Compare commits
443 Commits
release/1.
...
dependabot
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
ad9dbc795d | ||
|
|
c01983d02a | ||
|
|
fef70d5e8f | ||
|
|
c3544c9b8c | ||
|
|
b290b29502 | ||
|
|
d77a7f2ff1 | ||
|
|
3d44ffaef2 | ||
|
|
2efa299d04 | ||
|
|
2647aff4bc | ||
|
|
c151d8fd23 | ||
|
|
2c324d3759 | ||
|
|
50c549b5ac | ||
|
|
8379839010 | ||
|
|
5489f905a4 | ||
|
|
420e929463 | ||
|
|
13ab5a835d | ||
|
|
728e26f223 | ||
|
|
dbbd514242 | ||
|
|
ae00e1ee7b | ||
|
|
adc95137ac | ||
|
|
022d5a21cf | ||
|
|
7aca88474a | ||
|
|
b3278a4c29 | ||
|
|
552f11cb5f | ||
|
|
d8f74dc5e4 | ||
|
|
8d93fad778 | ||
|
|
9bb39a3a3f | ||
|
|
9e098a5b6d | ||
|
|
c6b9ed3b76 | ||
|
|
1c15cb2f91 | ||
|
|
89a7ddca7f | ||
|
|
097d818d4c | ||
|
|
f11d663b7e | ||
|
|
4679ca1df7 | ||
|
|
64a90192d9 | ||
|
|
ba7624781d | ||
|
|
d597f4c761 | ||
|
|
f099b42005 | ||
|
|
ce8c617c9d | ||
|
|
8ad52f720f | ||
|
|
c5afbaa95d | ||
|
|
929b5ddb0c | ||
|
|
070fffb95c | ||
|
|
216648bcfd | ||
|
|
5299db34cb | ||
|
|
8375bb8d39 | ||
|
|
63fa710319 | ||
|
|
d4276a1c32 | ||
|
|
6a03e0f209 | ||
|
|
38b728ae52 | ||
|
|
d162208d95 | ||
|
|
e687c27096 | ||
|
|
5611c9e42a | ||
|
|
07116df541 | ||
|
|
48b28e3abc | ||
|
|
51bd01b3dd | ||
|
|
285ff46a49 | ||
|
|
8305e64849 | ||
|
|
66dc34e75a | ||
|
|
fbd1d65618 | ||
|
|
c4d5f2ccd8 | ||
|
|
52c77b8451 | ||
|
|
99661be5f3 | ||
|
|
914db84824 | ||
|
|
f8f371c8d8 | ||
|
|
232a172c32 | ||
|
|
8d916d7a10 | ||
|
|
3fa44a58ec | ||
|
|
6f824cf325 | ||
|
|
f05e8502e6 | ||
|
|
25653d71b8 | ||
|
|
e6433fb2c1 | ||
|
|
0bee46e75b | ||
|
|
08b745ec9f | ||
|
|
0a2a57060b | ||
|
|
d33acc1466 | ||
|
|
d1ea0ef3d1 | ||
|
|
60abd87a32 | ||
|
|
71fff1613d | ||
|
|
b6a58d4f9b | ||
|
|
cf0c333744 | ||
|
|
7c0f4653b2 | ||
|
|
3829fc18c7 | ||
|
|
d494f63d08 | ||
|
|
83e7b7ec40 | ||
|
|
9294e30943 | ||
|
|
b74c2e2622 | ||
|
|
81aeaba48a | ||
|
|
c7b47af72f | ||
|
|
d9501187ef | ||
|
|
a4f28c079e | ||
|
|
8ec65f0b8e | ||
|
|
a7d01dc39a | ||
|
|
e0512acf94 | ||
|
|
8f2d4d9d40 | ||
|
|
9467cad55d | ||
|
|
d3e5095df1 | ||
|
|
2b61a122ff | ||
|
|
40f0765d30 | ||
|
|
bf67519768 | ||
|
|
b6422f7ffc | ||
|
|
eb1714aee0 | ||
|
|
705690ee8f | ||
|
|
c871764670 | ||
|
|
a3aa8b6682 | ||
|
|
cd602430ee | ||
|
|
264bb85efc | ||
|
|
761189ab2b | ||
|
|
5b77942993 | ||
|
|
f9dad51ae1 | ||
|
|
8f6dad76ef | ||
|
|
887e112e8f | ||
|
|
21d8875826 | ||
|
|
6e6bad9223 | ||
|
|
105d70e974 | ||
|
|
9efaead8f1 | ||
|
|
1ff9d5ce8f | ||
|
|
8694624bd5 | ||
|
|
003271117c | ||
|
|
f6418ba911 | ||
|
|
028caa9f8c | ||
|
|
d71829914a | ||
|
|
a1d34afa24 | ||
|
|
9cc03324f4 | ||
|
|
de54e710ed | ||
|
|
95d34854f4 | ||
|
|
ed91a4bdb4 | ||
|
|
179cfeff51 | ||
|
|
7eff024213 | ||
|
|
1def76f1f1 | ||
|
|
c9467dcbb2 | ||
|
|
bc796f412a | ||
|
|
4fd539b647 | ||
|
|
01698ae5ec | ||
|
|
f4863c6314 | ||
|
|
b5612f269a | ||
|
|
e7fbc8bcf3 | ||
|
|
2251b8d416 | ||
|
|
b13505c1c3 | ||
|
|
0adff9c35f | ||
|
|
908b0f9f5e | ||
|
|
169385bb5b | ||
|
|
f741122ffb | ||
|
|
959b4f8172 | ||
|
|
55b680c194 | ||
|
|
43aed386bc | ||
|
|
cb713e5b8c | ||
|
|
2c4e90a76f | ||
|
|
18bd329617 | ||
|
|
9e681b39fb | ||
|
|
6817ca9bcb | ||
|
|
73862be3ba | ||
|
|
02fa340896 | ||
|
|
4ee41dbc40 | ||
|
|
278210bb89 | ||
|
|
6fb45d8a73 | ||
|
|
e803ee9010 | ||
|
|
82632897aa | ||
|
|
46d39beb2c | ||
|
|
00ec19ef2d | ||
|
|
77f9977c02 | ||
|
|
9e7d99e3bf | ||
|
|
cc552c5f91 | ||
|
|
27a63abd1e | ||
|
|
bc8d6a396b | ||
|
|
f1b112e8f9 | ||
|
|
9a250baf62 | ||
|
|
79b84bed0e | ||
|
|
06a956ad20 | ||
|
|
c3265e2514 | ||
|
|
96f1d94e2c | ||
|
|
1886dc4fe7 | ||
|
|
24994a3ed4 | ||
|
|
d294e2e318 | ||
|
|
7c6cbc4d9f | ||
|
|
6cf3963c6c | ||
|
|
7d5f31f6cc | ||
|
|
5998a22819 | ||
|
|
d6a0cf0795 | ||
|
|
6e27e66738 | ||
|
|
f382fa9230 | ||
|
|
e71770f93e | ||
|
|
298f6cb1e8 | ||
|
|
3fdab87ee7 | ||
|
|
855c61a6ab | ||
|
|
0112c67b60 | ||
|
|
1010efd8d6 | ||
|
|
991cb77b6f | ||
|
|
e553231eae | ||
|
|
0a7b60f0f7 | ||
|
|
0ecc0280c0 | ||
|
|
afbf83c8b0 | ||
|
|
2f2f138595 | ||
|
|
95250fc44e | ||
|
|
f17df1e133 | ||
|
|
3569acca0b | ||
|
|
2e4bc3c5e2 | ||
|
|
6ebdd195e2 | ||
|
|
d5c87c49a8 | ||
|
|
009408d243 | ||
|
|
38d69c947c | ||
|
|
67eec36db4 | ||
|
|
85c62532a5 | ||
|
|
b69c13ddf6 | ||
|
|
5f34df8489 | ||
|
|
57590e0a1f | ||
|
|
6d4b33ef91 | ||
|
|
4f5695d43a | ||
|
|
150d6f8ab6 | ||
|
|
4f10463d9e | ||
|
|
a73dac2d91 | ||
|
|
bb7424d11d | ||
|
|
240657b167 | ||
|
|
43bc813c64 | ||
|
|
b3db5ca9df | ||
|
|
f795a43cc7 | ||
|
|
b1461f05d0 | ||
|
|
77cde96229 | ||
|
|
1db3f87a48 | ||
|
|
4a65a12c4f | ||
|
|
4ee11aae12 | ||
|
|
a7dbc22df1 | ||
|
|
6d601a7e88 | ||
|
|
48ca95b541 | ||
|
|
59a2403e28 | ||
|
|
6e511473a5 | ||
|
|
62de55f12d | ||
|
|
5e79b81a6a | ||
|
|
a3e8480ad9 | ||
|
|
4742d88ea3 | ||
|
|
2f26eca607 | ||
|
|
486e0e1437 | ||
|
|
9bd528607a | ||
|
|
f28e665c7d | ||
|
|
417963f168 | ||
|
|
edfd4c236d | ||
|
|
fe654310d7 | ||
|
|
37d5e5319f | ||
|
|
ea6411c685 | ||
|
|
4a1b96dcc4 | ||
|
|
bf9a425849 | ||
|
|
d35668e76a | ||
|
|
31d52e12c9 | ||
|
|
6a5c9d7a00 | ||
|
|
4d1a9fd47a | ||
|
|
f95506ba6a | ||
|
|
e6519e3a52 | ||
|
|
43fb0b20df | ||
|
|
94f8fa530b | ||
|
|
c20a4da9fc | ||
|
|
1ff806c67f | ||
|
|
d43ae0231f | ||
|
|
59fc1b341b | ||
|
|
20900218ce | ||
|
|
e89cf5a16a | ||
|
|
4104206980 | ||
|
|
c56728ff13 | ||
|
|
32c40ac939 | ||
|
|
a28748c339 | ||
|
|
f42f8b8ff1 | ||
|
|
68572bfd2e | ||
|
|
2392e50fd9 | ||
|
|
7c12dc9942 | ||
|
|
6bcbb93233 | ||
|
|
2867e88b64 | ||
|
|
e48b911c8d | ||
|
|
a7a1d9b2fb | ||
|
|
8321aaa5c7 | ||
|
|
cc1a43c495 | ||
|
|
f41cc1cb37 | ||
|
|
da8cfd39e9 | ||
|
|
93e8eaf7ee | ||
|
|
5fb5061645 | ||
|
|
dd5b8d7599 | ||
|
|
465d53cc88 | ||
|
|
036299803f | ||
|
|
d443fe7f66 | ||
|
|
b4c31cd5ba | ||
|
|
e5fb1ec7ff | ||
|
|
18e8da3937 | ||
|
|
8f978f86b8 | ||
|
|
21206fe773 | ||
|
|
381c560c10 | ||
|
|
c753584379 | ||
|
|
6125062a5b | ||
|
|
2263a58448 | ||
|
|
11ac26f6b2 | ||
|
|
fb5cfa3c25 | ||
|
|
fa0bead024 | ||
|
|
8c4eeb56c0 | ||
|
|
3b5b829086 | ||
|
|
4f37b2a293 | ||
|
|
2d543475e2 | ||
|
|
d6bcd9b725 | ||
|
|
62f253103c | ||
|
|
80f5ecf3be | ||
|
|
ea50b6a932 | ||
|
|
480c2730de | ||
|
|
0cd2348166 | ||
|
|
b0b91b7418 | ||
|
|
feafaaca31 | ||
|
|
1da3b304bb | ||
|
|
792b39fa92 | ||
|
|
b73385dbd2 | ||
|
|
3dac3f9bba | ||
|
|
2949bdc7b8 | ||
|
|
468d2a0a3b | ||
|
|
b8ac16d03c | ||
|
|
6c29e53ee8 | ||
|
|
6eb079576f | ||
|
|
91b0f0ba29 | ||
|
|
f4e3ba3265 | ||
|
|
853d361751 | ||
|
|
d73669e8fa | ||
|
|
933056706c | ||
|
|
b206a985cf | ||
|
|
bea8e5aff4 | ||
|
|
db15e03bdc | ||
|
|
95312d4d05 | ||
|
|
8bf7a997f7 | ||
|
|
315e7e0b4b | ||
|
|
af705da1a8 | ||
|
|
eabeb6ccb1 | ||
|
|
8f38e96e45 | ||
|
|
ffb7c795e1 | ||
|
|
56b8eea643 | ||
|
|
cb626e9fc8 | ||
|
|
e17f03e755 | ||
|
|
f5074ee3ae | ||
|
|
f4d2a76661 | ||
|
|
81c7613391 | ||
|
|
26ade11726 | ||
|
|
5d1f922b3b | ||
|
|
7ab84be9c7 | ||
|
|
b184e351e5 | ||
|
|
352f5b29ab | ||
|
|
fa54a2e3a5 | ||
|
|
97d542cf1c | ||
|
|
75f8b81d58 | ||
|
|
cff92111d5 | ||
|
|
a7668a2f3e | ||
|
|
ac80829caa | ||
|
|
1c3cbefa4d | ||
|
|
5860704b2d | ||
|
|
2952341e52 | ||
|
|
78a7920ba3 | ||
|
|
92709d03ce | ||
|
|
50425e979b | ||
|
|
a78967e51b | ||
|
|
6a1ac7f80a | ||
|
|
f55974a64b | ||
|
|
2e3cee4bd0 | ||
|
|
7261669c09 | ||
|
|
aba88130d9 | ||
|
|
e69fccb15f | ||
|
|
8641847e6c | ||
|
|
22b8a48842 | ||
|
|
9bc7fe855d | ||
|
|
10b4b6c665 | ||
|
|
796f433f6c | ||
|
|
ac3759254a | ||
|
|
e30919ba3a | ||
|
|
1d55943fa1 | ||
|
|
df74b23f31 | ||
|
|
725eee8c92 | ||
|
|
c7a045fa54 | ||
|
|
34d60870ac | ||
|
|
ed89de752c | ||
|
|
fb75aa94a9 | ||
|
|
96b1075132 | ||
|
|
e01d17d59b | ||
|
|
05d353c0ad | ||
|
|
4963240599 | ||
|
|
2aa08a5898 | ||
|
|
e3c137043f | ||
|
|
065c64a675 | ||
|
|
a56d289eef | ||
|
|
2ccc116eda | ||
|
|
4ae727a1fb | ||
|
|
085bf9413d | ||
|
|
e413d3e424 | ||
|
|
c61995ca97 | ||
|
|
10fe32e6f1 | ||
|
|
6bc5f33ded | ||
|
|
702fe7ac5e | ||
|
|
ce5ae3eac4 | ||
|
|
c1cffe9333 | ||
|
|
5be7c1c50d | ||
|
|
29055658a6 | ||
|
|
139e3d3802 | ||
|
|
b799a5728b | ||
|
|
8cd0328eec | ||
|
|
911af34f50 | ||
|
|
e536307e5c | ||
|
|
217ea3321a | ||
|
|
f101dde09b | ||
|
|
1b152647c5 | ||
|
|
ecc74ce4cd | ||
|
|
ac336aa32f | ||
|
|
165b874dfe | ||
|
|
f3e7b67bf1 | ||
|
|
03c128311a | ||
|
|
34a7bf5afe | ||
|
|
6c49570742 | ||
|
|
1003fe2ee6 | ||
|
|
7175a82c04 | ||
|
|
8e36a2e5f6 | ||
|
|
81436fcd72 | ||
|
|
5e026cfd03 | ||
|
|
001efdd1cb | ||
|
|
10ab77c549 | ||
|
|
7d92337b93 | ||
|
|
a7fbe0ac67 | ||
|
|
ee1060f2ff | ||
|
|
611d2e3ea2 | ||
|
|
bff80ec378 | ||
|
|
24cd8c5cc7 | ||
|
|
ddd5e951f5 | ||
|
|
da4cef044d | ||
|
|
89cfa4d78e | ||
|
|
6e59dce10b | ||
|
|
ebd6103e65 | ||
|
|
a7eaebbb77 | ||
|
|
c09cd2afce | ||
|
|
7810059ed0 | ||
|
|
a63ffe9739 | ||
|
|
a1172def7d | ||
|
|
8c906170c9 | ||
|
|
468701a129 | ||
|
|
34d0277e44 | ||
|
|
3440a05711 | ||
|
|
236c50fa7b | ||
|
|
e902c10295 | ||
|
|
313965d8c8 | ||
|
|
db7883d813 | ||
|
|
d0a2aa83be | ||
|
|
6cbb18d409 | ||
|
|
784cd34e3d | ||
|
|
43b648fee0 | ||
|
|
61a8606fbc | ||
|
|
5ae5fe30eb | ||
|
|
5a090fac90 | ||
|
|
f99eb32ac5 |
8
.github/dependabot.yml
vendored
Normal file
8
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,8 @@
|
|||||||
|
# Set update schedule for GitHub Actions
|
||||||
|
version: 2
|
||||||
|
updates:
|
||||||
|
- package-ecosystem: "github-actions"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
# Check for updates to GitHub Actions every week
|
||||||
|
interval: "weekly"
|
||||||
21
.github/workflows/code_coverage.yml
vendored
21
.github/workflows/code_coverage.yml
vendored
@@ -9,7 +9,7 @@ jobs:
|
|||||||
env:
|
env:
|
||||||
RUSTFLAGS: "-Cinstrument-coverage"
|
RUSTFLAGS: "-Cinstrument-coverage"
|
||||||
RUSTDOCFLAGS: "-Cinstrument-coverage"
|
RUSTDOCFLAGS: "-Cinstrument-coverage"
|
||||||
LLVM_PROFILE_FILE: "report-%p-%m.profraw"
|
LLVM_PROFILE_FILE: "./target/coverage/%p-%m.profraw"
|
||||||
|
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
@@ -19,14 +19,15 @@ jobs:
|
|||||||
- name: Install Rust toolchain
|
- name: Install Rust toolchain
|
||||||
uses: actions-rs/toolchain@v1
|
uses: actions-rs/toolchain@v1
|
||||||
with:
|
with:
|
||||||
toolchain: "1.65.0"
|
toolchain: stable
|
||||||
override: true
|
override: true
|
||||||
profile: minimal
|
profile: minimal
|
||||||
components: llvm-tools-preview
|
components: llvm-tools-preview
|
||||||
- name: Rust Cache
|
- name: Rust Cache
|
||||||
uses: Swatinem/rust-cache@v2.2.1
|
uses: Swatinem/rust-cache@v2.7.3
|
||||||
- name: Install grcov
|
- name: Install grcov
|
||||||
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
run: if [[ ! -e ~/.cargo/bin/grcov ]]; then cargo install grcov; fi
|
||||||
|
# TODO: re-enable the hwi tests
|
||||||
- name: Build simulator image
|
- name: Build simulator image
|
||||||
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
run: docker build -t hwi/ledger_emulator ./ci -f ci/Dockerfile.ledger
|
||||||
- name: Run simulator image
|
- name: Run simulator image
|
||||||
@@ -39,14 +40,16 @@ jobs:
|
|||||||
run: pip install hwi==2.1.1 protobuf==3.20.1
|
run: pip install hwi==2.1.1 protobuf==3.20.1
|
||||||
- name: Test
|
- name: Test
|
||||||
run: cargo test --all-features
|
run: cargo test --all-features
|
||||||
|
- name: Make coverage directory
|
||||||
|
run: mkdir coverage
|
||||||
- name: Run grcov
|
- name: Run grcov
|
||||||
run: mkdir coverage; grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --ignore '/*' -o ./coverage/lcov.info
|
run: grcov . --binary-path ./target/debug/ -s . -t lcov --branch --ignore-not-existing --keep-only '**/crates/**' --ignore '**/tests/**' --ignore '**/examples/**' -o ./coverage/lcov.info
|
||||||
- name: Generate HTML coverage report
|
- name: Generate HTML coverage report
|
||||||
run: genhtml -o coverage-report.html ./coverage/lcov.info
|
run: genhtml -o coverage-report.html --ignore-errors source ./coverage/lcov.info
|
||||||
# - name: Coveralls upload
|
- name: Coveralls upload
|
||||||
# uses: coverallsapp/github-action@master
|
uses: coverallsapp/github-action@master
|
||||||
# with:
|
with:
|
||||||
# github-token: ${{ secrets.GITHUB_TOKEN }}
|
github-token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
- name: Upload artifact
|
- name: Upload artifact
|
||||||
uses: actions/upload-artifact@v2
|
uses: actions/upload-artifact@v2
|
||||||
with:
|
with:
|
||||||
|
|||||||
51
.github/workflows/cont_integration.yml
vendored
51
.github/workflows/cont_integration.yml
vendored
@@ -12,7 +12,7 @@ jobs:
|
|||||||
rust:
|
rust:
|
||||||
- version: stable
|
- version: stable
|
||||||
clippy: true
|
clippy: true
|
||||||
- version: 1.57.0 # MSRV
|
- version: 1.63.0 # MSRV
|
||||||
features:
|
features:
|
||||||
- --no-default-features
|
- --no-default-features
|
||||||
- --all-features
|
- --all-features
|
||||||
@@ -26,12 +26,46 @@ jobs:
|
|||||||
override: true
|
override: true
|
||||||
profile: minimal
|
profile: minimal
|
||||||
- name: Rust Cache
|
- name: Rust Cache
|
||||||
uses: Swatinem/rust-cache@v2.2.1
|
uses: Swatinem/rust-cache@v2.7.3
|
||||||
|
- name: Pin dependencies for MSRV
|
||||||
|
if: matrix.rust.version == '1.63.0'
|
||||||
|
run: |
|
||||||
|
cargo update -p zstd-sys --precise "2.0.8+zstd.1.5.5"
|
||||||
|
cargo update -p time --precise "0.3.20"
|
||||||
|
cargo update -p home --precise "0.5.5"
|
||||||
- name: Build
|
- name: Build
|
||||||
run: cargo build ${{ matrix.features }}
|
run: cargo build ${{ matrix.features }}
|
||||||
- name: Test
|
- name: Test
|
||||||
run: cargo test ${{ matrix.features }}
|
run: cargo test ${{ matrix.features }}
|
||||||
|
|
||||||
|
check-no-std:
|
||||||
|
name: Check no_std
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- name: Checkout
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
- name: Install Rust toolchain
|
||||||
|
uses: actions-rs/toolchain@v1
|
||||||
|
with:
|
||||||
|
toolchain: stable
|
||||||
|
override: true
|
||||||
|
profile: minimal
|
||||||
|
# target: "thumbv6m-none-eabi"
|
||||||
|
- name: Rust Cache
|
||||||
|
uses: Swatinem/rust-cache@v2.7.3
|
||||||
|
- name: Check bdk_chain
|
||||||
|
working-directory: ./crates/chain
|
||||||
|
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||||
|
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,hashbrown
|
||||||
|
- name: Check bdk
|
||||||
|
working-directory: ./crates/bdk
|
||||||
|
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||||
|
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown
|
||||||
|
- name: Check esplora
|
||||||
|
working-directory: ./crates/esplora
|
||||||
|
# TODO "--target thumbv6m-none-eabi" should work but currently does not
|
||||||
|
run: cargo check --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown
|
||||||
|
|
||||||
check-wasm:
|
check-wasm:
|
||||||
name: Check WASM
|
name: Check WASM
|
||||||
runs-on: ubuntu-20.04
|
runs-on: ubuntu-20.04
|
||||||
@@ -43,7 +77,6 @@ jobs:
|
|||||||
uses: actions/checkout@v2
|
uses: actions/checkout@v2
|
||||||
# Install a recent version of clang that supports wasm32
|
# Install a recent version of clang that supports wasm32
|
||||||
- run: wget -O - https://apt.llvm.org/llvm-snapshot.gpg.key | sudo apt-key add - || exit 1
|
- run: wget -O - https://apt.llvm.org/llvm-snapshot.gpg.key | sudo apt-key add - || exit 1
|
||||||
- run: sudo apt-add-repository "deb http://apt.llvm.org/focal/ llvm-toolchain-focal-10 main" || exit 1
|
|
||||||
- run: sudo apt-get update || exit 1
|
- run: sudo apt-get update || exit 1
|
||||||
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
- run: sudo apt-get install -y libclang-common-10-dev clang-10 libc6-dev-i386 || exit 1
|
||||||
- name: Install Rust toolchain
|
- name: Install Rust toolchain
|
||||||
@@ -54,13 +87,13 @@ jobs:
|
|||||||
profile: minimal
|
profile: minimal
|
||||||
target: "wasm32-unknown-unknown"
|
target: "wasm32-unknown-unknown"
|
||||||
- name: Rust Cache
|
- name: Rust Cache
|
||||||
uses: Swatinem/rust-cache@v2.2.1
|
uses: Swatinem/rust-cache@v2.7.3
|
||||||
- name: Check bdk
|
- name: Check bdk
|
||||||
working-directory: ./crates/bdk
|
working-directory: ./crates/bdk
|
||||||
run: cargo check --target wasm32-unknown-unknown --features dev-getrandom-wasm
|
run: cargo check --target wasm32-unknown-unknown --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown,dev-getrandom-wasm
|
||||||
- name: Check esplora
|
- name: Check esplora
|
||||||
working-directory: ./crates/esplora
|
working-directory: ./crates/esplora
|
||||||
run: cargo check --target wasm32-unknown-unknown --features async --no-default-features
|
run: cargo check --target wasm32-unknown-unknown --no-default-features --features bitcoin/no-std,miniscript/no-std,bdk_chain/hashbrown,async
|
||||||
|
|
||||||
fmt:
|
fmt:
|
||||||
name: Rust fmt
|
name: Rust fmt
|
||||||
@@ -84,13 +117,11 @@ jobs:
|
|||||||
- uses: actions/checkout@v1
|
- uses: actions/checkout@v1
|
||||||
- uses: actions-rs/toolchain@v1
|
- uses: actions-rs/toolchain@v1
|
||||||
with:
|
with:
|
||||||
# we pin clippy instead of using "stable" so that our CI doesn't break
|
toolchain: stable
|
||||||
# at each new cargo release
|
|
||||||
toolchain: "1.67.0"
|
|
||||||
components: clippy
|
components: clippy
|
||||||
override: true
|
override: true
|
||||||
- name: Rust Cache
|
- name: Rust Cache
|
||||||
uses: Swatinem/rust-cache@v2.2.1
|
uses: Swatinem/rust-cache@v2.7.3
|
||||||
- uses: actions-rs/clippy-check@v1
|
- uses: actions-rs/clippy-check@v1
|
||||||
with:
|
with:
|
||||||
token: ${{ secrets.GITHUB_TOKEN }}
|
token: ${{ secrets.GITHUB_TOKEN }}
|
||||||
|
|||||||
2
.github/workflows/nightly_docs.yml
vendored
2
.github/workflows/nightly_docs.yml
vendored
@@ -16,7 +16,7 @@ jobs:
|
|||||||
- name: Update toolchain
|
- name: Update toolchain
|
||||||
run: rustup update
|
run: rustup update
|
||||||
- name: Rust Cache
|
- name: Rust Cache
|
||||||
uses: Swatinem/rust-cache@v2.2.1
|
uses: Swatinem/rust-cache@v2.7.3
|
||||||
- name: Build docs
|
- name: Build docs
|
||||||
run: cargo doc --no-deps
|
run: cargo doc --no-deps
|
||||||
env:
|
env:
|
||||||
|
|||||||
3
.gitignore
vendored
3
.gitignore
vendored
@@ -4,3 +4,6 @@ Cargo.lock
|
|||||||
|
|
||||||
*.swp
|
*.swp
|
||||||
.idea
|
.idea
|
||||||
|
|
||||||
|
# Example persisted files.
|
||||||
|
*.db
|
||||||
|
|||||||
10
CHANGELOG.md
10
CHANGELOG.md
@@ -158,7 +158,7 @@ BDK and LDK together.
|
|||||||
- Add the ability to specify which leaves to sign in a taproot transaction through `TapLeavesOptions` in `SignOptions`
|
- Add the ability to specify which leaves to sign in a taproot transaction through `TapLeavesOptions` in `SignOptions`
|
||||||
- Add the ability to specify whether a taproot transaction should be signed using the internal key or not, using `sign_with_tap_internal_key` in `SignOptions`
|
- Add the ability to specify whether a taproot transaction should be signed using the internal key or not, using `sign_with_tap_internal_key` in `SignOptions`
|
||||||
- Consolidate params `fee_amount` and `amount_needed` in `target_amount` in `CoinSelectionAlgorithm::coin_select` signature.
|
- Consolidate params `fee_amount` and `amount_needed` in `target_amount` in `CoinSelectionAlgorithm::coin_select` signature.
|
||||||
- Change the meaning of the `fee_amount` field inside `CoinSelectionResult`: from now on the `fee_amount` will represent only the fees asociated with the utxos in the `selected` field of `CoinSelectionResult`.
|
- Change the meaning of the `fee_amount` field inside `CoinSelectionResult`: from now on the `fee_amount` will represent only the fees associated with the utxos in the `selected` field of `CoinSelectionResult`.
|
||||||
- New `RpcBlockchain` implementation with various fixes.
|
- New `RpcBlockchain` implementation with various fixes.
|
||||||
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
- Return balance in separate categories, namely `confirmed`, `trusted_pending`, `untrusted_pending` & `immature`.
|
||||||
|
|
||||||
@@ -449,7 +449,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
#### Changed
|
#### Changed
|
||||||
- Simplify the architecture of blockchain traits
|
- Simplify the architecture of blockchain traits
|
||||||
- Improve sync
|
- Improve sync
|
||||||
- Remove unused varaint HeaderParseFail
|
- Remove unused variant `HeaderParseFail`
|
||||||
|
|
||||||
### CLI
|
### CLI
|
||||||
#### Added
|
#### Added
|
||||||
@@ -517,7 +517,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
- Default to SIGHASH_ALL if not specified
|
- Default to SIGHASH_ALL if not specified
|
||||||
- Replace ChangeSpendPolicy::filter_utxos with a predicate
|
- Replace ChangeSpendPolicy::filter_utxos with a predicate
|
||||||
- Make 'unspendable' into a HashSet
|
- Make 'unspendable' into a HashSet
|
||||||
- Stop implicitly enforcing manaul selection by .add_utxo
|
- Stop implicitly enforcing manual selection by .add_utxo
|
||||||
- Rename DumbCS to LargestFirstCoinSelection
|
- Rename DumbCS to LargestFirstCoinSelection
|
||||||
- Rename must_use_utxos to required_utxos
|
- Rename must_use_utxos to required_utxos
|
||||||
- Rename may_use_utxos to optional_uxtos
|
- Rename may_use_utxos to optional_uxtos
|
||||||
@@ -529,7 +529,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
- Use TXIN_DEFAULT_WEIGHT constant in coin selection
|
- Use TXIN_DEFAULT_WEIGHT constant in coin selection
|
||||||
- Replace `must_use` with `required` in coin selection
|
- Replace `must_use` with `required` in coin selection
|
||||||
- Take both spending policies into account in create_tx
|
- Take both spending policies into account in create_tx
|
||||||
- Check last derivation in cache to avoid recomputation
|
- Check last derivation in cache to avoid recomputing
|
||||||
- Use the branch-and-bound cs by default
|
- Use the branch-and-bound cs by default
|
||||||
- Make coin_select return UTXOs instead of TxIns
|
- Make coin_select return UTXOs instead of TxIns
|
||||||
- Build output lookup inside complete transaction
|
- Build output lookup inside complete transaction
|
||||||
@@ -550,7 +550,7 @@ final transaction is created by calling `finish` on the builder.
|
|||||||
- Require esplora feature for repl example
|
- Require esplora feature for repl example
|
||||||
|
|
||||||
#### Security
|
#### Security
|
||||||
- Use dirs-next instead of dirs since the latter is unmantained
|
- Use dirs-next instead of dirs since the latter is unmaintained
|
||||||
|
|
||||||
## [0.1.0-beta.1] - 2020-09-08
|
## [0.1.0-beta.1] - 2020-09-08
|
||||||
|
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ The codebase is maintained using the "contributor workflow" where everyone
|
|||||||
without exception contributes patch proposals using "pull requests". This
|
without exception contributes patch proposals using "pull requests". This
|
||||||
facilitates social contribution, easy testing and peer review.
|
facilitates social contribution, easy testing and peer review.
|
||||||
|
|
||||||
To contribute a patch, the worflow is a as follows:
|
To contribute a patch, the workflow is as follows:
|
||||||
|
|
||||||
1. Fork Repository
|
1. Fork Repository
|
||||||
2. Create topic branch
|
2. Create topic branch
|
||||||
@@ -46,15 +46,15 @@ Every new feature should be covered by functional tests where possible.
|
|||||||
When refactoring, structure your PR to make it easy to review and don't
|
When refactoring, structure your PR to make it easy to review and don't
|
||||||
hesitate to split it into multiple small, focused PRs.
|
hesitate to split it into multiple small, focused PRs.
|
||||||
|
|
||||||
The Minimal Supported Rust Version is 1.46 (enforced by our CI).
|
The Minimal Supported Rust Version is **1.57.0** (enforced by our CI).
|
||||||
|
|
||||||
Commits should cover both the issue fixed and the solution's rationale.
|
Commits should cover both the issue fixed and the solution's rationale.
|
||||||
These [guidelines](https://chris.beams.io/posts/git-commit/) should be kept in mind.
|
These [guidelines](https://chris.beams.io/posts/git-commit/) should be kept in mind. Commit messages should follow the ["Conventional Commits 1.0.0"](https://www.conventionalcommits.org/en/v1.0.0/) to make commit histories easier to read by humans and automated tools.
|
||||||
|
|
||||||
To facilitate communication with other contributors, the project is making use
|
To facilitate communication with other contributors, the project is making use
|
||||||
of GitHub's "assignee" field. First check that no one is assigned and then
|
of GitHub's "assignee" field. First check that no one is assigned and then
|
||||||
comment suggesting that you're working on it. If someone is already assigned,
|
comment suggesting that you're working on it. If someone is already assigned,
|
||||||
don't hesitate to ask if the assigned party or previous commenters are still
|
don't hesitate to ask if the assigned party or previous commenter are still
|
||||||
working on it if it has been awhile.
|
working on it if it has been awhile.
|
||||||
|
|
||||||
Deprecation policy
|
Deprecation policy
|
||||||
@@ -91,7 +91,7 @@ This is also enforced by the CI.
|
|||||||
Security
|
Security
|
||||||
--------
|
--------
|
||||||
|
|
||||||
Security is a high priority of BDK; disclosure of security vulnerabilites helps
|
Security is a high priority of BDK; disclosure of security vulnerabilities helps
|
||||||
prevent user loss of funds.
|
prevent user loss of funds.
|
||||||
|
|
||||||
Note that BDK is currently considered "pre-production" during this time, there
|
Note that BDK is currently considered "pre-production" during this time, there
|
||||||
|
|||||||
14
Cargo.toml
14
Cargo.toml
@@ -1,15 +1,21 @@
|
|||||||
[workspace]
|
[workspace]
|
||||||
|
resolver = "2"
|
||||||
members = [
|
members = [
|
||||||
"crates/bdk",
|
"crates/bdk",
|
||||||
"crates/chain",
|
"crates/chain",
|
||||||
"crates/file_store",
|
"crates/file_store",
|
||||||
"crates/electrum",
|
"crates/electrum",
|
||||||
"example-crates/keychain_tracker_electrum",
|
"crates/esplora",
|
||||||
"example-crates/keychain_tracker_esplora",
|
"crates/bitcoind_rpc",
|
||||||
"example-crates/keychain_tracker_example_cli",
|
"crates/hwi",
|
||||||
|
"example-crates/example_cli",
|
||||||
|
"example-crates/example_electrum",
|
||||||
|
"example-crates/example_esplora",
|
||||||
|
"example-crates/example_bitcoind_rpc_polling",
|
||||||
"example-crates/wallet_electrum",
|
"example-crates/wallet_electrum",
|
||||||
"example-crates/wallet_esplora",
|
"example-crates/wallet_esplora_blocking",
|
||||||
"example-crates/wallet_esplora_async",
|
"example-crates/wallet_esplora_async",
|
||||||
|
"example-crates/wallet_rpc",
|
||||||
"nursery/tmp_plan",
|
"nursery/tmp_plan",
|
||||||
"nursery/coin_select"
|
"nursery/coin_select"
|
||||||
]
|
]
|
||||||
|
|||||||
52
README.md
52
README.md
@@ -15,7 +15,7 @@
|
|||||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||||
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||||
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
<a href="https://blog.rust-lang.org/2022/08/11/Rust-1.63.0.html"><img alt="Rustc Version 1.63.0+" src="https://img.shields.io/badge/rustc-1.63.0%2B-lightgrey.svg"/></a>
|
||||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||||
</p>
|
</p>
|
||||||
|
|
||||||
@@ -33,7 +33,7 @@ It is built upon the excellent [`rust-bitcoin`] and [`rust-miniscript`] crates.
|
|||||||
|
|
||||||
> ⚠ The Bitcoin Dev Kit developers are in the process of releasing a `v1.0` which is a fundamental re-write of how the library works.
|
> ⚠ The Bitcoin Dev Kit developers are in the process of releasing a `v1.0` which is a fundamental re-write of how the library works.
|
||||||
> See for some background on this project: https://bitcoindevkit.org/blog/road-to-bdk-1/ (ignore the timeline 😁)
|
> See for some background on this project: https://bitcoindevkit.org/blog/road-to-bdk-1/ (ignore the timeline 😁)
|
||||||
> For a release timeline see the [`bdk_core_staging`] repo where a lot of the component work is being done. The plan is that everything in the `bdk_core_staging` repo will be moved into the `crates` directory here.
|
> For a release timeline see the [`BDK 1.0 project page`].
|
||||||
|
|
||||||
## Architecture
|
## Architecture
|
||||||
|
|
||||||
@@ -45,10 +45,50 @@ The project is split up into several crates in the `/crates` directory:
|
|||||||
- [`esplora`](./crates/esplora): Extends the [`esplora-client`] crate with methods to fetch chain data from an esplora HTTP server in the form that [`bdk_chain`] and `Wallet` can consume.
|
- [`esplora`](./crates/esplora): Extends the [`esplora-client`] crate with methods to fetch chain data from an esplora HTTP server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||||
- [`electrum`](./crates/electrum): Extends the [`electrum-client`] crate with methods to fetch chain data from an electrum server in the form that [`bdk_chain`] and `Wallet` can consume.
|
- [`electrum`](./crates/electrum): Extends the [`electrum-client`] crate with methods to fetch chain data from an electrum server in the form that [`bdk_chain`] and `Wallet` can consume.
|
||||||
|
|
||||||
Fully working examples of how to use these components are in `/example-crates`
|
Fully working examples of how to use these components are in `/example-crates`:
|
||||||
|
- [`example_cli`](./example-crates/example_cli): Library used by the `example_*` crates. Provides utilities for syncing, showing the balance, generating addresses and creating transactions without using the bdk `Wallet`.
|
||||||
|
- [`example_electrum`](./example-crates/example_electrum): A command line Bitcoin wallet application built on top of `example_cli` and the `electrum` crate. It shows the power of the bdk tools (`chain` + `file_store` + `electrum`), without depending on the main `bdk` library.
|
||||||
|
- [`example_esplora`](./example-crates/example_esplora): A command line Bitcoin wallet application built on top of `example_cli` and the `esplora` crate. It shows the power of the bdk tools (`chain` + `file_store` + `esplora`), without depending on the main `bdk` library.
|
||||||
|
- [`example_bitcoind_rpc_polling`](./example-crates/example_bitcoind_rpc_polling): A command line Bitcoin wallet application built on top of `example_cli` and the `bitcoind_rpc` crate. It shows the power of the bdk tools (`chain` + `file_store` + `bitcoind_rpc`), without depending on the main `bdk` library.
|
||||||
|
- [`wallet_esplora_blocking`](./example-crates/wallet_esplora_blocking): Uses the `Wallet` to sync and spend using the Esplora blocking interface.
|
||||||
|
- [`wallet_esplora_async`](./example-crates/wallet_esplora_async): Uses the `Wallet` to sync and spend using the Esplora asynchronous interface.
|
||||||
|
- [`wallet_electrum`](./example-crates/wallet_electrum): Uses the `Wallet` to sync and spend using Electrum.
|
||||||
|
|
||||||
[`bdk_core_staging`]: https://github.com/LLFourn/bdk_core_staging
|
[`BDK 1.0 project page`]: https://github.com/orgs/bitcoindevkit/projects/14
|
||||||
[`rust-miniscript`]: https://github.com/rust-bitcoin/rust-miniscript
|
[`rust-miniscript`]: https://github.com/rust-bitcoin/rust-miniscript
|
||||||
[`rust-bitcoin`]: https://github.com/rust-bitcoin/rust-bitcoin
|
[`rust-bitcoin`]: https://github.com/rust-bitcoin/rust-bitcoin
|
||||||
[`esplora-client`]: https://docs.rs/esplora-client/0.3.0/esplora_client/
|
[`esplora-client`]: https://docs.rs/esplora-client/
|
||||||
[`electrum-client`]: https://docs.rs/electrum-client/0.13.0/electrum_client/
|
[`electrum-client`]: https://docs.rs/electrum-client/
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||||
|
|
||||||
|
## Minimum Supported Rust Version (MSRV)
|
||||||
|
This library should compile with any combination of features with Rust 1.63.0.
|
||||||
|
|
||||||
|
To build with the MSRV you will need to pin dependencies as follows:
|
||||||
|
|
||||||
|
```shell
|
||||||
|
# zip 0.6.3 has MSRV 1.64.0
|
||||||
|
cargo update -p zip --precise "0.6.2"
|
||||||
|
# time 0.3.21 has MSRV 1.65.0
|
||||||
|
cargo update -p time --precise "0.3.20"
|
||||||
|
# jobserver 0.1.27 has MSRV 1.66.0
|
||||||
|
cargo update -p jobserver --precise "0.1.26"
|
||||||
|
# home 0.5.9 has MSRV 1.70.0
|
||||||
|
cargo update -p home --precise "0.5.5"
|
||||||
|
```
|
||||||
|
|
||||||
|
## License
|
||||||
|
|
||||||
|
Licensed under either of
|
||||||
|
|
||||||
|
* Apache License, Version 2.0, ([LICENSE-APACHE](LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||||
|
* MIT license ([LICENSE-MIT](LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||||
|
|
||||||
|
at your option.
|
||||||
|
|
||||||
|
### Contribution
|
||||||
|
|
||||||
|
Unless you explicitly state otherwise, any contribution intentionally
|
||||||
|
submitted for inclusion in the work by you, as defined in the Apache-2.0
|
||||||
|
license, shall be dual licensed as above, without any additional terms or
|
||||||
|
conditions.
|
||||||
|
|||||||
@@ -1 +1 @@
|
|||||||
msrv="1.57.0"
|
msrv="1.63.0"
|
||||||
|
|||||||
@@ -1,7 +1,7 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bdk"
|
name = "bdk"
|
||||||
homepage = "https://bitcoindevkit.org"
|
homepage = "https://bitcoindevkit.org"
|
||||||
version = "1.0.0-alpha.0"
|
version = "1.0.0-alpha.7"
|
||||||
repository = "https://github.com/bitcoindevkit/bdk"
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
documentation = "https://docs.rs/bdk"
|
documentation = "https://docs.rs/bdk"
|
||||||
description = "A modern, lightweight, descriptor-based wallet library"
|
description = "A modern, lightweight, descriptor-based wallet library"
|
||||||
@@ -10,35 +10,29 @@ readme = "README.md"
|
|||||||
license = "MIT OR Apache-2.0"
|
license = "MIT OR Apache-2.0"
|
||||||
authors = ["Bitcoin Dev Kit Developers"]
|
authors = ["Bitcoin Dev Kit Developers"]
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
rust-version = "1.57"
|
rust-version = "1.63"
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
log = "^0.4"
|
|
||||||
rand = "^0.8"
|
rand = "^0.8"
|
||||||
miniscript = { version = "9", features = ["serde"] }
|
miniscript = { version = "10.0.0", features = ["serde"], default-features = false }
|
||||||
bitcoin = { version = "0.29", features = ["serde", "base64", "rand"] }
|
bitcoin = { version = "0.30.0", features = ["serde", "base64", "rand-std"], default-features = false }
|
||||||
serde = { version = "^1.0", features = ["derive"] }
|
serde = { version = "^1.0", features = ["derive"] }
|
||||||
serde_json = { version = "^1.0" }
|
serde_json = { version = "^1.0" }
|
||||||
bdk_chain = { path = "../chain", version = "0.4.0", features = ["miniscript", "serde"] }
|
bdk_chain = { path = "../chain", version = "0.11.0", features = ["miniscript", "serde"], default-features = false }
|
||||||
|
|
||||||
# Optional dependencies
|
# Optional dependencies
|
||||||
hwi = { version = "0.5", optional = true, features = [ "use-miniscript"] }
|
bip39 = { version = "2.0", optional = true }
|
||||||
bip39 = { version = "1.0.1", optional = true }
|
|
||||||
|
|
||||||
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
[target.'cfg(target_arch = "wasm32")'.dependencies]
|
||||||
getrandom = "0.2"
|
getrandom = "0.2"
|
||||||
js-sys = "0.3"
|
js-sys = "0.3"
|
||||||
|
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
default = ["std"]
|
default = ["std"]
|
||||||
std = []
|
std = ["bitcoin/std", "miniscript/std", "bdk_chain/std"]
|
||||||
compiler = ["miniscript/compiler"]
|
compiler = ["miniscript/compiler"]
|
||||||
all-keys = ["keys-bip39"]
|
all-keys = ["keys-bip39"]
|
||||||
keys-bip39 = ["bip39"]
|
keys-bip39 = ["bip39"]
|
||||||
hardware-signer = ["hwi"]
|
|
||||||
test-hardware-signer = ["hardware-signer"]
|
|
||||||
|
|
||||||
|
|
||||||
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
# This feature is used to run `cargo check` in our CI targeting wasm. It's not recommended
|
||||||
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
# for libraries to explicitly include the "getrandom/js" feature, so we only do it when
|
||||||
@@ -47,17 +41,15 @@ dev-getrandom-wasm = ["getrandom/js"]
|
|||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
lazy_static = "1.4"
|
lazy_static = "1.4"
|
||||||
env_logger = "0.7"
|
|
||||||
# Move back to importing from rust-bitcoin once https://github.com/rust-bitcoin/rust-bitcoin/pull/1342 is released
|
|
||||||
base64 = "^0.13"
|
|
||||||
assert_matches = "1.5.0"
|
assert_matches = "1.5.0"
|
||||||
|
tempfile = "3"
|
||||||
|
bdk_file_store = { path = "../file_store" }
|
||||||
|
anyhow = "1"
|
||||||
|
|
||||||
[package.metadata.docs.rs]
|
[package.metadata.docs.rs]
|
||||||
all-features = true
|
all-features = true
|
||||||
rustdoc-args = ["--cfg", "docsrs"]
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
|
||||||
[[example]]
|
[[example]]
|
||||||
name = "mnemonic_to_descriptors"
|
name = "mnemonic_to_descriptors"
|
||||||
path = "examples/mnemonic_to_descriptors.rs"
|
path = "examples/mnemonic_to_descriptors.rs"
|
||||||
|
|||||||
@@ -13,7 +13,7 @@
|
|||||||
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
<a href="https://github.com/bitcoindevkit/bdk/actions?query=workflow%3ACI"><img alt="CI Status" src="https://github.com/bitcoindevkit/bdk/workflows/CI/badge.svg"></a>
|
||||||
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
<a href="https://coveralls.io/github/bitcoindevkit/bdk?branch=master"><img src="https://coveralls.io/repos/github/bitcoindevkit/bdk/badge.svg?branch=master"/></a>
|
||||||
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
<a href="https://docs.rs/bdk"><img alt="API Docs" src="https://img.shields.io/badge/docs.rs-bdk-green"/></a>
|
||||||
<a href="https://blog.rust-lang.org/2021/12/02/Rust-1.57.0.html"><img alt="Rustc Version 1.57.0+" src="https://img.shields.io/badge/rustc-1.57.0%2B-lightgrey.svg"/></a>
|
<a href="https://blog.rust-lang.org/2022/08/11/Rust-1.63.0.html"><img alt="Rustc Version 1.63.0+" src="https://img.shields.io/badge/rustc-1.63.0%2B-lightgrey.svg"/></a>
|
||||||
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
<a href="https://discord.gg/d7NkDKm"><img alt="Chat on Discord" src="https://img.shields.io/discord/753336465005608961?logo=discord"></a>
|
||||||
</p>
|
</p>
|
||||||
|
|
||||||
@@ -137,7 +137,7 @@ fn main() {
|
|||||||
<!-- use bdk::electrum_client::Client; -->
|
<!-- use bdk::electrum_client::Client; -->
|
||||||
<!-- use bdk::wallet::AddressIndex::New; -->
|
<!-- use bdk::wallet::AddressIndex::New; -->
|
||||||
|
|
||||||
<!-- use base64; -->
|
<!-- use bitcoin::base64; -->
|
||||||
<!-- use bdk::bitcoin::consensus::serialize; -->
|
<!-- use bdk::bitcoin::consensus::serialize; -->
|
||||||
<!-- use bdk::bitcoin::Network; -->
|
<!-- use bdk::bitcoin::Network; -->
|
||||||
|
|
||||||
@@ -174,7 +174,7 @@ fn main() {
|
|||||||
<!-- ```rust,no_run -->
|
<!-- ```rust,no_run -->
|
||||||
<!-- use bdk::{Wallet, SignOptions}; -->
|
<!-- use bdk::{Wallet, SignOptions}; -->
|
||||||
|
|
||||||
<!-- use base64; -->
|
<!-- use bitcoin::base64; -->
|
||||||
<!-- use bdk::bitcoin::consensus::deserialize; -->
|
<!-- use bdk::bitcoin::consensus::deserialize; -->
|
||||||
<!-- use bdk::bitcoin::Network; -->
|
<!-- use bdk::bitcoin::Network; -->
|
||||||
|
|
||||||
@@ -206,18 +206,17 @@ cargo test
|
|||||||
|
|
||||||
Licensed under either of
|
Licensed under either of
|
||||||
|
|
||||||
* Apache License, Version 2.0
|
* Apache License, Version 2.0, ([LICENSE-APACHE](../../LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
||||||
([LICENSE-APACHE](LICENSE-APACHE) or <https://www.apache.org/licenses/LICENSE-2.0>)
|
* MIT license ([LICENSE-MIT](../../LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
||||||
* MIT license
|
|
||||||
([LICENSE-MIT](LICENSE-MIT) or <https://opensource.org/licenses/MIT>)
|
|
||||||
|
|
||||||
at your option.
|
at your option.
|
||||||
|
|
||||||
## Contribution
|
### Contribution
|
||||||
|
|
||||||
Unless you explicitly state otherwise, any contribution intentionally submitted
|
Unless you explicitly state otherwise, any contribution intentionally
|
||||||
for inclusion in the work by you, as defined in the Apache-2.0 license, shall be
|
submitted for inclusion in the work by you, as defined in the Apache-2.0
|
||||||
dual licensed as above, without any additional terms or conditions.
|
license, shall be dual licensed as above, without any additional terms or
|
||||||
|
conditions.
|
||||||
|
|
||||||
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
[`bdk_chain`]: https://docs.rs/bdk_chain/latest
|
||||||
[`bdk_file_store`]: https://docs.rs/bdk_file_store/latest
|
[`bdk_file_store`]: https://docs.rs/bdk_file_store/latest
|
||||||
|
|||||||
@@ -11,15 +11,12 @@
|
|||||||
|
|
||||||
extern crate bdk;
|
extern crate bdk;
|
||||||
extern crate bitcoin;
|
extern crate bitcoin;
|
||||||
extern crate log;
|
|
||||||
extern crate miniscript;
|
extern crate miniscript;
|
||||||
extern crate serde_json;
|
extern crate serde_json;
|
||||||
|
|
||||||
use std::error::Error;
|
use std::error::Error;
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use log::info;
|
|
||||||
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use miniscript::policy::Concrete;
|
use miniscript::policy::Concrete;
|
||||||
use miniscript::Descriptor;
|
use miniscript::Descriptor;
|
||||||
@@ -36,13 +33,9 @@ use bdk::{KeychainKind, Wallet};
|
|||||||
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
/// This example demonstrates the interaction between a bdk wallet and miniscript policy.
|
||||||
|
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
env_logger::init_from_env(
|
|
||||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
|
||||||
);
|
|
||||||
|
|
||||||
// We start with a generic miniscript policy string
|
// We start with a generic miniscript policy string
|
||||||
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
let policy_str = "or(10@thresh(4,pk(029ffbe722b147f3035c87cb1c60b9a5947dd49c774cc31e94773478711a929ac0),pk(025f05815e3a1a8a83bfbb03ce016c9a2ee31066b98f567f6227df1d76ec4bd143),pk(025625f41e4a065efc06d5019cbbd56fe8c07595af1231e7cbc03fafb87ebb71ec),pk(02a27c8b850a00f67da3499b60562673dcf5fdfb82b7e17652a7ac54416812aefd),pk(03e618ec5f384d6e19ca9ebdb8e2119e5bef978285076828ce054e55c4daf473e2)),1@and(older(4209713),thresh(2,pk(03deae92101c790b12653231439f27b8897264125ecb2f46f48278603102573165),pk(033841045a531e1adf9910a6ec279589a90b3b8a904ee64ffd692bd08a8996c1aa),pk(02aebf2d10b040eb936a6f02f44ee82f8b34f5c1ccb20ff3949c2b28206b7c1068))))";
|
||||||
info!("Compiling policy: \n{}", policy_str);
|
println!("Compiling policy: \n{}", policy_str);
|
||||||
|
|
||||||
// Parse the string as a [`Concrete`] type miniscript policy.
|
// Parse the string as a [`Concrete`] type miniscript policy.
|
||||||
let policy = Concrete::<String>::from_str(policy_str)?;
|
let policy = Concrete::<String>::from_str(policy_str)?;
|
||||||
@@ -51,12 +44,12 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// `policy.compile()` returns the resulting miniscript from the policy.
|
// `policy.compile()` returns the resulting miniscript from the policy.
|
||||||
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
let descriptor = Descriptor::new_wsh(policy.compile()?)?;
|
||||||
|
|
||||||
info!("Compiled into following Descriptor: \n{}", descriptor);
|
println!("Compiled into following Descriptor: \n{}", descriptor);
|
||||||
|
|
||||||
// Create a new wallet from this descriptor
|
// Create a new wallet from this descriptor
|
||||||
let mut wallet = Wallet::new_no_persist(&format!("{}", descriptor), None, Network::Regtest)?;
|
let mut wallet = Wallet::new_no_persist(&format!("{}", descriptor), None, Network::Regtest)?;
|
||||||
|
|
||||||
info!(
|
println!(
|
||||||
"First derived address from the descriptor: \n{}",
|
"First derived address from the descriptor: \n{}",
|
||||||
wallet.get_address(New)
|
wallet.get_address(New)
|
||||||
);
|
);
|
||||||
@@ -64,7 +57,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
// BDK also has it's own `Policy` structure to represent the spending condition in a more
|
||||||
// human readable json format.
|
// human readable json format.
|
||||||
let spending_policy = wallet.policies(KeychainKind::External)?;
|
let spending_policy = wallet.policies(KeychainKind::External)?;
|
||||||
info!(
|
println!(
|
||||||
"The BDK spending policy: \n{}",
|
"The BDK spending policy: \n{}",
|
||||||
serde_json::to_string_pretty(&spending_policy)?
|
serde_json::to_string_pretty(&spending_policy)?
|
||||||
);
|
);
|
||||||
|
|||||||
@@ -6,21 +6,20 @@
|
|||||||
// You may not use this file except in accordance with one or both of these
|
// You may not use this file except in accordance with one or both of these
|
||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
|
use anyhow::anyhow;
|
||||||
|
use bdk::bitcoin::bip32::DerivationPath;
|
||||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||||
use bdk::bitcoin::util::bip32::DerivationPath;
|
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
use bdk::descriptor;
|
use bdk::descriptor;
|
||||||
use bdk::descriptor::IntoWalletDescriptor;
|
use bdk::descriptor::IntoWalletDescriptor;
|
||||||
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
use bdk::keys::bip39::{Language, Mnemonic, WordCount};
|
||||||
use bdk::keys::{GeneratableKey, GeneratedKey};
|
use bdk::keys::{GeneratableKey, GeneratedKey};
|
||||||
use bdk::miniscript::Tap;
|
use bdk::miniscript::Tap;
|
||||||
use bdk::Error as BDK_Error;
|
|
||||||
use std::error::Error;
|
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
/// This example demonstrates how to generate a mnemonic phrase
|
/// This example demonstrates how to generate a mnemonic phrase
|
||||||
/// using BDK and use that to generate a descriptor string.
|
/// using BDK and use that to generate a descriptor string.
