys derived from
|
||||||
|
/// `keychain` in a given derivation `range`.
|
||||||
|
pub fn keychain_outpoints_in_range(
|
||||||
|
&self,
|
||||||
|
keychain: &K,
|
||||||
|
range: impl RangeBounds<u32>,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (u32, OutPoint)> + '_ {
|
||||||
|
let start = match range.start_bound() {
|
||||||
|
Bound::Included(i) => Bound::Included((keychain.clone(), *i)),
|
||||||
|
Bound::Excluded(i) => Bound::Excluded((keychain.clone(), *i)),
|
||||||
|
Bound::Unbounded => Bound::Unbounded,
|
||||||
|
};
|
||||||
|
let end = match range.end_bound() {
|
||||||
|
Bound::Included(i) => Bound::Included((keychain.clone(), *i)),
|
||||||
|
Bound::Excluded(i) => Bound::Excluded((keychain.clone(), *i)),
|
||||||
|
Bound::Unbounded => Bound::Unbounded,
|
||||||
|
};
|
||||||
|
self.inner
|
||||||
|
.outputs_in_range((start, end))
|
||||||
|
.map(|((_, i), op)| (*i, op))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the highest derivation index of the `keychain` where [`KeychainTxOutIndex`] has
|
||||||
|
/// found a [`TxOut`] with it's script pubkey.
|
||||||
|
pub fn last_used_index(&self, keychain: &K) -> Option<u32> {
|
||||||
|
self.keychain_outpoints(keychain).last().map(|(i, _)| i)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the highest derivation index of each keychain that [`KeychainTxOutIndex`] has found
|
||||||
|
/// a [`TxOut`] with it's script pubkey.
|
||||||
|
pub fn last_used_indices(&self) -> BTreeMap<K, u32> {
|
||||||
|
self.keychains
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(keychain, _)| {
|
||||||
|
self.last_used_index(keychain)
|
||||||
|
.map(|index| (keychain.clone(), index))
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Applies the derivation changeset to the [`KeychainTxOutIndex`], extending the number of
|
||||||
|
/// derived scripts per keychain, as specified in the `changeset`.
|
||||||
|
pub fn apply_changeset(&mut self, changeset: super::ChangeSet<K>) {
|
||||||
|
let _ = self.reveal_to_target_multi(&changeset.0);
|
||||||
|
}
|
||||||
|
}
|
||||||
101
crates/chain/src/lib.rs
Normal file
101
crates/chain/src/lib.rs
Normal file
@@ -0,0 +1,101 @@
|
|||||||
|
//! This crate is a collection of core structures for [Bitcoin Dev Kit].
|
||||||
|
//!
|
||||||
|
//! The goal of this crate is to give wallets the mechanisms needed to:
|
||||||
|
//!
|
||||||
|
//! 1. Figure out what data they need to fetch.
|
||||||
|
//! 2. Process the data in a way that never leads to inconsistent states.
|
||||||
|
//! 3. Fully index that data and expose it to be consumed without friction.
|
||||||
|
//!
|
||||||
|
//! Our design goals for these mechanisms are:
|
||||||
|
//!
|
||||||
|
//! 1. Data source agnostic -- nothing in `bdk_chain` cares about where you get data from or whether
|
||||||
|
//! you do it synchronously or asynchronously. If you know a fact about the blockchain, you can just
|
||||||
|
//! tell `bdk_chain`'s APIs about it, and that information will be integrated, if it can be done
|
||||||
|
//! consistently.
|
||||||
|
//! 2. Data persistence agnostic -- `bdk_chain` does not care where you cache on-chain data, what you
|
||||||
|
//! cache or how you retrieve it from persistent storage.
|
||||||
|
//!
|
||||||
|
//! [Bitcoin Dev Kit]: https://bitcoindevkit.org/
|
||||||
|
|
||||||
|
#![no_std]
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
|
pub use bitcoin;
|
||||||
|
mod spk_txout_index;
|
||||||
|
pub use spk_txout_index::*;
|
||||||
|
mod chain_data;
|
||||||
|
pub use chain_data::*;
|
||||||
|
pub mod indexed_tx_graph;
|
||||||
|
pub use indexed_tx_graph::IndexedTxGraph;
|
||||||
|
pub mod keychain;
|
||||||
|
pub mod local_chain;
|
||||||
|
mod tx_data_traits;
|
||||||
|
pub mod tx_graph;
|
||||||
|
pub use tx_data_traits::*;
|
||||||
|
pub use tx_graph::TxGraph;
|
||||||
|
mod chain_oracle;
|
||||||
|
pub use chain_oracle::*;
|
||||||
|
mod persist;
|
||||||
|
pub use persist::*;
|
||||||
|
|
||||||
|
#[doc(hidden)]
|
||||||
|
pub mod example_utils;
|
||||||
|
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
pub use miniscript;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
mod descriptor_ext;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
pub use descriptor_ext::DescriptorExt;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
mod spk_iter;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
pub use spk_iter::*;
|
||||||
|
|
||||||
|
#[allow(unused_imports)]
|
||||||
|
#[macro_use]
|
||||||
|
extern crate alloc;
|
||||||
|
|
||||||
|
#[cfg(feature = "serde")]
|
||||||
|
pub extern crate serde_crate as serde;
|
||||||
|
|
||||||
|
#[cfg(feature = "bincode")]
|
||||||
|
extern crate bincode;
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
#[macro_use]
|
||||||
|
extern crate std;
|
||||||
|
|
||||||
|
#[cfg(all(not(feature = "std"), feature = "hashbrown"))]
|
||||||
|
extern crate hashbrown;
|
||||||
|
|
||||||
|
// When no-std use `alloc`'s Hash collections. This is activated by default
|
||||||
|
#[cfg(all(not(feature = "std"), not(feature = "hashbrown")))]
|
||||||
|
#[doc(hidden)]
|
||||||
|
pub mod collections {
|
||||||
|
#![allow(dead_code)]
|
||||||
|
pub type HashSet<K> = alloc::collections::BTreeSet<K>;
|
||||||
|
pub type HashMap<K, V> = alloc::collections::BTreeMap<K, V>;
|
||||||
|
pub use alloc::collections::{btree_map as hash_map, *};
|
||||||
|
}
|
||||||
|
|
||||||
|
// When we have std, use `std`'s all collections
|
||||||
|
#[cfg(all(feature = "std", not(feature = "hashbrown")))]
|
||||||
|
#[doc(hidden)]
|
||||||
|
pub mod collections {
|
||||||
|
pub use std::collections::{hash_map, *};
|
||||||
|
}
|
||||||
|
|
||||||
|
// With this special feature `hashbrown`, use `hashbrown`'s hash collections, and else from `alloc`.
|
||||||
|
#[cfg(feature = "hashbrown")]
|
||||||
|
#[doc(hidden)]
|
||||||
|
pub mod collections {
|
||||||
|
#![allow(dead_code)]
|
||||||
|
pub type HashSet<K> = hashbrown::HashSet<K>;
|
||||||
|
pub type HashMap<K, V> = hashbrown::HashMap<K, V>;
|
||||||
|
pub use alloc::collections::*;
|
||||||
|
pub use hashbrown::hash_map;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// How many confirmations are needed f or a coinbase output to be spent.
|
||||||
|
pub const COINBASE_MATURITY: u32 = 100;
|
||||||
799
crates/chain/src/local_chain.rs
Normal file
799
crates/chain/src/local_chain.rs
Normal file
@@ -0,0 +1,799 @@
|
|||||||
|
//! The [`LocalChain`] is a local implementation of [`ChainOracle`].
|
||||||
|
|
||||||
|
use core::convert::Infallible;
|
||||||
|
|
||||||
|
use crate::collections::BTreeMap;
|
||||||
|
use crate::{BlockId, ChainOracle};
|
||||||
|
use alloc::sync::Arc;
|
||||||
|
use bitcoin::block::Header;
|
||||||
|
use bitcoin::BlockHash;
|
||||||
|
|
||||||
|
/// The [`ChangeSet`] represents changes to [`LocalChain`].
|
||||||
|
///
|
||||||
|
/// The key represents the block height, and the value either represents added a new [`CheckPoint`]
|
||||||
|
/// (if [`Some`]), or removing a [`CheckPoint`] (if [`None`]).
|
||||||
|
pub type ChangeSet = BTreeMap<u32, Option<BlockHash>>;
|
||||||
|
|
||||||
|
/// A [`LocalChain`] checkpoint is used to find the agreement point between two chains and as a
|
||||||
|
/// transaction anchor.
|
||||||
|
///
|
||||||
|
/// Each checkpoint contains the height and hash of a block ([`BlockId`]).
|
||||||
|
///
|
||||||
|
/// Internally, checkpoints are nodes of a reference-counted linked-list. This allows the caller to
|
||||||
|
/// cheaply clone a [`CheckPoint`] without copying the whole list and to view the entire chain
|
||||||
|
/// without holding a lock on [`LocalChain`].
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct CheckPoint(Arc<CPInner>);
|
||||||
|
|
||||||
|
/// The internal contents of [`CheckPoint`].
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
struct CPInner {
|
||||||
|
/// Block id (hash and height).
|
||||||
|
block: BlockId,
|
||||||
|
/// Previous checkpoint (if any).
|
||||||
|
prev: Option<Arc<CPInner>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl CheckPoint {
|
||||||
|
/// Construct a new base block at the front of a linked list.
|
||||||
|
pub fn new(block: BlockId) -> Self {
|
||||||
|
Self(Arc::new(CPInner { block, prev: None }))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a checkpoint from a list of [`BlockId`]s in ascending height order.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// This method will error if any of the follow occurs:
|
||||||
|
///
|
||||||
|
/// - The `blocks` iterator is empty, in which case, the error will be `None`.
|
||||||
|
/// - The `blocks` iterator is not in ascending height order.
|
||||||
|
/// - The `blocks` iterator contains multiple [`BlockId`]s of the same height.
|
||||||
|
///
|
||||||
|
/// The error type is the last successful checkpoint constructed (if any).
|
||||||
|
pub fn from_block_ids(
|
||||||
|
block_ids: impl IntoIterator<Item = BlockId>,
|
||||||
|
) -> Result<Self, Option<Self>> {
|
||||||
|
let mut blocks = block_ids.into_iter();
|
||||||
|
let mut acc = CheckPoint::new(blocks.next().ok_or(None)?);
|
||||||
|
for id in blocks {
|
||||||
|
acc = acc.push(id).map_err(Some)?;
|
||||||
|
}
|
||||||
|
Ok(acc)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a checkpoint from the given `header` and block `height`.
|
||||||
|
///
|
||||||
|
/// If `header` is of the genesis block, the checkpoint won't have a [`prev`] node. Otherwise,
|
||||||
|
/// we return a checkpoint linked with the previous block.
|
||||||
|
///
|
||||||
|
/// [`prev`]: CheckPoint::prev
|
||||||
|
pub fn from_header(header: &bitcoin::block::Header, height: u32) -> Self {
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let this_block_id = BlockId { height, hash };
|
||||||
|
|
||||||
|
let prev_height = match height.checked_sub(1) {
|
||||||
|
Some(h) => h,
|
||||||
|
None => return Self::new(this_block_id),
|
||||||
|
};
|
||||||
|
|
||||||
|
let prev_block_id = BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: header.prev_blockhash,
|
||||||
|
};
|
||||||
|
|
||||||
|
CheckPoint::new(prev_block_id)
|
||||||
|
.push(this_block_id)
|
||||||
|
.expect("must construct checkpoint")
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Convenience method to convert the [`CheckPoint`] into an [`Update`].
|
||||||
|
///
|
||||||
|
/// For more information, refer to [`Update`].
|
||||||
|
pub fn into_update(self, introduce_older_blocks: bool) -> Update {
|
||||||
|
Update {
|
||||||
|
tip: self,
|
||||||
|
introduce_older_blocks,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Puts another checkpoint onto the linked list representing the blockchain.
|
||||||
|
///
|
||||||
|
/// Returns an `Err(self)` if the block you are pushing on is not at a greater height that the one you
|
||||||
|
/// are pushing on to.
|
||||||
|
pub fn push(self, block: BlockId) -> Result<Self, Self> {
|
||||||
|
if self.height() < block.height {
|
||||||
|
Ok(Self(Arc::new(CPInner {
|
||||||
|
block,
|
||||||
|
prev: Some(self.0),
|
||||||
|
})))
|
||||||
|
} else {
|
||||||
|
Err(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Extends the checkpoint linked list by a iterator of block ids.
|
||||||
|
///
|
||||||
|
/// Returns an `Err(self)` if there is block which does not have a greater height than the
|
||||||
|
/// previous one.
|
||||||
|
pub fn extend(self, blocks: impl IntoIterator<Item = BlockId>) -> Result<Self, Self> {
|
||||||
|
let mut curr = self.clone();
|
||||||
|
for block in blocks {
|
||||||
|
curr = curr.push(block).map_err(|_| self.clone())?;
|
||||||
|
}
|
||||||
|
Ok(curr)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the [`BlockId`] of the checkpoint.
|
||||||
|
pub fn block_id(&self) -> BlockId {
|
||||||
|
self.0.block
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the height of the checkpoint.
|
||||||
|
pub fn height(&self) -> u32 {
|
||||||
|
self.0.block.height
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the block hash of the checkpoint.
|
||||||
|
pub fn hash(&self) -> BlockHash {
|
||||||
|
self.0.block.hash
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the previous checkpoint in the chain
|
||||||
|
pub fn prev(&self) -> Option<CheckPoint> {
|
||||||
|
self.0.prev.clone().map(CheckPoint)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate from this checkpoint in descending height.
|
||||||
|
pub fn iter(&self) -> CheckPointIter {
|
||||||
|
self.clone().into_iter()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterates over checkpoints backwards.
|
||||||
|
pub struct CheckPointIter {
|
||||||
|
current: Option<Arc<CPInner>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Iterator for CheckPointIter {
|
||||||
|
type Item = CheckPoint;
|
||||||
|
|
||||||
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
|
let current = self.current.clone()?;
|
||||||
|
self.current = current.prev.clone();
|
||||||
|
Some(CheckPoint(current))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl IntoIterator for CheckPoint {
|
||||||
|
type Item = CheckPoint;
|
||||||
|
type IntoIter = CheckPointIter;
|
||||||
|
|
||||||
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
|
CheckPointIter {
|
||||||
|
current: Some(self.0),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Used to update [`LocalChain`].
|
||||||
|
///
|
||||||
|
/// This is used as input for [`LocalChain::apply_update`]. It contains the update's chain `tip` and
|
||||||
|
/// a flag `introduce_older_blocks` which signals whether this update intends to introduce missing
|
||||||
|
/// blocks to the original chain.
|
||||||
|
///
|
||||||
|
/// Block-by-block syncing mechanisms would typically create updates that builds upon the previous
|
||||||
|
/// tip. In this case, `introduce_older_blocks` would be `false`.
|
||||||
|
///
|
||||||
|
/// Script-pubkey based syncing mechanisms may not introduce transactions in a chronological order
|
||||||
|
/// so some updates require introducing older blocks (to anchor older transactions). For
|
||||||
|
/// script-pubkey based syncing, `introduce_older_blocks` would typically be `true`.
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct Update {
|
||||||
|
/// The update chain's new tip.
|
||||||
|
pub tip: CheckPoint,
|
||||||
|
|
||||||
|
/// Whether the update allows for introducing older blocks.
|
||||||
|
///
|
||||||
|
/// Refer to [struct-level documentation] for more.
|
||||||
|
///
|
||||||
|
/// [struct-level documentation]: Update
|
||||||
|
pub introduce_older_blocks: bool,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// This is a local implementation of [`ChainOracle`].
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct LocalChain {
|
||||||
|
tip: CheckPoint,
|
||||||
|
index: BTreeMap<u32, BlockHash>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl PartialEq for LocalChain {
|
||||||
|
fn eq(&self, other: &Self) -> bool {
|
||||||
|
self.index == other.index
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<LocalChain> for BTreeMap<u32, BlockHash> {
|
||||||
|
fn from(value: LocalChain) -> Self {
|
||||||
|
value.index
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl ChainOracle for LocalChain {
|
||||||
|
type Error = Infallible;
|
||||||
|
|
||||||
|
fn is_block_in_chain(
|
||||||
|
&self,
|
||||||
|
block: BlockId,
|
||||||
|
chain_tip: BlockId,
|
||||||
|
) -> Result<Option<bool>, Self::Error> {
|
||||||
|
if block.height > chain_tip.height {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
Ok(
|
||||||
|
match (
|
||||||
|
self.index.get(&block.height),
|
||||||
|
self.index.get(&chain_tip.height),
|
||||||
|
) {
|
||||||
|
(Some(cp), Some(tip_cp)) => Some(*cp == block.hash && *tip_cp == chain_tip.hash),
|
||||||
|
_ => None,
|
||||||
|
},
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn get_chain_tip(&self) -> Result<BlockId, Self::Error> {
|
||||||
|
Ok(self.tip.block_id())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl LocalChain {
|
||||||
|
/// Get the genesis hash.
|
||||||
|
pub fn genesis_hash(&self) -> BlockHash {
|
||||||
|
self.index.get(&0).copied().expect("must have genesis hash")
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct [`LocalChain`] from genesis `hash`.
|
||||||
|
#[must_use]
|
||||||
|
pub fn from_genesis_hash(hash: BlockHash) -> (Self, ChangeSet) {
|
||||||
|
let height = 0;
|
||||||
|
let chain = Self {
|
||||||
|
tip: CheckPoint::new(BlockId { height, hash }),
|
||||||
|
index: core::iter::once((height, hash)).collect(),
|
||||||
|
};
|
||||||
|
let changeset = chain.initial_changeset();
|
||||||
|
(chain, changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a [`LocalChain`] from an initial `changeset`.
|
||||||
|
pub fn from_changeset(changeset: ChangeSet) -> Result<Self, MissingGenesisError> {
|
||||||
|
let genesis_entry = changeset.get(&0).copied().flatten();
|
||||||
|
let genesis_hash = match genesis_entry {
|
||||||
|
Some(hash) => hash,
|
||||||
|
None => return Err(MissingGenesisError),
|
||||||
|
};
|
||||||
|
|
||||||
|
let (mut chain, _) = Self::from_genesis_hash(genesis_hash);
|
||||||
|
chain.apply_changeset(&changeset)?;
|
||||||
|
|
||||||
|
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||||
|
debug_assert!(chain._check_changeset_is_applied(&changeset));
|
||||||
|
|
||||||
|
Ok(chain)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a [`LocalChain`] from a given `checkpoint` tip.
|
||||||
|
pub fn from_tip(tip: CheckPoint) -> Result<Self, MissingGenesisError> {
|
||||||
|
let mut chain = Self {
|
||||||
|
tip,
|
||||||
|
index: BTreeMap::new(),
|
||||||
|
};
|
||||||
|
chain.reindex(0);
|
||||||
|
|
||||||
|
if chain.index.get(&0).copied().is_none() {
|
||||||
|
return Err(MissingGenesisError);
|
||||||
|
}
|
||||||
|
|
||||||
|
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||||
|
Ok(chain)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Constructs a [`LocalChain`] from a [`BTreeMap`] of height to [`BlockHash`].
|
||||||
|
///
|
||||||
|
/// The [`BTreeMap`] enforces the height order. However, the caller must ensure the blocks are
|
||||||
|
/// all of the same chain.
|
||||||
|
pub fn from_blocks(blocks: BTreeMap<u32, BlockHash>) -> Result<Self, MissingGenesisError> {
|
||||||
|
if !blocks.contains_key(&0) {
|
||||||
|
return Err(MissingGenesisError);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut tip: Option<CheckPoint> = None;
|
||||||
|
|
||||||
|
for block in &blocks {
|
||||||
|
match tip {
|
||||||
|
Some(curr) => {
|
||||||
|
tip = Some(
|
||||||
|
curr.push(BlockId::from(block))
|
||||||
|
.expect("BTreeMap is ordered"),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
None => tip = Some(CheckPoint::new(BlockId::from(block))),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let chain = Self {
|
||||||
|
index: blocks,
|
||||||
|
tip: tip.expect("already checked to have genesis"),
|
||||||
|
};
|
||||||
|
|
||||||
|
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||||
|
Ok(chain)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the highest checkpoint.
|
||||||
|
pub fn tip(&self) -> CheckPoint {
|
||||||
|
self.tip.clone()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Applies the given `update` to the chain.
|
||||||
|
///
|
||||||
|
/// The method returns [`ChangeSet`] on success. This represents the applied changes to `self`.
|
||||||
|
///
|
||||||
|
/// There must be no ambiguity about which of the existing chain's blocks are still valid and
|
||||||
|
/// which are now invalid. That is, the new chain must implicitly connect to a definite block in
|
||||||
|
/// the existing chain and invalidate the block after it (if it exists) by including a block at
|
||||||
|
/// the same height but with a different hash to explicitly exclude it as a connection point.
|
||||||
|
///
|
||||||
|
/// Additionally, an empty chain can be updated with any chain, and a chain with a single block
|
||||||
|
/// can have it's block invalidated by an update chain with a block at the same height but
|
||||||
|
/// different hash.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// An error will occur if the update does not correctly connect with `self`.
|
||||||
|
///
|
||||||
|
/// Refer to [`Update`] for more about the update struct.
|
||||||
|
///
|
||||||
|
/// [module-level documentation]: crate::local_chain
|
||||||
|
pub fn apply_update(&mut self, update: Update) -> Result<ChangeSet, CannotConnectError> {
|
||||||
|
let changeset = merge_chains(
|
||||||
|
self.tip.clone(),
|
||||||
|
update.tip.clone(),
|
||||||
|
update.introduce_older_blocks,
|
||||||
|
)?;
|
||||||
|
// `._check_index_is_consistent_with_tip` and `._check_changeset_is_applied` is called in
|
||||||
|
// `.apply_changeset`
|
||||||
|
self.apply_changeset(&changeset)
|
||||||
|
.map_err(|_| CannotConnectError {
|
||||||
|
try_include_height: 0,
|
||||||
|
})?;
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Update the chain with a given [`Header`] at `height` which you claim is connected to a existing block in the chain.
|
||||||
|
///
|
||||||
|
/// This is useful when you have a block header that you want to record as part of the chain but
|
||||||
|
/// don't necessarily know that the `prev_blockhash` is in the chain.
|
||||||
|
///
|
||||||
|
/// This will usually insert two new [`BlockId`]s into the chain: the header's block and the
|
||||||
|
/// header's `prev_blockhash` block. `connected_to` must already be in the chain but is allowed
|
||||||
|
/// to be `prev_blockhash` (in which case only one new block id will be inserted).
|
||||||
|
/// To be successful, `connected_to` must be chosen carefully so that `LocalChain`'s [update
|
||||||
|
/// rules][`apply_update`] are satisfied.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// [`ApplyHeaderError::InconsistentBlocks`] occurs if the `connected_to` block and the
|
||||||
|
/// [`Header`] is inconsistent. For example, if the `connected_to` block is the same height as
|
||||||
|
/// `header` or `prev_blockhash`, but has a different block hash. Or if the `connected_to`
|
||||||
|
/// height is greater than the header's `height`.
|
||||||
|
///
|
||||||
|
/// [`ApplyHeaderError::CannotConnect`] occurs if the internal call to [`apply_update`] fails.
|
||||||
|
///
|
||||||
|
/// [`apply_update`]: Self::apply_update
|
||||||
|
pub fn apply_header_connected_to(
|
||||||
|
&mut self,
|
||||||
|
header: &Header,
|
||||||
|
height: u32,
|
||||||
|
connected_to: BlockId,
|
||||||
|
) -> Result<ChangeSet, ApplyHeaderError> {
|
||||||
|
let this = BlockId {
|
||||||
|
height,
|
||||||
|
hash: header.block_hash(),
|
||||||
|
};
|
||||||
|
let prev = height.checked_sub(1).map(|prev_height| BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: header.prev_blockhash,
|
||||||
|
});
|
||||||
|
let conn = match connected_to {
|
||||||
|
// `connected_to` can be ignored if same as `this` or `prev` (duplicate)
|
||||||
|
conn if conn == this || Some(conn) == prev => None,
|
||||||
|
// this occurs if:
|
||||||
|
// - `connected_to` height is the same as `prev`, but different hash
|
||||||
|
// - `connected_to` height is the same as `this`, but different hash
|
||||||
|
// - `connected_to` height is greater than `this` (this is not allowed)
|
||||||
|
conn if conn.height >= height.saturating_sub(1) => {
|
||||||
|
return Err(ApplyHeaderError::InconsistentBlocks)
|
||||||
|
}
|
||||||
|
conn => Some(conn),
|
||||||
|
};
|
||||||
|
|
||||||
|
let update = Update {
|
||||||
|
tip: CheckPoint::from_block_ids([conn, prev, Some(this)].into_iter().flatten())
|
||||||
|
.expect("block ids must be in order"),
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
};
|
||||||
|
|
||||||
|
self.apply_update(update)
|
||||||
|
.map_err(ApplyHeaderError::CannotConnect)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Update the chain with a given [`Header`] connecting it with the previous block.
|
||||||
|
///
|
||||||
|
/// This is a convenience method to call [`apply_header_connected_to`] with the `connected_to`
|
||||||
|
/// parameter being `height-1:prev_blockhash`. If there is no previous block (i.e. genesis), we
|
||||||
|
/// use the current block as `connected_to`.
|
||||||
|
///
|
||||||
|
/// [`apply_header_connected_to`]: LocalChain::apply_header_connected_to
|
||||||
|
pub fn apply_header(
|
||||||
|
&mut self,
|
||||||
|
header: &Header,
|
||||||
|
height: u32,
|
||||||
|
) -> Result<ChangeSet, CannotConnectError> {
|
||||||
|
let connected_to = match height.checked_sub(1) {
|
||||||
|
Some(prev_height) => BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: header.prev_blockhash,
|
||||||
|
},
|
||||||
|
None => BlockId {
|
||||||
|
height,
|
||||||
|
hash: header.block_hash(),
|
||||||
|
},
|
||||||
|
};
|
||||||
|
self.apply_header_connected_to(header, height, connected_to)
|
||||||
|
.map_err(|err| match err {
|
||||||
|
ApplyHeaderError::InconsistentBlocks => {
|
||||||
|
unreachable!("connected_to is derived from the block so is always consistent")
|
||||||
|
}
|
||||||
|
ApplyHeaderError::CannotConnect(err) => err,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Apply the given `changeset`.
|
||||||
|
pub fn apply_changeset(&mut self, changeset: &ChangeSet) -> Result<(), MissingGenesisError> {
|
||||||
|
if let Some(start_height) = changeset.keys().next().cloned() {
|
||||||
|
// changes after point of agreement
|
||||||
|
let mut extension = BTreeMap::default();
|
||||||
|
// point of agreement
|
||||||
|
let mut base: Option<CheckPoint> = None;
|
||||||
|
|
||||||
|
for cp in self.iter_checkpoints() {
|
||||||
|
if cp.height() >= start_height {
|
||||||
|
extension.insert(cp.height(), cp.hash());
|
||||||
|
} else {
|
||||||
|
base = Some(cp);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for (&height, &hash) in changeset {
|
||||||
|
match hash {
|
||||||
|
Some(hash) => {
|
||||||
|
extension.insert(height, hash);
|
||||||
|
}
|
||||||
|
None => {
|
||||||
|
extension.remove(&height);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
let new_tip = match base {
|
||||||
|
Some(base) => base
|
||||||
|
.extend(extension.into_iter().map(BlockId::from))
|
||||||
|
.expect("extension is strictly greater than base"),
|
||||||
|
None => LocalChain::from_blocks(extension)?.tip(),
|
||||||
|
};
|
||||||
|
self.tip = new_tip;
|
||||||
|
self.reindex(start_height);
|
||||||
|
|
||||||
|
debug_assert!(self._check_index_is_consistent_with_tip());
|
||||||
|
debug_assert!(self._check_changeset_is_applied(changeset));
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert a [`BlockId`].
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// Replacing the block hash of an existing checkpoint will result in an error.
|
||||||
|
pub fn insert_block(&mut self, block_id: BlockId) -> Result<ChangeSet, AlterCheckPointError> {
|
||||||
|
if let Some(&original_hash) = self.index.get(&block_id.height) {
|
||||||
|
if original_hash != block_id.hash {
|
||||||
|
return Err(AlterCheckPointError {
|
||||||
|
height: block_id.height,
|
||||||
|
original_hash,
|
||||||
|
update_hash: Some(block_id.hash),
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
return Ok(ChangeSet::default());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut changeset = ChangeSet::default();
|
||||||
|
changeset.insert(block_id.height, Some(block_id.hash));
|
||||||
|
self.apply_changeset(&changeset)
|
||||||
|
.map_err(|_| AlterCheckPointError {
|
||||||
|
height: 0,
|
||||||
|
original_hash: self.genesis_hash(),
|
||||||
|
update_hash: changeset.get(&0).cloned().flatten(),
|
||||||
|
})?;
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Removes blocks from (and inclusive of) the given `block_id`.
|
||||||
|
///
|
||||||
|
/// This will remove blocks with a height equal or greater than `block_id`, but only if
|
||||||
|
/// `block_id` exists in the chain.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// This will fail with [`MissingGenesisError`] if the caller attempts to disconnect from the
|
||||||
|
/// genesis block.
|
||||||
|
pub fn disconnect_from(&mut self, block_id: BlockId) -> Result<ChangeSet, MissingGenesisError> {
|
||||||
|
if self.index.get(&block_id.height) != Some(&block_id.hash) {
|
||||||
|
return Ok(ChangeSet::default());
|
||||||
|
}
|
||||||
|
|
||||||
|
let changeset = self
|
||||||
|
.index
|
||||||
|
.range(block_id.height..)
|
||||||
|
.map(|(&height, _)| (height, None))
|
||||||
|
.collect::<ChangeSet>();
|
||||||
|
self.apply_changeset(&changeset).map(|_| changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Reindex the heights in the chain from (and including) `from` height
|
||||||
|
fn reindex(&mut self, from: u32) {
|
||||||
|
let _ = self.index.split_off(&from);
|
||||||
|
for cp in self.iter_checkpoints() {
|
||||||
|
if cp.height() < from {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
self.index.insert(cp.height(), cp.hash());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Derives an initial [`ChangeSet`], meaning that it can be applied to an empty chain to
|
||||||
|
/// recover the current chain.
|
||||||
|
pub fn initial_changeset(&self) -> ChangeSet {
|
||||||
|
self.index.iter().map(|(k, v)| (*k, Some(*v))).collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over checkpoints in descending height order.
|
||||||
|
pub fn iter_checkpoints(&self) -> CheckPointIter {
|
||||||
|
CheckPointIter {
|
||||||
|
current: Some(self.tip.0.clone()),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the internal index mapping the height to block hash.
|
||||||
|
pub fn blocks(&self) -> &BTreeMap<u32, BlockHash> {
|
||||||
|
&self.index
|
||||||
|
}
|
||||||
|
|
||||||
|
fn _check_index_is_consistent_with_tip(&self) -> bool {
|
||||||
|
let tip_history = self
|
||||||
|
.tip
|
||||||
|
.iter()
|
||||||
|
.map(|cp| (cp.height(), cp.hash()))
|
||||||
|
.collect::<BTreeMap<_, _>>();
|
||||||
|
self.index == tip_history
|
||||||
|
}
|
||||||
|
|
||||||
|
fn _check_changeset_is_applied(&self, changeset: &ChangeSet) -> bool {
|
||||||
|
for (height, exp_hash) in changeset {
|
||||||
|
if self.index.get(height) != exp_hash.as_ref() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
true
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An error which occurs when a [`LocalChain`] is constructed without a genesis checkpoint.
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
pub struct MissingGenesisError;
|
||||||
|
|
||||||
|
impl core::fmt::Display for MissingGenesisError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"cannot construct `LocalChain` without a genesis checkpoint"
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for MissingGenesisError {}
|
||||||
|
|
||||||
|
/// Represents a failure when trying to insert/remove a checkpoint to/from [`LocalChain`].
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
pub struct AlterCheckPointError {
|
||||||
|
/// The checkpoint's height.
|
||||||
|
pub height: u32,
|
||||||
|
/// The original checkpoint's block hash which cannot be replaced/removed.
|
||||||
|
pub original_hash: BlockHash,
|
||||||
|
/// The attempted update to the `original_block` hash.
|
||||||
|
pub update_hash: Option<BlockHash>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for AlterCheckPointError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self.update_hash {
|
||||||
|
Some(update_hash) => write!(
|
||||||
|
f,
|
||||||
|
"failed to insert block at height {}: original={} update={}",
|
||||||
|
self.height, self.original_hash, update_hash
|
||||||
|
),
|
||||||
|
None => write!(
|
||||||
|
f,
|
||||||
|
"failed to remove block at height {}: original={}",
|
||||||
|
self.height, self.original_hash
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AlterCheckPointError {}
|
||||||
|
|
||||||
|
/// Occurs when an update does not have a common checkpoint with the original chain.
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
pub struct CannotConnectError {
|
||||||
|
/// The suggested checkpoint to include to connect the two chains.
|
||||||
|
pub try_include_height: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for CannotConnectError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"introduced chain cannot connect with the original chain, try include height {}",
|
||||||
|
self.try_include_height,
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for CannotConnectError {}
|
||||||
|
|
||||||
|
/// The error type for [`LocalChain::apply_header_connected_to`].
|
||||||
|
#[derive(Debug, Clone, PartialEq)]
|
||||||
|
pub enum ApplyHeaderError {
|
||||||
|
/// Occurs when `connected_to` block conflicts with either the current block or previous block.
|
||||||
|
InconsistentBlocks,
|
||||||
|
/// Occurs when the update cannot connect with the original chain.
|
||||||
|
CannotConnect(CannotConnectError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for ApplyHeaderError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
ApplyHeaderError::InconsistentBlocks => write!(
|
||||||
|
f,
|
||||||
|
"the `connected_to` block conflicts with either the current or previous block"
|
||||||
|
),
|
||||||
|
ApplyHeaderError::CannotConnect(err) => core::fmt::Display::fmt(err, f),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for ApplyHeaderError {}
|
||||||
|
|
||||||
|
fn merge_chains(
|
||||||
|
original_tip: CheckPoint,
|
||||||
|
update_tip: CheckPoint,
|
||||||
|
introduce_older_blocks: bool,
|
||||||
|
) -> Result<ChangeSet, CannotConnectError> {
|
||||||
|
let mut changeset = ChangeSet::default();
|
||||||
|
let mut orig = original_tip.into_iter();
|
||||||
|
let mut update = update_tip.into_iter();
|
||||||
|
let mut curr_orig = None;
|
||||||
|
let mut curr_update = None;
|
||||||
|
let mut prev_orig: Option<CheckPoint> = None;
|
||||||
|
let mut prev_update: Option<CheckPoint> = None;
|
||||||
|
let mut point_of_agreement_found = false;
|
||||||
|
let mut prev_orig_was_invalidated = false;
|
||||||
|
let mut potentially_invalidated_heights = vec![];
|
||||||
|
|
||||||
|
// To find the difference between the new chain and the original we iterate over both of them
|
||||||
|
// from the tip backwards in tandem. We always dealing with the highest one from either chain
|
||||||
|
// first and move to the next highest. The crucial logic is applied when they have blocks at the
|
||||||
|
// same height.
|
||||||
|
loop {
|
||||||
|
if curr_orig.is_none() {
|
||||||
|
curr_orig = orig.next();
|
||||||
|
}
|
||||||
|
if curr_update.is_none() {
|
||||||
|
curr_update = update.next();
|
||||||
|
}
|
||||||
|
|
||||||
|
match (curr_orig.as_ref(), curr_update.as_ref()) {
|
||||||
|
// Update block that doesn't exist in the original chain
|
||||||
|
(o, Some(u)) if Some(u.height()) > o.map(|o| o.height()) => {
|
||||||
|
changeset.insert(u.height(), Some(u.hash()));
|
||||||
|
prev_update = curr_update.take();
|
||||||
|
}
|
||||||
|
// Original block that isn't in the update
|
||||||
|
(Some(o), u) if Some(o.height()) > u.map(|u| u.height()) => {
|
||||||
|
// this block might be gone if an earlier block gets invalidated
|
||||||
|
potentially_invalidated_heights.push(o.height());
|
||||||
|
prev_orig_was_invalidated = false;
|
||||||
|
prev_orig = curr_orig.take();
|
||||||
|
|
||||||
|
// OPTIMIZATION: we have run out of update blocks so we don't need to continue
|
||||||
|
// iterating because there's no possibility of adding anything to changeset.
|
||||||
|
if u.is_none() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
(Some(o), Some(u)) => {
|
||||||
|
if o.hash() == u.hash() {
|
||||||
|
// We have found our point of agreement 🎉 -- we require that the previous (i.e.
|
||||||
|
// higher because we are iterating backwards) block in the original chain was
|
||||||
|
// invalidated (if it exists). This ensures that there is an unambiguous point of
|
||||||
|
// connection to the original chain from the update chain (i.e. we know the
|
||||||
|
// precisely which original blocks are invalid).
|
||||||
|
if !prev_orig_was_invalidated && !point_of_agreement_found {
|
||||||
|
if let (Some(prev_orig), Some(_prev_update)) = (&prev_orig, &prev_update) {
|
||||||
|
return Err(CannotConnectError {
|
||||||
|
try_include_height: prev_orig.height(),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
point_of_agreement_found = true;
|
||||||
|
prev_orig_was_invalidated = false;
|
||||||
|
// OPTIMIZATION 1 -- If we know that older blocks cannot be introduced without
|
||||||
|
// invalidation, we can break after finding the point of agreement.
|
||||||
|
// OPTIMIZATION 2 -- if we have the same underlying pointer at this point, we
|
||||||
|
// can guarantee that no older blocks are introduced.
|
||||||
|
if !introduce_older_blocks || Arc::as_ptr(&o.0) == Arc::as_ptr(&u.0) {
|
||||||
|
return Ok(changeset);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// We have an invalidation height so we set the height to the updated hash and
|
||||||
|
// also purge all the original chain block hashes above this block.
|
||||||
|
changeset.insert(u.height(), Some(u.hash()));
|
||||||
|
for invalidated_height in potentially_invalidated_heights.drain(..) {
|
||||||
|
changeset.insert(invalidated_height, None);
|
||||||
|
}
|
||||||
|
prev_orig_was_invalidated = true;
|
||||||
|
}
|
||||||
|
prev_update = curr_update.take();
|
||||||
|
prev_orig = curr_orig.take();
|
||||||
|
}
|
||||||
|
(None, None) => {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
_ => {
|
||||||
|
unreachable!("compiler cannot tell that everything has been covered")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// When we don't have a point of agreement you can imagine it is implicitly the
|
||||||
|
// genesis block so we need to do the final connectivity check which in this case
|
||||||
|
// just means making sure the entire original chain was invalidated.
|
||||||
|
if !prev_orig_was_invalidated && !point_of_agreement_found {
|
||||||
|
if let Some(prev_orig) = prev_orig {
|
||||||
|
return Err(CannotConnectError {
|
||||||
|
try_include_height: prev_orig.height(),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
109
crates/chain/src/persist.rs
Normal file
109
crates/chain/src/persist.rs
Normal file
@@ -0,0 +1,109 @@
|
|||||||
|
use core::convert::Infallible;
|
||||||
|
|
||||||
|
use crate::Append;
|
||||||
|
|
||||||
|
/// `Persist` wraps a [`PersistBackend`] (`B`) to create a convenient staging area for changes (`C`)
|
||||||
|
/// before they are persisted.
|
||||||
|
///
|
||||||
|
/// Not all changes to the in-memory representation needs to be written to disk right away, so
|
||||||
|
/// [`Persist::stage`] can be used to *stage* changes first and then [`Persist::commit`] can be used
|
||||||
|
/// to write changes to disk.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct Persist<B, C> {
|
||||||
|
backend: B,
|
||||||
|
stage: C,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<B, C> Persist<B, C>
|
||||||
|
where
|
||||||
|
B: PersistBackend<C>,
|
||||||
|
C: Default + Append,
|
||||||
|
{
|
||||||
|
/// Create a new [`Persist`] from [`PersistBackend`].
|
||||||
|
pub fn new(backend: B) -> Self {
|
||||||
|
Self {
|
||||||
|
backend,
|
||||||
|
stage: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Stage a `changeset` to be committed later with [`commit`].
|
||||||
|
///
|
||||||
|
/// [`commit`]: Self::commit
|
||||||
|
pub fn stage(&mut self, changeset: C) {
|
||||||
|
self.stage.append(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the changes that have not been committed yet.
|
||||||
|
pub fn staged(&self) -> &C {
|
||||||
|
&self.stage
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Commit the staged changes to the underlying persistence backend.
|
||||||
|
///
|
||||||
|
/// Changes that are committed (if any) are returned.
|
||||||
|
///
|
||||||
|
/// # Error
|
||||||
|
///
|
||||||
|
/// Returns a backend-defined error if this fails.
|
||||||
|
pub fn commit(&mut self) -> Result<Option<C>, B::WriteError> {
|
||||||
|
if self.stage.is_empty() {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
self.backend
|
||||||
|
.write_changes(&self.stage)
|
||||||
|
// if written successfully, take and return `self.stage`
|
||||||
|
.map(|_| Some(core::mem::take(&mut self.stage)))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Stages a new changeset and commits it (along with any other previously staged changes) to
|
||||||
|
/// the persistence backend
|
||||||
|
///
|
||||||
|
/// Convience method for calling [`stage`] and then [`commit`].
|
||||||
|
///
|
||||||
|
/// [`stage`]: Self::stage
|
||||||
|
/// [`commit`]: Self::commit
|
||||||
|
pub fn stage_and_commit(&mut self, changeset: C) -> Result<Option<C>, B::WriteError> {
|
||||||
|
self.stage(changeset);
|
||||||
|
self.commit()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A persistence backend for [`Persist`].
|
||||||
|
///
|
||||||
|
/// `C` represents the changeset; a datatype that records changes made to in-memory data structures
|
||||||
|
/// that are to be persisted, or retrieved from persistence.
|
||||||
|
pub trait PersistBackend<C> {
|
||||||
|
/// The error the backend returns when it fails to write.
|
||||||
|
type WriteError: core::fmt::Debug;
|
||||||
|
|
||||||
|
/// The error the backend returns when it fails to load changesets `C`.
|
||||||
|
type LoadError: core::fmt::Debug;
|
||||||
|
|
||||||
|
/// Writes a changeset to the persistence backend.