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), anyhow::Error> {
|
||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
// In this example we are generating a 12 words mnemonic phrase
|
// In this example we are generating a 12 words mnemonic phrase
|
||||||
@@ -28,14 +27,14 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// using their respective `WordCount` variant.
|
// using their respective `WordCount` variant.
|
||||||
let mnemonic: GeneratedKey<_, Tap> =
|
let mnemonic: GeneratedKey<_, Tap> =
|
||||||
Mnemonic::generate((WordCount::Words12, Language::English))
|
Mnemonic::generate((WordCount::Words12, Language::English))
|
||||||
.map_err(|_| BDK_Error::Generic("Mnemonic generation error".to_string()))?;
|
.map_err(|_| anyhow!("Mnemonic generation error"))?;
|
||||||
|
|
||||||
println!("Mnemonic phrase: {}", *mnemonic);
|
println!("Mnemonic phrase: {}", *mnemonic);
|
||||||
let mnemonic_with_passphrase = (mnemonic, None);
|
let mnemonic_with_passphrase = (mnemonic, None);
|
||||||
|
|
||||||
// define external and internal derivation key path
|
// define external and internal derivation key path
|
||||||
let external_path = DerivationPath::from_str("m/86h/0h/0h/0").unwrap();
|
let external_path = DerivationPath::from_str("m/86h/1h/0h/0").unwrap();
|
||||||
let internal_path = DerivationPath::from_str("m/86h/0h/0h/1").unwrap();
|
let internal_path = DerivationPath::from_str("m/86h/1h/0h/1").unwrap();
|
||||||
|
|
||||||
// generate external and internal descriptor from mnemonic
|
// generate external and internal descriptor from mnemonic
|
||||||
let (external_descriptor, ext_keymap) =
|
let (external_descriptor, ext_keymap) =
|
||||||
|
|||||||
@@ -10,8 +10,6 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
extern crate bdk;
|
extern crate bdk;
|
||||||
extern crate env_logger;
|
|
||||||
extern crate log;
|
|
||||||
use std::error::Error;
|
use std::error::Error;
|
||||||
|
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
@@ -29,10 +27,6 @@ use bdk::wallet::signer::SignersContainer;
|
|||||||
/// one of the Extend Private key.
|
/// one of the Extend Private key.
|
||||||
|
|
||||||
fn main() -> Result<(), Box<dyn Error>> {
|
fn main() -> Result<(), Box<dyn Error>> {
|
||||||
env_logger::init_from_env(
|
|
||||||
env_logger::Env::default().filter_or(env_logger::DEFAULT_FILTER_ENV, "info"),
|
|
||||||
);
|
|
||||||
|
|
||||||
let secp = bitcoin::secp256k1::Secp256k1::new();
|
let secp = bitcoin::secp256k1::Secp256k1::new();
|
||||||
|
|
||||||
// The descriptor used in the example
|
// The descriptor used in the example
|
||||||
@@ -48,7 +42,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
// But they can be used as independent tools also.
|
// But they can be used as independent tools also.
|
||||||
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
let (wallet_desc, keymap) = desc.into_wallet_descriptor(&secp, Network::Testnet)?;
|
||||||
|
|
||||||
log::info!("Example Descriptor for policy analysis : {}", wallet_desc);
|
println!("Example Descriptor for policy analysis : {}", wallet_desc);
|
||||||
|
|
||||||
// Create the signer with the keymap and descriptor.
|
// Create the signer with the keymap and descriptor.
|
||||||
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
let signers_container = SignersContainer::build(keymap, &wallet_desc, &secp);
|
||||||
@@ -60,7 +54,7 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
.extract_policy(&signers_container, BuildSatisfaction::None, &secp)?
|
||||||
.expect("We expect a policy");
|
.expect("We expect a policy");
|
||||||
|
|
||||||
log::info!("Derived Policy for the descriptor {:#?}", policy);
|
println!("Derived Policy for the descriptor {:#?}", policy);
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -42,22 +42,16 @@ fn poly_mod(mut c: u64, val: u64) -> u64 {
|
|||||||
c
|
c
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Computes the checksum bytes of a descriptor.
|
/// Compute the checksum bytes of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
||||||
/// `exclude_hash = true` ignores all data after the first '#' (inclusive).
|
pub fn calc_checksum_bytes(mut desc: &str) -> Result<[u8; 8], DescriptorError> {
|
||||||
pub(crate) fn calc_checksum_bytes_internal(
|
|
||||||
mut desc: &str,
|
|
||||||
exclude_hash: bool,
|
|
||||||
) -> Result<[u8; 8], DescriptorError> {
|
|
||||||
let mut c = 1;
|
let mut c = 1;
|
||||||
let mut cls = 0;
|
let mut cls = 0;
|
||||||
let mut clscount = 0;
|
let mut clscount = 0;
|
||||||
|
|
||||||
let mut original_checksum = None;
|
let mut original_checksum = None;
|
||||||
if exclude_hash {
|
if let Some(split) = desc.split_once('#') {
|
||||||
if let Some(split) = desc.split_once('#') {
|
desc = split.0;
|
||||||
desc = split.0;
|
original_checksum = Some(split.1);
|
||||||
original_checksum = Some(split.1);
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
for ch in desc.as_bytes() {
|
for ch in desc.as_bytes() {
|
||||||
@@ -95,39 +89,10 @@ pub(crate) fn calc_checksum_bytes_internal(
|
|||||||
Ok(checksum)
|
Ok(checksum)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Compute the checksum bytes of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
|
||||||
pub fn calc_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
|
||||||
calc_checksum_bytes_internal(desc, true)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Compute the checksum of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
/// Compute the checksum of a descriptor, excludes any existing checksum in the descriptor string from the calculation
|
||||||
pub fn calc_checksum(desc: &str) -> Result<String, DescriptorError> {
|
pub fn calc_checksum(desc: &str) -> Result<String, DescriptorError> {
|
||||||
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
||||||
calc_checksum_bytes_internal(desc, true)
|
calc_checksum_bytes(desc).map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
||||||
.map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
|
||||||
}
|
|
||||||
|
|
||||||
// TODO in release 0.25.0, remove get_checksum_bytes and get_checksum
|
|
||||||
// TODO in release 0.25.0, consolidate calc_checksum_bytes_internal into calc_checksum_bytes
|
|
||||||
|
|
||||||
/// Compute the checksum bytes of a descriptor
|
|
||||||
#[deprecated(
|
|
||||||
since = "0.24.0",
|
|
||||||
note = "Use new `calc_checksum_bytes` function which excludes any existing checksum in the descriptor string before calculating the checksum hash bytes. See https://github.com/bitcoindevkit/bdk/pull/765."
|
|
||||||
)]
|
|
||||||
pub fn get_checksum_bytes(desc: &str) -> Result<[u8; 8], DescriptorError> {
|
|
||||||
calc_checksum_bytes_internal(desc, false)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Compute the checksum of a descriptor
|
|
||||||
#[deprecated(
|
|
||||||
since = "0.24.0",
|
|
||||||
note = "Use new `calc_checksum` function which excludes any existing checksum in the descriptor string before calculating the checksum hash. See https://github.com/bitcoindevkit/bdk/pull/765."
|
|
||||||
)]
|
|
||||||
pub fn get_checksum(desc: &str) -> Result<String, DescriptorError> {
|
|
||||||
// unsafe is okay here as the checksum only uses bytes in `CHECKSUM_CHARSET`
|
|
||||||
calc_checksum_bytes_internal(desc, false)
|
|
||||||
.map(|b| unsafe { String::from_utf8_unchecked(b.to_vec()) })
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
|
|||||||
@@ -516,13 +516,14 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
||||||
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
||||||
});
|
});
|
||||||
( wpkh ( $key:expr ) ) => ({
|
( wpkh ( $key:expr ) ) => ({
|
||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
||||||
});
|
});
|
||||||
( sh ( wpkh ( $key:expr ) ) ) => ({
|
( sh ( wpkh ( $key:expr ) ) ) => ({
|
||||||
@@ -532,7 +533,7 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
||||||
});
|
});
|
||||||
( sh ( $( $minisc:tt )* ) ) => ({
|
( sh ( $( $minisc:tt )* ) ) => ({
|
||||||
@@ -702,7 +703,7 @@ macro_rules! fragment {
|
|||||||
$crate::keys::make_pkh($key, &secp)
|
$crate::keys::make_pkh($key, &secp)
|
||||||
});
|
});
|
||||||
( after ( $value:expr ) ) => ({
|
( after ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(After, $crate::bitcoin::PackedLockTime($value)) // TODO!! https://github.com/rust-bitcoin/rust-bitcoin/issues/1302
|
$crate::impl_leaf_opcode_value!(After, $crate::miniscript::AbsLockTime::from_consensus($value))
|
||||||
});
|
});
|
||||||
( older ( $value:expr ) ) => ({
|
( older ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
||||||
@@ -796,7 +797,6 @@ macro_rules! fragment {
|
|||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use alloc::string::ToString;
|
use alloc::string::ToString;
|
||||||
use bitcoin::hashes::hex::ToHex;
|
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::{Descriptor, Legacy, Segwitv0};
|
use miniscript::{Descriptor, Legacy, Segwitv0};
|
||||||
@@ -805,8 +805,8 @@ mod test {
|
|||||||
|
|
||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::PrivateKey;
|
use bitcoin::PrivateKey;
|
||||||
|
|
||||||
// test the descriptor!() macro
|
// test the descriptor!() macro
|
||||||
@@ -822,18 +822,15 @@ mod test {
|
|||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
assert_eq!(!desc.has_wildcard(), is_fixed);
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let child_desc = desc
|
||||||
let child_desc = if !desc.has_wildcard() {
|
.at_derivation_index(i as u32)
|
||||||
desc.at_derivation_index(0)
|
.expect("i is not hardened");
|
||||||
} else {
|
|
||||||
desc.at_derivation_index(index)
|
|
||||||
};
|
|
||||||
let address = child_desc.address(Regtest);
|
let address = child_desc.address(Regtest);
|
||||||
if let Ok(address) = address {
|
if let Ok(address) = address {
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
} else {
|
} else {
|
||||||
let script = child_desc.script_pubkey();
|
let script = child_desc.script_pubkey();
|
||||||
assert_eq!(script.to_hex().as_str(), *expected.get(i).unwrap());
|
assert_eq!(script.to_hex_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1178,9 +1175,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
#[should_panic(
|
#[should_panic(expected = "Miniscript(ContextError(UncompressedKeysNotAllowed))")]
|
||||||
expected = "Miniscript(ContextError(CompressedOnly(\"04b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a87378ec38ff91d43e8c2092ebda601780485263da089465619e0358a5c1be7ac91f4\")))"
|
|
||||||
)]
|
|
||||||
fn test_dsl_miniscript_checks() {
|
fn test_dsl_miniscript_checks() {
|
||||||
let mut uncompressed_pk =
|
let mut uncompressed_pk =
|
||||||
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
||||||
|
|||||||
@@ -10,6 +10,7 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
//! Descriptor errors
|
//! Descriptor errors
|
||||||
|
use core::fmt;
|
||||||
|
|
||||||
/// Errors related to the parsing and usage of descriptors
|
/// Errors related to the parsing and usage of descriptors
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
@@ -20,6 +21,8 @@ pub enum Error {
|
|||||||
InvalidDescriptorChecksum,
|
InvalidDescriptorChecksum,
|
||||||
/// The descriptor contains hardened derivation steps on public extended keys
|
/// The descriptor contains hardened derivation steps on public extended keys
|
||||||
HardenedDerivationXpub,
|
HardenedDerivationXpub,
|
||||||
|
/// The descriptor contains multipath keys
|
||||||
|
MultiPath,
|
||||||
|
|
||||||
/// Error thrown while working with [`keys`](crate::keys)
|
/// Error thrown while working with [`keys`](crate::keys)
|
||||||
Key(crate::keys::KeyError),
|
Key(crate::keys::KeyError),
|
||||||
@@ -30,11 +33,11 @@ pub enum Error {
|
|||||||
InvalidDescriptorCharacter(u8),
|
InvalidDescriptorCharacter(u8),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Error during base58 decoding
|
/// Error during base58 decoding
|
||||||
Base58(bitcoin::util::base58::Error),
|
Base58(bitcoin::base58::Error),
|
||||||
/// Key-related error
|
/// Key-related error
|
||||||
Pk(bitcoin::util::key::Error),
|
Pk(bitcoin::key::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
/// Hex decoding error
|
/// Hex decoding error
|
||||||
@@ -51,8 +54,8 @@ impl From<crate::keys::KeyError> for Error {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl std::fmt::Display for Error {
|
impl fmt::Display for Error {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::InvalidHdKeyPath => write!(f, "Invalid HD key path"),
|
Self::InvalidHdKeyPath => write!(f, "Invalid HD key path"),
|
||||||
Self::InvalidDescriptorChecksum => {
|
Self::InvalidDescriptorChecksum => {
|
||||||
@@ -62,6 +65,10 @@ impl std::fmt::Display for Error {
|
|||||||
f,
|
f,
|
||||||
"The descriptor contains hardened derivation steps on public extended keys"
|
"The descriptor contains hardened derivation steps on public extended keys"
|
||||||
),
|
),
|
||||||
|
Self::MultiPath => write!(
|
||||||
|
f,
|
||||||
|
"The descriptor contains multipath keys, which are not supported yet"
|
||||||
|
),
|
||||||
Self::Key(err) => write!(f, "Key error: {}", err),
|
Self::Key(err) => write!(f, "Key error: {}", err),
|
||||||
Self::Policy(err) => write!(f, "Policy error: {}", err),
|
Self::Policy(err) => write!(f, "Policy error: {}", err),
|
||||||
Self::InvalidDescriptorCharacter(char) => {
|
Self::InvalidDescriptorCharacter(char) => {
|
||||||
@@ -79,9 +86,38 @@ impl std::fmt::Display for Error {
|
|||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
impl std::error::Error for Error {}
|
impl std::error::Error for Error {}
|
||||||
|
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
impl From<bitcoin::bip32::Error> for Error {
|
||||||
impl_error!(bitcoin::util::base58::Error, Base58);
|
fn from(err: bitcoin::bip32::Error) -> Self {
|
||||||
impl_error!(bitcoin::util::key::Error, Pk);
|
Error::Bip32(err)
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
}
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
}
|
||||||
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
|
||||||
|
impl From<bitcoin::base58::Error> for Error {
|
||||||
|
fn from(err: bitcoin::base58::Error) -> Self {
|
||||||
|
Error::Base58(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<bitcoin::key::Error> for Error {
|
||||||
|
fn from(err: bitcoin::key::Error) -> Self {
|
||||||
|
Error::Pk(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<miniscript::Error> for Error {
|
||||||
|
fn from(err: miniscript::Error) -> Self {
|
||||||
|
Error::Miniscript(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<bitcoin::hashes::hex::Error> for Error {
|
||||||
|
fn from(err: bitcoin::hashes::hex::Error) -> Self {
|
||||||
|
Error::Hex(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<crate::descriptor::policy::PolicyError> for Error {
|
||||||
|
fn from(err: crate::descriptor::policy::PolicyError) -> Self {
|
||||||
|
Error::Policy(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|||||||
@@ -18,17 +18,17 @@ use crate::collections::BTreeMap;
|
|||||||
use alloc::string::String;
|
use alloc::string::String;
|
||||||
use alloc::vec::Vec;
|
use alloc::vec::Vec;
|
||||||
|
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
||||||
use bitcoin::util::{psbt, taproot};
|
use bitcoin::{key::XOnlyPublicKey, secp256k1, PublicKey};
|
||||||
use bitcoin::{secp256k1, PublicKey, XOnlyPublicKey};
|
use bitcoin::{psbt, taproot};
|
||||||
use bitcoin::{Network, TxOut};
|
use bitcoin::{Network, TxOut};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DefiniteDescriptorKey, DescriptorSecretKey, DescriptorType, InnerXKey, SinglePubKey,
|
DefiniteDescriptorKey, DescriptorMultiXKey, DescriptorSecretKey, DescriptorType,
|
||||||
|
DescriptorXKey, InnerXKey, KeyMap, SinglePubKey, Wildcard,
|
||||||
};
|
};
|
||||||
pub use miniscript::{
|
pub use miniscript::{
|
||||||
descriptor::DescriptorXKey, descriptor::KeyMap, descriptor::Wildcard, Descriptor,
|
Descriptor, DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
||||||
DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
|
||||||
};
|
};
|
||||||
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
||||||
|
|
||||||
@@ -59,16 +59,16 @@ pub type DerivedDescriptor = Descriptor<DefiniteDescriptorKey>;
|
|||||||
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
||||||
|
|
||||||
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type TapKeyOrigins = BTreeMap<bitcoin::XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
pub type TapKeyOrigins = BTreeMap<XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
||||||
|
|
||||||
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
||||||
pub trait IntoWalletDescriptor {
|
pub trait IntoWalletDescriptor {
|
||||||
@@ -136,14 +136,10 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
network: Network,
|
network: Network,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'s, 'd>
|
impl<'s, 'd> miniscript::Translator<DescriptorPublicKey, String, DescriptorError>
|
||||||
miniscript::Translator<DescriptorPublicKey, miniscript::DummyKey, DescriptorError>
|
|
||||||
for Translator<'s, 'd>
|
for Translator<'s, 'd>
|
||||||
{
|
{
|
||||||
fn pk(
|
fn pk(&mut self, pk: &DescriptorPublicKey) -> Result<String, DescriptorError> {
|
||||||
&mut self,
|
|
||||||
pk: &DescriptorPublicKey,
|
|
||||||
) -> Result<miniscript::DummyKey, DescriptorError> {
|
|
||||||
let secp = &self.secp;
|
let secp = &self.secp;
|
||||||
|
|
||||||
let (_, _, networks) = if self.descriptor.is_taproot() {
|
let (_, _, networks) = if self.descriptor.is_taproot() {
|
||||||
@@ -161,7 +157,7 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
};
|
};
|
||||||
|
|
||||||
if networks.contains(&self.network) {
|
if networks.contains(&self.network) {
|
||||||
Ok(miniscript::DummyKey)
|
Ok(Default::default())
|
||||||
} else {
|
} else {
|
||||||
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
||||||
}
|
}
|
||||||
@@ -169,35 +165,40 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
fn sha256(
|
fn sha256(
|
||||||
&mut self,
|
&mut self,
|
||||||
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
||||||
) -> Result<miniscript::DummySha256Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn hash256(
|
fn hash256(
|
||||||
&mut self,
|
&mut self,
|
||||||
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
||||||
) -> Result<miniscript::DummyHash256Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn ripemd160(
|
fn ripemd160(
|
||||||
&mut self,
|
&mut self,
|
||||||
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
||||||
) -> Result<miniscript::DummyRipemd160Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn hash160(
|
fn hash160(
|
||||||
&mut self,
|
&mut self,
|
||||||
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
||||||
) -> Result<miniscript::DummyHash160Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// check the network for the keys
|
// check the network for the keys
|
||||||
self.0.translate_pk(&mut Translator {
|
use miniscript::TranslateErr;
|
||||||
|
match self.0.translate_pk(&mut Translator {
|
||||||
secp,
|
secp,
|
||||||
network,
|
network,
|
||||||
descriptor: &self.0,
|
descriptor: &self.0,
|
||||||
})?;
|
}) {
|
||||||
|
Ok(_) => {}
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
}
|
||||||
|
|
||||||
Ok(self)
|
Ok(self)
|
||||||
}
|
}
|
||||||
@@ -251,7 +252,12 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// fixup the network for keys that need it in the descriptor
|
// fixup the network for keys that need it in the descriptor
|
||||||
let translated = desc.translate_pk(&mut Translator { network })?;
|
use miniscript::TranslateErr;
|
||||||
|
let translated = match desc.translate_pk(&mut Translator { network }) {
|
||||||
|
Ok(descriptor) => descriptor,
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
};
|
||||||
// ...and in the key map
|
// ...and in the key map
|
||||||
let fixed_keymap = keymap
|
let fixed_keymap = keymap
|
||||||
.into_iter()
|
.into_iter()
|
||||||
@@ -302,6 +308,10 @@ pub(crate) fn into_wallet_descriptor_checked<T: IntoWalletDescriptor>(
|
|||||||
return Err(DescriptorError::HardenedDerivationXpub);
|
return Err(DescriptorError::HardenedDerivationXpub);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if descriptor.is_multipath() {
|
||||||
|
return Err(DescriptorError::MultiPath);
|
||||||
|
}
|
||||||
|
|
||||||
// Run miniscript's sanity check, which will look for duplicated keys and other potential
|
// Run miniscript's sanity check, which will look for duplicated keys and other potential
|
||||||
// issues
|
// issues
|
||||||
descriptor.sanity_check()?;
|
descriptor.sanity_check()?;
|
||||||
@@ -340,6 +350,18 @@ pub(crate) trait XKeyUtils {
|
|||||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl<T> XKeyUtils for DescriptorMultiXKey<T>
|
||||||
|
where
|
||||||
|
T: InnerXKey,
|
||||||
|
{
|
||||||
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
||||||
|
match self.origin {
|
||||||
|
Some((fingerprint, _)) => fingerprint,
|
||||||
|
None => self.xkey.xkey_fingerprint(secp),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl<T> XKeyUtils for DescriptorXKey<T>
|
impl<T> XKeyUtils for DescriptorXKey<T>
|
||||||
where
|
where
|
||||||
T: InnerXKey,
|
T: InnerXKey,
|
||||||
@@ -466,11 +488,6 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
) {
|
) {
|
||||||
Some(derive_path)
|
Some(derive_path)
|
||||||
} else {
|
} else {
|
||||||
log::debug!(
|
|
||||||
"Key `{}` derived with {} yields an unexpected key",
|
|
||||||
root_fingerprint,
|
|
||||||
derive_path
|
|
||||||
);
|
|
||||||
None
|
None
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
@@ -494,7 +511,10 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
false
|
false
|
||||||
});
|
});
|
||||||
|
|
||||||
path_found.map(|path| self.at_derivation_index(path))
|
path_found.map(|path| {
|
||||||
|
self.at_derivation_index(path)
|
||||||
|
.expect("We ignore hardened wildcards")
|
||||||
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_hd_keypaths(
|
fn derive_from_hd_keypaths(
|
||||||
@@ -545,7 +565,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
let descriptor = self.at_derivation_index(0);
|
let descriptor = self.at_derivation_index(0).expect("0 is not hardened");
|
||||||
match descriptor.desc_type() {
|
match descriptor.desc_type() {
|
||||||
// TODO: add pk() here
|
// TODO: add pk() here
|
||||||
DescriptorType::Pkh
|
DescriptorType::Pkh
|
||||||
@@ -585,11 +605,10 @@ mod test {
|
|||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::consensus::encode::deserialize;
|
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::{bip32, psbt};
|
use bitcoin::ScriptBuf;
|
||||||
use bitcoin::Script;
|
use bitcoin::{bip32, psbt::Psbt};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::psbt::PsbtUtils;
|
use crate::psbt::PsbtUtils;
|
||||||
@@ -600,7 +619,7 @@ mod test {
|
|||||||
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
||||||
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
||||||
@@ -623,7 +642,7 @@ mod test {
|
|||||||
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
||||||
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
||||||
@@ -654,7 +673,7 @@ mod test {
|
|||||||
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
||||||
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
||||||
@@ -678,7 +697,7 @@ mod test {
|
|||||||
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
||||||
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
||||||
@@ -845,6 +864,12 @@ mod test {
|
|||||||
|
|
||||||
assert_matches!(result, Err(DescriptorError::HardenedDerivationXpub));
|
assert_matches!(result, Err(DescriptorError::HardenedDerivationXpub));
|
||||||
|
|
||||||
|
let descriptor = "wpkh(tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/<0;1>/*)";
|
||||||
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
|
assert_matches!(result, Err(DescriptorError::MultiPath));
|
||||||
|
|
||||||
|
// repeated pubkeys
|
||||||
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*))";
|
let descriptor = "wsh(multi(2,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*,tpubD6NzVbkrYhZ4XHndKkuB8FifXm8r5FQHwrN6oZuWCz13qb93rtgKvD4PQsqC4HP4yhV3tA2fqr2RbY5mNXfM7RxXUoeABoDtsFUq2zJq6YK/0/*))";
|
||||||
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
let result = into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet);
|
||||||
|
|
||||||
@@ -861,9 +886,9 @@ mod test {
|
|||||||
let (descriptor, _) =
|
let (descriptor, _) =
|
||||||
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
||||||
|
|
||||||
let descriptor = descriptor.at_derivation_index(0);
|
let descriptor = descriptor.at_derivation_index(0).unwrap();
|
||||||
|
|
||||||
let script = Script::from_str("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
let script = ScriptBuf::from_hex("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
||||||
|
|
||||||
let mut psbt_input = psbt::Input::default();
|
let mut psbt_input = psbt::Input::default();
|
||||||
psbt_input
|
psbt_input
|
||||||
|
|||||||
@@ -33,21 +33,22 @@
|
|||||||
//! let signers = Arc::new(SignersContainer::build(key_map, &extended_desc, &secp));
|
//! let signers = Arc::new(SignersContainer::build(key_map, &extended_desc, &secp));
|
||||||
//! let policy = extended_desc.extract_policy(&signers, BuildSatisfaction::None, &secp)?;
|
//! let policy = extended_desc.extract_policy(&signers, BuildSatisfaction::None, &secp)?;
|
||||||
//! println!("policy: {}", serde_json::to_string(&policy).unwrap());
|
//! println!("policy: {}", serde_json::to_string(&policy).unwrap());
|
||||||
//! # Ok::<(), bdk::Error>(())
|
//! # Ok::<(), anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use crate::collections::{BTreeMap, HashSet, VecDeque};
|
use crate::collections::{BTreeMap, HashSet, VecDeque};
|
||||||
use alloc::string::String;
|
use alloc::string::String;
|
||||||
use alloc::vec::Vec;
|
use alloc::vec::Vec;
|
||||||
use core::cmp::max;
|
use core::cmp::max;
|
||||||
|
|
||||||
use core::fmt;
|
use core::fmt;
|
||||||
|
|
||||||
use serde::ser::SerializeMap;
|
use serde::ser::SerializeMap;
|
||||||
use serde::{Serialize, Serializer};
|
use serde::{Serialize, Serializer};
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
use bitcoin::{absolute, key::XOnlyPublicKey, PublicKey, Sequence};
|
||||||
use bitcoin::{LockTime, PublicKey, Sequence, XOnlyPublicKey};
|
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
||||||
@@ -57,9 +58,6 @@ use miniscript::{
|
|||||||
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
Descriptor, Miniscript, Satisfier, ScriptContext, SigType, Terminal, ToPublicKey,
|
||||||
};
|
};
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
|
||||||
use log::{debug, error, info, trace};
|
|
||||||
|
|
||||||
use crate::descriptor::ExtractPolicy;
|
use crate::descriptor::ExtractPolicy;
|
||||||
use crate::keys::ExtScriptContext;
|
use crate::keys::ExtScriptContext;
|
||||||
use crate::wallet::signer::{SignerId, SignersContainer};
|
use crate::wallet::signer::{SignerId, SignersContainer};
|
||||||
@@ -68,7 +66,7 @@ use crate::wallet::utils::{After, Older, SecpCtx};
|
|||||||
use super::checksum::calc_checksum;
|
use super::checksum::calc_checksum;
|
||||||
use super::error::Error;
|
use super::error::Error;
|
||||||
use super::XKeyUtils;
|
use super::XKeyUtils;
|
||||||
use bitcoin::util::psbt::{Input as PsbtInput, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, Psbt};
|
||||||
use miniscript::psbt::PsbtInputSatisfier;
|
use miniscript::psbt::PsbtInputSatisfier;
|
||||||
|
|
||||||
/// A unique identifier for a key
|
/// A unique identifier for a key
|
||||||
@@ -95,6 +93,9 @@ impl PkOrF {
|
|||||||
..
|
..
|
||||||
}) => PkOrF::XOnlyPubkey(*pk),
|
}) => PkOrF::XOnlyPubkey(*pk),
|
||||||
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
||||||
|
DescriptorPublicKey::MultiXPub(multi) => {
|
||||||
|
PkOrF::Fingerprint(multi.root_fingerprint(secp))
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -131,7 +132,7 @@ pub enum SatisfiableItem {
|
|||||||
/// Absolute timeclock timestamp
|
/// Absolute timeclock timestamp
|
||||||
AbsoluteTimelock {
|
AbsoluteTimelock {
|
||||||
/// The timelock value
|
/// The timelock value
|
||||||
value: LockTime,
|
value: absolute::LockTime,
|
||||||
},
|
},
|
||||||
/// Relative timelock locktime
|
/// Relative timelock locktime
|
||||||
RelativeTimelock {
|
RelativeTimelock {
|
||||||
@@ -451,11 +452,14 @@ pub struct Condition {
|
|||||||
pub csv: Option<Sequence>,
|
pub csv: Option<Sequence>,
|
||||||
/// Optional timelock condition
|
/// Optional timelock condition
|
||||||
#[serde(skip_serializing_if = "Option::is_none")]
|
#[serde(skip_serializing_if = "Option::is_none")]
|
||||||
pub timelock: Option<LockTime>,
|
pub timelock: Option<absolute::LockTime>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Condition {
|
impl Condition {
|
||||||
fn merge_nlocktime(a: LockTime, b: LockTime) -> Result<LockTime, PolicyError> {
|
fn merge_nlocktime(
|
||||||
|
a: absolute::LockTime,
|
||||||
|
b: absolute::LockTime,
|
||||||
|
) -> Result<absolute::LockTime, PolicyError> {
|
||||||
if !a.is_same_unit(b) {
|
if !a.is_same_unit(b) {
|
||||||
Err(PolicyError::MixedTimelockUnits)
|
Err(PolicyError::MixedTimelockUnits)
|
||||||
} else if a > b {
|
} else if a > b {
|
||||||
@@ -515,7 +519,7 @@ pub enum PolicyError {
|
|||||||
impl fmt::Display for PolicyError {
|
impl fmt::Display for PolicyError {
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::NotEnoughItemsSelected(err) => write!(f, "Not enought items selected: {}", err),
|
Self::NotEnoughItemsSelected(err) => write!(f, "Not enough items selected: {}", err),
|
||||||
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
Self::IndexOutOfRange(index) => write!(f, "Index out of range: {}", index),
|
||||||
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
Self::AddOnLeaf => write!(f, "Add on leaf"),
|
||||||
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
Self::AddOnPartialComplete => write!(f, "Add on partial complete"),
|
||||||
@@ -662,11 +666,11 @@ impl Policy {
|
|||||||
(0..*threshold).collect()
|
(0..*threshold).collect()
|
||||||
}
|
}
|
||||||
SatisfiableItem::Multisig { keys, .. } => (0..keys.len()).collect(),
|
SatisfiableItem::Multisig { keys, .. } => (0..keys.len()).collect(),
|
||||||
_ => vec![],
|
_ => HashSet::new(),
|
||||||
};
|
};
|
||||||
let selected = match path.get(&self.id) {
|
let selected: HashSet<_> = match path.get(&self.id) {
|
||||||
Some(arr) => arr,
|
Some(arr) => arr.iter().copied().collect(),
|
||||||
_ => &default,
|
_ => default,
|
||||||
};
|
};
|
||||||
|
|
||||||
match &self.item {
|
match &self.item {
|
||||||
@@ -674,14 +678,24 @@ impl Policy {
|
|||||||
let mapped_req = items
|
let mapped_req = items
|
||||||
.iter()
|
.iter()
|
||||||
.map(|i| i.get_condition(path))
|
.map(|i| i.get_condition(path))
|
||||||
.collect::<Result<Vec<_>, _>>()?;
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// if all the requirements are null we don't care about `selected` because there
|
// if all the requirements are null we don't care about `selected` because there
|
||||||
// are no requirements
|
// are no requirements
|
||||||
if mapped_req.iter().all(Condition::is_null) {
|
if mapped_req
|
||||||
|
.iter()
|
||||||
|
.all(|cond| matches!(cond, Ok(c) if c.is_null()))
|
||||||
|
{
|
||||||
return Ok(Condition::default());
|
return Ok(Condition::default());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// make sure all the indexes in the `selected` list are within range
|
||||||
|
for index in &selected {
|
||||||
|
if *index >= items.len() {
|
||||||
|
return Err(PolicyError::IndexOutOfRange(*index));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
// if we have something, make sure we have enough items. note that the user can set
|
// if we have something, make sure we have enough items. note that the user can set
|
||||||
// an empty value for this step in case of n-of-n, because `selected` is set to all
|
// an empty value for this step in case of n-of-n, because `selected` is set to all
|
||||||
// the elements above
|
// the elements above
|
||||||
@@ -690,23 +704,18 @@ impl Policy {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// check the selected items, see if there are conflicting requirements
|
// check the selected items, see if there are conflicting requirements
|
||||||
let mut requirements = Condition::default();
|
mapped_req
|
||||||
for item_index in selected {
|
.into_iter()
|
||||||
requirements = requirements.merge(
|
.enumerate()
|
||||||
mapped_req
|
.filter(|(index, _)| selected.contains(index))
|
||||||
.get(*item_index)
|
.try_fold(Condition::default(), |acc, (_, cond)| acc.merge(&cond?))
|
||||||
.ok_or(PolicyError::IndexOutOfRange(*item_index))?,
|
|
||||||
)?;
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(requirements)
|
|
||||||
}
|
}
|
||||||
SatisfiableItem::Multisig { keys, threshold } => {
|
SatisfiableItem::Multisig { keys, threshold } => {
|
||||||
if selected.len() < *threshold {
|
if selected.len() < *threshold {
|
||||||
return Err(PolicyError::NotEnoughItemsSelected(self.id.clone()));
|
return Err(PolicyError::NotEnoughItemsSelected(self.id.clone()));
|
||||||
}
|
}
|
||||||
if let Some(item) = selected.iter().find(|i| **i >= keys.len()) {
|
if let Some(item) = selected.into_iter().find(|&i| i >= keys.len()) {
|
||||||
return Err(PolicyError::IndexOutOfRange(*item));
|
return Err(PolicyError::IndexOutOfRange(item));
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(Condition::default())
|
Ok(Condition::default())
|
||||||
@@ -744,6 +753,7 @@ fn signer_id(key: &DescriptorPublicKey, secp: &SecpCtx) -> SignerId {
|
|||||||
..
|
..
|
||||||
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
||||||
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -781,9 +791,9 @@ fn make_generic_signature<M: Fn() -> SatisfiableItem, F: Fn(&Psbt) -> bool>(
|
|||||||
fn generic_sig_in_psbt<
|
fn generic_sig_in_psbt<
|
||||||
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
||||||
// for a specific key
|
// for a specific key
|
||||||
C: Fn(&PsbtInput, &SinglePubKey) -> bool,
|
C: Fn(&psbt::Input, &SinglePubKey) -> bool,
|
||||||
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
||||||
E: Fn(&PsbtInput, Fingerprint) -> Option<SinglePubKey>,
|
E: Fn(&psbt::Input, Fingerprint) -> Option<SinglePubKey>,
|
||||||
>(
|
>(
|
||||||
psbt: &Psbt,
|
psbt: &Psbt,
|
||||||
key: &DescriptorPublicKey,
|
key: &DescriptorPublicKey,
|
||||||
@@ -801,6 +811,13 @@ fn generic_sig_in_psbt<
|
|||||||
None => false,
|
None => false,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => {
|
||||||
|
//TODO check actual derivation matches
|
||||||
|
match extract(input, xpub.root_fingerprint(secp)) {
|
||||||
|
Some(pubkey) => check(input, &pubkey),
|
||||||
|
None => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -906,12 +923,12 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
}
|
}
|
||||||
Terminal::After(value) => {
|
Terminal::After(value) => {
|
||||||
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
||||||
value: value.into(),
|
value: (*value).into(),
|
||||||
}
|
}
|
||||||
.into();
|
.into();
|
||||||
policy.contribution = Satisfaction::Complete {
|
policy.contribution = Satisfaction::Complete {
|
||||||
condition: Condition {
|
condition: Condition {
|
||||||
timelock: Some(value.into()),
|
timelock: Some((*value).into()),
|
||||||
csv: None,
|
csv: None,
|
||||||
},
|
},
|
||||||
};
|
};
|
||||||
@@ -923,9 +940,9 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
{
|
{
|
||||||
let after = After::new(Some(current_height), false);
|
let after = After::new(Some(current_height), false);
|
||||||
let after_sat =
|
let after_sat =
|
||||||
Satisfier::<bitcoin::PublicKey>::check_after(&after, value.into());
|
Satisfier::<bitcoin::PublicKey>::check_after(&after, (*value).into());
|
||||||
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
||||||
Satisfier::<bitcoin::PublicKey>::check_after(&sat, value.into())
|
Satisfier::<bitcoin::PublicKey>::check_after(&sat, (*value).into())
|
||||||
});
|
});
|
||||||
if after_sat && inputs_sat {
|
if after_sat && inputs_sat {
|
||||||
policy.satisfaction = policy.contribution.clone();
|
policy.satisfaction = policy.contribution.clone();
|
||||||
@@ -1151,8 +1168,8 @@ mod test {
|
|||||||
use crate::wallet::signer::SignersContainer;
|
use crate::wallet::signer::SignersContainer;
|
||||||
use alloc::{string::ToString, sync::Arc};
|
use alloc::{string::ToString, sync::Arc};
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
@@ -1570,6 +1587,7 @@ mod test {
|
|||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -1636,6 +1654,7 @@ mod test {
|
|||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
|
|||||||
@@ -14,10 +14,10 @@
|
|||||||
//! This module contains the definition of various common script templates that are ready to be
|
//! This module contains the definition of various common script templates that are ready to be
|
||||||
//! used. See the documentation of each template for an example.
|
//! used. See the documentation of each template for an example.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::{Legacy, Segwitv0};
|
use miniscript::{Legacy, Segwitv0, Tap};
|
||||||
|
|
||||||
use super::{ExtendedDescriptor, IntoWalletDescriptor, KeyMap};
|
use super::{ExtendedDescriptor, IntoWalletDescriptor, KeyMap};
|
||||||
use crate::descriptor::DescriptorError;
|
use crate::descriptor::DescriptorError;
|
||||||
@@ -152,6 +152,34 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh<K> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// P2TR template. Expands to a descriptor `tr(key)`
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::Wallet;
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::P2TR;
|
||||||
|
///
|
||||||
|
/// let key =
|
||||||
|
/// bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")?;
|
||||||
|
/// let mut wallet = Wallet::new_no_persist(P2TR(key), None, Network::Testnet)?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(
|
||||||
|
/// wallet.get_address(New).to_string(),
|
||||||
|
/// "tb1pvjf9t34fznr53u5tqhejz4nr69luzkhlvsdsdfq9pglutrpve2xq7hps46"
|
||||||
|
/// );
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct P2TR<K: IntoDescriptorKey<Tap>>(pub K);
|
||||||
|
|
||||||
|
impl<K: IntoDescriptorKey<Tap>> DescriptorTemplate for P2TR<K> {
|
||||||
|
fn build(self, _network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
descriptor!(tr(self.0))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// BIP44 template. Expands to `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
/// BIP44 template. Expands to `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
///
|
///
|
||||||
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
||||||
@@ -167,7 +195,7 @@ impl<K: IntoDescriptorKey<Segwitv0>> DescriptorTemplate for P2Wpkh<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44;
|
/// use bdk::template::Bip44;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let mut wallet = Wallet::new_no_persist(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip44(key.clone(), KeychainKind::External),
|
/// Bip44(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip44(key, KeychainKind::Internal)),
|
/// Some(Bip44(key, KeychainKind::Internal)),
|
||||||
@@ -204,8 +232,8 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44Public;
|
/// use bdk::template::Bip44Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let mut wallet = Wallet::new_no_persist(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@@ -242,7 +270,7 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49;
|
/// use bdk::template::Bip49;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let mut wallet = Wallet::new_no_persist(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip49(key.clone(), KeychainKind::External),
|
/// Bip49(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip49(key, KeychainKind::Internal)),
|
/// Some(Bip49(key, KeychainKind::Internal)),
|
||||||
@@ -279,8 +307,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49Public;
|
/// use bdk::template::Bip49Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let mut wallet = Wallet::new_no_persist(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@@ -317,7 +345,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84;
|
/// use bdk::template::Bip84;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let mut wallet = Wallet::new_no_persist(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip84(key.clone(), KeychainKind::External),
|
/// Bip84(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip84(key, KeychainKind::Internal)),
|
/// Some(Bip84(key, KeychainKind::Internal)),
|
||||||
@@ -354,8 +382,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84Public;
|
/// use bdk::template::Bip84Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let mut wallet = Wallet::new_no_persist(
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@@ -377,6 +405,81 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84Public<K> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// BIP86 template. Expands to `tr(key/86'/{0,1}'/0'/{0,1}/*)`
|
||||||
|
///
|
||||||
|
/// Since there are hardened derivation steps, this template requires a private derivable key (generally a `xprv`/`tprv`).
|
||||||
|
///
|
||||||
|
/// See [`Bip86Public`] for a template that can work with a `xpub`/`tpub`.
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::Bip86;
|
||||||
|
///
|
||||||
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
|
/// Bip86(key.clone(), KeychainKind::External),
|
||||||
|
/// Some(Bip86(key, KeychainKind::Internal)),
|
||||||
|
/// Network::Testnet,
|
||||||
|
/// )?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(wallet.get_address(New).to_string(), "tb1p5unlj09djx8xsjwe97269kqtxqpwpu2epeskgqjfk4lnf69v4tnqpp35qu");
|
||||||
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "tr([c55b303f/86'/1'/0']tpubDCiHofpEs47kx358bPdJmTZHmCDqQ8qw32upCSxHrSEdeeBs2T5Mq6QMB2ukeMqhNBiyhosBvJErteVhfURPGXPv3qLJPw5MVpHUewsbP2m/0/*)#dkgvr5hm");
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct Bip86<K: DerivableKey<Tap>>(pub K, pub KeychainKind);
|
||||||
|
|
||||||
|
impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86<K> {
|
||||||
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
P2TR(segwit_v1::make_bipxx_private(86, self.0, self.1, network)?).build(network)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// BIP86 public template. Expands to `tr(key/{0,1}/*)`
|
||||||
|
///
|
||||||
|
/// This assumes that the key used has already been derived with `m/86'/0'/0'` for Mainnet or `m/86'/1'/0'` for Testnet.
|
||||||
|
///
|
||||||
|
/// This template requires the parent fingerprint to populate correctly the metadata of PSBTs.
|
||||||
|
///
|
||||||
|
/// See [`Bip86`] for a template that does the full derivation, but requires private data
|
||||||
|
/// for the key.
|
||||||
|
///
|
||||||
|
/// ## Example
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # use bdk::bitcoin::{PrivateKey, Network};
|
||||||
|
/// # use bdk::{Wallet, KeychainKind};
|
||||||
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
|
/// use bdk::template::Bip86Public;
|
||||||
|
///
|
||||||
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
|
/// let mut wallet = Wallet::new_no_persist(
|
||||||
|
/// Bip86Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
|
/// Some(Bip86Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
|
/// Network::Testnet,
|
||||||
|
/// )?;
|
||||||
|
///
|
||||||
|
/// assert_eq!(wallet.get_address(New).to_string(), "tb1pwjp9f2k5n0xq73ecuu0c5njvgqr3vkh7yaylmpqvsuuaafymh0msvcmh37");
|
||||||
|
/// assert_eq!(wallet.public_descriptor(KeychainKind::External).unwrap().to_string(), "tr([c55b303f/86'/1'/0']tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q/0/*)#2p65srku");
|
||||||
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
||||||
|
/// ```
|
||||||
|
pub struct Bip86Public<K: DerivableKey<Tap>>(pub K, pub bip32::Fingerprint, pub KeychainKind);
|
||||||
|
|
||||||
|
impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86Public<K> {
|
||||||
|
fn build(self, network: Network) -> Result<DescriptorTemplateOut, DescriptorError> {
|
||||||
|
P2TR(segwit_v1::make_bipxx_public(
|
||||||
|
86, self.0, self.1, self.2, network,
|
||||||
|
)?)
|
||||||
|
.build(network)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
macro_rules! expand_make_bipxx {
|
macro_rules! expand_make_bipxx {
|
||||||
( $mod_name:ident, $ctx:ty ) => {
|
( $mod_name:ident, $ctx:ty ) => {
|
||||||
mod $mod_name {
|
mod $mod_name {
|
||||||
@@ -443,6 +546,7 @@ macro_rules! expand_make_bipxx {
|
|||||||
|
|
||||||
expand_make_bipxx!(legacy, Legacy);
|
expand_make_bipxx!(legacy, Legacy);
|
||||||
expand_make_bipxx!(segwit_v0, Segwitv0);
|
expand_make_bipxx!(segwit_v0, Segwitv0);
|
||||||
|
expand_make_bipxx!(segwit_v1, Tap);
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
@@ -455,38 +559,37 @@ mod test {
|
|||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::ValidNetworks;
|
use crate::keys::ValidNetworks;
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::network::constants::Network::Regtest;
|
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::Descriptor;
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template_cointype() {
|
fn test_bip44_template_cointype() {
|
||||||
use bitcoin::util::bip32::ChildNumber::{self, Hardened};
|
use bitcoin::bip32::ChildNumber::{self, Hardened};
|
||||||
|
|
||||||
let xprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
let xprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
||||||
assert_eq!(Network::Bitcoin, xprvkey.network);
|
assert_eq!(Network::Bitcoin, xprvkey.network);
|
||||||
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Bitcoin)
|
.build(Network::Bitcoin)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.first().unwrap();
|
||||||
assert_matches!(purpose, Hardened { index: 44 });
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert_matches!(coin_type, Hardened { index: 0 });
|
assert_matches!(coin_type, Hardened { index: 0 });
|
||||||
}
|
}
|
||||||
|
|
||||||
let tprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let tprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
assert_eq!(Network::Testnet, tprvkey.network);
|
assert_eq!(Network::Testnet, tprvkey.network);
|
||||||
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Testnet)
|
.build(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.first().unwrap();
|
||||||
assert_matches!(purpose, Hardened { index: 44 });
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert_matches!(coin_type, Hardened { index: 1 });
|
assert_matches!(coin_type, Hardened { index: 1 });
|
||||||
@@ -497,20 +600,23 @@ mod test {
|
|||||||
fn check(
|
fn check(
|
||||||
desc: Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>,
|
desc: Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>,
|
||||||
is_witness: bool,
|
is_witness: bool,
|
||||||
|
is_taproot: bool,
|
||||||
is_fixed: bool,
|
is_fixed: bool,
|
||||||
|
network: Network,
|
||||||
expected: &[&str],
|
expected: &[&str],
|
||||||
) {
|
) {
|
||||||
let (desc, _key_map, _networks) = desc.unwrap();
|
let (desc, _key_map, _networks) = desc.unwrap();
|
||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
|
assert_eq!(desc.is_taproot(), is_taproot);
|
||||||
assert_eq!(!desc.has_wildcard(), is_fixed);
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let index = i as u32;
|
||||||
let child_desc = if !desc.has_wildcard() {
|
let child_desc = if !desc.has_wildcard() {
|
||||||
desc.at_derivation_index(0)
|
desc.at_derivation_index(0).unwrap()
|
||||||
} else {
|
} else {
|
||||||
desc.at_derivation_index(index)
|
desc.at_derivation_index(index).unwrap()
|
||||||
};
|
};
|
||||||
let address = child_desc.address(Regtest).unwrap();
|
let address = child_desc.address(network).unwrap();
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -524,7 +630,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Pkh(prvkey).build(Network::Bitcoin),
|
P2Pkh(prvkey).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"],
|
&["mwJ8hxFYW19JLuc65RCTaP4v1rzVU8cVMT"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -535,7 +643,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Pkh(pubkey).build(Network::Bitcoin),
|
P2Pkh(pubkey).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["muZpTpBYhxmRFuCjLc7C6BBDF32C8XVJUi"],
|
&["muZpTpBYhxmRFuCjLc7C6BBDF32C8XVJUi"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@@ -549,7 +659,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh_P2Sh(prvkey).build(Network::Bitcoin),
|
P2Wpkh_P2Sh(prvkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"],
|
&["2NB4ox5VDRw1ecUv6SnT3VQHPXveYztRqk5"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -560,7 +672,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh_P2Sh(pubkey).build(Network::Bitcoin),
|
P2Wpkh_P2Sh(pubkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["2N5LiC3CqzxDamRTPG1kiNv1FpNJQ7x28sb"],
|
&["2N5LiC3CqzxDamRTPG1kiNv1FpNJQ7x28sb"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
@@ -574,7 +688,9 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh(prvkey).build(Network::Bitcoin),
|
P2Wpkh(prvkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["bcrt1q4525hmgw265tl3drrl8jjta7ayffu6jfcwxx9y"],
|
&["bcrt1q4525hmgw265tl3drrl8jjta7ayffu6jfcwxx9y"],
|
||||||
);
|
);
|
||||||
|
|
||||||
@@ -585,19 +701,52 @@ mod test {
|
|||||||
check(
|
check(
|
||||||
P2Wpkh(pubkey).build(Network::Bitcoin),
|
P2Wpkh(pubkey).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
|
false,
|
||||||
true,
|
true,
|
||||||
|
Network::Regtest,
|
||||||
&["bcrt1qngw83fg8dz0k749cg7k3emc7v98wy0c7azaa6h"],
|
&["bcrt1qngw83fg8dz0k749cg7k3emc7v98wy0c7azaa6h"],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// P2TR `tr(key)`
|
||||||
|
#[test]
|
||||||
|
fn test_p2tr_template() {
|
||||||
|
let prvkey =
|
||||||
|
bitcoin::PrivateKey::from_wif("cTc4vURSzdx6QE6KVynWGomDbLaA75dNALMNyfjh3p8DRRar84Um")
|
||||||
|
.unwrap();
|
||||||
|
check(
|
||||||
|
P2TR(prvkey).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
true,
|
||||||
|
Network::Regtest,
|
||||||
|
&["bcrt1pvjf9t34fznr53u5tqhejz4nr69luzkhlvsdsdfq9pglutrpve2xqnwtkqq"],
|
||||||
|
);
|
||||||
|
|
||||||
|
let pubkey = bitcoin::PublicKey::from_str(
|
||||||
|
"03a34b99f22c790c4e36b2b3c2c35a36db06226e41c692fc82b8b56ac1c540c5bd",
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
check(
|
||||||
|
P2TR(pubkey).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
true,
|
||||||
|
Network::Regtest,
|
||||||
|
&["bcrt1pw74tdcrxlzn5r8z6ku2vztr86fgq0m245s72mjktf4afwzsf8ugs4evwdf"],
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template() {
|
fn test_bip44_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"n453VtnjDHPyDt2fDstKSu7A3YCJoHZ5g5",
|
"n453VtnjDHPyDt2fDstKSu7A3YCJoHZ5g5",
|
||||||
"mvfrrumXgTtwFPWDNUecBBgzuMXhYM7KRP",
|
"mvfrrumXgTtwFPWDNUecBBgzuMXhYM7KRP",
|
||||||
@@ -608,6 +757,8 @@ mod test {
|
|||||||
Bip44(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"muHF98X9KxEzdKrnFAX85KeHv96eXopaip",
|
"muHF98X9KxEzdKrnFAX85KeHv96eXopaip",
|
||||||
"n4hpyLJE5ub6B5Bymv4eqFxS5KjrewSmYR",
|
"n4hpyLJE5ub6B5Bymv4eqFxS5KjrewSmYR",
|
||||||
@@ -619,12 +770,14 @@ mod test {
|
|||||||
// BIP44 public `pkh(key/{0,1}/*)`
|
// BIP44 public `pkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_public_template() {
|
fn test_bip44_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"miNG7dJTzJqNbFS19svRdTCisC65dsubtR",
|
"miNG7dJTzJqNbFS19svRdTCisC65dsubtR",
|
||||||
"n2UqaDbCjWSFJvpC84m3FjUk5UaeibCzYg",
|
"n2UqaDbCjWSFJvpC84m3FjUk5UaeibCzYg",
|
||||||
@@ -635,6 +788,8 @@ mod test {
|
|||||||
Bip44Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"moDr3vJ8wpt5nNxSK55MPq797nXJb2Ru9H",
|
"moDr3vJ8wpt5nNxSK55MPq797nXJb2Ru9H",
|
||||||
"ms7A1Yt4uTezT2XkefW12AvLoko8WfNJMG",
|
"ms7A1Yt4uTezT2XkefW12AvLoko8WfNJMG",
|
||||||
@@ -646,11 +801,13 @@ mod test {
|
|||||||
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_template() {
|
fn test_bip49_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2N9bCAJXGm168MjVwpkBdNt6ucka3PKVoUV",
|
"2N9bCAJXGm168MjVwpkBdNt6ucka3PKVoUV",
|
||||||
"2NDckYkqrYyDMtttEav5hB3Bfw9EGAW5HtS",
|
"2NDckYkqrYyDMtttEav5hB3Bfw9EGAW5HtS",
|
||||||
@@ -661,6 +818,8 @@ mod test {
|
|||||||
Bip49(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2NB3pA8PnzJLGV8YEKNDFpbViZv3Bm1K6CG",
|
"2NB3pA8PnzJLGV8YEKNDFpbViZv3Bm1K6CG",
|
||||||
"2NBiX2Wzxngb5rPiWpUiJQ2uLVB4HBjFD4p",
|
"2NBiX2Wzxngb5rPiWpUiJQ2uLVB4HBjFD4p",
|
||||||
@@ -672,12 +831,14 @@ mod test {
|
|||||||
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_public_template() {
|
fn test_bip49_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt",
|
"2N3K4xbVAHoiTQSwxkZjWDfKoNC27pLkYnt",
|
||||||
"2NCTQfJ1sZa3wQ3pPseYRHbaNEpC3AquEfX",
|
"2NCTQfJ1sZa3wQ3pPseYRHbaNEpC3AquEfX",
|
||||||
@@ -688,6 +849,8 @@ mod test {
|
|||||||
Bip49Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"2NF2vttKibwyxigxtx95Zw8K7JhDbo5zPVJ",
|
"2NF2vttKibwyxigxtx95Zw8K7JhDbo5zPVJ",
|
||||||
"2Mtmyd8taksxNVWCJ4wVvaiss7QPZGcAJuH",
|
"2Mtmyd8taksxNVWCJ4wVvaiss7QPZGcAJuH",
|
||||||
@@ -699,11 +862,13 @@ mod test {
|
|||||||
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_template() {
|
fn test_bip84_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qkmvk2nadgplmd57ztld8nf8v2yxkzmdvwtjf8s",
|
"bcrt1qkmvk2nadgplmd57ztld8nf8v2yxkzmdvwtjf8s",
|
||||||
"bcrt1qx0v6zgfwe50m4kqc58cqzcyem7ay2sfl3gvqhp",
|
"bcrt1qx0v6zgfwe50m4kqc58cqzcyem7ay2sfl3gvqhp",
|
||||||
@@ -714,6 +879,8 @@ mod test {
|
|||||||
Bip84(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qtrwtz00wxl69e5xex7amy4xzlxkaefg3gfdkxa",
|
"bcrt1qtrwtz00wxl69e5xex7amy4xzlxkaefg3gfdkxa",
|
||||||
"bcrt1qqqasfhxpkkf7zrxqnkr2sfhn74dgsrc3e3ky45",
|
"bcrt1qqqasfhxpkkf7zrxqnkr2sfhn74dgsrc3e3ky45",
|
||||||
@@ -725,12 +892,14 @@ mod test {
|
|||||||
// BIP84 public `wpkh(key/{0,1}/*)`
|
// BIP84 public `wpkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_public_template() {
|
fn test_bip84_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2prcdvd0h",
|
"bcrt1qedg9fdlf8cnnqfd5mks6uz5w4kgpk2prcdvd0h",
|
||||||
"bcrt1q3lncdlwq3lgcaaeyruynjnlccr0ve0kakh6ana",
|
"bcrt1q3lncdlwq3lgcaaeyruynjnlccr0ve0kakh6ana",
|
||||||
@@ -741,6 +910,8 @@ mod test {
|
|||||||
Bip84Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
false,
|
false,
|
||||||
|
false,
|
||||||
|
Network::Regtest,
|
||||||
&[
|
&[
|
||||||
"bcrt1qm6wqukenh7guu792lj2njgw9n78cmwsy8xy3z2",
|
"bcrt1qm6wqukenh7guu792lj2njgw9n78cmwsy8xy3z2",
|
||||||
"bcrt1q694twxtjn4nnrvnyvra769j0a23rllj5c6cgwp",
|
"bcrt1q694twxtjn4nnrvnyvra769j0a23rllj5c6cgwp",
|
||||||
@@ -748,4 +919,67 @@ mod test {
|
|||||||
],
|
],
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// BIP86 `tr(key/86'/0'/0'/{0,1}/*)`
|
||||||
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
|
#[test]
|
||||||
|
fn test_bip86_template() {
|
||||||
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
||||||
|
check(
|
||||||
|
Bip86(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p5cyxnuxmeuwuvkwfem96lqzszd02n6xdcjrs20cac6yqjjwudpxqkedrcr",
|
||||||
|
"bc1p4qhjn9zdvkux4e44uhx8tc55attvtyu358kutcqkudyccelu0was9fqzwh",
|
||||||
|
"bc1p0d0rhyynq0awa9m8cqrcr8f5nxqx3aw29w4ru5u9my3h0sfygnzs9khxz8",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
check(
|
||||||
|
Bip86(prvkey, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p3qkhfews2uk44qtvauqyr2ttdsw7svhkl9nkm9s9c3x4ax5h60wqwruhk7",
|
||||||
|
"bc1ptdg60grjk9t3qqcqczp4tlyy3z47yrx9nhlrjsmw36q5a72lhdrs9f00nj",
|
||||||
|
"bc1pgcwgsu8naxp7xlp5p7ufzs7emtfza2las7r2e7krzjhe5qj5xz2q88kmk5",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// BIP86 public `tr(key/{0,1}/*)`
|
||||||
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
|
#[test]
|
||||||
|
fn test_bip86_public_template() {
|
||||||
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
||||||
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
||||||
|
check(
|
||||||
|
Bip86Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p5cyxnuxmeuwuvkwfem96lqzszd02n6xdcjrs20cac6yqjjwudpxqkedrcr",
|
||||||
|
"bc1p4qhjn9zdvkux4e44uhx8tc55attvtyu358kutcqkudyccelu0was9fqzwh",
|
||||||
|
"bc1p0d0rhyynq0awa9m8cqrcr8f5nxqx3aw29w4ru5u9my3h0sfygnzs9khxz8",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
check(
|
||||||
|
Bip86Public(pubkey, fingerprint, KeychainKind::Internal).build(Network::Bitcoin),
|
||||||
|
false,
|
||||||
|
true,
|
||||||
|
false,
|
||||||
|
Network::Bitcoin,
|
||||||
|
&[
|
||||||
|
"bc1p3qkhfews2uk44qtvauqyr2ttdsw7svhkl9nkm9s9c3x4ax5h60wqwruhk7",
|
||||||
|
"bc1ptdg60grjk9t3qqcqczp4tlyy3z47yrx9nhlrjsmw36q5a72lhdrs9f00nj",
|
||||||
|
"bc1pgcwgsu8naxp7xlp5p7ufzs7emtfza2las7r2e7krzjhe5qj5xz2q88kmk5",
|
||||||
|
],
|
||||||
|
);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,199 +0,0 @@
|
|||||||
// Bitcoin Dev Kit
|
|
||||||
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
|
||||||
//
|
|
||||||
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
|
||||||
//
|
|
||||||
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
|
||||||
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
|
||||||
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
|
||||||
// You may not use this file except in accordance with one or both of these
|
|
||||||
// licenses.