|
||||||
|
///
|
||||||
|
/// It is up to the backend what it does with this. It could store every changeset in a list or
|
||||||
|
/// it inserts the actual changes into a more structured database. All it needs to guarantee is
|
||||||
|
/// that [`load_from_persistence`] restores a keychain tracker to what it should be if all
|
||||||
|
/// changesets had been applied sequentially.
|
||||||
|
///
|
||||||
|
/// [`load_from_persistence`]: Self::load_from_persistence
|
||||||
|
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError>;
|
||||||
|
|
||||||
|
/// Return the aggregate changeset `C` from persistence.
|
||||||
|
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError>;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> PersistBackend<C> for () {
|
||||||
|
type WriteError = Infallible;
|
||||||
|
|
||||||
|
type LoadError = Infallible;
|
||||||
|
|
||||||
|
fn write_changes(&mut self, _changeset: &C) -> Result<(), Self::WriteError> {
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||||
|
Ok(None)
|
||||||
|
}
|
||||||
|
}
|
||||||
274
crates/chain/src/spk_iter.rs
Normal file
274
crates/chain/src/spk_iter.rs
Normal file
@@ -0,0 +1,274 @@
|
|||||||
|
use crate::{
|
||||||
|
bitcoin::{secp256k1::Secp256k1, ScriptBuf},
|
||||||
|
miniscript::{Descriptor, DescriptorPublicKey},
|
||||||
|
};
|
||||||
|
use core::{borrow::Borrow, ops::Bound, ops::RangeBounds};
|
||||||
|
|
||||||
|
/// Maximum [BIP32](https://bips.xyz/32) derivation index.
|
||||||
|
pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
||||||
|
|
||||||
|
/// An iterator for derived script pubkeys.
|
||||||
|
///
|
||||||
|
/// [`SpkIterator`] is an implementation of the [`Iterator`] trait which possesses its own `next()`
|
||||||
|
/// and `nth()` functions, both of which circumvent the unnecessary intermediate derivations required
|
||||||
|
/// when using their default implementations.
|
||||||
|
///
|
||||||
|
/// ## Examples
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// use bdk_chain::SpkIterator;
|
||||||
|
/// # use miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
|
/// # use bitcoin::{secp256k1::Secp256k1};
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
/// # let (descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||||
|
/// # let external_spk_0 = descriptor.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
/// # let external_spk_3 = descriptor.at_derivation_index(3).unwrap().script_pubkey();
|
||||||
|
/// # let external_spk_4 = descriptor.at_derivation_index(4).unwrap().script_pubkey();
|
||||||
|
///
|
||||||
|
/// // Creates a new script pubkey iterator starting at 0 from a descriptor.
|
||||||
|
/// let mut spk_iter = SpkIterator::new(&descriptor);
|
||||||
|
/// assert_eq!(spk_iter.next(), Some((0, external_spk_0)));
|
||||||
|
/// assert_eq!(spk_iter.next(), None);
|
||||||
|
/// ```
|
||||||
|
#[derive(Clone)]
|
||||||
|
pub struct SpkIterator<D> {
|
||||||
|
next_index: u32,
|
||||||
|
end: u32,
|
||||||
|
descriptor: D,
|
||||||
|
secp: Secp256k1<bitcoin::secp256k1::VerifyOnly>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<D> SpkIterator<D>
|
||||||
|
where
|
||||||
|
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||||
|
{
|
||||||
|
/// Create a new script pubkey iterator from `descriptor`.
|
||||||
|
///
|
||||||
|
/// This iterates from derivation index 0 and stops at index 0x7FFFFFFF (as specified in
|
||||||
|
/// BIP-32). Non-wildcard descriptors will only return one script pubkey at derivation index 0.
|
||||||
|
///
|
||||||
|
/// Use [`new_with_range`](SpkIterator::new_with_range) to create an iterator with a specified
|
||||||
|
/// derivation index range.
|
||||||
|
pub fn new(descriptor: D) -> Self {
|
||||||
|
SpkIterator::new_with_range(descriptor, 0..=BIP32_MAX_INDEX)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Create a new script pubkey iterator from `descriptor` and a given `range`.
|
||||||
|
///
|
||||||
|
/// Non-wildcard descriptors will only emit a single script pubkey (at derivation index 0).
|
||||||
|
/// Wildcard descriptors have an end-bound of 0x7FFFFFFF (inclusive).
|
||||||
|
///
|
||||||
|
/// Refer to [`new`](SpkIterator::new) for more.
|
||||||
|
pub fn new_with_range<R>(descriptor: D, range: R) -> Self
|
||||||
|
where
|
||||||
|
R: RangeBounds<u32>,
|
||||||
|
{
|
||||||
|
let start = match range.start_bound() {
|
||||||
|
Bound::Included(start) => *start,
|
||||||
|
Bound::Excluded(start) => *start + 1,
|
||||||
|
Bound::Unbounded => u32::MIN,
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut end = match range.end_bound() {
|
||||||
|
Bound::Included(end) => *end + 1,
|
||||||
|
Bound::Excluded(end) => *end,
|
||||||
|
Bound::Unbounded => u32::MAX,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Because `end` is exclusive, we want the maximum value to be BIP32_MAX_INDEX + 1.
|
||||||
|
end = end.min(BIP32_MAX_INDEX + 1);
|
||||||
|
|
||||||
|
Self {
|
||||||
|
next_index: start,
|
||||||
|
end,
|
||||||
|
descriptor,
|
||||||
|
secp: Secp256k1::verification_only(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the internal descriptor.
|
||||||
|
pub fn descriptor(&self) -> &D {
|
||||||
|
&self.descriptor
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<D> Iterator for SpkIterator<D>
|
||||||
|
where
|
||||||
|
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||||
|
{
|
||||||
|
type Item = (u32, ScriptBuf);
|
||||||
|
|
||||||
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
|
// For non-wildcard descriptors, we expect the first element to be Some((0, spk)), then None after.
|
||||||
|
// For wildcard descriptors, we expect it to keep iterating until exhausted.
|
||||||
|
if self.next_index >= self.end {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If the descriptor is non-wildcard, only index 0 will return an spk.
|
||||||
|
if !self.descriptor.borrow().has_wildcard() && self.next_index != 0 {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
let script = self
|
||||||
|
.descriptor
|
||||||
|
.borrow()
|
||||||
|
.derived_descriptor(&self.secp, self.next_index)
|
||||||
|
.expect("the descriptor cannot need hardened derivation")
|
||||||
|
.script_pubkey();
|
||||||
|
let output = (self.next_index, script);
|
||||||
|
|
||||||
|
self.next_index += 1;
|
||||||
|
|
||||||
|
Some(output)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn nth(&mut self, n: usize) -> Option<Self::Item> {
|
||||||
|
self.next_index = self
|
||||||
|
.next_index
|
||||||
|
.saturating_add(u32::try_from(n).unwrap_or(u32::MAX));
|
||||||
|
self.next()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod test {
|
||||||
|
use crate::{
|
||||||
|
bitcoin::secp256k1::Secp256k1,
|
||||||
|
keychain::KeychainTxOutIndex,
|
||||||
|
miniscript::{Descriptor, DescriptorPublicKey},
|
||||||
|
spk_iter::{SpkIterator, BIP32_MAX_INDEX},
|
||||||
|
};
|
||||||
|
|
||||||
|
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||||
|
enum TestKeychain {
|
||||||
|
External,
|
||||||
|
Internal,
|
||||||
|
}
|
||||||
|
|
||||||
|
fn init_txout_index() -> (
|
||||||
|
KeychainTxOutIndex<TestKeychain>,
|
||||||
|
Descriptor<DescriptorPublicKey>,
|
||||||
|
Descriptor<DescriptorPublicKey>,
|
||||||
|
) {
|
||||||
|
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::new(0);
|
||||||
|
|
||||||
|
let secp = Secp256k1::signing_only();
|
||||||
|
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||||
|
let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||||
|
|
||||||
|
txout_index.add_keychain(TestKeychain::External, external_descriptor.clone());
|
||||||
|
txout_index.add_keychain(TestKeychain::Internal, internal_descriptor.clone());
|
||||||
|
|
||||||
|
(txout_index, external_descriptor, internal_descriptor)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[allow(clippy::iter_nth_zero)]
|
||||||
|
#[rustfmt::skip]
|
||||||
|
fn test_spkiterator_wildcard() {
|
||||||
|
let (_, external_desc, _) = init_txout_index();
|
||||||
|
let external_spk_0 = external_desc.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
let external_spk_16 = external_desc.at_derivation_index(16).unwrap().script_pubkey();
|
||||||
|
let external_spk_20 = external_desc.at_derivation_index(20).unwrap().script_pubkey();
|
||||||
|
let external_spk_21 = external_desc.at_derivation_index(21).unwrap().script_pubkey();
|
||||||
|
let external_spk_max = external_desc.at_derivation_index(BIP32_MAX_INDEX).unwrap().script_pubkey();
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new(&external_desc);
|
||||||
|
let max_index = BIP32_MAX_INDEX - 22;
|
||||||
|
|
||||||
|
assert_eq!(external_spk.next(), Some((0, external_spk_0)));
|
||||||
|
assert_eq!(external_spk.nth(15), Some((16, external_spk_16)));
|
||||||
|
assert_eq!(external_spk.nth(3), Some((20, external_spk_20.clone())));
|
||||||
|
assert_eq!(external_spk.next(), Some((21, external_spk_21)));
|
||||||
|
assert_eq!(
|
||||||
|
external_spk.nth(max_index as usize),
|
||||||
|
Some((BIP32_MAX_INDEX, external_spk_max))
|
||||||
|
);
|
||||||
|
assert_eq!(external_spk.nth(0), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||||
|
assert_eq!(external_spk.nth(20), Some((20, external_spk_20)));
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||||
|
assert_eq!(external_spk.nth(21), None);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[allow(clippy::iter_nth_zero)]
|
||||||
|
fn test_spkiterator_non_wildcard() {
|
||||||
|
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||||
|
let external_spk_0 = no_wildcard_descriptor
|
||||||
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey();
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.next(), Some((0, external_spk_0.clone())));
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.nth(0), Some((0, external_spk_0.clone())));
|
||||||
|
assert_eq!(external_spk.nth(0), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..0);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..1);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.nth(0), Some((0, external_spk_0.clone())));
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
// We test that using new_with_range with range_len > 1 gives back an iterator with
|
||||||
|
// range_len = 1
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..10);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.nth(0), Some((0, external_spk_0)));
|
||||||
|
assert_eq!(external_spk.nth(0), None);
|
||||||
|
|
||||||
|
// non index-0 should NOT return an spk
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..1).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..=1).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..2).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..=2).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 10..11).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 10..=10).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// The following dummy traits were created to test if SpkIterator is working properly.
|
||||||
|
trait TestSendStatic: Send + 'static {
|
||||||
|
fn test(&self) -> u32 {
|
||||||
|
20
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestSendStatic for SpkIterator<Descriptor<DescriptorPublicKey>> {
|
||||||
|
fn test(&self) -> u32 {
|
||||||
|
20
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
324
crates/chain/src/spk_txout_index.rs
Normal file
324
crates/chain/src/spk_txout_index.rs
Normal file
@@ -0,0 +1,324 @@
|
|||||||
|
use core::ops::RangeBounds;
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
collections::{hash_map::Entry, BTreeMap, BTreeSet, HashMap},
|
||||||
|
indexed_tx_graph::Indexer,
|
||||||
|
};
|
||||||
|
use bitcoin::{self, OutPoint, Script, ScriptBuf, Transaction, TxOut, Txid};
|
||||||
|
|
||||||
|
/// An index storing [`TxOut`]s that have a script pubkey that matches those in a list.
|
||||||
|
///
|
||||||
|
/// The basic idea is that you insert script pubkeys you care about into the index with
|
||||||
|
/// [`insert_spk`] and then when you call [`Indexer::index_tx`] or [`Indexer::index_txout`], the
|
||||||
|
/// index will look at any txouts you pass in and store and index any txouts matching one of its
|
||||||
|
/// script pubkeys.
|
||||||
|
///
|
||||||
|
/// Each script pubkey is associated with an application-defined index script index `I`, which must be
|
||||||
|
/// [`Ord`]. Usually, this is used to associate the derivation index of the script pubkey or even a
|
||||||
|
/// combination of `(keychain, derivation_index)`.
|
||||||
|
///
|
||||||
|
/// Note there is no harm in scanning transactions that disappear from the blockchain or were never
|
||||||
|
/// in there in the first place. `SpkTxOutIndex` is intentionally *monotone* -- you cannot delete or
|
||||||
|
/// modify txouts that have been indexed. To find out which txouts from the index are actually in the
|
||||||
|
/// chain or unspent, you must use other sources of information like a [`TxGraph`].
|
||||||
|
///
|
||||||
|
/// [`TxOut`]: bitcoin::TxOut
|
||||||
|
/// [`insert_spk`]: Self::insert_spk
|
||||||
|
/// [`Ord`]: core::cmp::Ord
|
||||||
|
/// [`TxGraph`]: crate::tx_graph::TxGraph
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub struct SpkTxOutIndex<I> {
|
||||||
|
/// script pubkeys ordered by index
|
||||||
|
spks: BTreeMap<I, ScriptBuf>,
|
||||||
|
/// A reverse lookup from spk to spk index
|
||||||
|
spk_indices: HashMap<ScriptBuf, I>,
|
||||||
|
/// The set of unused indexes.
|
||||||
|
unused: BTreeSet<I>,
|
||||||
|
/// Lookup index and txout by outpoint.
|
||||||
|
txouts: BTreeMap<OutPoint, (I, TxOut)>,
|
||||||
|
/// Lookup from spk index to outpoints that had that spk
|
||||||
|
spk_txouts: BTreeSet<(I, OutPoint)>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<I> Default for SpkTxOutIndex<I> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self {
|
||||||
|
txouts: Default::default(),
|
||||||
|
spks: Default::default(),
|
||||||
|
spk_indices: Default::default(),
|
||||||
|
spk_txouts: Default::default(),
|
||||||
|
unused: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<I: Clone + Ord> Indexer for SpkTxOutIndex<I> {
|
||||||
|
type ChangeSet = ();
|
||||||
|
|
||||||
|
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet {
|
||||||
|
self.scan_txout(outpoint, txout);
|
||||||
|
Default::default()
|
||||||
|
}
|
||||||
|
|
||||||
|
fn index_tx(&mut self, tx: &Transaction) -> Self::ChangeSet {
|
||||||
|
self.scan(tx);
|
||||||
|
Default::default()
|
||||||
|
}
|
||||||
|
|
||||||
|
fn initial_changeset(&self) -> Self::ChangeSet {}
|
||||||
|
|
||||||
|
fn apply_changeset(&mut self, _changeset: Self::ChangeSet) {
|
||||||
|
// This applies nothing.
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_tx_relevant(&self, tx: &Transaction) -> bool {
|
||||||
|
self.is_relevant(tx)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||||
|
/// Scans a transaction's outputs for matching script pubkeys.
|
||||||
|
///
|
||||||
|
/// Typically, this is used in two situations:
|
||||||
|
///
|
||||||
|
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
||||||
|
/// your txouts.
|
||||||
|
/// 2. When getting new data from the chain, you usually scan it before incorporating it into your chain state.
|
||||||
|
pub fn scan(&mut self, tx: &Transaction) -> BTreeSet<I> {
|
||||||
|
let mut scanned_indices = BTreeSet::new();
|
||||||
|
let txid = tx.txid();
|
||||||
|
for (i, txout) in tx.output.iter().enumerate() {
|
||||||
|
let op = OutPoint::new(txid, i as u32);
|
||||||
|
if let Some(spk_i) = self.scan_txout(op, txout) {
|
||||||
|
scanned_indices.insert(spk_i.clone());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
scanned_indices
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Scan a single `TxOut` for a matching script pubkey and returns the index that matches the
|
||||||
|
/// script pubkey (if any).
|
||||||
|
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> Option<&I> {
|
||||||
|
let spk_i = self.spk_indices.get(&txout.script_pubkey);
|
||||||
|
if let Some(spk_i) = spk_i {
|
||||||
|
self.txouts.insert(op, (spk_i.clone(), txout.clone()));
|
||||||
|
self.spk_txouts.insert((spk_i.clone(), op));
|
||||||
|
self.unused.remove(spk_i);
|
||||||
|
}
|
||||||
|
spk_i
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the set of indexed outpoints.
|
||||||
|
pub fn outpoints(&self) -> &BTreeSet<(I, OutPoint)> {
|
||||||
|
&self.spk_txouts
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over all known txouts that spend to tracked script pubkeys.
|
||||||
|
pub fn txouts(
|
||||||
|
&self,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (&I, OutPoint, &TxOut)> + ExactSizeIterator {
|
||||||
|
self.txouts
|
||||||
|
.iter()
|
||||||
|
.map(|(op, (index, txout))| (index, *op, txout))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finds all txouts on a transaction that has previously been scanned and indexed.
|
||||||
|
pub fn txouts_in_tx(
|
||||||
|
&self,
|
||||||
|
txid: Txid,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (&I, OutPoint, &TxOut)> {
|
||||||
|
self.txouts
|
||||||
|
.range(OutPoint::new(txid, u32::MIN)..=OutPoint::new(txid, u32::MAX))
|
||||||
|
.map(|(op, (index, txout))| (index, *op, txout))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterates over all the outputs with script pubkeys in an index range.
|
||||||
|
pub fn outputs_in_range(
|
||||||
|
&self,
|
||||||
|
range: impl RangeBounds<I>,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (&I, OutPoint)> {
|
||||||
|
use bitcoin::hashes::Hash;
|
||||||
|
use core::ops::Bound::*;
|
||||||
|
let min_op = OutPoint {
|
||||||
|
txid: Txid::all_zeros(),
|
||||||
|
vout: u32::MIN,
|
||||||
|
};
|
||||||
|
let max_op = OutPoint {
|
||||||
|
txid: Txid::from_byte_array([0xff; Txid::LEN]),
|
||||||
|
vout: u32::MAX,
|
||||||
|
};
|
||||||
|
|
||||||
|
let start = match range.start_bound() {
|
||||||
|
Included(index) => Included((index.clone(), min_op)),
|
||||||
|
Excluded(index) => Excluded((index.clone(), max_op)),
|
||||||
|
Unbounded => Unbounded,
|
||||||
|
};
|
||||||
|
|
||||||
|
let end = match range.end_bound() {
|
||||||
|
Included(index) => Included((index.clone(), max_op)),
|
||||||
|
Excluded(index) => Excluded((index.clone(), min_op)),
|
||||||
|
Unbounded => Unbounded,
|
||||||
|
};
|
||||||
|
|
||||||
|
self.spk_txouts.range((start, end)).map(|(i, op)| (i, *op))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the txout and script pubkey index of the `TxOut` at `OutPoint`.
|
||||||
|
///
|
||||||
|
/// Returns `None` if the `TxOut` hasn't been scanned or if nothing matching was found there.
|
||||||
|
pub fn txout(&self, outpoint: OutPoint) -> Option<(&I, &TxOut)> {
|
||||||
|
self.txouts.get(&outpoint).map(|v| (&v.0, &v.1))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the script that has been inserted at the `index`.
|
||||||
|
///
|
||||||
|
/// If that index hasn't been inserted yet, it will return `None`.
|
||||||
|
pub fn spk_at_index(&self, index: &I) -> Option<&Script> {
|
||||||
|
self.spks.get(index).map(|s| s.as_script())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The script pubkeys that are being tracked by the index.
|
||||||
|
pub fn all_spks(&self) -> &BTreeMap<I, ScriptBuf> {
|
||||||
|
&self.spks
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Adds a script pubkey to scan for. Returns `false` and does nothing if spk already exists in the map
|
||||||
|
///
|
||||||
|
/// the index will look for outputs spending to this spk whenever it scans new data.
|
||||||
|
pub fn insert_spk(&mut self, index: I, spk: ScriptBuf) -> bool {
|
||||||
|
match self.spk_indices.entry(spk.clone()) {
|
||||||
|
Entry::Vacant(value) => {
|
||||||
|
value.insert(index.clone());
|
||||||
|
self.spks.insert(index.clone(), spk);
|
||||||
|
self.unused.insert(index);
|
||||||
|
true
|
||||||
|
}
|
||||||
|
Entry::Occupied(_) => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterates over all unused script pubkeys in an index range.
|
||||||
|
///
|
||||||
|
/// Here, "unused" means that after the script pubkey was stored in the index, the index has
|
||||||
|
/// never scanned a transaction output with it.
|
||||||
|
///
|
||||||
|
/// # Example
|
||||||
|
///
|
||||||
|
/// ```rust
|
||||||
|
/// # use bdk_chain::SpkTxOutIndex;
|
||||||
|
///
|
||||||
|
/// // imagine our spks are indexed like (keychain, derivation_index).
|
||||||
|
/// let txout_index = SpkTxOutIndex::<(u32, u32)>::default();
|
||||||
|
/// let all_unused_spks = txout_index.unused_spks(..);
|
||||||
|
/// let change_index = 1;
|
||||||
|
/// let unused_change_spks =
|
||||||
|
/// txout_index.unused_spks((change_index, u32::MIN)..(change_index, u32::MAX));
|
||||||
|
/// ```
|
||||||
|
pub fn unused_spks<R>(&self, range: R) -> impl DoubleEndedIterator<Item = (&I, &Script)> + Clone
|
||||||
|
where
|
||||||
|
R: RangeBounds<I>,
|
||||||
|
{
|
||||||
|
self.unused
|
||||||
|
.range(range)
|
||||||
|
.map(move |index| (index, self.spk_at_index(index).expect("must exist")))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns whether the script pubkey at `index` has been used or not.
|
||||||
|
///
|
||||||
|
/// Here, "unused" means that after the script pubkey was stored in the index, the index has
|
||||||
|
/// never scanned a transaction output with it.
|
||||||
|
pub fn is_used(&self, index: &I) -> bool {
|
||||||
|
self.unused.get(index).is_none()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Marks the script pubkey at `index` as used even though it hasn't seen an output spending to it.
|
||||||
|
/// This only affects when the `index` had already been added to `self` and was unused.
|
||||||
|
///
|
||||||
|
/// Returns whether the `index` was initially present as `unused`.
|
||||||
|
///
|
||||||
|
/// This is useful when you want to reserve a script pubkey for something but don't want to add
|
||||||
|
/// the transaction output using it to the index yet. Other callers will consider the `index` used
|
||||||
|
/// until you call [`unmark_used`].
|
||||||
|
///
|
||||||
|
/// [`unmark_used`]: Self::unmark_used
|
||||||
|
pub fn mark_used(&mut self, index: &I) -> bool {
|
||||||
|
self.unused.remove(index)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Undoes the effect of [`mark_used`]. Returns whether the `index` is inserted back into
|
||||||
|
/// `unused`.
|
||||||
|
///
|
||||||
|
/// Note that if `self` has scanned an output with this script pubkey then this will have no
|
||||||
|
/// effect.
|
||||||
|
///
|
||||||
|
/// [`mark_used`]: Self::mark_used
|
||||||
|
pub fn unmark_used(&mut self, index: &I) -> bool {
|
||||||
|
// we cannot set the index as unused when it does not exist
|
||||||
|
if !self.spks.contains_key(index) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
// we cannot set the index as unused when txouts are indexed under it
|
||||||
|
if self.outputs_in_range(index..=index).next().is_some() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
self.unused.insert(index.clone())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the index associated with the script pubkey.
|
||||||
|
pub fn index_of_spk(&self, script: &Script) -> Option<&I> {
|
||||||
|
self.spk_indices.get(script)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
||||||
|
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
||||||
|
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
||||||
|
/// received just uses the [`Transaction`] outputs directly, so it will be correct even if it has
|
||||||
|
/// not been scanned.
|
||||||
|
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
||||||
|
let mut sent = 0;
|
||||||
|
let mut received = 0;
|
||||||
|
|
||||||
|
for txin in &tx.input {
|
||||||
|
if let Some((_, txout)) = self.txout(txin.previous_output) {
|
||||||
|
sent += txout.value;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
for txout in &tx.output {
|
||||||
|
if self.index_of_spk(&txout.script_pubkey).is_some() {
|
||||||
|
received += txout.value;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
(sent, received)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Computes the net value that this transaction gives to the script pubkeys in the index and
|
||||||
|
/// *takes* from the transaction outputs in the index. Shorthand for calling
|
||||||
|
/// [`sent_and_received`] and subtracting sent from received.
|
||||||
|
///
|
||||||
|
/// [`sent_and_received`]: Self::sent_and_received
|
||||||
|
pub fn net_value(&self, tx: &Transaction) -> i64 {
|
||||||
|
let (sent, received) = self.sent_and_received(tx);
|
||||||
|
received as i64 - sent as i64
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether any of the inputs of this transaction spend a txout tracked or whether any output
|
||||||
|
/// matches one of our script pubkeys.
|
||||||
|
///
|
||||||
|
/// It is easily possible to misuse this method and get false negatives by calling it before you
|
||||||
|
/// have scanned the `TxOut`s the transaction is spending. For example, if you want to filter out
|
||||||
|
/// all the transactions in a block that are irrelevant, you **must first scan all the
|
||||||
|
/// transactions in the block** and only then use this method.
|
||||||
|
pub fn is_relevant(&self, tx: &Transaction) -> bool {
|
||||||
|
let input_matches = tx
|
||||||
|
.input
|
||||||
|
.iter()
|
||||||
|
.any(|input| self.txouts.contains_key(&input.previous_output));
|
||||||
|
let output_matches = tx
|
||||||
|
.output
|
||||||
|
.iter()
|
||||||
|
.any(|output| self.spk_indices.contains_key(&output.script_pubkey));
|
||||||
|
input_matches || output_matches
|
||||||
|
}
|
||||||
|
}
|
||||||
185
crates/chain/src/tx_data_traits.rs
Normal file
185
crates/chain/src/tx_data_traits.rs
Normal file
@@ -0,0 +1,185 @@
|
|||||||
|
use crate::collections::BTreeMap;
|
||||||
|
use crate::collections::BTreeSet;
|
||||||
|
use crate::BlockId;
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
|
||||||
|
/// Trait that "anchors" blockchain data to a specific block of height and hash.
|
||||||
|
///
|
||||||
|
/// If transaction A is anchored in block B, and block B is in the best chain, we can
|
||||||
|
/// assume that transaction A is also confirmed in the best chain. This does not necessarily mean
|
||||||
|
/// that transaction A is confirmed in block B. It could also mean transaction A is confirmed in a
|
||||||
|
/// parent block of B.
|
||||||
|
///
|
||||||
|
/// Every [`Anchor`] implementation must contain a [`BlockId`] parameter, and must implement
|
||||||
|
/// [`Ord`]. When implementing [`Ord`], the anchors' [`BlockId`]s should take precedence
|
||||||
|
/// over other elements inside the [`Anchor`]s for comparison purposes, i.e., you should first
|
||||||
|
/// compare the anchors' [`BlockId`]s and then care about the rest.
|
||||||
|
///
|
||||||
|
/// The example shows different types of anchors:
|
||||||
|
/// ```
|
||||||
|
/// # use bdk_chain::local_chain::LocalChain;
|
||||||
|
/// # use bdk_chain::tx_graph::TxGraph;
|
||||||
|
/// # use bdk_chain::BlockId;
|
||||||
|
/// # use bdk_chain::ConfirmationHeightAnchor;
|
||||||
|
/// # use bdk_chain::ConfirmationTimeHeightAnchor;
|
||||||
|
/// # use bdk_chain::example_utils::*;
|
||||||
|
/// # use bitcoin::hashes::Hash;
|
||||||
|
/// // Initialize the local chain with two blocks.
|
||||||
|
/// let chain = LocalChain::from_blocks(
|
||||||
|
/// [
|
||||||
|
/// (1, Hash::hash("first".as_bytes())),
|
||||||
|
/// (2, Hash::hash("second".as_bytes())),
|
||||||
|
/// ]
|
||||||
|
/// .into_iter()
|
||||||
|
/// .collect(),
|
||||||
|
/// );
|
||||||
|
///
|
||||||
|
/// // Transaction to be inserted into `TxGraph`s with different anchor types.
|
||||||
|
/// let tx = tx_from_hex(RAW_TX_1);
|
||||||
|
///
|
||||||
|
/// // Insert `tx` into a `TxGraph` that uses `BlockId` as the anchor type.
|
||||||
|
/// // When a transaction is anchored with `BlockId`, the anchor block and the confirmation block of
|
||||||
|
/// // the transaction is the same block.
|
||||||
|
/// let mut graph_a = TxGraph::<BlockId>::default();
|
||||||
|
/// let _ = graph_a.insert_tx(tx.clone());
|
||||||
|
/// graph_a.insert_anchor(
|
||||||
|
/// tx.txid(),
|
||||||
|
/// BlockId {
|
||||||
|
/// height: 1,
|
||||||
|
/// hash: Hash::hash("first".as_bytes()),
|
||||||
|
/// },
|
||||||
|
/// );
|
||||||
|
///
|
||||||
|
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationHeightAnchor` as the anchor type.
|
||||||
|
/// // This anchor records the anchor block and the confirmation height of the transaction.
|
||||||
|
/// // When a transaction is anchored with `ConfirmationHeightAnchor`, the anchor block and
|
||||||
|
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||||
|
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||||
|
/// let mut graph_b = TxGraph::<ConfirmationHeightAnchor>::default();
|
||||||
|
/// let _ = graph_b.insert_tx(tx.clone());
|
||||||
|
/// graph_b.insert_anchor(
|
||||||
|
/// tx.txid(),
|
||||||
|
/// ConfirmationHeightAnchor {
|
||||||
|
/// anchor_block: BlockId {
|
||||||
|
/// height: 2,
|
||||||
|
/// hash: Hash::hash("second".as_bytes()),
|
||||||
|
/// },
|
||||||
|
/// confirmation_height: 1,
|
||||||
|
/// },
|
||||||
|
/// );
|
||||||
|
///
|
||||||
|
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationTimeHeightAnchor` as the anchor type.
|
||||||
|
/// // This anchor records the anchor block, the confirmation height and time of the transaction.
|
||||||
|
/// // When a transaction is anchored with `ConfirmationTimeHeightAnchor`, the anchor block and
|
||||||
|
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||||
|
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||||
|
/// let mut graph_c = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||||
|
/// let _ = graph_c.insert_tx(tx.clone());
|
||||||
|
/// graph_c.insert_anchor(
|
||||||
|
/// tx.txid(),
|
||||||
|
/// ConfirmationTimeHeightAnchor {
|
||||||
|
/// anchor_block: BlockId {
|
||||||
|
/// height: 2,
|
||||||
|
/// hash: Hash::hash("third".as_bytes()),
|
||||||
|
/// },
|
||||||
|
/// confirmation_height: 1,
|
||||||
|
/// confirmation_time: 123,
|
||||||
|
/// },
|
||||||
|
/// );
|
||||||
|
/// ```
|
||||||
|
pub trait Anchor: core::fmt::Debug + Clone + Eq + PartialOrd + Ord + core::hash::Hash {
|
||||||
|
/// Returns the [`BlockId`] that the associated blockchain data is "anchored" in.
|
||||||
|
fn anchor_block(&self) -> BlockId;
|
||||||
|
|
||||||
|
/// Get the upper bound of the chain data's confirmation height.
|
||||||
|
///
|
||||||
|
/// The default definition gives a pessimistic answer. This can be overridden by the `Anchor`
|
||||||
|
/// implementation for a more accurate value.
|
||||||
|
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||||
|
self.anchor_block().height
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'a, A: Anchor> Anchor for &'a A {
|
||||||
|
fn anchor_block(&self) -> BlockId {
|
||||||
|
<A as Anchor>::anchor_block(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An [`Anchor`] that can be constructed from a given block, block height and transaction position
|
||||||
|
/// within the block.
|
||||||
|
pub trait AnchorFromBlockPosition: Anchor {
|
||||||
|
/// Construct the anchor from a given `block`, block height and `tx_pos` within the block.
|
||||||
|
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, tx_pos: usize) -> Self;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Trait that makes an object appendable.
|
||||||
|
pub trait Append {
|
||||||
|
/// Append another object of the same type onto `self`.
|
||||||
|
fn append(&mut self, other: Self);
|
||||||
|
|
||||||
|
/// Returns whether the structure is considered empty.
|
||||||
|
fn is_empty(&self) -> bool;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Ord, V> Append for BTreeMap<K, V> {
|
||||||
|
fn append(&mut self, other: Self) {
|
||||||
|
// We use `extend` instead of `BTreeMap::append` due to performance issues with `append`.
|
||||||
|
// Refer to https://github.com/rust-lang/rust/issues/34666#issuecomment-675658420
|
||||||
|
BTreeMap::extend(self, other)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
BTreeMap::is_empty(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<T: Ord> Append for BTreeSet<T> {
|
||||||
|
fn append(&mut self, other: Self) {
|
||||||
|
// We use `extend` instead of `BTreeMap::append` due to performance issues with `append`.
|
||||||
|
// Refer to https://github.com/rust-lang/rust/issues/34666#issuecomment-675658420
|
||||||
|
BTreeSet::extend(self, other)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
BTreeSet::is_empty(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<T> Append for Vec<T> {
|
||||||
|
fn append(&mut self, mut other: Self) {
|
||||||
|
Vec::append(self, &mut other)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
Vec::is_empty(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
macro_rules! impl_append_for_tuple {
|
||||||
|
($($a:ident $b:tt)*) => {
|
||||||
|
impl<$($a),*> Append for ($($a,)*) where $($a: Append),* {
|
||||||
|
|
||||||
|
fn append(&mut self, _other: Self) {
|
||||||
|
$(Append::append(&mut self.$b, _other.$b) );*
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
$(Append::is_empty(&self.$b) && )* true
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl_append_for_tuple!();
|
||||||
|
impl_append_for_tuple!(T0 0);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8 T9 9);
|
||||||
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8 T9 9 T10 10);
|
||||||
1541
crates/chain/src/tx_graph.rs
Normal file
1541
crates/chain/src/tx_graph.rs
Normal file
File diff suppressed because it is too large
Load Diff
78
crates/chain/tests/common/mod.rs
Normal file
78
crates/chain/tests/common/mod.rs
Normal file
@@ -0,0 +1,78 @@
|
|||||||
|
mod tx_template;
|
||||||
|
#[allow(unused_imports)]
|
||||||
|
pub use tx_template::*;
|
||||||
|
|
||||||
|
#[allow(unused_macros)]
|
||||||
|
macro_rules! block_id {
|
||||||
|
($height:expr, $hash:literal) => {{
|
||||||
|
bdk_chain::BlockId {
|
||||||
|
height: $height,
|
||||||
|
hash: bitcoin::hashes::Hash::hash($hash.as_bytes()),
|
||||||
|
}
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused_macros)]
|
||||||
|
macro_rules! h {
|
||||||
|
($index:literal) => {{
|
||||||
|
bitcoin::hashes::Hash::hash($index.as_bytes())
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused_macros)]
|
||||||
|
macro_rules! local_chain {
|
||||||
|
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||||
|
#[allow(unused_mut)]
|
||||||
|
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*].into_iter().collect())
|
||||||
|
.expect("chain must have genesis block")
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused_macros)]
|
||||||
|
macro_rules! chain_update {
|
||||||
|
[ $(($height:expr, $hash:expr)), * ] => {{
|
||||||
|
#[allow(unused_mut)]
|
||||||
|
bdk_chain::local_chain::Update {
|
||||||
|
tip: bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $hash).into()),*].into_iter().collect())
|
||||||
|
.expect("chain must have genesis block")
|
||||||
|
.tip(),
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
}
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused_macros)]
|
||||||
|
macro_rules! changeset {
|
||||||
|
(checkpoints: $($tail:tt)*) => { changeset!(index: TxHeight, checkpoints: $($tail)*) };
|
||||||
|
(
|
||||||
|
index: $ind:ty,
|
||||||
|
checkpoints: [ $(( $height:expr, $cp_to:expr )),* ]
|
||||||
|
$(,txids: [ $(( $txid:expr, $tx_to:expr )),* ])?
|
||||||
|
) => {{
|
||||||
|
use bdk_chain::collections::BTreeMap;
|
||||||
|
|
||||||
|
#[allow(unused_mut)]
|
||||||
|
bdk_chain::sparse_chain::ChangeSet::<$ind> {
|
||||||
|
checkpoints: {
|
||||||
|
let mut changes = BTreeMap::default();
|
||||||
|
$(changes.insert($height, $cp_to);)*
|
||||||
|
changes
|
||||||
|
},
|
||||||
|
txids: {
|
||||||
|
let mut changes = BTreeMap::default();
|
||||||
|
$($(changes.insert($txid, $tx_to.map(|h: TxHeight| h.into()));)*)?
|
||||||
|
changes
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused)]
|
||||||
|
pub fn new_tx(lt: u32) -> bitcoin::Transaction {
|
||||||
|
bitcoin::Transaction {
|
||||||
|
version: 0x00,
|
||||||
|
lock_time: bitcoin::absolute::LockTime::from_consensus(lt),
|
||||||
|
input: vec![],
|
||||||
|
output: vec![],
|
||||||
|
}
|
||||||
|
}
|
||||||
136
crates/chain/tests/common/tx_template.rs
Normal file
136
crates/chain/tests/common/tx_template.rs
Normal file
@@ -0,0 +1,136 @@
|
|||||||
|
use rand::distributions::{Alphanumeric, DistString};
|
||||||
|
use std::collections::HashMap;
|
||||||
|
|
||||||
|
use bdk_chain::{tx_graph::TxGraph, BlockId, SpkTxOutIndex};
|
||||||
|
use bitcoin::{
|
||||||
|
locktime::absolute::LockTime, secp256k1::Secp256k1, OutPoint, ScriptBuf, Sequence, Transaction,
|
||||||
|
TxIn, TxOut, Txid, Witness,
|
||||||
|
};
|
||||||
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
|
/// Template for creating a transaction in `TxGraph`.
|
||||||
|
///
|
||||||
|
/// The incentive for transaction templates is to create a transaction history in a simple manner to
|
||||||
|
/// avoid having to explicitly hash previous transactions to form previous outpoints of later
|
||||||
|
/// transactions.
|
||||||
|
#[derive(Clone, Copy, Default)]
|
||||||
|
pub struct TxTemplate<'a, A> {
|
||||||
|
/// Uniquely identifies the transaction, before it can have a txid.
|
||||||
|
pub tx_name: &'a str,
|
||||||
|
pub inputs: &'a [TxInTemplate<'a>],
|
||||||
|
pub outputs: &'a [TxOutTemplate],
|
||||||
|
pub anchors: &'a [A],
|
||||||
|
pub last_seen: Option<u64>,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
pub enum TxInTemplate<'a> {
|
||||||
|
/// This will give a random txid and vout.
|
||||||
|
Bogus,
|
||||||
|
|
||||||
|
/// This is used for coinbase transactions because they do not have previous outputs.
|
||||||
|
Coinbase,
|
||||||
|
|
||||||
|
/// Contains the `tx_name` and `vout` that we are spending. The rule is that we must only spend
|
||||||
|
/// from tx of a previous `TxTemplate`.
|
||||||
|
PrevTx(&'a str, usize),
|
||||||
|
}
|
||||||
|
|
||||||
|
pub struct TxOutTemplate {
|
||||||
|
pub value: u64,
|
||||||
|
pub spk_index: Option<u32>, // some = get spk from SpkTxOutIndex, none = random spk
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused)]
|
||||||
|
impl TxOutTemplate {
|
||||||
|
pub fn new(value: u64, spk_index: Option<u32>) -> Self {
|
||||||
|
TxOutTemplate { value, spk_index }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
pub fn init_graph<'a>(
|
||||||
|
tx_templates: impl IntoIterator<Item = &'a TxTemplate<'a, BlockId>>,
|
||||||
|
) -> (TxGraph<BlockId>, SpkTxOutIndex<u32>, HashMap<&'a str, Txid>) {
|
||||||
|
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/0/*)").unwrap();
|
||||||
|
let mut graph = TxGraph::<BlockId>::default();
|
||||||
|
let mut spk_index = SpkTxOutIndex::default();
|
||||||
|
(0..10).for_each(|index| {
|
||||||
|
spk_index.insert_spk(
|
||||||
|
index,
|
||||||
|
descriptor
|
||||||
|
.at_derivation_index(index)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey(),
|
||||||
|
);
|
||||||
|
});
|
||||||
|
let mut tx_ids = HashMap::<&'a str, Txid>::new();
|
||||||
|
|
||||||
|
for (bogus_txin_vout, tx_tmp) in tx_templates.into_iter().enumerate() {
|
||||||
|
let tx = Transaction {
|
||||||
|
version: 0,
|
||||||
|
lock_time: LockTime::ZERO,
|
||||||
|
input: tx_tmp
|
||||||
|
.inputs
|
||||||
|
.iter()
|
||||||
|
.map(|input| match input {
|
||||||
|
TxInTemplate::Bogus => TxIn {
|
||||||
|
previous_output: OutPoint::new(
|
||||||
|
bitcoin::hashes::Hash::hash(
|
||||||
|
Alphanumeric
|
||||||
|
.sample_string(&mut rand::thread_rng(), 20)
|
||||||
|
.as_bytes(),
|
||||||
|
),
|
||||||
|
bogus_txin_vout as u32,
|
||||||
|
),
|
||||||
|
script_sig: ScriptBuf::new(),
|
||||||
|
sequence: Sequence::default(),
|
||||||
|
witness: Witness::new(),
|
||||||
|
},
|
||||||
|
TxInTemplate::Coinbase => TxIn {
|
||||||
|
previous_output: OutPoint::null(),
|
||||||
|
script_sig: ScriptBuf::new(),
|
||||||
|
sequence: Sequence::MAX,
|
||||||
|
witness: Witness::new(),
|
||||||
|
},
|
||||||
|
TxInTemplate::PrevTx(prev_name, prev_vout) => {
|
||||||
|
let prev_txid = tx_ids.get(prev_name).expect(
|
||||||
|
"txin template must spend from tx of template that comes before",
|
||||||
|
);
|
||||||
|
TxIn {
|
||||||
|
previous_output: OutPoint::new(*prev_txid, *prev_vout as _),
|
||||||
|
script_sig: ScriptBuf::new(),
|
||||||
|
sequence: Sequence::default(),
|
||||||
|
witness: Witness::new(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
output: tx_tmp
|
||||||
|
.outputs
|
||||||
|
.iter()
|
||||||
|
.map(|output| match &output.spk_index {
|
||||||
|
None => TxOut {
|
||||||
|
value: output.value,
|
||||||
|
script_pubkey: ScriptBuf::new(),
|
||||||
|
},
|
||||||
|
Some(index) => TxOut {
|
||||||
|
value: output.value,
|
||||||
|
script_pubkey: spk_index.spk_at_index(index).unwrap().to_owned(),
|
||||||
|
},
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
};
|
||||||
|
|
||||||
|
tx_ids.insert(tx_tmp.tx_name, tx.txid());
|
||||||
|
spk_index.scan(&tx);
|
||||||
|
let _ = graph.insert_tx(tx.clone());
|
||||||
|
for anchor in tx_tmp.anchors.iter() {
|
||||||
|
let _ = graph.insert_anchor(tx.txid(), *anchor);
|
||||||
|
}
|
||||||
|
if let Some(seen_at) = tx_tmp.last_seen {
|
||||||
|
let _ = graph.insert_seen_at(tx.txid(), seen_at);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
(graph, spk_index, tx_ids)
|
||||||
|
}
|
||||||
467
crates/chain/tests/test_indexed_tx_graph.rs
Normal file
467
crates/chain/tests/test_indexed_tx_graph.rs
Normal file
@@ -0,0 +1,467 @@
|
|||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
|
||||||
|
use std::collections::BTreeSet;
|
||||||
|
|
||||||
|
use bdk_chain::{
|
||||||
|
indexed_tx_graph::{self, IndexedTxGraph},
|
||||||
|
keychain::{self, Balance, KeychainTxOutIndex},
|
||||||
|
local_chain::LocalChain,
|
||||||
|
tx_graph, BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||||
|
};
|
||||||
|
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, ScriptBuf, Transaction, TxIn, TxOut};
|
||||||
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
|
/// Ensure [`IndexedTxGraph::insert_relevant_txs`] can successfully index transactions NOT presented
|
||||||
|
/// in topological order.
|
||||||
|
///
|
||||||
|
/// Given 3 transactions (A, B, C), where A has 2 owned outputs. B and C spends an output each of A.
|
||||||
|
/// Typically, we would only know whether B and C are relevant if we have indexed A (A's outpoints
|
||||||
|
/// are associated with owned spks in the index). Ensure insertion and indexing is topological-
|
||||||
|
/// agnostic.
|
||||||
|
#[test]
|
||||||
|
fn insert_relevant_txs() {
|
||||||
|
const DESCRIPTOR: &str = "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)";
|
||||||
|
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), DESCRIPTOR)
|
||||||
|
.expect("must be valid");
|
||||||
|
let spk_0 = descriptor.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
let spk_1 = descriptor.at_derivation_index(9).unwrap().script_pubkey();
|
||||||
|
|
||||||
|
let mut graph = IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<()>>::new(
|
||||||
|
KeychainTxOutIndex::new(10),
|
||||||
|
);
|
||||||
|
graph.index.add_keychain((), descriptor);
|
||||||
|
|
||||||
|
let tx_a = Transaction {
|
||||||
|
output: vec![
|
||||||
|
TxOut {
|
||||||
|
value: 10_000,
|
||||||
|
script_pubkey: spk_0,
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
value: 20_000,
|
||||||
|
script_pubkey: spk_1,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_b = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::new(tx_a.txid(), 0),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
..common::new_tx(1)
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_c = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::new(tx_a.txid(), 1),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
..common::new_tx(2)
|
||||||
|
};
|
||||||
|
|
||||||
|
let txs = [tx_c, tx_b, tx_a];
|
||||||
|
|
||||||
|
let changeset = indexed_tx_graph::ChangeSet {
|
||||||
|
graph: tx_graph::ChangeSet {
|
||||||
|
txs: txs.clone().into(),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
indexer: keychain::ChangeSet([((), 9_u32)].into()),
|
||||||
|
};
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
graph.batch_insert_relevant(txs.iter().map(|tx| (tx, None))),
|
||||||
|
changeset,
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(graph.initial_changeset(), changeset,);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
/// Ensure consistency IndexedTxGraph list_* and balance methods. These methods lists
|
||||||
|
/// relevant txouts and utxos from the information fetched from a ChainOracle (here a LocalChain).
|
||||||
|
///
|
||||||
|
/// Test Setup:
|
||||||
|
///
|
||||||
|
/// Local Chain => <0> ----- <1> ----- <2> ----- <3> ---- ... ---- <150>
|
||||||
|
///
|
||||||
|
/// Keychains:
|
||||||
|
///
|
||||||
|
/// keychain_1: Trusted
|
||||||
|
/// keychain_2: Untrusted
|
||||||
|
///
|
||||||
|
/// Transactions:
|
||||||
|
///
|
||||||
|
/// tx1: A Coinbase, sending 70000 sats to "trusted" address. [Block 0]
|
||||||
|
/// tx2: A external Receive, sending 30000 sats to "untrusted" address. [Block 1]
|
||||||
|
/// tx3: Internal Spend. Spends tx2 and returns change of 10000 to "trusted" address. [Block 2]
|
||||||
|
/// tx4: Mempool tx, sending 20000 sats to "trusted" address.
|
||||||
|
/// tx5: Mempool tx, sending 15000 sats to "untested" address.
|
||||||
|
/// tx6: Complete unrelated tx. [Block 3]
|
||||||
|
///
|
||||||
|
/// Different transactions are added via `insert_relevant_txs`.
|
||||||
|
/// `list_owned_txout`, `list_owned_utxos` and `balance` method is asserted
|
||||||
|
/// with expected values at Block height 0, 1, and 2.
|
||||||
|
///
|
||||||
|
/// Finally Add more blocks to local chain until tx1 coinbase maturity hits.
|
||||||
|
/// Assert maturity at coinbase maturity inflection height. Block height 98 and 99.
|
||||||
|
|
||||||
|
fn test_list_owned_txouts() {
|
||||||
|
// Create Local chains
|
||||||
|
let local_chain = LocalChain::from_blocks((0..150).map(|i| (i as u32, h!("random"))).collect())
|
||||||
|
.expect("must have genesis hash");
|
||||||
|
|
||||||
|
// Initiate IndexedTxGraph
|
||||||
|
|
||||||
|
let (desc_1, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/0/*)").unwrap();
|
||||||
|
let (desc_2, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/1/*)").unwrap();
|
||||||
|
|
||||||
|
let mut graph = IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<String>>::new(
|
||||||
|
KeychainTxOutIndex::new(10),
|
||||||
|
);
|
||||||
|
|
||||||
|
graph.index.add_keychain("keychain_1".into(), desc_1);
|
||||||
|
graph.index.add_keychain("keychain_2".into(), desc_2);
|
||||||
|
|
||||||
|
// Get trusted and untrusted addresses
|
||||||
|
|
||||||
|
let mut trusted_spks: Vec<ScriptBuf> = Vec::new();
|
||||||
|
let mut untrusted_spks: Vec<ScriptBuf> = Vec::new();
|
||||||
|
|
||||||
|
{
|
||||||
|
// we need to scope here to take immutanble reference of the graph
|
||||||
|
for _ in 0..10 {
|
||||||
|
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_1".to_string());
|
||||||
|
// TODO Assert indexes
|
||||||
|
trusted_spks.push(script.to_owned());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
{
|
||||||
|
for _ in 0..10 {
|
||||||
|
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_2".to_string());
|
||||||
|
untrusted_spks.push(script.to_owned());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Create test transactions
|
||||||
|
|
||||||
|
// tx1 is the genesis coinbase
|
||||||
|
let tx1 = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::null(),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 70000,
|
||||||
|
script_pubkey: trusted_spks[0].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx2 is an incoming transaction received at untrusted keychain at block 1.
|
||||||
|
let tx2 = Transaction {
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 30000,
|
||||||
|
script_pubkey: untrusted_spks[0].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx3 spends tx2 and gives a change back in trusted keychain. Confirmed at Block 2.
|
||||||
|
let tx3 = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::new(tx2.txid(), 0),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 10000,
|
||||||
|
script_pubkey: trusted_spks[1].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx4 is an external transaction receiving at untrusted keychain, unconfirmed.
|
||||||
|
let tx4 = Transaction {
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 20000,
|
||||||
|
script_pubkey: untrusted_spks[1].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx5 is spending tx3 and receiving change at trusted keychain, unconfirmed.
|
||||||
|
let tx5 = Transaction {
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 15000,
|
||||||
|
script_pubkey: trusted_spks[2].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx6 is an unrelated transaction confirmed at 3.
|
||||||
|
let tx6 = common::new_tx(0);
|
||||||
|
|
||||||
|
// Insert transactions into graph with respective anchors
|
||||||
|
// For unconfirmed txs we pass in `None`.
|
||||||
|
|
||||||
|
let _ =
|
||||||
|
graph.batch_insert_relevant([&tx1, &tx2, &tx3, &tx6].iter().enumerate().map(|(i, tx)| {
|
||||||
|
let height = i as u32;
|
||||||
|
(
|
||||||
|
*tx,
|
||||||
|
local_chain
|
||||||
|
.blocks()
|
||||||
|
.get(&height)
|
||||||
|
.cloned()
|
||||||
|
.map(|hash| BlockId { height, hash })
|
||||||
|
.map(|anchor_block| ConfirmationHeightAnchor {
|
||||||
|
anchor_block,
|
||||||
|
confirmation_height: anchor_block.height,
|
||||||
|
}),
|
||||||
|
)
|
||||||
|
}));
|
||||||
|
|
||||||
|
let _ = graph.batch_insert_relevant_unconfirmed([&tx4, &tx5].iter().map(|tx| (*tx, 100)));
|
||||||
|
|
||||||
|
// A helper lambda to extract and filter data from the graph.
|
||||||
|
let fetch =
|
||||||
|
|height: u32,
|
||||||
|
graph: &IndexedTxGraph<ConfirmationHeightAnchor, KeychainTxOutIndex<String>>| {
|
||||||
|
let chain_tip = local_chain
|
||||||
|
.blocks()
|
||||||
|
.get(&height)
|
||||||
|
.map(|&hash| BlockId { height, hash })
|
||||||
|
.unwrap_or_else(|| panic!("block must exist at {}", height));
|
||||||
|
let txouts = graph
|
||||||
|
.graph()
|
||||||
|
.filter_chain_txouts(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let utxos = graph
|
||||||
|
.graph()
|
||||||
|
.filter_chain_unspents(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let balance = graph.graph().balance(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|_, spk: &Script| trusted_spks.contains(&spk.to_owned()),
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(txouts.len(), 5);
|
||||||
|
assert_eq!(utxos.len(), 4);
|
||||||
|
|
||||||
|
let confirmed_txouts_txid = txouts
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Confirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let unconfirmed_txouts_txid = txouts
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Unconfirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let confirmed_utxos_txid = utxos
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Confirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let unconfirmed_utxos_txid = utxos
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Unconfirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
(
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
|
||||||
|
// ----- TEST BLOCK -----
|
||||||
|
|
||||||
|
// AT Block 0
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(0, &graph);
|
||||||
|
|
||||||
|
assert_eq!(confirmed_txouts_txid, [tx1.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
[tx2.txid(), tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 25000, // tx3 + tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 0 // Nothing is confirmed yet
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 1
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(1, &graph);
|
||||||
|
|
||||||
|
// tx2 gets into confirmed txout set
|
||||||
|
assert_eq!(confirmed_txouts_txid, [tx1.txid(), tx2.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
// tx2 doesn't get into confirmed utxos set
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 25000, // tx3 + tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 0 // Nothing is confirmed yet
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 2
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(2, &graph);
|
||||||
|
|
||||||
|
// tx3 now gets into the confirmed txout set
|
||||||
|
assert_eq!(
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
[tx1.txid(), tx2.txid(), tx3.txid()].into()
|
||||||
|
);
|
||||||
|
assert_eq!(unconfirmed_txouts_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
// tx3 also gets into confirmed utxo set
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid(), tx3.txid()].into());
|
||||||
|
assert_eq!(unconfirmed_utxos_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 15000, // tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 10000 // tx3 got confirmed
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 98
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(98, &graph);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
[tx1.txid(), tx2.txid(), tx3.txid()].into()
|
||||||
|
);
|
||||||
|
assert_eq!(unconfirmed_txouts_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid(), tx3.txid()].into());
|
||||||
|
assert_eq!(unconfirmed_utxos_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
// Coinbase is still immature
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 15000, // tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 10000 // tx1 got matured
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 99
|
||||||
|
{
|
||||||
|
let (_, _, _, _, balance) = fetch(100, &graph);
|
||||||
|
|
||||||
|
// Coinbase maturity hits
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 0, // coinbase matured
|
||||||
|
trusted_pending: 15000, // tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 80000 // tx1 + tx3
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
388
crates/chain/tests/test_keychain_txout_index.rs
Normal file
388
crates/chain/tests/test_keychain_txout_index.rs
Normal file
@@ -0,0 +1,388 @@
|
|||||||
|
#![cfg(feature = "miniscript")]
|
||||||
|
|
||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
use bdk_chain::{
|
||||||
|
collections::BTreeMap,
|
||||||
|
indexed_tx_graph::Indexer,
|
||||||
|
keychain::{self, KeychainTxOutIndex},
|
||||||
|
Append,
|
||||||
|
};
|
||||||
|
|
||||||
|
use bitcoin::{secp256k1::Secp256k1, OutPoint, ScriptBuf, Transaction, TxOut};
|
||||||
|
use miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
|
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||||
|
enum TestKeychain {
|
||||||
|
External,
|
||||||
|
Internal,
|
||||||
|
}
|
||||||
|
|
||||||
|
fn init_txout_index(
|
||||||
|
lookahead: u32,
|
||||||
|
) -> (
|
||||||
|
bdk_chain::keychain::KeychainTxOutIndex<TestKeychain>,
|
||||||
|
Descriptor<DescriptorPublicKey>,
|
||||||
|
Descriptor<DescriptorPublicKey>,
|
||||||
|
) {
|
||||||
|
let mut txout_index = bdk_chain::keychain::KeychainTxOutIndex::<TestKeychain>::new(lookahead);
|
||||||
|
|
||||||
|
let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||||
|
let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||||
|
|
||||||
|
txout_index.add_keychain(TestKeychain::External, external_descriptor.clone());
|
||||||
|
txout_index.add_keychain(TestKeychain::Internal, internal_descriptor.clone());
|
||||||
|
|
||||||
|
(txout_index, external_descriptor, internal_descriptor)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> ScriptBuf {
|
||||||
|
descriptor
|
||||||
|
.derived_descriptor(&Secp256k1::verification_only(), index)
|
||||||
|
.expect("must derive")
|
||||||
|
.script_pubkey()
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_set_all_derivation_indices() {
|
||||||
|
use bdk_chain::indexed_tx_graph::Indexer;
|
||||||
|
|
||||||
|
let (mut txout_index, _, _) = init_txout_index(0);
|
||||||
|
let derive_to: BTreeMap<_, _> =
|
||||||
|
[(TestKeychain::External, 12), (TestKeychain::Internal, 24)].into();
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.reveal_to_target_multi(&derive_to).1.as_inner(),
|
||||||
|
&derive_to
|
||||||
|
);
|
||||||
|
assert_eq!(txout_index.last_revealed_indices(), &derive_to);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.reveal_to_target_multi(&derive_to).1,
|
||||||
|
keychain::ChangeSet::default(),
|
||||||
|
"no changes if we set to the same thing"
|
||||||
|
);
|
||||||
|
assert_eq!(txout_index.initial_changeset().as_inner(), &derive_to);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_lookahead() {
|
||||||
|
let (mut txout_index, external_desc, internal_desc) = init_txout_index(10);
|
||||||
|
|
||||||
|
// given:
|
||||||
|
// - external lookahead set to 10
|
||||||
|
// when:
|
||||||
|
// - set external derivation index to value higher than last, but within the lookahead value
|
||||||
|
// expect:
|
||||||
|
// - scripts cached in spk_txout_index should increase correctly
|
||||||
|
// - stored scripts of external keychain should be of expected counts
|
||||||
|
for index in (0..20).skip_while(|i| i % 2 == 1) {
|
||||||
|
let (revealed_spks, revealed_changeset) =
|
||||||
|
txout_index.reveal_to_target(&TestKeychain::External, index);
|
||||||
|
assert_eq!(
|
||||||
|
revealed_spks.collect::<Vec<_>>(),
|
||||||
|
vec![(index, spk_at_index(&external_desc, index))],
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
revealed_changeset.as_inner(),
|
||||||
|
&[(TestKeychain::External, index)].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.inner().all_spks().len(),
|
||||||
|
10 /* external lookahead */ +
|
||||||
|
10 /* internal lookahead */ +
|
||||||
|
index as usize + 1 /* `derived` count */
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::External)
|
||||||
|
.count(),
|
||||||
|
index as usize + 1,
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::Internal)
|
||||||
|
.count(),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.unused_keychain_spks(&TestKeychain::External)
|
||||||
|
.count(),
|
||||||
|
index as usize + 1,
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.unused_keychain_spks(&TestKeychain::Internal)
|
||||||
|
.count(),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// given:
|
||||||
|
// - internal lookahead is 10
|
||||||
|
// - internal derivation index is `None`
|
||||||
|
// when:
|
||||||
|
// - derivation index is set ahead of current derivation index + lookahead
|
||||||
|
// expect:
|
||||||
|
// - scripts cached in spk_txout_index should increase correctly, a.k.a. no scripts are skipped
|
||||||
|
let (revealed_spks, revealed_changeset) =
|
||||||
|
txout_index.reveal_to_target(&TestKeychain::Internal, 24);
|
||||||
|
assert_eq!(
|
||||||
|
revealed_spks.collect::<Vec<_>>(),
|
||||||
|
(0..=24)
|
||||||
|
.map(|index| (index, spk_at_index(&internal_desc, index)))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
revealed_changeset.as_inner(),
|
||||||
|
&[(TestKeychain::Internal, 24)].into()
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.inner().all_spks().len(),
|
||||||
|
10 /* external lookahead */ +
|
||||||
|
10 /* internal lookahead */ +
|
||||||
|
20 /* external stored index count */ +
|
||||||
|
25 /* internal stored index count */
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::Internal)
|
||||||
|
.count(),
|
||||||
|
25,
|
||||||
|
);
|
||||||
|
|
||||||
|
// ensure derivation indices are expected for each keychain
|
||||||
|
let last_external_index = txout_index
|
||||||
|
.last_revealed_index(&TestKeychain::External)
|
||||||
|
.expect("already derived");
|
||||||
|
let last_internal_index = txout_index
|
||||||
|
.last_revealed_index(&TestKeychain::Internal)
|
||||||
|
.expect("already derived");
|
||||||
|
assert_eq!(last_external_index, 19);
|
||||||
|
assert_eq!(last_internal_index, 24);
|
||||||
|
|
||||||
|
// when:
|
||||||
|
// - scanning txouts with spks within stored indexes
|
||||||
|
// expect:
|
||||||
|
// - no changes to stored index counts
|
||||||
|
let external_iter = 0..=last_external_index;
|
||||||
|
let internal_iter = last_internal_index - last_external_index..=last_internal_index;
|
||||||
|
for (external_index, internal_index) in external_iter.zip(internal_iter) {
|
||||||
|
let tx = Transaction {
|
||||||
|
output: vec![
|
||||||
|
TxOut {
|
||||||
|
script_pubkey: external_desc
|
||||||
|
.at_derivation_index(external_index)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey(),
|
||||||
|
value: 10_000,
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
script_pubkey: internal_desc
|
||||||
|
.at_derivation_index(internal_index)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey(),
|
||||||
|
value: 10_000,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
..common::new_tx(external_index)
|
||||||
|
};
|
||||||
|
assert_eq!(txout_index.index_tx(&tx), keychain::ChangeSet::default());
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.last_revealed_index(&TestKeychain::External),
|
||||||
|
Some(last_external_index)
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.last_revealed_index(&TestKeychain::Internal),
|
||||||
|
Some(last_internal_index)
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::External)
|
||||||
|
.count(),
|
||||||
|
last_external_index as usize + 1,
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::Internal)
|
||||||
|
.count(),
|
||||||
|
last_internal_index as usize + 1,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// when:
|
||||||
|
// - scanning txouts with spks above last stored index
|
||||||
|
// expect:
|
||||||
|
// - last revealed index should increase as expected
|
||||||
|
// - last used index should change as expected
|
||||||
|
#[test]
|
||||||
|
fn test_scan_with_lookahead() {
|
||||||
|
let (mut txout_index, external_desc, _) = init_txout_index(10);
|
||||||
|
|
||||||
|
let spks: BTreeMap<u32, ScriptBuf> = [0, 10, 20, 30]
|
||||||
|
.into_iter()
|
||||||
|
.map(|i| {
|
||||||
|
(
|
||||||
|
i,
|
||||||
|
external_desc
|
||||||
|
.at_derivation_index(i)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey(),
|
||||||
|
)
|
||||||
|
})
|
||||||
|
.collect();
|
||||||
|
|
||||||
|
for (&spk_i, spk) in &spks {
|
||||||
|
let op = OutPoint::new(h!("fake tx"), spk_i);
|
||||||
|
let txout = TxOut {
|
||||||
|
script_pubkey: spk.clone(),
|
||||||
|
value: 0,
|
||||||
|
};
|
||||||
|
|
||||||
|
let changeset = txout_index.index_txout(op, &txout);
|
||||||
|
assert_eq!(
|
||||||
|
changeset.as_inner(),
|
||||||
|
&[(TestKeychain::External, spk_i)].into()
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.last_revealed_index(&TestKeychain::External),
|
||||||
|
Some(spk_i)
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
txout_index.last_used_index(&TestKeychain::External),
|
||||||
|
Some(spk_i)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// now try with index 41 (lookahead surpassed), we expect that the txout to not be indexed
|
||||||
|
let spk_41 = external_desc
|
||||||
|
.at_derivation_index(41)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey();
|
||||||
|
let op = OutPoint::new(h!("fake tx"), 41);
|
||||||
|
let txout = TxOut {
|
||||||
|
script_pubkey: spk_41,
|
||||||
|
value: 0,
|
||||||
|
};
|
||||||
|
let changeset = txout_index.index_txout(op, &txout);
|
||||||
|
assert!(changeset.is_empty());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[rustfmt::skip]
|
||||||
|
fn test_wildcard_derivations() {
|
||||||
|
let (mut txout_index, external_desc, _) = init_txout_index(0);
|
||||||
|
let external_spk_0 = external_desc.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
let external_spk_16 = external_desc.at_derivation_index(16).unwrap().script_pubkey();
|
||||||
|
let external_spk_26 = external_desc.at_derivation_index(26).unwrap().script_pubkey();
|
||||||
|
let external_spk_27 = external_desc.at_derivation_index(27).unwrap().script_pubkey();
|
||||||
|
|
||||||
|
// - nothing is derived
|
||||||
|
// - unused list is also empty
|
||||||
|
//
|
||||||
|
// - next_derivation_index() == (0, true)
|
||||||
|
// - derive_new() == ((0, <spk>), keychain::ChangeSet)
|
||||||
|
// - next_unused() == ((0, <spk>), keychain::ChangeSet:is_empty())
|
||||||
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||||
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (0_u32, external_spk_0.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||||
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (0_u32, external_spk_0.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
|
// - derived till 25
|
||||||
|
// - used all spks till 15.
|
||||||
|
// - used list : [0..=15, 17, 20, 23]
|
||||||
|
// - unused list: [16, 18, 19, 21, 22, 24, 25]
|
||||||
|
|
||||||
|
// - next_derivation_index() = (26, true)
|
||||||
|
// - derive_new() = ((26, <spk>), keychain::ChangeSet)
|
||||||
|
// - next_unused() == ((16, <spk>), keychain::ChangeSet::is_empty())
|
||||||
|
let _ = txout_index.reveal_to_target(&TestKeychain::External, 25);
|
||||||
|
|
||||||
|
(0..=15)
|
||||||
|
.chain([17, 20, 23])
|
||||||
|
.for_each(|index| assert!(txout_index.mark_used(TestKeychain::External, index)));
|
||||||
|
|
||||||
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (26, true));
|
||||||
|
|
||||||
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (26, external_spk_26.as_script()));
|
||||||
|
|
||||||
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 26)].into());
|
||||||
|
|
||||||
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (16, external_spk_16.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
|
// - Use all the derived till 26.
|
||||||
|
// - next_unused() = ((27, <spk>), keychain::ChangeSet)
|
||||||
|
(0..=26).for_each(|index| {
|
||||||
|
txout_index.mark_used(TestKeychain::External, index);
|
||||||
|
});
|
||||||
|
|
||||||
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (27, external_spk_27.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 27)].into());
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_non_wildcard_derivations() {
|
||||||
|
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::new(0);
|
||||||
|
|
||||||
|
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||||
|
let external_spk = no_wildcard_descriptor
|
||||||
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey();
|
||||||
|
|
||||||
|
txout_index.add_keychain(TestKeychain::External, no_wildcard_descriptor);
|
||||||
|
|
||||||
|
// given:
|
||||||
|
// - `txout_index` with no stored scripts
|
||||||
|
// expect:
|
||||||
|
// - next derivation index should be new
|
||||||
|
// - when we derive a new script, script @ index 0
|
||||||
|
// - when we get the next unused script, script @ index 0
|
||||||
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||||
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||||
|
|
||||||
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
|
// given:
|
||||||
|
// - the non-wildcard descriptor already has a stored and used script
|
||||||
|
// expect:
|
||||||
|
// - next derivation index should not be new
|
||||||
|
// - derive new and next unused should return the old script
|
||||||
|
// - store_up_to should not panic and return empty changeset
|
||||||
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, false));
|
||||||
|
txout_index.mark_used(TestKeychain::External, 0);
|
||||||
|
|
||||||
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
let (revealed_spks, revealed_changeset) =
|
||||||
|
txout_index.reveal_to_target(&TestKeychain::External, 200);
|
||||||
|
assert_eq!(revealed_spks.count(), 0);
|
||||||
|
assert!(revealed_changeset.is_empty());
|
||||||
|
|
||||||
|
// we check that spks_of_keychain returns a SpkIterator with just one element
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::External)
|
||||||
|
.count(),
|
||||||
|
1,
|
||||||
|
);
|
||||||
|
}
|
||||||
681
crates/chain/tests/test_local_chain.rs
Normal file
681
crates/chain/tests/test_local_chain.rs
Normal file
@@ -0,0 +1,681 @@
|
|||||||
|
use bdk_chain::{
|
||||||
|
local_chain::{
|
||||||
|
AlterCheckPointError, ApplyHeaderError, CannotConnectError, ChangeSet, CheckPoint,
|
||||||
|
LocalChain, MissingGenesisError, Update,
|
||||||
|
},
|
||||||
|
BlockId,
|
||||||
|
};
|
||||||
|
use bitcoin::{block::Header, hashes::Hash, BlockHash};
|
||||||
|
|
||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
struct TestLocalChain<'a> {
|
||||||
|
name: &'static str,
|
||||||
|
chain: LocalChain,
|
||||||
|
update: Update,
|
||||||
|
exp: ExpectedResult<'a>,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Debug, PartialEq)]
|
||||||
|
enum ExpectedResult<'a> {
|
||||||
|
Ok {
|
||||||
|
changeset: &'a [(u32, Option<BlockHash>)],
|
||||||
|
init_changeset: &'a [(u32, Option<BlockHash>)],
|
||||||
|
},
|
||||||
|
Err(CannotConnectError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'a> TestLocalChain<'a> {
|
||||||
|
fn run(mut self) {
|
||||||
|
println!("[TestLocalChain] test: {}", self.name);
|
||||||
|
let got_changeset = match self.chain.apply_update(self.update) {
|
||||||
|
Ok(changeset) => changeset,
|
||||||
|
Err(got_err) => {
|
||||||
|
assert_eq!(
|
||||||
|
ExpectedResult::Err(got_err),
|
||||||
|
self.exp,
|
||||||
|
"{}: unexpected error",
|
||||||
|
self.name
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
match self.exp {
|
||||||
|
ExpectedResult::Ok {
|
||||||
|
changeset,
|
||||||
|
init_changeset,
|
||||||
|
} => {
|
||||||
|
assert_eq!(
|
||||||
|
got_changeset,
|
||||||
|
changeset.iter().cloned().collect(),
|
||||||
|
"{}: unexpected changeset",
|
||||||
|
self.name
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
self.chain.initial_changeset(),
|
||||||
|
init_changeset.iter().cloned().collect(),
|
||||||
|
"{}: unexpected initial changeset",
|
||||||
|
self.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
ExpectedResult::Err(err) => panic!(
|
||||||
|
"{}: expected error ({}), got non-error result: {:?}",
|
||||||
|
self.name, err, got_changeset
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn update_local_chain() {
|
||||||
|
[
|
||||||
|
TestLocalChain {
|
||||||
|
name: "add first tip",
|
||||||
|
chain: local_chain![(0, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("A"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[],
|
||||||
|
init_changeset: &[(0, Some(h!("A")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "add second tip",
|
||||||
|
chain: local_chain![(0, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("A")), (1, h!("B"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("A"))), (1, Some(h!("B")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "two disjoint chains cannot merge",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError {
|
||||||
|
try_include_height: 1,
|
||||||
|
}),
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "two disjoint chains cannot merge (existing chain longer)",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("B"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError {
|
||||||
|
try_include_height: 2,
|
||||||
|
}),
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "duplicate chains should merge",
|
||||||
|
chain: local_chain![(0, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("A"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[],
|
||||||
|
init_changeset: &[(0, Some(h!("A")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Introduce an older checkpoint (B)
|
||||||
|
// | 0 | 1 | 2 | 3
|
||||||
|
// chain | _ C D
|
||||||
|
// update | _ B C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "can introduce older checkpoint",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("C")), (3, h!("D"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("B")), (2, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("B"))), (2, Some(h!("C"))), (3, Some(h!("D")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Introduce an older checkpoint (A) that is not directly behind PoA
|
||||||
|
// | 0 | 2 | 3 | 4
|
||||||
|
// chain | _ B C
|
||||||
|
// update | _ A C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "can introduce older checkpoint 2",
|
||||||
|
chain: local_chain![(0, h!("_")), (3, h!("B")), (4, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("A")), (4, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(2, Some(h!("A")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (2, Some(h!("A"))), (3, Some(h!("B"))), (4, Some(h!("C")))],
|
||||||
|
}
|
||||||
|
},
|
||||||
|
// Introduce an older checkpoint (B) that is not the oldest checkpoint
|
||||||
|
// | 0 | 1 | 2 | 3
|
||||||
|
// chain | _ A C
|
||||||
|
// update | _ B C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "can introduce older checkpoint 3",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("A")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(2, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||||
|
}
|
||||||
|
},
|
||||||
|
// Introduce two older checkpoints below the PoA
|
||||||
|
// | 0 | 1 | 2 | 3
|
||||||
|
// chain | _ C
|
||||||
|
// update | _ A B C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "introduce two older checkpoints below PoA",
|
||||||
|
chain: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("A"))), (2, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "fix blockhash before agreement point",
|
||||||
|
chain: local_chain![(0, h!("im-wrong")), (1, h!("we-agree"))],
|
||||||
|
update: chain_update![(0, h!("fix")), (1, h!("we-agree"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(0, Some(h!("fix")))],
|
||||||
|
init_changeset: &[(0, Some(h!("fix"))), (1, Some(h!("we-agree")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// B and C are in both chain and update
|
||||||
|
// | 0 | 1 | 2 | 3 | 4
|
||||||
|
// chain | _ B C
|
||||||
|
// update | _ A B C D
|
||||||
|
// This should succeed with the point of agreement being C and A should be added in addition.
|
||||||
|
TestLocalChain {
|
||||||
|
name: "two points of agreement",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("A"))), (4, Some(h!("D")))],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(1, Some(h!("A"))),
|
||||||
|
(2, Some(h!("B"))),
|
||||||
|
(3, Some(h!("C"))),
|
||||||
|
(4, Some(h!("D"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Update and chain does not connect:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4
|
||||||
|
// chain | _ B C
|
||||||
|
// update | _ A B D
|
||||||
|
// This should fail as we cannot figure out whether C & D are on the same chain
|
||||||
|
TestLocalChain {
|
||||||
|
name: "update and chain does not connect",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError {
|
||||||
|
try_include_height: 3,
|
||||||
|
}),
|
||||||
|
},
|
||||||
|
// Transient invalidation:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | _ B C E
|
||||||
|
// update | _ B' C' D
|
||||||
|
// This should succeed and invalidate B,C and E with point of agreement being A.
|
||||||
|
TestLocalChain {
|
||||||
|
name: "transitive invalidation applies to checkpoints higher than invalidation",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(2, Some(h!("B'"))),
|
||||||
|
(3, Some(h!("C'"))),
|
||||||
|
(4, Some(h!("D"))),
|
||||||
|
(5, None),
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(2, Some(h!("B'"))),
|
||||||
|
(3, Some(h!("C'"))),
|
||||||
|
(4, Some(h!("D"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Transient invalidation:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4
|
||||||
|
// chain | _ B C E
|
||||||
|
// update | _ B' C' D
|
||||||
|
// This should succeed and invalidate B, C and E with no point of agreement
|
||||||
|
TestLocalChain {
|
||||||
|
name: "transitive invalidation applies to checkpoints higher than invalidation no point of agreement",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("B")), (2, h!("C")), (4, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("B'")), (2, h!("C'")), (3, h!("D"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(1, Some(h!("B'"))),
|
||||||
|
(2, Some(h!("C'"))),
|
||||||
|
(3, Some(h!("D"))),
|
||||||
|
(4, None)
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(1, Some(h!("B'"))),
|
||||||
|
(2, Some(h!("C'"))),
|
||||||
|
(3, Some(h!("D"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Transient invalidation:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | _ A B C E
|
||||||
|
// update | _ B' C' D
|
||||||
|
// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
||||||
|
// A was invalid.
|
||||||
|
TestLocalChain {
|
||||||
|
name: "invalidation but no connection",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError { try_include_height: 1 }),
|
||||||
|
},
|
||||||
|
// Introduce blocks between two points of agreement
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | A B D E
|
||||||
|
// update | A C E F
|
||||||
|
TestLocalChain {
|
||||||
|
name: "introduce blocks between two points of agreement",
|
||||||
|
chain: local_chain![(0, h!("A")), (1, h!("B")), (3, h!("D")), (4, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("A")), (2, h!("C")), (4, h!("E")), (5, h!("F"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(2, Some(h!("C"))),
|
||||||
|
(5, Some(h!("F"))),
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("A"))),
|
||||||
|
(1, Some(h!("B"))),
|
||||||
|
(2, Some(h!("C"))),
|
||||||
|
(3, Some(h!("D"))),
|
||||||
|
(4, Some(h!("E"))),
|
||||||
|
(5, Some(h!("F"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Allow update that is shorter than original chain
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | A C D E F
|
||||||
|
// update | A C D'
|
||||||
|
TestLocalChain {
|
||||||
|
name: "allow update that is shorter than original chain",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("C")), (3, h!("D")), (4, h!("E")), (5, h!("F"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("C")), (3, h!("D'"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(3, Some(h!("D'"))),
|
||||||
|
(4, None),
|
||||||
|
(5, None),
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(2, Some(h!("C"))),
|
||||||
|
(3, Some(h!("D'"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
]
|
||||||
|
.into_iter()
|
||||||
|
.for_each(TestLocalChain::run);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn local_chain_insert_block() {
|
||||||
|
struct TestCase {
|
||||||
|
original: LocalChain,
|
||||||
|
insert: (u32, BlockHash),
|
||||||
|
expected_result: Result<ChangeSet, AlterCheckPointError>,
|
||||||
|
expected_final: LocalChain,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_"))],
|
||||||
|
insert: (5, h!("block5")),
|
||||||
|
expected_result: Ok([(5, Some(h!("block5")))].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (5, h!("block5"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (3, h!("A"))],
|
||||||
|
insert: (4, h!("B")),
|
||||||
|
expected_result: Ok([(4, Some(h!("B")))].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (4, h!("B"))],
|
||||||
|
insert: (3, h!("A")),
|
||||||
|
expected_result: Ok([(3, Some(h!("A")))].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
insert: (2, h!("K")),
|
||||||
|
expected_result: Ok([].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
insert: (2, h!("J")),
|
||||||
|
expected_result: Err(AlterCheckPointError {
|
||||||
|
height: 2,
|
||||||
|
original_hash: h!("K"),
|
||||||
|
update_hash: Some(h!("J")),
|
||||||
|
}),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
let mut chain = t.original;
|
||||||
|
assert_eq!(
|
||||||
|
chain.insert_block(t.insert.into()),
|
||||||
|
t.expected_result,
|
||||||
|
"[{}] unexpected result when inserting block",
|
||||||
|
i,
|
||||||
|
);
|
||||||
|
assert_eq!(chain, t.expected_final, "[{}] unexpected final chain", i,);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn local_chain_disconnect_from() {
|
||||||
|
struct TestCase {
|
||||||
|
name: &'static str,
|
||||||
|
original: LocalChain,
|
||||||
|
disconnect_from: (u32, BlockHash),
|
||||||
|
exp_result: Result<ChangeSet, MissingGenesisError>,
|
||||||
|
exp_final: LocalChain,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "try_replace_genesis_should_fail",
|
||||||
|
original: local_chain![(0, h!("_"))],
|
||||||
|
disconnect_from: (0, h!("_")),
|
||||||
|
exp_result: Err(MissingGenesisError),
|
||||||
|
exp_final: local_chain![(0, h!("_"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "try_replace_genesis_should_fail_2",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
disconnect_from: (0, h!("_")),
|
||||||
|
exp_result: Err(MissingGenesisError),
|
||||||
|
exp_final: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "from_does_not_exist",
|
||||||
|
original: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||||
|
disconnect_from: (2, h!("B")),
|
||||||
|
exp_result: Ok(ChangeSet::default()),
|
||||||
|
exp_final: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "from_has_different_blockhash",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
disconnect_from: (2, h!("not_B")),
|
||||||
|
exp_result: Ok(ChangeSet::default()),
|
||||||
|
exp_final: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "disconnect_one",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
disconnect_from: (2, h!("B")),
|
||||||
|
exp_result: Ok(ChangeSet::from_iter([(2, None)])),
|
||||||
|
exp_final: local_chain![(0, h!("_"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "disconnect_three",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C")), (4, h!("D"))],
|
||||||
|
disconnect_from: (2, h!("B")),
|
||||||
|
exp_result: Ok(ChangeSet::from_iter([(2, None), (3, None), (4, None)])),
|
||||||
|
exp_final: local_chain![(0, h!("_"))],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("Case {}: {}", i, t.name);
|
||||||
|
|
||||||
|
let mut chain = t.original;
|
||||||
|
let result = chain.disconnect_from(t.disconnect_from.into());
|
||||||
|
assert_eq!(
|
||||||
|
result, t.exp_result,
|
||||||
|
"[{}:{}] unexpected changeset result",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
chain, t.exp_final,
|
||||||
|
"[{}:{}] unexpected final chain",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn checkpoint_from_block_ids() {
|
||||||
|
struct TestCase<'a> {
|
||||||
|
name: &'a str,
|
||||||
|
blocks: &'a [(u32, BlockHash)],
|
||||||
|
exp_result: Result<(), Option<(u32, BlockHash)>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "in_order",
|
||||||
|
blocks: &[(0, h!("A")), (1, h!("B")), (3, h!("D"))],
|
||||||
|
exp_result: Ok(()),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "with_duplicates",
|
||||||
|
blocks: &[(1, h!("B")), (2, h!("C")), (2, h!("C'"))],
|
||||||
|
exp_result: Err(Some((2, h!("C")))),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "not_in_order",
|
||||||
|
blocks: &[(1, h!("B")), (3, h!("D")), (2, h!("C"))],
|
||||||
|
exp_result: Err(Some((3, h!("D")))),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "empty",
|
||||||
|
blocks: &[],
|
||||||
|
exp_result: Err(None),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "single",
|
||||||
|
blocks: &[(21, h!("million"))],
|
||||||
|
exp_result: Ok(()),
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("running test case {}: '{}'", i, t.name);
|
||||||
|
let result = CheckPoint::from_block_ids(
|
||||||
|
t.blocks
|
||||||
|
.iter()
|
||||||
|
.map(|&(height, hash)| BlockId { height, hash }),
|
||||||
|
);
|
||||||
|
match t.exp_result {
|
||||||
|
Ok(_) => {
|
||||||
|
assert!(result.is_ok(), "[{}:{}] should be Ok", i, t.name);
|
||||||
|
let result_vec = {
|
||||||
|
let mut v = result
|
||||||
|
.unwrap()
|
||||||
|
.into_iter()
|
||||||
|
.map(|cp| (cp.height(), cp.hash()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
v.reverse();
|
||||||
|
v
|
||||||
|
};
|
||||||
|
assert_eq!(
|
||||||
|
&result_vec, t.blocks,
|
||||||
|
"[{}:{}] not equal to original block ids",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
Err(exp_last) => {
|
||||||
|
assert!(result.is_err(), "[{}:{}] should be Err", i, t.name);
|
||||||
|
let err = result.unwrap_err();
|
||||||
|
assert_eq!(
|
||||||
|
err.as_ref()
|
||||||
|
.map(|last_cp| (last_cp.height(), last_cp.hash())),
|
||||||
|
exp_last,
|
||||||
|
"[{}:{}] error's last cp height should be {:?}, got {:?}",
|
||||||
|
i,
|
||||||
|
t.name,
|
||||||
|
exp_last,
|
||||||
|
err
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn local_chain_apply_header_connected_to() {
|
||||||
|
fn header_from_prev_blockhash(prev_blockhash: BlockHash) -> Header {
|
||||||
|
Header {
|
||||||
|
version: bitcoin::block::Version::default(),
|
||||||
|
prev_blockhash,
|
||||||
|
merkle_root: bitcoin::hash_types::TxMerkleNode::all_zeros(),
|
||||||
|
time: 0,
|
||||||
|
bits: bitcoin::CompactTarget::default(),
|
||||||
|
nonce: 0,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
struct TestCase {
|
||||||
|
name: &'static str,
|
||||||
|
chain: LocalChain,
|
||||||
|
header: Header,
|
||||||
|
height: u32,
|
||||||
|
connected_to: BlockId,
|
||||||
|
exp_result: Result<Vec<(u32, Option<BlockHash>)>, ApplyHeaderError>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(h!("A"));
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let height = 2;
|
||||||
|
let connected_to = BlockId { height, hash };
|
||||||
|
TestCase {
|
||||||
|
name: "connected_to_self_header_applied_to_self",
|
||||||
|
chain: local_chain![(0, h!("_")), (height, hash)],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Ok(vec![]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let prev_hash = h!("A");
|
||||||
|
let prev_height = 1;
|
||||||
|
let header = header_from_prev_blockhash(prev_hash);
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let height = prev_height + 1;
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: prev_hash,
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "connected_to_prev_header_applied_to_self",
|
||||||
|
chain: local_chain![(0, h!("_")), (prev_height, prev_hash)],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Ok(vec![(height, Some(hash))]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(BlockHash::all_zeros());
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let height = 0;
|
||||||
|
let connected_to = BlockId { height, hash };
|
||||||
|
TestCase {
|
||||||
|
name: "genesis_applied_to_self",
|
||||||
|
chain: local_chain![(0, hash)],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Ok(vec![]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(h!("Z"));
|
||||||
|
let height = 10;
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let prev_height = height - 1;
|
||||||
|
let prev_hash = header.prev_blockhash;
|
||||||
|
TestCase {
|
||||||
|
name: "connect_at_connected_to",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
header,
|
||||||
|
height: 10,
|
||||||
|
connected_to: BlockId {
|
||||||
|
height: 3,
|
||||||
|
hash: h!("C"),
|
||||||
|
},
|
||||||
|
exp_result: Ok(vec![(prev_height, Some(prev_hash)), (height, Some(hash))]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let prev_hash = h!("A");
|
||||||
|
let prev_height = 1;
|
||||||
|
let header = header_from_prev_blockhash(prev_hash);
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: h!("not_prev_hash"),
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "inconsistent_prev_hash",
|
||||||
|
chain: local_chain![(0, h!("_")), (prev_height, h!("not_prev_hash"))],
|
||||||
|
header,
|
||||||
|
height: prev_height + 1,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Err(ApplyHeaderError::InconsistentBlocks),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let prev_hash = h!("A");
|
||||||
|
let prev_height = 1;
|
||||||
|
let header = header_from_prev_blockhash(prev_hash);
|
||||||
|
let height = prev_height + 1;
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height,
|
||||||
|
hash: h!("not_current_hash"),
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "inconsistent_current_block",
|
||||||
|
chain: local_chain![(0, h!("_")), (height, h!("not_current_hash"))],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Err(ApplyHeaderError::InconsistentBlocks),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(h!("B"));
|
||||||
|
let height = 3;
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height: 4,
|
||||||
|
hash: h!("D"),
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "connected_to_is_greater",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Err(ApplyHeaderError::InconsistentBlocks),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("running test case {}: '{}'", i, t.name);
|
||||||
|
let mut chain = t.chain;
|
||||||
|
let result = chain.apply_header_connected_to(&t.header, t.height, t.connected_to);
|
||||||
|
let exp_result = t
|
||||||
|
.exp_result
|
||||||
|
.map(|cs| cs.iter().cloned().collect::<ChangeSet>());
|
||||||
|
assert_eq!(result, exp_result, "[{}:{}] unexpected result", i, t.name);
|
||||||
|
}
|
||||||
|
}
|
||||||
100
crates/chain/tests/test_spk_txout_index.rs
Normal file
100
crates/chain/tests/test_spk_txout_index.rs
Normal file
@@ -0,0 +1,100 @@
|
|||||||
|
use bdk_chain::{indexed_tx_graph::Indexer, SpkTxOutIndex};
|
||||||
|
use bitcoin::{absolute, OutPoint, ScriptBuf, Transaction, TxIn, TxOut};
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn spk_txout_sent_and_received() {
|
||||||
|
let spk1 = ScriptBuf::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||||
|
let spk2 = ScriptBuf::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||||
|
|
||||||
|
let mut index = SpkTxOutIndex::default();
|
||||||
|
index.insert_spk(0, spk1.clone());
|
||||||
|
index.insert_spk(1, spk2.clone());
|
||||||
|
|
||||||
|
let tx1 = Transaction {
|
||||||
|
version: 0x02,
|
||||||
|
lock_time: absolute::LockTime::ZERO,
|
||||||
|
input: vec![],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 42_000,
|
||||||
|
script_pubkey: spk1.clone(),
|
||||||
|
}],
|
||||||
|
};
|
||||||
|
|
||||||
|
assert_eq!(index.sent_and_received(&tx1), (0, 42_000));
|
||||||
|
assert_eq!(index.net_value(&tx1), 42_000);
|
||||||
|
index.index_tx(&tx1);
|
||||||
|
assert_eq!(
|
||||||
|
index.sent_and_received(&tx1),
|
||||||
|
(0, 42_000),
|
||||||
|
"shouldn't change after scanning"
|
||||||
|
);
|
||||||
|
|
||||||
|
let tx2 = Transaction {
|
||||||
|
version: 0x1,
|
||||||
|
lock_time: absolute::LockTime::ZERO,
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint {
|
||||||
|
txid: tx1.txid(),
|
||||||
|
vout: 0,
|
||||||
|
},
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
output: vec![
|
||||||
|
TxOut {
|
||||||
|
value: 20_000,
|
||||||
|
script_pubkey: spk2,
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
script_pubkey: spk1,
|
||||||
|
value: 30_000,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
};
|
||||||
|
|
||||||
|
assert_eq!(index.sent_and_received(&tx2), (42_000, 50_000));
|
||||||
|
assert_eq!(index.net_value(&tx2), 8_000);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn mark_used() {
|
||||||
|
let spk1 = ScriptBuf::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||||
|
let spk2 = ScriptBuf::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||||
|
|
||||||
|
let mut spk_index = SpkTxOutIndex::default();
|
||||||
|
spk_index.insert_spk(1, spk1.clone());
|
||||||
|
spk_index.insert_spk(2, spk2);
|
||||||
|
|
||||||
|
assert!(!spk_index.is_used(&1));
|
||||||
|
spk_index.mark_used(&1);
|
||||||
|
assert!(spk_index.is_used(&1));
|
||||||
|
spk_index.unmark_used(&1);
|
||||||
|
assert!(!spk_index.is_used(&1));
|
||||||
|
spk_index.mark_used(&1);
|
||||||
|
assert!(spk_index.is_used(&1));
|
||||||
|
|
||||||
|
let tx1 = Transaction {
|
||||||
|
version: 0x02,
|
||||||
|
lock_time: absolute::LockTime::ZERO,
|
||||||
|
input: vec![],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 42_000,
|
||||||
|
script_pubkey: spk1,
|
||||||
|
}],
|
||||||
|
};
|
||||||
|
|
||||||
|
spk_index.index_tx(&tx1);
|
||||||
|
spk_index.unmark_used(&1);
|
||||||
|
assert!(
|
||||||
|
spk_index.is_used(&1),
|
||||||
|
"even though we unmark_used it doesn't matter because there was a tx scanned that used it"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn unmark_used_does_not_result_in_invalid_representation() {
|
||||||
|
let mut spk_index = SpkTxOutIndex::default();
|
||||||
|
assert!(!spk_index.unmark_used(&0));
|
||||||
|
assert!(!spk_index.unmark_used(&1));
|
||||||
|
assert!(!spk_index.unmark_used(&2));
|
||||||
|
assert!(spk_index.unused_spks(..).collect::<Vec<_>>().is_empty());
|
||||||
|
}
|
||||||
1174
crates/chain/tests/test_tx_graph.rs
Normal file
1174
crates/chain/tests/test_tx_graph.rs
Normal file
File diff suppressed because it is too large
Load Diff
668
crates/chain/tests/test_tx_graph_conflicts.rs
Normal file
668
crates/chain/tests/test_tx_graph_conflicts.rs
Normal file
@@ -0,0 +1,668 @@
|
|||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
|
||||||
|
use std::collections::{BTreeSet, HashSet};
|
||||||
|
|
||||||
|
use bdk_chain::{keychain::Balance, BlockId};
|
||||||
|
use bitcoin::{OutPoint, Script};
|
||||||
|
use common::*;
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
struct Scenario<'a> {
|
||||||
|
/// Name of the test scenario
|
||||||
|
name: &'a str,
|
||||||
|
/// Transaction templates
|
||||||
|
tx_templates: &'a [TxTemplate<'a, BlockId>],
|
||||||
|
/// Names of txs that must exist in the output of `list_chain_txs`
|
||||||
|
exp_chain_txs: HashSet<&'a str>,
|
||||||
|
/// Outpoints that must exist in the output of `filter_chain_txouts`
|
||||||
|
exp_chain_txouts: HashSet<(&'a str, u32)>,
|
||||||
|
/// Outpoints of UTXOs that must exist in the output of `filter_chain_unspents`
|
||||||
|
exp_unspents: HashSet<(&'a str, u32)>,
|
||||||
|
/// Expected balances
|
||||||
|
exp_balance: Balance,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// This test ensures that [`TxGraph`] will reliably filter out irrelevant transactions when
|
||||||
|
/// presented with multiple conflicting transaction scenarios using the [`TxTemplate`] structure.