|
|
||||||
|
|
||||||
use crate::bitcoin::Network;
|
|
||||||
use crate::{descriptor, wallet};
|
|
||||||
use alloc::{string::String, vec::Vec};
|
|
||||||
use bitcoin::{OutPoint, Txid};
|
|
||||||
use core::fmt;
|
|
||||||
|
|
||||||
/// Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
|
||||||
#[derive(Debug)]
|
|
||||||
pub enum Error {
|
|
||||||
/// Generic error
|
|
||||||
Generic(String),
|
|
||||||
/// Cannot build a tx without recipients
|
|
||||||
NoRecipients,
|
|
||||||
/// `manually_selected_only` option is selected but no utxo has been passed
|
|
||||||
NoUtxosSelected,
|
|
||||||
/// Output created is under the dust limit, 546 satoshis
|
|
||||||
OutputBelowDustLimit(usize),
|
|
||||||
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
|
||||||
InsufficientFunds {
|
|
||||||
/// Sats needed for some transaction
|
|
||||||
needed: u64,
|
|
||||||
/// Sats available for spending
|
|
||||||
available: u64,
|
|
||||||
},
|
|
||||||
/// Branch and bound coin selection possible attempts with sufficiently big UTXO set could grow
|
|
||||||
/// exponentially, thus a limit is set, and when hit, this error is thrown
|
|
||||||
BnBTotalTriesExceeded,
|
|
||||||
/// Branch and bound coin selection tries to avoid needing a change by finding the right inputs for
|
|
||||||
/// the desired outputs plus fee, if there is not such combination this error is thrown
|
|
||||||
BnBNoExactMatch,
|
|
||||||
/// Happens when trying to spend an UTXO that is not in the internal database
|
|
||||||
UnknownUtxo,
|
|
||||||
/// Thrown when a tx is not found in the internal database
|
|
||||||
TransactionNotFound,
|
|
||||||
/// Happens when trying to bump a transaction that is already confirmed
|
|
||||||
TransactionConfirmed,
|
|
||||||
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
|
||||||
IrreplaceableTransaction,
|
|
||||||
/// When bumping a tx the fee rate requested is lower than required
|
|
||||||
FeeRateTooLow {
|
|
||||||
/// Required fee rate (satoshi/vbyte)
|
|
||||||
required: crate::types::FeeRate,
|
|
||||||
},
|
|
||||||
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
|
||||||
FeeTooLow {
|
|
||||||
/// Required fee absolute value (satoshi)
|
|
||||||
required: u64,
|
|
||||||
},
|
|
||||||
/// Node doesn't have data to estimate a fee rate
|
|
||||||
FeeRateUnavailable,
|
|
||||||
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
|
||||||
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
|
||||||
/// explicit origin provided
|
|
||||||
///
|
|
||||||
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
|
||||||
MissingKeyOrigin(String),
|
|
||||||
/// Error while working with [`keys`](crate::keys)
|
|
||||||
Key(crate::keys::KeyError),
|
|
||||||
/// Descriptor checksum mismatch
|
|
||||||
ChecksumMismatch,
|
|
||||||
/// Spending policy is not compatible with this [`KeychainKind`](crate::types::KeychainKind)
|
|
||||||
SpendingPolicyRequired(crate::types::KeychainKind),
|
|
||||||
/// Error while extracting and manipulating policies
|
|
||||||
InvalidPolicyPathError(crate::descriptor::policy::PolicyError),
|
|
||||||
/// Signing error
|
|
||||||
Signer(crate::wallet::signer::SignerError),
|
|
||||||
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
|
||||||
InvalidOutpoint(OutPoint),
|
|
||||||
/// Error related to the parsing and usage of descriptors
|
|
||||||
Descriptor(crate::descriptor::error::Error),
|
|
||||||
/// Miniscript error
|
|
||||||
Miniscript(miniscript::Error),
|
|
||||||
/// Miniscript PSBT error
|
|
||||||
MiniscriptPsbt(MiniscriptPsbtError),
|
|
||||||
/// BIP32 error
|
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
|
||||||
/// Partially signed bitcoin transaction error
|
|
||||||
Psbt(bitcoin::util::psbt::Error),
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Errors returned by miniscript when updating inconsistent PSBTs
|
|
||||||
#[derive(Debug, Clone)]
|
|
||||||
pub enum MiniscriptPsbtError {
|
|
||||||
Conversion(miniscript::descriptor::ConversionError),
|
|
||||||
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
|
||||||
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl fmt::Display for MiniscriptPsbtError {
|
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
||||||
match self {
|
|
||||||
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
|
||||||
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
|
||||||
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::error::Error for MiniscriptPsbtError {}
|
|
||||||
|
|
||||||
impl fmt::Display for Error {
|
|
||||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
|
||||||
match self {
|
|
||||||
Self::Generic(err) => write!(f, "Generic error: {}", err),
|
|
||||||
Self::NoRecipients => write!(f, "Cannot build tx without recipients"),
|
|
||||||
Self::NoUtxosSelected => write!(f, "No UTXO selected"),
|
|
||||||
Self::OutputBelowDustLimit(limit) => {
|
|
||||||
write!(f, "Output below the dust limit: {}", limit)
|
|
||||||
}
|
|
||||||
Self::InsufficientFunds { needed, available } => write!(
|
|
||||||
f,
|
|
||||||
"Insufficient funds: {} sat available of {} sat needed",
|
|
||||||
available, needed
|
|
||||||
),
|
|
||||||
Self::BnBTotalTriesExceeded => {
|
|
||||||
write!(f, "Branch and bound coin selection: total tries exceeded")
|
|
||||||
}
|
|
||||||
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
|
||||||
Self::UnknownUtxo => write!(f, "UTXO not found in the internal database"),
|
|
||||||
Self::TransactionNotFound => {
|
|
||||||
write!(f, "Transaction not found in the internal database")
|
|
||||||
}
|
|
||||||
Self::TransactionConfirmed => write!(f, "Transaction already confirmed"),
|
|
||||||
Self::IrreplaceableTransaction => write!(f, "Transaction can't be replaced"),
|
|
||||||
Self::FeeRateTooLow { required } => write!(
|
|
||||||
f,
|
|
||||||
"Fee rate too low: required {} sat/vbyte",
|
|
||||||
required.as_sat_per_vb()
|
|
||||||
),
|
|
||||||
Self::FeeTooLow { required } => write!(f, "Fee to low: required {} sat", required),
|
|
||||||
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
|
||||||
Self::MissingKeyOrigin(err) => write!(f, "Missing key origin: {}", err),
|
|
||||||
Self::Key(err) => write!(f, "Key error: {}", err),
|
|
||||||
Self::ChecksumMismatch => write!(f, "Descriptor checksum mismatch"),
|
|
||||||
Self::SpendingPolicyRequired(keychain_kind) => {
|
|
||||||
write!(f, "Spending policy required: {:?}", keychain_kind)
|
|
||||||
}
|
|
||||||
Self::InvalidPolicyPathError(err) => write!(f, "Invalid policy path: {}", err),
|
|
||||||
Self::Signer(err) => write!(f, "Signer error: {}", err),
|
|
||||||
Self::InvalidOutpoint(outpoint) => write!(
|
|
||||||
f,
|
|
||||||
"Requested outpoint doesn't exist in the tx: {}",
|
|
||||||
outpoint
|
|
||||||
),
|
|
||||||
Self::Descriptor(err) => write!(f, "Descriptor error: {}", err),
|
|
||||||
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
|
||||||
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
|
||||||
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
|
||||||
Self::Psbt(err) => write!(f, "PSBT error: {}", err),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
|
||||||
impl std::error::Error for Error {}
|
|
||||||
|
|
||||||
macro_rules! impl_error {
|
|
||||||
( $from:ty, $to:ident ) => {
|
|
||||||
impl_error!($from, $to, Error);
|
|
||||||
};
|
|
||||||
( $from:ty, $to:ident, $impl_for:ty ) => {
|
|
||||||
impl core::convert::From<$from> for $impl_for {
|
|
||||||
fn from(err: $from) -> Self {
|
|
||||||
<$impl_for>::$to(err)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
impl_error!(descriptor::error::Error, Descriptor);
|
|
||||||
impl_error!(descriptor::policy::PolicyError, InvalidPolicyPathError);
|
|
||||||
impl_error!(wallet::signer::SignerError, Signer);
|
|
||||||
|
|
||||||
impl From<crate::keys::KeyError> for Error {
|
|
||||||
fn from(key_error: crate::keys::KeyError) -> Error {
|
|
||||||
match key_error {
|
|
||||||
crate::keys::KeyError::Miniscript(inner) => Error::Miniscript(inner),
|
|
||||||
crate::keys::KeyError::Bip32(inner) => Error::Bip32(inner),
|
|
||||||
crate::keys::KeyError::InvalidChecksum => Error::ChecksumMismatch,
|
|
||||||
e => Error::Key(e),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
|
||||||
impl_error!(MiniscriptPsbtError, MiniscriptPsbt);
|
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
|
||||||
impl_error!(bitcoin::util::psbt::Error, Psbt);
|
|
||||||
@@ -15,7 +15,7 @@
|
|||||||
// something that should be fairly simple to re-implement.
|
// something that should be fairly simple to re-implement.
|
||||||
|
|
||||||
use alloc::string::String;
|
use alloc::string::String;
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
@@ -142,7 +142,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
(word_count, language): Self::Options,
|
(word_count, language): Self::Options,
|
||||||
entropy: Self::Entropy,
|
entropy: Self::Entropy,
|
||||||
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
||||||
let entropy = &entropy.as_ref()[..(word_count as usize / 8)];
|
let entropy = &entropy[..(word_count as usize / 8)];
|
||||||
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
||||||
|
|
||||||
Ok(GeneratedKey::new(mnemonic, any_network()))
|
Ok(GeneratedKey::new(mnemonic, any_network()))
|
||||||
@@ -154,7 +154,7 @@ mod test {
|
|||||||
use alloc::string::ToString;
|
use alloc::string::ToString;
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use bip39::{Language, Mnemonic};
|
use bip39::{Language, Mnemonic};
|
||||||
|
|
||||||
|
|||||||
@@ -15,14 +15,15 @@ use crate::collections::HashSet;
|
|||||||
use alloc::string::{String, ToString};
|
use alloc::string::{String, ToString};
|
||||||
use alloc::vec::Vec;
|
use alloc::vec::Vec;
|
||||||
use core::any::TypeId;
|
use core::any::TypeId;
|
||||||
|
use core::fmt;
|
||||||
use core::marker::PhantomData;
|
use core::marker::PhantomData;
|
||||||
use core::ops::Deref;
|
use core::ops::Deref;
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::{Network, PrivateKey, PublicKey, XOnlyPublicKey};
|
use bitcoin::{key::XOnlyPublicKey, Network, PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
||||||
pub use miniscript::descriptor::{
|
pub use miniscript::descriptor::{
|
||||||
@@ -387,12 +388,12 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// network: bitcoin::Network,
|
/// network: bitcoin::Network,
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
@@ -403,7 +404,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@@ -412,20 +413,20 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// }
|
/// }
|
||||||
/// ```
|
/// ```
|
||||||
///
|
///
|
||||||
/// Types that don't internally encode the [`Network`](bitcoin::Network) in which they are valid need some extra
|
/// Types that don't internally encode the [`Network`] in which they are valid need some extra
|
||||||
/// steps to override the set of valid networks, otherwise only the network specified in the
|
/// steps to override the set of valid networks, otherwise only the network specified in the
|
||||||
/// [`ExtendedPrivKey`] or [`ExtendedPubKey`] will be considered valid.
|
/// [`ExtendedPrivKey`] or [`ExtendedPubKey`] will be considered valid.
|
||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{
|
/// use bdk::keys::{
|
||||||
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
||||||
@@ -435,7 +436,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@@ -753,7 +754,7 @@ fn expand_multi_keys<Pk: IntoDescriptorKey<Ctx>, Ctx: ScriptContext>(
|
|||||||
let (key_map, valid_networks) = key_maps_networks.into_iter().fold(
|
let (key_map, valid_networks) = key_maps_networks.into_iter().fold(
|
||||||
(KeyMap::default(), any_network()),
|
(KeyMap::default(), any_network()),
|
||||||
|(mut keys_acc, net_acc), (key, net)| {
|
|(mut keys_acc, net_acc), (key, net)| {
|
||||||
keys_acc.extend(key.into_iter());
|
keys_acc.extend(key);
|
||||||
let net_acc = merge_networks(&net_acc, &net);
|
let net_acc = merge_networks(&net_acc, &net);
|
||||||
|
|
||||||
(keys_acc, net_acc)
|
(keys_acc, net_acc)
|
||||||
@@ -926,16 +927,25 @@ pub enum KeyError {
|
|||||||
Message(String),
|
Message(String),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl_error!(miniscript::Error, Miniscript, KeyError);
|
impl From<miniscript::Error> for KeyError {
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32, KeyError);
|
fn from(err: miniscript::Error) -> Self {
|
||||||
|
KeyError::Miniscript(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl std::fmt::Display for KeyError {
|
impl From<bip32::Error> for KeyError {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn from(err: bip32::Error) -> Self {
|
||||||
|
KeyError::Bip32(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for KeyError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
match self {
|
match self {
|
||||||
Self::InvalidScriptContext => write!(f, "Invalid script context"),
|
Self::InvalidScriptContext => write!(f, "Invalid script context"),
|
||||||
Self::InvalidNetwork => write!(f, "Invalid network"),
|
Self::InvalidNetwork => write!(f, "Invalid network"),
|
||||||
@@ -952,7 +962,7 @@ impl std::error::Error for KeyError {}
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub mod test {
|
pub mod test {
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,13 @@
|
|||||||
#![doc = include_str!("../README.md")]
|
#![doc = include_str!("../README.md")]
|
||||||
|
// only enables the `doc_cfg` feature when the `docsrs` configuration attribute is defined
|
||||||
|
#![cfg_attr(docsrs, feature(doc_cfg))]
|
||||||
|
#![cfg_attr(
|
||||||
|
docsrs,
|
||||||
|
doc(html_logo_url = "https://github.com/bitcoindevkit/bdk/raw/master/static/bdk.png")
|
||||||
|
)]
|
||||||
#![no_std]
|
#![no_std]
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
#[macro_use]
|
#[macro_use]
|
||||||
extern crate std;
|
extern crate std;
|
||||||
@@ -9,9 +17,6 @@ extern crate std;
|
|||||||
pub extern crate alloc;
|
pub extern crate alloc;
|
||||||
|
|
||||||
pub extern crate bitcoin;
|
pub extern crate bitcoin;
|
||||||
#[cfg(feature = "hardware-signer")]
|
|
||||||
pub extern crate hwi;
|
|
||||||
extern crate log;
|
|
||||||
pub extern crate miniscript;
|
pub extern crate miniscript;
|
||||||
extern crate serde;
|
extern crate serde;
|
||||||
extern crate serde_json;
|
extern crate serde_json;
|
||||||
@@ -19,9 +24,6 @@ extern crate serde_json;
|
|||||||
#[cfg(feature = "keys-bip39")]
|
#[cfg(feature = "keys-bip39")]
|
||||||
extern crate bip39;
|
extern crate bip39;
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
|
||||||
#[macro_use]
|
|
||||||
pub(crate) mod error;
|
|
||||||
pub mod descriptor;
|
pub mod descriptor;
|
||||||
pub mod keys;
|
pub mod keys;
|
||||||
pub mod psbt;
|
pub mod psbt;
|
||||||
@@ -30,7 +32,6 @@ pub mod wallet;
|
|||||||
|
|
||||||
pub use descriptor::template;
|
pub use descriptor::template;
|
||||||
pub use descriptor::HdKeyPaths;
|
pub use descriptor::HdKeyPaths;
|
||||||
pub use error::Error;
|
|
||||||
pub use types::*;
|
pub use types::*;
|
||||||
pub use wallet::signer;
|
pub use wallet::signer;
|
||||||
pub use wallet::signer::SignOptions;
|
pub use wallet::signer::SignOptions;
|
||||||
|
|||||||
@@ -13,7 +13,7 @@
|
|||||||
|
|
||||||
use crate::FeeRate;
|
use crate::FeeRate;
|
||||||
use alloc::vec::Vec;
|
use alloc::vec::Vec;
|
||||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
use bitcoin::TxOut;
|
use bitcoin::TxOut;
|
||||||
|
|
||||||
// TODO upstream the functions here to `rust-bitcoin`?
|
// TODO upstream the functions here to `rust-bitcoin`?
|
||||||
@@ -35,24 +35,16 @@ pub trait PsbtUtils {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl PsbtUtils for Psbt {
|
impl PsbtUtils for Psbt {
|
||||||
#[allow(clippy::all)] // We want to allow `manual_map` but it is too new.
|
|
||||||
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut> {
|
fn get_utxo_for(&self, input_index: usize) -> Option<TxOut> {
|
||||||
let tx = &self.unsigned_tx;
|
let tx = &self.unsigned_tx;
|
||||||
|
let input = self.inputs.get(input_index)?;
|
||||||
|
|
||||||
if input_index >= tx.input.len() {
|
match (&input.witness_utxo, &input.non_witness_utxo) {
|
||||||
return None;
|
(Some(_), _) => input.witness_utxo.clone(),
|
||||||
}
|
(_, Some(_)) => input.non_witness_utxo.as_ref().map(|in_tx| {
|
||||||
|
in_tx.output[tx.input[input_index].previous_output.vout as usize].clone()
|
||||||
if let Some(input) = self.inputs.get(input_index) {
|
}),
|
||||||
if let Some(wit_utxo) = &input.witness_utxo {
|
_ => None,
|
||||||
Some(wit_utxo.clone())
|
|
||||||
} else if let Some(in_tx) = &input.non_witness_utxo {
|
|
||||||
Some(in_tx.output[tx.input[input_index].previous_output.vout as usize].clone())
|
|
||||||
} else {
|
|
||||||
None
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
None
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -14,17 +14,17 @@ use core::convert::AsRef;
|
|||||||
use core::ops::Sub;
|
use core::ops::Sub;
|
||||||
|
|
||||||
use bdk_chain::ConfirmationTime;
|
use bdk_chain::ConfirmationTime;
|
||||||
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
use bitcoin::blockdata::transaction::{OutPoint, Sequence, TxOut};
|
||||||
use bitcoin::{hash_types::Txid, util::psbt};
|
use bitcoin::{psbt, Weight};
|
||||||
|
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
/// Types of keychains
|
/// Types of keychains
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, Copy, PartialEq, Eq, Hash, Ord, PartialOrd)]
|
#[derive(Serialize, Deserialize, Debug, Clone, Copy, PartialEq, Eq, Hash, Ord, PartialOrd)]
|
||||||
pub enum KeychainKind {
|
pub enum KeychainKind {
|
||||||
/// External
|
/// External keychain, used for deriving recipient addresses.
|
||||||
External = 0,
|
External = 0,
|
||||||
/// Internal, usually used for change outputs
|
/// Internal keychain, used for deriving change addresses.
|
||||||
Internal = 1,
|
Internal = 1,
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -99,8 +99,8 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and weight units (`wu`).
|
/// Calculate fee rate from `fee` and weight units (`wu`).
|
||||||
pub fn from_wu(fee: u64, wu: usize) -> FeeRate {
|
pub fn from_wu(fee: u64, wu: Weight) -> FeeRate {
|
||||||
Self::from_vb(fee, wu.vbytes())
|
Self::from_vb(fee, wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and `vbytes`.
|
/// Calculate fee rate from `fee` and `vbytes`.
|
||||||
@@ -114,9 +114,14 @@ impl FeeRate {
|
|||||||
self.0
|
self.0
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Return the value as satoshi/kwu
|
||||||
|
pub fn sat_per_kwu(&self) -> f32 {
|
||||||
|
self.0 * 250.0_f32
|
||||||
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in weight units.
|
/// Calculate absolute fee in Satoshis using size in weight units.
|
||||||
pub fn fee_wu(&self, wu: usize) -> u64 {
|
pub fn fee_wu(&self, wu: Weight) -> u64 {
|
||||||
self.fee_vb(wu.vbytes())
|
self.fee_vb(wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
||||||
@@ -156,7 +161,7 @@ impl Vbytes for usize {
|
|||||||
///
|
///
|
||||||
/// [`Wallet`]: crate::Wallet
|
/// [`Wallet`]: crate::Wallet
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)]
|
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq, Hash)]
|
||||||
pub struct LocalUtxo {
|
pub struct LocalOutput {
|
||||||
/// Reference to a transaction output
|
/// Reference to a transaction output
|
||||||
pub outpoint: OutPoint,
|
pub outpoint: OutPoint,
|
||||||
/// Transaction output
|
/// Transaction output
|
||||||
@@ -187,11 +192,13 @@ pub struct WeightedUtxo {
|
|||||||
/// An unspent transaction output (UTXO).
|
/// An unspent transaction output (UTXO).
|
||||||
pub enum Utxo {
|
pub enum Utxo {
|
||||||
/// A UTXO owned by the local wallet.
|
/// A UTXO owned by the local wallet.
|
||||||
Local(LocalUtxo),
|
Local(LocalOutput),
|
||||||
/// A UTXO owned by another wallet.
|
/// A UTXO owned by another wallet.
|
||||||
Foreign {
|
Foreign {
|
||||||
/// The location of the output.
|
/// The location of the output.
|
||||||
outpoint: OutPoint,
|
outpoint: OutPoint,
|
||||||
|
/// The nSequence value to set for this input.
|
||||||
|
sequence: Option<Sequence>,
|
||||||
/// The information about the input we require to add it to a PSBT.
|
/// The information about the input we require to add it to a PSBT.
|
||||||
// Box it to stop the type being too big.
|
// Box it to stop the type being too big.
|
||||||
psbt_input: Box<psbt::Input>,
|
psbt_input: Box<psbt::Input>,
|
||||||
@@ -214,6 +221,7 @@ impl Utxo {
|
|||||||
Utxo::Foreign {
|
Utxo::Foreign {
|
||||||
outpoint,
|
outpoint,
|
||||||
psbt_input,
|
psbt_input,
|
||||||
|
..
|
||||||
} => {
|
} => {
|
||||||
if let Some(prev_tx) = &psbt_input.non_witness_utxo {
|
if let Some(prev_tx) = &psbt_input.non_witness_utxo {
|
||||||
return &prev_tx.output[outpoint.vout as usize];
|
return &prev_tx.output[outpoint.vout as usize];
|
||||||
@@ -227,39 +235,13 @@ impl Utxo {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
/// A wallet transaction
|
/// Get the sequence number if an explicit sequence number has to be set for this input.
|
||||||
#[derive(Serialize, Deserialize, Debug, Clone, PartialEq, Eq)]
|
pub fn sequence(&self) -> Option<Sequence> {
|
||||||
pub struct TransactionDetails {
|
match self {
|
||||||
/// Optional transaction
|
Utxo::Local(_) => None,
|
||||||
pub transaction: Option<Transaction>,
|
Utxo::Foreign { sequence, .. } => *sequence,
|
||||||
/// Transaction id
|
}
|
||||||
pub txid: Txid,
|
|
||||||
/// Received value (sats)
|
|
||||||
/// Sum of owned outputs of this transaction.
|
|
||||||
pub received: u64,
|
|
||||||
/// Sent value (sats)
|
|
||||||
/// Sum of owned inputs of this transaction.
|
|
||||||
pub sent: u64,
|
|
||||||
/// Fee value in sats if it was available.
|
|
||||||
pub fee: Option<u64>,
|
|
||||||
/// If the transaction is confirmed, contains height and Unix timestamp of the block containing the
|
|
||||||
/// transaction, unconfirmed transaction contains `None`.
|
|
||||||
pub confirmation_time: ConfirmationTime,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl PartialOrd for TransactionDetails {
|
|
||||||
fn partial_cmp(&self, other: &Self) -> Option<core::cmp::Ordering> {
|
|
||||||
Some(self.cmp(other))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl Ord for TransactionDetails {
|
|
||||||
fn cmp(&self, other: &Self) -> core::cmp::Ordering {
|
|
||||||
self.confirmation_time
|
|
||||||
.cmp(&other.confirmation_time)
|
|
||||||
.then_with(|| self.txid.cmp(&other.txid))
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -329,5 +311,6 @@ mod tests {
|
|||||||
fn test_fee_from_sat_per_kwu() {
|
fn test_fee_from_sat_per_kwu() {
|
||||||
let fee = FeeRate::from_sat_per_kwu(250.0);
|
let fee = FeeRate::from_sat_per_kwu(250.0);
|
||||||
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
assert!((fee.as_sat_per_vb() - 1.0).abs() < f32::EPSILON);
|
||||||
|
assert_eq!(fee.sat_per_kwu(), 250.0);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -26,9 +26,12 @@
|
|||||||
//! ```
|
//! ```
|
||||||
//! # use std::str::FromStr;
|
//! # use std::str::FromStr;
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::wallet::{self, coin_selection::*};
|
//! # use bdk::wallet::{self, ChangeSet, coin_selection::*, coin_selection};
|
||||||
|
//! # use bdk::wallet::error::CreateTxError;
|
||||||
|
//! # use bdk_chain::PersistBackend;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! # use bdk::wallet::coin_selection::decide_change;
|
//! # use bdk::wallet::coin_selection::decide_change;
|
||||||
|
//! # use anyhow::Error;
|
||||||
//! # const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
//! # const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
||||||
//! #[derive(Debug)]
|
//! #[derive(Debug)]
|
||||||
//! struct AlwaysSpendEverything;
|
//! struct AlwaysSpendEverything;
|
||||||
@@ -38,12 +41,12 @@
|
|||||||
//! &self,
|
//! &self,
|
||||||
//! required_utxos: Vec<WeightedUtxo>,
|
//! required_utxos: Vec<WeightedUtxo>,
|
||||||
//! optional_utxos: Vec<WeightedUtxo>,
|
//! optional_utxos: Vec<WeightedUtxo>,
|
||||||
//! fee_rate: FeeRate,
|
//! fee_rate: bdk::FeeRate,
|
||||||
//! target_amount: u64,
|
//! target_amount: u64,
|
||||||
//! drain_script: &Script,
|
//! drain_script: &Script,
|
||||||
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
//! ) -> Result<CoinSelectionResult, coin_selection::Error> {
|
||||||
//! let mut selected_amount = 0;
|
//! let mut selected_amount = 0;
|
||||||
//! let mut additional_weight = 0;
|
//! let mut additional_weight = Weight::ZERO;
|
||||||
//! let all_utxos_selected = required_utxos
|
//! let all_utxos_selected = required_utxos
|
||||||
//! .into_iter()
|
//! .into_iter()
|
||||||
//! .chain(optional_utxos)
|
//! .chain(optional_utxos)
|
||||||
@@ -51,7 +54,9 @@
|
|||||||
//! (&mut selected_amount, &mut additional_weight),
|
//! (&mut selected_amount, &mut additional_weight),
|
||||||
//! |(selected_amount, additional_weight), weighted_utxo| {
|
//! |(selected_amount, additional_weight), weighted_utxo| {
|
||||||
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
||||||
//! **additional_weight += TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight;
|
//! **additional_weight += Weight::from_wu(
|
||||||
|
//! (TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
//! );
|
||||||
//! Some(weighted_utxo.utxo)
|
//! Some(weighted_utxo.utxo)
|
||||||
//! },
|
//! },
|
||||||
//! )
|
//! )
|
||||||
@@ -59,7 +64,7 @@
|
|||||||
//! let additional_fees = fee_rate.fee_wu(additional_weight);
|
//! let additional_fees = fee_rate.fee_wu(additional_weight);
|
||||||
//! let amount_needed_with_fees = additional_fees + target_amount;
|
//! let amount_needed_with_fees = additional_fees + target_amount;
|
||||||
//! if selected_amount < amount_needed_with_fees {
|
//! if selected_amount < amount_needed_with_fees {
|
||||||
//! return Err(bdk::Error::InsufficientFunds {
|
//! return Err(coin_selection::Error::InsufficientFunds {
|
||||||
//! needed: amount_needed_with_fees,
|
//! needed: amount_needed_with_fees,
|
||||||
//! available: selected_amount,
|
//! available: selected_amount,
|
||||||
//! });
|
//! });
|
||||||
@@ -80,8 +85,11 @@
|
|||||||
//! # let mut wallet = doctest_wallet!();
|
//! # let mut wallet = doctest_wallet!();
|
||||||
//! // create wallet, sync, ...
|
//! // create wallet, sync, ...
|
||||||
//!
|
//!
|
||||||
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
//! let (psbt, details) = {
|
//! .unwrap()
|
||||||
|
//! .require_network(Network::Testnet)
|
||||||
|
//! .unwrap();
|
||||||
|
//! let psbt = {
|
||||||
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
||||||
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
||||||
//! builder.finish()?
|
//! builder.finish()?
|
||||||
@@ -89,19 +97,22 @@
|
|||||||
//!
|
//!
|
||||||
//! // inspect, sign, broadcast, ...
|
//! // inspect, sign, broadcast, ...
|
||||||
//!
|
//!
|
||||||
//! # Ok::<(), bdk::Error>(())
|
//! # Ok::<(), anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
|
use crate::chain::collections::HashSet;
|
||||||
use crate::types::FeeRate;
|
use crate::types::FeeRate;
|
||||||
use crate::wallet::utils::IsDust;
|
use crate::wallet::utils::IsDust;
|
||||||
|
use crate::Utxo;
|
||||||
use crate::WeightedUtxo;
|
use crate::WeightedUtxo;
|
||||||
use crate::{error::Error, Utxo};
|
|
||||||
|
|
||||||
use alloc::vec::Vec;
|
use alloc::vec::Vec;
|
||||||
use bitcoin::consensus::encode::serialize;
|
use bitcoin::consensus::encode::serialize;
|
||||||
use bitcoin::Script;
|
use bitcoin::OutPoint;
|
||||||
|
use bitcoin::{Script, Weight};
|
||||||
|
|
||||||
use core::convert::TryInto;
|
use core::convert::TryInto;
|
||||||
|
use core::fmt::{self, Formatter};
|
||||||
use rand::seq::SliceRandom;
|
use rand::seq::SliceRandom;
|
||||||
|
|
||||||
/// Default coin selection algorithm used by [`TxBuilder`](super::tx_builder::TxBuilder) if not
|
/// Default coin selection algorithm used by [`TxBuilder`](super::tx_builder::TxBuilder) if not
|
||||||
@@ -112,6 +123,43 @@ pub type DefaultCoinSelectionAlgorithm = BranchAndBoundCoinSelection;
|
|||||||
// prev_txid (32 bytes) + prev_vout (4 bytes) + sequence (4 bytes)
|
// prev_txid (32 bytes) + prev_vout (4 bytes) + sequence (4 bytes)
|
||||||
pub(crate) const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
pub(crate) const TXIN_BASE_WEIGHT: usize = (32 + 4 + 4) * 4;
|
||||||
|
|
||||||
|
/// Errors that can be thrown by the [`coin_selection`](crate::wallet::coin_selection) module
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub enum Error {
|
||||||
|
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||||
|
InsufficientFunds {
|
||||||
|
/// Sats needed for some transaction
|
||||||
|
needed: u64,
|
||||||
|
/// Sats available for spending
|
||||||
|
available: u64,
|
||||||
|
},
|
||||||
|
/// Branch and bound coin selection tries to avoid needing a change by finding the right inputs for
|
||||||
|
/// the desired outputs plus fee, if there is not such combination this error is thrown
|
||||||
|
BnBNoExactMatch,
|
||||||
|
/// Branch and bound coin selection possible attempts with sufficiently big UTXO set could grow
|
||||||
|
/// exponentially, thus a limit is set, and when hit, this error is thrown
|
||||||
|
BnBTotalTriesExceeded,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for Error {
|
||||||
|
fn fmt(&self, f: &mut Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::InsufficientFunds { needed, available } => write!(
|
||||||
|
f,
|
||||||
|
"Insufficient funds: {} sat available of {} sat needed",
|
||||||
|
available, needed
|
||||||
|
),
|
||||||
|
Self::BnBTotalTriesExceeded => {
|
||||||
|
write!(f, "Branch and bound coin selection: total tries exceeded")
|
||||||
|
}
|
||||||
|
Self::BnBNoExactMatch => write!(f, "Branch and bound coin selection: not exact match"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for Error {}
|
||||||
|
|
||||||
#[derive(Debug)]
|
#[derive(Debug)]
|
||||||
/// Remaining amount after performing coin selection
|
/// Remaining amount after performing coin selection
|
||||||
pub enum Excess {
|
pub enum Excess {
|
||||||
@@ -208,12 +256,6 @@ impl CoinSelectionAlgorithm for LargestFirstCoinSelection {
|
|||||||
target_amount: u64,
|
target_amount: u64,
|
||||||
drain_script: &Script,
|
drain_script: &Script,
|
||||||
) -> Result<CoinSelectionResult, Error> {
|
) -> Result<CoinSelectionResult, Error> {
|
||||||
log::debug!(
|
|
||||||
"target_amount = `{}`, fee_rate = `{:?}`",
|
|
||||||
target_amount,
|
|
||||||
fee_rate
|
|
||||||
);
|
|
||||||
|
|
||||||
// We put the "required UTXOs" first and make sure the optional UTXOs are sorted,
|
// We put the "required UTXOs" first and make sure the optional UTXOs are sorted,
|
||||||
// initially smallest to largest, before being reversed with `.rev()`.
|
// initially smallest to largest, before being reversed with `.rev()`.
|
||||||
let utxos = {
|
let utxos = {
|
||||||
@@ -302,16 +344,10 @@ fn select_sorted_utxos(
|
|||||||
(&mut selected_amount, &mut fee_amount),
|
(&mut selected_amount, &mut fee_amount),
|
||||||
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
||||||
if must_use || **selected_amount < target_amount + **fee_amount {
|
if must_use || **selected_amount < target_amount + **fee_amount {
|
||||||
**fee_amount +=
|
**fee_amount += fee_rate.fee_wu(Weight::from_wu(
|
||||||
fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
));
|
||||||
**selected_amount += weighted_utxo.utxo.txout().value;
|
**selected_amount += weighted_utxo.utxo.txout().value;
|
||||||
|
|
||||||
log::debug!(
|
|
||||||
"Selected {}, updated fee_amount = `{}`",
|
|
||||||
weighted_utxo.utxo.outpoint(),
|
|
||||||
fee_amount
|
|
||||||
);
|
|
||||||
|
|
||||||
Some(weighted_utxo.utxo)
|
Some(weighted_utxo.utxo)
|
||||||
} else {
|
} else {
|
||||||
None
|
None
|
||||||
@@ -351,7 +387,9 @@ struct OutputGroup {
|
|||||||
|
|
||||||
impl OutputGroup {
|
impl OutputGroup {
|
||||||
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
||||||
let fee = fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
let fee = fee_rate.fee_wu(Weight::from_wu(
|
||||||
|
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
));
|
||||||
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
||||||
OutputGroup {
|
OutputGroup {
|
||||||
weighted_utxo,
|
weighted_utxo,
|
||||||
@@ -675,16 +713,36 @@ impl BranchAndBoundCoinSelection {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Remove duplicate UTXOs.
|
||||||
|
///
|
||||||
|
/// If a UTXO appears in both `required` and `optional`, the appearance in `required` is kept.
|
||||||
|
pub(crate) fn filter_duplicates<I>(required: I, optional: I) -> (I, I)
|
||||||
|
where
|
||||||
|
I: IntoIterator<Item = WeightedUtxo> + FromIterator<WeightedUtxo>,
|
||||||
|
{
|
||||||
|
let mut visited = HashSet::<OutPoint>::new();
|
||||||
|
let required = required
|
||||||
|
.into_iter()
|
||||||
|
.filter(|utxo| visited.insert(utxo.utxo.outpoint()))
|
||||||
|
.collect::<I>();
|
||||||
|
let optional = optional
|
||||||
|
.into_iter()
|
||||||
|
.filter(|utxo| visited.insert(utxo.utxo.outpoint()))
|
||||||
|
.collect::<I>();
|
||||||
|
(required, optional)
|
||||||
|
}
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use bdk_chain::ConfirmationTime;
|
use bdk_chain::ConfirmationTime;
|
||||||
use bitcoin::{OutPoint, Script, TxOut};
|
use bitcoin::{OutPoint, ScriptBuf, TxOut};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::types::*;
|
use crate::types::*;
|
||||||
|
use crate::wallet::coin_selection::filter_duplicates;
|
||||||
use crate::wallet::Vbytes;
|
use crate::wallet::Vbytes;
|
||||||
|
|
||||||
use rand::rngs::StdRng;
|
use rand::rngs::StdRng;
|
||||||
@@ -706,11 +764,11 @@ mod test {
|
|||||||
.unwrap();
|
.unwrap();
|
||||||
WeightedUtxo {
|
WeightedUtxo {
|
||||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||||
utxo: Utxo::Local(LocalUtxo {
|
utxo: Utxo::Local(LocalOutput {
|
||||||
outpoint,
|
outpoint,
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value,
|
value,
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@@ -722,9 +780,13 @@ mod test {
|
|||||||
|
|
||||||
fn get_test_utxos() -> Vec<WeightedUtxo> {
|
fn get_test_utxos() -> Vec<WeightedUtxo> {
|
||||||
vec![
|
vec![
|
||||||
utxo(100_000, 0, ConfirmationTime::Unconfirmed),
|
utxo(100_000, 0, ConfirmationTime::Unconfirmed { last_seen: 0 }),
|
||||||
utxo(FEE_AMOUNT - 40, 1, ConfirmationTime::Unconfirmed),
|
utxo(
|
||||||
utxo(200_000, 2, ConfirmationTime::Unconfirmed),
|
FEE_AMOUNT - 40,
|
||||||
|
1,
|
||||||
|
ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||||
|
),
|
||||||
|
utxo(200_000, 2, ConfirmationTime::Unconfirmed { last_seen: 0 }),
|
||||||
]
|
]
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -759,17 +821,18 @@ mod test {
|
|||||||
|
|
||||||
fn generate_random_utxos(rng: &mut StdRng, utxos_number: usize) -> Vec<WeightedUtxo> {
|
fn generate_random_utxos(rng: &mut StdRng, utxos_number: usize) -> Vec<WeightedUtxo> {
|
||||||
let mut res = Vec::new();
|
let mut res = Vec::new();
|
||||||
for _ in 0..utxos_number {
|
for i in 0..utxos_number {
|
||||||
res.push(WeightedUtxo {
|
res.push(WeightedUtxo {
|
||||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||||
utxo: Utxo::Local(LocalUtxo {
|
utxo: Utxo::Local(LocalOutput {
|
||||||
outpoint: OutPoint::from_str(
|
outpoint: OutPoint::from_str(&format!(
|
||||||
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:0",
|
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:{}",
|
||||||
)
|
i
|
||||||
|
))
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value: rng.gen_range(0..200000000),
|
value: rng.gen_range(0..200000000),
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@@ -780,7 +843,7 @@ mod test {
|
|||||||
time: rng.next_u64(),
|
time: rng.next_u64(),
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
ConfirmationTime::Unconfirmed
|
ConfirmationTime::Unconfirmed { last_seen: 0 }
|
||||||
},
|
},
|
||||||
}),
|
}),
|
||||||
});
|
});
|
||||||
@@ -789,24 +852,26 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn generate_same_value_utxos(utxos_value: u64, utxos_number: usize) -> Vec<WeightedUtxo> {
|
fn generate_same_value_utxos(utxos_value: u64, utxos_number: usize) -> Vec<WeightedUtxo> {
|
||||||
let utxo = WeightedUtxo {
|
(0..utxos_number)
|
||||||
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
.map(|i| WeightedUtxo {
|
||||||
utxo: Utxo::Local(LocalUtxo {
|
satisfaction_weight: P2WPKH_SATISFACTION_SIZE,
|
||||||
outpoint: OutPoint::from_str(
|
utxo: Utxo::Local(LocalOutput {
|
||||||
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:0",
|
outpoint: OutPoint::from_str(&format!(
|
||||||
)
|
"ebd9813ecebc57ff8f30797de7c205e3c7498ca950ea4341ee51a685ff2fa30a:{}",
|
||||||
.unwrap(),
|
i
|
||||||
txout: TxOut {
|
))
|
||||||
value: utxos_value,
|
.unwrap(),
|
||||||
script_pubkey: Script::new(),
|
txout: TxOut {
|
||||||
},
|
value: utxos_value,
|
||||||
keychain: KeychainKind::External,
|
script_pubkey: ScriptBuf::new(),
|
||||||
is_spent: false,
|
},
|
||||||
derivation_index: 42,
|
keychain: KeychainKind::External,
|
||||||
confirmation_time: ConfirmationTime::Unconfirmed,
|
is_spent: false,
|
||||||
}),
|
derivation_index: 42,
|
||||||
};
|
confirmation_time: ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||||
vec![utxo; utxos_number]
|
}),
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
}
|
}
|
||||||
|
|
||||||
fn sum_random_utxos(mut rng: &mut StdRng, utxos: &mut Vec<WeightedUtxo>) -> u64 {
|
fn sum_random_utxos(mut rng: &mut StdRng, utxos: &mut Vec<WeightedUtxo>) -> u64 {
|
||||||
@@ -821,10 +886,10 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_largest_first_coin_selection_success() {
|
fn test_largest_first_coin_selection_success() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
utxos,
|
utxos,
|
||||||
vec![],
|
vec![],
|
||||||
@@ -842,10 +907,10 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_largest_first_coin_selection_use_all() {
|
fn test_largest_first_coin_selection_use_all() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
utxos,
|
utxos,
|
||||||
vec![],
|
vec![],
|
||||||
@@ -863,10 +928,10 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_largest_first_coin_selection_use_only_necessary() {
|
fn test_largest_first_coin_selection_use_only_necessary() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -885,10 +950,10 @@ mod test {
|
|||||||
#[should_panic(expected = "InsufficientFunds")]
|
#[should_panic(expected = "InsufficientFunds")]
|
||||||
fn test_largest_first_coin_selection_insufficient_funds() {
|
fn test_largest_first_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 500_000 + FEE_AMOUNT;
|
let target_amount = 500_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
LargestFirstCoinSelection::default()
|
LargestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -903,10 +968,10 @@ mod test {
|
|||||||
#[should_panic(expected = "InsufficientFunds")]
|
#[should_panic(expected = "InsufficientFunds")]
|
||||||
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
LargestFirstCoinSelection::default()
|
LargestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -920,10 +985,10 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_oldest_first_coin_selection_success() {
|
fn test_oldest_first_coin_selection_success() {
|
||||||
let utxos = get_oldest_first_test_utxos();
|
let utxos = get_oldest_first_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 180_000 + FEE_AMOUNT;
|
let target_amount = 180_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -941,10 +1006,10 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_oldest_first_coin_selection_use_all() {
|
fn test_oldest_first_coin_selection_use_all() {
|
||||||
let utxos = get_oldest_first_test_utxos();
|
let utxos = get_oldest_first_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
utxos,
|
utxos,
|
||||||
vec![],
|
vec![],
|
||||||
@@ -962,10 +1027,10 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_oldest_first_coin_selection_use_only_necessary() {
|
fn test_oldest_first_coin_selection_use_only_necessary() {
|
||||||
let utxos = get_oldest_first_test_utxos();
|
let utxos = get_oldest_first_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -984,10 +1049,10 @@ mod test {
|
|||||||
#[should_panic(expected = "InsufficientFunds")]
|
#[should_panic(expected = "InsufficientFunds")]
|
||||||
fn test_oldest_first_coin_selection_insufficient_funds() {
|
fn test_oldest_first_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_oldest_first_test_utxos();
|
let utxos = get_oldest_first_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 600_000 + FEE_AMOUNT;
|
let target_amount = 600_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
OldestFirstCoinSelection::default()
|
OldestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -1004,9 +1069,9 @@ mod test {
|
|||||||
let utxos = get_oldest_first_test_utxos();
|
let utxos = get_oldest_first_test_utxos();
|
||||||
|
|
||||||
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
OldestFirstCoinSelection::default()
|
OldestFirstCoinSelection
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
utxos,
|
utxos,
|
||||||
@@ -1023,7 +1088,7 @@ mod test {
|
|||||||
// select three outputs
|
// select three outputs
|
||||||
let utxos = generate_same_value_utxos(100_000, 20);
|
let utxos = generate_same_value_utxos(100_000, 20);
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
@@ -1045,7 +1110,7 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_coin_selection_required_are_enough() {
|
fn test_bnb_coin_selection_required_are_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default()
|
let result = BranchAndBoundCoinSelection::default()
|
||||||
@@ -1066,7 +1131,7 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_coin_selection_optional_are_enough() {
|
fn test_bnb_coin_selection_optional_are_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 299756 + FEE_AMOUNT;
|
let target_amount = 299756 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default()
|
let result = BranchAndBoundCoinSelection::default()
|
||||||
@@ -1091,14 +1156,18 @@ mod test {
|
|||||||
|
|
||||||
let required = vec![utxos[0].clone()];
|
let required = vec![utxos[0].clone()];
|
||||||
let mut optional = utxos[1..].to_vec();
|
let mut optional = utxos[1..].to_vec();
|
||||||
optional.push(utxo(500_000, 3, ConfirmationTime::Unconfirmed));
|
optional.push(utxo(
|
||||||
|
500_000,
|
||||||
|
3,
|
||||||
|
ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||||
|
));
|
||||||
|
|
||||||
// Defensive assertions, for sanity and in case someone changes the test utxos vector.
|
// Defensive assertions, for sanity and in case someone changes the test utxos vector.
|
||||||
let amount: u64 = required.iter().map(|u| u.utxo.txout().value).sum();
|
let amount: u64 = required.iter().map(|u| u.utxo.txout().value).sum();
|
||||||
assert_eq!(amount, 100_000);
|
assert_eq!(amount, 100_000);
|
||||||
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
||||||
assert!(amount > 150_000);
|
assert!(amount > 150_000);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let target_amount = 150_000 + FEE_AMOUNT;
|
let target_amount = 150_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
@@ -1121,7 +1190,7 @@ mod test {
|
|||||||
#[should_panic(expected = "InsufficientFunds")]
|
#[should_panic(expected = "InsufficientFunds")]
|
||||||
fn test_bnb_coin_selection_insufficient_funds() {
|
fn test_bnb_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 500_000 + FEE_AMOUNT;
|
let target_amount = 500_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::default()
|
BranchAndBoundCoinSelection::default()
|
||||||
@@ -1139,7 +1208,7 @@ mod test {
|
|||||||
#[should_panic(expected = "InsufficientFunds")]
|
#[should_panic(expected = "InsufficientFunds")]
|
||||||
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::default()
|
BranchAndBoundCoinSelection::default()
|
||||||
@@ -1156,7 +1225,7 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_coin_selection_check_fee_rate() {
|
fn test_bnb_coin_selection_check_fee_rate() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 99932; // first utxo's effective value
|
let target_amount = 99932; // first utxo's effective value
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
@@ -1184,7 +1253,7 @@ mod test {
|
|||||||
for _i in 0..200 {
|
for _i in 0..200 {
|
||||||
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
||||||
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
.coin_select(
|
.coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
@@ -1212,7 +1281,7 @@ mod test {
|
|||||||
let size_of_change = 31;
|
let size_of_change = 31;
|
||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
BranchAndBoundCoinSelection::new(size_of_change)
|
BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1243,7 +1312,7 @@ mod test {
|
|||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::new(size_of_change)
|
BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1279,7 +1348,7 @@ mod test {
|
|||||||
// cost_of_change + 5.