|
||||||
|
/// This test also checks that [`TxGraph::list_chain_txs`], [`TxGraph::filter_chain_txouts`],
|
||||||
|
/// [`TxGraph::filter_chain_unspents`], and [`TxGraph::balance`] return correct data.
|
||||||
|
#[test]
|
||||||
|
fn test_tx_conflict_handling() {
|
||||||
|
// Create Local chains
|
||||||
|
let local_chain = local_chain!(
|
||||||
|
(0, h!("A")),
|
||||||
|
(1, h!("B")),
|
||||||
|
(2, h!("C")),
|
||||||
|
(3, h!("D")),
|
||||||
|
(4, h!("E")),
|
||||||
|
(5, h!("F")),
|
||||||
|
(6, h!("G"))
|
||||||
|
);
|
||||||
|
let chain_tip = local_chain.tip().block_id();
|
||||||
|
|
||||||
|
let scenarios = [
|
||||||
|
Scenario {
|
||||||
|
name: "coinbase tx cannot be in mempool and be unconfirmed",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "unconfirmed_coinbase",
|
||||||
|
inputs: &[TxInTemplate::Coinbase],
|
||||||
|
outputs: &[TxOutTemplate::new(5000, Some(0))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "confirmed_genesis",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(1))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "unconfirmed_conflict",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("confirmed_genesis", 0),
|
||||||
|
TxInTemplate::PrevTx("unconfirmed_coinbase", 0)
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "confirmed_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("confirmed_genesis", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||||
|
anchors: &[block_id!(4, "E")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["confirmed_genesis", "confirmed_conflict"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("confirmed_genesis", 0), ("confirmed_conflict", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("confirmed_conflict", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 20000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "2 unconfirmed txs with same last_seens conflict",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
outputs: &[TxOutTemplate::new(40000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// the txgraph is going to pick tx_conflict_2 because of higher lexicographical txid
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_2", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "2 unconfirmed txs with different last_seens conflict",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0)), TxOutTemplate::new(10000, Some(1))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::PrevTx("tx1", 1)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx1", 1), ("tx_conflict_2", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "3 unconfirmed txs with different last_seens conflict",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_3",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(40000, Some(3))],
|
||||||
|
last_seen: Some(400),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_3"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_3", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_3", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 40000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "unconfirmed tx conflicts with tx in orphaned block, orphaned higher last_seen",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_orphaned_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "Orphaned Block")],
|
||||||
|
last_seen: Some(300),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_orphaned_conflict"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_orphaned_conflict", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_orphaned_conflict", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "unconfirmed tx conflicts with tx in orphaned block, orphaned lower last_seen",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_orphaned_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "Orphaned Block")],
|
||||||
|
last_seen: Some(100),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_1"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_1", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_1", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 20000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "multiple unconfirmed txs conflict with a confirmed tx",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_3",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(40000, Some(3))],
|
||||||
|
last_seen: Some(400),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_confirmed_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_confirmed_conflict"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_confirmed_conflict", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_confirmed_conflict", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 50000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends B, all the transactions are unconfirmed, B' has higher last_seen than B",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
last_seen: Some(22),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(23),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
last_seen: Some(24),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("B", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
last_seen: Some(25),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// A, B, C will appear in the list methods
|
||||||
|
// This is because B' has a higher last seen than B, but C has a higher
|
||||||
|
// last seen than B', so B and C are considered canonical
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B", "C"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B", 0), ("C", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("C", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends B, A and B' are in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "E")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("B", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// B and C should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 20000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends B', A and B' are in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "E")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("B'", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// B should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'", "C"]),
|
||||||
|
exp_chain_txouts: HashSet::from([
|
||||||
|
("A", 0),
|
||||||
|
("B'", 0),
|
||||||
|
("C", 0),
|
||||||
|
]),
|
||||||
|
exp_unspents: HashSet::from([("C", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends both B and B', A is in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("B", 0),
|
||||||
|
TxInTemplate::PrevTx("B'", 0),
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// C should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, B' is confirmed, C spends both B and B', A is in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("B", 0),
|
||||||
|
TxInTemplate::PrevTx("B'", 0),
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(5))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// C should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 50000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, B' is confirmed, C spends both B and B', D spends C, A is in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("B", 0),
|
||||||
|
TxInTemplate::PrevTx("B'", 0),
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(5))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "D",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("C", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(6))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// D should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 50000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for scenario in scenarios {
|
||||||
|
let (tx_graph, spk_index, exp_tx_ids) = init_graph(scenario.tx_templates.iter());
|
||||||
|
|
||||||
|
let txs = tx_graph
|
||||||
|
.list_chain_txs(&local_chain, chain_tip)
|
||||||
|
.map(|tx| tx.tx_node.txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_txs = scenario
|
||||||
|
.exp_chain_txs
|
||||||
|
.iter()
|
||||||
|
.map(|txid| *exp_tx_ids.get(txid).expect("txid must exist"))
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
txs, exp_txs,
|
||||||
|
"\n[{}] 'list_chain_txs' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let txouts = tx_graph
|
||||||
|
.filter_chain_txouts(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
spk_index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.map(|(_, full_txout)| full_txout.outpoint)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_txouts = scenario
|
||||||
|
.exp_chain_txouts
|
||||||
|
.iter()
|
||||||
|
.map(|(txid, vout)| OutPoint {
|
||||||
|
txid: *exp_tx_ids.get(txid).expect("txid must exist"),
|
||||||
|
vout: *vout,
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
txouts, exp_txouts,
|
||||||
|
"\n[{}] 'filter_chain_txouts' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let utxos = tx_graph
|
||||||
|
.filter_chain_unspents(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
spk_index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.map(|(_, full_txout)| full_txout.outpoint)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_utxos = scenario
|
||||||
|
.exp_unspents
|
||||||
|
.iter()
|
||||||
|
.map(|(txid, vout)| OutPoint {
|
||||||
|
txid: *exp_tx_ids.get(txid).expect("txid must exist"),
|
||||||
|
vout: *vout,
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
utxos, exp_utxos,
|
||||||
|
"\n[{}] 'filter_chain_unspents' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let balance = tx_graph.balance(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
spk_index.outpoints().iter().cloned(),
|
||||||
|
|_, spk: &Script| spk_index.index_of_spk(spk).is_some(),
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
balance, scenario.exp_balance,
|
||||||
|
"\n[{}] 'balance' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
17
crates/electrum/Cargo.toml
Normal file
17
crates/electrum/Cargo.toml
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_electrum"
|
||||||
|
version = "0.7.0"
|
||||||
|
edition = "2021"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk_electrum"
|
||||||
|
description = "Fetch data from electrum in the form BDK accepts"
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../chain", version = "0.9.0", default-features = false }
|
||||||
|
electrum-client = { version = "0.18" }
|
||||||
|
#rustls = { version = "=0.21.1", optional = true, features = ["dangerous_configuration"] }
|
||||||
7
crates/electrum/README.md
Normal file
7
crates/electrum/README.md
Normal file
@@ -0,0 +1,7 @@
|
|||||||
|
# BDK Electrum
|
||||||
|
|
||||||
|
BDK Electrum extends [`electrum-client`] to update [`bdk_chain`] structures
|
||||||
|
from an Electrum server.
|
||||||
|
|
||||||
|
[`electrum-client`]: https://docs.rs/electrum-client/
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||||
559
crates/electrum/src/electrum_ext.rs
Normal file
559
crates/electrum/src/electrum_ext.rs
Normal file
@@ -0,0 +1,559 @@
|
|||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{OutPoint, ScriptBuf, Transaction, Txid},
|
||||||
|
local_chain::{self, CheckPoint},
|
||||||
|
tx_graph::{self, TxGraph},
|
||||||
|
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeHeightAnchor,
|
||||||
|
};
|
||||||
|
use electrum_client::{Client, ElectrumApi, Error, HeaderNotification};
|
||||||
|
use std::{
|
||||||
|
collections::{BTreeMap, BTreeSet, HashMap, HashSet},
|
||||||
|
fmt::Debug,
|
||||||
|
str::FromStr,
|
||||||
|
};
|
||||||
|
|
||||||
|
/// We include a chain suffix of a certain length for the purpose of robustness.
|
||||||
|
const CHAIN_SUFFIX_LENGTH: u32 = 8;
|
||||||
|
|
||||||
|
/// Represents updates fetched from an Electrum server, but excludes full transactions.
|
||||||
|
///
|
||||||
|
/// To provide a complete update to [`TxGraph`], you'll need to call [`Self::missing_full_txs`] to
|
||||||
|
/// determine the full transactions missing from [`TxGraph`]. Then call [`Self::into_tx_graph`] to
|
||||||
|
/// fetch the full transactions from Electrum and finalize the update.
|
||||||
|
#[derive(Debug, Default, Clone)]
|
||||||
|
pub struct RelevantTxids(HashMap<Txid, BTreeSet<ConfirmationHeightAnchor>>);
|
||||||
|
|
||||||
|
impl RelevantTxids {
|
||||||
|
/// Determine the full transactions that are missing from `graph`.
|
||||||
|
///
|
||||||
|
/// Refer to [`RelevantTxids`] for more details.
|
||||||
|
pub fn missing_full_txs<A: Anchor>(&self, graph: &TxGraph<A>) -> Vec<Txid> {
|
||||||
|
self.0
|
||||||
|
.keys()
|
||||||
|
.filter(move |&&txid| graph.as_ref().get_tx(txid).is_none())
|
||||||
|
.cloned()
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finalizes the [`TxGraph`] update by fetching `missing` txids from the `client`.
|
||||||
|
///
|
||||||
|
/// Refer to [`RelevantTxids`] for more details.
|
||||||
|
pub fn into_tx_graph(
|
||||||
|
self,
|
||||||
|
client: &Client,
|
||||||
|
seen_at: Option<u64>,
|
||||||
|
missing: Vec<Txid>,
|
||||||
|
) -> Result<TxGraph<ConfirmationHeightAnchor>, Error> {
|
||||||
|
let new_txs = client.batch_transaction_get(&missing)?;
|
||||||
|
let mut graph = TxGraph::<ConfirmationHeightAnchor>::new(new_txs);
|
||||||
|
for (txid, anchors) in self.0 {
|
||||||
|
if let Some(seen_at) = seen_at {
|
||||||
|
let _ = graph.insert_seen_at(txid, seen_at);
|
||||||
|
}
|
||||||
|
for anchor in anchors {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(graph)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finalizes the update by fetching `missing` txids from the `client`, where the
|
||||||
|
/// resulting [`TxGraph`] has anchors of type [`ConfirmationTimeHeightAnchor`].
|
||||||
|
///
|
||||||
|
/// Refer to [`RelevantTxids`] for more details.
|
||||||
|
///
|
||||||
|
/// **Note:** The confirmation time might not be precisely correct if there has been a reorg.
|
||||||
|
// Electrum's API intends that we use the merkle proof API, we should change `bdk_electrum` to
|
||||||
|
// use it.
|
||||||
|
pub fn into_confirmation_time_tx_graph(
|
||||||
|
self,
|
||||||
|
client: &Client,
|
||||||
|
seen_at: Option<u64>,
|
||||||
|
missing: Vec<Txid>,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||||
|
let graph = self.into_tx_graph(client, seen_at, missing)?;
|
||||||
|
|
||||||
|
let relevant_heights = {
|
||||||
|
let mut visited_heights = HashSet::new();
|
||||||
|
graph
|
||||||
|
.all_anchors()
|
||||||
|
.iter()
|
||||||
|
.map(|(a, _)| a.confirmation_height_upper_bound())
|
||||||
|
.filter(move |&h| visited_heights.insert(h))
|
||||||
|
.collect::<Vec<_>>()
|
||||||
|
};
|
||||||
|
|
||||||
|
let height_to_time = relevant_heights
|
||||||
|
.clone()
|
||||||
|
.into_iter()
|
||||||
|
.zip(
|
||||||
|
client
|
||||||
|
.batch_block_header(relevant_heights)?
|
||||||
|
.into_iter()
|
||||||
|
.map(|bh| bh.time as u64),
|
||||||
|
)
|
||||||
|
.collect::<HashMap<u32, u64>>();
|
||||||
|
|
||||||
|
let graph_changeset = {
|
||||||
|
let old_changeset = TxGraph::default().apply_update(graph);
|
||||||
|
tx_graph::ChangeSet {
|
||||||
|
txs: old_changeset.txs,
|
||||||
|
txouts: old_changeset.txouts,
|
||||||
|
last_seen: old_changeset.last_seen,
|
||||||
|
anchors: old_changeset
|
||||||
|
.anchors
|
||||||
|
.into_iter()
|
||||||
|
.map(|(height_anchor, txid)| {
|
||||||
|
let confirmation_height = height_anchor.confirmation_height;
|
||||||
|
let confirmation_time = height_to_time[&confirmation_height];
|
||||||
|
let time_anchor = ConfirmationTimeHeightAnchor {
|
||||||
|
anchor_block: height_anchor.anchor_block,
|
||||||
|
confirmation_height,
|
||||||
|
confirmation_time,
|
||||||
|
};
|
||||||
|
(time_anchor, txid)
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut new_graph = TxGraph::default();
|
||||||
|
new_graph.apply_changeset(graph_changeset);
|
||||||
|
Ok(new_graph)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Combination of chain and transactions updates from electrum
|
||||||
|
///
|
||||||
|
/// We have to update the chain and the txids at the same time since we anchor the txids to
|
||||||
|
/// the same chain tip that we check before and after we gather the txids.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct ElectrumUpdate {
|
||||||
|
/// Chain update
|
||||||
|
pub chain_update: local_chain::Update,
|
||||||
|
/// Transaction updates from electrum
|
||||||
|
pub relevant_txids: RelevantTxids,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Trait to extend [`Client`] functionality.
|
||||||
|
pub trait ElectrumExt {
|
||||||
|
/// Full scan the keychain scripts specified with the blockchain (via an Electrum client) and
|
||||||
|
/// returns updates for [`bdk_chain`] data structures.
|
||||||
|
///
|
||||||
|
/// - `prev_tip`: the most recent blockchain tip present locally
|
||||||
|
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||||
|
///
|
||||||
|
/// The full scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||||
|
/// transactions. `batch_size` specifies the max number of script pubkeys to request for in a
|
||||||
|
/// single batch request.
|
||||||
|
fn full_scan<K: Ord + Clone>(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
|
stop_gap: usize,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<(ElectrumUpdate, BTreeMap<K, u32>), Error>;
|
||||||
|
|
||||||
|
/// Sync a set of scripts with the blockchain (via an Electrum client) for the data specified
|
||||||
|
/// and returns updates for [`bdk_chain`] data structures.
|
||||||
|
///
|
||||||
|
/// - `prev_tip`: the most recent blockchain tip present locally
|
||||||
|
/// - `misc_spks`: an iterator of scripts we want to sync transactions for
|
||||||
|
/// - `txids`: transactions for which we want updated [`Anchor`]s
|
||||||
|
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||||
|
/// want to include in the update
|
||||||
|
///
|
||||||
|
/// `batch_size` specifies the max number of script pubkeys to request for in a single batch
|
||||||
|
/// request.
|
||||||
|
///
|
||||||
|
/// If the scripts to sync are unknown, such as when restoring or importing a keychain that
|
||||||
|
/// may include scripts that have been used, use [`full_scan`] with the keychain.
|
||||||
|
///
|
||||||
|
/// [`full_scan`]: ElectrumExt::full_scan
|
||||||
|
fn sync(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<ElectrumUpdate, Error>;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: ElectrumApi> ElectrumExt for A {
|
||||||
|
fn full_scan<K: Ord + Clone>(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
|
stop_gap: usize,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<(ElectrumUpdate, BTreeMap<K, u32>), Error> {
|
||||||
|
let mut request_spks = keychain_spks
|
||||||
|
.into_iter()
|
||||||
|
.map(|(k, s)| (k.clone(), s.into_iter()))
|
||||||
|
.collect::<BTreeMap<K, _>>();
|
||||||
|
let mut scanned_spks = BTreeMap::<(K, u32), (ScriptBuf, bool)>::new();
|
||||||
|
|
||||||
|
let (electrum_update, keychain_update) = loop {
|
||||||
|
let (tip, _) = construct_update_tip(self, prev_tip.clone())?;
|
||||||
|
let mut relevant_txids = RelevantTxids::default();
|
||||||
|
let cps = tip
|
||||||
|
.iter()
|
||||||
|
.take(10)
|
||||||
|
.map(|cp| (cp.height(), cp))
|
||||||
|
.collect::<BTreeMap<u32, CheckPoint>>();
|
||||||
|
|
||||||
|
if !request_spks.is_empty() {
|
||||||
|
if !scanned_spks.is_empty() {
|
||||||
|
scanned_spks.append(&mut populate_with_spks(
|
||||||
|
self,
|
||||||
|
&cps,
|
||||||
|
&mut relevant_txids,
|
||||||
|
&mut scanned_spks
|
||||||
|
.iter()
|
||||||
|
.map(|(i, (spk, _))| (i.clone(), spk.clone())),
|
||||||
|
stop_gap,
|
||||||
|
batch_size,
|
||||||
|
)?);
|
||||||
|
}
|
||||||
|
for (keychain, keychain_spks) in &mut request_spks {
|
||||||
|
scanned_spks.extend(
|
||||||
|
populate_with_spks(
|
||||||
|
self,
|
||||||
|
&cps,
|
||||||
|
&mut relevant_txids,
|
||||||
|
keychain_spks,
|
||||||
|
stop_gap,
|
||||||
|
batch_size,
|
||||||
|
)?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(spk_i, spk)| ((keychain.clone(), spk_i), spk)),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// check for reorgs during scan process
|
||||||
|
let server_blockhash = self.block_header(tip.height() as usize)?.block_hash();
|
||||||
|
if tip.hash() != server_blockhash {
|
||||||
|
continue; // reorg
|
||||||
|
}
|
||||||
|
|
||||||
|
let chain_update = local_chain::Update {
|
||||||
|
tip,
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
};
|
||||||
|
|
||||||
|
let keychain_update = request_spks
|
||||||
|
.into_keys()
|
||||||
|
.filter_map(|k| {
|
||||||
|
scanned_spks
|
||||||
|
.range((k.clone(), u32::MIN)..=(k.clone(), u32::MAX))
|
||||||
|
.rev()
|
||||||
|
.find(|(_, (_, active))| *active)
|
||||||
|
.map(|((_, i), _)| (k, *i))
|
||||||
|
})
|
||||||
|
.collect::<BTreeMap<_, _>>();
|
||||||
|
|
||||||
|
break (
|
||||||
|
ElectrumUpdate {
|
||||||
|
chain_update,
|
||||||
|
relevant_txids,
|
||||||
|
},
|
||||||
|
keychain_update,
|
||||||
|
);
|
||||||
|
};
|
||||||
|
|
||||||
|
Ok((electrum_update, keychain_update))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn sync(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<ElectrumUpdate, Error> {
|
||||||
|
let spk_iter = misc_spks
|
||||||
|
.into_iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, spk)| (i as u32, spk));
|
||||||
|
|
||||||
|
let (mut electrum_update, _) = self.full_scan(
|
||||||
|
prev_tip.clone(),
|
||||||
|
[((), spk_iter)].into(),
|
||||||
|
usize::MAX,
|
||||||
|
batch_size,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let (tip, _) = construct_update_tip(self, prev_tip)?;
|
||||||
|
let cps = tip
|
||||||
|
.iter()
|
||||||
|
.take(10)
|
||||||
|
.map(|cp| (cp.height(), cp))
|
||||||
|
.collect::<BTreeMap<u32, CheckPoint>>();
|
||||||
|
|
||||||
|
populate_with_txids(self, &cps, &mut electrum_update.relevant_txids, txids)?;
|
||||||
|
|
||||||
|
let _txs =
|
||||||
|
populate_with_outpoints(self, &cps, &mut electrum_update.relevant_txids, outpoints)?;
|
||||||
|
|
||||||
|
Ok(electrum_update)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return a [`CheckPoint`] of the latest tip, that connects with `prev_tip`.
|
||||||
|
fn construct_update_tip(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
) -> Result<(CheckPoint, Option<u32>), Error> {
|
||||||
|
let HeaderNotification { height, .. } = client.block_headers_subscribe()?;
|
||||||
|
let new_tip_height = height as u32;
|
||||||
|
|
||||||
|
// If electrum returns a tip height that is lower than our previous tip, then checkpoints do
|
||||||
|
// not need updating. We just return the previous tip and use that as the point of agreement.
|
||||||
|
if new_tip_height < prev_tip.height() {
|
||||||
|
return Ok((prev_tip.clone(), Some(prev_tip.height())));
|
||||||
|
}
|
||||||
|
|
||||||
|
// Atomically fetch the latest `CHAIN_SUFFIX_LENGTH` count of blocks from Electrum. We use this
|
||||||
|
// to construct our checkpoint update.
|
||||||
|
let mut new_blocks = {
|
||||||
|
let start_height = new_tip_height.saturating_sub(CHAIN_SUFFIX_LENGTH - 1);
|
||||||
|
let hashes = client
|
||||||
|
.block_headers(start_height as _, CHAIN_SUFFIX_LENGTH as _)?
|
||||||
|
.headers
|
||||||
|
.into_iter()
|
||||||
|
.map(|h| h.block_hash());
|
||||||
|
(start_height..).zip(hashes).collect::<BTreeMap<u32, _>>()
|
||||||
|
};
|
||||||
|
|
||||||
|
// Find the "point of agreement" (if any).
|
||||||
|
let agreement_cp = {
|
||||||
|
let mut agreement_cp = Option::<CheckPoint>::None;
|
||||||
|
for cp in prev_tip.iter() {
|
||||||
|
let cp_block = cp.block_id();
|
||||||
|
let hash = match new_blocks.get(&cp_block.height) {
|
||||||
|
Some(&hash) => hash,
|
||||||
|
None => {
|
||||||
|
assert!(
|
||||||
|
new_tip_height >= cp_block.height,
|
||||||
|
"already checked that electrum's tip cannot be smaller"
|
||||||
|
);
|
||||||
|
let hash = client.block_header(cp_block.height as _)?.block_hash();
|
||||||
|
new_blocks.insert(cp_block.height, hash);
|
||||||
|
hash
|
||||||
|
}
|
||||||
|
};
|
||||||
|
if hash == cp_block.hash {
|
||||||
|
agreement_cp = Some(cp);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
agreement_cp
|
||||||
|
};
|
||||||
|
|
||||||
|
let agreement_height = agreement_cp.as_ref().map(CheckPoint::height);
|
||||||
|
|
||||||
|
let new_tip = new_blocks
|
||||||
|
.into_iter()
|
||||||
|
// Prune `new_blocks` to only include blocks that are actually new.
|
||||||
|
.filter(|(height, _)| Some(*height) > agreement_height)
|
||||||
|
.map(|(height, hash)| BlockId { height, hash })
|
||||||
|
.fold(agreement_cp, |prev_cp, block| {
|
||||||
|
Some(match prev_cp {
|
||||||
|
Some(cp) => cp.push(block).expect("must extend checkpoint"),
|
||||||
|
None => CheckPoint::new(block),
|
||||||
|
})
|
||||||
|
})
|
||||||
|
.expect("must have at least one checkpoint");
|
||||||
|
|
||||||
|
Ok((new_tip, agreement_height))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A [tx status] comprises of a concatenation of `tx_hash:height:`s. We transform a single one of
|
||||||
|
/// these concatenations into a [`ConfirmationHeightAnchor`] if possible.
|
||||||
|
///
|
||||||
|
/// We use the lowest possible checkpoint as the anchor block (from `cps`). If an anchor block
|
||||||
|
/// cannot be found, or the transaction is unconfirmed, [`None`] is returned.
|
||||||
|
///
|
||||||
|
/// [tx status](https://electrumx-spesmilo.readthedocs.io/en/latest/protocol-basics.html#status)
|
||||||
|
fn determine_tx_anchor(
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
raw_height: i32,
|
||||||
|
txid: Txid,
|
||||||
|
) -> Option<ConfirmationHeightAnchor> {
|
||||||
|
// The electrum API has a weird quirk where an unconfirmed transaction is presented with a
|
||||||
|
// height of 0. To avoid invalid representation in our data structures, we manually set
|
||||||
|
// transactions residing in the genesis block to have height 0, then interpret a height of 0 as
|
||||||
|
// unconfirmed for all other transactions.
|
||||||
|
if txid
|
||||||
|
== Txid::from_str("4a5e1e4baab89f3a32518a88c31bc87f618f76673e2cc77ab2127b7afdeda33b")
|
||||||
|
.expect("must deserialize genesis coinbase txid")
|
||||||
|
{
|
||||||
|
let anchor_block = cps.values().next()?.block_id();
|
||||||
|
return Some(ConfirmationHeightAnchor {
|
||||||
|
anchor_block,
|
||||||
|
confirmation_height: 0,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
match raw_height {
|
||||||
|
h if h <= 0 => {
|
||||||
|
debug_assert!(h == 0 || h == -1, "unexpected height ({}) from electrum", h);
|
||||||
|
None
|
||||||
|
}
|
||||||
|
h => {
|
||||||
|
let h = h as u32;
|
||||||
|
let anchor_block = cps.range(h..).next().map(|(_, cp)| cp.block_id())?;
|
||||||
|
if h > anchor_block.height {
|
||||||
|
None
|
||||||
|
} else {
|
||||||
|
Some(ConfirmationHeightAnchor {
|
||||||
|
anchor_block,
|
||||||
|
confirmation_height: h,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn populate_with_outpoints(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
relevant_txids: &mut RelevantTxids,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
) -> Result<HashMap<Txid, Transaction>, Error> {
|
||||||
|
let mut full_txs = HashMap::new();
|
||||||
|
for outpoint in outpoints {
|
||||||
|
let txid = outpoint.txid;
|
||||||
|
let tx = client.transaction_get(&txid)?;
|
||||||
|
debug_assert_eq!(tx.txid(), txid);
|
||||||
|
let txout = match tx.output.get(outpoint.vout as usize) {
|
||||||
|
Some(txout) => txout,
|
||||||
|
None => continue,
|
||||||
|
};
|
||||||
|
// attempt to find the following transactions (alongside their chain positions), and
|
||||||
|
// add to our sparsechain `update`:
|
||||||
|
let mut has_residing = false; // tx in which the outpoint resides
|
||||||
|
let mut has_spending = false; // tx that spends the outpoint
|
||||||
|
for res in client.script_get_history(&txout.script_pubkey)? {
|
||||||
|
if has_residing && has_spending {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
if res.tx_hash == txid {
|
||||||
|
if has_residing {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
has_residing = true;
|
||||||
|
full_txs.insert(res.tx_hash, tx.clone());
|
||||||
|
} else {
|
||||||
|
if has_spending {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
let res_tx = match full_txs.get(&res.tx_hash) {
|
||||||
|
Some(tx) => tx,
|
||||||
|
None => {
|
||||||
|
let res_tx = client.transaction_get(&res.tx_hash)?;
|
||||||
|
full_txs.insert(res.tx_hash, res_tx);
|
||||||
|
full_txs.get(&res.tx_hash).expect("just inserted")
|
||||||
|
}
|
||||||
|
};
|
||||||
|
has_spending = res_tx
|
||||||
|
.input
|
||||||
|
.iter()
|
||||||
|
.any(|txin| txin.previous_output == outpoint);
|
||||||
|
if !has_spending {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let anchor = determine_tx_anchor(cps, res.height, res.tx_hash);
|
||||||
|
let tx_entry = relevant_txids.0.entry(res.tx_hash).or_default();
|
||||||
|
if let Some(anchor) = anchor {
|
||||||
|
tx_entry.insert(anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(full_txs)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn populate_with_txids(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
relevant_txids: &mut RelevantTxids,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
) -> Result<(), Error> {
|
||||||
|
for txid in txids {
|
||||||
|
let tx = match client.transaction_get(&txid) {
|
||||||
|
Ok(tx) => tx,
|
||||||
|
Err(electrum_client::Error::Protocol(_)) => continue,
|
||||||
|
Err(other_err) => return Err(other_err),
|
||||||
|
};
|
||||||
|
|
||||||
|
let spk = tx
|
||||||
|
.output
|
||||||
|
.first()
|
||||||
|
.map(|txo| &txo.script_pubkey)
|
||||||
|
.expect("tx must have an output");
|
||||||
|
|
||||||
|
let anchor = match client
|
||||||
|
.script_get_history(spk)?
|
||||||
|
.into_iter()
|
||||||
|
.find(|r| r.tx_hash == txid)
|
||||||
|
{
|
||||||
|
Some(r) => determine_tx_anchor(cps, r.height, txid),
|
||||||
|
None => continue,
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_entry = relevant_txids.0.entry(txid).or_default();
|
||||||
|
if let Some(anchor) = anchor {
|
||||||
|
tx_entry.insert(anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn populate_with_spks<I: Ord + Clone>(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
relevant_txids: &mut RelevantTxids,
|
||||||
|
spks: &mut impl Iterator<Item = (I, ScriptBuf)>,
|
||||||
|
stop_gap: usize,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<BTreeMap<I, (ScriptBuf, bool)>, Error> {
|
||||||
|
let mut unused_spk_count = 0_usize;
|
||||||
|
let mut scanned_spks = BTreeMap::new();
|
||||||
|
|
||||||
|
loop {
|
||||||
|
let spks = (0..batch_size)
|
||||||
|
.map_while(|_| spks.next())
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
if spks.is_empty() {
|
||||||
|
return Ok(scanned_spks);
|
||||||
|
}
|
||||||
|
|
||||||
|
let spk_histories =
|
||||||
|
client.batch_script_get_history(spks.iter().map(|(_, s)| s.as_script()))?;
|
||||||
|
|
||||||
|
for ((spk_index, spk), spk_history) in spks.into_iter().zip(spk_histories) {
|
||||||
|
if spk_history.is_empty() {
|
||||||
|
scanned_spks.insert(spk_index, (spk, false));
|
||||||
|
unused_spk_count += 1;
|
||||||
|
if unused_spk_count > stop_gap {
|
||||||
|
return Ok(scanned_spks);
|
||||||
|
}
|
||||||
|
continue;
|
||||||
|
} else {
|
||||||
|
scanned_spks.insert(spk_index, (spk, true));
|
||||||
|
unused_spk_count = 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
for tx in spk_history {
|
||||||
|
let tx_entry = relevant_txids.0.entry(tx.tx_hash).or_default();
|
||||||
|
if let Some(anchor) = determine_tx_anchor(cps, tx.height, tx.tx_hash) {
|
||||||
|
tx_entry.insert(anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
30
crates/electrum/src/lib.rs
Normal file
30
crates/electrum/src/lib.rs
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
//! This crate is used for updating structures of [`bdk_chain`] with data from an Electrum server.
|
||||||
|
//!
|
||||||
|
//! The two primary methods are [`ElectrumExt::sync`] and [`ElectrumExt::full_scan`]. In most cases
|
||||||
|
//! [`ElectrumExt::sync`] is used to sync the transaction histories of scripts that the application
|
||||||
|
//! cares about, for example the scripts for all the receive addresses of a Wallet's keychain that it
|
||||||
|
//! has shown a user. [`ElectrumExt::full_scan`] is meant to be used when importing or restoring a
|
||||||
|
//! keychain where the range of possibly used scripts is not known. In this case it is necessary to
|
||||||
|
//! scan all keychain scripts until a number (the "stop gap") of unused scripts is discovered. For a
|
||||||
|
//! sync or full scan the user receives relevant blockchain data and output updates for
|
||||||
|
//! [`bdk_chain`] including [`RelevantTxids`].
|
||||||
|
//!
|
||||||
|
//! The [`RelevantTxids`] only includes `txid`s and not full transactions. The caller is responsible
|
||||||
|
//! for obtaining full transactions before applying new data to their [`bdk_chain`]. This can be
|
||||||
|
//! done with these steps:
|
||||||
|
//!
|
||||||
|
//! 1. Determine which full transactions are missing. Use [`RelevantTxids::missing_full_txs`].
|
||||||
|
//!
|
||||||
|
//! 2. Obtaining the full transactions. To do this via electrum use [`ElectrumApi::batch_transaction_get`].
|
||||||
|
//!
|
||||||
|
//! Refer to [`example_electrum`] for a complete example.
|
||||||
|
//!
|
||||||
|
//! [`ElectrumApi::batch_transaction_get`]: electrum_client::ElectrumApi::batch_transaction_get
|
||||||
|
//! [`example_electrum`]: https://github.com/bitcoindevkit/bdk/tree/master/example-crates/example_electrum
|
||||||
|
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
|
mod electrum_ext;
|
||||||
|
pub use bdk_chain;
|
||||||
|
pub use electrum_client;
|
||||||
|
pub use electrum_ext::*;
|
||||||
34
crates/esplora/Cargo.toml
Normal file
34
crates/esplora/Cargo.toml
Normal file
@@ -0,0 +1,34 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_esplora"
|
||||||
|
version = "0.7.0"
|
||||||
|
edition = "2021"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk_esplora"
|
||||||
|
description = "Fetch data from esplora in the form that accepts"
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../chain", version = "0.9.0", default-features = false }
|
||||||
|
esplora-client = { version = "0.6.0", default-features = false }
|
||||||
|
async-trait = { version = "0.1.66", optional = true }
|
||||||
|
futures = { version = "0.3.26", optional = true }
|
||||||
|
|
||||||
|
# use these dependencies if you need to enable their /no-std features
|
||||||
|
bitcoin = { version = "0.30.0", optional = true, default-features = false }
|
||||||
|
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||||
|
|
||||||
|
[target.'cfg(not(target_arch = "wasm32"))'.dev-dependencies]
|
||||||
|
electrsd = { version= "0.25.0", features = ["bitcoind_25_0", "esplora_a33e97e1", "legacy"] }
|
||||||
|
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
default = ["std", "async-https", "blocking"]
|
||||||
|
std = ["bdk_chain/std"]
|
||||||
|
async = ["async-trait", "futures", "esplora-client/async"]
|
||||||
|
async-https = ["async", "esplora-client/async-https"]
|
||||||
|
async-https-rustls = ["async", "esplora-client/async-https-rustls"]
|
||||||
|
blocking = ["esplora-client/blocking"]
|
||||||
36
crates/esplora/README.md
Normal file
36
crates/esplora/README.md
Normal file
@@ -0,0 +1,36 @@
|
|||||||
|
# BDK Esplora
|
||||||
|
|
||||||
|
BDK Esplora extends [`esplora-client`] to update [`bdk_chain`] structures
|
||||||
|
from an Esplora server.
|
||||||
|
|
||||||
|
## Usage
|
||||||
|
|
||||||
|
There are two versions of the extension trait (blocking and async).
|
||||||
|
|
||||||
|
For blocking-only:
|
||||||
|
```toml
|
||||||
|
bdk_esplora = { version = "0.3", features = ["blocking"] }
|
||||||
|
```
|
||||||
|
|
||||||
|
For async-only:
|
||||||
|
```toml
|
||||||
|
bdk_esplora = { version = "0.3", features = ["async"] }
|
||||||
|
```
|
||||||
|
|
||||||
|
For async-only (with https):
|
||||||
|
```toml
|
||||||
|
bdk_esplora = { version = "0.3", features = ["async-https"] }
|
||||||
|
```
|
||||||
|
|
||||||
|
To use the extension traits:
|
||||||
|
```rust
|
||||||
|
// for blocking
|
||||||
|
use bdk_esplora::EsploraExt;
|
||||||
|
// for async
|
||||||
|
// use bdk_esplora::EsploraAsyncExt;
|
||||||
|
```
|
||||||
|
|
||||||
|
For full examples, refer to [`example-crates/wallet_esplora_blocking`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_blocking) and [`example-crates/wallet_esplora_async`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_async).
|
||||||
|
|
||||||
|
[`esplora-client`]: https://docs.rs/esplora-client/
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||||
302
crates/esplora/src/async_ext.rs
Normal file
302
crates/esplora/src/async_ext.rs
Normal file
@@ -0,0 +1,302 @@
|
|||||||
|
use async_trait::async_trait;
|
||||||
|
use bdk_chain::collections::btree_map;
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{BlockHash, OutPoint, ScriptBuf, Txid},
|
||||||
|
collections::BTreeMap,
|
||||||
|
local_chain::{self, CheckPoint},
|
||||||
|
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||||
|
};
|
||||||
|
use esplora_client::{Error, TxStatus};
|
||||||
|
use futures::{stream::FuturesOrdered, TryStreamExt};
|
||||||
|
|
||||||
|
use crate::anchor_from_status;
|
||||||
|
|
||||||
|
/// Trait to extend the functionality of [`esplora_client::AsyncClient`].
|
||||||
|
///
|
||||||
|
/// Refer to [crate-level documentation] for more.
|
||||||
|
///
|
||||||
|
/// [crate-level documentation]: crate
|
||||||
|
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||||
|
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||||
|
pub trait EsploraAsyncExt {
|
||||||
|
/// Prepare a [`LocalChain`] update with blocks fetched from Esplora.
|
||||||
|
///
|
||||||
|
/// * `local_tip` is the previous tip of [`LocalChain::tip`].
|
||||||
|
/// * `request_heights` is the block heights that we are interested in fetching from Esplora.
|
||||||
|
///
|
||||||
|
/// The result of this method can be applied to [`LocalChain::apply_update`].
|
||||||
|
///
|
||||||
|
/// ## Consistency
|
||||||
|
///
|
||||||
|
/// The chain update returned is guaranteed to be consistent as long as there is not a *large* re-org
|
||||||
|
/// during the call. The size of re-org we can tollerate is server dependent but will be at
|
||||||
|
/// least 10.
|
||||||
|
///
|
||||||
|
/// [`LocalChain`]: bdk_chain::local_chain::LocalChain
|
||||||
|
/// [`LocalChain::tip`]: bdk_chain::local_chain::LocalChain::tip
|
||||||
|
/// [`LocalChain::apply_update`]: bdk_chain::local_chain::LocalChain::apply_update
|
||||||
|
#[allow(clippy::result_large_err)]
|
||||||
|
async fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||||
|
) -> Result<local_chain::Update, Error>;
|
||||||
|
|
||||||
|
/// Full scan the keychain scripts specified with the blockchain (via an Esplora client) and
|
||||||
|
/// returns a [`TxGraph`] and a map of last active indices.
|
||||||
|
///
|
||||||
|
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||||
|
///
|
||||||
|
/// The full scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||||
|
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||||
|
/// parallel.
|
||||||
|
#[allow(clippy::result_large_err)]
|
||||||
|
async fn full_scan<K: Ord + Clone + Send>(
|
||||||
|
&self,
|
||||||
|
keychain_spks: BTreeMap<
|
||||||
|
K,
|
||||||
|
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, ScriptBuf)> + Send> + Send,
|
||||||
|
>,
|
||||||
|
stop_gap: usize,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||||
|
|
||||||
|
/// Sync a set of scripts with the blockchain (via an Esplora client) for the data
|
||||||
|
/// specified and return a [`TxGraph`].
|
||||||
|
///
|
||||||
|
/// * `misc_spks`: scripts that we want to sync transactions for
|
||||||
|
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||||
|
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||||
|
/// want to include in the update
|
||||||
|
///
|
||||||
|
/// If the scripts to sync are unknown, such as when restoring or importing a keychain that
|
||||||
|
/// may include scripts that have been used, use [`full_scan`] with the keychain.
|
||||||
|
///
|
||||||
|
/// [`full_scan`]: EsploraAsyncExt::full_scan
|
||||||
|
#[allow(clippy::result_large_err)]
|
||||||
|
async fn sync(
|
||||||
|
&self,
|
||||||
|
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = ScriptBuf> + Send> + Send,
|
||||||
|
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||||
|
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error>;
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||||
|
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||||
|
impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||||
|
async fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||||
|
) -> Result<local_chain::Update, Error> {
|
||||||
|
// Fetch latest N (server dependent) blocks from Esplora. The server guarantees these are
|
||||||
|
// consistent.
|
||||||
|
let mut fetched_blocks = self
|
||||||
|
.get_blocks(None)
|
||||||
|
.await?
|
||||||
|
.into_iter()
|
||||||
|
.map(|b| (b.time.height, b.id))
|
||||||
|
.collect::<BTreeMap<u32, BlockHash>>();
|
||||||
|
let new_tip_height = fetched_blocks
|
||||||
|
.keys()
|
||||||
|
.last()
|
||||||
|
.copied()
|
||||||
|
.expect("must have atleast one block");
|
||||||
|
|
||||||
|
// Fetch blocks of heights that the caller is interested in, skipping blocks that are
|
||||||
|
// already fetched when constructing `fetched_blocks`.
|
||||||
|
for height in request_heights {
|
||||||
|
// do not fetch blocks higher than remote tip
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// only fetch what is missing
|
||||||
|
if let btree_map::Entry::Vacant(entry) = fetched_blocks.entry(height) {
|
||||||
|
// ❗The return value of `get_block_hash` is not strictly guaranteed to be consistent
|
||||||
|
// with the chain at the time of `get_blocks` above (there could have been a deep
|
||||||
|
// re-org). Since `get_blocks` returns 10 (or so) blocks we are assuming that it's
|
||||||
|
// not possible to have a re-org deeper than that.
|
||||||
|
entry.insert(self.get_block_hash(height).await?);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Ensure `fetched_blocks` can create an update that connects with the original chain by
|
||||||
|
// finding a "Point of Agreement".
|
||||||
|
for (height, local_hash) in local_tip.iter().map(|cp| (cp.height(), cp.hash())) {
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
let fetched_hash = match fetched_blocks.entry(height) {
|
||||||
|
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||||
|
btree_map::Entry::Vacant(entry) => {
|
||||||
|
*entry.insert(self.get_block_hash(height).await?)
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// We have found point of agreement so the update will connect!
|
||||||
|
if fetched_hash == local_hash {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(local_chain::Update {
|
||||||
|
tip: CheckPoint::from_block_ids(fetched_blocks.into_iter().map(BlockId::from))
|
||||||
|
.expect("must be in height order"),
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn full_scan<K: Ord + Clone + Send>(
|
||||||
|
&self,
|
||||||
|
keychain_spks: BTreeMap<
|
||||||
|
K,
|
||||||
|
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, ScriptBuf)> + Send> + Send,
|
||||||
|
>,
|
||||||
|
stop_gap: usize,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||||
|
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||||
|
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||||
|
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||||
|
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||||
|
|
||||||
|
for (keychain, spks) in keychain_spks {
|
||||||
|
let mut spks = spks.into_iter();
|
||||||
|
let mut last_index = Option::<u32>::None;
|
||||||
|
let mut last_active_index = Option::<u32>::None;
|
||||||
|
|
||||||
|
loop {
|
||||||
|
let handles = spks
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.map(|(spk_index, spk)| {
|
||||||
|
let client = self.clone();
|
||||||
|
async move {
|
||||||
|
let mut last_seen = None;
|
||||||
|
let mut spk_txs = Vec::new();
|
||||||
|
loop {
|
||||||
|
let txs = client.scripthash_txs(&spk, last_seen).await?;
|
||||||
|
let tx_count = txs.len();
|
||||||
|
last_seen = txs.last().map(|tx| tx.txid);
|
||||||
|
spk_txs.extend(txs);
|
||||||
|
if tx_count < 25 {
|
||||||
|
break Result::<_, Error>::Ok((spk_index, spk_txs));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<FuturesOrdered<_>>();
|
||||||
|
|
||||||
|
if handles.is_empty() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
for (index, txs) in handles.try_collect::<Vec<TxsOfSpkIndex>>().await? {
|
||||||
|
last_index = Some(index);
|
||||||
|
if !txs.is_empty() {
|
||||||
|
last_active_index = Some(index);
|
||||||
|
}
|
||||||
|
for tx in txs {
|
||||||
|
let _ = graph.insert_tx(tx.to_tx());
|
||||||
|
if let Some(anchor) = anchor_from_status(&tx.status) {
|
||||||
|
let _ = graph.insert_anchor(tx.txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||||
|
let past_gap_limit = if let Some(i) = last_active_index {
|
||||||
|
last_index > i.saturating_add(stop_gap as u32)
|
||||||
|
} else {
|
||||||
|
last_index >= stop_gap as u32
|
||||||
|
};
|
||||||
|
if past_gap_limit {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(last_active_index) = last_active_index {
|
||||||
|
last_active_indexes.insert(keychain, last_active_index);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok((graph, last_active_indexes))
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn sync(
|
||||||
|
&self,
|
||||||
|
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = ScriptBuf> + Send> + Send,
|
||||||
|
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||||
|
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||||
|
let mut graph = self
|
||||||
|
.full_scan(
|
||||||
|
[(
|
||||||
|
(),
|
||||||
|
misc_spks
|
||||||
|
.into_iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, spk)| (i as u32, spk)),
|
||||||
|
)]
|
||||||
|
.into(),
|
||||||
|
usize::MAX,
|
||||||
|
parallel_requests,
|
||||||
|
)
|
||||||
|
.await
|
||||||
|
.map(|(g, _)| g)?;
|
||||||
|
|
||||||
|
let mut txids = txids.into_iter();
|
||||||
|
loop {
|
||||||
|
let handles = txids
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.filter(|&txid| graph.get_tx(txid).is_none())
|
||||||
|
.map(|txid| {
|
||||||
|
let client = self.clone();
|
||||||
|
async move { client.get_tx_status(&txid).await.map(|s| (txid, s)) }
|
||||||
|
})
|
||||||
|
.collect::<FuturesOrdered<_>>();
|
||||||
|
|
||||||
|
if handles.is_empty() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
for (txid, status) in handles.try_collect::<Vec<(Txid, TxStatus)>>().await? {
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for op in outpoints.into_iter() {
|
||||||
|
if graph.get_tx(op.txid).is_none() {
|
||||||
|
if let Some(tx) = self.get_tx(&op.txid).await? {
|
||||||
|
let _ = graph.insert_tx(tx);
|
||||||
|
}
|
||||||
|
let status = self.get_tx_status(&op.txid).await?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(op.txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(op_status) = self.get_output_status(&op.txid, op.vout as _).await? {
|
||||||
|
if let Some(txid) = op_status.txid {
|
||||||
|
if graph.get_tx(txid).is_none() {
|
||||||
|
if let Some(tx) = self.get_tx(&txid).await? {
|
||||||
|
let _ = graph.insert_tx(tx);
|
||||||
|
}
|
||||||
|
let status = self.get_tx_status(&txid).await?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(graph)
|
||||||
|
}
|
||||||
|
}
|
||||||
294
crates/esplora/src/blocking_ext.rs
Normal file
294
crates/esplora/src/blocking_ext.rs
Normal file
@@ -0,0 +1,294 @@
|
|||||||
|
use std::thread::JoinHandle;
|
||||||
|
|
||||||
|
use bdk_chain::collections::btree_map;
|
||||||
|
use bdk_chain::collections::BTreeMap;
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{BlockHash, OutPoint, ScriptBuf, Txid},
|
||||||
|
local_chain::{self, CheckPoint},
|
||||||
|
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||||
|
};
|
||||||
|
use esplora_client::{Error, TxStatus};
|
||||||
|
|
||||||
|
use crate::anchor_from_status;
|
||||||
|
|
||||||
|
/// Trait to extend the functionality of [`esplora_client::BlockingClient`].
|
||||||
|
///
|
||||||
|
/// Refer to [crate-level documentation] for more.
|
||||||
|
///
|
||||||
|
/// [crate-level documentation]: crate
|
||||||
|
pub trait EsploraExt {
|
||||||
|
/// Prepare a [`LocalChain`] update with blocks fetched from Esplora.
|
||||||
|
///
|
||||||
|
/// * `local_tip` is the previous tip of [`LocalChain::tip`].
|
||||||
|
/// * `request_heights` is the block heights that we are interested in fetching from Esplora.
|
||||||
|
///
|
||||||
|
/// The result of this method can be applied to [`LocalChain::apply_update`].
|
||||||
|
///
|
||||||
|
/// ## Consistency
|
||||||
|
///
|
||||||
|
/// The chain update returned is guaranteed to be consistent as long as there is not a *large* re-org
|
||||||
|
/// during the call. The size of re-org we can tollerate is server dependent but will be at
|
||||||
|
/// least 10.
|
||||||
|
///
|
||||||
|
/// [`LocalChain`]: bdk_chain::local_chain::LocalChain
|
||||||
|
/// [`LocalChain::tip`]: bdk_chain::local_chain::LocalChain::tip
|
||||||
|
/// [`LocalChain::apply_update`]: bdk_chain::local_chain::LocalChain::apply_update
|
||||||
|
#[allow(clippy::result_large_err)]
|
||||||
|
fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<Item = u32>,
|
||||||
|
) -> Result<local_chain::Update, Error>;
|
||||||
|
|
||||||
|
/// Full scan the keychain scripts specified with the blockchain (via an Esplora client) and
|
||||||
|
/// returns a [`TxGraph`] and a map of last active indices.
|
||||||
|
///
|
||||||
|
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||||
|
///
|
||||||
|
/// The full scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||||
|
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||||
|
/// parallel.
|
||||||
|
#[allow(clippy::result_large_err)]
|
||||||
|
fn full_scan<K: Ord + Clone>(
|
||||||
|
&self,
|
||||||
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
|
stop_gap: usize,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||||
|
|
||||||
|
/// Sync a set of scripts with the blockchain (via an Esplora client) for the data
|
||||||
|
/// specified and return a [`TxGraph`].
|
||||||
|
///
|
||||||
|
/// * `misc_spks`: scripts that we want to sync transactions for
|
||||||
|
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||||
|
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||||
|
/// want to include in the update
|
||||||
|
///
|
||||||
|
/// If the scripts to sync are unknown, such as when restoring or importing a keychain that
|
||||||
|
/// may include scripts that have been used, use [`full_scan`] with the keychain.
|
||||||
|
///
|
||||||
|
/// [`full_scan`]: EsploraExt::full_scan
|
||||||
|
#[allow(clippy::result_large_err)]
|
||||||
|
fn sync(
|
||||||
|
&self,
|
||||||
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error>;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl EsploraExt for esplora_client::BlockingClient {
|
||||||
|
fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<Item = u32>,
|
||||||
|
) -> Result<local_chain::Update, Error> {
|
||||||
|
// Fetch latest N (server dependent) blocks from Esplora. The server guarantees these are
|
||||||
|
// consistent.
|
||||||
|
let mut fetched_blocks = self
|
||||||
|
.get_blocks(None)?
|
||||||
|
.into_iter()
|
||||||
|
.map(|b| (b.time.height, b.id))
|
||||||
|
.collect::<BTreeMap<u32, BlockHash>>();
|
||||||
|
let new_tip_height = fetched_blocks
|
||||||
|
.keys()
|
||||||
|
.last()
|
||||||
|
.copied()
|
||||||
|
.expect("must atleast have one block");
|
||||||
|
|
||||||
|
// Fetch blocks of heights that the caller is interested in, skipping blocks that are
|
||||||
|
// already fetched when constructing `fetched_blocks`.
|
||||||
|
for height in request_heights {
|
||||||
|
// do not fetch blocks higher than remote tip
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// only fetch what is missing
|
||||||
|
if let btree_map::Entry::Vacant(entry) = fetched_blocks.entry(height) {
|
||||||
|
// ❗The return value of `get_block_hash` is not strictly guaranteed to be consistent
|
||||||
|
// with the chain at the time of `get_blocks` above (there could have been a deep
|
||||||
|
// re-org). Since `get_blocks` returns 10 (or so) blocks we are assuming that it's
|
||||||
|
// not possible to have a re-org deeper than that.
|
||||||
|
entry.insert(self.get_block_hash(height)?);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Ensure `fetched_blocks` can create an update that connects with the original chain by
|
||||||
|
// finding a "Point of Agreement".
|
||||||
|
for (height, local_hash) in local_tip.iter().map(|cp| (cp.height(), cp.hash())) {
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
let fetched_hash = match fetched_blocks.entry(height) {
|
||||||
|
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||||
|
btree_map::Entry::Vacant(entry) => *entry.insert(self.get_block_hash(height)?),
|
||||||
|
};
|
||||||
|
|
||||||
|
// We have found point of agreement so the update will connect!
|
||||||
|
if fetched_hash == local_hash {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(local_chain::Update {
|
||||||
|
tip: CheckPoint::from_block_ids(fetched_blocks.into_iter().map(BlockId::from))
|
||||||
|
.expect("must be in height order"),
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn full_scan<K: Ord + Clone>(
|
||||||
|
&self,
|
||||||
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
|
stop_gap: usize,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||||
|
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||||
|
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||||
|
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||||
|
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||||
|
|
||||||
|
for (keychain, spks) in keychain_spks {
|
||||||
|
let mut spks = spks.into_iter();
|
||||||
|
let mut last_index = Option::<u32>::None;
|
||||||
|
let mut last_active_index = Option::<u32>::None;
|
||||||
|
|
||||||
|
loop {
|
||||||
|
let handles = spks
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.map(|(spk_index, spk)| {
|
||||||
|
std::thread::spawn({
|
||||||
|
let client = self.clone();
|
||||||
|
move || -> Result<TxsOfSpkIndex, Error> {
|
||||||
|
let mut last_seen = None;
|
||||||
|
let mut spk_txs = Vec::new();
|
||||||
|
loop {
|
||||||
|
let txs = client.scripthash_txs(&spk, last_seen)?;
|
||||||
|
let tx_count = txs.len();
|
||||||
|
last_seen = txs.last().map(|tx| tx.txid);
|
||||||
|
spk_txs.extend(txs);
|
||||||
|
if tx_count < 25 {
|
||||||
|
break Ok((spk_index, spk_txs));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
})
|
||||||
|
.collect::<Vec<JoinHandle<Result<TxsOfSpkIndex, Error>>>>();
|
||||||
|
|
||||||
|
if handles.is_empty() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
for handle in handles {
|
||||||
|
let (index, txs) = handle.join().expect("thread must not panic")?;
|
||||||
|
last_index = Some(index);
|
||||||
|
if !txs.is_empty() {
|
||||||
|
last_active_index = Some(index);
|
||||||
|
}
|
||||||
|
for tx in txs {
|
||||||
|
let _ = graph.insert_tx(tx.to_tx());
|
||||||
|
if let Some(anchor) = anchor_from_status(&tx.status) {
|
||||||
|
let _ = graph.insert_anchor(tx.txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||||
|
let past_gap_limit = if let Some(i) = last_active_index {
|
||||||
|
last_index > i.saturating_add(stop_gap as u32)
|
||||||
|
} else {
|
||||||
|
last_index >= stop_gap as u32
|
||||||
|
};
|
||||||
|
if past_gap_limit {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(last_active_index) = last_active_index {
|
||||||
|
last_active_indexes.insert(keychain, last_active_index);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok((graph, last_active_indexes))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn sync(
|
||||||
|
&self,
|
||||||
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||||
|
let mut graph = self
|
||||||
|
.full_scan(
|
||||||
|
[(
|
||||||
|
(),
|
||||||
|
misc_spks
|
||||||
|
.into_iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, spk)| (i as u32, spk)),
|
||||||
|
)]
|
||||||
|
.into(),
|
||||||
|
usize::MAX,
|
||||||
|
parallel_requests,
|
||||||
|
)
|
||||||
|
.map(|(g, _)| g)?;
|
||||||
|
|
||||||
|
let mut txids = txids.into_iter();
|
||||||
|
loop {
|
||||||
|
let handles = txids
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.filter(|&txid| graph.get_tx(txid).is_none())
|
||||||
|
.map(|txid| {
|
||||||
|
std::thread::spawn({
|
||||||
|
let client = self.clone();
|
||||||
|
move || client.get_tx_status(&txid).map(|s| (txid, s))
|
||||||
|
})
|
||||||
|
})
|
||||||
|
.collect::<Vec<JoinHandle<Result<(Txid, TxStatus), Error>>>>();
|
||||||
|
|
||||||
|
if handles.is_empty() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
for handle in handles {
|
||||||
|
let (txid, status) = handle.join().expect("thread must not panic")?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for op in outpoints {
|
||||||
|
if graph.get_tx(op.txid).is_none() {
|
||||||
|
if let Some(tx) = self.get_tx(&op.txid)? {
|
||||||
|
let _ = graph.insert_tx(tx);
|
||||||
|
}
|
||||||
|
let status = self.get_tx_status(&op.txid)?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(op.txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(op_status) = self.get_output_status(&op.txid, op.vout as _)? {
|
||||||
|
if let Some(txid) = op_status.txid {
|
||||||
|
if graph.get_tx(txid).is_none() {
|
||||||
|
if let Some(tx) = self.get_tx(&txid)? {
|
||||||
|
let _ = graph.insert_tx(tx);
|
||||||
|
}
|
||||||
|
let status = self.get_tx_status(&txid)?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(graph)
|
||||||
|
}
|
||||||
|
}
|
||||||
50
crates/esplora/src/lib.rs
Normal file
50
crates/esplora/src/lib.rs
Normal file
@@ -0,0 +1,50 @@
|
|||||||
|
#![doc = include_str!("../README.md")]
|
||||||
|
|
||||||
|
//! This crate is used for updating structures of [`bdk_chain`] with data from an Esplora server.
|
||||||
|
//!
|
||||||
|
//! The two primary methods are [`EsploraExt::sync`] and [`EsploraExt::full_scan`]. In most cases
|
||||||
|
//! [`EsploraExt::sync`] is used to sync the transaction histories of scripts that the application
|
||||||
|
//! cares about, for example the scripts for all the receive addresses of a Wallet's keychain that it
|
||||||
|
//! has shown a user. [`EsploraExt::full_scan`] is meant to be used when importing or restoring a
|
||||||
|
//! keychain where the range of possibly used scripts is not known. In this case it is necessary to
|
||||||
|
//! scan all keychain scripts until a number (the "stop gap") of unused scripts is discovered. For a
|
||||||
|
//! sync or full scan the user receives relevant blockchain data and output updates for [`bdk_chain`]
|
||||||
|
//! via a new [`TxGraph`] to be appended to any existing [`TxGraph`] data.
|
||||||
|
//!
|
||||||
|
//! Refer to [`example_esplora`] for a complete example.
|
||||||
|
//!
|
||||||
|
//! [`TxGraph`]: bdk_chain::tx_graph::TxGraph
|
||||||
|
//! [`example_esplora`]: https://github.com/bitcoindevkit/bdk/tree/master/example-crates/example_esplora
|
||||||
|
|
||||||
|
use bdk_chain::{BlockId, ConfirmationTimeHeightAnchor};
|
||||||
|
use esplora_client::TxStatus;
|
||||||
|
|
||||||
|
pub use esplora_client;
|
||||||
|
|
||||||
|
#[cfg(feature = "blocking")]
|
||||||
|
mod blocking_ext;
|
||||||
|
#[cfg(feature = "blocking")]
|
||||||
|
pub use blocking_ext::*;
|
||||||
|
|
||||||
|
#[cfg(feature = "async")]
|
||||||
|
mod async_ext;
|
||||||
|
#[cfg(feature = "async")]
|
||||||
|
pub use async_ext::*;
|
||||||
|
|
||||||
|
fn anchor_from_status(status: &TxStatus) -> Option<ConfirmationTimeHeightAnchor> {
|
||||||
|
if let TxStatus {
|
||||||
|
block_height: Some(height),
|
||||||
|
block_hash: Some(hash),
|
||||||
|
block_time: Some(time),
|
||||||
|
..
|
||||||
|
} = status.clone()
|
||||||
|
{
|
||||||
|
Some(ConfirmationTimeHeightAnchor {
|
||||||
|
anchor_block: BlockId { height, hash },
|
||||||
|
confirmation_height: height,
|
||||||
|
confirmation_time: time,
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
}
|
||||||
206
crates/esplora/tests/async_ext.rs
Normal file
206
crates/esplora/tests/async_ext.rs
Normal file
@@ -0,0 +1,206 @@
|
|||||||
|
use bdk_esplora::EsploraAsyncExt;
|
||||||
|
use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||||
|
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||||
|
use electrsd::{Conf, ElectrsD};
|
||||||
|
use esplora_client::{self, AsyncClient, Builder};
|
||||||
|
use std::collections::{BTreeMap, HashSet};
|
||||||
|
use std::str::FromStr;
|
||||||
|
use std::thread::sleep;
|
||||||
|
use std::time::Duration;
|
||||||
|
|
||||||
|
use bdk_chain::bitcoin::{Address, Amount, BlockHash, Txid};
|
||||||
|
|
||||||
|
struct TestEnv {
|
||||||
|
bitcoind: BitcoinD,
|
||||||
|
#[allow(dead_code)]
|
||||||
|
electrsd: ElectrsD,
|
||||||
|
client: AsyncClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestEnv {
|
||||||
|
fn new() -> Result<Self, anyhow::Error> {
|
||||||
|
let bitcoind_exe =
|
||||||
|
bitcoind::downloaded_exe_path().expect("bitcoind version feature must be enabled");
|
||||||
|
let bitcoind = BitcoinD::new(bitcoind_exe).unwrap();
|
||||||
|
|
||||||
|
let mut electrs_conf = Conf::default();
|
||||||
|
electrs_conf.http_enabled = true;
|
||||||
|
let electrs_exe =
|
||||||
|
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||||
|
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &electrs_conf)?;
|
||||||
|
|
||||||
|
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||||
|
let client = Builder::new(base_url.as_str()).build_async()?;
|
||||||
|
|
||||||
|
Ok(Self {
|
||||||
|
bitcoind,
|
||||||
|
electrsd,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_blocks(
|
||||||
|
&self,
|
||||||
|
count: usize,
|
||||||
|
address: Option<Address>,
|
||||||
|
) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let coinbase_address = match address {
|
||||||
|
Some(address) => address,
|
||||||
|
None => self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)?
|
||||||
|
.assume_checked(),
|
||||||
|
};
|
||||||
|
let block_hashes = self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.generate_to_address(count as _, &coinbase_address)?;
|
||||||
|
Ok(block_hashes)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[tokio::test]
|
||||||
|
pub async fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let receive_address0 =
|
||||||
|
Address::from_str("bcrt1qc6fweuf4xjvz4x3gx3t9e0fh4hvqyu2qw4wvxm")?.assume_checked();
|
||||||
|
let receive_address1 =
|
||||||
|
Address::from_str("bcrt1qfjg5lv3dvc9az8patec8fjddrs4aqtauadnagr")?.assume_checked();
|
||||||
|
|
||||||
|
let misc_spks = [
|
||||||
|
receive_address0.script_pubkey(),
|
||||||
|
receive_address1.script_pubkey(),
|
||||||
|
];
|
||||||
|
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
let txid1 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address1,
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let txid2 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address0,
|
||||||
|
Amount::from_sat(20000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().await.unwrap() < 102 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph_update = env
|
||||||
|
.client
|
||||||
|
.sync(
|
||||||
|
misc_spks.into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
1,
|
||||||
|
)
|
||||||
|
.await?;
|
||||||
|
|
||||||
|
let mut graph_update_txids: Vec<Txid> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
graph_update_txids.sort();
|
||||||
|
let mut expected_txids = vec![txid1, txid2];
|
||||||
|
expected_txids.sort();
|
||||||
|
assert_eq!(graph_update_txids, expected_txids);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Test the bounds of the address scan depending on the gap limit.
|
||||||
|
#[tokio::test]
|
||||||
|
pub async fn test_async_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
|
||||||
|
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||||
|
let addresses = [
|
||||||
|
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||||
|
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||||
|
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||||
|
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||||
|
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||||
|
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||||
|
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||||
|
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||||
|
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||||
|
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||||
|
];
|
||||||
|
let addresses: Vec<_> = addresses
|
||||||
|
.into_iter()
|
||||||
|
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||||
|
.collect();
|
||||||
|
let spks: Vec<_> = addresses
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||||
|
.collect();
|
||||||
|
let mut keychains = BTreeMap::new();
|
||||||
|
keychains.insert(0, spks);
|
||||||
|
|
||||||
|
// Then receive coins on the 4th address.
|
||||||
|
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[3],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().await.unwrap() < 103 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||||
|
// will.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 2, 1).await?;
|
||||||
|
assert!(graph_update.full_txs().next().is_none());
|
||||||
|
assert!(active_indices.is_empty());
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 3, 1).await?;
|
||||||
|
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
|
||||||
|
// Now receive a coin on the last address.
|
||||||
|
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[addresses.len() - 1],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().await.unwrap() < 104 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||||
|
// The last active indice won't be updated in the first case but will in the second one.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 4, 1).await?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 1);
|
||||||
|
assert!(txs.contains(&txid_4th_addr));
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains, 5, 1).await?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 2);
|
||||||
|
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||||
|
assert_eq!(active_indices[&0], 9);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
411
crates/esplora/tests/blocking_ext.rs
Normal file
411
crates/esplora/tests/blocking_ext.rs
Normal file
@@ -0,0 +1,411 @@
|
|||||||
|
use bdk_chain::local_chain::LocalChain;
|
||||||
|
use bdk_chain::BlockId;
|
||||||
|
use bdk_esplora::EsploraExt;
|
||||||
|
use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||||
|
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||||
|
use electrsd::{Conf, ElectrsD};
|
||||||
|
use esplora_client::{self, BlockingClient, Builder};
|
||||||
|
use std::collections::{BTreeMap, BTreeSet, HashSet};
|
||||||
|
use std::str::FromStr;
|
||||||
|
use std::thread::sleep;
|
||||||
|
use std::time::Duration;
|
||||||
|
|
||||||
|
use bdk_chain::bitcoin::{Address, Amount, BlockHash, Txid};
|
||||||
|
|
||||||
|
macro_rules! h {
|
||||||
|
($index:literal) => {{
|
||||||
|
bdk_chain::bitcoin::hashes::Hash::hash($index.as_bytes())
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
macro_rules! local_chain {
|
||||||
|
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||||
|
#[allow(unused_mut)]
|
||||||
|
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*].into_iter().collect())
|
||||||
|
.expect("chain must have genesis block")
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
struct TestEnv {
|
||||||
|
bitcoind: BitcoinD,
|
||||||
|
#[allow(dead_code)]
|
||||||
|
electrsd: ElectrsD,
|
||||||
|
client: BlockingClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestEnv {
|
||||||
|
fn new() -> Result<Self, anyhow::Error> {
|
||||||
|
let bitcoind_exe =
|
||||||
|
bitcoind::downloaded_exe_path().expect("bitcoind version feature must be enabled");
|
||||||
|
let bitcoind = BitcoinD::new(bitcoind_exe).unwrap();
|
||||||
|
|
||||||
|
let mut electrs_conf = Conf::default();
|
||||||
|
electrs_conf.http_enabled = true;
|
||||||
|
let electrs_exe =
|
||||||
|
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||||
|
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &electrs_conf)?;
|
||||||
|
|
||||||
|
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||||
|
let client = Builder::new(base_url.as_str()).build_blocking()?;
|
||||||
|
|
||||||
|
Ok(Self {
|
||||||
|
bitcoind,
|
||||||
|
electrsd,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn reset_electrsd(mut self) -> anyhow::Result<Self> {
|
||||||
|
let mut electrs_conf = Conf::default();
|
||||||
|
electrs_conf.http_enabled = true;
|
||||||
|
let electrs_exe =
|
||||||
|
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||||
|
let electrsd = ElectrsD::with_conf(electrs_exe, &self.bitcoind, &electrs_conf)?;
|
||||||
|
|
||||||
|
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||||
|
let client = Builder::new(base_url.as_str()).build_blocking()?;
|
||||||
|
self.electrsd = electrsd;
|
||||||
|
self.client = client;
|
||||||
|
Ok(self)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_blocks(
|
||||||
|
&self,
|
||||||
|
count: usize,
|
||||||
|
address: Option<Address>,
|
||||||
|
) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let coinbase_address = match address {
|
||||||
|
Some(address) => address,
|
||||||
|
None => self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)?
|
||||||
|
.assume_checked(),
|
||||||
|
};
|
||||||
|
let block_hashes = self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.generate_to_address(count as _, &coinbase_address)?;
|
||||||
|
Ok(block_hashes)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
pub fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let receive_address0 =
|
||||||
|
Address::from_str("bcrt1qc6fweuf4xjvz4x3gx3t9e0fh4hvqyu2qw4wvxm")?.assume_checked();
|
||||||
|
let receive_address1 =
|
||||||
|
Address::from_str("bcrt1qfjg5lv3dvc9az8patec8fjddrs4aqtauadnagr")?.assume_checked();
|
||||||
|
|
||||||
|
let misc_spks = [
|
||||||
|
receive_address0.script_pubkey(),
|
||||||
|
receive_address1.script_pubkey(),
|
||||||
|
];
|
||||||
|
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
let txid1 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address1,
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let txid2 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address0,
|
||||||
|
Amount::from_sat(20000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().unwrap() < 102 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph_update = env.client.sync(
|
||||||
|
misc_spks.into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
1,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let mut graph_update_txids: Vec<Txid> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
graph_update_txids.sort();
|
||||||
|
let mut expected_txids = vec![txid1, txid2];
|
||||||
|
expected_txids.sort();
|
||||||
|
assert_eq!(graph_update_txids, expected_txids);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Test the bounds of the address scan depending on the gap limit.
|
||||||
|
#[test]
|
||||||
|
pub fn test_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
|
||||||
|
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||||
|
let addresses = [
|
||||||
|
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||||
|
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||||
|
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||||
|
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||||
|
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||||
|
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||||
|
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||||
|
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||||
|
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||||
|
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||||
|
];
|
||||||
|
let addresses: Vec<_> = addresses
|
||||||
|
.into_iter()
|
||||||
|
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||||
|
.collect();
|
||||||
|
let spks: Vec<_> = addresses
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||||
|
.collect();
|
||||||
|
let mut keychains = BTreeMap::new();
|
||||||
|
keychains.insert(0, spks);
|
||||||
|
|
||||||
|
// Then receive coins on the 4th address.
|
||||||
|
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[3],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().unwrap() < 103 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||||
|
// will.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 2, 1)?;
|
||||||
|
assert!(graph_update.full_txs().next().is_none());
|
||||||
|
assert!(active_indices.is_empty());
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 3, 1)?;
|
||||||
|
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
|
||||||
|
// Now receive a coin on the last address.
|
||||||
|
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[addresses.len() - 1],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().unwrap() < 104 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||||
|
// The last active indice won't be updated in the first case but will in the second one.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 4, 1)?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 1);
|
||||||
|
assert!(txs.contains(&txid_4th_addr));
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains, 5, 1)?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 2);
|
||||||
|
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||||
|
assert_eq!(active_indices[&0], 9);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn update_local_chain() -> anyhow::Result<()> {
|
||||||
|
const TIP_HEIGHT: u32 = 50;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let blocks = {
|
||||||
|
let bitcoind_client = &env.bitcoind.client;
|
||||||
|
assert_eq!(bitcoind_client.get_block_count()?, 1);
|
||||||
|
[
|
||||||
|
(0, bitcoind_client.get_block_hash(0)?),
|
||||||
|
(1, bitcoind_client.get_block_hash(1)?),
|
||||||
|
]
|
||||||
|
.into_iter()
|
||||||
|
.chain((2..).zip(env.mine_blocks((TIP_HEIGHT - 1) as usize, None)?))
|
||||||
|
.collect::<BTreeMap<_, _>>()
|
||||||
|
};
|
||||||
|
// so new blocks can be seen by Electrs
|
||||||
|
let env = env.reset_electrsd()?;
|
||||||
|
|
||||||
|
struct TestCase {
|
||||||
|
name: &'static str,
|
||||||
|
chain: LocalChain,
|
||||||
|
request_heights: &'static [u32],
|
||||||
|
exp_update_heights: &'static [u32],
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_blocks",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (21, blocks[&21])],
|
||||||
|
request_heights: &[22, 25, 28],
|
||||||
|
exp_update_heights: &[21, 22, 25, 28],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_prev_blocks",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (1, blocks[&1]), (5, blocks[&5])],
|
||||||
|
request_heights: &[4],
|
||||||
|
exp_update_heights: &[4, 5],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_prev_blocks_2",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (1, blocks[&1]), (10, blocks[&10])],
|
||||||
|
request_heights: &[4, 6],
|
||||||
|
exp_update_heights: &[4, 6, 10],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_and_prev_blocks",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (7, blocks[&7]), (11, blocks[&11])],
|
||||||
|
request_heights: &[8, 9, 15],
|
||||||
|
exp_update_heights: &[8, 9, 11, 15],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_tip_only",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (5, blocks[&5]), (49, blocks[&49])],
|
||||||
|
request_heights: &[TIP_HEIGHT],
|
||||||
|
exp_update_heights: &[49],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_nothing",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (13, blocks[&13]), (23, blocks[&23])],
|
||||||
|
request_heights: &[],
|
||||||
|
exp_update_heights: &[23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_nothing_during_reorg",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (13, blocks[&13]), (23, h!("23"))],
|
||||||
|
request_heights: &[],
|
||||||
|
exp_update_heights: &[13, 23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_nothing_during_reorg_2",
|
||||||
|
chain: local_chain![
|
||||||
|
(0, blocks[&0]),
|
||||||
|
(21, blocks[&21]),
|
||||||
|
(22, h!("22")),
|
||||||
|
(23, h!("23"))
|
||||||
|
],
|
||||||
|
request_heights: &[],
|
||||||
|
exp_update_heights: &[21, 22, 23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_prev_blocks_during_reorg",
|
||||||
|
chain: local_chain![
|
||||||
|
(0, blocks[&0]),
|
||||||
|
(21, blocks[&21]),
|
||||||
|
(22, h!("22")),
|
||||||
|
(23, h!("23"))
|
||||||
|
],
|
||||||
|
request_heights: &[17, 20],
|
||||||
|
exp_update_heights: &[17, 20, 21, 22, 23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_blocks_during_reorg",
|
||||||
|
chain: local_chain![
|
||||||
|
(0, blocks[&0]),
|
||||||
|
(9, blocks[&9]),
|
||||||
|
(22, h!("22")),
|
||||||
|
(23, h!("23"))
|
||||||
|
],
|
||||||
|
request_heights: &[25, 27],
|
||||||
|
exp_update_heights: &[9, 22, 23, 25, 27],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_blocks_during_reorg_2",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (9, h!("9"))],
|
||||||
|
request_heights: &[10],
|
||||||
|
exp_update_heights: &[0, 9, 10],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_and_prev_blocks_during_reorg",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (1, blocks[&1]), (9, h!("9"))],
|
||||||
|
request_heights: &[8, 11],
|
||||||
|
exp_update_heights: &[1, 8, 9, 11],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("Case {}: {}", i, t.name);
|
||||||
|
let mut chain = t.chain;
|
||||||
|
|
||||||
|
let update = env
|
||||||
|
.client
|
||||||
|
.update_local_chain(chain.tip(), t.request_heights.iter().copied())
|
||||||
|
.map_err(|err| {
|
||||||
|
anyhow::format_err!("[{}:{}] `update_local_chain` failed: {}", i, t.name, err)
|
||||||
|
})?;
|
||||||
|
|
||||||
|
let update_blocks = update
|
||||||
|
.tip
|
||||||
|
.iter()
|
||||||
|
.map(|cp| cp.block_id())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let exp_update_blocks = t
|
||||||
|
.exp_update_heights
|
||||||
|
.iter()
|
||||||
|
.map(|&height| {
|
||||||
|
let hash = blocks[&height];
|
||||||
|
BlockId { height, hash }
|
||||||
|
})
|
||||||
|
.chain(
|
||||||
|
// Electrs Esplora `get_block` call fetches 10 blocks which is included in the
|
||||||
|
// update
|
||||||
|
blocks
|
||||||
|
.range(TIP_HEIGHT - 9..)
|
||||||
|
.map(|(&height, &hash)| BlockId { height, hash }),
|
||||||
|
)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
update_blocks, exp_update_blocks,
|
||||||
|
"[{}:{}] unexpected update",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let _ = chain
|
||||||
|
.apply_update(update)
|
||||||
|
.unwrap_or_else(|err| panic!("[{}:{}] update failed to apply: {}", i, t.name, err));
|
||||||
|
|
||||||
|
// all requested heights must exist in the final chain
|
||||||
|
for height in t.request_heights {
|
||||||
|
let exp_blockhash = blocks.get(height).expect("block must exist in bitcoind");
|
||||||
|
assert_eq!(
|
||||||
|
chain.blocks().get(height),
|
||||||
|
Some(exp_blockhash),
|
||||||
|
"[{}:{}] block {}:{} must exist in final chain",
|
||||||
|
i,
|
||||||
|
t.name,
|
||||||
|
height,
|
||||||
|
exp_blockhash
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
19
crates/file_store/Cargo.toml
Normal file
19
crates/file_store/Cargo.toml
Normal file
@@ -0,0 +1,19 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_file_store"
|
||||||
|
version = "0.5.0"
|
||||||
|
edition = "2021"
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk_file_store"
|
||||||
|
description = "A simple append-only flat file implementation of Persist for Bitcoin Dev Kit."
|
||||||
|
keywords = ["bitcoin", "persist", "persistence", "bdk", "file"]
|
||||||
|
authors = ["Bitcoin Dev Kit Developers"]
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../chain", version = "0.9.0", features = [ "serde", "miniscript" ] }
|
||||||
|
bincode = { version = "1" }
|
||||||
|
serde = { version = "1", features = ["derive"] }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
tempfile = "3"
|
||||||
10
crates/file_store/README.md
Normal file
10
crates/file_store/README.md
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
# BDK File Store
|
||||||
|
|
||||||
|
This is a simple append-only flat file implementation of
|
||||||
|
[`Persist`](`bdk_chain::Persist`).
|
||||||
|
|
||||||
|
The main structure is [`Store`](`crate::Store`), which can be used with [`bdk`]'s
|
||||||
|
`Wallet` to persist wallet data into a flat file.
|
||||||
|
|
||||||
|
[`bdk`]: https://docs.rs/bdk/latest
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
||||||
108
crates/file_store/src/entry_iter.rs
Normal file
108
crates/file_store/src/entry_iter.rs
Normal file
@@ -0,0 +1,108 @@
|
|||||||
|
use bincode::Options;
|
||||||
|
use std::{
|
||||||
|
fs::File,
|
||||||
|
io::{self, BufReader, Seek},
|
||||||
|
marker::PhantomData,
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::bincode_options;
|
||||||
|
|
||||||
|
/// Iterator over entries in a file store.
|
||||||
|
///
|
||||||
|
/// Reads and returns an entry each time [`next`] is called. If an error occurs while reading the
|
||||||
|
/// iterator will yield a `Result::Err(_)` instead and then `None` for the next call to `next`.
|
||||||
|
///
|
||||||
|
/// [`next`]: Self::next
|
||||||
|
pub struct EntryIter<'t, T> {
|
||||||
|
/// Buffered reader around the file
|
||||||
|
db_file: BufReader<&'t mut File>,
|
||||||
|
finished: bool,
|
||||||
|
/// The file position for the first read of `db_file`.
|
||||||
|
start_pos: Option<u64>,
|
||||||
|
types: PhantomData<T>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'t, T> EntryIter<'t, T> {
|
||||||
|
pub fn new(start_pos: u64, db_file: &'t mut File) -> Self {
|
||||||
|
Self {
|
||||||
|
db_file: BufReader::new(db_file),
|
||||||
|
start_pos: Some(start_pos),
|
||||||
|
finished: false,
|
||||||
|
types: PhantomData,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'t, T> Iterator for EntryIter<'t, T>
|
||||||
|
where
|
||||||
|
T: serde::de::DeserializeOwned,
|
||||||
|
{
|
||||||
|
type Item = Result<T, IterError>;
|
||||||
|
|
||||||
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
|
if self.finished {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
(|| {
|
||||||
|
if let Some(start) = self.start_pos.take() {
|
||||||
|
self.db_file.seek(io::SeekFrom::Start(start))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let pos_before_read = self.db_file.stream_position()?;
|
||||||
|
match bincode_options().deserialize_from(&mut self.db_file) {
|
||||||
|
Ok(changeset) => Ok(Some(changeset)),
|
||||||
|
Err(e) => {
|
||||||
|
self.finished = true;
|
||||||
|
let pos_after_read = self.db_file.stream_position()?;
|
||||||
|
// allow unexpected EOF if 0 bytes were read
|
||||||
|
if let bincode::ErrorKind::Io(inner) = &*e {
|
||||||
|
if inner.kind() == io::ErrorKind::UnexpectedEof
|
||||||
|
&& pos_after_read == pos_before_read
|
||||||
|
{
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
self.db_file.seek(io::SeekFrom::Start(pos_before_read))?;
|
||||||
|
Err(IterError::Bincode(*e))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})()
|
||||||
|
.transpose()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'t, T> Drop for EntryIter<'t, T> {
|
||||||
|
fn drop(&mut self) {
|
||||||
|
// This syncs the underlying file's offset with the buffer's position. This way, we
|
||||||
|
// maintain the correct position to start the next read/write.
|
||||||
|
if let Ok(pos) = self.db_file.stream_position() {
|
||||||
|
let _ = self.db_file.get_mut().seek(io::SeekFrom::Start(pos));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Error type for [`EntryIter`].