|
// cost_of_change + 5.
|
||||||
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1319,7 +1388,7 @@ mod test {
|
|||||||
let target_amount =
|
let target_amount =
|
||||||
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
.bnb(
|
.bnb(
|
||||||
@@ -1350,7 +1419,7 @@ mod test {
|
|||||||
.map(|u| OutputGroup::new(u, fee_rate))
|
.map(|u| OutputGroup::new(u, fee_rate))
|
||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
||||||
vec![],
|
vec![],
|
||||||
@@ -1368,7 +1437,7 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_exclude_negative_effective_value() {
|
fn test_bnb_exclude_negative_effective_value() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
vec![],
|
vec![],
|
||||||
@@ -1390,7 +1459,7 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_include_negative_effective_value_when_required() {
|
fn test_bnb_include_negative_effective_value_when_required() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let (required, optional) = utxos
|
let (required, optional) = utxos
|
||||||
.into_iter()
|
.into_iter()
|
||||||
@@ -1416,7 +1485,7 @@ mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bnb_sum_of_effective_value_negative() {
|
fn test_bnb_sum_of_effective_value_negative() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
utxos,
|
utxos,
|
||||||
@@ -1434,4 +1503,95 @@ mod test {
|
|||||||
})
|
})
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_filter_duplicates() {
|
||||||
|
fn utxo(txid: &str, value: u64) -> WeightedUtxo {
|
||||||
|
WeightedUtxo {
|
||||||
|
satisfaction_weight: 0,
|
||||||
|
utxo: Utxo::Local(LocalOutput {
|
||||||
|
outpoint: OutPoint::new(bitcoin::hashes::Hash::hash(txid.as_bytes()), 0),
|
||||||
|
txout: TxOut {
|
||||||
|
value,
|
||||||
|
script_pubkey: ScriptBuf::new(),
|
||||||
|
},
|
||||||
|
keychain: KeychainKind::External,
|
||||||
|
is_spent: false,
|
||||||
|
derivation_index: 0,
|
||||||
|
confirmation_time: ConfirmationTime::Confirmed {
|
||||||
|
height: 12345,
|
||||||
|
time: 12345,
|
||||||
|
},
|
||||||
|
}),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn to_utxo_vec(utxos: &[(&str, u64)]) -> Vec<WeightedUtxo> {
|
||||||
|
let mut v = utxos
|
||||||
|
.iter()
|
||||||
|
.map(|&(txid, value)| utxo(txid, value))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
v.sort_by_key(|u| u.utxo.outpoint());
|
||||||
|
v
|
||||||
|
}
|
||||||
|
|
||||||
|
struct TestCase<'a> {
|
||||||
|
name: &'a str,
|
||||||
|
required: &'a [(&'a str, u64)],
|
||||||
|
optional: &'a [(&'a str, u64)],
|
||||||
|
exp_required: &'a [(&'a str, u64)],
|
||||||
|
exp_optional: &'a [(&'a str, u64)],
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "no_duplicates",
|
||||||
|
required: &[("A", 1000), ("B", 2100)],
|
||||||
|
optional: &[("C", 1000)],
|
||||||
|
exp_required: &[("A", 1000), ("B", 2100)],
|
||||||
|
exp_optional: &[("C", 1000)],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "duplicate_required_utxos",
|
||||||
|
required: &[("A", 3000), ("B", 1200), ("C", 1234), ("A", 3000)],
|
||||||
|
optional: &[("D", 2100)],
|
||||||
|
exp_required: &[("A", 3000), ("B", 1200), ("C", 1234)],
|
||||||
|
exp_optional: &[("D", 2100)],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "duplicate_optional_utxos",
|
||||||
|
required: &[("A", 3000), ("B", 1200)],
|
||||||
|
optional: &[("C", 5000), ("D", 1300), ("C", 5000)],
|
||||||
|
exp_required: &[("A", 3000), ("B", 1200)],
|
||||||
|
exp_optional: &[("C", 5000), ("D", 1300)],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "duplicate_across_required_and_optional_utxos",
|
||||||
|
required: &[("A", 3000), ("B", 1200), ("C", 2100)],
|
||||||
|
optional: &[("A", 3000), ("D", 1200), ("E", 5000)],
|
||||||
|
exp_required: &[("A", 3000), ("B", 1200), ("C", 2100)],
|
||||||
|
exp_optional: &[("D", 1200), ("E", 5000)],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("Case {}: {}", i, t.name);
|
||||||
|
let (required, optional) =
|
||||||
|
filter_duplicates(to_utxo_vec(t.required), to_utxo_vec(t.optional));
|
||||||
|
assert_eq!(
|
||||||
|
required,
|
||||||
|
to_utxo_vec(t.exp_required),
|
||||||
|
"[{}:{}] unexpected `required` result",
|
||||||
|
i,
|
||||||
|
t.name
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
optional,
|
||||||
|
to_utxo_vec(t.exp_optional),
|
||||||
|
"[{}:{}] unexpected `optional` result",
|
||||||
|
i,
|
||||||
|
t.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
292
crates/bdk/src/wallet/error.rs
Normal file
292
crates/bdk/src/wallet/error.rs
Normal file
@@ -0,0 +1,292 @@
|
|||||||
|
// Bitcoin Dev Kit
|
||||||
|
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
||||||
|
//
|
||||||
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
||||||
|
//
|
||||||
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
||||||
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
||||||
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
||||||
|
// You may not use this file except in accordance with one or both of these
|
||||||
|
// licenses.
|
||||||
|
|
||||||
|
//! Errors that can be thrown by the [`Wallet`](crate::wallet::Wallet)
|
||||||
|
|
||||||
|
use crate::descriptor::policy::PolicyError;
|
||||||
|
use crate::descriptor::DescriptorError;
|
||||||
|
use crate::wallet::coin_selection;
|
||||||
|
use crate::{descriptor, FeeRate, KeychainKind};
|
||||||
|
use alloc::string::String;
|
||||||
|
use bitcoin::{absolute, psbt, OutPoint, Sequence, Txid};
|
||||||
|
use core::fmt;
|
||||||
|
|
||||||
|
/// Errors returned by miniscript when updating inconsistent PSBTs
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub enum MiniscriptPsbtError {
|
||||||
|
/// Descriptor key conversion error
|
||||||
|
Conversion(miniscript::descriptor::ConversionError),
|
||||||
|
/// Return error type for PsbtExt::update_input_with_descriptor
|
||||||
|
UtxoUpdate(miniscript::psbt::UtxoUpdateError),
|
||||||
|
/// Return error type for PsbtExt::update_output_with_descriptor
|
||||||
|
OutputUpdate(miniscript::psbt::OutputUpdateError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for MiniscriptPsbtError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Conversion(err) => write!(f, "Conversion error: {}", err),
|
||||||
|
Self::UtxoUpdate(err) => write!(f, "UTXO update error: {}", err),
|
||||||
|
Self::OutputUpdate(err) => write!(f, "Output update error: {}", err),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for MiniscriptPsbtError {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::finish`]
|
||||||
|
///
|
||||||
|
/// [`TxBuilder::finish`]: crate::wallet::tx_builder::TxBuilder::finish
|
||||||
|
pub enum CreateTxError<P> {
|
||||||
|
/// There was a problem with the descriptors passed in
|
||||||
|
Descriptor(DescriptorError),
|
||||||
|
/// We were unable to write wallet data to the persistence backend
|
||||||
|
Persist(P),
|
||||||
|
/// There was a problem while extracting and manipulating policies
|
||||||
|
Policy(PolicyError),
|
||||||
|
/// Spending policy is not compatible with this [`KeychainKind`]
|
||||||
|
SpendingPolicyRequired(KeychainKind),
|
||||||
|
/// Requested invalid transaction version '0'
|
||||||
|
Version0,
|
||||||
|
/// Requested transaction version `1`, but at least `2` is needed to use OP_CSV
|
||||||
|
Version1Csv,
|
||||||
|
/// Requested `LockTime` is less than is required to spend from this script
|
||||||
|
LockTime {
|
||||||
|
/// Requested `LockTime`
|
||||||
|
requested: absolute::LockTime,
|
||||||
|
/// Required `LockTime`
|
||||||
|
required: absolute::LockTime,
|
||||||
|
},
|
||||||
|
/// Cannot enable RBF with a `Sequence` >= 0xFFFFFFFE
|
||||||
|
RbfSequence,
|
||||||
|
/// Cannot enable RBF with `Sequence` given a required OP_CSV
|
||||||
|
RbfSequenceCsv {
|
||||||
|
/// Given RBF `Sequence`
|
||||||
|
rbf: Sequence,
|
||||||
|
/// Required OP_CSV `Sequence`
|
||||||
|
csv: Sequence,
|
||||||
|
},
|
||||||
|
/// When bumping a tx the absolute fee requested is lower than replaced tx absolute fee
|
||||||
|
FeeTooLow {
|
||||||
|
/// Required fee absolute value (satoshi)
|
||||||
|
required: u64,
|
||||||
|
},
|
||||||
|
/// When bumping a tx the fee rate requested is lower than required
|
||||||
|
FeeRateTooLow {
|
||||||
|
/// Required fee rate (satoshi/vbyte)
|
||||||
|
required: FeeRate,
|
||||||
|
},
|
||||||
|
/// `manually_selected_only` option is selected but no utxo has been passed
|
||||||
|
NoUtxosSelected,
|
||||||
|
/// Output created is under the dust limit, 546 satoshis
|
||||||
|
OutputBelowDustLimit(usize),
|
||||||
|
/// The `change_policy` was set but the wallet does not have a change_descriptor
|
||||||
|
ChangePolicyDescriptor,
|
||||||
|
/// There was an error with coin selection
|
||||||
|
CoinSelection(coin_selection::Error),
|
||||||
|
/// Wallet's UTXO set is not enough to cover recipient's requested plus fee
|
||||||
|
InsufficientFunds {
|
||||||
|
/// Sats needed for some transaction
|
||||||
|
needed: u64,
|
||||||
|
/// Sats available for spending
|
||||||
|
available: u64,
|
||||||
|
},
|
||||||
|
/// Cannot build a tx without recipients
|
||||||
|
NoRecipients,
|
||||||
|
/// Partially signed bitcoin transaction error
|
||||||
|
Psbt(psbt::Error),
|
||||||
|
/// In order to use the [`TxBuilder::add_global_xpubs`] option every extended
|
||||||
|
/// key in the descriptor must either be a master key itself (having depth = 0) or have an
|
||||||
|
/// explicit origin provided
|
||||||
|
///
|
||||||
|
/// [`TxBuilder::add_global_xpubs`]: crate::wallet::tx_builder::TxBuilder::add_global_xpubs
|
||||||
|
MissingKeyOrigin(String),
|
||||||
|
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||||
|
UnknownUtxo,
|
||||||
|
/// Missing non_witness_utxo on foreign utxo for given `OutPoint`
|
||||||
|
MissingNonWitnessUtxo(OutPoint),
|
||||||
|
/// Miniscript PSBT error
|
||||||
|
MiniscriptPsbt(MiniscriptPsbtError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> fmt::Display for CreateTxError<P>
|
||||||
|
where
|
||||||
|
P: fmt::Display,
|
||||||
|
{
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Descriptor(e) => e.fmt(f),
|
||||||
|
Self::Persist(e) => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"failed to write wallet data to persistence backend: {}",
|
||||||
|
e
|
||||||
|
)
|
||||||
|
}
|
||||||
|
Self::Policy(e) => e.fmt(f),
|
||||||
|
CreateTxError::SpendingPolicyRequired(keychain_kind) => {
|
||||||
|
write!(f, "Spending policy required: {:?}", keychain_kind)
|
||||||
|
}
|
||||||
|
CreateTxError::Version0 => {
|
||||||
|
write!(f, "Invalid version `0`")
|
||||||
|
}
|
||||||
|
CreateTxError::Version1Csv => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"TxBuilder requested version `1`, but at least `2` is needed to use OP_CSV"
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::LockTime {
|
||||||
|
requested,
|
||||||
|
required,
|
||||||
|
} => {
|
||||||
|
write!(f, "TxBuilder requested timelock of `{:?}`, but at least `{:?}` is required to spend from this script", required, requested)
|
||||||
|
}
|
||||||
|
CreateTxError::RbfSequence => {
|
||||||
|
write!(f, "Cannot enable RBF with a nSequence >= 0xFFFFFFFE")
|
||||||
|
}
|
||||||
|
CreateTxError::RbfSequenceCsv { rbf, csv } => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Cannot enable RBF with nSequence `{:?}` given a required OP_CSV of `{:?}`",
|
||||||
|
rbf, csv
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::FeeTooLow { required } => {
|
||||||
|
write!(f, "Fee to low: required {} sat", required)
|
||||||
|
}
|
||||||
|
CreateTxError::FeeRateTooLow { required } => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Fee rate too low: required {} sat/vbyte",
|
||||||
|
required.as_sat_per_vb()
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::NoUtxosSelected => {
|
||||||
|
write!(f, "No UTXO selected")
|
||||||
|
}
|
||||||
|
CreateTxError::OutputBelowDustLimit(limit) => {
|
||||||
|
write!(f, "Output below the dust limit: {}", limit)
|
||||||
|
}
|
||||||
|
CreateTxError::ChangePolicyDescriptor => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"The `change_policy` can be set only if the wallet has a change_descriptor"
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::CoinSelection(e) => e.fmt(f),
|
||||||
|
CreateTxError::InsufficientFunds { needed, available } => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Insufficient funds: {} sat available of {} sat needed",
|
||||||
|
available, needed
|
||||||
|
)
|
||||||
|
}
|
||||||
|
CreateTxError::NoRecipients => {
|
||||||
|
write!(f, "Cannot build tx without recipients")
|
||||||
|
}
|
||||||
|
CreateTxError::Psbt(e) => e.fmt(f),
|
||||||
|
CreateTxError::MissingKeyOrigin(err) => {
|
||||||
|
write!(f, "Missing key origin: {}", err)
|
||||||
|
}
|
||||||
|
CreateTxError::UnknownUtxo => {
|
||||||
|
write!(f, "UTXO not found in the internal database")
|
||||||
|
}
|
||||||
|
CreateTxError::MissingNonWitnessUtxo(outpoint) => {
|
||||||
|
write!(f, "Missing non_witness_utxo on foreign utxo {}", outpoint)
|
||||||
|
}
|
||||||
|
CreateTxError::MiniscriptPsbt(err) => {
|
||||||
|
write!(f, "Miniscript PSBT error: {}", err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<descriptor::error::Error> for CreateTxError<P> {
|
||||||
|
fn from(err: descriptor::error::Error) -> Self {
|
||||||
|
CreateTxError::Descriptor(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<PolicyError> for CreateTxError<P> {
|
||||||
|
fn from(err: PolicyError) -> Self {
|
||||||
|
CreateTxError::Policy(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<MiniscriptPsbtError> for CreateTxError<P> {
|
||||||
|
fn from(err: MiniscriptPsbtError) -> Self {
|
||||||
|
CreateTxError::MiniscriptPsbt(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<psbt::Error> for CreateTxError<P> {
|
||||||
|
fn from(err: psbt::Error) -> Self {
|
||||||
|
CreateTxError::Psbt(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<P> From<coin_selection::Error> for CreateTxError<P> {
|
||||||
|
fn from(err: coin_selection::Error) -> Self {
|
||||||
|
CreateTxError::CoinSelection(err)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl<P: core::fmt::Display + core::fmt::Debug> std::error::Error for CreateTxError<P> {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`Wallet::build_fee_bump`]
|
||||||
|
///
|
||||||
|
/// [`Wallet::build_fee_bump`]: super::Wallet::build_fee_bump
|
||||||
|
pub enum BuildFeeBumpError {
|
||||||
|
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||||
|
UnknownUtxo(OutPoint),
|
||||||
|
/// Thrown when a tx is not found in the internal database
|
||||||
|
TransactionNotFound(Txid),
|
||||||
|
/// Happens when trying to bump a transaction that is already confirmed
|
||||||
|
TransactionConfirmed(Txid),
|
||||||
|
/// Trying to replace a tx that has a sequence >= `0xFFFFFFFE`
|
||||||
|
IrreplaceableTransaction(Txid),
|
||||||
|
/// Node doesn't have data to estimate a fee rate
|
||||||
|
FeeRateUnavailable,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for BuildFeeBumpError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::UnknownUtxo(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"UTXO not found in the internal database with txid: {}, vout: {}",
|
||||||
|
outpoint.txid, outpoint.vout
|
||||||
|
),
|
||||||
|
Self::TransactionNotFound(txid) => {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"Transaction not found in the internal database with txid: {}",
|
||||||
|
txid
|
||||||
|
)
|
||||||
|
}
|
||||||
|
Self::TransactionConfirmed(txid) => {
|
||||||
|
write!(f, "Transaction already confirmed with txid: {}", txid)
|
||||||
|
}
|
||||||
|
Self::IrreplaceableTransaction(txid) => {
|
||||||
|
write!(f, "Transaction can't be replaced with txid: {}", txid)
|
||||||
|
}
|
||||||
|
Self::FeeRateUnavailable => write!(f, "Fee rate unavailable"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for BuildFeeBumpError {}
|
||||||
@@ -56,7 +56,6 @@
|
|||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
use alloc::string::{String, ToString};
|
use alloc::string::{String, ToString};
|
||||||
use bdk_chain::sparse_chain::ChainPosition;
|
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
use miniscript::descriptor::{ShInner, WshInner};
|
use miniscript::descriptor::{ShInner, WshInner};
|
||||||
@@ -127,11 +126,12 @@ impl FullyNodedExport {
|
|||||||
Self::is_compatible_with_core(&descriptor)?;
|
Self::is_compatible_with_core(&descriptor)?;
|
||||||
|
|
||||||
let blockheight = if include_blockheight {
|
let blockheight = if include_blockheight {
|
||||||
wallet
|
wallet.transactions().next().map_or(0, |canonical_tx| {
|
||||||
.transactions()
|
match canonical_tx.chain_position {
|
||||||
.next()
|
bdk_chain::ChainPosition::Confirmed(a) => a.confirmation_height,
|
||||||
.and_then(|(pos, _)| pos.height().into())
|
bdk_chain::ChainPosition::Unconfirmed(_) => 0,
|
||||||
.unwrap_or(0)
|
}
|
||||||
|
})
|
||||||
} else {
|
} else {
|
||||||
0
|
0
|
||||||
};
|
};
|
||||||
@@ -231,7 +231,7 @@ mod test {
|
|||||||
input: vec![],
|
input: vec![],
|
||||||
output: vec![],
|
output: vec![],
|
||||||
version: 0,
|
version: 0,
|
||||||
lock_time: bitcoin::PackedLockTime::ZERO,
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
};
|
};
|
||||||
wallet
|
wallet
|
||||||
.insert_checkpoint(BlockId {
|
.insert_checkpoint(BlockId {
|
||||||
|
|||||||
@@ -19,7 +19,7 @@
|
|||||||
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
||||||
//! # use bdk::wallet::AddressIndex::New;
|
//! # use bdk::wallet::AddressIndex::New;
|
||||||
//! # use bdk::{FeeRate, KeychainKind, SignOptions, Wallet};
|
//! # use bdk::{FeeRate, KeychainKind, SignOptions, Wallet};
|
||||||
//! # use hwi::{types::HWIChain, HWIClient};
|
//! # use hwi::HWIClient;
|
||||||
//! # use std::sync::Arc;
|
//! # use std::sync::Arc;
|
||||||
//! #
|
//! #
|
||||||
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
@@ -28,7 +28,7 @@
|
|||||||
//! panic!("No devices found!");
|
//! panic!("No devices found!");
|
||||||
//! }
|
//! }
|
||||||
//! let first_device = devices.remove(0)?;
|
//! let first_device = devices.remove(0)?;
|
||||||
//! let custom_signer = HWISigner::from_device(&first_device, HWIChain::Test)?;
|
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
//!
|
//!
|
||||||
//! # let mut wallet = Wallet::new_no_persist(
|
//! # let mut wallet = Wallet::new_no_persist(
|
||||||
//! # "",
|
//! # "",
|
||||||
@@ -47,9 +47,9 @@
|
|||||||
//! # }
|
//! # }
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::psbt::PartiallySignedTransaction;
|
use bitcoin::psbt::PartiallySignedTransaction;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
|
||||||
|
|
||||||
use hwi::error::Error;
|
use hwi::error::Error;
|
||||||
use hwi::types::{HWIChain, HWIDevice};
|
use hwi::types::{HWIChain, HWIDevice};
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
@@ -19,7 +19,7 @@
|
|||||||
//! # use core::str::FromStr;
|
//! # use core::str::FromStr;
|
||||||
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bitcoin::util::psbt;
|
//! # use bitcoin::psbt;
|
||||||
//! # use bdk::signer::*;
|
//! # use bdk::signer::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! # #[derive(Debug)]
|
//! # #[derive(Debug)]
|
||||||
@@ -76,34 +76,35 @@
|
|||||||
//! Arc::new(custom_signer)
|
//! Arc::new(custom_signer)
|
||||||
//! );
|
//! );
|
||||||
//!
|
//!
|
||||||
//! # Ok::<_, bdk::Error>(())
|
//! # Ok::<_, anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use crate::collections::BTreeMap;
|
use crate::collections::BTreeMap;
|
||||||
|
use alloc::string::String;
|
||||||
use alloc::sync::Arc;
|
use alloc::sync::Arc;
|
||||||
use alloc::vec::Vec;
|
use alloc::vec::Vec;
|
||||||
use core::cmp::Ordering;
|
use core::cmp::Ordering;
|
||||||
use core::fmt;
|
use core::fmt;
|
||||||
use core::ops::{Bound::Included, Deref};
|
use core::ops::{Bound::Included, Deref};
|
||||||
|
|
||||||
use bitcoin::blockdata::opcodes;
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
||||||
use bitcoin::blockdata::script::Builder as ScriptBuilder;
|
use bitcoin::hashes::hash160;
|
||||||
use bitcoin::hashes::{hash160, Hash};
|
|
||||||
use bitcoin::secp256k1::Message;
|
use bitcoin::secp256k1::Message;
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
use bitcoin::sighash::{EcdsaSighashType, TapSighash, TapSighashType};
|
||||||
use bitcoin::util::{ecdsa, psbt, schnorr, sighash, taproot};
|
use bitcoin::{ecdsa, psbt, sighash, taproot};
|
||||||
use bitcoin::{secp256k1, XOnlyPublicKey};
|
use bitcoin::{key::TapTweak, key::XOnlyPublicKey, secp256k1};
|
||||||
use bitcoin::{EcdsaSighashType, PrivateKey, PublicKey, SchnorrSighashType, Script};
|
use bitcoin::{PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
Descriptor, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey, KeyMap, SinglePriv,
|
Descriptor, DescriptorMultiXKey, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey,
|
||||||
SinglePubKey,
|
InnerXKey, KeyMap, SinglePriv, SinglePubKey,
|
||||||
};
|
};
|
||||||
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
||||||
|
|
||||||
use super::utils::SecpCtx;
|
use super::utils::SecpCtx;
|
||||||
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
use crate::descriptor::{DescriptorMeta, XKeyUtils};
|
||||||
use crate::psbt::PsbtUtils;
|
use crate::psbt::PsbtUtils;
|
||||||
|
use crate::wallet::error::MiniscriptPsbtError;
|
||||||
|
|
||||||
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
/// Identifier of a signer in the `SignersContainers`. Used as a key to find the right signer among
|
||||||
/// multiple of them
|
/// multiple of them
|
||||||
@@ -130,7 +131,7 @@ impl From<Fingerprint> for SignerId {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Signing error
|
/// Signing error
|
||||||
#[derive(Debug, PartialEq, Eq, Clone)]
|
#[derive(Debug)]
|
||||||
pub enum SignerError {
|
pub enum SignerError {
|
||||||
/// The private key is missing for the required public key
|
/// The private key is missing for the required public key
|
||||||
MissingKey,
|
MissingKey,
|
||||||
@@ -160,16 +161,12 @@ pub enum SignerError {
|
|||||||
InvalidSighash,
|
InvalidSighash,
|
||||||
/// Error while computing the hash to sign
|
/// Error while computing the hash to sign
|
||||||
SighashError(sighash::Error),
|
SighashError(sighash::Error),
|
||||||
/// Error while signing using hardware wallets
|
/// Miniscript PSBT error
|
||||||
#[cfg(feature = "hardware-signer")]
|
MiniscriptPsbt(MiniscriptPsbtError),
|
||||||
HWIError(hwi::error::Error),
|
/// To be used only by external libraries implementing [`InputSigner`] or
|
||||||
}
|
/// [`TransactionSigner`], so that they can return their own custom errors, without having to
|
||||||
|
/// modify [`SignerError`] in BDK.
|
||||||
#[cfg(feature = "hardware-signer")]
|
External(String),
|
||||||
impl From<hwi::error::Error> for SignerError {
|
|
||||||
fn from(e: hwi::error::Error) -> Self {
|
|
||||||
SignerError::HWIError(e)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl From<sighash::Error> for SignerError {
|
impl From<sighash::Error> for SignerError {
|
||||||
@@ -193,8 +190,8 @@ impl fmt::Display for SignerError {
|
|||||||
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
Self::NonStandardSighash => write!(f, "The psbt contains a non standard sighash"),
|
||||||
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
Self::InvalidSighash => write!(f, "Invalid SIGHASH for the signing context in use"),
|
||||||
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
Self::SighashError(err) => write!(f, "Error while computing the hash to sign: {}", err),
|
||||||
#[cfg(feature = "hardware-signer")]
|
Self::MiniscriptPsbt(err) => write!(f, "Miniscript PSBT error: {}", err),
|
||||||
Self::HWIError(err) => write!(f, "Error while signing using hardware wallets: {}", err),
|
Self::External(err) => write!(f, "{}", err),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -218,7 +215,7 @@ pub enum SignerContext {
|
|||||||
},
|
},
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Wrapper structure to pair a signer with its context
|
/// Wrapper to pair a signer with its context
|
||||||
#[derive(Debug, Clone)]
|
#[derive(Debug, Clone)]
|
||||||
pub struct SignerWrapper<S: Sized + fmt::Debug + Clone> {
|
pub struct SignerWrapper<S: Sized + fmt::Debug + Clone> {
|
||||||
signer: S,
|
signer: S,
|
||||||
@@ -383,6 +380,48 @@ impl InputSigner for SignerWrapper<DescriptorXKey<ExtendedPrivKey>> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fn multikey_to_xkeys<K: InnerXKey + Clone>(
|
||||||
|
multikey: DescriptorMultiXKey<K>,
|
||||||
|
) -> Vec<DescriptorXKey<K>> {
|
||||||
|
multikey
|
||||||
|
.derivation_paths
|
||||||
|
.into_paths()
|
||||||
|
.into_iter()
|
||||||
|
.map(|derivation_path| DescriptorXKey {
|
||||||
|
origin: multikey.origin.clone(),
|
||||||
|
xkey: multikey.xkey.clone(),
|
||||||
|
derivation_path,
|
||||||
|
wildcard: multikey.wildcard,
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
|
SignerId::from(self.root_fingerprint(secp))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
||||||
|
Some(DescriptorSecretKey::MultiXPrv(self.signer.clone()))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl InputSigner for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn sign_input(
|
||||||
|
&self,
|
||||||
|
psbt: &mut psbt::PartiallySignedTransaction,
|
||||||
|
input_index: usize,
|
||||||
|
sign_options: &SignOptions,
|
||||||
|
secp: &SecpCtx,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
let xkeys = multikey_to_xkeys(self.signer.clone());
|
||||||
|
for xkey in xkeys {
|
||||||
|
SignerWrapper::new(xkey, self.ctx).sign_input(psbt, input_index, sign_options, secp)?
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl SignerCommon for SignerWrapper<PrivateKey> {
|
impl SignerCommon for SignerWrapper<PrivateKey> {
|
||||||
fn id(&self, secp: &SecpCtx) -> SignerId {
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
||||||
@@ -418,20 +457,23 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
let x_only_pubkey = XOnlyPublicKey::from(pubkey.inner);
|
let x_only_pubkey = XOnlyPublicKey::from(pubkey.inner);
|
||||||
|
|
||||||
if let SignerContext::Tap { is_internal_key } = self.ctx {
|
if let SignerContext::Tap { is_internal_key } = self.ctx {
|
||||||
if is_internal_key
|
if let Some(psbt_internal_key) = psbt.inputs[input_index].tap_internal_key {
|
||||||
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
if is_internal_key
|
||||||
&& sign_options.sign_with_tap_internal_key
|
&& psbt.inputs[input_index].tap_key_sig.is_none()
|
||||||
{
|
&& sign_options.sign_with_tap_internal_key
|
||||||
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
&& x_only_pubkey == psbt_internal_key
|
||||||
sign_psbt_schnorr(
|
{
|
||||||
&self.inner,
|
let (hash, hash_ty) = Tap::sighash(psbt, input_index, None)?;
|
||||||
x_only_pubkey,
|
sign_psbt_schnorr(
|
||||||
None,
|
&self.inner,
|
||||||
&mut psbt.inputs[input_index],
|
x_only_pubkey,
|
||||||
hash,
|
None,
|
||||||
hash_ty,
|
&mut psbt.inputs[input_index],
|
||||||
secp,
|
hash,
|
||||||
);
|
hash_ty,
|
||||||
|
secp,
|
||||||
|
);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if let Some((leaf_hashes, _)) =
|
if let Some((leaf_hashes, _)) =
|
||||||
@@ -477,8 +519,16 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let (hash, hash_ty) = match self.ctx {
|
let (hash, hash_ty) = match self.ctx {
|
||||||
SignerContext::Segwitv0 => Segwitv0::sighash(psbt, input_index, ())?,
|
SignerContext::Segwitv0 => {
|
||||||
SignerContext::Legacy => Legacy::sighash(psbt, input_index, ())?,
|
let (h, t) = Segwitv0::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
|
SignerContext::Legacy => {
|
||||||
|
let (h, t) = Legacy::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
_ => return Ok(()), // handled above
|
_ => return Ok(()), // handled above
|
||||||
};
|
};
|
||||||
sign_psbt_ecdsa(
|
sign_psbt_ecdsa(
|
||||||
@@ -499,12 +549,12 @@ fn sign_psbt_ecdsa(
|
|||||||
secret_key: &secp256k1::SecretKey,
|
secret_key: &secp256k1::SecretKey,
|
||||||
pubkey: PublicKey,
|
pubkey: PublicKey,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: bitcoin::Sighash,
|
hash: impl bitcoin::hashes::Hash + bitcoin::secp256k1::ThirtyTwoByteHash,
|
||||||
hash_ty: EcdsaSighashType,
|
hash_ty: EcdsaSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
allow_grinding: bool,
|
allow_grinding: bool,
|
||||||
) {
|
) {
|
||||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
let msg = &Message::from(hash);
|
||||||
let sig = if allow_grinding {
|
let sig = if allow_grinding {
|
||||||
secp.sign_ecdsa_low_r(msg, secret_key)
|
secp.sign_ecdsa_low_r(msg, secret_key)
|
||||||
} else {
|
} else {
|
||||||
@@ -513,7 +563,7 @@ fn sign_psbt_ecdsa(
|
|||||||
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
||||||
.expect("invalid or corrupted ecdsa signature");
|
.expect("invalid or corrupted ecdsa signature");
|
||||||
|
|
||||||
let final_signature = ecdsa::EcdsaSig { sig, hash_ty };
|
let final_signature = ecdsa::Signature { sig, hash_ty };
|
||||||
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -523,12 +573,10 @@ fn sign_psbt_schnorr(
|
|||||||
pubkey: XOnlyPublicKey,
|
pubkey: XOnlyPublicKey,
|
||||||
leaf_hash: Option<taproot::TapLeafHash>,
|
leaf_hash: Option<taproot::TapLeafHash>,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: taproot::TapSighashHash,
|
hash: TapSighash,
|
||||||
hash_ty: SchnorrSighashType,
|
hash_ty: TapSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
) {
|
) {
|
||||||
use schnorr::TapTweak;
|
|
||||||
|
|
||||||
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
||||||
let keypair = match leaf_hash {
|
let keypair = match leaf_hash {
|
||||||
None => keypair
|
None => keypair
|
||||||
@@ -537,12 +585,12 @@ fn sign_psbt_schnorr(
|
|||||||
Some(_) => keypair, // no tweak for script spend
|
Some(_) => keypair, // no tweak for script spend
|
||||||
};
|
};
|
||||||
|
|
||||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
let msg = &Message::from(hash);
|
||||||
let sig = secp.sign_schnorr(msg, &keypair);
|
let sig = secp.sign_schnorr(msg, &keypair);
|
||||||
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
||||||
.expect("invalid or corrupted schnorr signature");
|
.expect("invalid or corrupted schnorr signature");
|
||||||
|
|
||||||
let final_signature = schnorr::SchnorrSig { sig, hash_ty };
|
let final_signature = taproot::Signature { sig, hash_ty };
|
||||||
|
|
||||||
if let Some(lh) = leaf_hash {
|
if let Some(lh) = leaf_hash {
|
||||||
psbt_input
|
psbt_input
|
||||||
@@ -632,6 +680,11 @@ impl SignersContainer {
|
|||||||
SignerOrdering::default(),
|
SignerOrdering::default(),
|
||||||
Arc::new(SignerWrapper::new(xprv, ctx)),
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
),
|
),
|
||||||
|
DescriptorSecretKey::MultiXPrv(xprv) => container.add_external(
|
||||||
|
SignerId::from(xprv.root_fingerprint(secp)),
|
||||||
|
SignerOrdering::default(),
|
||||||
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
|
),
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -699,7 +752,7 @@ pub struct SignOptions {
|
|||||||
/// Whether the signer should trust the `witness_utxo`, if the `non_witness_utxo` hasn't been
|
/// Whether the signer should trust the `witness_utxo`, if the `non_witness_utxo` hasn't been
|
||||||
/// provided
|
/// provided
|
||||||
///
|
///
|
||||||
/// Defaults to `false` to mitigate the "SegWit bug" which chould trick the wallet into
|
/// Defaults to `false` to mitigate the "SegWit bug" which should trick the wallet into
|
||||||
/// paying a fee larger than expected.
|
/// paying a fee larger than expected.
|
||||||
///
|
///
|
||||||
/// Some wallets, especially if relatively old, might not provide the `non_witness_utxo` for
|
/// Some wallets, especially if relatively old, might not provide the `non_witness_utxo` for
|
||||||
@@ -753,9 +806,10 @@ pub struct SignOptions {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Customize which taproot script-path leaves the signer should sign.
|
/// Customize which taproot script-path leaves the signer should sign.
|
||||||
#[derive(Debug, Clone, PartialEq, Eq)]
|
#[derive(Default, Debug, Clone, PartialEq, Eq)]
|
||||||
pub enum TapLeavesOptions {
|
pub enum TapLeavesOptions {
|
||||||
/// The signer will sign all the leaves it has a key for.
|
/// The signer will sign all the leaves it has a key for.
|
||||||
|
#[default]
|
||||||
All,
|
All,
|
||||||
/// The signer won't sign leaves other than the ones specified. Note that it could still ignore
|
/// The signer won't sign leaves other than the ones specified. Note that it could still ignore
|
||||||
/// some of the specified leaves, if it doesn't have the right key to sign them.
|
/// some of the specified leaves, if it doesn't have the right key to sign them.
|
||||||
@@ -766,13 +820,6 @@ pub enum TapLeavesOptions {
|
|||||||
None,
|
None,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for TapLeavesOptions {
|
|
||||||
fn default() -> Self {
|
|
||||||
TapLeavesOptions::All
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[allow(clippy::derivable_impls)]
|
|
||||||
impl Default for SignOptions {
|
impl Default for SignOptions {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
SignOptions {
|
SignOptions {
|
||||||
@@ -802,7 +849,7 @@ pub(crate) trait ComputeSighash {
|
|||||||
|
|
||||||
impl ComputeSighash for Legacy {
|
impl ComputeSighash for Legacy {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::LegacySighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@@ -849,19 +896,9 @@ impl ComputeSighash for Legacy {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn p2wpkh_script_code(script: &Script) -> Script {
|
|
||||||
ScriptBuilder::new()
|
|
||||||
.push_opcode(opcodes::all::OP_DUP)
|
|
||||||
.push_opcode(opcodes::all::OP_HASH160)
|
|
||||||
.push_slice(&script[2..])
|
|
||||||
.push_opcode(opcodes::all::OP_EQUALVERIFY)
|
|
||||||
.push_opcode(opcodes::all::OP_CHECKSIG)
|
|
||||||
.into_script()
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ComputeSighash for Segwitv0 {
|
impl ComputeSighash for Segwitv0 {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::SegwitV0Sighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@@ -908,14 +945,21 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
Some(ref witness_script) => witness_script.clone(),
|
Some(ref witness_script) => witness_script.clone(),
|
||||||
None => {
|
None => {
|
||||||
if utxo.script_pubkey.is_v0_p2wpkh() {
|
if utxo.script_pubkey.is_v0_p2wpkh() {
|
||||||
p2wpkh_script_code(&utxo.script_pubkey)
|
utxo.script_pubkey
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else if psbt_input
|
} else if psbt_input
|
||||||
.redeem_script
|
.redeem_script
|
||||||
.as_ref()
|
.as_ref()
|
||||||
.map(Script::is_v0_p2wpkh)
|
.map(|s| s.is_v0_p2wpkh())
|
||||||
.unwrap_or(false)
|
.unwrap_or(false)
|
||||||
{
|
{
|
||||||
p2wpkh_script_code(psbt_input.redeem_script.as_ref().unwrap())
|
psbt_input
|
||||||
|
.redeem_script
|
||||||
|
.as_ref()
|
||||||
|
.unwrap()
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else {
|
} else {
|
||||||
return Err(SignerError::MissingWitnessScript);
|
return Err(SignerError::MissingWitnessScript);
|
||||||
}
|
}
|
||||||
@@ -936,14 +980,14 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
|
|
||||||
impl ComputeSighash for Tap {
|
impl ComputeSighash for Tap {
|
||||||
type Extra = Option<taproot::TapLeafHash>;
|
type Extra = Option<taproot::TapLeafHash>;
|
||||||
type Sighash = taproot::TapSighashHash;
|
type Sighash = TapSighash;
|
||||||
type SighashType = SchnorrSighashType;
|
type SighashType = TapSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
psbt: &psbt::PartiallySignedTransaction,
|
psbt: &psbt::PartiallySignedTransaction,
|
||||||
input_index: usize,
|
input_index: usize,
|
||||||
extra: Self::Extra,
|
extra: Self::Extra,
|
||||||
) -> Result<(Self::Sighash, SchnorrSighashType), SignerError> {
|
) -> Result<(Self::Sighash, TapSighashType), SignerError> {
|
||||||
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
||||||
return Err(SignerError::InputIndexOutOfRange);
|
return Err(SignerError::InputIndexOutOfRange);
|
||||||
}
|
}
|
||||||
@@ -952,8 +996,8 @@ impl ComputeSighash for Tap {
|
|||||||
|
|
||||||
let sighash_type = psbt_input
|
let sighash_type = psbt_input
|
||||||
.sighash_type
|
.sighash_type
|
||||||
.unwrap_or_else(|| SchnorrSighashType::Default.into())
|
.unwrap_or_else(|| TapSighashType::Default.into())
|
||||||
.schnorr_hash_ty()
|
.taproot_hash_ty()
|
||||||
.map_err(|_| SignerError::InvalidSighash)?;
|
.map_err(|_| SignerError::InvalidSighash)?;
|
||||||
let witness_utxos = (0..psbt.inputs.len())
|
let witness_utxos = (0..psbt.inputs.len())
|
||||||
.map(|i| psbt.get_utxo_for(i))
|
.map(|i| psbt.get_utxo_for(i))
|
||||||
@@ -1015,8 +1059,8 @@ mod signers_container_tests {
|
|||||||
use crate::descriptor::IntoWalletDescriptor;
|
use crate::descriptor::IntoWalletDescriptor;
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
|
|||||||
@@ -17,8 +17,12 @@
|
|||||||
//! # use std::str::FromStr;
|
//! # use std::str::FromStr;
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
|
//! # use bdk::wallet::ChangeSet;
|
||||||
|
//! # use bdk::wallet::error::CreateTxError;
|
||||||
//! # use bdk::wallet::tx_builder::CreateTx;
|
//! # use bdk::wallet::tx_builder::CreateTx;
|
||||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! # use bdk_chain::PersistBackend;
|
||||||
|
//! # use anyhow::Error;
|
||||||
|
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
//! # let mut wallet = doctest_wallet!();
|
//! # let mut wallet = doctest_wallet!();
|
||||||
//! // create a TxBuilder from a wallet
|
//! // create a TxBuilder from a wallet
|
||||||
//! let mut tx_builder = wallet.build_tx();
|
//! let mut tx_builder = wallet.build_tx();
|
||||||
@@ -27,32 +31,32 @@
|
|||||||
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
||||||
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
||||||
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
||||||
//! .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
//! .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
//! // Only spend non-change outputs
|
//! // Only spend non-change outputs
|
||||||
//! .do_not_spend_change()
|
//! .do_not_spend_change()
|
||||||
//! // Turn on RBF signaling
|
//! // Turn on RBF signaling
|
||||||
//! .enable_rbf();
|
//! .enable_rbf();
|
||||||
//! let (psbt, tx_details) = tx_builder.finish()?;
|
//! let psbt = tx_builder.finish()?;
|
||||||
//! # Ok::<(), bdk::Error>(())
|
//! # Ok::<(), anyhow::Error>(())
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use crate::collections::BTreeMap;
|
use crate::collections::BTreeMap;
|
||||||
use crate::collections::HashSet;
|
use crate::collections::HashSet;
|
||||||
use alloc::{boxed::Box, rc::Rc, string::String, vec::Vec};
|
use alloc::{boxed::Box, rc::Rc, string::String, vec::Vec};
|
||||||
use bdk_chain::ConfirmationTime;
|
use bdk_chain::PersistBackend;
|
||||||
use core::cell::RefCell;
|
use core::cell::RefCell;
|
||||||
|
use core::fmt;
|
||||||
use core::marker::PhantomData;
|
use core::marker::PhantomData;
|
||||||
|
|
||||||
use bitcoin::util::psbt::{self, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||||
use bitcoin::{LockTime, OutPoint, Script, Sequence, Transaction};
|
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction, Txid};
|
||||||
|
|
||||||
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
||||||
use super::persist;
|
use super::ChangeSet;
|
||||||
use crate::{
|
use crate::types::{FeeRate, KeychainKind, LocalOutput, WeightedUtxo};
|
||||||
types::{FeeRate, KeychainKind, LocalUtxo, WeightedUtxo},
|
use crate::wallet::CreateTxError;
|
||||||
TransactionDetails,
|
use crate::{Utxo, Wallet};
|
||||||
};
|
|
||||||
use crate::{Error, Utxo, Wallet};
|
|
||||||
/// Context in which the [`TxBuilder`] is valid
|
/// Context in which the [`TxBuilder`] is valid
|
||||||
pub trait TxBuilderContext: core::fmt::Debug + Default + Clone {}
|
pub trait TxBuilderContext: core::fmt::Debug + Default + Clone {}
|
||||||
|
|
||||||
@@ -81,11 +85,15 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// # use bdk::wallet::tx_builder::*;
|
/// # use bdk::wallet::tx_builder::*;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use core::str::FromStr;
|
/// # use core::str::FromStr;
|
||||||
|
/// # use bdk::wallet::ChangeSet;
|
||||||
|
/// # use bdk::wallet::error::CreateTxError;
|
||||||
|
/// # use bdk_chain::PersistBackend;
|
||||||
|
/// # use anyhow::Error;
|
||||||
/// # let mut wallet = doctest_wallet!();
|
/// # let mut wallet = doctest_wallet!();
|
||||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// # let addr2 = addr1.clone();
|
/// # let addr2 = addr1.clone();
|
||||||
/// // chaining
|
/// // chaining
|
||||||
/// let (psbt1, details) = {
|
/// let psbt1 = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder
|
/// builder
|
||||||
/// .ordering(TxOrdering::Untouched)
|
/// .ordering(TxOrdering::Untouched)
|
||||||
@@ -95,7 +103,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// // non-chaining
|
/// // non-chaining
|
||||||
/// let (psbt2, details) = {
|
/// let psbt2 = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder.ordering(TxOrdering::Untouched);
|
/// builder.ordering(TxOrdering::Untouched);
|
||||||
/// for addr in &[addr1, addr2] {
|
/// for addr in &[addr1, addr2] {
|
||||||
@@ -105,7 +113,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// assert_eq!(psbt1.unsigned_tx.output[..2], psbt2.unsigned_tx.output[..2]);
|
/// assert_eq!(psbt1.unsigned_tx.output[..2], psbt2.unsigned_tx.output[..2]);
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), anyhow::Error>(())
|
||||||
/// ```
|
/// ```
|
||||||
///
|
///
|
||||||
/// At the moment [`coin_selection`] is an exception to the rule as it consumes `self`.
|
/// At the moment [`coin_selection`] is an exception to the rule as it consumes `self`.
|
||||||
@@ -129,9 +137,9 @@ pub struct TxBuilder<'a, D, Cs, Ctx> {
|
|||||||
//TODO: TxParams should eventually be exposed publicly.
|
//TODO: TxParams should eventually be exposed publicly.
|
||||||
#[derive(Default, Debug, Clone)]
|
#[derive(Default, Debug, Clone)]
|
||||||
pub(crate) struct TxParams {
|
pub(crate) struct TxParams {
|
||||||
pub(crate) recipients: Vec<(Script, u64)>,
|
pub(crate) recipients: Vec<(ScriptBuf, u64)>,
|
||||||
pub(crate) drain_wallet: bool,
|
pub(crate) drain_wallet: bool,
|
||||||
pub(crate) drain_to: Option<Script>,
|
pub(crate) drain_to: Option<ScriptBuf>,
|
||||||
pub(crate) fee_policy: Option<FeePolicy>,
|
pub(crate) fee_policy: Option<FeePolicy>,
|
||||||
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
@@ -140,7 +148,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) manually_selected_only: bool,
|
pub(crate) manually_selected_only: bool,
|
||||||
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
||||||
pub(crate) ordering: TxOrdering,
|
pub(crate) ordering: TxOrdering,
|
||||||
pub(crate) locktime: Option<LockTime>,
|
pub(crate) locktime: Option<absolute::LockTime>,
|
||||||
pub(crate) rbf: Option<RbfValue>,
|
pub(crate) rbf: Option<RbfValue>,
|
||||||
pub(crate) version: Option<Version>,
|
pub(crate) version: Option<Version>,
|
||||||
pub(crate) change_policy: ChangeSpendPolicy,
|
pub(crate) change_policy: ChangeSpendPolicy,
|
||||||
@@ -148,7 +156,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) add_global_xpubs: bool,
|
pub(crate) add_global_xpubs: bool,
|
||||||
pub(crate) include_output_redeem_witness_script: bool,
|
pub(crate) include_output_redeem_witness_script: bool,
|
||||||
pub(crate) bumping_fee: Option<PreviousFee>,
|
pub(crate) bumping_fee: Option<PreviousFee>,
|
||||||
pub(crate) current_height: Option<LockTime>,
|
pub(crate) current_height: Option<absolute::LockTime>,
|
||||||
pub(crate) allow_dust: bool,
|
pub(crate) allow_dust: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -182,14 +190,33 @@ impl<'a, D, Cs: Clone, Ctx> Clone for TxBuilder<'a, D, Cs, Ctx> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// methods supported by both contexts, for any CoinSelectionAlgorithm
|
// methods supported by both contexts, for any CoinSelectionAlgorithm
|
||||||
impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D, Cs, Ctx> {
|
impl<'a, D, Cs, Ctx> TxBuilder<'a, D, Cs, Ctx> {
|
||||||
/// Set a custom fee rate
|
/// Set a custom fee rate
|
||||||
|
/// The fee_rate method sets the mining fee paid by the transaction as a rate on its size.
|
||||||
|
/// This means that the total fee paid is equal to this rate * size of the transaction in virtual Bytes (vB) or Weight Unit (wu).
|
||||||
|
/// This rate is internally expressed in satoshis-per-virtual-bytes (sats/vB) using FeeRate::from_sat_per_vb, but can also be set by:
|
||||||
|
/// * sats/kvB (1000 sats/kvB == 1 sats/vB) using FeeRate::from_sat_per_kvb
|
||||||
|
/// * btc/kvB (0.00001000 btc/kvB == 1 sats/vB) using FeeRate::from_btc_per_kvb
|
||||||
|
/// * sats/kwu (250 sats/kwu == 1 sats/vB) using FeeRate::from_sat_per_kwu
|
||||||
|
/// Default is 1 sat/vB (see min_relay_fee)
|
||||||
|
///
|
||||||
|
/// Note that this is really a minimum feerate -- it's possible to
|
||||||
|
/// overshoot it slightly since adding a change output to drain the remaining
|
||||||
|
/// excess might not be viable.
|
||||||
pub fn fee_rate(&mut self, fee_rate: FeeRate) -> &mut Self {
|
pub fn fee_rate(&mut self, fee_rate: FeeRate) -> &mut Self {
|
||||||
self.params.fee_policy = Some(FeePolicy::FeeRate(fee_rate));
|
self.params.fee_policy = Some(FeePolicy::FeeRate(fee_rate));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Set an absolute fee
|
/// Set an absolute fee
|
||||||
|
/// The fee_absolute method refers to the absolute transaction fee in satoshis (sats).
|
||||||
|
/// If anyone sets both the fee_absolute method and the fee_rate method,
|
||||||
|
/// the FeePolicy enum will be set by whichever method was called last,
|
||||||
|
/// as the FeeRate and FeeAmount are mutually exclusive.
|
||||||
|
///
|
||||||
|
/// Note that this is really a minimum absolute fee -- it's possible to
|
||||||
|
/// overshoot it slightly since adding a change output to drain the remaining
|
||||||
|
/// excess might not be viable.
|
||||||
pub fn fee_absolute(&mut self, fee_amount: u64) -> &mut Self {
|
pub fn fee_absolute(&mut self, fee_amount: u64) -> &mut Self {
|
||||||
self.params.fee_policy = Some(FeePolicy::FeeAmount(fee_amount));
|
self.params.fee_policy = Some(FeePolicy::FeeAmount(fee_amount));
|
||||||
self
|
self
|
||||||
@@ -242,7 +269,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
/// # use std::collections::BTreeMap;
|
/// # use std::collections::BTreeMap;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
/// # let mut wallet = doctest_wallet!();
|
/// # let mut wallet = doctest_wallet!();
|
||||||
/// let mut path = BTreeMap::new();
|
/// let mut path = BTreeMap::new();
|
||||||
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
||||||
@@ -252,7 +282,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
/// .add_recipient(to_address.script_pubkey(), 50_000)
|
/// .add_recipient(to_address.script_pubkey(), 50_000)
|
||||||
/// .policy_path(path, KeychainKind::External);
|
/// .policy_path(path, KeychainKind::External);
|
||||||
///
|
///
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), anyhow::Error>(())
|
||||||
/// ```
|
/// ```
|
||||||
pub fn policy_path(
|
pub fn policy_path(
|
||||||
&mut self,
|
&mut self,
|
||||||
@@ -274,16 +304,21 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
///
|
///
|
||||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||||
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, Error> {
|
pub fn add_utxos(&mut self, outpoints: &[OutPoint]) -> Result<&mut Self, AddUtxoError> {
|
||||||
{
|
{
|
||||||
let wallet = self.wallet.borrow();
|
let wallet = self.wallet.borrow();
|
||||||
let utxos = outpoints
|
let utxos = outpoints
|
||||||
.iter()
|
.iter()
|
||||||
.map(|outpoint| wallet.get_utxo(*outpoint).ok_or(Error::UnknownUtxo))
|
.map(|outpoint| {
|
||||||
|
wallet
|
||||||
|
.get_utxo(*outpoint)
|
||||||
|
.ok_or(AddUtxoError::UnknownUtxo(*outpoint))
|
||||||
|
})
|
||||||
.collect::<Result<Vec<_>, _>>()?;
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
|
||||||
for utxo in utxos {
|
for utxo in utxos {
|
||||||
let descriptor = wallet.get_descriptor_for_keychain(utxo.keychain);
|
let descriptor = wallet.get_descriptor_for_keychain(utxo.keychain);
|
||||||
|
#[allow(deprecated)]
|
||||||
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
||||||
self.params.utxos.push(WeightedUtxo {
|
self.params.utxos.push(WeightedUtxo {
|
||||||
satisfaction_weight,
|
satisfaction_weight,
|
||||||
@@ -299,7 +334,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
///
|
///
|
||||||
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
/// These have priority over the "unspendable" utxos, meaning that if a utxo is present both in
|
||||||
/// the "utxos" and the "unspendable" list, it will be spent.
|
/// the "utxos" and the "unspendable" list, it will be spent.
|
||||||
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, Error> {
|
pub fn add_utxo(&mut self, outpoint: OutPoint) -> Result<&mut Self, AddUtxoError> {
|
||||||
self.add_utxos(&[outpoint])
|
self.add_utxos(&[outpoint])
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -331,6 +366,10 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
///
|
///
|
||||||
/// This is an **EXPERIMENTAL** feature, API and other major changes are expected.
|
/// This is an **EXPERIMENTAL** feature, API and other major changes are expected.
|
||||||
///
|
///
|
||||||
|
/// In order to use [`Wallet::calculate_fee`] or [`Wallet::calculate_fee_rate`] for a transaction
|
||||||
|
/// created with foreign UTXO(s) you must manually insert the corresponding TxOut(s) into the tx
|
||||||
|
/// graph using the [`Wallet::insert_txout`] function.