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub enum IterError {
|
||||||
|
/// Failure to read from the file.
|
||||||
|
Io(io::Error),
|
||||||
|
/// Failure to decode data from the file.
|
||||||
|
Bincode(bincode::ErrorKind),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for IterError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
IterError::Io(e) => write!(f, "io error trying to read entry {}", e),
|
||||||
|
IterError::Bincode(e) => write!(f, "bincode error while reading entry {}", e),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<io::Error> for IterError {
|
||||||
|
fn from(value: io::Error) -> Self {
|
||||||
|
IterError::Io(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl std::error::Error for IterError {}
|
||||||
42
crates/file_store/src/lib.rs
Normal file
42
crates/file_store/src/lib.rs
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
#![doc = include_str!("../README.md")]
|
||||||
|
mod entry_iter;
|
||||||
|
mod store;
|
||||||
|
use std::io;
|
||||||
|
|
||||||
|
use bincode::{DefaultOptions, Options};
|
||||||
|
pub use entry_iter::*;
|
||||||
|
pub use store::*;
|
||||||
|
|
||||||
|
pub(crate) fn bincode_options() -> impl bincode::Options {
|
||||||
|
DefaultOptions::new().with_varint_encoding()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Error that occurs due to problems encountered with the file.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub enum FileError {
|
||||||
|
/// IO error, this may mean that the file is too short.
|
||||||
|
Io(io::Error),
|
||||||
|
/// Magic bytes do not match what is expected.
|
||||||
|
InvalidMagicBytes { got: Vec<u8>, expected: Vec<u8> },
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for FileError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Io(e) => write!(f, "io error trying to read file: {}", e),
|
||||||
|
Self::InvalidMagicBytes { got, expected } => write!(
|
||||||
|
f,
|
||||||
|
"file has invalid magic bytes: expected={:?} got={:?}",
|
||||||
|
expected, got,
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<io::Error> for FileError {
|
||||||
|
fn from(value: io::Error) -> Self {
|
||||||
|
Self::Io(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl std::error::Error for FileError {}
|
||||||
459
crates/file_store/src/store.rs
Normal file
459
crates/file_store/src/store.rs
Normal file
@@ -0,0 +1,459 @@
|
|||||||
|
use std::{
|
||||||
|
fmt::Debug,
|
||||||
|
fs::{File, OpenOptions},
|
||||||
|
io::{self, Read, Seek, Write},
|
||||||
|
marker::PhantomData,
|
||||||
|
path::Path,
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_chain::{Append, PersistBackend};
|
||||||
|
use bincode::Options;
|
||||||
|
|
||||||
|
use crate::{bincode_options, EntryIter, FileError, IterError};
|
||||||
|
|
||||||
|
/// Persists an append-only list of changesets (`C`) to a single file.
|
||||||
|
///
|
||||||
|
/// The changesets are the results of altering a tracker implementation (`T`).
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct Store<C> {
|
||||||
|
magic_len: usize,
|
||||||
|
db_file: File,
|
||||||
|
marker: PhantomData<C>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> PersistBackend<C> for Store<C>
|
||||||
|
where
|
||||||
|
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||||
|
{
|
||||||
|
type WriteError = std::io::Error;
|
||||||
|
|
||||||
|
type LoadError = IterError;
|
||||||
|
|
||||||
|
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError> {
|
||||||
|
self.append_changeset(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||||
|
self.aggregate_changesets().map_err(|e| e.iter_error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> Store<C>
|
||||||
|
where
|
||||||
|
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||||
|
{
|
||||||
|
/// Create a new [`Store`] file in write-only mode; error if the file exists.
|
||||||
|
///
|
||||||
|
/// `magic` is the prefixed bytes to write to the new file. This will be checked when opening
|
||||||
|
/// the `Store` in the future with [`open`].
|
||||||
|
///
|
||||||
|
/// [`open`]: Store::open
|
||||||
|
pub fn create_new<P>(magic: &[u8], file_path: P) -> Result<Self, FileError>
|
||||||
|
where
|
||||||
|
P: AsRef<Path>,
|
||||||
|
{
|
||||||
|
if file_path.as_ref().exists() {
|
||||||
|
// `io::Error` is used instead of a variant on `FileError` because there is already a
|
||||||
|
// nightly-only `File::create_new` method
|
||||||
|
return Err(FileError::Io(io::Error::new(
|
||||||
|
io::ErrorKind::Other,
|
||||||
|
"file already exists",
|
||||||
|
)));
|
||||||
|
}
|
||||||
|
let mut f = OpenOptions::new()
|
||||||
|
.create(true)
|
||||||
|
.read(true)
|
||||||
|
.write(true)
|
||||||
|
.open(file_path)?;
|
||||||
|
f.write_all(magic)?;
|
||||||
|
Ok(Self {
|
||||||
|
magic_len: magic.len(),
|
||||||
|
db_file: f,
|
||||||
|
marker: Default::default(),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Open an existing [`Store`].
|
||||||
|
///
|
||||||
|
/// Use [`create_new`] to create a new `Store`.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// If the prefixed bytes of the opened file does not match the provided `magic`, the
|
||||||
|
/// [`FileError::InvalidMagicBytes`] error variant will be returned.
|
||||||
|
///
|
||||||
|
/// [`create_new`]: Store::create_new
|
||||||
|
pub fn open<P>(magic: &[u8], file_path: P) -> Result<Self, FileError>
|
||||||
|
where
|
||||||
|
P: AsRef<Path>,
|
||||||
|
{
|
||||||
|
let mut f = OpenOptions::new().read(true).write(true).open(file_path)?;
|
||||||
|
|
||||||
|
let mut magic_buf = vec![0_u8; magic.len()];
|
||||||
|
f.read_exact(&mut magic_buf)?;
|
||||||
|
if magic_buf != magic {
|
||||||
|
return Err(FileError::InvalidMagicBytes {
|
||||||
|
got: magic_buf,
|
||||||
|
expected: magic.to_vec(),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(Self {
|
||||||
|
magic_len: magic.len(),
|
||||||
|
db_file: f,
|
||||||
|
marker: Default::default(),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Attempt to open existing [`Store`] file; create it if the file is non-existent.
|
||||||
|
///
|
||||||
|
/// Internally, this calls either [`open`] or [`create_new`].
|
||||||
|
///
|
||||||
|
/// [`open`]: Store::open
|
||||||
|
/// [`create_new`]: Store::create_new
|
||||||
|
pub fn open_or_create_new<P>(magic: &[u8], file_path: P) -> Result<Self, FileError>
|
||||||
|
where
|
||||||
|
P: AsRef<Path>,
|
||||||
|
{
|
||||||
|
if file_path.as_ref().exists() {
|
||||||
|
Self::open(magic, file_path)
|
||||||
|
} else {
|
||||||
|
Self::create_new(magic, file_path)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterates over the stored changeset from first to last, changing the seek position at each
|
||||||
|
/// iteration.
|
||||||
|
///
|
||||||
|
/// The iterator may fail to read an entry and therefore return an error. However, the first time
|
||||||
|
/// it returns an error will be the last. After doing so, the iterator will always yield `None`.
|
||||||
|
///
|
||||||
|
/// **WARNING**: This method changes the write position in the underlying file. You should
|
||||||
|
/// always iterate over all entries until `None` is returned if you want your next write to go
|
||||||
|
/// at the end; otherwise, you will write over existing entries.
|
||||||
|
pub fn iter_changesets(&mut self) -> EntryIter<C> {
|
||||||
|
EntryIter::new(self.magic_len as u64, &mut self.db_file)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Loads all the changesets that have been stored as one giant changeset.
|
||||||
|
///
|
||||||
|
/// This function returns the aggregate changeset, or `None` if nothing was persisted.
|
||||||
|
/// If reading or deserializing any of the entries fails, an error is returned that
|
||||||
|
/// consists of all those it was able to read.
|
||||||
|
///
|
||||||
|
/// You should usually check the error. In many applications, it may make sense to do a full
|
||||||
|
/// wallet scan with a stop-gap after getting an error, since it is likely that one of the
|
||||||
|
/// changesets it was unable to read changed the derivation indices of the tracker.
|
||||||
|
///
|
||||||
|
/// **WARNING**: This method changes the write position of the underlying file. The next
|
||||||
|
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
||||||
|
pub fn aggregate_changesets(&mut self) -> Result<Option<C>, AggregateChangesetsError<C>> {
|
||||||
|
let mut changeset = Option::<C>::None;
|
||||||
|
for next_changeset in self.iter_changesets() {
|
||||||
|
let next_changeset = match next_changeset {
|
||||||
|
Ok(next_changeset) => next_changeset,
|
||||||
|
Err(iter_error) => {
|
||||||
|
return Err(AggregateChangesetsError {
|
||||||
|
changeset,
|
||||||
|
iter_error,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
};
|
||||||
|
match &mut changeset {
|
||||||
|
Some(changeset) => changeset.append(next_changeset),
|
||||||
|
changeset => *changeset = Some(next_changeset),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Append a new changeset to the file and truncate the file to the end of the appended
|
||||||
|
/// changeset.
|
||||||
|
///
|
||||||
|
/// The truncation is to avoid the possibility of having a valid but inconsistent changeset
|
||||||
|
/// directly after the appended changeset.
|
||||||
|
pub fn append_changeset(&mut self, changeset: &C) -> Result<(), io::Error> {
|
||||||
|
// no need to write anything if changeset is empty
|
||||||
|
if changeset.is_empty() {
|
||||||
|
return Ok(());
|
||||||
|
}
|
||||||
|
|
||||||
|
bincode_options()
|
||||||
|
.serialize_into(&mut self.db_file, changeset)
|
||||||
|
.map_err(|e| match *e {
|
||||||
|
bincode::ErrorKind::Io(inner) => inner,
|
||||||
|
unexpected_err => panic!("unexpected bincode error: {}", unexpected_err),
|
||||||
|
})?;
|
||||||
|
|
||||||
|
// truncate file after this changeset addition
|
||||||
|
// if this is not done, data after this changeset may represent valid changesets, however
|
||||||
|
// applying those changesets on top of this one may result in an inconsistent state
|
||||||
|
let pos = self.db_file.stream_position()?;
|
||||||
|
self.db_file.set_len(pos)?;
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Error type for [`Store::aggregate_changesets`].
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct AggregateChangesetsError<C> {
|
||||||
|
/// The partially-aggregated changeset.
|
||||||
|
pub changeset: Option<C>,
|
||||||
|
|
||||||
|
/// The error returned by [`EntryIter`].
|
||||||
|
pub iter_error: IterError,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> std::fmt::Display for AggregateChangesetsError<C> {
|
||||||
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
|
std::fmt::Display::fmt(&self.iter_error, f)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C: std::fmt::Debug> std::error::Error for AggregateChangesetsError<C> {}
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod test {
|
||||||
|
use super::*;
|
||||||
|
|
||||||
|
use bincode::DefaultOptions;
|
||||||
|
use std::{
|
||||||
|
collections::BTreeSet,
|
||||||
|
io::{Read, Write},
|
||||||
|
vec::Vec,
|
||||||
|
};
|
||||||
|
use tempfile::NamedTempFile;
|
||||||
|
|
||||||
|
const TEST_MAGIC_BYTES_LEN: usize = 12;
|
||||||
|
const TEST_MAGIC_BYTES: [u8; TEST_MAGIC_BYTES_LEN] =
|
||||||
|
[98, 100, 107, 102, 115, 49, 49, 49, 49, 49, 49, 49];
|
||||||
|
|
||||||
|
type TestChangeSet = BTreeSet<String>;
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
struct TestTracker;
|
||||||
|
|
||||||
|
/// Check behavior of [`Store::create_new`] and [`Store::open`].
|
||||||
|
#[test]
|
||||||
|
fn construct_store() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
let file_path = temp_dir.path().join("db_file");
|
||||||
|
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect_err("must not open as file does not exist yet");
|
||||||
|
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must create file");
|
||||||
|
// cannot create new as file already exists
|
||||||
|
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect_err("must fail as file already exists now");
|
||||||
|
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must open as file exists now");
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn open_or_create_new() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
let file_path = temp_dir.path().join("db_file");
|
||||||
|
let changeset = BTreeSet::from(["hello".to_string(), "world".to_string()]);
|
||||||
|
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must create");
|
||||||
|
assert!(file_path.exists());
|
||||||
|
db.append_changeset(&changeset).expect("must succeed");
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must recover");
|
||||||
|
let recovered_changeset = db.aggregate_changesets().expect("must succeed");
|
||||||
|
assert_eq!(recovered_changeset, Some(changeset));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn new_fails_if_file_is_too_short() {
|
||||||
|
let mut file = NamedTempFile::new().unwrap();
|
||||||
|
file.write_all(&TEST_MAGIC_BYTES[..TEST_MAGIC_BYTES_LEN - 1])
|
||||||
|
.expect("should write");
|
||||||
|
|
||||||
|
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||||
|
Err(FileError::Io(e)) => assert_eq!(e.kind(), std::io::ErrorKind::UnexpectedEof),
|
||||||
|
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn new_fails_if_magic_bytes_are_invalid() {
|
||||||
|
let invalid_magic_bytes = "ldkfs0000000";
|
||||||
|
|
||||||
|
let mut file = NamedTempFile::new().unwrap();
|
||||||
|
file.write_all(invalid_magic_bytes.as_bytes())
|
||||||
|
.expect("should write");
|
||||||
|
|
||||||
|
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||||
|
Err(FileError::InvalidMagicBytes { got, .. }) => {
|
||||||
|
assert_eq!(got, invalid_magic_bytes.as_bytes())
|
||||||
|
}
|
||||||
|
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn append_changeset_truncates_invalid_bytes() {
|
||||||
|
// initial data to write to file (magic bytes + invalid data)
|
||||||
|
let mut data = [255_u8; 2000];
|
||||||
|
data[..TEST_MAGIC_BYTES_LEN].copy_from_slice(&TEST_MAGIC_BYTES);
|
||||||
|
|
||||||
|
let changeset = TestChangeSet::from(["one".into(), "two".into(), "three!".into()]);
|
||||||
|
|
||||||
|
let mut file = NamedTempFile::new().unwrap();
|
||||||
|
file.write_all(&data).expect("should write");
|
||||||
|
|
||||||
|
let mut store =
|
||||||
|
Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()).expect("should open");
|
||||||
|
match store.iter_changesets().next() {
|
||||||
|
Some(Err(IterError::Bincode(_))) => {}
|
||||||
|
unexpected_res => panic!("unexpected result: {:?}", unexpected_res),
|
||||||
|
}
|
||||||
|
|
||||||
|
store.append_changeset(&changeset).expect("should append");
|
||||||
|
|
||||||
|
drop(store);
|
||||||
|
|
||||||
|
let got_bytes = {
|
||||||
|
let mut buf = Vec::new();
|
||||||
|
file.reopen()
|
||||||
|
.unwrap()
|
||||||
|
.read_to_end(&mut buf)
|
||||||
|
.expect("should read");
|
||||||
|
buf
|
||||||
|
};
|
||||||
|
|
||||||
|
let expected_bytes = {
|
||||||
|
let mut buf = TEST_MAGIC_BYTES.to_vec();
|
||||||
|
DefaultOptions::new()
|
||||||
|
.with_varint_encoding()
|
||||||
|
.serialize_into(&mut buf, &changeset)
|
||||||
|
.expect("should encode");
|
||||||
|
buf
|
||||||
|
};
|
||||||
|
|
||||||
|
assert_eq!(got_bytes, expected_bytes);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn last_write_is_short() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
|
||||||
|
let changesets = [
|
||||||
|
TestChangeSet::from(["1".into()]),
|
||||||
|
TestChangeSet::from(["2".into(), "3".into()]),
|
||||||
|
TestChangeSet::from(["4".into(), "5".into(), "6".into()]),
|
||||||
|
];
|
||||||
|
let last_changeset = TestChangeSet::from(["7".into(), "8".into(), "9".into()]);
|
||||||
|
let last_changeset_bytes = bincode_options().serialize(&last_changeset).unwrap();
|
||||||
|
|
||||||
|
for short_write_len in 1..last_changeset_bytes.len() - 1 {
|
||||||
|
let file_path = temp_dir.path().join(format!("{}.dat", short_write_len));
|
||||||
|
println!("Test file: {:?}", file_path);
|
||||||
|
|
||||||
|
// simulate creating a file, writing data where the last write is incomplete
|
||||||
|
{
|
||||||
|
let mut db =
|
||||||
|
Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
for changeset in &changesets {
|
||||||
|
db.append_changeset(changeset).unwrap();
|
||||||
|
}
|
||||||
|
// this is the incomplete write
|
||||||
|
db.db_file
|
||||||
|
.write_all(&last_changeset_bytes[..short_write_len])
|
||||||
|
.unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
// load file again and aggregate changesets
|
||||||
|
// write the last changeset again (this time it succeeds)
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
let err = db
|
||||||
|
.aggregate_changesets()
|
||||||
|
.expect_err("should return error as last read is short");
|
||||||
|
assert_eq!(
|
||||||
|
err.changeset,
|
||||||
|
changesets.iter().cloned().reduce(|mut acc, cs| {
|
||||||
|
Append::append(&mut acc, cs);
|
||||||
|
acc
|
||||||
|
}),
|
||||||
|
"should recover all changesets that are written in full",
|
||||||
|
);
|
||||||
|
db.db_file.write_all(&last_changeset_bytes).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
// load file again - this time we should successfully aggregate all changesets
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
let aggregated_changesets = db
|
||||||
|
.aggregate_changesets()
|
||||||
|
.expect("aggregating all changesets should succeed");
|
||||||
|
assert_eq!(
|
||||||
|
aggregated_changesets,
|
||||||
|
changesets
|
||||||
|
.iter()
|
||||||
|
.cloned()
|
||||||
|
.chain(core::iter::once(last_changeset.clone()))
|
||||||
|
.reduce(|mut acc, cs| {
|
||||||
|
Append::append(&mut acc, cs);
|
||||||
|
acc
|
||||||
|
}),
|
||||||
|
"should recover all changesets",
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn write_after_short_read() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
|
||||||
|
let changesets = (0..20)
|
||||||
|
.map(|n| TestChangeSet::from([format!("{}", n)]))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
let last_changeset = TestChangeSet::from(["last".into()]);
|
||||||
|
|
||||||
|
for read_count in 0..changesets.len() {
|
||||||
|
let file_path = temp_dir.path().join(format!("{}.dat", read_count));
|
||||||
|
println!("Test file: {:?}", file_path);
|
||||||
|
|
||||||
|
// First, we create the file with all the changesets!
|
||||||
|
let mut db = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
for changeset in &changesets {
|
||||||
|
db.append_changeset(changeset).unwrap();
|
||||||
|
}
|
||||||
|
drop(db);
|
||||||
|
|
||||||
|
// We re-open the file and read `read_count` number of changesets.
|
||||||
|
let mut db = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
let mut exp_aggregation = db
|
||||||
|
.iter_changesets()
|
||||||
|
.take(read_count)
|
||||||
|
.map(|r| r.expect("must read valid changeset"))
|
||||||
|
.fold(TestChangeSet::default(), |mut acc, v| {
|
||||||
|
Append::append(&mut acc, v);
|
||||||
|
acc
|
||||||
|
});
|
||||||
|
// We write after a short read.
|
||||||
|
db.write_changes(&last_changeset)
|
||||||
|
.expect("last write must succeed");
|
||||||
|
Append::append(&mut exp_aggregation, last_changeset.clone());
|
||||||
|
drop(db);
|
||||||
|
|
||||||
|
// We open the file again and check whether aggregate changeset is expected.
|
||||||
|
let aggregation = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.unwrap()
|
||||||
|
.aggregate_changesets()
|
||||||
|
.expect("must aggregate changesets")
|
||||||
|
.unwrap_or_default();
|
||||||
|
assert_eq!(aggregation, exp_aggregation);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
13
crates/hwi/Cargo.toml
Normal file
13
crates/hwi/Cargo.toml
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_hwi"
|
||||||
|
version = "0.1.0"
|
||||||
|
edition = "2021"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
description = "Utilities to use bdk with hardware wallets"
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk = { path = "../bdk" }
|
||||||
|
hwi = { version = "0.7.0", features = [ "miniscript"] }
|
||||||
42
crates/hwi/src/lib.rs
Normal file
42
crates/hwi/src/lib.rs
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
//! HWI Signer
|
||||||
|
//!
|
||||||
|
//! This crate contains HWISigner, an implementation of a [`TransactionSigner`] to be
|
||||||
|
//! used with hardware wallets.
|
||||||
|
//! ```no_run
|
||||||
|
//! # use bdk::bitcoin::Network;
|
||||||
|
//! # use bdk::signer::SignerOrdering;
|
||||||
|
//! # use bdk_hwi::HWISigner;
|
||||||
|
//! # use bdk::wallet::AddressIndex::New;
|
||||||
|
//! # use bdk::{FeeRate, KeychainKind, SignOptions, Wallet};
|
||||||
|
//! # use hwi::HWIClient;
|
||||||
|
//! # use std::sync::Arc;
|
||||||
|
//! #
|
||||||
|
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
|
//! let mut devices = HWIClient::enumerate()?;
|
||||||
|
//! if devices.is_empty() {
|
||||||
|
//! panic!("No devices found!");
|
||||||
|
//! }
|
||||||
|
//! let first_device = devices.remove(0)?;
|
||||||
|
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
|
//!
|
||||||
|
//! # let mut wallet = Wallet::new_no_persist(
|
||||||
|
//! # "",
|
||||||
|
//! # None,
|
||||||
|
//! # Network::Testnet,
|
||||||
|
//! # )?;
|
||||||
|
//! #
|
||||||
|
//! // Adding the hardware signer to the BDK wallet
|
||||||
|
//! wallet.add_signer(
|
||||||
|
//! KeychainKind::External,
|
||||||
|
//! SignerOrdering(200),
|
||||||
|
//! Arc::new(custom_signer),
|
||||||
|
//! );
|
||||||
|
//!
|
||||||
|
//! # Ok(())
|
||||||
|
//! # }
|
||||||
|
//! ```
|
||||||
|
//!
|
||||||
|
//! [`TransactionSigner`]: bdk::wallet::signer::TransactionSigner
|
||||||
|
|
||||||
|
mod signer;
|
||||||
|
pub use signer::*;
|
||||||
94
crates/hwi/src/signer.rs
Normal file
94
crates/hwi/src/signer.rs
Normal file
@@ -0,0 +1,94 @@
|
|||||||
|
use bdk::bitcoin::bip32::Fingerprint;
|
||||||
|
use bdk::bitcoin::psbt::PartiallySignedTransaction;
|
||||||
|
use bdk::bitcoin::secp256k1::{All, Secp256k1};
|
||||||
|
|
||||||
|
use hwi::error::Error;
|
||||||
|
use hwi::types::{HWIChain, HWIDevice};
|
||||||
|
use hwi::HWIClient;
|
||||||
|
|
||||||
|
use bdk::signer::{SignerCommon, SignerError, SignerId, TransactionSigner};
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Custom signer for Hardware Wallets
|
||||||
|
///
|
||||||
|
/// This ignores `sign_options` and leaves the decisions up to the hardware wallet.
|
||||||
|
pub struct HWISigner {
|
||||||
|
fingerprint: Fingerprint,
|
||||||
|
client: HWIClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl HWISigner {
|
||||||
|
/// Create a instance from the specified device and chain
|
||||||
|
pub fn from_device(device: &HWIDevice, chain: HWIChain) -> Result<HWISigner, Error> {
|
||||||
|
let client = HWIClient::get_client(device, false, chain)?;
|
||||||
|
Ok(HWISigner {
|
||||||
|
fingerprint: device.fingerprint,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for HWISigner {
|
||||||
|
fn id(&self, _secp: &Secp256k1<All>) -> SignerId {
|
||||||
|
SignerId::Fingerprint(self.fingerprint)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TransactionSigner for HWISigner {
|
||||||
|
fn sign_transaction(
|
||||||
|
&self,
|
||||||
|
psbt: &mut PartiallySignedTransaction,
|
||||||
|
_sign_options: &bdk::SignOptions,
|
||||||
|
_secp: &Secp256k1<All>,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
psbt.combine(
|
||||||
|
self.client
|
||||||
|
.sign_tx(psbt)
|
||||||
|
.map_err(|e| {
|
||||||
|
SignerError::External(format!("While signing with hardware wallet: {}", e))
|
||||||
|
})?
|
||||||
|
.psbt,
|
||||||
|
)
|
||||||
|
.expect("Failed to combine HW signed psbt with passed PSBT");
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// TODO: re-enable this once we have the `get_funded_wallet` test util
|
||||||
|
// #[cfg(test)]
|
||||||
|
// mod tests {
|
||||||
|
// #[test]
|
||||||
|
// fn test_hardware_signer() {
|
||||||
|
// use std::sync::Arc;
|
||||||
|
//
|
||||||
|
// use bdk::tests::get_funded_wallet;
|
||||||
|
// use bdk::signer::SignerOrdering;
|
||||||
|
// use bdk::bitcoin::Network;
|
||||||
|
// use crate::HWISigner;
|
||||||
|
// use hwi::HWIClient;
|
||||||
|
//
|
||||||
|
// let mut devices = HWIClient::enumerate().unwrap();
|
||||||
|
// if devices.is_empty() {
|
||||||
|
// panic!("No devices found!");
|
||||||
|
// }
|
||||||
|
// let device = devices.remove(0).unwrap();
|
||||||
|
// let client = HWIClient::get_client(&device, true, Network::Regtest.into()).unwrap();
|
||||||
|
// let descriptors = client.get_descriptors::<String>(None).unwrap();
|
||||||
|
// let custom_signer = HWISigner::from_device(&device, Network::Regtest.into()).unwrap();
|
||||||
|
//
|
||||||
|
// let (mut wallet, _) = get_funded_wallet(&descriptors.internal[0]);
|
||||||
|
// wallet.add_signer(
|
||||||
|
// bdk::KeychainKind::External,
|
||||||
|
// SignerOrdering(200),
|
||||||
|
// Arc::new(custom_signer),
|
||||||
|
// );
|
||||||
|
//
|
||||||
|
// let addr = wallet.get_address(bdk::wallet::AddressIndex::LastUnused);
|
||||||
|
// let mut builder = wallet.build_tx();
|
||||||
|
// builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
// let (mut psbt, _) = builder.finish().unwrap();
|
||||||
|
//
|
||||||
|
// let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||||
|
// assert!(finalized);
|
||||||
|
// }
|
||||||
|
// }
|
||||||
12
example-crates/example_bitcoind_rpc_polling/Cargo.toml
Normal file
12
example-crates/example_bitcoind_rpc_polling/Cargo.toml
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
[package]
|
||||||
|
name = "example_bitcoind_rpc_polling"
|
||||||
|
version = "0.1.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||||
|
bdk_bitcoind_rpc = { path = "../../crates/bitcoind_rpc" }
|
||||||
|
example_cli = { path = "../example_cli" }
|
||||||
|
ctrlc = { version = "^2" }
|
||||||
68
example-crates/example_bitcoind_rpc_polling/README.md
Normal file
68
example-crates/example_bitcoind_rpc_polling/README.md
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
# Example RPC CLI
|
||||||
|
|
||||||
|
### Simple Regtest Test
|
||||||
|
|
||||||
|
1. Start local regtest bitcoind.
|
||||||
|
```
|
||||||
|
mkdir -p /tmp/regtest/bitcoind
|
||||||
|
bitcoind -regtest -server -fallbackfee=0.0002 -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -datadir=/tmp/regtest/bitcoind -daemon
|
||||||
|
```
|
||||||
|
2. Create a test bitcoind wallet and set bitcoind env.
|
||||||
|
```
|
||||||
|
bitcoin-cli -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -named createwallet wallet_name="test"
|
||||||
|
export RPC_URL=127.0.0.1:18443
|
||||||
|
export RPC_USER=<your-rpc-username>
|
||||||
|
export RPC_PASS=<your-rpc-password>
|
||||||
|
```
|
||||||
|
3. Get test bitcoind wallet info.
|
||||||
|
```
|
||||||
|
bitcoin-cli -rpcwallet="test" -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -datadir=/tmp/regtest/bitcoind -regtest getwalletinfo
|
||||||
|
```
|
||||||
|
4. Get new test bitcoind wallet address.
|
||||||
|
```
|
||||||
|
BITCOIND_ADDRESS=$(bitcoin-cli -rpcwallet="test" -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> getnewaddress)
|
||||||
|
echo $BITCOIND_ADDRESS
|
||||||
|
```
|
||||||
|
5. Generate 101 blocks with reward to test bitcoind wallet address.
|
||||||
|
```
|
||||||
|
bitcoin-cli -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> generatetoaddress 101 $BITCOIND_ADDRESS
|
||||||
|
```
|
||||||
|
6. Verify test bitcoind wallet balance.
|
||||||
|
```
|
||||||
|
bitcoin-cli -rpcwallet="test" -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> getbalances
|
||||||
|
```
|
||||||
|
7. Set descriptor env and get address from RPC CLI wallet.
|
||||||
|
```
|
||||||
|
export DESCRIPTOR="wpkh(tprv8ZgxMBicQKsPfK9BTf82oQkHhawtZv19CorqQKPFeaHDMA4dXYX6eWsJGNJ7VTQXWmoHdrfjCYuDijcRmNFwSKcVhswzqs4fugE8turndGc/1/*)"
|
||||||
|
cargo run -- --network regtest address next
|
||||||
|
```
|
||||||
|
8. Send 5 test bitcoin to RPC CLI wallet.
|
||||||
|
```
|
||||||
|
bitcoin-cli -rpcwallet="test" -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> sendtoaddress <address> 5
|
||||||
|
```
|
||||||
|
9. Sync blockchain with RPC CLI wallet.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest sync
|
||||||
|
<CNTRL-C to stop syncing>
|
||||||
|
```
|
||||||
|
10. Get RPC CLI wallet unconfirmed balances.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest balance
|
||||||
|
```
|
||||||
|
11. Generate 1 block with reward to test bitcoind wallet address.
|
||||||
|
```
|
||||||
|
bitcoin-cli -datadir=/tmp/regtest/bitcoind -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -regtest generatetoaddress 10 $BITCOIND_ADDRESS
|
||||||
|
```
|
||||||
|
12. Sync the blockchain with RPC CLI wallet.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest sync
|
||||||
|
<CNTRL-C to stop syncing>
|
||||||
|
```
|
||||||
|
13. Get RPC CLI wallet confirmed balances.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest balance
|
||||||
|
```
|
||||||
|
14. Get RPC CLI wallet transactions.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest txout list
|
||||||
|
```
|
||||||
386
example-crates/example_bitcoind_rpc_polling/src/main.rs
Normal file
386
example-crates/example_bitcoind_rpc_polling/src/main.rs
Normal file
@@ -0,0 +1,386 @@
|
|||||||
|
use std::{
|
||||||
|
path::PathBuf,
|
||||||
|
sync::{
|
||||||
|
atomic::{AtomicBool, Ordering},
|
||||||
|
Arc, Mutex,
|
||||||
|
},
|
||||||
|
time::{Duration, Instant},
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_bitcoind_rpc::{
|
||||||
|
bitcoincore_rpc::{Auth, Client, RpcApi},
|
||||||
|
Emitter,
|
||||||
|
};
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{constants::genesis_block, Block, Transaction},
|
||||||
|
indexed_tx_graph, keychain,
|
||||||
|
local_chain::{self, LocalChain},
|
||||||
|
ConfirmationTimeHeightAnchor, IndexedTxGraph,
|
||||||
|
};
|
||||||
|
use example_cli::{
|
||||||
|
anyhow,
|
||||||
|
clap::{self, Args, Subcommand},
|
||||||
|
Keychain,
|
||||||
|
};
|
||||||
|
|
||||||
|
const DB_MAGIC: &[u8] = b"bdk_example_rpc";
|
||||||
|
const DB_PATH: &str = ".bdk_example_rpc.db";
|
||||||
|
|
||||||
|
/// The mpsc channel bound for emissions from [`Emitter`].
|
||||||
|
const CHANNEL_BOUND: usize = 10;
|
||||||
|
/// Delay for printing status to stdout.
|
||||||
|
const STDOUT_PRINT_DELAY: Duration = Duration::from_secs(6);
|
||||||
|
/// Delay between mempool emissions.
|
||||||
|
const MEMPOOL_EMIT_DELAY: Duration = Duration::from_secs(30);
|
||||||
|
/// Delay for committing to persistence.
|
||||||
|
const DB_COMMIT_DELAY: Duration = Duration::from_secs(60);
|
||||||
|
|
||||||
|
type ChangeSet = (
|
||||||
|
local_chain::ChangeSet,
|
||||||
|
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||||
|
);
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
enum Emission {
|
||||||
|
Block(bdk_bitcoind_rpc::BlockEvent<Block>),
|
||||||
|
Mempool(Vec<(Transaction, u64)>),
|
||||||
|
Tip(u32),
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Args, Debug, Clone)]
|
||||||
|
struct RpcArgs {
|
||||||
|
/// RPC URL
|
||||||
|
#[clap(env = "RPC_URL", long, default_value = "127.0.0.1:8332")]
|
||||||
|
url: String,
|
||||||
|
/// RPC auth cookie file
|
||||||
|
#[clap(env = "RPC_COOKIE", long)]
|
||||||
|
rpc_cookie: Option<PathBuf>,
|
||||||
|
/// RPC auth username
|
||||||
|
#[clap(env = "RPC_USER", long)]
|
||||||
|
rpc_user: Option<String>,
|
||||||
|
/// RPC auth password
|
||||||
|
#[clap(env = "RPC_PASS", long)]
|
||||||
|
rpc_password: Option<String>,
|
||||||
|
/// Starting block height to fallback to if no point of agreement if found
|
||||||
|
#[clap(env = "FALLBACK_HEIGHT", long, default_value = "0")]
|
||||||
|
fallback_height: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<RpcArgs> for Auth {
|
||||||
|
fn from(args: RpcArgs) -> Self {
|
||||||
|
match (args.rpc_cookie, args.rpc_user, args.rpc_password) {
|
||||||
|
(None, None, None) => Self::None,
|
||||||
|
(Some(path), _, _) => Self::CookieFile(path),
|
||||||
|
(_, Some(user), Some(pass)) => Self::UserPass(user, pass),
|
||||||
|
(_, Some(_), None) => panic!("rpc auth: missing rpc_pass"),
|
||||||
|
(_, None, Some(_)) => panic!("rpc auth: missing rpc_user"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl RpcArgs {
|
||||||
|
fn new_client(&self) -> anyhow::Result<Client> {
|
||||||
|
Ok(Client::new(
|
||||||
|
&self.url,
|
||||||
|
match (&self.rpc_cookie, &self.rpc_user, &self.rpc_password) {
|
||||||
|
(None, None, None) => Auth::None,
|
||||||
|
(Some(path), _, _) => Auth::CookieFile(path.clone()),
|
||||||
|
(_, Some(user), Some(pass)) => Auth::UserPass(user.clone(), pass.clone()),
|
||||||
|
(_, Some(_), None) => panic!("rpc auth: missing rpc_pass"),
|
||||||
|
(_, None, Some(_)) => panic!("rpc auth: missing rpc_user"),
|
||||||
|
},
|
||||||
|
)?)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
enum RpcCommands {
|
||||||
|
/// Syncs local state with remote state via RPC (starting from last point of agreement) and
|
||||||
|
/// stores/indexes relevant transactions
|
||||||
|
Sync {
|
||||||
|
#[clap(flatten)]
|
||||||
|
rpc_args: RpcArgs,
|
||||||
|
},
|
||||||
|
/// Sync by having the emitter logic in a separate thread
|
||||||
|
Live {
|
||||||
|
#[clap(flatten)]
|
||||||
|
rpc_args: RpcArgs,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
fn main() -> anyhow::Result<()> {
|
||||||
|
let start = Instant::now();
|
||||||
|
|
||||||
|
let (args, keymap, index, db, init_changeset) =
|
||||||
|
example_cli::init::<RpcCommands, RpcArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] loaded initial changeset from db",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
let (init_chain_changeset, init_graph_changeset) = init_changeset;
|
||||||
|
|
||||||
|
let graph = Mutex::new({
|
||||||
|
let mut graph = IndexedTxGraph::new(index);
|
||||||
|
graph.apply_changeset(init_graph_changeset);
|
||||||
|
graph
|
||||||
|
});
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] loaded indexed tx graph from changeset",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
|
||||||
|
let chain = Mutex::new(if init_chain_changeset.is_empty() {
|
||||||
|
let genesis_hash = genesis_block(args.network).block_hash();
|
||||||
|
let (chain, chain_changeset) = LocalChain::from_genesis_hash(genesis_hash);
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
db.stage((chain_changeset, Default::default()));
|
||||||
|
db.commit()?;
|
||||||
|
chain
|
||||||
|
} else {
|
||||||
|
LocalChain::from_changeset(init_chain_changeset)?
|
||||||
|
});
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] loaded local chain from changeset",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
|
||||||
|
let rpc_cmd = match args.command {
|
||||||
|
example_cli::Commands::ChainSpecific(rpc_cmd) => rpc_cmd,
|
||||||
|
general_cmd => {
|
||||||
|
return example_cli::handle_commands(
|
||||||
|
&graph,
|
||||||
|
&db,
|
||||||
|
&chain,
|
||||||
|
&keymap,
|
||||||
|
args.network,
|
||||||
|
|rpc_args, tx| {
|
||||||
|
let client = rpc_args.new_client()?;
|
||||||
|
client.send_raw_transaction(tx)?;
|
||||||
|
Ok(())
|
||||||
|
},
|
||||||
|
general_cmd,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
match rpc_cmd {
|
||||||
|
RpcCommands::Sync { rpc_args } => {
|
||||||
|
let RpcArgs {
|
||||||
|
fallback_height, ..