|
||||||
|
///
|
||||||
/// # Errors
|
/// # Errors
|
||||||
///
|
///
|
||||||
/// This method returns errors in the following circumstances:
|
/// This method returns errors in the following circumstances:
|
||||||
@@ -350,23 +389,38 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
outpoint: OutPoint,
|
outpoint: OutPoint,
|
||||||
psbt_input: psbt::Input,
|
psbt_input: psbt::Input,
|
||||||
satisfaction_weight: usize,
|
satisfaction_weight: usize,
|
||||||
) -> Result<&mut Self, Error> {
|
) -> Result<&mut Self, AddForeignUtxoError> {
|
||||||
|
self.add_foreign_utxo_with_sequence(
|
||||||
|
outpoint,
|
||||||
|
psbt_input,
|
||||||
|
satisfaction_weight,
|
||||||
|
Sequence::MAX,
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Same as [add_foreign_utxo](TxBuilder::add_foreign_utxo) but allows to set the nSequence value.
|
||||||
|
pub fn add_foreign_utxo_with_sequence(
|
||||||
|
&mut self,
|
||||||
|
outpoint: OutPoint,
|
||||||
|
psbt_input: psbt::Input,
|
||||||
|
satisfaction_weight: usize,
|
||||||
|
sequence: Sequence,
|
||||||
|
) -> Result<&mut Self, AddForeignUtxoError> {
|
||||||
if psbt_input.witness_utxo.is_none() {
|
if psbt_input.witness_utxo.is_none() {
|
||||||
match psbt_input.non_witness_utxo.as_ref() {
|
match psbt_input.non_witness_utxo.as_ref() {
|
||||||
Some(tx) => {
|
Some(tx) => {
|
||||||
if tx.txid() != outpoint.txid {
|
if tx.txid() != outpoint.txid {
|
||||||
return Err(Error::Generic(
|
return Err(AddForeignUtxoError::InvalidTxid {
|
||||||
"Foreign utxo outpoint does not match PSBT input".into(),
|
input_txid: tx.txid(),
|
||||||
));
|
foreign_utxo: outpoint,
|
||||||
|
});
|
||||||
}
|
}
|
||||||
if tx.output.len() <= outpoint.vout as usize {
|
if tx.output.len() <= outpoint.vout as usize {
|
||||||
return Err(Error::InvalidOutpoint(outpoint));
|
return Err(AddForeignUtxoError::InvalidOutpoint(outpoint));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
None => {
|
None => {
|
||||||
return Err(Error::Generic(
|
return Err(AddForeignUtxoError::MissingUtxo);
|
||||||
"Foreign utxo missing witness_utxo or non_witness_utxo".into(),
|
|
||||||
))
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -375,6 +429,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
satisfaction_weight,
|
satisfaction_weight,
|
||||||
utxo: Utxo::Foreign {
|
utxo: Utxo::Foreign {
|
||||||
outpoint,
|
outpoint,
|
||||||
|
sequence: Some(sequence),
|
||||||
psbt_input: Box::new(psbt_input),
|
psbt_input: Box::new(psbt_input),
|
||||||
},
|
},
|
||||||
});
|
});
|
||||||
@@ -428,7 +483,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
/// Use a specific nLockTime while creating the transaction
|
/// Use a specific nLockTime while creating the transaction
|
||||||
///
|
///
|
||||||
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
||||||
pub fn nlocktime(&mut self, locktime: LockTime) -> &mut Self {
|
pub fn nlocktime(&mut self, locktime: absolute::LockTime) -> &mut Self {
|
||||||
self.params.locktime = Some(locktime);
|
self.params.locktime = Some(locktime);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -467,7 +522,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::util::psbt::Input::witness_utxo) field when spending from
|
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::psbt::Input::witness_utxo) field when spending from
|
||||||
/// SegWit descriptors.
|
/// SegWit descriptors.
|
||||||
///
|
///
|
||||||
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
||||||
@@ -477,8 +532,8 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::util::psbt::Output::redeem_script) and
|
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::psbt::Output::redeem_script) and
|
||||||
/// [`psbt::Output::witness_script`](bitcoin::util::psbt::Output::witness_script) fields.
|
/// [`psbt::Output::witness_script`](bitcoin::psbt::Output::witness_script) fields.
|
||||||
///
|
///
|
||||||
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
||||||
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
||||||
@@ -504,7 +559,7 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
|
|
||||||
/// Choose the coin selection algorithm
|
/// Choose the coin selection algorithm
|
||||||
///
|
///
|
||||||
/// Overrides the [`DefaultCoinSelectionAlgorithm`](super::coin_selection::DefaultCoinSelectionAlgorithm).
|
/// Overrides the [`DefaultCoinSelectionAlgorithm`].
|
||||||
///
|
///
|
||||||
/// Note that this function consumes the builder and returns it so it is usually best to put this as the first call on the builder.
|
/// Note that this function consumes the builder and returns it so it is usually best to put this as the first call on the builder.
|
||||||
pub fn coin_selection<P: CoinSelectionAlgorithm>(
|
pub fn coin_selection<P: CoinSelectionAlgorithm>(
|
||||||
@@ -519,20 +574,6 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Finish building the transaction.
|
|
||||||
///
|
|
||||||
/// Returns the [`BIP174`] "PSBT" and summary details about the transaction.
|
|
||||||
///
|
|
||||||
/// [`BIP174`]: https://github.com/bitcoin/bips/blob/master/bip-0174.mediawiki
|
|
||||||
pub fn finish(self) -> Result<(Psbt, TransactionDetails), Error>
|
|
||||||
where
|
|
||||||
D: persist::PersistBackend<KeychainKind, ConfirmationTime>,
|
|
||||||
{
|
|
||||||
self.wallet
|
|
||||||
.borrow_mut()
|
|
||||||
.create_tx(self.coin_selection, self.params)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Enable signaling RBF
|
/// Enable signaling RBF
|
||||||
///
|
///
|
||||||
/// This will use the default nSequence value of `0xFFFFFFFD`.
|
/// This will use the default nSequence value of `0xFFFFFFFD`.
|
||||||
@@ -565,7 +606,8 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
///
|
///
|
||||||
/// In both cases, if you don't provide a current height, we use the last sync height.
|
/// In both cases, if you don't provide a current height, we use the last sync height.
|
||||||
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
||||||
self.params.current_height = Some(LockTime::from_height(height).expect("Invalid height"));
|
self.params.current_height =
|
||||||
|
Some(absolute::LockTime::from_height(height).expect("Invalid height"));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -578,22 +620,122 @@ impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx: TxBuilderContext> TxBuilder<'a, D,
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl<'a, D, Cs: CoinSelectionAlgorithm, Ctx> TxBuilder<'a, D, Cs, Ctx> {
|
||||||
|
/// Finish building the transaction.
|
||||||
|
///
|
||||||
|
/// Returns a new [`Psbt`] per [`BIP174`].
|
||||||
|
///
|
||||||
|
/// [`BIP174`]: https://github.com/bitcoin/bips/blob/master/bip-0174.mediawiki
|
||||||
|
pub fn finish(self) -> Result<Psbt, CreateTxError<D::WriteError>>
|
||||||
|
where
|
||||||
|
D: PersistBackend<ChangeSet>,
|
||||||
|
{
|
||||||
|
self.wallet
|
||||||
|
.borrow_mut()
|
||||||
|
.create_tx(self.coin_selection, self.params)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::add_utxo`] and [`TxBuilder::add_utxos`]
|
||||||
|
pub enum AddUtxoError {
|
||||||
|
/// Happens when trying to spend an UTXO that is not in the internal database
|
||||||
|
UnknownUtxo(OutPoint),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for AddUtxoError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::UnknownUtxo(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"UTXO not found in the internal database for txid: {} with vout: {}",
|
||||||
|
outpoint.txid, outpoint.vout
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AddUtxoError {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::add_foreign_utxo`].
|
||||||
|
pub enum AddForeignUtxoError {
|
||||||
|
/// Foreign utxo outpoint txid does not match PSBT input txid
|
||||||
|
InvalidTxid {
|
||||||
|
/// PSBT input txid
|
||||||
|
input_txid: Txid,
|
||||||
|
/// Foreign UTXO outpoint
|
||||||
|
foreign_utxo: OutPoint,
|
||||||
|
},
|
||||||
|
/// Requested outpoint doesn't exist in the tx (vout greater than available outputs)
|
||||||
|
InvalidOutpoint(OutPoint),
|
||||||
|
/// Foreign utxo missing witness_utxo or non_witness_utxo
|
||||||
|
MissingUtxo,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for AddForeignUtxoError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::InvalidTxid {
|
||||||
|
input_txid,
|
||||||
|
foreign_utxo,
|
||||||
|
} => write!(
|
||||||
|
f,
|
||||||
|
"Foreign UTXO outpoint txid: {} does not match PSBT input txid: {}",
|
||||||
|
foreign_utxo.txid, input_txid,
|
||||||
|
),
|
||||||
|
Self::InvalidOutpoint(outpoint) => write!(
|
||||||
|
f,
|
||||||
|
"Requested outpoint doesn't exist for txid: {} with vout: {}",
|
||||||
|
outpoint.txid, outpoint.vout,
|
||||||
|
),
|
||||||
|
Self::MissingUtxo => write!(f, "Foreign utxo missing witness_utxo or non_witness_utxo"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AddForeignUtxoError {}
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Error returned from [`TxBuilder::allow_shrinking`]
|
||||||
|
pub enum AllowShrinkingError {
|
||||||
|
/// Script/PubKey was not in the original transaction
|
||||||
|
MissingScriptPubKey(ScriptBuf),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl fmt::Display for AllowShrinkingError {
|
||||||
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::MissingScriptPubKey(script_buf) => write!(
|
||||||
|
f,
|
||||||
|
"Script/PubKey was not in the original transaction: {}",
|
||||||
|
script_buf,
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AllowShrinkingError {}
|
||||||
|
|
||||||
impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
||||||
/// Replace the recipients already added with a new list
|
/// Replace the recipients already added with a new list
|
||||||
pub fn set_recipients(&mut self, recipients: Vec<(Script, u64)>) -> &mut Self {
|
pub fn set_recipients(&mut self, recipients: Vec<(ScriptBuf, u64)>) -> &mut Self {
|
||||||
self.params.recipients = recipients;
|
self.params.recipients = recipients;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add a recipient to the internal list
|
/// Add a recipient to the internal list
|
||||||
pub fn add_recipient(&mut self, script_pubkey: Script, amount: u64) -> &mut Self {
|
pub fn add_recipient(&mut self, script_pubkey: ScriptBuf, amount: u64) -> &mut Self {
|
||||||
self.params.recipients.push((script_pubkey, amount));
|
self.params.recipients.push((script_pubkey, amount));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add data as an output, using OP_RETURN
|
/// Add data as an output, using OP_RETURN
|
||||||
pub fn add_data(&mut self, data: &[u8]) -> &mut Self {
|
pub fn add_data<T: AsRef<PushBytes>>(&mut self, data: &T) -> &mut Self {
|
||||||
let script = Script::new_op_return(data);
|
let script = ScriptBuf::new_op_return(data);
|
||||||
self.add_recipient(script, 0u64);
|
self.add_recipient(script, 0u64);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -622,8 +764,15 @@ impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
|||||||
/// # use std::str::FromStr;
|
/// # use std::str::FromStr;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
|
/// # use bdk::wallet::ChangeSet;
|
||||||
|
/// # use bdk::wallet::error::CreateTxError;
|
||||||
/// # use bdk::wallet::tx_builder::CreateTx;
|
/// # use bdk::wallet::tx_builder::CreateTx;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # use bdk_chain::PersistBackend;
|
||||||
|
/// # use anyhow::Error;
|
||||||
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
/// # let mut wallet = doctest_wallet!();
|
/// # let mut wallet = doctest_wallet!();
|
||||||
/// let mut tx_builder = wallet.build_tx();
|
/// let mut tx_builder = wallet.build_tx();
|
||||||
///
|
///
|
||||||
@@ -632,17 +781,17 @@ impl<'a, D, Cs: CoinSelectionAlgorithm> TxBuilder<'a, D, Cs, CreateTx> {
|
|||||||
/// .drain_wallet()
|
/// .drain_wallet()
|
||||||
/// // Send the excess (which is all the coins minus the fee) to this address.
|
/// // Send the excess (which is all the coins minus the fee) to this address.
|
||||||
/// .drain_to(to_address.script_pubkey())
|
/// .drain_to(to_address.script_pubkey())
|
||||||
/// .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
/// .enable_rbf();
|
/// .enable_rbf();
|
||||||
/// let (psbt, tx_details) = tx_builder.finish()?;
|
/// let psbt = tx_builder.finish()?;
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), anyhow::Error>(())
|
||||||
/// ```
|
/// ```
|
||||||
///
|
///
|
||||||
/// [`allow_shrinking`]: Self::allow_shrinking
|
/// [`allow_shrinking`]: Self::allow_shrinking
|
||||||
/// [`add_recipient`]: Self::add_recipient
|
/// [`add_recipient`]: Self::add_recipient
|
||||||
/// [`add_utxos`]: Self::add_utxos
|
/// [`add_utxos`]: Self::add_utxos
|
||||||
/// [`drain_wallet`]: Self::drain_wallet
|
/// [`drain_wallet`]: Self::drain_wallet
|
||||||
pub fn drain_to(&mut self, script_pubkey: Script) -> &mut Self {
|
pub fn drain_to(&mut self, script_pubkey: ScriptBuf) -> &mut Self {
|
||||||
self.params.drain_to = Some(script_pubkey);
|
self.params.drain_to = Some(script_pubkey);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@@ -660,7 +809,10 @@ impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
|||||||
///
|
///
|
||||||
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
||||||
/// transaction we are bumping.
|
/// transaction we are bumping.
|
||||||
pub fn allow_shrinking(&mut self, script_pubkey: Script) -> Result<&mut Self, Error> {
|
pub fn allow_shrinking(
|
||||||
|
&mut self,
|
||||||
|
script_pubkey: ScriptBuf,
|
||||||
|
) -> Result<&mut Self, AllowShrinkingError> {
|
||||||
match self
|
match self
|
||||||
.params
|
.params
|
||||||
.recipients
|
.recipients
|
||||||
@@ -672,18 +824,16 @@ impl<'a, D> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpFee> {
|
|||||||
self.params.drain_to = Some(script_pubkey);
|
self.params.drain_to = Some(script_pubkey);
|
||||||
Ok(self)
|
Ok(self)
|
||||||
}
|
}
|
||||||
None => Err(Error::Generic(format!(
|
None => Err(AllowShrinkingError::MissingScriptPubKey(script_pubkey)),
|
||||||
"{} was not in the original transaction",
|
|
||||||
script_pubkey
|
|
||||||
))),
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Ordering of the transaction's inputs and outputs
|
/// Ordering of the transaction's inputs and outputs
|
||||||
#[derive(Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
#[derive(Default, Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
||||||
pub enum TxOrdering {
|
pub enum TxOrdering {
|
||||||
/// Randomized (default)
|
/// Randomized (default)
|
||||||
|
#[default]
|
||||||
Shuffle,
|
Shuffle,
|
||||||
/// Unchanged
|
/// Unchanged
|
||||||
Untouched,
|
Untouched,
|
||||||
@@ -691,12 +841,6 @@ pub enum TxOrdering {
|
|||||||
Bip69Lexicographic,
|
Bip69Lexicographic,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for TxOrdering {
|
|
||||||
fn default() -> Self {
|
|
||||||
TxOrdering::Shuffle
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl TxOrdering {
|
impl TxOrdering {
|
||||||
/// Sort transaction inputs and outputs by [`TxOrdering`] variant
|
/// Sort transaction inputs and outputs by [`TxOrdering`] variant
|
||||||
pub fn sort_tx(&self, tx: &mut Transaction) {
|
pub fn sort_tx(&self, tx: &mut Transaction) {
|
||||||
@@ -750,9 +894,10 @@ impl RbfValue {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Policy regarding the use of change outputs when creating a transaction
|
/// Policy regarding the use of change outputs when creating a transaction
|
||||||
#[derive(Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
#[derive(Default, Debug, Ord, PartialOrd, Eq, PartialEq, Hash, Clone, Copy)]
|
||||||
pub enum ChangeSpendPolicy {
|
pub enum ChangeSpendPolicy {
|
||||||
/// Use both change and non-change outputs (default)
|
/// Use both change and non-change outputs (default)
|
||||||
|
#[default]
|
||||||
ChangeAllowed,
|
ChangeAllowed,
|
||||||
/// Only use change outputs (see [`TxBuilder::only_spend_change`])
|
/// Only use change outputs (see [`TxBuilder::only_spend_change`])
|
||||||
OnlyChange,
|
OnlyChange,
|
||||||
@@ -760,14 +905,8 @@ pub enum ChangeSpendPolicy {
|
|||||||
ChangeForbidden,
|
ChangeForbidden,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for ChangeSpendPolicy {
|
|
||||||
fn default() -> Self {
|
|
||||||
ChangeSpendPolicy::ChangeAllowed
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ChangeSpendPolicy {
|
impl ChangeSpendPolicy {
|
||||||
pub(crate) fn is_satisfied_by(&self, utxo: &LocalUtxo) -> bool {
|
pub(crate) fn is_satisfied_by(&self, utxo: &LocalOutput) -> bool {
|
||||||
match self {
|
match self {
|
||||||
ChangeSpendPolicy::ChangeAllowed => true,
|
ChangeSpendPolicy::ChangeAllowed => true,
|
||||||
ChangeSpendPolicy::OnlyChange => utxo.keychain == KeychainKind::Internal,
|
ChangeSpendPolicy::OnlyChange => utxo.keychain == KeychainKind::Internal,
|
||||||
@@ -865,28 +1004,31 @@ mod test {
|
|||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(tx.output[0].value, 800);
|
assert_eq!(tx.output[0].value, 800);
|
||||||
assert_eq!(tx.output[1].script_pubkey, From::from(vec![0xAA]));
|
assert_eq!(tx.output[1].script_pubkey, ScriptBuf::from(vec![0xAA]));
|
||||||
assert_eq!(tx.output[2].script_pubkey, From::from(vec![0xAA, 0xEE]));
|
assert_eq!(
|
||||||
|
tx.output[2].script_pubkey,
|
||||||
|
ScriptBuf::from(vec![0xAA, 0xEE])
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_test_utxos() -> Vec<LocalUtxo> {
|
fn get_test_utxos() -> Vec<LocalOutput> {
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
|
|
||||||
vec![
|
vec![
|
||||||
LocalUtxo {
|
LocalOutput {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 0,
|
vout: 0,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
confirmation_time: ConfirmationTime::Unconfirmed,
|
confirmation_time: ConfirmationTime::Unconfirmed { last_seen: 0 },
|
||||||
derivation_index: 0,
|
derivation_index: 0,
|
||||||
},
|
},
|
||||||
LocalUtxo {
|
LocalOutput {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 1,
|
vout: 1,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
|
|||||||
@@ -10,7 +10,7 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::{LockTime, Script, Sequence};
|
use bitcoin::{absolute, Script, Sequence};
|
||||||
|
|
||||||
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
||||||
|
|
||||||
@@ -65,7 +65,7 @@ pub(crate) fn check_nsequence_rbf(rbf: Sequence, csv: Sequence) -> bool {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
||||||
fn check_after(&self, n: LockTime) -> bool {
|
fn check_after(&self, n: absolute::LockTime) -> bool {
|
||||||
if let Some(current_height) = self.current_height {
|
if let Some(current_height) = self.current_height {
|
||||||
current_height >= n.to_consensus_u32()
|
current_height >= n.to_consensus_u32()
|
||||||
} else {
|
} else {
|
||||||
@@ -119,12 +119,14 @@ mod test {
|
|||||||
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
||||||
|
|
||||||
use super::{check_nsequence_rbf, IsDust};
|
use super::{check_nsequence_rbf, IsDust};
|
||||||
use crate::bitcoin::{Address, Sequence};
|
use crate::bitcoin::{Address, Network, Sequence};
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_is_dust() {
|
fn test_is_dust() {
|
||||||
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2pkh.is_p2pkh());
|
assert!(script_p2pkh.is_p2pkh());
|
||||||
@@ -132,6 +134,8 @@ mod test {
|
|||||||
assert!(!546.is_dust(&script_p2pkh));
|
assert!(!546.is_dust(&script_p2pkh));
|
||||||
|
|
||||||
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2wpkh.is_v0_p2wpkh());
|
assert!(script_p2wpkh.is_v0_p2wpkh());
|
||||||
|
|||||||
@@ -1,25 +1,68 @@
|
|||||||
#![allow(unused)]
|
#![allow(unused)]
|
||||||
use bdk::{wallet::AddressIndex, Wallet};
|
|
||||||
|
use bdk::{wallet::AddressIndex, KeychainKind, LocalOutput, Wallet};
|
||||||
|
use bdk_chain::indexed_tx_graph::Indexer;
|
||||||
use bdk_chain::{BlockId, ConfirmationTime};
|
use bdk_chain::{BlockId, ConfirmationTime};
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
use bitcoin::{BlockHash, Network, Transaction, TxOut};
|
use bitcoin::{Address, BlockHash, Network, OutPoint, Transaction, TxIn, TxOut, Txid};
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
/// Return a fake wallet that appears to be funded for testing.
|
// Return a fake wallet that appears to be funded for testing.
|
||||||
|
//
|
||||||
|
// The funded wallet containing a tx with a 76_000 sats input and two outputs, one spending 25_000
|
||||||
|
// to a foreign address and one returning 50_000 back to the wallet as change. The remaining 1000
|
||||||
|
// sats are the transaction fee.
|
||||||
pub fn get_funded_wallet_with_change(
|
pub fn get_funded_wallet_with_change(
|
||||||
descriptor: &str,
|
descriptor: &str,
|
||||||
change: Option<&str>,
|
change: Option<&str>,
|
||||||
) -> (Wallet, bitcoin::Txid) {
|
) -> (Wallet, bitcoin::Txid) {
|
||||||
let mut wallet = Wallet::new_no_persist(descriptor, change, Network::Regtest).unwrap();
|
let mut wallet = Wallet::new_no_persist(descriptor, change, Network::Regtest).unwrap();
|
||||||
let address = wallet.get_address(AddressIndex::New).address;
|
let change_address = wallet.get_address(AddressIndex::New).address;
|
||||||
|
let sendto_address = Address::from_str("bcrt1q3qtze4ys45tgdvguj66zrk4fu6hq3a3v9pfly5")
|
||||||
|
.expect("address")
|
||||||
|
.require_network(Network::Regtest)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
let tx = Transaction {
|
let tx0 = Transaction {
|
||||||
version: 1,
|
version: 1,
|
||||||
lock_time: bitcoin::PackedLockTime(0),
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
input: vec![],
|
input: vec![TxIn {
|
||||||
output: vec![TxOut {
|
previous_output: OutPoint {
|
||||||
value: 50_000,
|
txid: Txid::all_zeros(),
|
||||||
script_pubkey: address.script_pubkey(),
|
vout: 0,
|
||||||
|
},
|
||||||
|
script_sig: Default::default(),
|
||||||
|
sequence: Default::default(),
|
||||||
|
witness: Default::default(),
|
||||||
}],
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 76_000,
|
||||||
|
script_pubkey: change_address.script_pubkey(),
|
||||||
|
}],
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx1 = Transaction {
|
||||||
|
version: 1,
|
||||||
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint {
|
||||||
|
txid: tx0.txid(),
|
||||||
|
vout: 0,
|
||||||
|
},
|
||||||
|
script_sig: Default::default(),
|
||||||
|
sequence: Default::default(),
|
||||||
|
witness: Default::default(),
|
||||||
|
}],
|
||||||
|
output: vec![
|
||||||
|
TxOut {
|
||||||
|
value: 50_000,
|
||||||
|
script_pubkey: change_address.script_pubkey(),
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
value: 25_000,
|
||||||
|
script_pubkey: sendto_address.script_pubkey(),
|
||||||
|
},
|
||||||
|
],
|
||||||
};
|
};
|
||||||
|
|
||||||
wallet
|
wallet
|
||||||
@@ -28,19 +71,39 @@ pub fn get_funded_wallet_with_change(
|
|||||||
hash: BlockHash::all_zeros(),
|
hash: BlockHash::all_zeros(),
|
||||||
})
|
})
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
wallet
|
||||||
|
.insert_checkpoint(BlockId {
|
||||||
|
height: 2_000,
|
||||||
|
hash: BlockHash::all_zeros(),
|
||||||
|
})
|
||||||
|
.unwrap();
|
||||||
wallet
|
wallet
|
||||||
.insert_tx(
|
.insert_tx(
|
||||||
tx.clone(),
|
tx0,
|
||||||
ConfirmationTime::Confirmed {
|
ConfirmationTime::Confirmed {
|
||||||
height: 1_000,
|
height: 1_000,
|
||||||
time: 100,
|
time: 100,
|
||||||
},
|
},
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
wallet
|
||||||
|
.insert_tx(
|
||||||
|
tx1.clone(),
|
||||||
|
ConfirmationTime::Confirmed {
|
||||||
|
height: 2_000,
|
||||||
|
time: 200,
|
||||||
|
},
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
(wallet, tx.txid())
|
(wallet, tx1.txid())
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// Return a fake wallet that appears to be funded for testing.
|
||||||
|
//
|
||||||
|
// The funded wallet containing a tx with a 76_000 sats input and two outputs, one spending 25_000
|
||||||
|
// to a foreign address and one returning 50_000 back to the wallet as change. The remaining 1000
|
||||||
|
// sats are the transaction fee.
|
||||||
pub fn get_funded_wallet(descriptor: &str) -> (Wallet, bitcoin::Txid) {
|
pub fn get_funded_wallet(descriptor: &str) -> (Wallet, bitcoin::Txid) {
|
||||||
get_funded_wallet_with_change(descriptor, None)
|
get_funded_wallet_with_change(descriptor, None)
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -2,7 +2,7 @@ use bdk::bitcoin::TxIn;
|
|||||||
use bdk::wallet::AddressIndex;
|
use bdk::wallet::AddressIndex;
|
||||||
use bdk::wallet::AddressIndex::New;
|
use bdk::wallet::AddressIndex::New;
|
||||||
use bdk::{psbt, FeeRate, SignOptions};
|
use bdk::{psbt, FeeRate, SignOptions};
|
||||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
mod common;
|
mod common;
|
||||||
use common::*;
|
use common::*;
|
||||||
@@ -18,7 +18,7 @@ fn test_psbt_malformed_psbt_input_legacy() {
|
|||||||
let send_to = wallet.get_address(AddressIndex::New);
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let mut psbt = builder.finish().unwrap();
|
||||||
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||||
let options = SignOptions {
|
let options = SignOptions {
|
||||||
trust_witness_utxo: true,
|
trust_witness_utxo: true,
|
||||||
@@ -35,7 +35,7 @@ fn test_psbt_malformed_psbt_input_segwit() {
|
|||||||
let send_to = wallet.get_address(AddressIndex::New);
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let mut psbt = builder.finish().unwrap();
|
||||||
psbt.inputs.push(psbt_bip.inputs[1].clone());
|
psbt.inputs.push(psbt_bip.inputs[1].clone());
|
||||||
let options = SignOptions {
|
let options = SignOptions {
|
||||||
trust_witness_utxo: true,
|
trust_witness_utxo: true,
|
||||||
@@ -51,7 +51,7 @@ fn test_psbt_malformed_tx_input() {
|
|||||||
let send_to = wallet.get_address(AddressIndex::New);
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let mut psbt = builder.finish().unwrap();
|
||||||
psbt.unsigned_tx.input.push(TxIn::default());
|
psbt.unsigned_tx.input.push(TxIn::default());
|
||||||
let options = SignOptions {
|
let options = SignOptions {
|
||||||
trust_witness_utxo: true,
|
trust_witness_utxo: true,
|
||||||
@@ -67,7 +67,7 @@ fn test_psbt_sign_with_finalized() {
|
|||||||
let send_to = wallet.get_address(AddressIndex::New);
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
|
||||||
// add a finalized input
|
// add a finalized input
|
||||||
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
psbt.inputs.push(psbt_bip.inputs[0].clone());
|
||||||
@@ -89,7 +89,7 @@ fn test_psbt_fee_rate_with_witness_utxo() {
|
|||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let mut psbt = builder.finish().unwrap();
|
||||||
let fee_amount = psbt.fee_amount();
|
let fee_amount = psbt.fee_amount();
|
||||||
assert!(fee_amount.is_some());
|
assert!(fee_amount.is_some());
|
||||||
|
|
||||||
@@ -114,7 +114,7 @@ fn test_psbt_fee_rate_with_nonwitness_utxo() {
|
|||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let mut psbt = builder.finish().unwrap();
|
||||||
let fee_amount = psbt.fee_amount();
|
let fee_amount = psbt.fee_amount();
|
||||||
assert!(fee_amount.is_some());
|
assert!(fee_amount.is_some());
|
||||||
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
let unfinalized_fee_rate = psbt.fee_rate().unwrap();
|
||||||
@@ -138,7 +138,7 @@ fn test_psbt_fee_rate_with_missing_txout() {
|
|||||||
let mut builder = wpkh_wallet.build_tx();
|
let mut builder = wpkh_wallet.build_tx();
|
||||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
let (mut wpkh_psbt, _) = builder.finish().unwrap();
|
let mut wpkh_psbt = builder.finish().unwrap();
|
||||||
|
|
||||||
wpkh_psbt.inputs[0].witness_utxo = None;
|
wpkh_psbt.inputs[0].witness_utxo = None;
|
||||||
wpkh_psbt.inputs[0].non_witness_utxo = None;
|
wpkh_psbt.inputs[0].non_witness_utxo = None;
|
||||||
@@ -150,9 +150,43 @@ fn test_psbt_fee_rate_with_missing_txout() {
|
|||||||
let mut builder = pkh_wallet.build_tx();
|
let mut builder = pkh_wallet.build_tx();
|
||||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
builder.fee_rate(FeeRate::from_sat_per_vb(expected_fee_rate));
|
||||||
let (mut pkh_psbt, _) = builder.finish().unwrap();
|
let mut pkh_psbt = builder.finish().unwrap();
|
||||||
|
|
||||||
pkh_psbt.inputs[0].non_witness_utxo = None;
|
pkh_psbt.inputs[0].non_witness_utxo = None;
|
||||||
assert!(pkh_psbt.fee_amount().is_none());
|
assert!(pkh_psbt.fee_amount().is_none());
|
||||||
assert!(pkh_psbt.fee_rate().is_none());
|
assert!(pkh_psbt.fee_rate().is_none());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_psbt_multiple_internalkey_signers() {
|
||||||
|
use bdk::signer::{SignerContext, SignerOrdering, SignerWrapper};
|
||||||
|
use bdk::KeychainKind;
|
||||||
|
use bitcoin::{secp256k1::Secp256k1, PrivateKey};
|
||||||
|
use miniscript::psbt::PsbtExt;
|
||||||
|
use std::sync::Arc;
|
||||||
|
|
||||||
|
let secp = Secp256k1::new();
|
||||||
|
let (mut wallet, _) = get_funded_wallet(get_test_tr_single_sig());
|
||||||
|
let send_to = wallet.get_address(AddressIndex::New);
|
||||||
|
let mut builder = wallet.build_tx();
|
||||||
|
builder.add_recipient(send_to.script_pubkey(), 10_000);
|
||||||
|
let mut psbt = builder.finish().unwrap();
|
||||||
|
// Adds a signer for the wrong internal key, bdk should not use this key to sign
|
||||||
|
wallet.add_signer(
|
||||||
|
KeychainKind::External,
|
||||||
|
// A signerordering lower than 100, bdk will use this signer first
|
||||||
|
SignerOrdering(0),
|
||||||
|
Arc::new(SignerWrapper::new(
|
||||||
|
PrivateKey::from_wif("5J5PZqvCe1uThJ3FZeUUFLCh2FuK9pZhtEK4MzhNmugqTmxCdwE").unwrap(),
|
||||||
|
SignerContext::Tap {
|
||||||
|
is_internal_key: true,
|
||||||
|
},
|
||||||
|
)),
|
||||||
|
);
|
||||||
|
let _ = wallet.sign(&mut psbt, SignOptions::default()).unwrap();
|
||||||
|
// Checks that we signed using the right key
|
||||||
|
assert!(
|
||||||
|
psbt.finalize_mut(&secp).is_ok(),
|
||||||
|
"The wrong internal key was used"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
28
crates/bitcoind_rpc/Cargo.toml
Normal file
28
crates/bitcoind_rpc/Cargo.toml
Normal file
@@ -0,0 +1,28 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_bitcoind_rpc"
|
||||||
|
version = "0.6.0"
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.63"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
documentation = "https://docs.rs/bdk_bitcoind_rpc"
|
||||||
|
description = "This crate is used for emitting blockchain data from the `bitcoind` RPC interface."
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
# For no-std, remember to enable the bitcoin/no-std feature
|
||||||
|
bitcoin = { version = "0.30", default-features = false }
|
||||||
|
bitcoincore-rpc = { version = "0.17" }
|
||||||
|
bdk_chain = { path = "../chain", version = "0.11", default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
bitcoind = { version = "0.33", features = ["25_0"] }
|
||||||
|
anyhow = { version = "1" }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
default = ["std"]
|
||||||
|
std = ["bitcoin/std", "bdk_chain/std"]
|
||||||
|
serde = ["bitcoin/serde", "bdk_chain/serde"]
|
||||||
3
crates/bitcoind_rpc/README.md
Normal file
3
crates/bitcoind_rpc/README.md
Normal file
@@ -0,0 +1,3 @@
|
|||||||
|
# BDK Bitcoind RPC
|
||||||
|
|
||||||
|
This crate is used for emitting blockchain data from the `bitcoind` RPC interface.
|
||||||
328
crates/bitcoind_rpc/src/lib.rs
Normal file
328
crates/bitcoind_rpc/src/lib.rs
Normal file
@@ -0,0 +1,328 @@
|
|||||||
|
//! This crate is used for emitting blockchain data from the `bitcoind` RPC interface. It does not
|
||||||
|
//! use the wallet RPC API, so this crate can be used with wallet-disabled Bitcoin Core nodes.
|
||||||
|
//!
|
||||||
|
//! [`Emitter`] is the main structure which sources blockchain data from [`bitcoincore_rpc::Client`].
|
||||||
|
//!
|
||||||
|
//! To only get block updates (exclude mempool transactions), the caller can use
|
||||||
|
//! [`Emitter::next_block`] or/and [`Emitter::next_header`] until it returns `Ok(None)` (which means
|
||||||
|
//! the chain tip is reached). A separate method, [`Emitter::mempool`] can be used to emit the whole
|
||||||
|
//! mempool.
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
|
use bdk_chain::{local_chain::CheckPoint, BlockId};
|
||||||
|
use bitcoin::{block::Header, Block, BlockHash, Transaction};
|
||||||
|
pub use bitcoincore_rpc;
|
||||||
|
use bitcoincore_rpc::bitcoincore_rpc_json;
|
||||||
|
|
||||||
|
/// The [`Emitter`] is used to emit data sourced from [`bitcoincore_rpc::Client`].
|
||||||
|
///
|
||||||
|
/// Refer to [module-level documentation] for more.
|
||||||
|
///
|
||||||
|
/// [module-level documentation]: crate
|
||||||
|
pub struct Emitter<'c, C> {
|
||||||
|
client: &'c C,
|
||||||
|
start_height: u32,
|
||||||
|
|
||||||
|
/// The checkpoint of the last-emitted block that is in the best chain. If it is later found
|
||||||
|
/// that the block is no longer in the best chain, it will be popped off from here.
|
||||||
|
last_cp: CheckPoint,
|
||||||
|
|
||||||
|
/// The block result returned from rpc of the last-emitted block. As this result contains the
|
||||||
|
/// next block's block hash (which we use to fetch the next block), we set this to `None`
|
||||||
|
/// whenever there are no more blocks, or the next block is no longer in the best chain. This
|
||||||
|
/// gives us an opportunity to re-fetch this result.
|
||||||
|
last_block: Option<bitcoincore_rpc_json::GetBlockResult>,
|
||||||
|
|
||||||
|
/// The latest first-seen epoch of emitted mempool transactions. This is used to determine
|
||||||
|
/// whether a mempool transaction is already emitted.
|
||||||
|
last_mempool_time: usize,
|
||||||
|
|
||||||
|
/// The last emitted block during our last mempool emission. This is used to determine whether
|
||||||
|
/// there has been a reorg since our last mempool emission.
|
||||||
|
last_mempool_tip: Option<u32>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'c, C: bitcoincore_rpc::RpcApi> Emitter<'c, C> {
|
||||||
|
/// Construct a new [`Emitter`].
|
||||||
|
///
|
||||||
|
/// `last_cp` informs the emitter of the chain we are starting off with. This way, the emitter
|
||||||
|
/// can start emission from a block that connects to the original chain.
|
||||||
|
///
|
||||||
|
/// `start_height` starts emission from a given height (if there are no conflicts with the
|
||||||
|
/// original chain).
|
||||||
|
pub fn new(client: &'c C, last_cp: CheckPoint, start_height: u32) -> Self {
|
||||||
|
Self {
|
||||||
|
client,
|
||||||
|
start_height,
|
||||||
|
last_cp,
|
||||||
|
last_block: None,
|
||||||
|
last_mempool_time: 0,
|
||||||
|
last_mempool_tip: None,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Emit mempool transactions, alongside their first-seen unix timestamps.
|
||||||
|
///
|
||||||
|
/// This method emits each transaction only once, unless we cannot guarantee the transaction's
|
||||||
|
/// ancestors are already emitted.
|
||||||
|
///
|
||||||
|
/// To understand why, consider a receiver which filters transactions based on whether it
|
||||||
|
/// alters the UTXO set of tracked script pubkeys. If an emitted mempool transaction spends a
|
||||||
|
/// tracked UTXO which is confirmed at height `h`, but the receiver has only seen up to block
|
||||||
|
/// of height `h-1`, we want to re-emit this transaction until the receiver has seen the block
|
||||||
|
/// at height `h`.
|
||||||
|
pub fn mempool(&mut self) -> Result<Vec<(Transaction, u64)>, bitcoincore_rpc::Error> {
|
||||||
|
let client = self.client;
|
||||||
|
|
||||||
|
// This is the emitted tip height during the last mempool emission.
|
||||||
|
let prev_mempool_tip = self
|
||||||
|
.last_mempool_tip
|
||||||
|
// We use `start_height - 1` as we cannot guarantee that the block at
|
||||||
|
// `start_height` has been emitted.
|
||||||
|
.unwrap_or(self.start_height.saturating_sub(1));
|
||||||
|
|
||||||
|
// Mempool txs come with a timestamp of when the tx is introduced to the mempool. We keep
|
||||||
|
// track of the latest mempool tx's timestamp to determine whether we have seen a tx
|
||||||
|
// before. `prev_mempool_time` is the previous timestamp and `last_time` records what will
|
||||||
|
// be the new latest timestamp.
|
||||||
|
let prev_mempool_time = self.last_mempool_time;
|
||||||
|
let mut latest_time = prev_mempool_time;
|
||||||
|
|
||||||
|
let txs_to_emit = client
|
||||||
|
.get_raw_mempool_verbose()?
|
||||||
|
.into_iter()
|
||||||
|
.filter_map({
|
||||||
|
let latest_time = &mut latest_time;
|
||||||
|
move |(txid, tx_entry)| -> Option<Result<_, bitcoincore_rpc::Error>> {
|
||||||
|
let tx_time = tx_entry.time as usize;
|
||||||
|
if tx_time > *latest_time {
|
||||||
|
*latest_time = tx_time;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Avoid emitting transactions that are already emitted if we can guarantee
|
||||||
|
// blocks containing ancestors are already emitted. The bitcoind rpc interface
|
||||||
|
// provides us with the block height that the tx is introduced to the mempool.
|
||||||
|
// If we have already emitted the block of height, we can assume that all
|
||||||
|
// ancestor txs have been processed by the receiver.
|
||||||
|
let is_already_emitted = tx_time <= prev_mempool_time;
|
||||||
|
let is_within_height = tx_entry.height <= prev_mempool_tip as _;
|
||||||
|
if is_already_emitted && is_within_height {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
let tx = match client.get_raw_transaction(&txid, None) {
|
||||||
|
Ok(tx) => tx,
|
||||||
|
// the tx is confirmed or evicted since `get_raw_mempool_verbose`
|
||||||
|
Err(err) if err.is_not_found_error() => return None,
|
||||||
|
Err(err) => return Some(Err(err)),
|
||||||
|
};
|
||||||
|
|
||||||
|
Some(Ok((tx, tx_time as u64)))
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
|
||||||
|
self.last_mempool_time = latest_time;
|
||||||
|
self.last_mempool_tip = Some(self.last_cp.height());
|
||||||
|
|
||||||
|
Ok(txs_to_emit)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Emit the next block height and header (if any).
|
||||||
|
pub fn next_header(&mut self) -> Result<Option<BlockEvent<Header>>, bitcoincore_rpc::Error> {
|
||||||
|
Ok(poll(self, |hash| self.client.get_block_header(hash))?
|
||||||
|
.map(|(checkpoint, block)| BlockEvent { block, checkpoint }))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Emit the next block height and block (if any).
|
||||||
|
pub fn next_block(&mut self) -> Result<Option<BlockEvent<Block>>, bitcoincore_rpc::Error> {
|
||||||
|
Ok(poll(self, |hash| self.client.get_block(hash))?
|
||||||
|
.map(|(checkpoint, block)| BlockEvent { block, checkpoint }))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A newly emitted block from [`Emitter`].
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct BlockEvent<B> {
|
||||||
|
/// Either a full [`Block`] or [`Header`] of the new block.
|
||||||
|
pub block: B,
|
||||||
|
|
||||||
|
/// The checkpoint of the new block.
|
||||||
|
///
|
||||||
|
/// A [`CheckPoint`] is a node of a linked list of [`BlockId`]s. This checkpoint is linked to
|
||||||
|
/// all [`BlockId`]s originally passed in [`Emitter::new`] as well as emitted blocks since then.
|
||||||
|
/// These blocks are guaranteed to be of the same chain.
|
||||||
|
///
|
||||||
|
/// This is important as BDK structures require block-to-apply to be connected with another
|
||||||
|
/// block in the original chain.
|
||||||
|
pub checkpoint: CheckPoint,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<B> BlockEvent<B> {
|
||||||
|
/// The block height of this new block.
|
||||||
|
pub fn block_height(&self) -> u32 {
|
||||||
|
self.checkpoint.height()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The block hash of this new block.
|
||||||
|
pub fn block_hash(&self) -> BlockHash {
|
||||||
|
self.checkpoint.hash()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The [`BlockId`] of a previous block that this block connects to.
|
||||||
|
///
|
||||||
|
/// This either returns a [`BlockId`] of a previously emitted block or from the chain we started
|
||||||
|
/// with (passed in as `last_cp` in [`Emitter::new`]).
|
||||||
|
///
|
||||||
|
/// This value is derived from [`BlockEvent::checkpoint`].
|
||||||
|
pub fn connected_to(&self) -> BlockId {
|
||||||
|
match self.checkpoint.prev() {
|
||||||
|
Some(prev_cp) => prev_cp.block_id(),
|
||||||
|
// there is no previous checkpoint, so just connect with itself
|
||||||
|
None => self.checkpoint.block_id(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
enum PollResponse {
|
||||||
|
Block(bitcoincore_rpc_json::GetBlockResult),
|
||||||
|
NoMoreBlocks,
|
||||||
|
/// Fetched block is not in the best chain.
|
||||||
|
BlockNotInBestChain,
|
||||||
|
AgreementFound(bitcoincore_rpc_json::GetBlockResult, CheckPoint),
|
||||||
|
/// Force the genesis checkpoint down the receiver's throat.
|
||||||
|
AgreementPointNotFound(BlockHash),
|
||||||
|
}
|
||||||
|
|
||||||
|
fn poll_once<C>(emitter: &Emitter<C>) -> Result<PollResponse, bitcoincore_rpc::Error>
|
||||||
|
where
|
||||||
|
C: bitcoincore_rpc::RpcApi,
|
||||||
|
{
|
||||||
|
let client = emitter.client;
|
||||||
|
|
||||||
|
if let Some(last_res) = &emitter.last_block {
|
||||||
|
let next_hash = if last_res.height < emitter.start_height as _ {
|
||||||
|
// enforce start height
|
||||||
|
let next_hash = client.get_block_hash(emitter.start_height as _)?;
|
||||||
|
// make sure last emission is still in best chain
|
||||||
|
if client.get_block_hash(last_res.height as _)? != last_res.hash {
|
||||||
|
return Ok(PollResponse::BlockNotInBestChain);
|
||||||
|
}
|
||||||
|
next_hash
|
||||||
|
} else {
|
||||||
|
match last_res.nextblockhash {
|
||||||
|
None => return Ok(PollResponse::NoMoreBlocks),
|
||||||
|
Some(next_hash) => next_hash,
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let res = client.get_block_info(&next_hash)?;
|
||||||
|
if res.confirmations < 0 {
|
||||||
|
return Ok(PollResponse::BlockNotInBestChain);
|
||||||
|
}
|
||||||
|
|
||||||
|
return Ok(PollResponse::Block(res));
|
||||||
|
}
|
||||||
|
|
||||||
|
for cp in emitter.last_cp.iter() {
|
||||||
|
let res = match client.get_block_info(&cp.hash()) {
|
||||||
|
// block not in best chain
|
||||||
|
Ok(res) if res.confirmations < 0 => continue,
|
||||||
|
Ok(res) => res,
|
||||||
|
Err(e) if e.is_not_found_error() => {
|
||||||
|
if cp.height() > 0 {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// if we can't find genesis block, we can't create an update that connects
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
Err(e) => return Err(e),
|
||||||
|
};
|
||||||
|
|
||||||
|
// agreement point found
|
||||||
|
return Ok(PollResponse::AgreementFound(res, cp));
|
||||||
|
}
|
||||||
|
|
||||||
|
let genesis_hash = client.get_block_hash(0)?;
|
||||||
|
Ok(PollResponse::AgreementPointNotFound(genesis_hash))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn poll<C, V, F>(
|
||||||
|
emitter: &mut Emitter<C>,
|
||||||
|
get_item: F,
|
||||||
|
) -> Result<Option<(CheckPoint, V)>, bitcoincore_rpc::Error>
|
||||||
|
where
|
||||||
|
C: bitcoincore_rpc::RpcApi,
|
||||||
|
F: Fn(&BlockHash) -> Result<V, bitcoincore_rpc::Error>,
|
||||||
|
{
|
||||||
|
loop {
|
||||||
|
match poll_once(emitter)? {
|
||||||
|
PollResponse::Block(res) => {
|
||||||
|
let height = res.height as u32;
|
||||||
|
let hash = res.hash;
|
||||||
|
let item = get_item(&hash)?;
|
||||||
|
|
||||||
|
let new_cp = emitter
|
||||||
|
.last_cp
|
||||||
|
.clone()
|
||||||
|
.push(BlockId { height, hash })
|
||||||
|
.expect("must push");
|
||||||
|
emitter.last_cp = new_cp.clone();
|
||||||
|
emitter.last_block = Some(res);
|
||||||
|
return Ok(Some((new_cp, item)));
|
||||||
|
}
|
||||||
|
PollResponse::NoMoreBlocks => {
|
||||||
|
emitter.last_block = None;
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
PollResponse::BlockNotInBestChain => {
|
||||||
|
emitter.last_block = None;
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
PollResponse::AgreementFound(res, cp) => {
|
||||||
|
let agreement_h = res.height as u32;
|
||||||
|
|
||||||
|
// The tip during the last mempool emission needs to in the best chain, we reduce
|
||||||
|
// it if it is not.
|
||||||
|
if let Some(h) = emitter.last_mempool_tip.as_mut() {
|
||||||
|
if *h > agreement_h {
|
||||||
|
*h = agreement_h;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// get rid of evicted blocks
|
||||||
|
emitter.last_cp = cp;
|
||||||
|
emitter.last_block = Some(res);
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
PollResponse::AgreementPointNotFound(genesis_hash) => {
|
||||||
|
emitter.last_cp = CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: genesis_hash,
|
||||||
|
});
|
||||||
|
emitter.last_block = None;
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Extends [`bitcoincore_rpc::Error`].
|
||||||
|
pub trait BitcoindRpcErrorExt {
|
||||||
|
/// Returns whether the error is a "not found" error.
|
||||||
|
///
|
||||||
|
/// This is useful since [`Emitter`] emits [`Result<_, bitcoincore_rpc::Error>`]s as
|
||||||
|
/// [`Iterator::Item`].
|
||||||
|
fn is_not_found_error(&self) -> bool;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl BitcoindRpcErrorExt for bitcoincore_rpc::Error {
|
||||||
|
fn is_not_found_error(&self) -> bool {
|
||||||
|
if let bitcoincore_rpc::Error::JsonRpc(bitcoincore_rpc::jsonrpc::Error::Rpc(rpc_err)) = self
|
||||||
|
{
|
||||||
|
rpc_err.code == -5
|
||||||
|
} else {
|
||||||
|
false
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
864
crates/bitcoind_rpc/tests/test_emitter.rs
Normal file
864
crates/bitcoind_rpc/tests/test_emitter.rs
Normal file
@@ -0,0 +1,864 @@
|
|||||||
|
use std::collections::{BTreeMap, BTreeSet};
|
||||||
|
|
||||||
|
use bdk_bitcoind_rpc::Emitter;
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{Address, Amount, BlockHash, Txid},
|
||||||
|
keychain::Balance,
|
||||||
|
local_chain::{self, CheckPoint, LocalChain},
|
||||||
|
Append, BlockId, IndexedTxGraph, SpkTxOutIndex,
|
||||||
|
};
|
||||||
|
use bitcoin::{
|
||||||
|
address::NetworkChecked, block::Header, hash_types::TxMerkleNode, hashes::Hash,
|
||||||
|
secp256k1::rand::random, Block, CompactTarget, OutPoint, ScriptBuf, ScriptHash, Transaction,
|
||||||
|
TxIn, TxOut, WScriptHash,
|
||||||
|
};
|
||||||
|
use bitcoincore_rpc::{
|
||||||
|
bitcoincore_rpc_json::{GetBlockTemplateModes, GetBlockTemplateRules},
|
||||||
|
RpcApi,
|
||||||
|
};
|
||||||
|
|
||||||
|
struct TestEnv {
|
||||||
|
#[allow(dead_code)]
|
||||||
|
daemon: bitcoind::BitcoinD,
|
||||||
|
client: bitcoincore_rpc::Client,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestEnv {
|
||||||
|
fn new() -> anyhow::Result<Self> {
|
||||||
|
let daemon = match std::env::var_os("TEST_BITCOIND") {
|
||||||
|
Some(bitcoind_path) => bitcoind::BitcoinD::new(bitcoind_path),
|
||||||
|
None => bitcoind::BitcoinD::from_downloaded(),
|
||||||
|
}?;
|
||||||
|
let client = bitcoincore_rpc::Client::new(
|
||||||
|
&daemon.rpc_url(),
|
||||||
|
bitcoincore_rpc::Auth::CookieFile(daemon.params.cookie_file.clone()),
|
||||||
|
)?;
|
||||||
|
Ok(Self { daemon, client })
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_blocks(
|
||||||
|
&self,
|
||||||
|
count: usize,
|
||||||
|
address: Option<Address>,
|
||||||
|
) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let coinbase_address = match address {
|
||||||
|
Some(address) => address,
|
||||||
|
None => self.client.get_new_address(None, None)?.assume_checked(),
|
||||||
|
};
|
||||||
|
let block_hashes = self
|
||||||
|
.client
|
||||||
|
.generate_to_address(count as _, &coinbase_address)?;
|
||||||
|
Ok(block_hashes)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_empty_block(&self) -> anyhow::Result<(usize, BlockHash)> {
|
||||||
|
let bt = self.client.get_block_template(
|
||||||
|
GetBlockTemplateModes::Template,
|
||||||
|
&[GetBlockTemplateRules::SegWit],
|
||||||
|
&[],
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let txdata = vec![Transaction {
|
||||||
|
version: 1,
|
||||||
|
lock_time: bitcoin::absolute::LockTime::from_height(0)?,
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: bitcoin::OutPoint::default(),
|
||||||
|
script_sig: ScriptBuf::builder()
|
||||||
|
.push_int(bt.height as _)
|
||||||
|
// randomn number so that re-mining creates unique block
|
||||||
|
.push_int(random())
|
||||||
|
.into_script(),
|
||||||
|
sequence: bitcoin::Sequence::default(),
|
||||||
|
witness: bitcoin::Witness::new(),
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 0,
|
||||||
|
script_pubkey: ScriptBuf::new_p2sh(&ScriptHash::all_zeros()),
|
||||||
|
}],
|
||||||
|
}];
|
||||||
|
|
||||||
|
let bits: [u8; 4] = bt
|
||||||
|
.bits
|
||||||
|
.clone()
|
||||||
|
.try_into()
|
||||||
|
.expect("rpc provided us with invalid bits");
|
||||||
|
|
||||||
|
let mut block = Block {
|
||||||
|
header: Header {
|
||||||
|
version: bitcoin::block::Version::default(),
|
||||||
|
prev_blockhash: bt.previous_block_hash,
|
||||||
|
merkle_root: TxMerkleNode::all_zeros(),
|
||||||
|
time: Ord::max(bt.min_time, std::time::UNIX_EPOCH.elapsed()?.as_secs()) as u32,
|
||||||
|
bits: CompactTarget::from_consensus(u32::from_be_bytes(bits)),
|
||||||
|
nonce: 0,
|
||||||
|
},
|
||||||
|
txdata,
|
||||||
|
};
|
||||||
|
|
||||||
|
block.header.merkle_root = block.compute_merkle_root().expect("must compute");
|
||||||
|
|
||||||
|
for nonce in 0..=u32::MAX {
|
||||||
|
block.header.nonce = nonce;
|
||||||
|
if block.header.target().is_met_by(block.block_hash()) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
self.client.submit_block(&block)?;
|
||||||
|
Ok((bt.height as usize, block.block_hash()))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn invalidate_blocks(&self, count: usize) -> anyhow::Result<()> {
|
||||||
|
let mut hash = self.client.get_best_block_hash()?;
|
||||||
|
for _ in 0..count {
|
||||||
|
let prev_hash = self.client.get_block_info(&hash)?.previousblockhash;
|
||||||
|
self.client.invalidate_block(&hash)?;
|
||||||
|
match prev_hash {
|
||||||
|
Some(prev_hash) => hash = prev_hash,
|
||||||
|
None => break,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn reorg(&self, count: usize) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let start_height = self.client.get_block_count()?;
|
||||||
|
self.invalidate_blocks(count)?;
|
||||||
|
|
||||||
|
let res = self.mine_blocks(count, None);
|
||||||
|
assert_eq!(
|
||||||
|
self.client.get_block_count()?,
|
||||||
|
start_height,
|
||||||
|
"reorg should not result in height change"
|
||||||
|
);
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
fn reorg_empty_blocks(&self, count: usize) -> anyhow::Result<Vec<(usize, BlockHash)>> {
|
||||||
|
let start_height = self.client.get_block_count()?;
|
||||||
|
self.invalidate_blocks(count)?;
|
||||||
|
|
||||||
|
let res = (0..count)
|
||||||
|
.map(|_| self.mine_empty_block())
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
assert_eq!(
|
||||||
|
self.client.get_block_count()?,
|
||||||
|
start_height,
|
||||||
|
"reorg should not result in height change"
|
||||||
|
);
|
||||||
|
Ok(res)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn send(&self, address: &Address<NetworkChecked>, amount: Amount) -> anyhow::Result<Txid> {
|
||||||
|
let txid = self
|
||||||
|
.client
|
||||||
|
.send_to_address(address, amount, None, None, None, None, None, None)?;
|
||||||
|
Ok(txid)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure that blocks are emitted in order even after reorg.
|
||||||
|
///
|
||||||
|
/// 1. Mine 101 blocks.
|
||||||
|
/// 2. Emit blocks from [`Emitter`] and update the [`LocalChain`].
|
||||||
|
/// 3. Reorg highest 6 blocks.
|
||||||
|
/// 4. Emit blocks from [`Emitter`] and re-update the [`LocalChain`].
|
||||||
|
#[test]
|
||||||
|
pub fn test_sync_local_chain() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let (mut local_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||||
|
let mut emitter = Emitter::new(&env.client, local_chain.tip(), 0);
|
||||||
|
|
||||||
|
// mine some blocks and returned the actual block hashes
|
||||||
|
let exp_hashes = {
|
||||||
|
let mut hashes = vec![env.client.get_block_hash(0)?]; // include genesis block
|
||||||
|
hashes.extend(env.mine_blocks(101, None)?);
|
||||||
|
hashes
|
||||||
|
};
|
||||||
|
|
||||||
|
// see if the emitter outputs the right blocks
|
||||||
|
println!("first sync:");
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
let hash = emission.block_hash();
|
||||||
|
assert_eq!(
|
||||||
|
emission.block_hash(),
|
||||||
|
exp_hashes[height as usize],
|
||||||
|
"emitted block hash is unexpected"
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?,
|
||||||
|
BTreeMap::from([(height, Some(hash))]),
|
||||||
|
"chain update changeset is unexpected",
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.blocks(),
|
||||||
|
&exp_hashes
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, hash)| (i as u32, *hash))
|
||||||
|
.collect(),
|
||||||
|
"final local_chain state is unexpected",
|
||||||
|
);
|
||||||
|
|
||||||
|
// perform reorg
|
||||||
|
let reorged_blocks = env.reorg(6)?;
|
||||||
|
let exp_hashes = exp_hashes
|
||||||
|
.iter()
|
||||||
|
.take(exp_hashes.len() - reorged_blocks.len())
|
||||||
|
.chain(&reorged_blocks)
|
||||||
|
.cloned()
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
// see if the emitter outputs the right blocks
|
||||||
|
println!("after reorg:");
|
||||||
|
let mut exp_height = exp_hashes.len() - reorged_blocks.len();
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
let hash = emission.block_hash();
|
||||||
|
assert_eq!(
|
||||||
|
height, exp_height as u32,
|
||||||
|
"emitted block has unexpected height"
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
hash, exp_hashes[height as usize],
|
||||||
|
"emitted block is unexpected"
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?,
|
||||||
|
if exp_height == exp_hashes.len() - reorged_blocks.len() {
|
||||||
|
core::iter::once((height, Some(hash)))
|
||||||
|
.chain((height + 1..exp_hashes.len() as u32).map(|h| (h, None)))
|
||||||
|
.collect::<bdk_chain::local_chain::ChangeSet>()
|
||||||
|
} else {
|
||||||
|
BTreeMap::from([(height, Some(hash))])
|
||||||
|
},
|
||||||
|
"chain update changeset is unexpected",
|
||||||
|
);
|
||||||
|
|
||||||
|
exp_height += 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
local_chain.blocks(),
|
||||||
|
&exp_hashes
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, hash)| (i as u32, *hash))
|
||||||
|
.collect(),
|
||||||
|
"final local_chain state is unexpected after reorg",
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure that [`EmittedUpdate::into_tx_graph_update`] behaves appropriately for both mempool and
|
||||||
|
/// block updates.
|
||||||
|
///
|
||||||
|
/// [`EmittedUpdate::into_tx_graph_update`]: bdk_bitcoind_rpc::EmittedUpdate::into_tx_graph_update
|
||||||
|
#[test]
|
||||||
|
fn test_into_tx_graph() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
|
||||||
|
println!("getting new addresses!");
|
||||||
|
let addr_0 = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
let addr_1 = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
let addr_2 = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
println!("got new addresses!");
|
||||||
|
|
||||||
|
println!("mining block!");
|
||||||
|
env.mine_blocks(101, None)?;
|
||||||
|
println!("mined blocks!");
|
||||||
|
|
||||||
|
let (mut chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||||
|
let mut indexed_tx_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||||
|
let mut index = SpkTxOutIndex::<usize>::default();
|
||||||
|
index.insert_spk(0, addr_0.script_pubkey());
|
||||||
|
index.insert_spk(1, addr_1.script_pubkey());
|
||||||
|
index.insert_spk(2, addr_2.script_pubkey());
|
||||||
|
index
|
||||||
|
});
|
||||||
|
|
||||||
|
let emitter = &mut Emitter::new(&env.client, chain.tip(), 0);
|
||||||
|
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
let _ = chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?;
|
||||||
|
let indexed_additions = indexed_tx_graph.apply_block_relevant(&emission.block, height);
|
||||||
|
assert!(indexed_additions.is_empty());
|
||||||
|
}
|
||||||
|
|
||||||
|
// send 3 txs to a tracked address, these txs will be in the mempool
|
||||||
|
let exp_txids = {
|
||||||
|
let mut txids = BTreeSet::new();
|
||||||
|
for _ in 0..3 {
|
||||||
|
txids.insert(env.client.send_to_address(
|
||||||
|
&addr_0,
|
||||||
|
Amount::from_sat(10_000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
)?);
|
||||||
|
}
|
||||||
|
txids
|
||||||
|
};
|
||||||
|
|
||||||
|
// expect that the next block should be none and we should get 3 txs from mempool
|
||||||
|
{
|
||||||
|
// next block should be `None`
|
||||||
|
assert!(emitter.next_block()?.is_none());
|
||||||
|
|
||||||
|
let mempool_txs = emitter.mempool()?;
|
||||||
|
let indexed_additions = indexed_tx_graph.batch_insert_unconfirmed(mempool_txs);
|
||||||
|
assert_eq!(
|
||||||
|
indexed_additions
|
||||||
|
.graph
|
||||||
|
.txs
|
||||||
|
.iter()
|
||||||
|
.map(|tx| tx.txid())
|
||||||
|
.collect::<BTreeSet<Txid>>(),
|
||||||
|
exp_txids,
|
||||||
|
"changeset should have the 3 mempool transactions",
|
||||||
|
);
|
||||||
|
assert!(indexed_additions.graph.anchors.is_empty());
|
||||||
|
}
|
||||||
|
|
||||||
|
// mine a block that confirms the 3 txs
|
||||||
|
let exp_block_hash = env.mine_blocks(1, None)?[0];
|
||||||
|
let exp_block_height = env.client.get_block_info(&exp_block_hash)?.height as u32;
|
||||||
|
let exp_anchors = exp_txids
|
||||||
|
.iter()
|
||||||
|
.map({
|
||||||
|
let anchor = BlockId {
|
||||||
|
height: exp_block_height,
|
||||||
|
hash: exp_block_hash,
|
||||||
|
};
|
||||||
|
move |&txid| (anchor, txid)
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
// must receive mined block which will confirm the transactions.
|
||||||
|
{
|
||||||
|
let emission = emitter.next_block()?.expect("must get mined block");
|
||||||
|
let height = emission.block_height();
|
||||||
|
let _ = chain.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})?;
|
||||||
|
let indexed_additions = indexed_tx_graph.apply_block_relevant(&emission.block, height);
|
||||||
|
assert!(indexed_additions.graph.txs.is_empty());
|
||||||
|
assert!(indexed_additions.graph.txouts.is_empty());
|
||||||
|
assert_eq!(indexed_additions.graph.anchors, exp_anchors);
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure next block emitted after reorg is at reorg height.
|
||||||
|
///
|
||||||
|
/// After a reorg, if the last-emitted block height is equal or greater than the reorg height, and
|
||||||
|
/// the fallback height is equal to or lower than the reorg height, the next block/header emission
|
||||||
|
/// should be at the reorg height.
|
||||||
|
///
|
||||||
|
/// TODO: If the reorg height is lower than the fallback height, how do we find a block height to
|
||||||
|
/// emit that can connect with our receiver chain?
|
||||||
|
#[test]
|
||||||
|
fn ensure_block_emitted_after_reorg_is_at_reorg_height() -> anyhow::Result<()> {
|
||||||
|
const EMITTER_START_HEIGHT: usize = 100;
|
||||||
|
const CHAIN_TIP_HEIGHT: usize = 110;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
EMITTER_START_HEIGHT as _,
|
||||||
|
);
|
||||||
|
|
||||||
|
env.mine_blocks(CHAIN_TIP_HEIGHT, None)?;
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
|
||||||
|
for reorg_count in 1..=10 {
|
||||||
|
let replaced_blocks = env.reorg_empty_blocks(reorg_count)?;
|
||||||
|
let next_emission = emitter.next_header()?.expect("must emit block after reorg");
|
||||||
|
assert_eq!(
|
||||||
|
(
|
||||||
|
next_emission.block_height() as usize,
|
||||||
|
next_emission.block_hash()
|
||||||
|
),
|
||||||
|
replaced_blocks[0],
|
||||||
|
"block emitted after reorg should be at the reorg height"
|
||||||
|
);
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn process_block(
|
||||||
|
recv_chain: &mut LocalChain,
|
||||||
|
recv_graph: &mut IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||||
|
block: Block,
|
||||||
|
block_height: u32,
|
||||||
|
) -> anyhow::Result<()> {
|
||||||
|
recv_chain
|
||||||
|
.apply_update(CheckPoint::from_header(&block.header, block_height).into_update(false))?;
|
||||||
|
let _ = recv_graph.apply_block(block, block_height);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn sync_from_emitter<C>(
|
||||||
|
recv_chain: &mut LocalChain,
|
||||||
|
recv_graph: &mut IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||||
|
emitter: &mut Emitter<C>,
|
||||||
|
) -> anyhow::Result<()>
|
||||||
|
where
|
||||||
|
C: bitcoincore_rpc::RpcApi,
|
||||||
|
{
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
process_block(recv_chain, recv_graph, emission.block, height)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn get_balance(
|
||||||
|
recv_chain: &LocalChain,
|
||||||
|
recv_graph: &IndexedTxGraph<BlockId, SpkTxOutIndex<()>>,
|
||||||
|
) -> anyhow::Result<Balance> {
|
||||||
|
let chain_tip = recv_chain.tip().block_id();
|
||||||
|
let outpoints = recv_graph.index.outpoints().clone();
|
||||||
|
let balance = recv_graph
|
||||||
|
.graph()
|
||||||
|
.balance(recv_chain, chain_tip, outpoints, |_, _| true);
|
||||||
|
Ok(balance)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// If a block is reorged out, ensure that containing transactions that do not exist in the
|
||||||
|
/// replacement block(s) become unconfirmed.
|
||||||
|
#[test]
|
||||||
|
fn tx_can_become_unconfirmed_after_reorg() -> anyhow::Result<()> {
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
const ADDITIONAL_COUNT: usize = 11;
|
||||||
|
const SEND_AMOUNT: Amount = Amount::from_sat(10_000);
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// setup addresses
|
||||||
|
let addr_to_mine = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
let spk_to_track = ScriptBuf::new_v0_p2wsh(&WScriptHash::all_zeros());
|
||||||
|
let addr_to_track = Address::from_script(&spk_to_track, bitcoin::Network::Regtest)?;
|
||||||
|
|
||||||
|
// setup receiver
|
||||||
|
let (mut recv_chain, _) = LocalChain::from_genesis_hash(env.client.get_block_hash(0)?);
|
||||||
|
let mut recv_graph = IndexedTxGraph::<BlockId, _>::new({
|
||||||
|
let mut recv_index = SpkTxOutIndex::default();
|
||||||
|
recv_index.insert_spk((), spk_to_track.clone());
|
||||||
|
recv_index
|
||||||
|
});
|
||||||
|
|
||||||
|
// mine and sync receiver up to tip
|
||||||
|
env.mine_blocks(PREMINE_COUNT, Some(addr_to_mine))?;
|
||||||
|
|
||||||
|
// create transactions that are tracked by our receiver
|
||||||
|
for _ in 0..ADDITIONAL_COUNT {
|
||||||
|
let txid = env.send(&addr_to_track, SEND_AMOUNT)?;
|
||||||
|
|
||||||
|
// lock outputs that send to `addr_to_track`
|
||||||
|
let outpoints_to_lock = env
|
||||||
|
.client
|
||||||
|
.get_transaction(&txid, None)?
|
||||||
|
.transaction()?
|
||||||
|
.output
|
||||||
|
.into_iter()
|
||||||
|
.enumerate()
|
||||||
|
.filter(|(_, txo)| txo.script_pubkey == spk_to_track)
|
||||||
|
.map(|(vout, _)| OutPoint::new(txid, vout as _))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
env.client.lock_unspent(&outpoints_to_lock)?;
|
||||||
|
|
||||||
|
let _ = env.mine_blocks(1, None)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
// get emitter up to tip
|
||||||
|
sync_from_emitter(&mut recv_chain, &mut recv_graph, &mut emitter)?;
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
get_balance(&recv_chain, &recv_graph)?,
|
||||||
|
Balance {
|
||||||
|
confirmed: SEND_AMOUNT.to_sat() * ADDITIONAL_COUNT as u64,
|
||||||
|
..Balance::default()
|
||||||
|
},
|
||||||
|
"initial balance must be correct",
|
||||||
|
);
|
||||||
|
|
||||||
|
// perform reorgs with different depths
|
||||||
|
for reorg_count in 1..=ADDITIONAL_COUNT {
|
||||||
|
env.reorg_empty_blocks(reorg_count)?;
|
||||||
|
sync_from_emitter(&mut recv_chain, &mut recv_graph, &mut emitter)?;
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
get_balance(&recv_chain, &recv_graph)?,
|
||||||
|
Balance {
|
||||||
|
confirmed: SEND_AMOUNT.to_sat() * (ADDITIONAL_COUNT - reorg_count) as u64,
|
||||||
|
trusted_pending: SEND_AMOUNT.to_sat() * reorg_count as u64,
|
||||||
|
..Balance::default()
|
||||||
|
},
|
||||||
|
"reorg_count: {}",
|
||||||
|
reorg_count,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure avoid-re-emission-logic is sound when [`Emitter`] is synced to tip.
|
||||||
|
///
|
||||||
|
/// The receiver (bdk_chain structures) is synced to the chain tip, and there is txs in the mempool.
|
||||||
|
/// When we call Emitter::mempool multiple times, mempool txs should not be re-emitted, even if the
|
||||||
|
/// chain tip is extended.
|
||||||
|
#[test]
|
||||||
|
fn mempool_avoids_re_emission() -> anyhow::Result<()> {
|
||||||
|
const BLOCKS_TO_MINE: usize = 101;
|
||||||
|
const MEMPOOL_TX_COUNT: usize = 2;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine blocks and sync up emitter
|
||||||
|
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
env.mine_blocks(BLOCKS_TO_MINE, Some(addr.clone()))?;
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
|
||||||
|
// have some random txs in mempool
|
||||||
|
let exp_txids = (0..MEMPOOL_TX_COUNT)
|
||||||
|
.map(|_| env.send(&addr, Amount::from_sat(2100)))
|
||||||
|
.collect::<Result<BTreeSet<Txid>, _>>()?;
|
||||||
|
|
||||||
|
// the first emission should include all transactions
|
||||||
|
let emitted_txids = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<Txid>>();
|
||||||
|
assert_eq!(
|
||||||
|
emitted_txids, exp_txids,
|
||||||
|
"all mempool txs should be emitted"
|
||||||
|
);
|
||||||
|
|
||||||
|
// second emission should be empty
|
||||||
|
assert!(
|
||||||
|
emitter.mempool()?.is_empty(),
|
||||||
|
"second emission should be empty"
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine empty blocks + sync up our emitter -> we should still not re-emit
|
||||||
|
for _ in 0..BLOCKS_TO_MINE {
|
||||||
|
env.mine_empty_block()?;
|
||||||
|
}
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
assert!(
|
||||||
|
emitter.mempool()?.is_empty(),
|
||||||
|
"third emission, after chain tip is extended, should also be empty"
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure mempool tx is still re-emitted if [`Emitter`] has not reached the tx's introduction
|
||||||
|
/// height.
|
||||||
|
///
|
||||||
|
/// We introduce a mempool tx after each block, where blocks are empty (does not confirm previous
|
||||||
|
/// mempool txs). Then we emit blocks from [`Emitter`] (intertwining `mempool` calls). We check
|
||||||
|
/// that `mempool` should always re-emit txs that have introduced at a height greater than the last
|
||||||
|
/// emitted block height.
|
||||||
|
#[test]
|
||||||
|
fn mempool_re_emits_if_tx_introduction_height_not_reached() -> anyhow::Result<()> {
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
const MEMPOOL_TX_COUNT: usize = 21;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine blocks to get initial balance, sync emitter up to tip
|
||||||
|
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
env.mine_blocks(PREMINE_COUNT, Some(addr.clone()))?;
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
|
||||||
|
// mine blocks to introduce txs to mempool at different heights
|
||||||
|
let tx_introductions = (0..MEMPOOL_TX_COUNT)
|
||||||
|
.map(|_| -> anyhow::Result<_> {
|
||||||
|
let (height, _) = env.mine_empty_block()?;
|
||||||
|
let txid = env.send(&addr, Amount::from_sat(2100))?;
|
||||||
|
Ok((height, txid))
|
||||||
|
})
|
||||||
|
.collect::<anyhow::Result<BTreeSet<_>>>()?;
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
tx_introductions.iter().map(|&(_, txid)| txid).collect(),
|
||||||
|
"first mempool emission should include all txs",
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
tx_introductions.iter().map(|&(_, txid)| txid).collect(),
|
||||||
|
"second mempool emission should still include all txs",
|
||||||
|
);
|
||||||
|
|
||||||
|
// At this point, the emitter has seen all mempool transactions. It should only re-emit those
|
||||||
|
// that have introduction heights less than the emitter's last-emitted block tip.
|
||||||
|
while let Some(emission) = emitter.next_header()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
// We call `mempool()` twice.
|
||||||
|
// The second call (at height `h`) should skip the tx introduced at height `h`.
|
||||||
|
for try_index in 0..2 {
|
||||||
|
let exp_txids = tx_introductions
|
||||||
|
.range((height as usize + try_index, Txid::all_zeros())..)
|
||||||
|
.map(|&(_, txid)| txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let emitted_txids = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
emitted_txids, exp_txids,
|
||||||
|
"\n emission {} (try {}) must only contain txs introduced at that height or lower: \n\t missing: {:?} \n\t extra: {:?}",
|
||||||
|
height,
|
||||||
|
try_index,
|
||||||
|
exp_txids
|
||||||
|
.difference(&emitted_txids)
|
||||||
|
.map(|txid| (txid, tx_introductions.iter().find_map(|(h, id)| if id == txid { Some(h) } else { None }).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
emitted_txids
|
||||||
|
.difference(&exp_txids)
|
||||||
|
.map(|txid| (txid, tx_introductions.iter().find_map(|(h, id)| if id == txid { Some(h) } else { None }).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Ensure we force re-emit all mempool txs after reorg.
|
||||||
|
#[test]
|
||||||
|
fn mempool_during_reorg() -> anyhow::Result<()> {
|
||||||
|
const TIP_DIFF: usize = 10;
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
0,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine blocks to get initial balance
|
||||||
|
let addr = env.client.get_new_address(None, None)?.assume_checked();
|
||||||
|
env.mine_blocks(PREMINE_COUNT, Some(addr.clone()))?;
|
||||||
|
|
||||||
|
// introduce mempool tx at each block extension
|
||||||
|
for _ in 0..TIP_DIFF {
|
||||||
|
env.mine_empty_block()?;
|
||||||
|
env.send(&addr, Amount::from_sat(2100))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
// sync emitter to tip, first mempool emission should include all txs (as we haven't emitted
|
||||||
|
// from the mempool yet)
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
assert_eq!(
|
||||||
|
emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
env.client
|
||||||
|
.get_raw_mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.collect::<BTreeSet<_>>(),
|
||||||
|
"first mempool emission should include all txs",
|
||||||
|
);
|
||||||
|
|
||||||
|
// perform reorgs at different heights, these reorgs will not confirm transactions in the
|
||||||
|
// mempool
|
||||||
|
for reorg_count in 1..TIP_DIFF {
|
||||||
|
println!("REORG COUNT: {}", reorg_count);
|
||||||
|
env.reorg_empty_blocks(reorg_count)?;
|
||||||
|
|
||||||
|
// This is a map of mempool txids to tip height where the tx was introduced to the mempool
|
||||||
|
// we recalculate this at every loop as reorgs may evict transactions from mempool. We use
|
||||||
|
// the introduction height to determine whether we expect a tx to appear in a mempool
|
||||||
|
// emission.
|
||||||
|
// TODO: How can have have reorg logic in `TestEnv` NOT blacklast old blocks first?
|
||||||
|
let tx_introductions = dbg!(env
|
||||||
|
.client
|
||||||
|
.get_raw_mempool_verbose()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(txid, entry)| (txid, entry.height as usize))
|
||||||
|
.collect::<BTreeMap<_, _>>());
|
||||||
|
|
||||||
|
// `next_header` emits the replacement block of the reorg
|
||||||
|
if let Some(emission) = emitter.next_header()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
println!("\t- replacement height: {}", height);
|
||||||
|
|
||||||
|
// the mempool emission (that follows the first block emission after reorg) should only
|
||||||
|
// include mempool txs introduced at reorg height or greater
|
||||||
|
let mempool = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_mempool = tx_introductions
|
||||||
|
.iter()
|
||||||
|
.filter(|(_, &intro_h)| intro_h >= (height as usize))
|
||||||
|
.map(|(&txid, _)| txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
mempool, exp_mempool,
|
||||||
|
"the first mempool emission after reorg should only include mempool txs introduced at reorg height or greater"
|
||||||
|
);
|
||||||
|
|
||||||
|
let mempool = emitter
|
||||||
|
.mempool()?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(tx, _)| tx.txid())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_mempool = tx_introductions
|
||||||
|
.iter()
|
||||||
|
.filter(|&(_, &intro_height)| intro_height > (height as usize))
|
||||||
|
.map(|(&txid, _)| txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
mempool, exp_mempool,
|
||||||
|
"following mempool emissions after reorg should exclude mempool introduction heights <= last emitted block height: \n\t missing: {:?} \n\t extra: {:?}",
|
||||||
|
exp_mempool
|
||||||
|
.difference(&mempool)
|
||||||
|
.map(|txid| (txid, tx_introductions.get(txid).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
mempool
|
||||||
|
.difference(&exp_mempool)
|
||||||
|
.map(|txid| (txid, tx_introductions.get(txid).unwrap()))
|
||||||
|
.collect::<Vec<_>>(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// sync emitter to tip
|
||||||
|
while emitter.next_header()?.is_some() {}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// If blockchain re-org includes the start height, emit new start height block
|
||||||
|
///
|
||||||
|
/// 1. mine 101 blocks
|
||||||
|
/// 2. emit blocks 99a, 100a
|
||||||
|
/// 3. invalidate blocks 99a, 100a, 101a
|
||||||
|
/// 4. mine new blocks 99b, 100b, 101b
|
||||||
|
/// 5. emit block 99b
|
||||||
|
///
|
||||||
|
/// The block hash of 99b should be different than 99a, but their previous block hashes should
|
||||||
|
/// be the same.
|
||||||
|
#[test]
|
||||||
|
fn no_agreement_point() -> anyhow::Result<()> {
|
||||||
|
const PREMINE_COUNT: usize = 101;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
|
||||||
|
// start height is 99
|
||||||
|
let mut emitter = Emitter::new(
|
||||||
|
&env.client,
|
||||||
|
CheckPoint::new(BlockId {
|
||||||
|
height: 0,
|
||||||
|
hash: env.client.get_block_hash(0)?,
|
||||||
|
}),
|
||||||
|
(PREMINE_COUNT - 2) as u32,
|
||||||
|
);
|
||||||
|
|
||||||
|
// mine 101 blocks
|
||||||
|
env.mine_blocks(PREMINE_COUNT, None)?;
|
||||||
|
|
||||||
|
// emit block 99a
|
||||||
|
let block_header_99a = emitter.next_header()?.expect("block 99a header").block;
|
||||||
|
let block_hash_99a = block_header_99a.block_hash();
|
||||||
|
let block_hash_98a = block_header_99a.prev_blockhash;
|
||||||
|
|
||||||
|
// emit block 100a
|
||||||
|
let block_header_100a = emitter.next_header()?.expect("block 100a header").block;
|
||||||
|
let block_hash_100a = block_header_100a.block_hash();
|
||||||
|
|
||||||
|
// get hash for block 101a
|
||||||
|
let block_hash_101a = env.client.get_block_hash(101)?;
|
||||||
|
|
||||||
|
// invalidate blocks 99a, 100a, 101a
|
||||||
|
env.client.invalidate_block(&block_hash_99a)?;
|
||||||
|
env.client.invalidate_block(&block_hash_100a)?;
|
||||||
|
env.client.invalidate_block(&block_hash_101a)?;
|
||||||
|
|
||||||
|
// mine new blocks 99b, 100b, 101b
|
||||||
|
env.mine_blocks(3, None)?;
|
||||||
|
|
||||||
|
// emit block header 99b
|
||||||
|
let block_header_99b = emitter.next_header()?.expect("block 99b header").block;
|
||||||
|
let block_hash_99b = block_header_99b.block_hash();
|
||||||
|
let block_hash_98b = block_header_99b.prev_blockhash;
|
||||||
|
|
||||||
|
assert_ne!(block_hash_99a, block_hash_99b);
|
||||||
|
assert_eq!(block_hash_98a, block_hash_98b);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
@@ -1,8 +1,8 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bdk_chain"
|
name = "bdk_chain"
|
||||||
version = "0.4.0"
|
version = "0.11.0"
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
rust-version = "1.57"
|
rust-version = "1.63"
|
||||||
homepage = "https://bitcoindevkit.org"
|
homepage = "https://bitcoindevkit.org"
|
||||||
repository = "https://github.com/bitcoindevkit/bdk"
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
documentation = "https://docs.rs/bdk_chain"
|
documentation = "https://docs.rs/bdk_chain"
|
||||||
@@ -13,18 +13,18 @@ readme = "README.md"
|
|||||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
bitcoin = { version = "0.29" }
|
# For no-std, remember to enable the bitcoin/no-std feature
|
||||||
|
bitcoin = { version = "0.30.0", default-features = false }
|
||||||
serde_crate = { package = "serde", version = "1", optional = true, features = ["derive"] }
|
serde_crate = { package = "serde", version = "1", optional = true, features = ["derive"] }
|
||||||
|
|
||||||
# Use hashbrown as a feature flag to have HashSet and HashMap from it.
|
# Use hashbrown as a feature flag to have HashSet and HashMap from it.
|
||||||
# note version 0.13 breaks outs MSRV.
|
hashbrown = { version = "0.9.1", optional = true, features = ["serde"] }
|
||||||
hashbrown = { version = "0.12", optional = true, features = ["serde"] }
|
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||||
miniscript = { version = "9.0.0", optional = true }
|
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
rand = "0.8"
|
rand = "0.8"
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
default = ["std", "miniscript"]
|
default = ["std"]
|
||||||
std = []
|
std = ["bitcoin/std", "miniscript/std"]
|
||||||
serde = ["serde_crate", "bitcoin/serde" ]
|
serde = ["serde_crate", "bitcoin/serde"]
|
||||||
|
|||||||
@@ -1,75 +1,45 @@
|
|||||||
use bitcoin::{hashes::Hash, BlockHash, OutPoint, TxOut, Txid};
|
use bitcoin::{hashes::Hash, BlockHash, OutPoint, TxOut, Txid};
|
||||||
|
|
||||||
use crate::{
|
use crate::{Anchor, AnchorFromBlockPosition, COINBASE_MATURITY};
|
||||||
sparse_chain::{self, ChainPosition},
|
|
||||||
COINBASE_MATURITY,
|
|
||||||
};
|
|
||||||
|
|
||||||
/// Represents the height at which a transaction is confirmed.
|
/// Represents the observed position of some chain data.
|
||||||
#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Hash)]
|
///
|
||||||
#[cfg_attr(
|
/// The generic `A` should be a [`Anchor`] implementation.
|
||||||
feature = "serde",
|
#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, core::hash::Hash)]
|
||||||
derive(serde::Deserialize, serde::Serialize),
|
pub enum ChainPosition<A> {
|
||||||
serde(crate = "serde_crate")
|
/// The chain data is seen as confirmed, and in anchored by `A`.
|
||||||
)]
|
Confirmed(A),
|
||||||
pub enum TxHeight {
|
/// The chain data is not confirmed and last seen in the mempool at this timestamp.
|
||||||
Confirmed(u32),
|
Unconfirmed(u64),
|
||||||
Unconfirmed,
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Default for TxHeight {
|
impl<A> ChainPosition<A> {
|
||||||
fn default() -> Self {
|
/// Returns whether [`ChainPosition`] is confirmed or not.
|
||||||
Self::Unconfirmed
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl core::fmt::Display for TxHeight {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
match self {
|
|
||||||
Self::Confirmed(h) => core::write!(f, "confirmed_at({})", h),
|
|
||||||
Self::Unconfirmed => core::write!(f, "unconfirmed"),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl From<Option<u32>> for TxHeight {
|
|
||||||
fn from(opt: Option<u32>) -> Self {
|
|
||||||
match opt {
|
|
||||||
Some(h) => Self::Confirmed(h),
|
|
||||||
None => Self::Unconfirmed,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl From<TxHeight> for Option<u32> {
|
|
||||||
fn from(height: TxHeight) -> Self {
|
|
||||||
match height {
|
|
||||||
TxHeight::Confirmed(h) => Some(h),
|
|
||||||
TxHeight::Unconfirmed => None,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl crate::sparse_chain::ChainPosition for TxHeight {
|
|
||||||
fn height(&self) -> TxHeight {
|
|
||||||
*self
|
|
||||||
}
|
|
||||||
|
|
||||||
fn max_ord_of_height(height: TxHeight) -> Self {
|
|
||||||
height
|
|
||||||
}
|
|
||||||
|
|
||||||
fn min_ord_of_height(height: TxHeight) -> Self {
|
|
||||||
height
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl TxHeight {
|
|
||||||
pub fn is_confirmed(&self) -> bool {
|
pub fn is_confirmed(&self) -> bool {
|
||||||
matches!(self, Self::Confirmed(_))
|
matches!(self, Self::Confirmed(_))
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl<A: Clone> ChainPosition<&A> {
|
||||||
|
/// Maps a [`ChainPosition<&A>`] into a [`ChainPosition<A>`] by cloning the contents.
|
||||||
|
pub fn cloned(self) -> ChainPosition<A> {
|
||||||
|
match self {
|
||||||
|
ChainPosition::Confirmed(a) => ChainPosition::Confirmed(a.clone()),
|
||||||
|
ChainPosition::Unconfirmed(last_seen) => ChainPosition::Unconfirmed(last_seen),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor> ChainPosition<A> {
|
||||||
|
/// Determines the upper bound of the confirmation height.
|
||||||
|
pub fn confirmation_height_upper_bound(&self) -> Option<u32> {
|
||||||
|
match self {
|
||||||
|
ChainPosition::Confirmed(a) => Some(a.confirmation_height_upper_bound()),
|
||||||
|
ChainPosition::Unconfirmed(_) => None,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// Block height and timestamp at which a transaction is confirmed.
|
/// Block height and timestamp at which a transaction is confirmed.
|
||||||
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
#[cfg_attr(
|
#[cfg_attr(
|
||||||
@@ -78,47 +48,49 @@ impl TxHeight {
|
|||||||
serde(crate = "serde_crate")
|
serde(crate = "serde_crate")
|
||||||
)]
|
)]
|
||||||
pub enum ConfirmationTime {
|
pub enum ConfirmationTime {
|
||||||
Confirmed { height: u32, time: u64 },
|
/// The transaction is confirmed
|
||||||
Unconfirmed,
|
Confirmed {
|
||||||
}
|
/// Confirmation height.
|
||||||
|
height: u32,
|
||||||
impl sparse_chain::ChainPosition for ConfirmationTime {
|
/// Confirmation time in unix seconds.
|
||||||
fn height(&self) -> TxHeight {
|
time: u64,
|
||||||
match self {
|
},
|
||||||
ConfirmationTime::Confirmed { height, .. } => TxHeight::Confirmed(*height),
|
/// The transaction is unconfirmed
|
||||||
ConfirmationTime::Unconfirmed => TxHeight::Unconfirmed,
|
Unconfirmed {
|
||||||
}
|
/// The last-seen timestamp in unix seconds.
|
||||||
}
|
last_seen: u64,
|
||||||
|
},
|
||||||
fn max_ord_of_height(height: TxHeight) -> Self {
|
|
||||||
match height {
|
|
||||||
TxHeight::Confirmed(height) => Self::Confirmed {
|
|
||||||
height,
|
|
||||||
time: u64::MAX,
|
|
||||||
},
|
|
||||||
TxHeight::Unconfirmed => Self::Unconfirmed,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn min_ord_of_height(height: TxHeight) -> Self {
|
|
||||||
match height {
|
|
||||||
TxHeight::Confirmed(height) => Self::Confirmed {
|
|
||||||
height,
|
|
||||||
time: u64::MIN,
|
|
||||||
},
|
|
||||||
TxHeight::Unconfirmed => Self::Unconfirmed,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ConfirmationTime {
|
impl ConfirmationTime {
|
||||||
|
/// Construct an unconfirmed variant using the given `last_seen` time in unix seconds.
|
||||||
|
pub fn unconfirmed(last_seen: u64) -> Self {
|
||||||
|
Self::Unconfirmed { last_seen }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns whether [`ConfirmationTime`] is the confirmed variant.
|
||||||
pub fn is_confirmed(&self) -> bool {
|
pub fn is_confirmed(&self) -> bool {
|
||||||
matches!(self, Self::Confirmed { .. })
|
matches!(self, Self::Confirmed { .. })
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl From<ChainPosition<ConfirmationTimeHeightAnchor>> for ConfirmationTime {
|
||||||
|
fn from(observed_as: ChainPosition<ConfirmationTimeHeightAnchor>) -> Self {
|
||||||
|
match observed_as {
|
||||||
|
ChainPosition::Confirmed(a) => Self::Confirmed {
|
||||||
|
height: a.confirmation_height,
|
||||||
|
time: a.confirmation_time,
|
||||||
|
},
|
||||||
|
ChainPosition::Unconfirmed(last_seen) => Self::Unconfirmed { last_seen },
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// A reference to a block in the canonical chain.
|
/// A reference to a block in the canonical chain.
|
||||||
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord)]
|
///
|
||||||
|
/// `BlockId` implements [`Anchor`]. When a transaction is anchored to `BlockId`, the confirmation
|
||||||
|
/// block and anchor block are the same block.
|
||||||
|
#[derive(Debug, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
#[cfg_attr(
|
#[cfg_attr(
|
||||||
feature = "serde",
|
feature = "serde",
|
||||||
derive(serde::Deserialize, serde::Serialize),
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
@@ -131,11 +103,23 @@ pub struct BlockId {
|
|||||||
pub hash: BlockHash,
|
pub hash: BlockHash,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl Anchor for BlockId {
|
||||||
|
fn anchor_block(&self) -> Self {
|
||||||
|
*self
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AnchorFromBlockPosition for BlockId {
|
||||||
|
fn from_block_position(_block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||||
|
block_id
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl Default for BlockId {
|
impl Default for BlockId {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self {
|
Self {
|
||||||
height: Default::default(),
|
height: Default::default(),
|
||||||
hash: BlockHash::from_inner([0u8; 32]),
|
hash: BlockHash::all_zeros(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -161,51 +145,119 @@ impl From<(&u32, &BlockHash)> for BlockId {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// An [`Anchor`] implementation that also records the exact confirmation height of the transaction.
|
||||||
|
///
|
||||||
|
/// Note that the confirmation block and the anchor block can be different here.
|
||||||
|
///
|
||||||
|
/// Refer to [`Anchor`] for more details.
|
||||||
|
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate")
|
||||||
|
)]
|
||||||
|
pub struct ConfirmationHeightAnchor {
|
||||||
|
/// The exact confirmation height of the transaction.
|
||||||
|
///
|
||||||
|
/// It is assumed that this value is never larger than the height of the anchor block.
|
||||||
|
pub confirmation_height: u32,
|
||||||
|
/// The anchor block.
|
||||||
|
pub anchor_block: BlockId,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Anchor for ConfirmationHeightAnchor {
|
||||||
|
fn anchor_block(&self) -> BlockId {
|
||||||
|
self.anchor_block
|
||||||
|
}
|
||||||
|
|
||||||
|
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||||
|
self.confirmation_height
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AnchorFromBlockPosition for ConfirmationHeightAnchor {
|
||||||
|
fn from_block_position(_block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||||
|
Self {
|
||||||
|
anchor_block: block_id,
|
||||||
|
confirmation_height: block_id.height,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An [`Anchor`] implementation that also records the exact confirmation time and height of the
|
||||||
|
/// transaction.
|
||||||
|
///
|
||||||
|
/// Note that the confirmation block and the anchor block can be different here.
|
||||||
|
///
|
||||||
|
/// Refer to [`Anchor`] for more details.
|
||||||
|
#[derive(Debug, Default, Clone, PartialEq, Eq, Copy, PartialOrd, Ord, core::hash::Hash)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(crate = "serde_crate")
|
||||||
|
)]
|
||||||
|
pub struct ConfirmationTimeHeightAnchor {
|
||||||
|
/// The confirmation height of the transaction being anchored.
|
||||||
|
pub confirmation_height: u32,
|
||||||
|
/// The confirmation time of the transaction being anchored.
|
||||||
|
pub confirmation_time: u64,
|
||||||
|
/// The anchor block.
|
||||||
|
pub anchor_block: BlockId,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Anchor for ConfirmationTimeHeightAnchor {
|
||||||
|
fn anchor_block(&self) -> BlockId {
|
||||||
|
self.anchor_block
|
||||||
|
}
|
||||||
|
|
||||||
|
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||||
|
self.confirmation_height
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AnchorFromBlockPosition for ConfirmationTimeHeightAnchor {
|
||||||
|
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, _tx_pos: usize) -> Self {
|
||||||
|
Self {
|
||||||
|
anchor_block: block_id,
|
||||||
|
confirmation_height: block_id.height,
|
||||||
|
confirmation_time: block.header.time as _,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/// A `TxOut` with as much data as we can retrieve about it
|
/// A `TxOut` with as much data as we can retrieve about it
|
||||||
#[derive(Debug, Clone, PartialEq)]
|
#[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord)]
|
||||||
pub struct FullTxOut<I> {
|
pub struct FullTxOut<A> {
|
||||||
|
/// The position of the transaction in `outpoint` in the overall chain.
|
||||||
|
pub chain_position: ChainPosition<A>,
|
||||||
/// The location of the `TxOut`.
|
/// The location of the `TxOut`.
|
||||||
pub outpoint: OutPoint,
|
pub outpoint: OutPoint,
|
||||||
/// The `TxOut`.
|
/// The `TxOut`.
|
||||||
pub txout: TxOut,
|
pub txout: TxOut,
|
||||||
/// The position of the transaction in `outpoint` in the overall chain.
|
|
||||||
pub chain_position: I,
|
|
||||||
/// The txid and chain position of the transaction (if any) that has spent this output.
|
/// The txid and chain position of the transaction (if any) that has spent this output.
|
||||||
pub spent_by: Option<(I, Txid)>,
|
pub spent_by: Option<(ChainPosition<A>, Txid)>,
|
||||||
/// Whether this output is on a coinbase transaction.
|
/// Whether this output is on a coinbase transaction.
|
||||||
pub is_on_coinbase: bool,
|
pub is_on_coinbase: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<I: ChainPosition> FullTxOut<I> {
|
impl<A: Anchor> FullTxOut<A> {
|
||||||
/// Whether the utxo is/was/will be spendable at `height`.
|
/// Whether the `txout` is considered mature.
|
||||||
///
|
///
|
||||||
/// It is spendable if it is not an immature coinbase output and no spending tx has been
|
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||||
/// confirmed by that height.
|
/// method may return false-negatives. In other words, interpreted confirmation count may be
|
||||||
pub fn is_spendable_at(&self, height: u32) -> bool {
|
/// less than the actual value.
|
||||||
if !self.is_mature(height) {
|
///
|
||||||
return false;
|
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||||
}
|
pub fn is_mature(&self, tip: u32) -> bool {
|
||||||
|
|
||||||
if self.chain_position.height() > TxHeight::Confirmed(height) {
|
|
||||||
return false;
|
|
||||||
}
|
|
||||||
|
|
||||||
match &self.spent_by {
|
|
||||||
Some((spending_height, _)) => spending_height.height() > TxHeight::Confirmed(height),
|
|
||||||
None => true,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
pub fn is_mature(&self, height: u32) -> bool {
|
|
||||||
if self.is_on_coinbase {
|
if self.is_on_coinbase {
|
||||||
let tx_height = match self.chain_position.height() {
|
let tx_height = match &self.chain_position {
|
||||||
TxHeight::Confirmed(tx_height) => tx_height,
|
ChainPosition::Confirmed(anchor) => anchor.confirmation_height_upper_bound(),
|
||||||
TxHeight::Unconfirmed => {
|
ChainPosition::Unconfirmed(_) => {
|
||||||
debug_assert!(false, "coinbase tx can never be unconfirmed");
|
debug_assert!(false, "coinbase tx can never be unconfirmed");
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
let age = height.saturating_sub(tx_height);
|
let age = tip.saturating_sub(tx_height);
|
||||||
if age + 1 < COINBASE_MATURITY {
|
if age + 1 < COINBASE_MATURITY {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
@@ -213,6 +265,68 @@ impl<I: ChainPosition> FullTxOut<I> {
|
|||||||
|
|
||||||
true
|
true
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/// Whether the utxo is/was/will be spendable with chain `tip`.
|
||||||
|
///
|
||||||
|
/// This method does not take into account the lock time.
|
||||||
|
///
|
||||||
|
/// Depending on the implementation of [`confirmation_height_upper_bound`] in [`Anchor`], this
|
||||||
|
/// method may return false-negatives. In other words, interpreted confirmation count may be
|
||||||
|
/// less than the actual value.
|
||||||
|
///
|
||||||
|
/// [`confirmation_height_upper_bound`]: Anchor::confirmation_height_upper_bound
|
||||||
|
pub fn is_confirmed_and_spendable(&self, tip: u32) -> bool {
|
||||||
|
if !self.is_mature(tip) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let confirmation_height = match &self.chain_position {
|
||||||
|
ChainPosition::Confirmed(anchor) => anchor.confirmation_height_upper_bound(),
|
||||||
|
ChainPosition::Unconfirmed(_) => return false,
|
||||||
|
};
|
||||||
|
if confirmation_height > tip {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// if the spending tx is confirmed within tip height, the txout is no longer spendable
|
||||||
|
if let Some((ChainPosition::Confirmed(spending_anchor), _)) = &self.spent_by {
|
||||||
|
if spending_anchor.anchor_block().height <= tip {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
true
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// TODO: make test
|
#[cfg(test)]
|
||||||
|
mod test {
|
||||||
|
use super::*;
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn chain_position_ord() {
|
||||||
|
let unconf1 = ChainPosition::<ConfirmationHeightAnchor>::Unconfirmed(10);
|
||||||
|
let unconf2 = ChainPosition::<ConfirmationHeightAnchor>::Unconfirmed(20);
|
||||||
|
let conf1 = ChainPosition::Confirmed(ConfirmationHeightAnchor {
|
||||||
|
confirmation_height: 9,
|
||||||
|
anchor_block: BlockId {
|
||||||
|
height: 20,
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
});
|
||||||
|
let conf2 = ChainPosition::Confirmed(ConfirmationHeightAnchor {
|
||||||
|
confirmation_height: 12,
|
||||||
|
anchor_block: BlockId {
|
||||||
|
height: 15,
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
});
|
||||||
|
|
||||||
|
assert!(unconf2 > unconf1, "higher last_seen means higher ord");
|
||||||
|
assert!(unconf1 > conf1, "unconfirmed is higher ord than confirmed");
|
||||||
|
assert!(
|
||||||
|
conf2 > conf1,
|
||||||
|
"confirmation_height is higher then it should be higher ord"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|||||||
@@ -1,639 +0,0 @@
|
|||||||
//! Module for structures that combine the features of [`sparse_chain`] and [`tx_graph`].
|
|
||||||
use crate::{
|
|
||||||
collections::HashSet,
|
|
||||||
sparse_chain::{self, ChainPosition, SparseChain},
|
|
||||||
tx_graph::{self, TxGraph},
|
|
||||||
BlockId, ForEachTxOut, FullTxOut, TxHeight,
|
|
||||||
};
|
|
||||||
use alloc::{string::ToString, vec::Vec};
|
|
||||||
use bitcoin::{OutPoint, Transaction, TxOut, Txid};
|
|
||||||
use core::fmt::Debug;
|
|
||||||
|
|
||||||
/// A consistent combination of a [`SparseChain<P>`] and a [`TxGraph<T>`].
|
|
||||||
///
|
|
||||||
/// `SparseChain` only keeps track of transaction ids and their position in the chain, but you often
|
|
||||||
/// want to store the full transactions as well. Additionally, you want to make sure that everything
|
|
||||||
/// in the chain is consistent with the full transaction data. `ChainGraph` enforces these two
|
|
||||||
/// invariants:
|
|
||||||
///
|
|
||||||
/// 1. Every transaction that is in the chain is also in the graph (you always have the full
|
|
||||||
/// transaction).
|
|
||||||
/// 2. No transactions in the chain conflict with each other, i.e., they don't double spend each
|
|
||||||
/// other or have ancestors that double spend each other.
|
|
||||||
///
|
|
||||||
/// Note that the `ChainGraph` guarantees a 1:1 mapping between transactions in the `chain` and
|
|
||||||
/// `graph` but not the other way around. Transactions may fall out of the *chain* (via re-org or
|
|
||||||
/// mempool eviction) but will remain in the *graph*.
|
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
|
||||||
pub struct ChainGraph<P = TxHeight> {
|
|
||||||
chain: SparseChain<P>,
|
|
||||||
graph: TxGraph,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> Default for ChainGraph<P> {
|
|
||||||
fn default() -> Self {
|
|
||||||
Self {
|
|
||||||
chain: Default::default(),
|
|
||||||
graph: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> AsRef<SparseChain<P>> for ChainGraph<P> {
|
|
||||||
fn as_ref(&self) -> &SparseChain<P> {
|
|
||||||
&self.chain
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> AsRef<TxGraph> for ChainGraph<P> {
|
|
||||||
fn as_ref(&self) -> &TxGraph {
|
|
||||||
&self.graph
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> AsRef<ChainGraph<P>> for ChainGraph<P> {
|
|
||||||
fn as_ref(&self) -> &ChainGraph<P> {
|
|
||||||
self
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> ChainGraph<P> {
|
|
||||||
/// Returns a reference to the internal [`SparseChain`].
|
|
||||||
pub fn chain(&self) -> &SparseChain<P> {
|
|
||||||
&self.chain
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns a reference to the internal [`TxGraph`].
|
|
||||||
pub fn graph(&self) -> &TxGraph {
|
|
||||||
&self.graph
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> ChainGraph<P>
|
|
||||||
where
|
|
||||||
P: ChainPosition,
|
|
||||||
{
|
|
||||||
/// Create a new chain graph from a `chain` and a `graph`.
|
|
||||||
///
|
|
||||||
/// There are two reasons this can return an `Err`:
|
|
||||||
///
|
|
||||||
/// 1. There is a transaction in the `chain` that does not have its corresponding full
|
|
||||||
/// transaction in `graph`.
|
|
||||||
/// 2. The `chain` has two transactions that are allegedly in it, but they conflict in the `graph`
|
|
||||||
/// (so could not possibly be in the same chain).
|
|
||||||
pub fn new(chain: SparseChain<P>, graph: TxGraph) -> Result<Self, NewError<P>> {
|
|
||||||
let mut missing = HashSet::default();
|
|
||||||
for (pos, txid) in chain.txids() {
|
|
||||||
if let Some(tx) = graph.get_tx(*txid) {
|
|
||||||
let conflict = graph
|
|
||||||
.walk_conflicts(tx, |_, txid| Some((chain.tx_position(txid)?.clone(), txid)))
|
|
||||||
.next();
|
|
||||||
if let Some((conflict_pos, conflict)) = conflict {
|
|
||||||
return Err(NewError::Conflict {
|
|
||||||
a: (pos.clone(), *txid),
|
|
||||||
b: (conflict_pos, conflict),
|
|
||||||
});
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
missing.insert(*txid);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if !missing.is_empty() {
|
|
||||||
return Err(NewError::Missing(missing));
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(Self { chain, graph })
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Take an update in the form of a [`SparseChain<P>`][`SparseChain`] and attempt to turn it
|
|
||||||
/// into a chain graph by filling in full transactions from `self` and from `new_txs`. This
|
|
||||||
/// returns a `ChainGraph<P, Cow<T>>` where the [`Cow<'a, T>`] will borrow the transaction if it
|
|
||||||
/// got it from `self`.
|
|
||||||
///
|
|
||||||
/// This is useful when interacting with services like an electrum server which returns a list
|
|
||||||
/// of txids and heights when calling [`script_get_history`], which can easily be inserted into a
|
|
||||||
/// [`SparseChain<TxHeight>`][`SparseChain`]. From there, you need to figure out which full
|
|
||||||
/// transactions you are missing in your chain graph and form `new_txs`. You then use
|
|
||||||
/// `inflate_update` to turn this into an update `ChainGraph<P, Cow<Transaction>>` and finally
|
|
||||||
/// use [`determine_changeset`] to generate the changeset from it.
|
|
||||||
///
|
|
||||||
/// [`SparseChain`]: crate::sparse_chain::SparseChain
|
|
||||||
/// [`Cow<'a, T>`]: std::borrow::Cow
|
|
||||||
/// [`script_get_history`]: https://docs.rs/electrum-client/latest/electrum_client/trait.ElectrumApi.html#tymethod.script_get_history
|
|
||||||
/// [`determine_changeset`]: Self::determine_changeset
|
|
||||||
pub fn inflate_update(
|
|
||||||
&self,
|
|
||||||
update: SparseChain<P>,
|
|
||||||
new_txs: impl IntoIterator<Item = Transaction>,
|
|
||||||
) -> Result<ChainGraph<P>, NewError<P>> {
|
|
||||||
let mut inflated_chain = SparseChain::default();
|
|
||||||
let mut inflated_graph = TxGraph::default();
|
|
||||||
|
|
||||||
for (height, hash) in update.checkpoints().clone().into_iter() {
|
|
||||||
let _ = inflated_chain
|
|
||||||
.insert_checkpoint(BlockId { height, hash })
|
|
||||||
.expect("must insert");
|
|
||||||
}
|
|
||||||
|
|
||||||
// [TODO] @evanlinjin: These need better comments
|
|
||||||
// - copy transactions that have changed positions into the graph
|
|
||||||
// - add new transactions to an inflated chain
|
|
||||||
for (pos, txid) in update.txids() {
|
|
||||||
match self.chain.tx_position(*txid) {
|
|
||||||
Some(original_pos) => {
|
|
||||||
if original_pos != pos {
|
|
||||||
let tx = self
|
|
||||||
.graph
|
|
||||||
.get_tx(*txid)
|
|
||||||
.expect("tx must exist as it is referenced in sparsechain")
|
|
||||||
.clone();
|
|
||||||
let _ = inflated_chain
|
|
||||||
.insert_tx(*txid, pos.clone())
|
|
||||||
.expect("must insert since this was already in update");
|
|
||||||
let _ = inflated_graph.insert_tx(tx);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
None => {
|
|
||||||
let _ = inflated_chain
|
|
||||||
.insert_tx(*txid, pos.clone())
|
|
||||||
.expect("must insert since this was already in update");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for tx in new_txs {
|
|
||||||
let _ = inflated_graph.insert_tx(tx);
|
|
||||||
}
|
|
||||||
|
|
||||||
ChainGraph::new(inflated_chain, inflated_graph)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Gets the checkpoint limit.
|
|
||||||
///
|
|
||||||
/// Refer to [`SparseChain::checkpoint_limit`] for more.
|
|
||||||
pub fn checkpoint_limit(&self) -> Option<usize> {
|
|
||||||
self.chain.checkpoint_limit()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Sets the checkpoint limit.
|
|
||||||
///
|
|
||||||
/// Refer to [`SparseChain::set_checkpoint_limit`] for more.
|
|
||||||
pub fn set_checkpoint_limit(&mut self, limit: Option<usize>) {
|
|
||||||
self.chain.set_checkpoint_limit(limit)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the changes required to invalidate checkpoints `from_height` (inclusive) and
|
|
||||||
/// above. Displaced transactions will have their positions moved to [`TxHeight::Unconfirmed`].
|
|
||||||
pub fn invalidate_checkpoints_preview(&self, from_height: u32) -> ChangeSet<P> {
|
|
||||||
ChangeSet {
|
|
||||||
chain: self.chain.invalidate_checkpoints_preview(from_height),
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Invalidate checkpoints `from_height` (inclusive) and above. Displaced transactions will be
|
|
||||||
/// re-positioned to [`TxHeight::Unconfirmed`].