|
||||||
|
} = rpc_args;
|
||||||
|
|
||||||
|
let chain_tip = chain.lock().unwrap().tip();
|
||||||
|
let rpc_client = rpc_args.new_client()?;
|
||||||
|
let mut emitter = Emitter::new(&rpc_client, chain_tip, fallback_height);
|
||||||
|
|
||||||
|
let mut last_db_commit = Instant::now();
|
||||||
|
let mut last_print = Instant::now();
|
||||||
|
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
|
||||||
|
let mut chain = chain.lock().unwrap();
|
||||||
|
let mut graph = graph.lock().unwrap();
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
|
||||||
|
let chain_changeset = chain
|
||||||
|
.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})
|
||||||
|
.expect("must always apply as we receive blocks in order from emitter");
|
||||||
|
let graph_changeset = graph.apply_block_relevant(&emission.block, height);
|
||||||
|
db.stage((chain_changeset, graph_changeset));
|
||||||
|
|
||||||
|
// commit staged db changes in intervals
|
||||||
|
if last_db_commit.elapsed() >= DB_COMMIT_DELAY {
|
||||||
|
last_db_commit = Instant::now();
|
||||||
|
db.commit()?;
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] committed to db (took {}s)",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
last_db_commit.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// print synced-to height and current balance in intervals
|
||||||
|
if last_print.elapsed() >= STDOUT_PRINT_DELAY {
|
||||||
|
last_print = Instant::now();
|
||||||
|
let synced_to = chain.tip();
|
||||||
|
let balance = {
|
||||||
|
graph.graph().balance(
|
||||||
|
&*chain,
|
||||||
|
synced_to.block_id(),
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|(k, _), _| k == &Keychain::Internal,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] synced to {} @ {} | total: {} sats",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
synced_to.hash(),
|
||||||
|
synced_to.height(),
|
||||||
|
balance.total()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let mempool_txs = emitter.mempool()?;
|
||||||
|
let graph_changeset = graph.lock().unwrap().batch_insert_relevant_unconfirmed(
|
||||||
|
mempool_txs.iter().map(|(tx, time)| (tx, *time)),
|
||||||
|
);
|
||||||
|
{
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
db.stage((local_chain::ChangeSet::default(), graph_changeset));
|
||||||
|
db.commit()?; // commit one last time
|
||||||
|
}
|
||||||
|
}
|
||||||
|
RpcCommands::Live { rpc_args } => {
|
||||||
|
let RpcArgs {
|
||||||
|
fallback_height, ..
|
||||||
|
} = rpc_args;
|
||||||
|
let sigterm_flag = start_ctrlc_handler();
|
||||||
|
|
||||||
|
let last_cp = chain.lock().unwrap().tip();
|
||||||
|
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] starting emitter thread...",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
let (tx, rx) = std::sync::mpsc::sync_channel::<Emission>(CHANNEL_BOUND);
|
||||||
|
let emission_jh = std::thread::spawn(move || -> anyhow::Result<()> {
|
||||||
|
let rpc_client = rpc_args.new_client()?;
|
||||||
|
let mut emitter = Emitter::new(&rpc_client, last_cp, fallback_height);
|
||||||
|
|
||||||
|
let mut block_count = rpc_client.get_block_count()? as u32;
|
||||||
|
tx.send(Emission::Tip(block_count))?;
|
||||||
|
|
||||||
|
loop {
|
||||||
|
match emitter.next_block()? {
|
||||||
|
Some(block_emission) => {
|
||||||
|
let height = block_emission.block_height();
|
||||||
|
if sigterm_flag.load(Ordering::Acquire) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
if height > block_count {
|
||||||
|
block_count = rpc_client.get_block_count()? as u32;
|
||||||
|
tx.send(Emission::Tip(block_count))?;
|
||||||
|
}
|
||||||
|
tx.send(Emission::Block(block_emission))?;
|
||||||
|
}
|
||||||
|
None => {
|
||||||
|
if await_flag(&sigterm_flag, MEMPOOL_EMIT_DELAY) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
println!("preparing mempool emission...");
|
||||||
|
let now = Instant::now();
|
||||||
|
tx.send(Emission::Mempool(emitter.mempool()?))?;
|
||||||
|
println!("mempool emission prepared in {}s", now.elapsed().as_secs());
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
println!("emitter thread shutting down...");
|
||||||
|
Ok(())
|
||||||
|
});
|
||||||
|
|
||||||
|
let mut tip_height = 0_u32;
|
||||||
|
let mut last_db_commit = Instant::now();
|
||||||
|
let mut last_print = Option::<Instant>::None;
|
||||||
|
|
||||||
|
for emission in rx {
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
let mut graph = graph.lock().unwrap();
|
||||||
|
let mut chain = chain.lock().unwrap();
|
||||||
|
|
||||||
|
let changeset = match emission {
|
||||||
|
Emission::Block(block_emission) => {
|
||||||
|
let height = block_emission.block_height();
|
||||||
|
let chain_update = local_chain::Update {
|
||||||
|
tip: block_emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
};
|
||||||
|
let chain_changeset = chain
|
||||||
|
.apply_update(chain_update)
|
||||||
|
.expect("must always apply as we receive blocks in order from emitter");
|
||||||
|
let graph_changeset =
|
||||||
|
graph.apply_block_relevant(&block_emission.block, height);
|
||||||
|
(chain_changeset, graph_changeset)
|
||||||
|
}
|
||||||
|
Emission::Mempool(mempool_txs) => {
|
||||||
|
let graph_changeset = graph.batch_insert_relevant_unconfirmed(
|
||||||
|
mempool_txs.iter().map(|(tx, time)| (tx, *time)),
|
||||||
|
);
|
||||||
|
(local_chain::ChangeSet::default(), graph_changeset)
|
||||||
|
}
|
||||||
|
Emission::Tip(h) => {
|
||||||
|
tip_height = h;
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
db.stage(changeset);
|
||||||
|
|
||||||
|
if last_db_commit.elapsed() >= DB_COMMIT_DELAY {
|
||||||
|
last_db_commit = Instant::now();
|
||||||
|
db.commit()?;
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] committed to db (took {}s)",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
last_db_commit.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
if last_print.map_or(Duration::MAX, |i| i.elapsed()) >= STDOUT_PRINT_DELAY {
|
||||||
|
last_print = Some(Instant::now());
|
||||||
|
let synced_to = chain.tip();
|
||||||
|
let balance = {
|
||||||
|
graph.graph().balance(
|
||||||
|
&*chain,
|
||||||
|
synced_to.block_id(),
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|(k, _), _| k == &Keychain::Internal,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] synced to {} @ {} / {} | total: {} sats",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
synced_to.hash(),
|
||||||
|
synced_to.height(),
|
||||||
|
tip_height,
|
||||||
|
balance.total()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
emission_jh.join().expect("must join emitter thread")?;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
fn start_ctrlc_handler() -> Arc<AtomicBool> {
|
||||||
|
let flag = Arc::new(AtomicBool::new(false));
|
||||||
|
let cloned_flag = flag.clone();
|
||||||
|
|
||||||
|
ctrlc::set_handler(move || cloned_flag.store(true, Ordering::Release));
|
||||||
|
|
||||||
|
flag
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
fn await_flag(flag: &AtomicBool, duration: Duration) -> bool {
|
||||||
|
let start = Instant::now();
|
||||||
|
loop {
|
||||||
|
if flag.load(Ordering::Acquire) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if start.elapsed() >= duration {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
std::thread::sleep(Duration::from_secs(1));
|
||||||
|
}
|
||||||
|
}
|
||||||
17
example-crates/example_cli/Cargo.toml
Normal file
17
example-crates/example_cli/Cargo.toml
Normal file
@@ -0,0 +1,17 @@
|
|||||||
|
[package]
|
||||||
|
name = "example_cli"
|
||||||
|
version = "0.2.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../../crates/chain", features = ["serde", "miniscript"]}
|
||||||
|
bdk_file_store = { path = "../../crates/file_store" }
|
||||||
|
bdk_tmp_plan = { path = "../../nursery/tmp_plan" }
|
||||||
|
bdk_coin_select = { path = "../../nursery/coin_select" }
|
||||||
|
|
||||||
|
clap = { version = "3.2.23", features = ["derive", "env"] }
|
||||||
|
anyhow = "1"
|
||||||
|
serde = { version = "1", features = ["derive"] }
|
||||||
|
serde_json = { version = "^1.0" }
|
||||||
702
example-crates/example_cli/src/lib.rs
Normal file
702
example-crates/example_cli/src/lib.rs
Normal file
@@ -0,0 +1,702 @@
|
|||||||
|
pub use anyhow;
|
||||||
|
use anyhow::Context;
|
||||||
|
use bdk_coin_select::{coin_select_bnb, CoinSelector, CoinSelectorOpt, WeightedValue};
|
||||||
|
use bdk_file_store::Store;
|
||||||
|
use serde::{de::DeserializeOwned, Serialize};
|
||||||
|
use std::{cmp::Reverse, collections::HashMap, path::PathBuf, sync::Mutex, time::Duration};
|
||||||
|
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{
|
||||||
|
absolute, address, psbt::Prevouts, secp256k1::Secp256k1, sighash::SighashCache, Address,
|
||||||
|
Network, Sequence, Transaction, TxIn, TxOut,
|
||||||
|
},
|
||||||
|
indexed_tx_graph::{self, IndexedTxGraph},
|
||||||
|
keychain::{self, KeychainTxOutIndex},
|
||||||
|
local_chain,
|
||||||
|
miniscript::{
|
||||||
|
descriptor::{DescriptorSecretKey, KeyMap},
|
||||||
|
Descriptor, DescriptorPublicKey,
|
||||||
|
},
|
||||||
|
Anchor, Append, ChainOracle, DescriptorExt, FullTxOut, Persist, PersistBackend,
|
||||||
|
};
|
||||||
|
pub use bdk_file_store;
|
||||||
|
pub use clap;
|
||||||
|
|
||||||
|
use clap::{Parser, Subcommand};
|
||||||
|
|
||||||
|
pub type KeychainTxGraph<A> = IndexedTxGraph<A, KeychainTxOutIndex<Keychain>>;
|
||||||
|
pub type KeychainChangeSet<A> = (
|
||||||
|
local_chain::ChangeSet,
|
||||||
|
indexed_tx_graph::ChangeSet<A, keychain::ChangeSet<Keychain>>,
|
||||||
|
);
|
||||||
|
pub type Database<C> = Persist<Store<C>, C>;
|
||||||
|
|
||||||
|
#[derive(Parser)]
|
||||||
|
#[clap(author, version, about, long_about = None)]
|
||||||
|
#[clap(propagate_version = true)]
|
||||||
|
pub struct Args<CS: clap::Subcommand, S: clap::Args> {
|
||||||
|
#[clap(env = "DESCRIPTOR")]
|
||||||
|
pub descriptor: String,
|
||||||
|
#[clap(env = "CHANGE_DESCRIPTOR")]
|
||||||
|
pub change_descriptor: Option<String>,
|
||||||
|
|
||||||
|
#[clap(env = "BITCOIN_NETWORK", long, default_value = "signet")]
|
||||||
|
pub network: Network,
|
||||||
|
|
||||||
|
#[clap(env = "BDK_DB_PATH", long, default_value = ".bdk_example_db")]
|
||||||
|
pub db_path: PathBuf,
|
||||||
|
|
||||||
|
#[clap(env = "BDK_CP_LIMIT", long, default_value = "20")]
|
||||||
|
pub cp_limit: usize,
|
||||||
|
|
||||||
|
#[clap(subcommand)]
|
||||||
|
pub command: Commands<CS, S>,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(clippy::almost_swapped)]
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
pub enum Commands<CS: clap::Subcommand, S: clap::Args> {
|
||||||
|
#[clap(flatten)]
|
||||||
|
ChainSpecific(CS),
|
||||||
|
/// Address generation and inspection.
|
||||||
|
Address {
|
||||||
|
#[clap(subcommand)]
|
||||||
|
addr_cmd: AddressCmd,
|
||||||
|
},
|
||||||
|
/// Get the wallet balance.
|
||||||
|
Balance,
|
||||||
|
/// TxOut related commands.
|
||||||
|
#[clap(name = "txout")]
|
||||||
|
TxOut {
|
||||||
|
#[clap(subcommand)]
|
||||||
|
txout_cmd: TxOutCmd,
|
||||||
|
},
|
||||||
|
/// Send coins to an address.
|
||||||
|
Send {
|
||||||
|
/// Amount to send in satoshis
|
||||||
|
value: u64,
|
||||||
|
/// Destination address
|
||||||
|
address: Address<address::NetworkUnchecked>,
|
||||||
|
#[clap(short, default_value = "bnb")]
|
||||||
|
coin_select: CoinSelectionAlgo,
|
||||||
|
#[clap(flatten)]
|
||||||
|
chain_specific: S,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub enum CoinSelectionAlgo {
|
||||||
|
LargestFirst,
|
||||||
|
SmallestFirst,
|
||||||
|
OldestFirst,
|
||||||
|
NewestFirst,
|
||||||
|
BranchAndBound,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Default for CoinSelectionAlgo {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self::LargestFirst
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::str::FromStr for CoinSelectionAlgo {
|
||||||
|
type Err = anyhow::Error;
|
||||||
|
|
||||||
|
fn from_str(s: &str) -> Result<Self, Self::Err> {
|
||||||
|
use CoinSelectionAlgo::*;
|
||||||
|
Ok(match s {
|
||||||
|
"largest-first" => LargestFirst,
|
||||||
|
"smallest-first" => SmallestFirst,
|
||||||
|
"oldest-first" => OldestFirst,
|
||||||
|
"newest-first" => NewestFirst,
|
||||||
|
"bnb" => BranchAndBound,
|
||||||
|
unknown => {
|
||||||
|
return Err(anyhow::anyhow!(
|
||||||
|
"unknown coin selection algorithm '{}'",
|
||||||
|
unknown
|
||||||
|
))
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for CoinSelectionAlgo {
|
||||||
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
|
use CoinSelectionAlgo::*;
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"{}",
|
||||||
|
match self {
|
||||||
|
LargestFirst => "largest-first",
|
||||||
|
SmallestFirst => "smallest-first",
|
||||||
|
OldestFirst => "oldest-first",
|
||||||
|
NewestFirst => "newest-first",
|
||||||
|
BranchAndBound => "bnb",
|
||||||
|
}
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(clippy::almost_swapped)]
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
pub enum AddressCmd {
|
||||||
|
/// Get the next unused address.
|
||||||
|
Next,
|
||||||
|
/// Get a new address regardless of the existing unused addresses.
|
||||||
|
New,
|
||||||
|
/// List all addresses
|
||||||
|
List {
|
||||||
|
/// List change addresses
|
||||||
|
#[clap(long)]
|
||||||
|
change: bool,
|
||||||
|
},
|
||||||
|
/// Get last revealed address index for each keychain.
|
||||||
|
Index,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
pub enum TxOutCmd {
|
||||||
|
/// List transaction outputs.
|
||||||
|
List {
|
||||||
|
/// Return only spent outputs.
|
||||||
|
#[clap(short, long)]
|
||||||
|
spent: bool,
|
||||||
|
/// Return only unspent outputs.
|
||||||
|
#[clap(short, long)]
|
||||||
|
unspent: bool,
|
||||||
|
/// Return only confirmed outputs.
|
||||||
|
#[clap(long)]
|
||||||
|
confirmed: bool,
|
||||||
|
/// Return only unconfirmed outputs.
|
||||||
|
#[clap(long)]
|
||||||
|
unconfirmed: bool,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(
|
||||||
|
Debug, Clone, Copy, PartialOrd, Ord, PartialEq, Eq, serde::Deserialize, serde::Serialize,
|
||||||
|
)]
|
||||||
|
pub enum Keychain {
|
||||||
|
External,
|
||||||
|
Internal,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for Keychain {
|
||||||
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Keychain::External => write!(f, "external"),
|
||||||
|
Keychain::Internal => write!(f, "internal"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(clippy::type_complexity)]
|
||||||
|
pub fn create_tx<A: Anchor, O: ChainOracle>(
|
||||||
|
graph: &mut KeychainTxGraph<A>,
|
||||||
|
chain: &O,
|
||||||
|
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||||
|
cs_algorithm: CoinSelectionAlgo,
|
||||||
|
address: Address,
|
||||||
|
value: u64,
|
||||||
|
) -> anyhow::Result<(
|
||||||
|
Transaction,
|
||||||
|
Option<(keychain::ChangeSet<Keychain>, (Keychain, u32))>,
|
||||||
|
)>
|
||||||
|
where
|
||||||
|
O::Error: std::error::Error + Send + Sync + 'static,
|
||||||
|
{
|
||||||
|
let mut changeset = keychain::ChangeSet::default();
|
||||||
|
|
||||||
|
let assets = bdk_tmp_plan::Assets {
|
||||||
|
keys: keymap.iter().map(|(pk, _)| pk.clone()).collect(),
|
||||||
|
..Default::default()
|
||||||
|
};
|
||||||
|
|
||||||
|
// TODO use planning module
|
||||||
|
let mut candidates = planned_utxos(graph, chain, &assets)?;
|
||||||
|
|
||||||
|
// apply coin selection algorithm
|
||||||
|
match cs_algorithm {
|
||||||
|
CoinSelectionAlgo::LargestFirst => {
|
||||||
|
candidates.sort_by_key(|(_, utxo)| Reverse(utxo.txout.value))
|
||||||
|
}
|
||||||
|
CoinSelectionAlgo::SmallestFirst => candidates.sort_by_key(|(_, utxo)| utxo.txout.value),
|
||||||
|
CoinSelectionAlgo::OldestFirst => {
|
||||||
|
candidates.sort_by_key(|(_, utxo)| utxo.chain_position.clone())
|
||||||
|
}
|
||||||
|
CoinSelectionAlgo::NewestFirst => {
|
||||||
|
candidates.sort_by_key(|(_, utxo)| Reverse(utxo.chain_position.clone()))
|
||||||
|
}
|
||||||
|
CoinSelectionAlgo::BranchAndBound => {}
|
||||||
|
}
|
||||||
|
|
||||||
|
// turn the txos we chose into weight and value
|
||||||
|
let wv_candidates = candidates
|
||||||
|
.iter()
|
||||||
|
.map(|(plan, utxo)| {
|
||||||
|
WeightedValue::new(
|
||||||
|
utxo.txout.value,
|
||||||
|
plan.expected_weight() as _,
|
||||||
|
plan.witness_version().is_some(),
|
||||||
|
)
|
||||||
|
})
|
||||||
|
.collect();
|
||||||
|
|
||||||
|
let mut outputs = vec![TxOut {
|
||||||
|
value,
|
||||||
|
script_pubkey: address.script_pubkey(),
|
||||||
|
}];
|
||||||
|
|
||||||
|
let internal_keychain = if graph.index.keychains().get(&Keychain::Internal).is_some() {
|
||||||
|
Keychain::Internal
|
||||||
|
} else {
|
||||||
|
Keychain::External
|
||||||
|
};
|
||||||
|
|
||||||
|
let ((change_index, change_script), change_changeset) =
|
||||||
|
graph.index.next_unused_spk(&internal_keychain);
|
||||||
|
changeset.append(change_changeset);
|
||||||
|
|
||||||
|
// Clone to drop the immutable reference.
|
||||||
|
let change_script = change_script.into();
|
||||||
|
|
||||||
|
let change_plan = bdk_tmp_plan::plan_satisfaction(
|
||||||
|
&graph
|
||||||
|
.index
|
||||||
|
.keychains()
|
||||||
|
.get(&internal_keychain)
|
||||||
|
.expect("must exist")
|
||||||
|
.at_derivation_index(change_index)
|
||||||
|
.expect("change_index can't be hardened"),
|
||||||
|
&assets,
|
||||||
|
)
|
||||||
|
.expect("failed to obtain change plan");
|
||||||
|
|
||||||
|
let mut change_output = TxOut {
|
||||||
|
value: 0,
|
||||||
|
script_pubkey: change_script,
|
||||||
|
};
|
||||||
|
|
||||||
|
let cs_opts = CoinSelectorOpt {
|
||||||
|
target_feerate: 0.5,
|
||||||
|
min_drain_value: graph
|
||||||
|
.index
|
||||||
|
.keychains()
|
||||||
|
.get(&internal_keychain)
|
||||||
|
.expect("must exist")
|
||||||
|
.dust_value(),
|
||||||
|
..CoinSelectorOpt::fund_outputs(
|
||||||
|
&outputs,
|
||||||
|
&change_output,
|
||||||
|
change_plan.expected_weight() as u32,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
|
||||||
|
// TODO: How can we make it easy to shuffle in order of inputs and outputs here?
|
||||||
|
// apply coin selection by saying we need to fund these outputs
|
||||||
|
let mut coin_selector = CoinSelector::new(&wv_candidates, &cs_opts);
|
||||||
|
|
||||||
|
// just select coins in the order provided until we have enough
|
||||||
|
// only use the first result (least waste)
|
||||||
|
let selection = match cs_algorithm {
|
||||||
|
CoinSelectionAlgo::BranchAndBound => {
|
||||||
|
coin_select_bnb(Duration::from_secs(10), coin_selector.clone())
|
||||||
|
.map_or_else(|| coin_selector.select_until_finished(), |cs| cs.finish())?
|
||||||
|
}
|
||||||
|
_ => coin_selector.select_until_finished()?,
|
||||||
|
};
|
||||||
|
let (_, selection_meta) = selection.best_strategy();
|
||||||
|
|
||||||
|
// get the selected utxos
|
||||||
|
let selected_txos = selection.apply_selection(&candidates).collect::<Vec<_>>();
|
||||||
|
|
||||||
|
if let Some(drain_value) = selection_meta.drain_value {
|
||||||
|
change_output.value = drain_value;
|
||||||
|
// if the selection tells us to use change and the change value is sufficient, we add it as an output
|
||||||
|
outputs.push(change_output)
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut transaction = Transaction {
|
||||||
|
version: 0x02,
|
||||||
|
// because the temporary planning module does not support timelocks, we can use the chain
|
||||||
|
// tip as the `lock_time` for anti-fee-sniping purposes
|
||||||
|
lock_time: absolute::LockTime::from_height(chain.get_chain_tip()?.height)
|
||||||
|
.expect("invalid height"),
|
||||||
|
input: selected_txos
|
||||||
|
.iter()
|
||||||
|
.map(|(_, utxo)| TxIn {
|
||||||
|
previous_output: utxo.outpoint,
|
||||||
|
sequence: Sequence::ENABLE_RBF_NO_LOCKTIME,
|
||||||
|
..Default::default()
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
output: outputs,
|
||||||
|
};
|
||||||
|
|
||||||
|
let prevouts = selected_txos
|
||||||
|
.iter()
|
||||||
|
.map(|(_, utxo)| utxo.txout.clone())
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
let sighash_prevouts = Prevouts::All(&prevouts);
|
||||||
|
|
||||||
|
// first, set tx values for the plan so that we don't change them while signing
|
||||||
|
for (i, (plan, _)) in selected_txos.iter().enumerate() {
|
||||||
|
if let Some(sequence) = plan.required_sequence() {
|
||||||
|
transaction.input[i].sequence = sequence
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// create a short lived transaction
|
||||||
|
let _sighash_tx = transaction.clone();
|
||||||
|
let mut sighash_cache = SighashCache::new(&_sighash_tx);
|
||||||
|
|
||||||
|
for (i, (plan, _)) in selected_txos.iter().enumerate() {
|
||||||
|
let requirements = plan.requirements();
|
||||||
|
let mut auth_data = bdk_tmp_plan::SatisfactionMaterial::default();
|
||||||
|
assert!(
|
||||||
|
!requirements.requires_hash_preimages(),
|
||||||
|
"can't have hash pre-images since we didn't provide any."
|
||||||
|
);
|
||||||
|
assert!(
|
||||||
|
requirements.signatures.sign_with_keymap(
|
||||||
|
i,
|
||||||
|
keymap,
|
||||||
|
&sighash_prevouts,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
&mut sighash_cache,
|
||||||
|
&mut auth_data,
|
||||||
|
&Secp256k1::default(),
|
||||||
|
)?,
|
||||||
|
"we should have signed with this input."
|
||||||
|
);
|
||||||
|
|
||||||
|
match plan.try_complete(&auth_data) {
|
||||||
|
bdk_tmp_plan::PlanState::Complete {
|
||||||
|
final_script_sig,
|
||||||
|
final_script_witness,
|
||||||
|
} => {
|
||||||
|
if let Some(witness) = final_script_witness {
|
||||||
|
transaction.input[i].witness = witness;
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(script_sig) = final_script_sig {
|
||||||
|
transaction.input[i].script_sig = script_sig;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
bdk_tmp_plan::PlanState::Incomplete(_) => {
|
||||||
|
return Err(anyhow::anyhow!(
|
||||||
|
"we weren't able to complete the plan with our keys."
|
||||||
|
));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let change_info = if selection_meta.drain_value.is_some() {
|
||||||
|
Some((changeset, (internal_keychain, change_index)))
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
};
|
||||||
|
|
||||||
|
Ok((transaction, change_info))
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(clippy::type_complexity)]
|
||||||
|
pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDerive>(
|
||||||
|
graph: &KeychainTxGraph<A>,
|
||||||
|
chain: &O,
|
||||||
|
assets: &bdk_tmp_plan::Assets<K>,
|
||||||
|
) -> Result<Vec<(bdk_tmp_plan::Plan<K>, FullTxOut<A>)>, O::Error> {
|
||||||
|
let chain_tip = chain.get_chain_tip()?;
|
||||||
|
let outpoints = graph.index.outpoints().iter().cloned();
|
||||||
|
graph
|
||||||
|
.graph()
|
||||||
|
.try_filter_chain_unspents(chain, chain_tip, outpoints)
|
||||||
|
.filter_map(
|
||||||
|
#[allow(clippy::type_complexity)]
|
||||||
|
|r| -> Option<Result<(bdk_tmp_plan::Plan<K>, FullTxOut<A>), _>> {
|
||||||
|
let (k, i, full_txo) = match r {
|
||||||
|
Err(err) => return Some(Err(err)),
|
||||||
|
Ok(((k, i), full_txo)) => (k, i, full_txo),
|
||||||
|
};
|
||||||
|
let desc = graph
|
||||||
|
.index
|
||||||
|
.keychains()
|
||||||
|
.get(&k)
|
||||||
|
.expect("keychain must exist")
|
||||||
|
.at_derivation_index(i)
|
||||||
|
.expect("i can't be hardened");
|
||||||
|
let plan = bdk_tmp_plan::plan_satisfaction(&desc, assets)?;
|
||||||
|
Some(Ok((plan, full_txo)))
|
||||||
|
},
|
||||||
|
)
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn handle_commands<CS: clap::Subcommand, S: clap::Args, A: Anchor, O: ChainOracle, C>(
|
||||||
|
graph: &Mutex<KeychainTxGraph<A>>,
|
||||||
|
db: &Mutex<Database<C>>,
|
||||||
|
chain: &Mutex<O>,
|
||||||
|
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||||
|
network: Network,
|
||||||
|
broadcast: impl FnOnce(S, &Transaction) -> anyhow::Result<()>,
|
||||||
|
cmd: Commands<CS, S>,
|
||||||
|
) -> anyhow::Result<()>
|
||||||
|
where
|
||||||
|
O::Error: std::error::Error + Send + Sync + 'static,
|
||||||
|
C: Default + Append + DeserializeOwned + Serialize + From<KeychainChangeSet<A>>,
|
||||||
|
{
|
||||||
|
match cmd {
|
||||||
|
Commands::ChainSpecific(_) => unreachable!("example code should handle this!"),
|
||||||
|
Commands::Address { addr_cmd } => {
|
||||||
|
let graph = &mut *graph.lock().unwrap();
|
||||||
|
let index = &mut graph.index;
|
||||||
|
|
||||||
|
match addr_cmd {
|
||||||
|
AddressCmd::Next | AddressCmd::New => {
|
||||||
|
let spk_chooser = match addr_cmd {
|
||||||
|
AddressCmd::Next => KeychainTxOutIndex::next_unused_spk,
|
||||||
|
AddressCmd::New => KeychainTxOutIndex::reveal_next_spk,
|
||||||
|
_ => unreachable!("only these two variants exist in match arm"),
|
||||||
|
};
|
||||||
|
|
||||||
|
let ((spk_i, spk), index_changeset) = spk_chooser(index, &Keychain::External);
|
||||||
|
let db = &mut *db.lock().unwrap();
|
||||||
|
db.stage_and_commit(C::from((
|
||||||
|
local_chain::ChangeSet::default(),
|
||||||
|
indexed_tx_graph::ChangeSet::from(index_changeset),
|
||||||
|
)))?;
|
||||||
|
let addr =
|
||||||
|
Address::from_script(spk, network).context("failed to derive address")?;
|
||||||
|
println!("[address @ {}] {}", spk_i, addr);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
AddressCmd::Index => {
|
||||||
|
for (keychain, derivation_index) in index.last_revealed_indices() {
|
||||||
|
println!("{:?}: {}", keychain, derivation_index);
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
AddressCmd::List { change } => {
|
||||||
|
let target_keychain = match change {
|
||||||
|
true => Keychain::Internal,
|
||||||
|
false => Keychain::External,
|
||||||
|
};
|
||||||
|
for (spk_i, spk) in index.revealed_keychain_spks(&target_keychain) {
|
||||||
|
let address = Address::from_script(spk, network)
|
||||||
|
.expect("should always be able to derive address");
|
||||||
|
println!(
|
||||||
|
"{:?} {} used:{}",
|
||||||
|
spk_i,
|
||||||
|
address,
|
||||||
|
index.is_used(target_keychain, spk_i)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Commands::Balance => {
|
||||||
|
let graph = &*graph.lock().unwrap();
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
fn print_balances<'a>(
|
||||||
|
title_str: &'a str,
|
||||||
|
items: impl IntoIterator<Item = (&'a str, u64)>,
|
||||||
|
) {
|
||||||
|
println!("{}:", title_str);
|
||||||
|
for (name, amount) in items.into_iter() {
|
||||||
|
println!(" {:<10} {:>12} sats", name, amount)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let balance = graph.graph().try_balance(
|
||||||
|
chain,
|
||||||
|
chain.get_chain_tip()?,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|(k, _), _| k == &Keychain::Internal,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let confirmed_total = balance.confirmed + balance.immature;
|
||||||
|
let unconfirmed_total = balance.untrusted_pending + balance.trusted_pending;
|
||||||
|
|
||||||
|
print_balances(
|
||||||
|
"confirmed",
|
||||||
|
[
|
||||||
|
("total", confirmed_total),
|
||||||
|
("spendable", balance.confirmed),
|
||||||
|
("immature", balance.immature),
|
||||||
|
],
|
||||||
|
);
|
||||||
|
print_balances(
|
||||||
|
"unconfirmed",
|
||||||
|
[
|
||||||
|
("total", unconfirmed_total),
|
||||||
|
("trusted", balance.trusted_pending),
|
||||||
|
("untrusted", balance.untrusted_pending),
|
||||||
|
],
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
Commands::TxOut { txout_cmd } => {
|
||||||
|
let graph = &*graph.lock().unwrap();
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
let chain_tip = chain.get_chain_tip()?;
|
||||||
|
let outpoints = graph.index.outpoints().iter().cloned();
|
||||||
|
|
||||||
|
match txout_cmd {
|
||||||
|
TxOutCmd::List {
|
||||||
|
spent,
|
||||||
|
unspent,
|
||||||
|
confirmed,
|
||||||
|
unconfirmed,
|
||||||
|
} => {
|
||||||
|
let txouts = graph
|
||||||
|
.graph()
|
||||||
|
.try_filter_chain_txouts(chain, chain_tip, outpoints)
|
||||||
|
.filter(|r| match r {
|
||||||
|
Ok((_, full_txo)) => match (spent, unspent) {
|
||||||
|
(true, false) => full_txo.spent_by.is_some(),
|
||||||
|
(false, true) => full_txo.spent_by.is_none(),
|
||||||
|
_ => true,
|
||||||
|
},
|
||||||
|
// always keep errored items
|
||||||
|
Err(_) => true,
|
||||||
|
})
|
||||||
|
.filter(|r| match r {
|
||||||
|
Ok((_, full_txo)) => match (confirmed, unconfirmed) {
|
||||||
|
(true, false) => full_txo.chain_position.is_confirmed(),
|
||||||
|
(false, true) => !full_txo.chain_position.is_confirmed(),
|
||||||
|
_ => true,
|
||||||
|
},
|
||||||
|
// always keep errored items
|
||||||
|
Err(_) => true,
|
||||||
|
})
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
|
||||||
|
for (spk_i, full_txo) in txouts {
|
||||||
|
let addr = Address::from_script(&full_txo.txout.script_pubkey, network)?;
|
||||||
|
println!(
|
||||||
|
"{:?} {} {} {} spent:{:?}",
|
||||||
|
spk_i, full_txo.txout.value, full_txo.outpoint, addr, full_txo.spent_by
|
||||||
|
)
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Commands::Send {
|
||||||
|
value,
|
||||||
|
address,
|
||||||
|
coin_select,
|
||||||
|
chain_specific,
|
||||||
|
} => {
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
let address = address.require_network(network)?;
|
||||||
|
let (transaction, change_index) = {
|
||||||
|
let graph = &mut *graph.lock().unwrap();
|
||||||
|
// take mutable ref to construct tx -- it is only open for a short time while building it.
|
||||||
|
let (tx, change_info) =
|
||||||
|
create_tx(graph, chain, keymap, coin_select, address, value)?;
|
||||||
|
|
||||||
|
if let Some((index_changeset, (change_keychain, index))) = change_info {
|
||||||
|
// We must first persist to disk the fact that we've got a new address from the
|
||||||
|
// change keychain so future scans will find the tx we're about to broadcast.
|
||||||
|
// If we're unable to persist this, then we don't want to broadcast.
|
||||||
|
{
|
||||||
|
let db = &mut *db.lock().unwrap();
|
||||||
|
db.stage_and_commit(C::from((
|
||||||
|
local_chain::ChangeSet::default(),
|
||||||
|
indexed_tx_graph::ChangeSet::from(index_changeset),
|
||||||
|
)))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
// We don't want other callers/threads to use this address while we're using it
|
||||||
|
// but we also don't want to scan the tx we just created because it's not
|
||||||
|
// technically in the blockchain yet.
|
||||||
|
graph.index.mark_used(change_keychain, index);
|
||||||
|
(tx, Some((change_keychain, index)))
|
||||||
|
} else {
|
||||||
|
(tx, None)
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
match (broadcast)(chain_specific, &transaction) {
|
||||||
|
Ok(_) => {
|
||||||
|
println!("Broadcasted Tx : {}", transaction.txid());
|
||||||
|
|
||||||
|
let keychain_changeset = graph.lock().unwrap().insert_tx(transaction);
|
||||||
|
|
||||||
|
// We know the tx is at least unconfirmed now. Note if persisting here fails,
|
||||||
|
// it's not a big deal since we can always find it again form
|
||||||
|
// blockchain.
|
||||||
|
db.lock().unwrap().stage_and_commit(C::from((
|
||||||
|
local_chain::ChangeSet::default(),
|
||||||
|
keychain_changeset,
|
||||||
|
)))?;
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
Err(e) => {
|
||||||
|
if let Some((keychain, index)) = change_index {
|
||||||
|
// We failed to broadcast, so allow our change address to be used in the future
|
||||||
|
graph.lock().unwrap().index.unmark_used(keychain, index);
|
||||||
|
}
|
||||||
|
Err(e)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(clippy::type_complexity)]
|
||||||
|
pub fn init<CS: clap::Subcommand, S: clap::Args, C>(
|
||||||
|
db_magic: &[u8],
|
||||||
|
db_default_path: &str,
|
||||||
|
) -> anyhow::Result<(
|
||||||
|
Args<CS, S>,
|
||||||
|
KeyMap,
|
||||||
|
KeychainTxOutIndex<Keychain>,
|
||||||
|
Mutex<Database<C>>,
|
||||||
|
C,
|
||||||
|
)>
|
||||||
|
where
|
||||||
|
C: Default + Append + Serialize + DeserializeOwned,
|
||||||
|
{
|
||||||
|
if std::env::var("BDK_DB_PATH").is_err() {
|
||||||
|
std::env::set_var("BDK_DB_PATH", db_default_path);
|
||||||
|
}
|
||||||
|
let args = Args::<CS, S>::parse();
|
||||||
|
let secp = Secp256k1::default();
|
||||||
|
|
||||||
|
let mut index = KeychainTxOutIndex::<Keychain>::default();
|
||||||
|
|
||||||
|
let (descriptor, mut keymap) =
|
||||||
|
Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &args.descriptor)?;
|
||||||
|
index.add_keychain(Keychain::External, descriptor);
|
||||||
|
|
||||||
|
if let Some((internal_descriptor, internal_keymap)) = args
|
||||||
|
.change_descriptor
|
||||||
|
.as_ref()
|
||||||
|
.map(|desc_str| Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, desc_str))
|
||||||
|
.transpose()?
|
||||||
|
{
|
||||||
|
keymap.extend(internal_keymap);
|
||||||
|
index.add_keychain(Keychain::Internal, internal_descriptor);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut db_backend = match Store::<C>::open_or_create_new(db_magic, &args.db_path) {
|
||||||
|
Ok(db_backend) => db_backend,
|
||||||
|
// we cannot return `err` directly as it has lifetime `'m`
|
||||||
|
Err(err) => return Err(anyhow::anyhow!("failed to init db backend: {:?}", err)),
|
||||||
|
};
|
||||||
|
|
||||||
|
let init_changeset = db_backend.load_from_persistence()?.unwrap_or_default();
|
||||||
|
|
||||||
|
Ok((
|
||||||
|
args,
|
||||||
|
keymap,
|
||||||
|
index,
|
||||||
|
Mutex::new(Database::new(db_backend)),
|
||||||
|
init_changeset,
|
||||||
|
))
|
||||||
|
}
|
||||||
11
example-crates/example_electrum/Cargo.toml
Normal file
11
example-crates/example_electrum/Cargo.toml
Normal file
@@ -0,0 +1,11 @@
|
|||||||
|
[package]
|
||||||
|
name = "example_electrum"
|
||||||
|
version = "0.2.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||||
|
bdk_electrum = { path = "../../crates/electrum" }
|
||||||
|
example_cli = { path = "../example_cli" }
|
||||||
327
example-crates/example_electrum/src/main.rs
Normal file
327
example-crates/example_electrum/src/main.rs
Normal file
@@ -0,0 +1,327 @@
|
|||||||
|
use std::{
|
||||||
|
collections::BTreeMap,
|
||||||
|
io::{self, Write},
|
||||||
|
sync::Mutex,
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{constants::genesis_block, Address, Network, OutPoint, Txid},
|
||||||
|
indexed_tx_graph::{self, IndexedTxGraph},
|
||||||
|
keychain,
|
||||||
|
local_chain::{self, LocalChain},
|
||||||
|
Append, ConfirmationHeightAnchor,
|
||||||
|
};
|
||||||
|
use bdk_electrum::{
|
||||||
|
electrum_client::{self, Client, ElectrumApi},
|
||||||
|
ElectrumExt, ElectrumUpdate,
|
||||||
|
};
|
||||||
|
use example_cli::{
|
||||||
|
anyhow::{self, Context},
|
||||||
|
clap::{self, Parser, Subcommand},
|
||||||
|
Keychain,
|
||||||
|
};
|
||||||
|
|
||||||
|
const DB_MAGIC: &[u8] = b"bdk_example_electrum";
|
||||||
|
const DB_PATH: &str = ".bdk_example_electrum.db";
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
enum ElectrumCommands {
|
||||||
|
/// Scans the addresses in the wallet using the electrum API.
|
||||||
|
Scan {
|
||||||
|
/// When a gap this large has been found for a keychain, it will stop.
|
||||||
|
#[clap(long, default_value = "5")]
|
||||||
|
stop_gap: usize,
|
||||||
|
#[clap(flatten)]
|
||||||
|
scan_options: ScanOptions,
|
||||||
|
#[clap(flatten)]
|
||||||
|
electrum_args: ElectrumArgs,
|
||||||
|
},
|
||||||
|
/// Scans particular addresses using the electrum API.
|
||||||
|
Sync {
|
||||||
|
/// Scan all the unused addresses.
|
||||||
|
#[clap(long)]
|
||||||
|
unused_spks: bool,
|
||||||
|
/// Scan every address that you have derived.
|
||||||
|
#[clap(long)]
|
||||||
|
all_spks: bool,
|
||||||
|
/// Scan unspent outpoints for spends or changes to confirmation status of residing tx.
|
||||||
|
#[clap(long)]
|
||||||
|
utxos: bool,
|
||||||
|
/// Scan unconfirmed transactions for updates.
|
||||||
|
#[clap(long)]
|
||||||
|
unconfirmed: bool,
|
||||||
|
#[clap(flatten)]
|
||||||
|
scan_options: ScanOptions,
|
||||||
|
#[clap(flatten)]
|
||||||
|
electrum_args: ElectrumArgs,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
impl ElectrumCommands {
|
||||||
|
fn electrum_args(&self) -> ElectrumArgs {
|
||||||
|
match self {
|
||||||
|
ElectrumCommands::Scan { electrum_args, .. } => electrum_args.clone(),
|
||||||
|
ElectrumCommands::Sync { electrum_args, .. } => electrum_args.clone(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(clap::Args, Debug, Clone)]
|
||||||
|
pub struct ElectrumArgs {
|
||||||
|
/// The electrum url to use to connect to. If not provided it will use a default electrum server
|
||||||
|
/// for your chosen network.
|
||||||
|
electrum_url: Option<String>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl ElectrumArgs {
|
||||||
|
pub fn client(&self, network: Network) -> anyhow::Result<Client> {
|
||||||
|
let electrum_url = self.electrum_url.as_deref().unwrap_or(match network {
|
||||||
|
Network::Bitcoin => "ssl://electrum.blockstream.info:50002",
|
||||||
|
Network::Testnet => "ssl://electrum.blockstream.info:60002",
|
||||||
|
Network::Regtest => "tcp://localhost:60401",
|
||||||
|
Network::Signet => "tcp://signet-electrumx.wakiyamap.dev:50001",
|
||||||
|
_ => panic!("Unknown network"),
|
||||||
|
});
|
||||||
|
let config = electrum_client::Config::builder()
|
||||||
|
.validate_domain(matches!(network, Network::Bitcoin))
|
||||||
|
.build();
|
||||||
|
|
||||||
|
Ok(electrum_client::Client::from_config(electrum_url, config)?)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Parser, Debug, Clone, PartialEq)]
|
||||||
|
pub struct ScanOptions {
|
||||||
|
/// Set batch size for each script_history call to electrum client.
|
||||||
|
#[clap(long, default_value = "25")]
|
||||||
|
pub batch_size: usize,
|
||||||
|
}
|
||||||
|
|
||||||
|
type ChangeSet = (
|
||||||
|
local_chain::ChangeSet,
|
||||||
|
indexed_tx_graph::ChangeSet<ConfirmationHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||||
|
);
|
||||||
|
|
||||||
|
fn main() -> anyhow::Result<()> {
|
||||||
|
let (args, keymap, index, db, (disk_local_chain, disk_tx_graph)) =
|
||||||
|
example_cli::init::<ElectrumCommands, ElectrumArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||||
|
|
||||||
|
let graph = Mutex::new({
|
||||||
|
let mut graph = IndexedTxGraph::new(index);
|
||||||
|
graph.apply_changeset(disk_tx_graph);
|
||||||
|
graph
|
||||||
|
});
|
||||||
|
|
||||||
|
let chain = Mutex::new({
|
||||||
|
let genesis_hash = genesis_block(args.network).block_hash();
|
||||||
|
let (mut chain, _) = LocalChain::from_genesis_hash(genesis_hash);
|
||||||
|
chain.apply_changeset(&disk_local_chain)?;
|
||||||
|
chain
|
||||||
|
});
|
||||||
|
|
||||||
|
let electrum_cmd = match &args.command {
|
||||||
|
example_cli::Commands::ChainSpecific(electrum_cmd) => electrum_cmd,
|
||||||
|
general_cmd => {
|
||||||
|
return example_cli::handle_commands(
|
||||||
|
&graph,
|
||||||
|
&db,
|
||||||
|
&chain,
|
||||||
|
&keymap,
|
||||||
|
args.network,
|
||||||
|
|electrum_args, tx| {
|
||||||
|
let client = electrum_args.client(args.network)?;
|
||||||
|
client.transaction_broadcast(tx)?;
|
||||||
|
Ok(())
|
||||||
|
},
|
||||||
|
general_cmd.clone(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let client = electrum_cmd.electrum_args().client(args.network)?;
|
||||||
|
|
||||||
|
let response = match electrum_cmd.clone() {
|
||||||
|
ElectrumCommands::Scan {
|
||||||
|
stop_gap,
|
||||||
|
scan_options,
|
||||||
|
..
|
||||||
|
} => {
|
||||||
|
let (keychain_spks, tip) = {
|
||||||
|
let graph = &*graph.lock().unwrap();
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
|
||||||
|
let keychain_spks = graph
|
||||||
|
.index
|
||||||
|
.all_unbounded_spk_iters()
|
||||||
|
.into_iter()
|
||||||
|
.map(|(keychain, iter)| {
|
||||||
|
let mut first = true;
|
||||||
|
let spk_iter = iter.inspect(move |(i, _)| {
|
||||||
|
if first {
|
||||||
|
eprint!("\nscanning {}: ", keychain);
|
||||||
|
first = false;
|
||||||
|
}
|
||||||
|
|
||||||
|
eprint!("{} ", i);
|
||||||
|
let _ = io::stdout().flush();
|
||||||
|
});
|
||||||
|
(keychain, spk_iter)
|
||||||
|
})
|
||||||
|
.collect::<BTreeMap<_, _>>();
|
||||||
|
|
||||||
|
let tip = chain.tip();
|
||||||
|
(keychain_spks, tip)
|
||||||
|
};
|
||||||
|
|
||||||
|
client
|
||||||
|
.full_scan(tip, keychain_spks, stop_gap, scan_options.batch_size)
|
||||||
|
.context("scanning the blockchain")?
|
||||||
|
}
|
||||||
|
ElectrumCommands::Sync {
|
||||||
|
mut unused_spks,
|
||||||
|
all_spks,
|
||||||
|
mut utxos,
|
||||||
|
mut unconfirmed,
|
||||||
|
scan_options,
|
||||||
|
..
|
||||||
|
} => {
|
||||||
|
// Get a short lock on the tracker to get the spks we're interested in
|
||||||
|
let graph = graph.lock().unwrap();
|
||||||
|
let chain = chain.lock().unwrap();
|
||||||
|
let chain_tip = chain.tip().block_id();
|
||||||
|
|
||||||
|
if !(all_spks || unused_spks || utxos || unconfirmed) {
|
||||||
|
unused_spks = true;
|
||||||
|
unconfirmed = true;
|
||||||
|
utxos = true;
|
||||||
|
} else if all_spks {
|
||||||
|
unused_spks = false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut spks: Box<dyn Iterator<Item = bdk_chain::bitcoin::ScriptBuf>> =
|
||||||
|
Box::new(core::iter::empty());
|
||||||
|
if all_spks {
|
||||||
|
let all_spks = graph
|
||||||
|
.index
|
||||||
|
.revealed_spks()
|
||||||
|
.map(|(k, i, spk)| (k, i, spk.to_owned()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
spks = Box::new(spks.chain(all_spks.into_iter().map(|(k, i, spk)| {
|
||||||
|
eprintln!("scanning {}:{}", k, i);
|
||||||
|
spk
|
||||||
|
})));
|
||||||
|
}
|
||||||
|
if unused_spks {
|
||||||
|
let unused_spks = graph
|
||||||
|
.index
|
||||||
|
.unused_spks()
|
||||||
|
.map(|(k, i, spk)| (k, i, spk.to_owned()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
spks = Box::new(spks.chain(unused_spks.into_iter().map(|(k, i, spk)| {
|
||||||
|
eprintln!(
|
||||||
|
"Checking if address {} {}:{} has been used",
|
||||||
|
Address::from_script(&spk, args.network).unwrap(),
|
||||||
|
k,
|
||||||
|
i,
|
||||||
|
);
|
||||||
|
spk
|
||||||
|
})));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut outpoints: Box<dyn Iterator<Item = OutPoint>> = Box::new(core::iter::empty());
|
||||||
|
|
||||||
|
if utxos {
|
||||||
|
let init_outpoints = graph.index.outpoints().iter().cloned();
|
||||||
|
|
||||||
|
let utxos = graph
|
||||||
|
.graph()
|
||||||
|
.filter_chain_unspents(&*chain, chain_tip, init_outpoints)
|
||||||
|
.map(|(_, utxo)| utxo)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
outpoints = Box::new(
|
||||||
|
utxos
|
||||||
|
.into_iter()
|
||||||
|
.inspect(|utxo| {
|
||||||
|
eprintln!(
|
||||||
|
"Checking if outpoint {} (value: {}) has been spent",
|
||||||
|
utxo.outpoint, utxo.txout.value
|
||||||
|
);
|
||||||
|
})
|
||||||
|
.map(|utxo| utxo.outpoint),
|
||||||
|
);
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut txids: Box<dyn Iterator<Item = Txid>> = Box::new(core::iter::empty());
|
||||||
|
|
||||||
|
if unconfirmed {
|
||||||
|
let unconfirmed_txids = graph
|
||||||
|
.graph()
|
||||||
|
.list_chain_txs(&*chain, chain_tip)
|
||||||
|
.filter(|canonical_tx| !canonical_tx.chain_position.is_confirmed())
|
||||||
|
.map(|canonical_tx| canonical_tx.tx_node.txid)
|
||||||
|
.collect::<Vec<Txid>>();
|
||||||
|
|
||||||
|
txids = Box::new(unconfirmed_txids.into_iter().inspect(|txid| {
|
||||||
|
eprintln!("Checking if {} is confirmed yet", txid);
|
||||||
|
}));
|
||||||
|
}
|
||||||
|
|
||||||
|
let tip = chain.tip();
|
||||||
|
|
||||||
|
// drop lock on graph and chain
|
||||||
|
drop((graph, chain));
|
||||||
|
|
||||||
|
let electrum_update = client
|
||||||
|
.sync(tip, spks, txids, outpoints, scan_options.batch_size)
|
||||||
|
.context("scanning the blockchain")?;
|
||||||
|
(electrum_update, BTreeMap::new())
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let (
|
||||||
|
ElectrumUpdate {
|
||||||
|
chain_update,
|
||||||
|
relevant_txids,
|
||||||
|
},
|
||||||
|
keychain_update,
|
||||||
|
) = response;
|
||||||
|
|
||||||
|
let missing_txids = {
|
||||||
|
let graph = &*graph.lock().unwrap();
|
||||||
|
relevant_txids.missing_full_txs(graph.graph())
|
||||||
|
};
|
||||||
|
|
||||||
|
let now = std::time::UNIX_EPOCH
|
||||||
|
.elapsed()
|
||||||
|
.expect("must get time")
|
||||||
|
.as_secs();
|
||||||
|
|
||||||
|
let graph_update = relevant_txids.into_tx_graph(&client, Some(now), missing_txids)?;
|
||||||
|
|
||||||
|
let db_changeset = {
|
||||||
|
let mut chain = chain.lock().unwrap();
|
||||||
|
let mut graph = graph.lock().unwrap();
|
||||||
|
|
||||||
|
let chain = chain.apply_update(chain_update)?;
|
||||||
|
|
||||||
|
let indexed_tx_graph = {
|
||||||
|
let mut changeset =
|
||||||
|
indexed_tx_graph::ChangeSet::<ConfirmationHeightAnchor, _>::default();
|
||||||
|
let (_, indexer) = graph.index.reveal_to_target_multi(&keychain_update);
|
||||||
|
changeset.append(indexed_tx_graph::ChangeSet {
|
||||||
|
indexer,
|
||||||
|
..Default::default()
|
||||||
|
});
|
||||||
|
changeset.append(graph.apply_update(graph_update));
|
||||||
|
changeset
|
||||||
|
};
|
||||||
|
|
||||||
|
(chain, indexed_tx_graph)
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
db.stage(db_changeset);
|
||||||
|
db.commit()?;
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
12
example-crates/example_esplora/Cargo.toml
Normal file
12
example-crates/example_esplora/Cargo.toml
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
[package]
|
||||||
|
name = "example_esplora"
|
||||||
|
version = "0.1.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||||
|
bdk_esplora = { path = "../../crates/esplora", features = ["blocking"] }
|
||||||
|
example_cli = { path = "../example_cli" }
|
||||||
|
|
||||||
345
example-crates/example_esplora/src/main.rs
Normal file
345
example-crates/example_esplora/src/main.rs
Normal file
@@ -0,0 +1,345 @@
|
|||||||
|
use std::{
|
||||||
|
collections::{BTreeMap, BTreeSet},
|
||||||
|
io::{self, Write},
|
||||||
|
sync::Mutex,
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{constants::genesis_block, Address, Network, OutPoint, ScriptBuf, Txid},
|
||||||
|
indexed_tx_graph::{self, IndexedTxGraph},
|
||||||
|
keychain,
|
||||||
|
local_chain::{self, LocalChain},
|
||||||
|
Append, ConfirmationTimeHeightAnchor,
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_esplora::{esplora_client, EsploraExt};
|
||||||
|
|
||||||
|
use example_cli::{
|
||||||
|
anyhow::{self, Context},
|
||||||
|
clap::{self, Parser, Subcommand},
|
||||||
|
Keychain,
|
||||||
|
};
|
||||||
|
|
||||||
|
const DB_MAGIC: &[u8] = b"bdk_example_esplora";
|
||||||
|
const DB_PATH: &str = ".bdk_esplora_example.db";
|
||||||
|
|
||||||
|
type ChangeSet = (
|
||||||
|
local_chain::ChangeSet,
|
||||||
|
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||||
|
);
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
enum EsploraCommands {
|
||||||
|
/// Scans the addresses in the wallet using the esplora API.
|
||||||
|
Scan {
|
||||||
|
/// When a gap this large has been found for a keychain, it will stop.
|
||||||
|
#[clap(long, default_value = "5")]
|
||||||
|
stop_gap: usize,
|
||||||
|
#[clap(flatten)]
|
||||||
|
scan_options: ScanOptions,
|
||||||
|
#[clap(flatten)]
|
||||||
|
esplora_args: EsploraArgs,
|
||||||
|
},
|
||||||
|
/// Scan for particular addresses and unconfirmed transactions using the esplora API.
|
||||||
|
Sync {
|
||||||
|
/// Scan all the unused addresses.
|
||||||
|
#[clap(long)]
|
||||||
|
unused_spks: bool,
|
||||||
|
/// Scan every address that you have derived.
|
||||||
|
#[clap(long)]
|
||||||
|
all_spks: bool,
|
||||||
|
/// Scan unspent outpoints for spends or changes to confirmation status of residing tx.
|
||||||
|
#[clap(long)]
|
||||||
|
utxos: bool,
|
||||||
|
/// Scan unconfirmed transactions for updates.
|
||||||
|
#[clap(long)]
|
||||||
|
unconfirmed: bool,
|
||||||
|
#[clap(flatten)]
|
||||||
|
scan_options: ScanOptions,
|
||||||
|
#[clap(flatten)]
|
||||||
|
esplora_args: EsploraArgs,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
impl EsploraCommands {
|
||||||
|
fn esplora_args(&self) -> EsploraArgs {
|
||||||
|
match self {
|
||||||
|
EsploraCommands::Scan { esplora_args, .. } => esplora_args.clone(),
|
||||||
|
EsploraCommands::Sync { esplora_args, .. } => esplora_args.clone(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(clap::Args, Debug, Clone)]
|
||||||
|
pub struct EsploraArgs {
|
||||||
|
/// The esplora url endpoint to connect to e.g. `<https://blockstream.info/api>`
|
||||||
|
/// If not provided it'll be set to a default for the network provided
|
||||||
|
esplora_url: Option<String>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl EsploraArgs {
|
||||||
|
pub fn client(&self, network: Network) -> anyhow::Result<esplora_client::BlockingClient> {
|
||||||
|
let esplora_url = self.esplora_url.as_deref().unwrap_or(match network {
|
||||||
|
Network::Bitcoin => "https://blockstream.info/api",
|
||||||
|
Network::Testnet => "https://blockstream.info/testnet/api",
|
||||||
|
Network::Regtest => "http://localhost:3002",
|
||||||
|
Network::Signet => "https://mempool.space/signet/api",
|
||||||
|
_ => panic!("unsupported network"),
|
||||||
|
});
|
||||||
|
|
||||||
|
let client = esplora_client::Builder::new(esplora_url).build_blocking()?;
|
||||||
|
Ok(client)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Parser, Debug, Clone, PartialEq)]
|
||||||
|
pub struct ScanOptions {
|
||||||
|
/// Max number of concurrent esplora server requests.
|
||||||
|
#[clap(long, default_value = "1")]
|
||||||
|
pub parallel_requests: usize,
|
||||||
|
}
|
||||||
|
|
||||||
|
fn main() -> anyhow::Result<()> {
|
||||||
|
let (args, keymap, index, db, init_changeset) =
|
||||||
|
example_cli::init::<EsploraCommands, EsploraArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||||
|
|
||||||
|
let genesis_hash = genesis_block(args.network).block_hash();
|
||||||
|
|
||||||
|
let (init_chain_changeset, init_indexed_tx_graph_changeset) = init_changeset;
|
||||||
|
|
||||||
|
// Construct `IndexedTxGraph` and `LocalChain` with our initial changeset. They are wrapped in
|
||||||
|
// `Mutex` to display how they can be used in a multithreaded context. Technically the mutexes
|
||||||
|
// aren't strictly needed here.
|
||||||
|
let graph = Mutex::new({
|
||||||
|
let mut graph = IndexedTxGraph::new(index);
|
||||||
|
graph.apply_changeset(init_indexed_tx_graph_changeset);
|
||||||
|
graph
|
||||||
|
});
|
||||||
|
let chain = Mutex::new({
|
||||||
|
let (mut chain, _) = LocalChain::from_genesis_hash(genesis_hash);
|
||||||
|
chain.apply_changeset(&init_chain_changeset)?;
|
||||||
|
chain
|
||||||
|
});
|
||||||
|
|
||||||
|
let esplora_cmd = match &args.command {
|
||||||
|
// These are commands that are handled by this example (sync, scan).
|
||||||
|
example_cli::Commands::ChainSpecific(esplora_cmd) => esplora_cmd,
|
||||||
|
// These are general commands handled by example_cli. Execute the cmd and return.
|
||||||
|
general_cmd => {
|
||||||
|
return example_cli::handle_commands(
|
||||||
|
&graph,
|
||||||
|
&db,
|
||||||
|
&chain,
|
||||||
|
&keymap,
|
||||||
|
args.network,
|
||||||
|
|esplora_args, tx| {
|
||||||
|
let client = esplora_args.client(args.network)?;
|
||||||
|
client
|
||||||
|
.broadcast(tx)
|
||||||
|
.map(|_| ())
|
||||||
|
.map_err(anyhow::Error::from)
|
||||||
|
},
|
||||||
|
general_cmd.clone(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let client = esplora_cmd.esplora_args().client(args.network)?;
|
||||||
|
// Prepare the `IndexedTxGraph` update based on whether we are scanning or syncing.
|
||||||
|
// Scanning: We are iterating through spks of all keychains and scanning for transactions for
|
||||||
|
// each spk. We start with the lowest derivation index spk and stop scanning after `stop_gap`
|
||||||
|
// number of consecutive spks have no transaction history. A Scan is done in situations of
|
||||||
|
// wallet restoration. It is a special case. Applications should use "sync" style updates
|
||||||
|
// after an initial scan.
|
||||||
|
// Syncing: We only check for specified spks, utxos and txids to update their confirmation
|
||||||
|
// status or fetch missing transactions.
|
||||||
|
let indexed_tx_graph_changeset = match &esplora_cmd {
|
||||||
|
EsploraCommands::Scan {
|
||||||
|
stop_gap,
|
||||||
|
scan_options,
|
||||||
|
..
|
||||||
|
} => {
|
||||||
|
let keychain_spks = graph
|
||||||
|
.lock()
|
||||||
|
.expect("mutex must not be poisoned")
|
||||||
|
.index
|
||||||
|
.all_unbounded_spk_iters()
|
||||||
|
.into_iter()
|
||||||
|
// This `map` is purely for logging.
|
||||||
|
.map(|(keychain, iter)| {
|
||||||
|
let mut first = true;
|
||||||
|
let spk_iter = iter.inspect(move |(i, _)| {
|
||||||
|
if first {
|
||||||
|
eprint!("\nscanning {}: ", keychain);
|
||||||
|
first = false;
|
||||||
|
}
|
||||||
|
eprint!("{} ", i);
|
||||||
|
// Flush early to ensure we print at every iteration.
|
||||||
|
let _ = io::stderr().flush();
|
||||||
|
});
|
||||||
|
(keychain, spk_iter)
|
||||||
|
})
|
||||||
|
.collect::<BTreeMap<_, _>>();
|
||||||
|
|
||||||
|
// The client scans keychain spks for transaction histories, stopping after `stop_gap`
|
||||||
|
// is reached. It returns a `TxGraph` update (`graph_update`) and a structure that
|
||||||
|
// represents the last active spk derivation indices of keychains
|
||||||
|
// (`keychain_indices_update`).
|
||||||
|
let (graph_update, last_active_indices) = client
|
||||||
|
.full_scan(keychain_spks, *stop_gap, scan_options.parallel_requests)
|
||||||
|
.context("scanning for transactions")?;
|
||||||
|
|
||||||
|
let mut graph = graph.lock().expect("mutex must not be poisoned");
|
||||||
|
// Because we did a stop gap based scan we are likely to have some updates to our
|
||||||
|
// deriviation indices. Usually before a scan you are on a fresh wallet with no
|
||||||
|
// addresses derived so we need to derive up to last active addresses the scan found
|
||||||
|
// before adding the transactions.
|
||||||
|
let (_, index_changeset) = graph.index.reveal_to_target_multi(&last_active_indices);
|
||||||
|
let mut indexed_tx_graph_changeset = graph.apply_update(graph_update);
|
||||||
|
indexed_tx_graph_changeset.append(index_changeset.into());
|
||||||
|
indexed_tx_graph_changeset
|
||||||
|
}
|
||||||
|
EsploraCommands::Sync {
|
||||||
|
mut unused_spks,
|
||||||
|
all_spks,
|
||||||
|
mut utxos,
|
||||||
|
mut unconfirmed,
|
||||||
|
scan_options,
|
||||||
|
..
|
||||||
|
} => {
|
||||||
|
if !(*all_spks || unused_spks || utxos || unconfirmed) {
|
||||||
|
// If nothing is specifically selected, we select everything (except all spks).
|
||||||
|
unused_spks = true;
|
||||||
|
unconfirmed = true;
|
||||||
|
utxos = true;
|
||||||
|
} else if *all_spks {
|
||||||
|
// If all spks is selected, we don't need to also select unused spks (as unused spks
|
||||||
|
// is a subset of all spks).
|
||||||
|
unused_spks = false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Spks, outpoints and txids we want updates on will be accumulated here.
|
||||||
|
let mut spks: Box<dyn Iterator<Item = ScriptBuf>> = Box::new(core::iter::empty());
|
||||||
|
let mut outpoints: Box<dyn Iterator<Item = OutPoint>> = Box::new(core::iter::empty());
|
||||||
|
let mut txids: Box<dyn Iterator<Item = Txid>> = Box::new(core::iter::empty());
|
||||||
|
|
||||||
|
// Get a short lock on the structures to get spks, utxos, and txs that we are interested
|
||||||
|
// in.
|
||||||
|
{
|
||||||
|
let graph = graph.lock().unwrap();
|
||||||
|
let chain = chain.lock().unwrap();
|
||||||
|
let chain_tip = chain.tip().block_id();
|
||||||
|
|
||||||
|
if *all_spks {
|
||||||
|
let all_spks = graph
|
||||||
|
.index
|
||||||
|
.revealed_spks()
|
||||||
|
.map(|(k, i, spk)| (k, i, spk.to_owned()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
spks = Box::new(spks.chain(all_spks.into_iter().map(|(k, i, spk)| {
|
||||||
|
eprintln!("scanning {}:{}", k, i);
|
||||||
|
// Flush early to ensure we print at every iteration.
|
||||||
|
let _ = io::stderr().flush();
|
||||||
|
spk
|
||||||
|
})));
|
||||||
|
}
|
||||||
|
if unused_spks {
|
||||||
|
let unused_spks = graph
|
||||||
|
.index
|
||||||
|
.unused_spks()
|
||||||
|
.map(|(k, i, spk)| (k, i, spk.to_owned()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
spks = Box::new(spks.chain(unused_spks.into_iter().map(|(k, i, spk)| {
|
||||||
|
eprintln!(
|
||||||
|
"Checking if address {} {}:{} has been used",
|
||||||
|
Address::from_script(&spk, args.network).unwrap(),
|
||||||
|
k,
|
||||||
|
i,
|
||||||
|
);
|
||||||
|
// Flush early to ensure we print at every iteration.
|
||||||
|
let _ = io::stderr().flush();
|
||||||
|
spk
|
||||||
|
})));
|
||||||
|
}
|
||||||
|
if utxos {
|
||||||
|
// We want to search for whether the UTXO is spent, and spent by which
|
||||||
|
// transaction. We provide the outpoint of the UTXO to
|
||||||
|
// `EsploraExt::update_tx_graph_without_keychain`.
|
||||||
|
let init_outpoints = graph.index.outpoints().iter().cloned();
|
||||||
|
let utxos = graph
|
||||||
|
.graph()
|
||||||
|
.filter_chain_unspents(&*chain, chain_tip, init_outpoints)
|
||||||
|
.map(|(_, utxo)| utxo)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
outpoints = Box::new(
|
||||||
|
utxos
|
||||||
|
.into_iter()
|
||||||
|
.inspect(|utxo| {
|
||||||
|
eprintln!(
|
||||||
|
"Checking if outpoint {} (value: {}) has been spent",
|
||||||
|
utxo.outpoint, utxo.txout.value
|
||||||
|
);
|
||||||
|
// Flush early to ensure we print at every iteration.
|
||||||
|
let _ = io::stderr().flush();
|
||||||
|
})
|
||||||
|
.map(|utxo| utxo.outpoint),
|
||||||
|
);
|
||||||
|
};
|
||||||
|
if unconfirmed {
|
||||||
|
// We want to search for whether the unconfirmed transaction is now confirmed.
|
||||||
|
// We provide the unconfirmed txids to
|
||||||
|
// `EsploraExt::update_tx_graph_without_keychain`.
|
||||||
|
let unconfirmed_txids = graph
|
||||||
|
.graph()
|
||||||
|
.list_chain_txs(&*chain, chain_tip)
|
||||||
|
.filter(|canonical_tx| !canonical_tx.chain_position.is_confirmed())
|
||||||
|
.map(|canonical_tx| canonical_tx.tx_node.txid)
|
||||||
|
.collect::<Vec<Txid>>();
|
||||||
|
txids = Box::new(unconfirmed_txids.into_iter().inspect(|txid| {
|
||||||
|
eprintln!("Checking if {} is confirmed yet", txid);
|
||||||
|
// Flush early to ensure we print at every iteration.
|
||||||
|
let _ = io::stderr().flush();
|
||||||
|
}));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph_update =
|
||||||
|
client.sync(spks, txids, outpoints, scan_options.parallel_requests)?;
|
||||||
|
|
||||||
|
graph.lock().unwrap().apply_update(graph_update)
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
println!();
|
||||||
|
|
||||||
|
// Now that we're done updating the `IndexedTxGraph`, it's time to update the `LocalChain`! We
|
||||||
|
// want the `LocalChain` to have data about all the anchors in the `TxGraph` - for this reason,
|
||||||
|
// we want retrieve the blocks at the heights of the newly added anchors that are missing from
|
||||||
|
// our view of the chain.
|
||||||
|
let (missing_block_heights, tip) = {
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
let missing_block_heights = indexed_tx_graph_changeset
|
||||||
|
.graph
|
||||||
|
.missing_heights_from(chain)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let tip = chain.tip();
|
||||||
|
(missing_block_heights, tip)
|
||||||
|
};
|
||||||
|
|
||||||
|
println!("prev tip: {}", tip.height());
|
||||||
|
println!("missing block heights: {:?}", missing_block_heights);
|
||||||
|
|
||||||
|
// Here, we actually fetch the missing blocks and create a `local_chain::Update`.
|
||||||
|
let chain_changeset = {
|
||||||
|
let chain_update = client
|
||||||
|
.update_local_chain(tip, missing_block_heights)
|
||||||
|
.context("scanning for blocks")?;
|
||||||
|
println!("new tip: {}", chain_update.tip.height());
|
||||||
|
chain.lock().unwrap().apply_update(chain_update)?
|
||||||
|
};
|
||||||
|
|
||||||
|
// We persist the changes
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
db.stage((chain_changeset, indexed_tx_graph_changeset));
|
||||||
|
db.commit()?;
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
10
example-crates/wallet_electrum/Cargo.toml
Normal file
10
example-crates/wallet_electrum/Cargo.toml
Normal file
@@ -0,0 +1,10 @@
|
|||||||
|
[package]
|
||||||
|
name = "wallet_electrum_example"
|
||||||
|
version = "0.2.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk = { path = "../../crates/bdk" }
|
||||||
|
bdk_electrum = { path = "../../crates/electrum" }
|
||||||
|
bdk_file_store = { path = "../../crates/file_store" }
|
||||||
|
anyhow = "1"
|
||||||
107
example-crates/wallet_electrum/src/main.rs
Normal file
107
example-crates/wallet_electrum/src/main.rs
Normal file
@@ -0,0 +1,107 @@
|
|||||||
|
const DB_MAGIC: &str = "bdk_wallet_electrum_example";
|
||||||
|
const SEND_AMOUNT: u64 = 5000;
|
||||||
|
const STOP_GAP: usize = 50;
|
||||||
|
const BATCH_SIZE: usize = 5;
|
||||||
|
|
||||||
|
use std::io::Write;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
|
use bdk::bitcoin::Address;
|
||||||
|
use bdk::wallet::Update;
|
||||||
|
use bdk::SignOptions;
|
||||||
|
use bdk::{bitcoin::Network, Wallet};
|
||||||
|
use bdk_electrum::{
|
||||||
|
electrum_client::{self, ElectrumApi},
|
||||||
|
ElectrumExt, ElectrumUpdate,
|
||||||
|
};
|
||||||
|
use bdk_file_store::Store;
|
||||||
|
|
||||||
|
fn main() -> Result<(), anyhow::Error> {
|
||||||
|
let db_path = std::env::temp_dir().join("bdk-electrum-example");
|
||||||
|
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||||
|
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||||
|
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||||
|
|
||||||
|
let mut wallet = Wallet::new_or_load(
|
||||||
|
external_descriptor,
|
||||||
|
Some(internal_descriptor),
|
||||||
|
db,
|
||||||
|
Network::Testnet,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let address = wallet.try_get_address(bdk::wallet::AddressIndex::New)?;
|
||||||
|
println!("Generated Address: {}", address);
|
||||||
|
|
||||||
|
let balance = wallet.get_balance();
|
||||||
|
println!("Wallet balance before syncing: {} sats", balance.total());
|
||||||
|
|
||||||
|
print!("Syncing...");
|
||||||
|
let client = electrum_client::Client::new("ssl://electrum.blockstream.info:60002")?;
|
||||||
|
|
||||||
|
let prev_tip = wallet.latest_checkpoint();
|
||||||
|
let keychain_spks = wallet
|
||||||
|
.all_unbounded_spk_iters()
|
||||||
|
.into_iter()
|
||||||
|
.map(|(k, k_spks)| {
|
||||||
|
let mut once = Some(());
|
||||||
|
let mut stdout = std::io::stdout();
|
||||||
|
let k_spks = k_spks
|
||||||
|
.inspect(move |(spk_i, _)| match once.take() {
|
||||||
|
Some(_) => print!("\nScanning keychain [{:?}]", k),
|
||||||
|
None => print!(" {:<3}", spk_i),
|
||||||
|
})
|
||||||
|
.inspect(move |_| stdout.flush().expect("must flush"));
|
||||||
|
(k, k_spks)
|
||||||
|
})
|
||||||
|
.collect();
|
||||||
|
|
||||||
|
let (
|
||||||
|
ElectrumUpdate {
|
||||||
|
chain_update,
|
||||||
|
relevant_txids,
|
||||||
|
},
|
||||||
|
keychain_update,
|
||||||
|
) = client.full_scan(prev_tip, keychain_spks, STOP_GAP, BATCH_SIZE)?;
|
||||||
|
|
||||||
|
println!();
|
||||||
|
|
||||||
|
let missing = relevant_txids.missing_full_txs(wallet.as_ref());
|
||||||
|
let graph_update = relevant_txids.into_confirmation_time_tx_graph(&client, None, missing)?;
|
||||||
|
|
||||||
|
let wallet_update = Update {
|
||||||
|
last_active_indices: keychain_update,
|
||||||
|
graph: graph_update,
|
||||||
|
chain: Some(chain_update),
|
||||||
|
};
|
||||||
|
wallet.apply_update(wallet_update)?;
|
||||||
|
wallet.commit()?;
|
||||||
|
|
||||||
|
let balance = wallet.get_balance();
|
||||||
|
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||||
|
|
||||||
|
if balance.total() < SEND_AMOUNT {
|
||||||
|
println!(
|
||||||
|
"Please send at least {} sats to the receiving address",
|
||||||
|
SEND_AMOUNT
|
||||||
|
);
|
||||||
|
std::process::exit(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
|
|
||||||
|
let mut tx_builder = wallet.build_tx();
|
||||||
|
tx_builder
|
||||||
|
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||||
|
.enable_rbf();
|
||||||
|
|
||||||
|
let mut psbt = tx_builder.finish()?;
|
||||||
|
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let tx = psbt.extract_tx();
|
||||||
|
client.transaction_broadcast(&tx)?;
|
||||||
|
println!("Tx broadcasted! Txid: {}", tx.txid());
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
13
example-crates/wallet_esplora_async/Cargo.toml
Normal file
13
example-crates/wallet_esplora_async/Cargo.toml
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
[package]
|
||||||
|
name = "wallet_esplora_async"
|
||||||
|
version = "0.2.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk = { path = "../../crates/bdk" }
|
||||||
|
bdk_esplora = { path = "../../crates/esplora", features = ["async-https"] }
|
||||||
|
bdk_file_store = { path = "../../crates/file_store" }
|
||||||
|
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||||
|
anyhow = "1"
|
||||||
98
example-crates/wallet_esplora_async/src/main.rs
Normal file
98
example-crates/wallet_esplora_async/src/main.rs
Normal file
@@ -0,0 +1,98 @@
|
|||||||
|
use std::{io::Write, str::FromStr};
|
||||||
|
|
||||||
|
use bdk::{
|
||||||
|
bitcoin::{Address, Network},
|
||||||
|
wallet::{AddressIndex, Update},
|
||||||
|
SignOptions, Wallet,
|
||||||
|
};
|
||||||
|
use bdk_esplora::{esplora_client, EsploraAsyncExt};
|
||||||
|
use bdk_file_store::Store;
|
||||||
|
|
||||||
|
const DB_MAGIC: &str = "bdk_wallet_esplora_async_example";
|
||||||
|
const SEND_AMOUNT: u64 = 5000;
|
||||||
|
const STOP_GAP: usize = 50;
|
||||||
|
const PARALLEL_REQUESTS: usize = 5;
|
||||||
|
|
||||||
|
#[tokio::main]
|
||||||
|
async fn main() -> Result<(), anyhow::Error> {
|
||||||
|
let db_path = std::env::temp_dir().join("bdk-esplora-async-example");
|
||||||
|
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||||
|
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||||
|
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||||
|
|
||||||
|
let mut wallet = Wallet::new_or_load(
|
||||||
|
external_descriptor,
|
||||||
|
Some(internal_descriptor),
|
||||||
|
db,
|
||||||
|
Network::Testnet,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let address = wallet.try_get_address(AddressIndex::New)?;
|
||||||
|
println!("Generated Address: {}", address);
|
||||||
|
|
||||||
|
let balance = wallet.get_balance();
|
||||||
|
println!("Wallet balance before syncing: {} sats", balance.total());
|
||||||
|
|
||||||
|
print!("Syncing...");
|
||||||
|
let client =
|
||||||
|
esplora_client::Builder::new("https://blockstream.info/testnet/api").build_async()?;
|
||||||
|
|
||||||
|
let prev_tip = wallet.latest_checkpoint();
|
||||||
|
let keychain_spks = wallet
|
||||||
|
.all_unbounded_spk_iters()
|
||||||
|
.into_iter()
|
||||||
|
.map(|(k, k_spks)| {
|
||||||
|
let mut once = Some(());
|
||||||
|
let mut stdout = std::io::stdout();
|
||||||
|
let k_spks = k_spks
|
||||||
|
.inspect(move |(spk_i, _)| match once.take() {
|
||||||
|
Some(_) => print!("\nScanning keychain [{:?}]", k),
|
||||||
|
None => print!(" {:<3}", spk_i),
|
||||||
|
})
|
||||||
|
.inspect(move |_| stdout.flush().expect("must flush"));
|
||||||
|
(k, k_spks)
|
||||||
|
})
|
||||||
|
.collect();
|
||||||
|
let (update_graph, last_active_indices) = client
|
||||||
|
.full_scan(keychain_spks, STOP_GAP, PARALLEL_REQUESTS)
|
||||||
|
.await?;
|
||||||
|
let missing_heights = update_graph.missing_heights(wallet.local_chain());
|
||||||
|
let chain_update = client.update_local_chain(prev_tip, missing_heights).await?;
|
||||||
|
let update = Update {
|
||||||
|
last_active_indices,
|
||||||
|
graph: update_graph,
|
||||||
|
chain: Some(chain_update),
|
||||||
|
};
|
||||||
|
wallet.apply_update(update)?;
|
||||||
|
wallet.commit()?;
|
||||||
|
println!();
|
||||||
|
|
||||||
|
let balance = wallet.get_balance();
|
||||||
|
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||||
|
|
||||||
|
if balance.total() < SEND_AMOUNT {
|
||||||
|
println!(
|
||||||
|
"Please send at least {} sats to the receiving address",
|
||||||
|
SEND_AMOUNT
|
||||||
|
);
|
||||||
|
std::process::exit(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
|
|
||||||
|
let mut tx_builder = wallet.build_tx();
|
||||||
|
tx_builder
|
||||||
|
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||||
|
.enable_rbf();
|
||||||
|
|
||||||
|
let mut psbt = tx_builder.finish()?;
|
||||||
|
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let tx = psbt.extract_tx();
|
||||||
|
client.broadcast(&tx).await?;
|
||||||
|
println!("Tx broadcasted! Txid: {}", tx.txid());
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
13
example-crates/wallet_esplora_blocking/Cargo.toml
Normal file
13
example-crates/wallet_esplora_blocking/Cargo.toml
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
[package]
|
||||||
|
name = "wallet_esplora_blocking"
|
||||||
|
version = "0.2.0"
|
||||||
|
edition = "2021"
|
||||||
|
publish = false
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk = { path = "../../crates/bdk" }
|
||||||
|
bdk_esplora = { path = "../../crates/esplora", features = ["blocking"] }
|
||||||
|
bdk_file_store = { path = "../../crates/file_store" }
|
||||||
|
anyhow = "1"
|
||||||
98
example-crates/wallet_esplora_blocking/src/main.rs
Normal file
98
example-crates/wallet_esplora_blocking/src/main.rs
Normal file
@@ -0,0 +1,98 @@
|
|||||||
|
const DB_MAGIC: &str = "bdk_wallet_esplora_example";
|
||||||
|
const SEND_AMOUNT: u64 = 1000;
|
||||||
|
const STOP_GAP: usize = 5;
|
||||||
|
const PARALLEL_REQUESTS: usize = 1;
|
||||||
|
|
||||||
|
use std::{io::Write, str::FromStr};
|
||||||
|
|
||||||
|
use bdk::{
|
||||||
|
bitcoin::{Address, Network},
|
||||||
|
wallet::{AddressIndex, Update},
|
||||||
|
SignOptions, Wallet,
|
||||||
|
};
|
||||||
|
use bdk_esplora::{esplora_client, EsploraExt};
|
||||||
|
use bdk_file_store::Store;
|
||||||
|
|
||||||
|
fn main() -> Result<(), anyhow::Error> {
|
||||||
|
let db_path = std::env::temp_dir().join("bdk-esplora-example");
|
||||||
|
let db = Store::<bdk::wallet::ChangeSet>::open_or_create_new(DB_MAGIC.as_bytes(), db_path)?;
|
||||||
|
let external_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/0/*)";
|
||||||
|
let internal_descriptor = "wpkh(tprv8ZgxMBicQKsPdy6LMhUtFHAgpocR8GC6QmwMSFpZs7h6Eziw3SpThFfczTDh5rW2krkqffa11UpX3XkeTTB2FvzZKWXqPY54Y6Rq4AQ5R8L/84'/1'/0'/1/*)";
|
||||||
|
|
||||||
|
let mut wallet = Wallet::new_or_load(
|
||||||
|
external_descriptor,
|
||||||
|
Some(internal_descriptor),
|
||||||
|
db,
|
||||||
|
Network::Testnet,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let address = wallet.try_get_address(AddressIndex::New)?;
|
||||||
|
println!("Generated Address: {}", address);
|
||||||
|
|
||||||
|
let balance = wallet.get_balance();
|
||||||
|
println!("Wallet balance before syncing: {} sats", balance.total());
|
||||||
|
|
||||||
|
print!("Syncing...");
|
||||||
|
let client =
|
||||||
|
esplora_client::Builder::new("https://blockstream.info/testnet/api").build_blocking()?;
|
||||||
|
|
||||||
|
let prev_tip = wallet.latest_checkpoint();
|
||||||
|
let keychain_spks = wallet
|
||||||
|
.all_unbounded_spk_iters()
|
||||||
|
.into_iter()
|
||||||
|
.map(|(k, k_spks)| {
|
||||||
|
let mut once = Some(());
|
||||||
|
let mut stdout = std::io::stdout();
|
||||||
|
let k_spks = k_spks
|
||||||
|
.inspect(move |(spk_i, _)| match once.take() {
|
||||||
|
Some(_) => print!("\nScanning keychain [{:?}]", k),
|
||||||
|
None => print!(" {:<3}", spk_i),
|
||||||
|
})
|
||||||
|
.inspect(move |_| stdout.flush().expect("must flush"));
|
||||||
|
(k, k_spks)
|
||||||
|
})
|
||||||
|
.collect();
|
||||||
|
|
||||||
|
let (update_graph, last_active_indices) =
|
||||||
|
client.full_scan(keychain_spks, STOP_GAP, PARALLEL_REQUESTS)?;
|
||||||
|
let missing_heights = update_graph.missing_heights(wallet.local_chain());
|
||||||
|
let chain_update = client.update_local_chain(prev_tip, missing_heights)?;
|
||||||
|
let update = Update {
|
||||||
|
last_active_indices,
|
||||||
|
graph: update_graph,
|
||||||
|
chain: Some(chain_update),
|
||||||
|
};
|
||||||
|
|
||||||
|
wallet.apply_update(update)?;
|
||||||
|
wallet.commit()?;
|
||||||
|
println!();
|
||||||
|
|
||||||
|
let balance = wallet.get_balance();
|
||||||
|
println!("Wallet balance after syncing: {} sats", balance.total());
|
||||||
|
|
||||||
|
if balance.total() < SEND_AMOUNT {
|
||||||
|
println!(
|
||||||
|
"Please send at least {} sats to the receiving address",
|
||||||
|
SEND_AMOUNT
|
||||||
|
);
|
||||||
|
std::process::exit(0);
|
||||||
|
}
|
||||||
|
|
||||||
|
let faucet_address = Address::from_str("mkHS9ne12qx9pS9VojpwU5xtRd4T7X7ZUt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
|
|
||||||
|
let mut tx_builder = wallet.build_tx();
|
||||||
|
tx_builder
|
||||||
|
.add_recipient(faucet_address.script_pubkey(), SEND_AMOUNT)
|
||||||
|
.enable_rbf();
|
||||||
|
|
||||||
|
let mut psbt = tx_builder.finish()?;
|
||||||
|
let finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||||
|
assert!(finalized);
|
||||||
|
|
||||||
|
let tx = psbt.extract_tx();
|
||||||
|
client.broadcast(&tx)?;
|
||||||
|
println!("Tx broadcasted! Txid: {}", tx.txid());
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user