|
|
||||||
///
|
|
||||||
/// This is equivalent to calling [`Self::invalidate_checkpoints_preview`] and
|
|
||||||
/// [`Self::apply_changeset`] in sequence.
|
|
||||||
pub fn invalidate_checkpoints(&mut self, from_height: u32) -> ChangeSet<P>
|
|
||||||
where
|
|
||||||
ChangeSet<P>: Clone,
|
|
||||||
{
|
|
||||||
let changeset = self.invalidate_checkpoints_preview(from_height);
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
changeset
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Get a transaction currently in the underlying [`SparseChain`].
|
|
||||||
///
|
|
||||||
/// This does not necessarily mean that it is *confirmed* in the blockchain; it might just be in
|
|
||||||
/// the unconfirmed transaction list within the [`SparseChain`].
|
|
||||||
pub fn get_tx_in_chain(&self, txid: Txid) -> Option<(&P, &Transaction)> {
|
|
||||||
let position = self.chain.tx_position(txid)?;
|
|
||||||
let full_tx = self.graph.get_tx(txid).expect("must exist");
|
|
||||||
Some((position, full_tx))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the changes required to insert a transaction into the inner [`ChainGraph`] and
|
|
||||||
/// [`SparseChain`] at the given `position`.
|
|
||||||
///
|
|
||||||
/// If inserting it into the chain `position` will result in conflicts, the returned
|
|
||||||
/// [`ChangeSet`] should evict conflicting transactions.
|
|
||||||
pub fn insert_tx_preview(
|
|
||||||
&self,
|
|
||||||
tx: Transaction,
|
|
||||||
pos: P,
|
|
||||||
) -> Result<ChangeSet<P>, InsertTxError<P>> {
|
|
||||||
let mut changeset = ChangeSet {
|
|
||||||
chain: self.chain.insert_tx_preview(tx.txid(), pos)?,
|
|
||||||
graph: self.graph.insert_tx_preview(tx),
|
|
||||||
};
|
|
||||||
self.fix_conflicts(&mut changeset)?;
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Inserts [`Transaction`] at the given chain position.
|
|
||||||
///
|
|
||||||
/// This is equivalent to calling [`Self::insert_tx_preview`] and [`Self::apply_changeset`] in
|
|
||||||
/// sequence.
|
|
||||||
pub fn insert_tx(&mut self, tx: Transaction, pos: P) -> Result<ChangeSet<P>, InsertTxError<P>> {
|
|
||||||
let changeset = self.insert_tx_preview(tx, pos)?;
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the changes required to insert a [`TxOut`] into the internal [`TxGraph`].
|
|
||||||
pub fn insert_txout_preview(&self, outpoint: OutPoint, txout: TxOut) -> ChangeSet<P> {
|
|
||||||
ChangeSet {
|
|
||||||
chain: Default::default(),
|
|
||||||
graph: self.graph.insert_txout_preview(outpoint, txout),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Inserts a [`TxOut`] into the internal [`TxGraph`].
|
|
||||||
///
|
|
||||||
/// This is equivalent to calling [`Self::insert_txout_preview`] and [`Self::apply_changeset`]
|
|
||||||
/// in sequence.
|
|
||||||
pub fn insert_txout(&mut self, outpoint: OutPoint, txout: TxOut) -> ChangeSet<P> {
|
|
||||||
let changeset = self.insert_txout_preview(outpoint, txout);
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
changeset
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the changes required to insert a `block_id` (a height and block hash) into the
|
|
||||||
/// chain.
|
|
||||||
///
|
|
||||||
/// If a checkpoint with a different hash already exists at that height, this will return an error.
|
|
||||||
pub fn insert_checkpoint_preview(
|
|
||||||
&self,
|
|
||||||
block_id: BlockId,
|
|
||||||
) -> Result<ChangeSet<P>, InsertCheckpointError> {
|
|
||||||
self.chain
|
|
||||||
.insert_checkpoint_preview(block_id)
|
|
||||||
.map(|chain_changeset| ChangeSet {
|
|
||||||
chain: chain_changeset,
|
|
||||||
..Default::default()
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Inserts checkpoint into [`Self`].
|
|
||||||
///
|
|
||||||
/// This is equivalent to calling [`Self::insert_checkpoint_preview`] and
|
|
||||||
/// [`Self::apply_changeset`] in sequence.
|
|
||||||
pub fn insert_checkpoint(
|
|
||||||
&mut self,
|
|
||||||
block_id: BlockId,
|
|
||||||
) -> Result<ChangeSet<P>, InsertCheckpointError> {
|
|
||||||
let changeset = self.insert_checkpoint_preview(block_id)?;
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Calculates the difference between self and `update` in the form of a [`ChangeSet`].
|
|
||||||
pub fn determine_changeset(
|
|
||||||
&self,
|
|
||||||
update: &ChainGraph<P>,
|
|
||||||
) -> Result<ChangeSet<P>, UpdateError<P>> {
|
|
||||||
let chain_changeset = self
|
|
||||||
.chain
|
|
||||||
.determine_changeset(&update.chain)
|
|
||||||
.map_err(UpdateError::Chain)?;
|
|
||||||
|
|
||||||
let mut changeset = ChangeSet {
|
|
||||||
chain: chain_changeset,
|
|
||||||
graph: self.graph.determine_additions(&update.graph),
|
|
||||||
};
|
|
||||||
|
|
||||||
self.fix_conflicts(&mut changeset)?;
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Given a transaction, return an iterator of `txid`s that conflict with it (spends at least
|
|
||||||
/// one of the same inputs). This iterator includes all descendants of conflicting transactions.
|
|
||||||
///
|
|
||||||
/// This method only returns conflicts that exist in the [`SparseChain`] as transactions that
|
|
||||||
/// are not included in [`SparseChain`] are already considered as evicted.
|
|
||||||
pub fn tx_conflicts_in_chain<'a>(
|
|
||||||
&'a self,
|
|
||||||
tx: &'a Transaction,
|
|
||||||
) -> impl Iterator<Item = (&'a P, Txid)> + 'a {
|
|
||||||
self.graph.walk_conflicts(tx, move |_, conflict_txid| {
|
|
||||||
self.chain
|
|
||||||
.tx_position(conflict_txid)
|
|
||||||
.map(|conflict_pos| (conflict_pos, conflict_txid))
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Fix changeset conflicts.
|
|
||||||
///
|
|
||||||
/// **WARNING:** If there are any missing full txs, conflict resolution will not be complete. In
|
|
||||||
/// debug mode, this will result in panic.
|
|
||||||
fn fix_conflicts(&self, changeset: &mut ChangeSet<P>) -> Result<(), UnresolvableConflict<P>> {
|
|
||||||
let mut chain_conflicts = vec![];
|
|
||||||
|
|
||||||
for (&txid, pos_change) in &changeset.chain.txids {
|
|
||||||
let pos = match pos_change {
|
|
||||||
Some(pos) => {
|
|
||||||
// Ignore txs that are still in the chain -- we only care about new ones
|
|
||||||
if self.chain.tx_position(txid).is_some() {
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
pos
|
|
||||||
}
|
|
||||||
// Ignore txids that are being deleted by the change (they can't conflict)
|
|
||||||
None => continue,
|
|
||||||
};
|
|
||||||
|
|
||||||
let mut full_tx = self.graph.get_tx(txid);
|
|
||||||
|
|
||||||
if full_tx.is_none() {
|
|
||||||
full_tx = changeset.graph.tx.iter().find(|tx| tx.txid() == txid)
|
|
||||||
}
|
|
||||||
|
|
||||||
debug_assert!(full_tx.is_some(), "should have full tx at this point");
|
|
||||||
|
|
||||||
let full_tx = match full_tx {
|
|
||||||
Some(full_tx) => full_tx,
|
|
||||||
None => continue,
|
|
||||||
};
|
|
||||||
|
|
||||||
for (conflict_pos, conflict_txid) in self.tx_conflicts_in_chain(full_tx) {
|
|
||||||
chain_conflicts.push((pos.clone(), txid, conflict_pos, conflict_txid))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for (update_pos, update_txid, conflicting_pos, conflicting_txid) in chain_conflicts {
|
|
||||||
// We have found a tx that conflicts with our update txid. Only allow this when the
|
|
||||||
// conflicting tx will be positioned as "unconfirmed" after the update is applied.
|
|
||||||
// If so, we will modify the changeset to evict the conflicting txid.
|
|
||||||
|
|
||||||
// determine the position of the conflicting txid after the current changeset is applied
|
|
||||||
let conflicting_new_pos = changeset
|
|
||||||
.chain
|
|
||||||
.txids
|
|
||||||
.get(&conflicting_txid)
|
|
||||||
.map(Option::as_ref)
|
|
||||||
.unwrap_or(Some(conflicting_pos));
|
|
||||||
|
|
||||||
match conflicting_new_pos {
|
|
||||||
None => {
|
|
||||||
// conflicting txid will be deleted, can ignore
|
|
||||||
}
|
|
||||||
Some(existing_new_pos) => match existing_new_pos.height() {
|
|
||||||
TxHeight::Confirmed(_) => {
|
|
||||||
// the new position of the conflicting tx is "confirmed", therefore cannot be
|
|
||||||
// evicted, return error
|
|
||||||
return Err(UnresolvableConflict {
|
|
||||||
already_confirmed_tx: (conflicting_pos.clone(), conflicting_txid),
|
|
||||||
update_tx: (update_pos, update_txid),
|
|
||||||
});
|
|
||||||
}
|
|
||||||
TxHeight::Unconfirmed => {
|
|
||||||
// the new position of the conflicting tx is "unconfirmed", therefore it can
|
|
||||||
// be evicted
|
|
||||||
changeset.chain.txids.insert(conflicting_txid, None);
|
|
||||||
}
|
|
||||||
},
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Applies `changeset` to `self`.
|
|
||||||
///
|
|
||||||
/// **Warning** this method assumes that the changeset is correctly formed. If it is not, the
|
|
||||||
/// chain graph may behave incorrectly in the future and panic unexpectedly.
|
|
||||||
pub fn apply_changeset(&mut self, changeset: ChangeSet<P>) {
|
|
||||||
self.chain.apply_changeset(changeset.chain);
|
|
||||||
self.graph.apply_additions(changeset.graph);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Applies the `update` chain graph. Note this is shorthand for calling
|
|
||||||
/// [`Self::determine_changeset()`] and [`Self::apply_changeset()`] in sequence.
|
|
||||||
pub fn apply_update(&mut self, update: ChainGraph<P>) -> Result<ChangeSet<P>, UpdateError<P>> {
|
|
||||||
let changeset = self.determine_changeset(&update)?;
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Get the full transaction output at an outpoint if it exists in the chain and the graph.
|
|
||||||
pub fn full_txout(&self, outpoint: OutPoint) -> Option<FullTxOut<P>> {
|
|
||||||
self.chain.full_txout(&self.graph, outpoint)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Iterate over the full transactions and their position in the chain ordered by their position
|
|
||||||
/// in ascending order.
|
|
||||||
pub fn transactions_in_chain(&self) -> impl DoubleEndedIterator<Item = (&P, &Transaction)> {
|
|
||||||
self.chain
|
|
||||||
.txids()
|
|
||||||
.map(move |(pos, txid)| (pos, self.graph.get_tx(*txid).expect("must exist")))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Find the transaction in the chain that spends `outpoint`.
|
|
||||||
///
|
|
||||||
/// This uses the input/output relationships in the internal `graph`. Note that the transaction
|
|
||||||
/// which includes `outpoint` does not need to be in the `graph` or the `chain` for this to
|
|
||||||
/// return `Some(_)`.
|
|
||||||
pub fn spent_by(&self, outpoint: OutPoint) -> Option<(&P, Txid)> {
|
|
||||||
self.chain.spent_by(&self.graph, outpoint)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Whether the chain graph contains any data whatsoever.
|
|
||||||
pub fn is_empty(&self) -> bool {
|
|
||||||
self.chain.is_empty() && self.graph.is_empty()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Represents changes to [`ChainGraph`].
|
|
||||||
///
|
|
||||||
/// This is essentially a combination of [`sparse_chain::ChangeSet`] and [`tx_graph::Additions`].
|
|
||||||
#[derive(Debug, Clone, PartialEq)]
|
|
||||||
#[cfg_attr(
|
|
||||||
feature = "serde",
|
|
||||||
derive(serde::Deserialize, serde::Serialize),
|
|
||||||
serde(
|
|
||||||
crate = "serde_crate",
|
|
||||||
bound(
|
|
||||||
deserialize = "P: serde::Deserialize<'de>",
|
|
||||||
serialize = "P: serde::Serialize"
|
|
||||||
)
|
|
||||||
)
|
|
||||||
)]
|
|
||||||
#[must_use]
|
|
||||||
pub struct ChangeSet<P> {
|
|
||||||
pub chain: sparse_chain::ChangeSet<P>,
|
|
||||||
pub graph: tx_graph::Additions,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> ChangeSet<P> {
|
|
||||||
/// Returns `true` if this [`ChangeSet`] records no changes.
|
|
||||||
pub fn is_empty(&self) -> bool {
|
|
||||||
self.chain.is_empty() && self.graph.is_empty()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns `true` if this [`ChangeSet`] contains transaction evictions.
|
|
||||||
pub fn contains_eviction(&self) -> bool {
|
|
||||||
self.chain
|
|
||||||
.txids
|
|
||||||
.iter()
|
|
||||||
.any(|(_, new_pos)| new_pos.is_none())
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Appends the changes in `other` into self such that applying `self` afterward has the same
|
|
||||||
/// effect as sequentially applying the original `self` and `other`.
|
|
||||||
pub fn append(&mut self, other: ChangeSet<P>)
|
|
||||||
where
|
|
||||||
P: ChainPosition,
|
|
||||||
{
|
|
||||||
self.chain.append(other.chain);
|
|
||||||
self.graph.append(other.graph);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> Default for ChangeSet<P> {
|
|
||||||
fn default() -> Self {
|
|
||||||
Self {
|
|
||||||
chain: Default::default(),
|
|
||||||
graph: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> ForEachTxOut for ChainGraph<P> {
|
|
||||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut))) {
|
|
||||||
self.graph.for_each_txout(f)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> ForEachTxOut for ChangeSet<P> {
|
|
||||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut))) {
|
|
||||||
self.graph.for_each_txout(f)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Error that may occur when calling [`ChainGraph::new`].
|
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
|
||||||
pub enum NewError<P> {
|
|
||||||
/// Two transactions within the sparse chain conflicted with each other
|
|
||||||
Conflict { a: (P, Txid), b: (P, Txid) },
|
|
||||||
/// One or more transactions in the chain were not in the graph
|
|
||||||
Missing(HashSet<Txid>),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P: core::fmt::Debug> core::fmt::Display for NewError<P> {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
match self {
|
|
||||||
NewError::Conflict { a, b } => write!(
|
|
||||||
f,
|
|
||||||
"Unable to inflate sparse chain to chain graph since transactions {:?} and {:?}",
|
|
||||||
a, b
|
|
||||||
),
|
|
||||||
NewError::Missing(missing) => write!(
|
|
||||||
f,
|
|
||||||
"missing full transactions for {}",
|
|
||||||
missing
|
|
||||||
.iter()
|
|
||||||
.map(|txid| txid.to_string())
|
|
||||||
.collect::<Vec<_>>()
|
|
||||||
.join(", ")
|
|
||||||
),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
|
||||||
impl<P: core::fmt::Debug> std::error::Error for NewError<P> {}
|
|
||||||
|
|
||||||
/// Error that may occur when inserting a transaction.
|
|
||||||
///
|
|
||||||
/// Refer to [`ChainGraph::insert_tx_preview`] and [`ChainGraph::insert_tx`].
|
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
|
||||||
pub enum InsertTxError<P> {
|
|
||||||
Chain(sparse_chain::InsertTxError<P>),
|
|
||||||
UnresolvableConflict(UnresolvableConflict<P>),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P: core::fmt::Debug> core::fmt::Display for InsertTxError<P> {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
match self {
|
|
||||||
InsertTxError::Chain(inner) => core::fmt::Display::fmt(inner, f),
|
|
||||||
InsertTxError::UnresolvableConflict(inner) => core::fmt::Display::fmt(inner, f),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> From<sparse_chain::InsertTxError<P>> for InsertTxError<P> {
|
|
||||||
fn from(inner: sparse_chain::InsertTxError<P>) -> Self {
|
|
||||||
Self::Chain(inner)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
|
||||||
impl<P: core::fmt::Debug> std::error::Error for InsertTxError<P> {}
|
|
||||||
|
|
||||||
/// A nice alias of [`sparse_chain::InsertCheckpointError`].
|
|
||||||
pub type InsertCheckpointError = sparse_chain::InsertCheckpointError;
|
|
||||||
|
|
||||||
/// Represents an update failure.
|
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
|
||||||
pub enum UpdateError<P> {
|
|
||||||
/// The update chain was inconsistent with the existing chain
|
|
||||||
Chain(sparse_chain::UpdateError<P>),
|
|
||||||
/// A transaction in the update spent the same input as an already confirmed transaction
|
|
||||||
UnresolvableConflict(UnresolvableConflict<P>),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P: core::fmt::Debug> core::fmt::Display for UpdateError<P> {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
match self {
|
|
||||||
UpdateError::Chain(inner) => core::fmt::Display::fmt(inner, f),
|
|
||||||
UpdateError::UnresolvableConflict(inner) => core::fmt::Display::fmt(inner, f),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> From<sparse_chain::UpdateError<P>> for UpdateError<P> {
|
|
||||||
fn from(inner: sparse_chain::UpdateError<P>) -> Self {
|
|
||||||
Self::Chain(inner)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
|
||||||
impl<P: core::fmt::Debug> std::error::Error for UpdateError<P> {}
|
|
||||||
|
|
||||||
/// Represents an unresolvable conflict between an update's transaction and an
|
|
||||||
/// already-confirmed transaction.
|
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
|
||||||
pub struct UnresolvableConflict<P> {
|
|
||||||
pub already_confirmed_tx: (P, Txid),
|
|
||||||
pub update_tx: (P, Txid),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P: core::fmt::Debug> core::fmt::Display for UnresolvableConflict<P> {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
let Self {
|
|
||||||
already_confirmed_tx,
|
|
||||||
update_tx,
|
|
||||||
} = self;
|
|
||||||
write!(f, "update transaction {} at height {:?} conflicts with an already confirmed transaction {} at height {:?}",
|
|
||||||
update_tx.1, update_tx.0, already_confirmed_tx.1, already_confirmed_tx.0)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> From<UnresolvableConflict<P>> for UpdateError<P> {
|
|
||||||
fn from(inner: UnresolvableConflict<P>) -> Self {
|
|
||||||
Self::UnresolvableConflict(inner)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<P> From<UnresolvableConflict<P>> for InsertTxError<P> {
|
|
||||||
fn from(inner: UnresolvableConflict<P>) -> Self {
|
|
||||||
Self::UnresolvableConflict(inner)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
|
||||||
impl<P: core::fmt::Debug> std::error::Error for UnresolvableConflict<P> {}
|
|
||||||
25
crates/chain/src/chain_oracle.rs
Normal file
25
crates/chain/src/chain_oracle.rs
Normal file
@@ -0,0 +1,25 @@
|
|||||||
|
use crate::BlockId;
|
||||||
|
|
||||||
|
/// Represents a service that tracks the blockchain.
|
||||||
|
///
|
||||||
|
/// The main method is [`is_block_in_chain`] which determines whether a given block of [`BlockId`]
|
||||||
|
/// is an ancestor of the `chain_tip`.
|
||||||
|
///
|
||||||
|
/// [`is_block_in_chain`]: Self::is_block_in_chain
|
||||||
|
pub trait ChainOracle {
|
||||||
|
/// Error type.
|
||||||
|
type Error: core::fmt::Debug;
|
||||||
|
|
||||||
|
/// Determines whether `block` of [`BlockId`] exists as an ancestor of `chain_tip`.
|
||||||
|
///
|
||||||
|
/// If `None` is returned, it means the implementation cannot determine whether `block` exists
|
||||||
|
/// under `chain_tip`.
|
||||||
|
fn is_block_in_chain(
|
||||||
|
&self,
|
||||||
|
block: BlockId,
|
||||||
|
chain_tip: BlockId,
|
||||||
|
) -> Result<Option<bool>, Self::Error>;
|
||||||
|
|
||||||
|
/// Get the best chain's chain tip.
|
||||||
|
fn get_chain_tip(&self) -> Result<BlockId, Self::Error>;
|
||||||
|
}
|
||||||
@@ -3,12 +3,14 @@ use crate::miniscript::{Descriptor, DescriptorPublicKey};
|
|||||||
/// A trait to extend the functionality of a miniscript descriptor.
|
/// A trait to extend the functionality of a miniscript descriptor.
|
||||||
pub trait DescriptorExt {
|
pub trait DescriptorExt {
|
||||||
/// Returns the minimum value (in satoshis) at which an output is broadcastable.
|
/// Returns the minimum value (in satoshis) at which an output is broadcastable.
|
||||||
|
/// Panics if the descriptor wildcard is hardened.
|
||||||
fn dust_value(&self) -> u64;
|
fn dust_value(&self) -> u64;
|
||||||
}
|
}
|
||||||
|
|
||||||
impl DescriptorExt for Descriptor<DescriptorPublicKey> {
|
impl DescriptorExt for Descriptor<DescriptorPublicKey> {
|
||||||
fn dust_value(&self) -> u64 {
|
fn dust_value(&self) -> u64 {
|
||||||
self.at_derivation_index(0)
|
self.at_derivation_index(0)
|
||||||
|
.expect("descriptor can't have hardened derivation")
|
||||||
.script_pubkey()
|
.script_pubkey()
|
||||||
.dust_value()
|
.dust_value()
|
||||||
.to_sat()
|
.to_sat()
|
||||||
|
|||||||
354
crates/chain/src/indexed_tx_graph.rs
Normal file
354
crates/chain/src/indexed_tx_graph.rs
Normal file
@@ -0,0 +1,354 @@
|
|||||||
|
//! Contains the [`IndexedTxGraph`] and associated types. Refer to the
|
||||||
|
//! [`IndexedTxGraph`] documentation for more.
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
use bitcoin::{Block, OutPoint, Transaction, TxOut, Txid};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
keychain,
|
||||||
|
tx_graph::{self, TxGraph},
|
||||||
|
Anchor, AnchorFromBlockPosition, Append, BlockId,
|
||||||
|
};
|
||||||
|
|
||||||
|
/// The [`IndexedTxGraph`] combines a [`TxGraph`] and an [`Indexer`] implementation.
|
||||||
|
///
|
||||||
|
/// It ensures that [`TxGraph`] and [`Indexer`] are updated atomically.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct IndexedTxGraph<A, I> {
|
||||||
|
/// Transaction index.
|
||||||
|
pub index: I,
|
||||||
|
graph: TxGraph<A>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, I: Default> Default for IndexedTxGraph<A, I> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self {
|
||||||
|
graph: Default::default(),
|
||||||
|
index: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, I> IndexedTxGraph<A, I> {
|
||||||
|
/// Construct a new [`IndexedTxGraph`] with a given `index`.
|
||||||
|
pub fn new(index: I) -> Self {
|
||||||
|
Self {
|
||||||
|
index,
|
||||||
|
graph: TxGraph::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference of the internal transaction graph.
|
||||||
|
pub fn graph(&self) -> &TxGraph<A> {
|
||||||
|
&self.graph
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I> {
|
||||||
|
/// Applies the [`ChangeSet`] to the [`IndexedTxGraph`].
|
||||||
|
pub fn apply_changeset(&mut self, changeset: ChangeSet<A, I::ChangeSet>) {
|
||||||
|
self.index.apply_changeset(changeset.indexer);
|
||||||
|
|
||||||
|
for tx in &changeset.graph.txs {
|
||||||
|
self.index.index_tx(tx);
|
||||||
|
}
|
||||||
|
for (&outpoint, txout) in &changeset.graph.txouts {
|
||||||
|
self.index.index_txout(outpoint, txout);
|
||||||
|
}
|
||||||
|
|
||||||
|
self.graph.apply_changeset(changeset.graph);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Determines the [`ChangeSet`] between `self` and an empty [`IndexedTxGraph`].
|
||||||
|
pub fn initial_changeset(&self) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.initial_changeset();
|
||||||
|
let indexer = self.index.initial_changeset();
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||||
|
where
|
||||||
|
I::ChangeSet: Default + Append,
|
||||||
|
{
|
||||||
|
fn index_tx_graph_changeset(
|
||||||
|
&mut self,
|
||||||
|
tx_graph_changeset: &tx_graph::ChangeSet<A>,
|
||||||
|
) -> I::ChangeSet {
|
||||||
|
let mut changeset = I::ChangeSet::default();
|
||||||
|
for added_tx in &tx_graph_changeset.txs {
|
||||||
|
changeset.append(self.index.index_tx(added_tx));
|
||||||
|
}
|
||||||
|
for (&added_outpoint, added_txout) in &tx_graph_changeset.txouts {
|
||||||
|
changeset.append(self.index.index_txout(added_outpoint, added_txout));
|
||||||
|
}
|
||||||
|
changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Apply an `update` directly.
|
||||||
|
///
|
||||||
|
/// `update` is a [`TxGraph<A>`] and the resultant changes is returned as [`ChangeSet`].
|
||||||
|
pub fn apply_update(&mut self, update: TxGraph<A>) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.apply_update(update);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert a floating `txout` of given `outpoint`.
|
||||||
|
pub fn insert_txout(&mut self, outpoint: OutPoint, txout: TxOut) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.insert_txout(outpoint, txout);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert and index a transaction into the graph.
|
||||||
|
pub fn insert_tx(&mut self, tx: Transaction) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.insert_tx(tx);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert an `anchor` for a given transaction.
|
||||||
|
pub fn insert_anchor(&mut self, txid: Txid, anchor: A) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
self.graph.insert_anchor(txid, anchor).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert a unix timestamp of when a transaction is seen in the mempool.
|
||||||
|
///
|
||||||
|
/// This is used for transaction conflict resolution in [`TxGraph`] where the transaction with
|
||||||
|
/// the later last-seen is prioritized.
|
||||||
|
pub fn insert_seen_at(&mut self, txid: Txid, seen_at: u64) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
self.graph.insert_seen_at(txid, seen_at).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert transactions, filtering out those that are irrelevant.
|
||||||
|
///
|
||||||
|
/// Relevancy is determined by the [`Indexer::is_tx_relevant`] implementation of `I`. Irrelevant
|
||||||
|
/// transactions in `txs` will be ignored. `txs` do not need to be in topological order.
|
||||||
|
pub fn batch_insert_relevant<'t>(
|
||||||
|
&mut self,
|
||||||
|
txs: impl IntoIterator<Item = (&'t Transaction, impl IntoIterator<Item = A>)>,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||||
|
// This is achieved by:
|
||||||
|
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||||
|
// not store anything about them.
|
||||||
|
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||||
|
// returns true or not. (in a second loop).
|
||||||
|
let txs = txs.into_iter().collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let mut indexer = I::ChangeSet::default();
|
||||||
|
for (tx, _) in &txs {
|
||||||
|
indexer.append(self.index.index_tx(tx));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut graph = tx_graph::ChangeSet::default();
|
||||||
|
for (tx, anchors) in txs {
|
||||||
|
if self.index.is_tx_relevant(tx) {
|
||||||
|
let txid = tx.txid();
|
||||||
|
graph.append(self.graph.insert_tx(tx.clone()));
|
||||||
|
for anchor in anchors {
|
||||||
|
graph.append(self.graph.insert_anchor(txid, anchor));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert unconfirmed transactions, filtering out those that are irrelevant.
|
||||||
|
///
|
||||||
|
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||||
|
/// Irrelevant transactions in `txs` will be ignored.
|
||||||
|
///
|
||||||
|
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||||
|
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||||
|
/// conflict-resolution in [`TxGraph`] (refer to [`TxGraph::insert_seen_at`] for details).
|
||||||
|
pub fn batch_insert_relevant_unconfirmed<'t>(
|
||||||
|
&mut self,
|
||||||
|
unconfirmed_txs: impl IntoIterator<Item = (&'t Transaction, u64)>,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
// The algorithm below allows for non-topologically ordered transactions by using two loops.
|
||||||
|
// This is achieved by:
|
||||||
|
// 1. insert all txs into the index. If they are irrelevant then that's fine it will just
|
||||||
|
// not store anything about them.
|
||||||
|
// 2. decide whether to insert them into the graph depending on whether `is_tx_relevant`
|
||||||
|
// returns true or not. (in a second loop).
|
||||||
|
let txs = unconfirmed_txs.into_iter().collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let mut indexer = I::ChangeSet::default();
|
||||||
|
for (tx, _) in &txs {
|
||||||
|
indexer.append(self.index.index_tx(tx));
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph = self.graph.batch_insert_unconfirmed(
|
||||||
|
txs.into_iter()
|
||||||
|
.filter(|(tx, _)| self.index.is_tx_relevant(tx))
|
||||||
|
.map(|(tx, seen_at)| (tx.clone(), seen_at)),
|
||||||
|
);
|
||||||
|
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert unconfirmed transactions.
|
||||||
|
///
|
||||||
|
/// Items of `txs` are tuples containing the transaction and a *last seen* timestamp. The
|
||||||
|
/// *last seen* communicates when the transaction is last seen in the mempool which is used for
|
||||||
|
/// conflict-resolution in [`TxGraph`] (refer to [`TxGraph::insert_seen_at`] for details).
|
||||||
|
///
|
||||||
|
/// To filter out irrelevant transactions, use [`batch_insert_relevant_unconfirmed`] instead.
|
||||||
|
///
|
||||||
|
/// [`batch_insert_relevant_unconfirmed`]: IndexedTxGraph::batch_insert_relevant_unconfirmed
|
||||||
|
pub fn batch_insert_unconfirmed(
|
||||||
|
&mut self,
|
||||||
|
txs: impl IntoIterator<Item = (Transaction, u64)>,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let graph = self.graph.batch_insert_unconfirmed(txs);
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Methods are available if the anchor (`A`) implements [`AnchorFromBlockPosition`].
|
||||||
|
impl<A: Anchor, I: Indexer> IndexedTxGraph<A, I>
|
||||||
|
where
|
||||||
|
I::ChangeSet: Default + Append,
|
||||||
|
A: AnchorFromBlockPosition,
|
||||||
|
{
|
||||||
|
/// Batch insert all transactions of the given `block` of `height`, filtering out those that are
|
||||||
|
/// irrelevant.
|
||||||
|
///
|
||||||
|
/// Each inserted transaction's anchor will be constructed from
|
||||||
|
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||||
|
///
|
||||||
|
/// Relevancy is determined by the internal [`Indexer::is_tx_relevant`] implementation of `I`.
|
||||||
|
/// Irrelevant transactions in `txs` will be ignored.
|
||||||
|
pub fn apply_block_relevant(
|
||||||
|
&mut self,
|
||||||
|
block: &Block,
|
||||||
|
height: u32,
|
||||||
|
) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let block_id = BlockId {
|
||||||
|
hash: block.block_hash(),
|
||||||
|
height,
|
||||||
|
};
|
||||||
|
let mut changeset = ChangeSet::<A, I::ChangeSet>::default();
|
||||||
|
for (tx_pos, tx) in block.txdata.iter().enumerate() {
|
||||||
|
changeset.indexer.append(self.index.index_tx(tx));
|
||||||
|
if self.index.is_tx_relevant(tx) {
|
||||||
|
let txid = tx.txid();
|
||||||
|
let anchor = A::from_block_position(block, block_id, tx_pos);
|
||||||
|
changeset.graph.append(self.graph.insert_tx(tx.clone()));
|
||||||
|
changeset
|
||||||
|
.graph
|
||||||
|
.append(self.graph.insert_anchor(txid, anchor));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Batch insert all transactions of the given `block` of `height`.
|
||||||
|
///
|
||||||
|
/// Each inserted transaction's anchor will be constructed from
|
||||||
|
/// [`AnchorFromBlockPosition::from_block_position`].
|
||||||
|
///
|
||||||
|
/// To only insert relevant transactions, use [`apply_block_relevant`] instead.
|
||||||
|
///
|
||||||
|
/// [`apply_block_relevant`]: IndexedTxGraph::apply_block_relevant
|
||||||
|
pub fn apply_block(&mut self, block: Block, height: u32) -> ChangeSet<A, I::ChangeSet> {
|
||||||
|
let block_id = BlockId {
|
||||||
|
hash: block.block_hash(),
|
||||||
|
height,
|
||||||
|
};
|
||||||
|
let mut graph = tx_graph::ChangeSet::default();
|
||||||
|
for (tx_pos, tx) in block.txdata.iter().enumerate() {
|
||||||
|
let anchor = A::from_block_position(&block, block_id, tx_pos);
|
||||||
|
graph.append(self.graph.insert_anchor(tx.txid(), anchor));
|
||||||
|
graph.append(self.graph.insert_tx(tx.clone()));
|
||||||
|
}
|
||||||
|
let indexer = self.index_tx_graph_changeset(&graph);
|
||||||
|
ChangeSet { graph, indexer }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Represents changes to an [`IndexedTxGraph`].
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
#[cfg_attr(
|
||||||
|
feature = "serde",
|
||||||
|
derive(serde::Deserialize, serde::Serialize),
|
||||||
|
serde(
|
||||||
|
crate = "serde_crate",
|
||||||
|
bound(
|
||||||
|
deserialize = "A: Ord + serde::Deserialize<'de>, IA: serde::Deserialize<'de>",
|
||||||
|
serialize = "A: Ord + serde::Serialize, IA: serde::Serialize"
|
||||||
|
)
|
||||||
|
)
|
||||||
|
)]
|
||||||
|
#[must_use]
|
||||||
|
pub struct ChangeSet<A, IA> {
|
||||||
|
/// [`TxGraph`] changeset.
|
||||||
|
pub graph: tx_graph::ChangeSet<A>,
|
||||||
|
/// [`Indexer`] changeset.
|
||||||
|
pub indexer: IA,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, IA: Default> Default for ChangeSet<A, IA> {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self {
|
||||||
|
graph: Default::default(),
|
||||||
|
indexer: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: Anchor, IA: Append> Append for ChangeSet<A, IA> {
|
||||||
|
fn append(&mut self, other: Self) {
|
||||||
|
self.graph.append(other.graph);
|
||||||
|
self.indexer.append(other.indexer);
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
self.graph.is_empty() && self.indexer.is_empty()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, IA: Default> From<tx_graph::ChangeSet<A>> for ChangeSet<A, IA> {
|
||||||
|
fn from(graph: tx_graph::ChangeSet<A>) -> Self {
|
||||||
|
Self {
|
||||||
|
graph,
|
||||||
|
..Default::default()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A, K> From<keychain::ChangeSet<K>> for ChangeSet<A, keychain::ChangeSet<K>> {
|
||||||
|
fn from(indexer: keychain::ChangeSet<K>) -> Self {
|
||||||
|
Self {
|
||||||
|
graph: Default::default(),
|
||||||
|
indexer,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Utilities for indexing transaction data.
|
||||||
|
///
|
||||||
|
/// Types which implement this trait can be used to construct an [`IndexedTxGraph`].
|
||||||
|
/// This trait's methods should rarely be called directly.
|
||||||
|
pub trait Indexer {
|
||||||
|
/// The resultant "changeset" when new transaction data is indexed.
|
||||||
|
type ChangeSet;
|
||||||
|
|
||||||
|
/// Scan and index the given `outpoint` and `txout`.
|
||||||
|
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet;
|
||||||
|
|
||||||
|
/// Scans a transaction for relevant outpoints, which are stored and indexed internally.
|
||||||
|
fn index_tx(&mut self, tx: &Transaction) -> Self::ChangeSet;
|
||||||
|
|
||||||
|
/// Apply changeset to itself.
|
||||||
|
fn apply_changeset(&mut self, changeset: Self::ChangeSet);
|
||||||
|
|
||||||
|
/// Determines the [`ChangeSet`] between `self` and an empty [`Indexer`].
|
||||||
|
fn initial_changeset(&self) -> Self::ChangeSet;
|
||||||
|
|
||||||
|
/// Determines whether the transaction should be included in the index.
|
||||||
|
fn is_tx_relevant(&self, tx: &Transaction) -> bool;
|
||||||
|
}
|
||||||
@@ -8,40 +8,23 @@
|
|||||||
//! has a `txout` containing an indexed script pubkey). Internally, this uses [`SpkTxOutIndex`], but
|
//! has a `txout` containing an indexed script pubkey). Internally, this uses [`SpkTxOutIndex`], but
|
||||||
//! also maintains "revealed" and "lookahead" index counts per keychain.
|
//! also maintains "revealed" and "lookahead" index counts per keychain.
|
||||||
//!
|
//!
|
||||||
//! [`KeychainTracker`] combines [`ChainGraph`] and [`KeychainTxOutIndex`] and enforces atomic
|
|
||||||
//! changes between both these structures. [`KeychainScan`] is a structure used to update to
|
|
||||||
//! [`KeychainTracker`] and changes made on a [`KeychainTracker`] are reported by
|
|
||||||
//! [`KeychainChangeSet`]s.
|
|
||||||
//!
|
|
||||||
//! [`SpkTxOutIndex`]: crate::SpkTxOutIndex
|
//! [`SpkTxOutIndex`]: crate::SpkTxOutIndex
|
||||||
use crate::{
|
|
||||||
chain_graph::{self, ChainGraph},
|
|
||||||
collections::BTreeMap,
|
|
||||||
sparse_chain::ChainPosition,
|
|
||||||
tx_graph::TxGraph,
|
|
||||||
ForEachTxOut,
|
|
||||||
};
|
|
||||||
|
|
||||||
#[cfg(feature = "miniscript")]
|
use crate::{collections::BTreeMap, Append};
|
||||||
pub mod persist;
|
|
||||||
#[cfg(feature = "miniscript")]
|
|
||||||
pub use persist::*;
|
|
||||||
#[cfg(feature = "miniscript")]
|
|
||||||
mod tracker;
|
|
||||||
#[cfg(feature = "miniscript")]
|
|
||||||
pub use tracker::*;
|
|
||||||
#[cfg(feature = "miniscript")]
|
#[cfg(feature = "miniscript")]
|
||||||
mod txout_index;
|
mod txout_index;
|
||||||
#[cfg(feature = "miniscript")]
|
#[cfg(feature = "miniscript")]
|
||||||
pub use txout_index::*;
|
pub use txout_index::*;
|
||||||
|
|
||||||
/// Represents updates to the derivation index of a [`KeychainTxOutIndex`].
|
/// Represents updates to the derivation index of a [`KeychainTxOutIndex`].
|
||||||
|
/// It maps each keychain `K` to its last revealed index.
|
||||||
///
|
///
|
||||||
/// It can be applied to [`KeychainTxOutIndex`] with [`apply_additions`]. [`DerivationAdditions] are
|
/// It can be applied to [`KeychainTxOutIndex`] with [`apply_changeset`]. [`ChangeSet`]s are
|
||||||
/// monotone in that they will never decrease the revealed derivation index.
|
/// monotone in that they will never decrease the revealed derivation index.
|
||||||
///
|
///
|
||||||
/// [`KeychainTxOutIndex`]: crate::keychain::KeychainTxOutIndex
|
/// [`KeychainTxOutIndex`]: crate::keychain::KeychainTxOutIndex
|
||||||
/// [`apply_additions`]: crate::keychain::KeychainTxOutIndex::apply_additions
|
/// [`apply_changeset`]: crate::keychain::KeychainTxOutIndex::apply_changeset
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
#[cfg_attr(
|
#[cfg_attr(
|
||||||
feature = "serde",
|
feature = "serde",
|
||||||
@@ -55,158 +38,49 @@ pub use txout_index::*;
|
|||||||
)
|
)
|
||||||
)]
|
)]
|
||||||
#[must_use]
|
#[must_use]
|
||||||
pub struct DerivationAdditions<K>(pub BTreeMap<K, u32>);
|
pub struct ChangeSet<K>(pub BTreeMap<K, u32>);
|
||||||
|
|
||||||
impl<K> DerivationAdditions<K> {
|
|
||||||
/// Returns whether the additions are empty.
|
|
||||||
pub fn is_empty(&self) -> bool {
|
|
||||||
self.0.is_empty()
|
|
||||||
}
|
|
||||||
|
|
||||||
|
impl<K> ChangeSet<K> {
|
||||||
/// Get the inner map of the keychain to its new derivation index.
|
/// Get the inner map of the keychain to its new derivation index.
|
||||||
pub fn as_inner(&self) -> &BTreeMap<K, u32> {
|
pub fn as_inner(&self) -> &BTreeMap<K, u32> {
|
||||||
&self.0
|
&self.0
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<K: Ord> DerivationAdditions<K> {
|
impl<K: Ord> Append for ChangeSet<K> {
|
||||||
/// Append another [`DerivationAdditions`] into self.
|
/// Append another [`ChangeSet`] into self.
|
||||||
///
|
///
|
||||||
/// If the keychain already exists, increase the index when the other's index > self's index.
|
/// If the keychain already exists, increase the index when the other's index > self's index.
|
||||||
/// If the keychain did not exist, append the new keychain.
|
/// If the keychain did not exist, append the new keychain.
|
||||||
pub fn append(&mut self, mut other: Self) {
|
fn append(&mut self, mut other: Self) {
|
||||||
self.0.iter_mut().for_each(|(key, index)| {
|
self.0.iter_mut().for_each(|(key, index)| {
|
||||||
if let Some(other_index) = other.0.remove(key) {
|
if let Some(other_index) = other.0.remove(key) {
|
||||||
*index = other_index.max(*index);
|
*index = other_index.max(*index);
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
|
// We use `extend` instead of `BTreeMap::append` due to performance issues with `append`.
|
||||||
|
// Refer to https://github.com/rust-lang/rust/issues/34666#issuecomment-675658420
|
||||||
|
self.0.extend(other.0);
|
||||||
|
}
|
||||||
|
|
||||||
self.0.append(&mut other.0);
|
/// Returns whether the changeset are empty.
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
self.0.is_empty()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<K> Default for DerivationAdditions<K> {
|
impl<K> Default for ChangeSet<K> {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
Self(Default::default())
|
Self(Default::default())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<K> AsRef<BTreeMap<K, u32>> for DerivationAdditions<K> {
|
impl<K> AsRef<BTreeMap<K, u32>> for ChangeSet<K> {
|
||||||
fn as_ref(&self) -> &BTreeMap<K, u32> {
|
fn as_ref(&self) -> &BTreeMap<K, u32> {
|
||||||
&self.0
|
&self.0
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[derive(Clone, Debug, PartialEq)]
|
|
||||||
/// An update that includes the last active indexes of each keychain.
|
|
||||||
pub struct KeychainScan<K, P> {
|
|
||||||
/// The update data in the form of a chain that could be applied
|
|
||||||
pub update: ChainGraph<P>,
|
|
||||||
/// The last active indexes of each keychain
|
|
||||||
pub last_active_indices: BTreeMap<K, u32>,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> Default for KeychainScan<K, P> {
|
|
||||||
fn default() -> Self {
|
|
||||||
Self {
|
|
||||||
update: Default::default(),
|
|
||||||
last_active_indices: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> From<ChainGraph<P>> for KeychainScan<K, P> {
|
|
||||||
fn from(update: ChainGraph<P>) -> Self {
|
|
||||||
KeychainScan {
|
|
||||||
update,
|
|
||||||
last_active_indices: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Represents changes to a [`KeychainTracker`].
|
|
||||||
///
|
|
||||||
/// This is essentially a combination of [`DerivationAdditions`] and [`chain_graph::ChangeSet`].
|
|
||||||
#[derive(Clone, Debug)]
|
|
||||||
#[cfg_attr(
|
|
||||||
feature = "serde",
|
|
||||||
derive(serde::Deserialize, serde::Serialize),
|
|
||||||
serde(
|
|
||||||
crate = "serde_crate",
|
|
||||||
bound(
|
|
||||||
deserialize = "K: Ord + serde::Deserialize<'de>, P: serde::Deserialize<'de>",
|
|
||||||
serialize = "K: Ord + serde::Serialize, P: serde::Serialize"
|
|
||||||
)
|
|
||||||
)
|
|
||||||
)]
|
|
||||||
#[must_use]
|
|
||||||
pub struct KeychainChangeSet<K, P> {
|
|
||||||
/// The changes in local keychain derivation indices
|
|
||||||
pub derivation_indices: DerivationAdditions<K>,
|
|
||||||
/// The changes that have occurred in the blockchain
|
|
||||||
pub chain_graph: chain_graph::ChangeSet<P>,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> Default for KeychainChangeSet<K, P> {
|
|
||||||
fn default() -> Self {
|
|
||||||
Self {
|
|
||||||
chain_graph: Default::default(),
|
|
||||||
derivation_indices: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> KeychainChangeSet<K, P> {
|
|
||||||
/// Returns whether the [`KeychainChangeSet`] is empty (no changes recorded).
|
|
||||||
pub fn is_empty(&self) -> bool {
|
|
||||||
self.chain_graph.is_empty() && self.derivation_indices.is_empty()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Appends the changes in `other` into `self` such that applying `self` afterward has the same
|
|
||||||
/// effect as sequentially applying the original `self` and `other`.
|
|
||||||
///
|
|
||||||
/// Note the derivation indices cannot be decreased, so `other` will only change the derivation
|
|
||||||
/// index for a keychain, if it's value is higher than the one in `self`.
|
|
||||||
pub fn append(&mut self, other: KeychainChangeSet<K, P>)
|
|
||||||
where
|
|
||||||
K: Ord,
|
|
||||||
P: ChainPosition,
|
|
||||||
{
|
|
||||||
self.derivation_indices.append(other.derivation_indices);
|
|
||||||
self.chain_graph.append(other.chain_graph);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> From<chain_graph::ChangeSet<P>> for KeychainChangeSet<K, P> {
|
|
||||||
fn from(changeset: chain_graph::ChangeSet<P>) -> Self {
|
|
||||||
Self {
|
|
||||||
chain_graph: changeset,
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> From<DerivationAdditions<K>> for KeychainChangeSet<K, P> {
|
|
||||||
fn from(additions: DerivationAdditions<K>) -> Self {
|
|
||||||
Self {
|
|
||||||
derivation_indices: additions,
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> AsRef<TxGraph> for KeychainScan<K, P> {
|
|
||||||
fn as_ref(&self) -> &TxGraph {
|
|
||||||
self.update.graph()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> ForEachTxOut for KeychainChangeSet<K, P> {
|
|
||||||
fn for_each_txout(&self, f: impl FnMut((bitcoin::OutPoint, &bitcoin::TxOut))) {
|
|
||||||
self.chain_graph.for_each_txout(f)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Balance, differentiated into various categories.
|
/// Balance, differentiated into various categories.
|
||||||
#[derive(Debug, PartialEq, Eq, Clone, Default)]
|
#[derive(Debug, PartialEq, Eq, Clone, Default)]
|
||||||
#[cfg_attr(
|
#[cfg_attr(
|
||||||
@@ -265,9 +139,8 @@ impl core::ops::Add for Balance {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use crate::TxHeight;
|
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn append_keychain_derivation_indices() {
|
fn append_keychain_derivation_indices() {
|
||||||
#[derive(Ord, PartialOrd, Eq, PartialEq, Clone, Debug)]
|
#[derive(Ord, PartialOrd, Eq, PartialEq, Clone, Debug)]
|
||||||
@@ -285,25 +158,18 @@ mod test {
|
|||||||
rhs_di.insert(Keychain::Two, 5);
|
rhs_di.insert(Keychain::Two, 5);
|
||||||
lhs_di.insert(Keychain::Three, 3);
|
lhs_di.insert(Keychain::Three, 3);
|
||||||
rhs_di.insert(Keychain::Four, 4);
|
rhs_di.insert(Keychain::Four, 4);
|
||||||
let mut lhs = KeychainChangeSet {
|
|
||||||
derivation_indices: DerivationAdditions(lhs_di),
|
|
||||||
chain_graph: chain_graph::ChangeSet::<TxHeight>::default(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let rhs = KeychainChangeSet {
|
|
||||||
derivation_indices: DerivationAdditions(rhs_di),
|
|
||||||
chain_graph: chain_graph::ChangeSet::<TxHeight>::default(),
|
|
||||||
};
|
|
||||||
|
|
||||||
|
let mut lhs = ChangeSet(lhs_di);
|
||||||
|
let rhs = ChangeSet(rhs_di);
|
||||||
lhs.append(rhs);
|
lhs.append(rhs);
|
||||||
|
|
||||||
// Exiting index doesn't update if the new index in `other` is lower than `self`.
|
// Exiting index doesn't update if the new index in `other` is lower than `self`.
|
||||||
assert_eq!(lhs.derivation_indices.0.get(&Keychain::One), Some(&7));
|
assert_eq!(lhs.0.get(&Keychain::One), Some(&7));
|
||||||
// Existing index updates if the new index in `other` is higher than `self`.
|
// Existing index updates if the new index in `other` is higher than `self`.
|
||||||
assert_eq!(lhs.derivation_indices.0.get(&Keychain::Two), Some(&5));
|
assert_eq!(lhs.0.get(&Keychain::Two), Some(&5));
|
||||||
// Existing index is unchanged if keychain doesn't exist in `other`.
|
// Existing index is unchanged if keychain doesn't exist in `other`.
|
||||||
assert_eq!(lhs.derivation_indices.0.get(&Keychain::Three), Some(&3));
|
assert_eq!(lhs.0.get(&Keychain::Three), Some(&3));
|
||||||
// New keychain gets added if the keychain is in `other` but not in `self`.
|
// New keychain gets added if the keychain is in `other` but not in `self`.
|
||||||
assert_eq!(lhs.derivation_indices.0.get(&Keychain::Four), Some(&4));
|
assert_eq!(lhs.0.get(&Keychain::Four), Some(&4));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,108 +0,0 @@
|
|||||||
//! Persistence for changes made to a [`KeychainTracker`].
|
|
||||||
//!
|
|
||||||
//! BDK's [`KeychainTracker`] needs somewhere to persist changes it makes during operation.
|
|
||||||
//! Operations like giving out a new address are crucial to persist so that next time the
|
|
||||||
//! application is loaded, it can find transactions related to that address.
|
|
||||||
//!
|
|
||||||
//! Note that the [`KeychainTracker`] does not read this persisted data during operation since it
|
|
||||||
//! always has a copy in memory.
|
|
||||||
//!
|
|
||||||
//! [`KeychainTracker`]: crate::keychain::KeychainTracker
|
|
||||||
|
|
||||||
use crate::{keychain, sparse_chain::ChainPosition};
|
|
||||||
|
|
||||||
/// `Persist` wraps a [`PersistBackend`] to create a convenient staging area for changes before they
|
|
||||||
/// are persisted. Not all changes made to the [`KeychainTracker`] need to be written to disk right
|
|
||||||
/// away so you can use [`Persist::stage`] to *stage* it first and then [`Persist::commit`] to
|
|
||||||
/// finally, write it to disk.
|
|
||||||
///
|
|
||||||
/// [`KeychainTracker`]: keychain::KeychainTracker
|
|
||||||
#[derive(Debug)]
|
|
||||||
pub struct Persist<K, P, B> {
|
|
||||||
backend: B,
|
|
||||||
stage: keychain::KeychainChangeSet<K, P>,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P, B> Persist<K, P, B> {
|
|
||||||
/// Create a new `Persist` from a [`PersistBackend`].
|
|
||||||
pub fn new(backend: B) -> Self {
|
|
||||||
Self {
|
|
||||||
backend,
|
|
||||||
stage: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Stage a `changeset` to later persistence with [`commit`].
|
|
||||||
///
|
|
||||||
/// [`commit`]: Self::commit
|
|
||||||
pub fn stage(&mut self, changeset: keychain::KeychainChangeSet<K, P>)
|
|
||||||
where
|
|
||||||
K: Ord,
|
|
||||||
P: ChainPosition,
|
|
||||||
{
|
|
||||||
self.stage.append(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Get the changes that haven't been committed yet
|
|
||||||
pub fn staged(&self) -> &keychain::KeychainChangeSet<K, P> {
|
|
||||||
&self.stage
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Commit the staged changes to the underlying persistence backend.
|
|
||||||
///
|
|
||||||
/// Returns a backend-defined error if this fails.
|
|
||||||
pub fn commit(&mut self) -> Result<(), B::WriteError>
|
|
||||||
where
|
|
||||||
B: PersistBackend<K, P>,
|
|
||||||
{
|
|
||||||
self.backend.append_changeset(&self.stage)?;
|
|
||||||
self.stage = Default::default();
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// A persistence backend for [`Persist`].
|
|
||||||
pub trait PersistBackend<K, P> {
|
|
||||||
/// The error the backend returns when it fails to write.
|
|
||||||
type WriteError: core::fmt::Debug;
|
|
||||||
|
|
||||||
/// The error the backend returns when it fails to load.
|
|
||||||
type LoadError: core::fmt::Debug;
|
|
||||||
|
|
||||||
/// Appends a new changeset to the persistent backend.
|
|
||||||
///
|
|
||||||
/// It is up to the backend what it does with this. It could store every changeset in a list or
|
|
||||||
/// it inserts the actual changes into a more structured database. All it needs to guarantee is
|
|
||||||
/// that [`load_into_keychain_tracker`] restores a keychain tracker to what it should be if all
|
|
||||||
/// changesets had been applied sequentially.
|
|
||||||
///
|
|
||||||
/// [`load_into_keychain_tracker`]: Self::load_into_keychain_tracker
|
|
||||||
fn append_changeset(
|
|
||||||
&mut self,
|
|
||||||
changeset: &keychain::KeychainChangeSet<K, P>,
|
|
||||||
) -> Result<(), Self::WriteError>;
|
|
||||||
|
|
||||||
/// Applies all the changesets the backend has received to `tracker`.
|
|
||||||
fn load_into_keychain_tracker(
|
|
||||||
&mut self,
|
|
||||||
tracker: &mut keychain::KeychainTracker<K, P>,
|
|
||||||
) -> Result<(), Self::LoadError>;
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> PersistBackend<K, P> for () {
|
|
||||||
type WriteError = ();
|
|
||||||
type LoadError = ();
|
|
||||||
|
|
||||||
fn append_changeset(
|
|
||||||
&mut self,
|
|
||||||
_changeset: &keychain::KeychainChangeSet<K, P>,
|
|
||||||
) -> Result<(), Self::WriteError> {
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
fn load_into_keychain_tracker(
|
|
||||||
&mut self,
|
|
||||||
_tracker: &mut keychain::KeychainTracker<K, P>,
|
|
||||||
) -> Result<(), Self::LoadError> {
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,308 +0,0 @@
|
|||||||
use bitcoin::Transaction;
|
|
||||||
use miniscript::{Descriptor, DescriptorPublicKey};
|
|
||||||
|
|
||||||
use crate::{
|
|
||||||
chain_graph::{self, ChainGraph},
|
|
||||||
collections::*,
|
|
||||||
keychain::{KeychainChangeSet, KeychainScan, KeychainTxOutIndex},
|
|
||||||
sparse_chain::{self, SparseChain},
|
|
||||||
tx_graph::TxGraph,
|
|
||||||
BlockId, FullTxOut, TxHeight,
|
|
||||||
};
|
|
||||||
|
|
||||||
use super::{Balance, DerivationAdditions};
|
|
||||||
|
|
||||||
/// A convenient combination of a [`KeychainTxOutIndex`] and a [`ChainGraph`].
|
|
||||||
///
|
|
||||||
/// The [`KeychainTracker`] atomically updates its [`KeychainTxOutIndex`] whenever new chain data is
|
|
||||||
/// incorporated into its internal [`ChainGraph`].
|
|
||||||
#[derive(Clone, Debug)]
|
|
||||||
pub struct KeychainTracker<K, P> {
|
|
||||||
/// Index between script pubkeys to transaction outputs
|
|
||||||
pub txout_index: KeychainTxOutIndex<K>,
|
|
||||||
chain_graph: ChainGraph<P>,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> KeychainTracker<K, P>
|
|
||||||
where
|
|
||||||
P: sparse_chain::ChainPosition,
|
|
||||||
K: Ord + Clone + core::fmt::Debug,
|
|
||||||
{
|
|
||||||
/// Add a keychain to the tracker's `txout_index` with a descriptor to derive addresses.
|
|
||||||
/// This is just shorthand for calling [`KeychainTxOutIndex::add_keychain`] on the internal
|
|
||||||
/// `txout_index`.
|
|
||||||
///
|
|
||||||
/// Adding a keychain means you will be able to derive new script pubkeys under that keychain
|
|
||||||
/// and the tracker will discover transaction outputs with those script pubkeys.
|
|
||||||
pub fn add_keychain(&mut self, keychain: K, descriptor: Descriptor<DescriptorPublicKey>) {
|
|
||||||
self.txout_index.add_keychain(keychain, descriptor)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Get the internal map of keychains to their descriptors. This is just shorthand for calling
|
|
||||||
/// [`KeychainTxOutIndex::keychains`] on the internal `txout_index`.
|
|
||||||
pub fn keychains(&mut self) -> &BTreeMap<K, Descriptor<DescriptorPublicKey>> {
|
|
||||||
self.txout_index.keychains()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Get the checkpoint limit of the internal [`SparseChain`].
|
|
||||||
///
|
|
||||||
/// Refer to [`SparseChain::checkpoint_limit`] for more.
|
|
||||||
pub fn checkpoint_limit(&self) -> Option<usize> {
|
|
||||||
self.chain_graph.checkpoint_limit()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Set the checkpoint limit of the internal [`SparseChain`].
|
|
||||||
///
|
|
||||||
/// Refer to [`SparseChain::set_checkpoint_limit`] for more.
|
|
||||||
pub fn set_checkpoint_limit(&mut self, limit: Option<usize>) {
|
|
||||||
self.chain_graph.set_checkpoint_limit(limit)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the resultant [`KeychainChangeSet`] if the given [`KeychainScan`] is applied.
|
|
||||||
///
|
|
||||||
/// Internally, we call [`ChainGraph::determine_changeset`] and also determine the additions of
|
|
||||||
/// [`KeychainTxOutIndex`].
|
|
||||||
pub fn determine_changeset(
|
|
||||||
&self,
|
|
||||||
scan: &KeychainScan<K, P>,
|
|
||||||
) -> Result<KeychainChangeSet<K, P>, chain_graph::UpdateError<P>> {
|
|
||||||
// TODO: `KeychainTxOutIndex::determine_additions`
|
|
||||||
let mut derivation_indices = scan.last_active_indices.clone();
|
|
||||||
derivation_indices.retain(|keychain, index| {
|
|
||||||
match self.txout_index.last_revealed_index(keychain) {
|
|
||||||
Some(existing) => *index > existing,
|
|
||||||
None => true,
|
|
||||||
}
|
|
||||||
});
|
|
||||||
|
|
||||||
Ok(KeychainChangeSet {
|
|
||||||
derivation_indices: DerivationAdditions(derivation_indices),
|
|
||||||
chain_graph: self.chain_graph.determine_changeset(&scan.update)?,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Directly applies a [`KeychainScan`] on [`KeychainTracker`].
|
|
||||||
///
|
|
||||||
/// This is equivalent to calling [`determine_changeset`] and [`apply_changeset`] in sequence.
|
|
||||||
///
|
|
||||||
/// [`determine_changeset`]: Self::determine_changeset
|
|
||||||
/// [`apply_changeset`]: Self::apply_changeset
|
|
||||||
pub fn apply_update(
|
|
||||||
&mut self,
|
|
||||||
scan: KeychainScan<K, P>,
|
|
||||||
) -> Result<KeychainChangeSet<K, P>, chain_graph::UpdateError<P>> {
|
|
||||||
let changeset = self.determine_changeset(&scan)?;
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Applies the changes in `changeset` to [`KeychainTracker`].
|
|
||||||
///
|
|
||||||
/// Internally, this calls [`KeychainTxOutIndex::apply_additions`] and
|
|
||||||
/// [`ChainGraph::apply_changeset`] in sequence.
|
|
||||||
pub fn apply_changeset(&mut self, changeset: KeychainChangeSet<K, P>) {
|
|
||||||
let KeychainChangeSet {
|
|
||||||
derivation_indices,
|
|
||||||
chain_graph,
|
|
||||||
} = changeset;
|
|
||||||
self.txout_index.apply_additions(derivation_indices);
|
|
||||||
let _ = self.txout_index.scan(&chain_graph);
|
|
||||||
self.chain_graph.apply_changeset(chain_graph)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Iterates through [`FullTxOut`]s that are considered to exist in our representation of the
|
|
||||||
/// blockchain/mempool.
|
|
||||||
///
|
|
||||||
/// In other words, these are `txout`s of confirmed and in-mempool transactions, based on our
|
|
||||||
/// view of the blockchain/mempool.
|
|
||||||
pub fn full_txouts(&self) -> impl Iterator<Item = (&(K, u32), FullTxOut<P>)> + '_ {
|
|
||||||
self.txout_index
|
|
||||||
.txouts()
|
|
||||||
.filter_map(move |(spk_i, op, _)| Some((spk_i, self.chain_graph.full_txout(op)?)))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Iterates through [`FullTxOut`]s that are unspent outputs.
|
|
||||||
///
|
|
||||||
/// Refer to [`full_txouts`] for more.
|
|
||||||
///
|
|
||||||
/// [`full_txouts`]: Self::full_txouts
|
|
||||||
pub fn full_utxos(&self) -> impl Iterator<Item = (&(K, u32), FullTxOut<P>)> + '_ {
|
|
||||||
self.full_txouts()
|
|
||||||
.filter(|(_, txout)| txout.spent_by.is_none())
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns a reference to the internal [`ChainGraph`].
|
|
||||||
pub fn chain_graph(&self) -> &ChainGraph<P> {
|
|
||||||
&self.chain_graph
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns a reference to the internal [`TxGraph`] (which is part of the [`ChainGraph`]).
|
|
||||||
pub fn graph(&self) -> &TxGraph {
|
|
||||||
self.chain_graph().graph()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns a reference to the internal [`SparseChain`] (which is part of the [`ChainGraph`]).
|
|
||||||
pub fn chain(&self) -> &SparseChain<P> {
|
|
||||||
self.chain_graph().chain()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the changes as a result of inserting `block_id` (a height and block hash) into the
|
|
||||||
/// tracker.
|
|
||||||
///
|
|
||||||
/// The caller is responsible for guaranteeing that a block exists at that height. If a
|
|
||||||
/// checkpoint already exists at that height with a different hash; this will return an error.
|
|
||||||
/// Otherwise it will return `Ok(true)` if the checkpoint didn't already exist or `Ok(false)`
|
|
||||||
/// if it did.
|
|
||||||
///
|
|
||||||
/// **Warning**: This function modifies the internal state of the tracker. You are responsible
|
|
||||||
/// for persisting these changes to disk if you need to restore them.
|
|
||||||
pub fn insert_checkpoint_preview(
|
|
||||||
&self,
|
|
||||||
block_id: BlockId,
|
|
||||||
) -> Result<KeychainChangeSet<K, P>, chain_graph::InsertCheckpointError> {
|
|
||||||
Ok(KeychainChangeSet {
|
|
||||||
chain_graph: self.chain_graph.insert_checkpoint_preview(block_id)?,
|
|
||||||
..Default::default()
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Directly insert a `block_id` into the tracker.
|
|
||||||
///
|
|
||||||
/// This is equivalent of calling [`insert_checkpoint_preview`] and [`apply_changeset`] in
|
|
||||||
/// sequence.
|
|
||||||
///
|
|
||||||
/// [`insert_checkpoint_preview`]: Self::insert_checkpoint_preview
|
|
||||||
/// [`apply_changeset`]: Self::apply_changeset
|
|
||||||
pub fn insert_checkpoint(
|
|
||||||
&mut self,
|
|
||||||
block_id: BlockId,
|
|
||||||
) -> Result<KeychainChangeSet<K, P>, chain_graph::InsertCheckpointError> {
|
|
||||||
let changeset = self.insert_checkpoint_preview(block_id)?;
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Determines the changes as a result of inserting a transaction into the inner [`ChainGraph`]
|
|
||||||
/// and optionally into the inner chain at `position`.
|
|
||||||
///
|
|
||||||
/// **Warning**: This function modifies the internal state of the chain graph. You are
|
|
||||||
/// responsible for persisting these changes to disk if you need to restore them.
|
|
||||||
pub fn insert_tx_preview(
|
|
||||||
&self,
|
|
||||||
tx: Transaction,
|
|
||||||
pos: P,
|
|
||||||
) -> Result<KeychainChangeSet<K, P>, chain_graph::InsertTxError<P>> {
|
|
||||||
Ok(KeychainChangeSet {
|
|
||||||
chain_graph: self.chain_graph.insert_tx_preview(tx, pos)?,
|
|
||||||
..Default::default()
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Directly insert a transaction into the inner [`ChainGraph`] and optionally into the inner
|
|
||||||
/// chain at `position`.
|
|
||||||
///
|
|
||||||
/// This is equivalent of calling [`insert_tx_preview`] and [`apply_changeset`] in sequence.
|
|
||||||
///
|
|
||||||
/// [`insert_tx_preview`]: Self::insert_tx_preview
|
|
||||||
/// [`apply_changeset`]: Self::apply_changeset
|
|
||||||
pub fn insert_tx(
|
|
||||||
&mut self,
|
|
||||||
tx: Transaction,
|
|
||||||
pos: P,
|
|
||||||
) -> Result<KeychainChangeSet<K, P>, chain_graph::InsertTxError<P>> {
|
|
||||||
let changeset = self.insert_tx_preview(tx, pos)?;
|
|
||||||
self.apply_changeset(changeset.clone());
|
|
||||||
Ok(changeset)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns the *balance* of the keychain, i.e., the value of unspent transaction outputs tracked.
|
|
||||||
///
|
|
||||||
/// The caller provides a `should_trust` predicate which must decide whether the value of
|
|
||||||
/// unconfirmed outputs on this keychain are guaranteed to be realized or not. For example:
|
|
||||||
///
|
|
||||||
/// - For an *internal* (change) keychain, `should_trust` should generally be `true` since even if
|
|
||||||
/// you lose an internal output due to eviction, you will always gain back the value from whatever output the
|
|
||||||
/// unconfirmed transaction was spending (since that output is presumably from your wallet).
|
|
||||||
/// - For an *external* keychain, you might want `should_trust` to return `false` since someone may cancel (by double spending)
|
|
||||||
/// a payment made to addresses on that keychain.
|
|
||||||
///
|
|
||||||
/// When in doubt set `should_trust` to return false. This doesn't do anything other than change
|
|
||||||
/// where the unconfirmed output's value is accounted for in `Balance`.
|
|
||||||
pub fn balance(&self, mut should_trust: impl FnMut(&K) -> bool) -> Balance {
|
|
||||||
let mut immature = 0;
|
|
||||||
let mut trusted_pending = 0;
|
|
||||||
let mut untrusted_pending = 0;
|
|
||||||
let mut confirmed = 0;
|
|
||||||
let last_sync_height = self.chain().latest_checkpoint().map(|latest| latest.height);
|
|
||||||
for ((keychain, _), utxo) in self.full_utxos() {
|
|
||||||
let chain_position = &utxo.chain_position;
|
|
||||||
|
|
||||||
match chain_position.height() {
|
|
||||||
TxHeight::Confirmed(_) => {
|
|
||||||
if utxo.is_on_coinbase {
|
|
||||||
if utxo.is_mature(
|
|
||||||
last_sync_height
|
|
||||||
.expect("since it's confirmed we must have a checkpoint"),
|
|
||||||
) {
|
|
||||||
confirmed += utxo.txout.value;
|
|
||||||
} else {
|
|
||||||
immature += utxo.txout.value;
|
|
||||||
}
|
|
||||||
} else {
|
|
||||||
confirmed += utxo.txout.value;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
TxHeight::Unconfirmed => {
|
|
||||||
if should_trust(keychain) {
|
|
||||||
trusted_pending += utxo.txout.value;
|
|
||||||
} else {
|
|
||||||
untrusted_pending += utxo.txout.value;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
Balance {
|
|
||||||
immature,
|
|
||||||
trusted_pending,
|
|
||||||
untrusted_pending,
|
|
||||||
confirmed,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Returns the balance of all spendable confirmed unspent outputs of this tracker at a
|
|
||||||
/// particular height.
|
|
||||||
pub fn balance_at(&self, height: u32) -> u64 {
|
|
||||||
self.full_txouts()
|
|
||||||
.filter(|(_, full_txout)| full_txout.is_spendable_at(height))
|
|
||||||
.map(|(_, full_txout)| full_txout.txout.value)
|
|
||||||
.sum()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> Default for KeychainTracker<K, P> {
|
|
||||||
fn default() -> Self {
|
|
||||||
Self {
|
|
||||||
txout_index: Default::default(),
|
|
||||||
chain_graph: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> AsRef<SparseChain<P>> for KeychainTracker<K, P> {
|
|
||||||
fn as_ref(&self) -> &SparseChain<P> {
|
|
||||||
self.chain_graph.chain()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> AsRef<TxGraph> for KeychainTracker<K, P> {
|
|
||||||
fn as_ref(&self) -> &TxGraph {
|
|
||||||
self.chain_graph.graph()
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> AsRef<ChainGraph<P>> for KeychainTracker<K, P> {
|
|
||||||
fn as_ref(&self) -> &ChainGraph<P> {
|
|
||||||
&self.chain_graph
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,28 +1,60 @@
|
|||||||
use crate::{
|
use crate::{
|
||||||
collections::*,
|
collections::*,
|
||||||
|
indexed_tx_graph::Indexer,
|
||||||
miniscript::{Descriptor, DescriptorPublicKey},
|
miniscript::{Descriptor, DescriptorPublicKey},
|
||||||
ForEachTxOut, SpkTxOutIndex,
|
spk_iter::BIP32_MAX_INDEX,
|
||||||
|
SpkIterator, SpkTxOutIndex,
|
||||||
|
};
|
||||||
|
use bitcoin::{OutPoint, Script, Transaction, TxOut, Txid};
|
||||||
|
use core::{
|
||||||
|
fmt::Debug,
|
||||||
|
ops::{Bound, RangeBounds},
|
||||||
};
|
};
|
||||||
use alloc::{borrow::Cow, vec::Vec};
|
|
||||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, TxOut};
|
|
||||||
use core::{fmt::Debug, ops::Deref};
|
|
||||||
|
|
||||||
use super::DerivationAdditions;
|
use crate::Append;
|
||||||
|
|
||||||
/// Maximum [BIP32](https://bips.xyz/32) derivation index.
|
const DEFAULT_LOOKAHEAD: u32 = 25;
|
||||||
pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
|
||||||
|
|
||||||
/// A convenient wrapper around [`SpkTxOutIndex`] that relates script pubkeys to miniscript public
|
/// [`KeychainTxOutIndex`] controls how script pubkeys are revealed for multiple keychains, and
|
||||||
/// [`Descriptor`]s.
|
/// indexes [`TxOut`]s with them.
|
||||||
///
|
///
|
||||||
/// Descriptors are referenced by the provided keychain generic (`K`).
|
/// A single keychain is a chain of script pubkeys derived from a single [`Descriptor`]. Keychains
|
||||||
|
/// are identified using the `K` generic. Script pubkeys are identified by the keychain that they
|
||||||
|
/// are derived from `K`, as well as the derivation index `u32`.
|
||||||
///
|
///
|
||||||
/// Script pubkeys for a descriptor are revealed chronologically from index 0. I.e., If the last
|
/// # Revealed script pubkeys
|
||||||
/// revealed index of a descriptor is 5; scripts of indices 0 to 4 are guaranteed to be already
|
|
||||||
/// revealed. In addition to revealed scripts, we have a `lookahead` parameter for each keychain,
|
|
||||||
/// which defines the number of script pubkeys to store ahead of the last revealed index.
|
|
||||||
///
|
///
|
||||||
/// Methods that could update the last revealed index will return [`DerivationAdditions`] to report
|
/// Tracking how script pubkeys are revealed is useful for collecting chain data. For example, if
|
||||||
|
/// the user has requested 5 script pubkeys (to receive money with), we only need to use those
|
||||||
|
/// script pubkeys to scan for chain data.
|
||||||
|
///
|
||||||
|
/// Call [`reveal_to_target`] or [`reveal_next_spk`] to reveal more script pubkeys.
|
||||||
|
/// Call [`revealed_keychain_spks`] or [`revealed_spks`] to iterate through revealed script pubkeys.
|
||||||
|
///
|
||||||
|
/// # Lookahead script pubkeys
|
||||||
|
///
|
||||||
|
/// When an user first recovers a wallet (i.e. from a recovery phrase and/or descriptor), we will
|
||||||
|
/// NOT have knowledge of which script pubkeys are revealed. So when we index a transaction or
|
||||||
|
/// txout (using [`index_tx`]/[`index_txout`]) we scan the txouts against script pubkeys derived
|
||||||
|
/// above the last revealed index. These additionally-derived script pubkeys are called the
|
||||||
|
/// lookahead.
|
||||||
|
///
|
||||||
|
/// The [`KeychainTxOutIndex`] is constructed with the `lookahead` and cannot be altered. The
|
||||||
|
/// default `lookahead` count is 1000. Use [`new`] to set a custom `lookahead`.
|
||||||
|
///
|
||||||
|
/// # Unbounded script pubkey iterator
|
||||||
|
///
|
||||||
|
/// For script-pubkey-based chain sources (such as Electrum/Esplora), an initial scan is best done
|
||||||
|
/// by iterating though derived script pubkeys one by one and requesting transaction histories for
|
||||||
|
/// each script pubkey. We will stop after x-number of script pubkeys have empty histories. An
|
||||||
|
/// unbounded script pubkey iterator is useful to pass to such a chain source.
|
||||||
|
///
|
||||||
|
/// Call [`unbounded_spk_iter`] to get an unbounded script pubkey iterator for a given keychain.
|
||||||
|
/// Call [`all_unbounded_spk_iters`] to get unbounded script pubkey iterators for all keychains.
|
||||||
|
///
|
||||||
|
/// # Change sets
|
||||||
|
///
|
||||||
|
/// Methods that can update the last revealed index will return [`super::ChangeSet`] to report
|
||||||
/// these changes. This can be persisted for future recovery.
|
/// these changes. This can be persisted for future recovery.
|
||||||
///
|
///
|
||||||
/// ## Synopsis
|
/// ## Synopsis
|
||||||
@@ -47,7 +79,7 @@ pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
|||||||
/// # let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
/// # let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
/// # let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
/// # let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||||
/// # let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
/// # let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||||
/// # let descriptor_for_user_42 = external_descriptor.clone();
|
/// # let (descriptor_for_user_42, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/2/*)").unwrap();
|
||||||
/// txout_index.add_keychain(MyKeychain::External, external_descriptor);
|
/// txout_index.add_keychain(MyKeychain::External, external_descriptor);
|
||||||
/// txout_index.add_keychain(MyKeychain::Internal, internal_descriptor);
|
/// txout_index.add_keychain(MyKeychain::Internal, internal_descriptor);
|
||||||
/// txout_index.add_keychain(MyKeychain::MyAppUser { user_id: 42 }, descriptor_for_user_42);
|
/// txout_index.add_keychain(MyKeychain::MyAppUser { user_id: 42 }, descriptor_for_user_42);
|
||||||
@@ -58,6 +90,15 @@ pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
|||||||
/// [`Ord`]: core::cmp::Ord
|
/// [`Ord`]: core::cmp::Ord
|
||||||
/// [`SpkTxOutIndex`]: crate::spk_txout_index::SpkTxOutIndex
|
/// [`SpkTxOutIndex`]: crate::spk_txout_index::SpkTxOutIndex
|
||||||
/// [`Descriptor`]: crate::miniscript::Descriptor
|
/// [`Descriptor`]: crate::miniscript::Descriptor
|
||||||
|
/// [`reveal_to_target`]: KeychainTxOutIndex::reveal_to_target
|
||||||
|
/// [`reveal_next_spk`]: KeychainTxOutIndex::reveal_next_spk
|
||||||
|
/// [`revealed_keychain_spks`]: KeychainTxOutIndex::revealed_keychain_spks
|
||||||
|
/// [`revealed_spks`]: KeychainTxOutIndex::revealed_spks
|
||||||
|
/// [`index_tx`]: KeychainTxOutIndex::index_tx
|
||||||
|
/// [`index_txout`]: KeychainTxOutIndex::index_txout
|
||||||
|
/// [`new`]: KeychainTxOutIndex::new
|
||||||
|
/// [`unbounded_spk_iter`]: KeychainTxOutIndex::unbounded_spk_iter
|
||||||
|
/// [`all_unbounded_spk_iters`]: KeychainTxOutIndex::all_unbounded_spk_iters
|
||||||
#[derive(Clone, Debug)]
|
#[derive(Clone, Debug)]
|
||||||
pub struct KeychainTxOutIndex<K> {
|
pub struct KeychainTxOutIndex<K> {
|
||||||
inner: SpkTxOutIndex<(K, u32)>,
|
inner: SpkTxOutIndex<(K, u32)>,
|
||||||
@@ -66,67 +107,192 @@ pub struct KeychainTxOutIndex<K> {
|
|||||||
// last revealed indexes
|
// last revealed indexes
|
||||||
last_revealed: BTreeMap<K, u32>,
|
last_revealed: BTreeMap<K, u32>,
|
||||||
// lookahead settings for each keychain
|
// lookahead settings for each keychain
|
||||||
lookahead: BTreeMap<K, u32>,
|
lookahead: u32,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<K> Default for KeychainTxOutIndex<K> {
|
impl<K> Default for KeychainTxOutIndex<K> {
|
||||||
fn default() -> Self {
|
fn default() -> Self {
|
||||||
|
Self::new(DEFAULT_LOOKAHEAD)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Clone + Ord + Debug> Indexer for KeychainTxOutIndex<K> {
|
||||||
|
type ChangeSet = super::ChangeSet<K>;
|
||||||
|
|
||||||
|
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet {
|
||||||
|
match self.inner.scan_txout(outpoint, txout).cloned() {
|
||||||
|
Some((keychain, index)) => self.reveal_to_target(&keychain, index).1,
|
||||||
|
None => super::ChangeSet::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn index_tx(&mut self, tx: &bitcoin::Transaction) -> Self::ChangeSet {
|
||||||
|
let mut changeset = super::ChangeSet::<K>::default();
|
||||||
|
for (op, txout) in tx.output.iter().enumerate() {
|
||||||
|
changeset.append(self.index_txout(OutPoint::new(tx.txid(), op as u32), txout));
|
||||||
|
}
|
||||||
|
changeset
|
||||||
|
}
|
||||||
|
|
||||||
|
fn initial_changeset(&self) -> Self::ChangeSet {
|
||||||
|
super::ChangeSet(self.last_revealed.clone())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn apply_changeset(&mut self, changeset: Self::ChangeSet) {
|
||||||
|
self.apply_changeset(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_tx_relevant(&self, tx: &bitcoin::Transaction) -> bool {
|
||||||
|
self.inner.is_relevant(tx)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K> KeychainTxOutIndex<K> {
|
||||||
|
/// Construct a [`KeychainTxOutIndex`] with the given `lookahead`.
|
||||||
|
///
|
||||||
|
/// The `lookahead` is the number of script pubkeys to derive and cache from the internal
|
||||||
|
/// descriptors over and above the last revealed script index. Without a lookahead the index
|
||||||
|
/// will miss outputs you own when processing transactions whose output script pubkeys lie
|
||||||
|
/// beyond the last revealed index. In certain situations, such as when performing an initial
|
||||||
|
/// scan of the blockchain during wallet import, it may be uncertain or unknown what the index
|
||||||
|
/// of the last revealed script pubkey actually is.
|
||||||
|
///
|
||||||
|
/// Refer to [struct-level docs](KeychainTxOutIndex) for more about `lookahead`.
|
||||||
|
pub fn new(lookahead: u32) -> Self {
|
||||||
Self {
|
Self {
|
||||||
inner: SpkTxOutIndex::default(),
|
inner: SpkTxOutIndex::default(),
|
||||||
keychains: BTreeMap::default(),
|
keychains: BTreeMap::new(),
|
||||||
last_revealed: BTreeMap::default(),
|
last_revealed: BTreeMap::new(),
|
||||||
lookahead: BTreeMap::default(),
|
lookahead,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<K> Deref for KeychainTxOutIndex<K> {
|
/// Methods that are *re-exposed* from the internal [`SpkTxOutIndex`].
|
||||||
type Target = SpkTxOutIndex<(K, u32)>;
|
|
||||||
|
|
||||||
fn deref(&self) -> &Self::Target {
|
|
||||||
&self.inner
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||||
/// Scans an object for relevant outpoints, which are stored and indexed internally.
|
|
||||||
///
|
|
||||||
/// If the matched script pubkey is part of the lookahead, the last stored index is updated for
|
|
||||||
/// the script pubkey's keychain and the [`DerivationAdditions`] returned will reflect the
|
|
||||||
/// change.
|
|
||||||
///
|
|
||||||
/// Typically, this method is used in two situations:
|
|
||||||
///
|
|
||||||
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
|
||||||
/// your txouts.
|
|
||||||
/// 2. When getting new data from the chain, you usually scan it before incorporating it into
|
|
||||||
/// your chain state (i.e., `SparseChain`, `ChainGraph`).
|
|
||||||
///
|
|
||||||
/// See [`ForEachTxout`] for the types that support this.
|
|
||||||
///
|
|
||||||
/// [`ForEachTxout`]: crate::ForEachTxOut
|
|
||||||
pub fn scan(&mut self, txouts: &impl ForEachTxOut) -> DerivationAdditions<K> {
|
|
||||||
let mut additions = DerivationAdditions::<K>::default();
|
|
||||||
txouts.for_each_txout(|(op, txout)| additions.append(self.scan_txout(op, txout)));
|
|
||||||
additions
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Scan a single outpoint for a matching script pubkey.
|
|
||||||
///
|
|
||||||
/// If it matches, this will store and index it.
|
|
||||||
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> DerivationAdditions<K> {
|
|
||||||
match self.inner.scan_txout(op, txout).cloned() {
|
|
||||||
Some((keychain, index)) => self.reveal_to_target(&keychain, index).1,
|
|
||||||
None => DerivationAdditions::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Return a reference to the internal [`SpkTxOutIndex`].
|
/// Return a reference to the internal [`SpkTxOutIndex`].
|
||||||
|
///
|
||||||
|
/// **WARNING:** The internal index will contain lookahead spks. Refer to
|
||||||
|
/// [struct-level docs](KeychainTxOutIndex) for more about `lookahead`.
|
||||||
pub fn inner(&self) -> &SpkTxOutIndex<(K, u32)> {
|
pub fn inner(&self) -> &SpkTxOutIndex<(K, u32)> {
|
||||||
&self.inner
|
&self.inner
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return a reference to the internal map of the keychain to descriptors.
|
/// Get a reference to the set of indexed outpoints.
|
||||||
|
pub fn outpoints(&self) -> &BTreeSet<((K, u32), OutPoint)> {
|
||||||
|
self.inner.outpoints()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over known txouts that spend to tracked script pubkeys.
|
||||||
|
pub fn txouts(
|
||||||
|
&self,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (K, u32, OutPoint, &TxOut)> + ExactSizeIterator {
|
||||||
|
self.inner
|
||||||
|
.txouts()
|
||||||
|
.map(|((k, i), op, txo)| (k.clone(), *i, op, txo))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finds all txouts on a transaction that has previously been scanned and indexed.
|
||||||
|
pub fn txouts_in_tx(
|
||||||
|
&self,
|
||||||
|
txid: Txid,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (K, u32, OutPoint, &TxOut)> {
|
||||||
|
self.inner
|
||||||
|
.txouts_in_tx(txid)
|
||||||
|
.map(|((k, i), op, txo)| (k.clone(), *i, op, txo))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return the [`TxOut`] of `outpoint` if it has been indexed.
|
||||||
|
///
|
||||||
|
/// The associated keychain and keychain index of the txout's spk is also returned.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::txout`] internally.
|
||||||
|
pub fn txout(&self, outpoint: OutPoint) -> Option<(K, u32, &TxOut)> {
|
||||||
|
self.inner
|
||||||
|
.txout(outpoint)
|
||||||
|
.map(|((k, i), txo)| (k.clone(), *i, txo))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return the script that exists under the given `keychain`'s `index`.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::spk_at_index`] internally.
|
||||||
|
pub fn spk_at_index(&self, keychain: K, index: u32) -> Option<&Script> {
|
||||||
|
self.inner.spk_at_index(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns the keychain and keychain index associated with the spk.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::index_of_spk`] internally.
|
||||||
|
pub fn index_of_spk(&self, script: &Script) -> Option<(K, u32)> {
|
||||||
|
self.inner.index_of_spk(script).cloned()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Returns whether the spk under the `keychain`'s `index` has been used.
|
||||||
|
///
|
||||||
|
/// Here, "unused" means that after the script pubkey was stored in the index, the index has
|
||||||
|
/// never scanned a transaction output with it.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::is_used`] internally.
|
||||||
|
pub fn is_used(&self, keychain: K, index: u32) -> bool {
|
||||||
|
self.inner.is_used(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Marks the script pubkey at `index` as used even though the tracker hasn't seen an output
|
||||||
|
/// with it.
|
||||||
|
///
|
||||||
|
/// This only has an effect when the `index` had been added to `self` already and was unused.
|
||||||
|
///
|
||||||
|
/// Returns whether the `index` was initially present as `unused`.
|
||||||
|
///
|
||||||
|
/// This is useful when you want to reserve a script pubkey for something but don't want to add
|
||||||
|
/// the transaction output using it to the index yet. Other callers will consider `index` on
|
||||||
|
/// `keychain` used until you call [`unmark_used`].
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::mark_used`] internally.
|
||||||
|
///
|
||||||
|
/// [`unmark_used`]: Self::unmark_used
|
||||||
|
pub fn mark_used(&mut self, keychain: K, index: u32) -> bool {
|
||||||
|
self.inner.mark_used(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Undoes the effect of [`mark_used`]. Returns whether the `index` is inserted back into
|
||||||
|
/// `unused`.
|
||||||
|
///
|
||||||
|
/// Note that if `self` has scanned an output with this script pubkey, then this will have no
|
||||||
|
/// effect.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::unmark_used`] internally.
|
||||||
|
///
|
||||||
|
/// [`mark_used`]: Self::mark_used
|
||||||
|
pub fn unmark_used(&mut self, keychain: K, index: u32) -> bool {
|
||||||
|
self.inner.unmark_used(&(keychain, index))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
||||||
|
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
||||||
|
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
||||||
|
/// received just uses the [`Transaction`] outputs directly, so it will be correct even if it has
|
||||||
|
/// not been scanned.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::sent_and_received`] internally.
|
||||||
|
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
||||||
|
self.inner.sent_and_received(tx)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Computes the net value that this transaction gives to the script pubkeys in the index and
|
||||||
|
/// *takes* from the transaction outputs in the index. Shorthand for calling
|
||||||
|
/// [`sent_and_received`] and subtracting sent from received.
|
||||||
|
///
|
||||||
|
/// This calls [`SpkTxOutIndex::net_value`] internally.
|
||||||
|
///
|
||||||
|
/// [`sent_and_received`]: Self::sent_and_received
|
||||||
|
pub fn net_value(&self, tx: &Transaction) -> i64 {
|
||||||
|
self.inner.net_value(tx)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
||||||
|
/// Return a reference to the internal map of keychain to descriptors.
|
||||||
pub fn keychains(&self) -> &BTreeMap<K, Descriptor<DescriptorPublicKey>> {
|
pub fn keychains(&self) -> &BTreeMap<K, Descriptor<DescriptorPublicKey>> {
|
||||||
&self.keychains
|
&self.keychains
|
||||||
}
|
}
|
||||||
@@ -140,84 +306,49 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
///
|
///
|
||||||
/// This will panic if a different `descriptor` is introduced to the same `keychain`.
|
/// This will panic if a different `descriptor` is introduced to the same `keychain`.
|
||||||
pub fn add_keychain(&mut self, keychain: K, descriptor: Descriptor<DescriptorPublicKey>) {
|
pub fn add_keychain(&mut self, keychain: K, descriptor: Descriptor<DescriptorPublicKey>) {
|
||||||
let old_descriptor = &*self.keychains.entry(keychain).or_insert(descriptor.clone());
|
let old_descriptor = &*self
|
||||||
|
.keychains
|
||||||
|
.entry(keychain.clone())
|
||||||
|
.or_insert_with(|| descriptor.clone());
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
&descriptor, old_descriptor,
|
&descriptor, old_descriptor,
|
||||||
"keychain already contains a different descriptor"
|
"keychain already contains a different descriptor"
|
||||||
);
|
);
|
||||||
|
self.replenish_lookahead(&keychain, self.lookahead);
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return the lookahead setting for each keychain.
|
/// Get the lookahead setting.
|
||||||
///
|
///
|
||||||
/// Refer to [`set_lookahead`] for a deeper explanation of the `lookahead`.
|
/// Refer to [`new`] for more information on the `lookahead`.
|
||||||
///
|
///
|
||||||
/// [`set_lookahead`]: Self::set_lookahead
|
/// [`new`]: Self::new
|
||||||
pub fn lookaheads(&self) -> &BTreeMap<K, u32> {
|
pub fn lookahead(&self) -> u32 {
|
||||||
&self.lookahead
|
self.lookahead
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Convenience method to call [`set_lookahead`] for all keychains.
|
/// Store lookahead scripts until `target_index` (inclusive).
|
||||||
///
|
///
|
||||||
/// [`set_lookahead`]: Self::set_lookahead
|
/// This does not change the global `lookahead` setting.
|
||||||
pub fn set_lookahead_for_all(&mut self, lookahead: u32) {
|
|
||||||
for keychain in &self.keychains.keys().cloned().collect::<Vec<_>>() {
|
|
||||||
self.lookahead.insert(keychain.clone(), lookahead);
|
|
||||||
self.replenish_lookahead(keychain);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Set the lookahead count for `keychain`.
|
|
||||||
///
|
|
||||||
/// The lookahead is the number of scripts to cache ahead of the last stored script index. This
|
|
||||||
/// is useful during a scan via [`scan`] or [`scan_txout`].
|
|
||||||
///
|
|
||||||
/// # Panics
|
|
||||||
///
|
|
||||||
/// This will panic if the `keychain` does not exist.
|
|
||||||
///
|
|
||||||
/// [`scan`]: Self::scan
|
|
||||||
/// [`scan_txout`]: Self::scan_txout
|
|
||||||
pub fn set_lookahead(&mut self, keychain: &K, lookahead: u32) {
|
|
||||||
self.lookahead.insert(keychain.clone(), lookahead);
|
|
||||||
self.replenish_lookahead(keychain);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Convenience method to call [`lookahead_to_target`] for multiple keychains.
|
|
||||||
///
|
|
||||||
/// [`lookahead_to_target`]: Self::lookahead_to_target
|
|
||||||
pub fn lookahead_to_target_multi(&mut self, target_indexes: BTreeMap<K, u32>) {
|
|
||||||
for (keychain, target_index) in target_indexes {
|
|
||||||
self.lookahead_to_target(&keychain, target_index)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Store lookahead scripts until `target_index`.
|
|
||||||
///
|
|
||||||
/// This does not change the `lookahead` setting.
|
|
||||||
pub fn lookahead_to_target(&mut self, keychain: &K, target_index: u32) {
|
pub fn lookahead_to_target(&mut self, keychain: &K, target_index: u32) {
|
||||||
let next_index = self.next_store_index(keychain);
|
let (next_index, _) = self.next_index(keychain);
|
||||||
if let Some(temp_lookahead) = target_index.checked_sub(next_index).filter(|&v| v > 0) {
|
|
||||||
let old_lookahead = self.lookahead.insert(keychain.clone(), temp_lookahead);
|
|
||||||
self.replenish_lookahead(keychain);
|
|
||||||
|
|
||||||
// revert
|
let temp_lookahead = (target_index + 1)
|
||||||
match old_lookahead {
|
.checked_sub(next_index)
|
||||||
Some(lookahead) => self.lookahead.insert(keychain.clone(), lookahead),
|
.filter(|&index| index > 0);
|
||||||
None => self.lookahead.remove(keychain),
|
|
||||||
};
|
if let Some(temp_lookahead) = temp_lookahead {
|
||||||
|
self.replenish_lookahead(keychain, temp_lookahead);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn replenish_lookahead(&mut self, keychain: &K) {
|
fn replenish_lookahead(&mut self, keychain: &K, lookahead: u32) {
|
||||||
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||||
let next_store_index = self.next_store_index(keychain);
|
let next_store_index = self.next_store_index(keychain);
|
||||||
let next_reveal_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
let next_reveal_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
||||||
let lookahead = self.lookahead.get(keychain).map_or(0, |v| *v);
|
|
||||||
|
|
||||||
for (new_index, new_spk) in range_descriptor_spks(
|
for (new_index, new_spk) in
|
||||||
Cow::Borrowed(descriptor),
|
SpkIterator::new_with_range(descriptor, next_store_index..next_reveal_index + lookahead)
|
||||||
next_store_index..next_reveal_index + lookahead,
|
{
|
||||||
) {
|
|
||||||
let _inserted = self
|
let _inserted = self
|
||||||
.inner
|
.inner
|
||||||
.insert_spk((keychain.clone(), new_index), new_spk);
|
.insert_spk((keychain.clone(), new_index), new_spk);
|
||||||
@@ -228,64 +359,74 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
fn next_store_index(&self, keychain: &K) -> u32 {
|
fn next_store_index(&self, keychain: &K) -> u32 {
|
||||||
self.inner()
|
self.inner()
|
||||||
.all_spks()
|
.all_spks()
|
||||||
|
// This range is filtering out the spks with a keychain different than
|
||||||
|
// `keychain`. We don't use filter here as range is more optimized.
|
||||||
.range((keychain.clone(), u32::MIN)..(keychain.clone(), u32::MAX))
|
.range((keychain.clone(), u32::MIN)..(keychain.clone(), u32::MAX))
|
||||||
.last()
|
.last()
|
||||||
.map_or(0, |((_, v), _)| *v + 1)
|
.map_or(0, |((_, index), _)| *index + 1)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Generates script pubkey iterators for every `keychain`. The iterators iterate over all
|
/// Get an unbounded spk iterator over a given `keychain`.
|
||||||
/// derivable script pubkeys.
|
|
||||||
pub fn spks_of_all_keychains(
|
|
||||||
&self,
|
|
||||||
) -> BTreeMap<K, impl Iterator<Item = (u32, Script)> + Clone> {
|
|
||||||
self.keychains
|
|
||||||
.iter()
|
|
||||||
.map(|(keychain, descriptor)| {
|
|
||||||
(
|
|
||||||
keychain.clone(),
|
|
||||||
range_descriptor_spks(Cow::Owned(descriptor.clone()), 0..),
|
|
||||||
)
|
|
||||||
})
|
|
||||||
.collect()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Generates a script pubkey iterator for the given `keychain`'s descriptor (if it exists). The
|
|
||||||
/// iterator iterates over all derivable scripts of the keychain's descriptor.
|
|
||||||
///
|
///
|
||||||
/// # Panics
|
/// # Panics
|
||||||
///
|
///
|
||||||
/// This will panic if the `keychain` does not exist.
|
/// This will panic if the given `keychain`'s descriptor does not exist.
|
||||||
pub fn spks_of_keychain(&self, keychain: &K) -> impl Iterator<Item = (u32, Script)> + Clone {
|
pub fn unbounded_spk_iter(&self, keychain: &K) -> SpkIterator<Descriptor<DescriptorPublicKey>> {
|
||||||
let descriptor = self
|
SpkIterator::new(
|
||||||
.keychains
|
self.keychains
|
||||||
.get(keychain)
|
.get(keychain)
|
||||||
.expect("keychain must exist")
|
.expect("keychain does not exist")
|
||||||
.clone();
|
.clone(),
|
||||||
range_descriptor_spks(Cow::Owned(descriptor), 0..)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Convenience method to get [`revealed_spks_of_keychain`] of all keychains.
|
/// Get unbounded spk iterators for all keychains.
|
||||||
///
|
pub fn all_unbounded_spk_iters(
|
||||||
/// [`revealed_spks_of_keychain`]: Self::revealed_spks_of_keychain
|
|
||||||
pub fn revealed_spks_of_all_keychains(
|
|
||||||
&self,
|
&self,
|
||||||
) -> BTreeMap<K, impl Iterator<Item = (u32, &Script)> + Clone> {
|
) -> BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>> {
|
||||||
self.keychains
|
self.keychains
|
||||||
.keys()
|
.iter()
|
||||||
.map(|keychain| (keychain.clone(), self.revealed_spks_of_keychain(keychain)))
|
.map(|(k, descriptor)| (k.clone(), SpkIterator::new(descriptor.clone())))
|
||||||
.collect()
|
.collect()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Iterates over the script pubkeys revealed by this index under `keychain`.
|
/// Iterate over revealed spks of all keychains.
|
||||||
pub fn revealed_spks_of_keychain(
|
pub fn revealed_spks(&self) -> impl DoubleEndedIterator<Item = (K, u32, &Script)> + Clone {
|
||||||
|
self.keychains.keys().flat_map(|keychain| {
|
||||||
|
self.revealed_keychain_spks(keychain)
|
||||||
|
.map(|(i, spk)| (keychain.clone(), i, spk))
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed spks of the given `keychain`.
|
||||||
|
pub fn revealed_keychain_spks(
|
||||||
&self,
|
&self,
|
||||||
keychain: &K,
|
keychain: &K,
|
||||||
) -> impl DoubleEndedIterator<Item = (u32, &Script)> + Clone {
|
) -> impl DoubleEndedIterator<Item = (u32, &Script)> + Clone {
|
||||||
let next_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
let next_i = self.last_revealed.get(keychain).map_or(0, |&i| i + 1);
|
||||||
self.inner
|
self.inner
|
||||||
.all_spks()
|
.all_spks()
|
||||||
.range((keychain.clone(), u32::MIN)..(keychain.clone(), next_index))
|
.range((keychain.clone(), u32::MIN)..(keychain.clone(), next_i))
|
||||||
.map(|((_, derivation_index), spk)| (*derivation_index, spk))
|
.map(|((_, i), spk)| (*i, spk.as_script()))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed, but unused, spks of all keychains.
|
||||||
|
pub fn unused_spks(&self) -> impl DoubleEndedIterator<Item = (K, u32, &Script)> + Clone {
|
||||||
|
self.keychains.keys().flat_map(|keychain| {
|
||||||
|
self.unused_keychain_spks(keychain)
|
||||||
|
.map(|(i, spk)| (keychain.clone(), i, spk))
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over revealed, but unused, spks of the given `keychain`.
|
||||||
|
pub fn unused_keychain_spks(
|
||||||
|
&self,
|
||||||
|
keychain: &K,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (u32, &Script)> + Clone {
|
||||||
|
let next_i = self.last_revealed.get(keychain).map_or(0, |&i| i + 1);
|
||||||
|
self.inner
|
||||||
|
.unused_spks((keychain.clone(), u32::MIN)..(keychain.clone(), next_i))
|
||||||
|
.map(|((_, i), spk)| (*i, spk))
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Get the next derivation index for `keychain`. The next index is the index after the last revealed
|
/// Get the next derivation index for `keychain`. The next index is the index after the last revealed
|
||||||
@@ -341,21 +482,21 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychains: &BTreeMap<K, u32>,
|
keychains: &BTreeMap<K, u32>,
|
||||||
) -> (
|
) -> (
|
||||||
BTreeMap<K, impl Iterator<Item = (u32, Script)>>,
|
BTreeMap<K, SpkIterator<Descriptor<DescriptorPublicKey>>>,
|
||||||
DerivationAdditions<K>,
|
super::ChangeSet<K>,
|
||||||
) {
|
) {
|
||||||
let mut additions = DerivationAdditions::default();
|
let mut changeset = super::ChangeSet::default();
|
||||||
let mut spks = BTreeMap::new();
|
let mut spks = BTreeMap::new();
|
||||||
|
|
||||||
for (keychain, &index) in keychains {
|
for (keychain, &index) in keychains {
|
||||||
let (new_spks, new_additions) = self.reveal_to_target(keychain, index);
|
let (new_spks, new_changeset) = self.reveal_to_target(keychain, index);
|
||||||
if !new_additions.is_empty() {
|
if !new_changeset.is_empty() {
|
||||||
spks.insert(keychain.clone(), new_spks);
|
spks.insert(keychain.clone(), new_spks);
|
||||||
additions.append(new_additions);
|
changeset.append(new_changeset.clone());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
(spks, additions)
|
(spks, changeset)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Reveals script pubkeys of the `keychain`'s descriptor **up to and including** the
|
/// Reveals script pubkeys of the `keychain`'s descriptor **up to and including** the
|
||||||
@@ -366,7 +507,7 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
/// reveal up to the last possible index.
|
/// reveal up to the last possible index.
|
||||||
///
|
///
|
||||||
/// This returns an iterator of newly revealed indices (alongside their scripts) and a
|
/// This returns an iterator of newly revealed indices (alongside their scripts) and a
|
||||||
/// [`DerivationAdditions`], which reports updates to the latest revealed index. If no new script
|
/// [`super::ChangeSet`], which reports updates to the latest revealed index. If no new script
|
||||||
/// pubkeys are revealed, then both of these will be empty.
|
/// pubkeys are revealed, then both of these will be empty.
|
||||||
///
|
///
|
||||||
/// # Panics
|
/// # Panics
|
||||||
@@ -376,72 +517,62 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: &K,
|
keychain: &K,
|
||||||
target_index: u32,
|
target_index: u32,
|
||||||
) -> (impl Iterator<Item = (u32, Script)>, DerivationAdditions<K>) {
|
) -> (
|
||||||
|
SpkIterator<Descriptor<DescriptorPublicKey>>,
|
||||||
|
super::ChangeSet<K>,
|
||||||
|
) {
|
||||||
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
let descriptor = self.keychains.get(keychain).expect("keychain must exist");
|
||||||
let has_wildcard = descriptor.has_wildcard();
|
let has_wildcard = descriptor.has_wildcard();
|
||||||
|
|
||||||
let target_index = if has_wildcard { target_index } else { 0 };
|
let target_index = if has_wildcard { target_index } else { 0 };
|
||||||
let next_reveal_index = self.last_revealed.get(keychain).map_or(0, |v| *v + 1);
|
let next_reveal_index = self
|
||||||
let lookahead = self.lookahead.get(keychain).map_or(0, |v| *v);
|
.last_revealed
|
||||||
|
.get(keychain)
|
||||||
|
.map_or(0, |index| *index + 1);
|
||||||
|
|
||||||
debug_assert_eq!(
|
debug_assert!(next_reveal_index + self.lookahead >= self.next_store_index(keychain));
|
||||||
next_reveal_index + lookahead,
|
|
||||||
self.next_store_index(keychain)
|
|
||||||
);
|
|
||||||
|
|
||||||
// if we need to reveal new indices, the latest revealed index goes here
|
// If the target_index is already revealed, we are done
|
||||||
let mut reveal_to_index = None;
|
if next_reveal_index > target_index {
|
||||||
|
return (
|
||||||
// if the target is not yet revealed, but is already stored (due to lookahead), we need to
|
SpkIterator::new_with_range(
|
||||||
// set the `reveal_to_index` as target here (as the `for` loop below only updates
|
descriptor.clone(),
|
||||||
// `reveal_to_index` for indexes that are NOT stored)
|
next_reveal_index..next_reveal_index,
|
||||||
if next_reveal_index <= target_index && target_index < next_reveal_index + lookahead {
|
),
|
||||||
reveal_to_index = Some(target_index);
|
super::ChangeSet::default(),
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
// we range over indexes that are not stored
|
// We range over the indexes that are not stored and insert their spks in the index.
|
||||||
let range = next_reveal_index + lookahead..=target_index + lookahead;
|
// Indexes from next_reveal_index to next_reveal_index + lookahead are already stored (due
|
||||||
for (new_index, new_spk) in range_descriptor_spks(Cow::Borrowed(descriptor), range) {
|
// to lookahead), so we only range from next_reveal_index + lookahead to target + lookahead
|
||||||
|
let range = next_reveal_index + self.lookahead..=target_index + self.lookahead;
|
||||||
|
for (new_index, new_spk) in SpkIterator::new_with_range(descriptor, range) {
|
||||||
let _inserted = self
|
let _inserted = self
|
||||||
.inner
|
.inner
|
||||||
.insert_spk((keychain.clone(), new_index), new_spk);
|
.insert_spk((keychain.clone(), new_index), new_spk);
|
||||||
debug_assert!(_inserted, "must not have existing spk",);
|
debug_assert!(_inserted, "must not have existing spk");
|
||||||
|
debug_assert!(
|
||||||
// everything after `target_index` is stored for lookahead only
|
has_wildcard || new_index == 0,
|
||||||
if new_index <= target_index {
|
"non-wildcard descriptors must not iterate past index 0"
|
||||||
reveal_to_index = Some(new_index);
|
);
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
match reveal_to_index {
|
let _old_index = self.last_revealed.insert(keychain.clone(), target_index);
|
||||||
Some(index) => {
|
debug_assert!(_old_index < Some(target_index));
|
||||||
let _old_index = self.last_revealed.insert(keychain.clone(), index);
|
(
|
||||||
debug_assert!(_old_index < Some(index));
|
SpkIterator::new_with_range(descriptor.clone(), next_reveal_index..target_index + 1),
|
||||||
(
|
super::ChangeSet(core::iter::once((keychain.clone(), target_index)).collect()),
|
||||||
range_descriptor_spks(
|
)
|
||||||
Cow::Owned(descriptor.clone()),
|
|
||||||
next_reveal_index..index + 1,
|
|
||||||
),
|
|
||||||
DerivationAdditions(core::iter::once((keychain.clone(), index)).collect()),
|
|
||||||
)
|
|
||||||
}
|
|
||||||
None => (
|
|
||||||
range_descriptor_spks(
|
|
||||||
Cow::Owned(descriptor.clone()),
|
|
||||||
next_reveal_index..next_reveal_index,
|
|
||||||
),
|
|
||||||
DerivationAdditions::default(),
|
|
||||||
),
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Attempts to reveal the next script pubkey for `keychain`.
|
/// Attempts to reveal the next script pubkey for `keychain`.
|
||||||
///
|
///
|
||||||
/// Returns the derivation index of the revealed script pubkey, the revealed script pubkey and a
|
/// Returns the derivation index of the revealed script pubkey, the revealed script pubkey and a
|
||||||
/// [`DerivationAdditions`] which represents changes in the last revealed index (if any).
|
/// [`super::ChangeSet`] which represents changes in the last revealed index (if any).
|
||||||
///
|
///
|
||||||
/// When a new script cannot be revealed, we return the last revealed script and an empty
|
/// When a new script cannot be revealed, we return the last revealed script and an empty
|
||||||
/// [`DerivationAdditions`]. There are two scenarios when a new script pubkey cannot be derived:
|
/// [`super::ChangeSet`]. There are two scenarios when a new script pubkey cannot be derived:
|
||||||
///
|
///
|
||||||
/// 1. The descriptor has no wildcard and already has one script revealed.
|
/// 1. The descriptor has no wildcard and already has one script revealed.
|
||||||
/// 2. The descriptor has already revealed scripts up to the numeric bound.
|
/// 2. The descriptor has already revealed scripts up to the numeric bound.
|
||||||
@@ -449,14 +580,14 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
/// # Panics
|
/// # Panics
|
||||||
///
|
///
|
||||||
/// Panics if the `keychain` does not exist.
|
/// Panics if the `keychain` does not exist.
|
||||||
pub fn reveal_next_spk(&mut self, keychain: &K) -> ((u32, &Script), DerivationAdditions<K>) {
|
pub fn reveal_next_spk(&mut self, keychain: &K) -> ((u32, &Script), super::ChangeSet<K>) {
|
||||||
let (next_index, _) = self.next_index(keychain);
|
let (next_index, _) = self.next_index(keychain);
|
||||||
let additions = self.reveal_to_target(keychain, next_index).1;
|
let changeset = self.reveal_to_target(keychain, next_index).1;
|
||||||
let script = self
|
let script = self
|
||||||
.inner
|
.inner
|
||||||
.spk_at_index(&(keychain.clone(), next_index))
|
.spk_at_index(&(keychain.clone(), next_index))
|
||||||
.expect("script must already be stored");
|
.expect("script must already be stored");
|
||||||
((next_index, script), additions)
|
((next_index, script), changeset)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Gets the next unused script pubkey in the keychain. I.e., the script pubkey with the lowest
|
/// Gets the next unused script pubkey in the keychain. I.e., the script pubkey with the lowest
|
||||||
@@ -471,73 +602,59 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
/// # Panics
|
/// # Panics
|
||||||
///
|
///
|
||||||
/// Panics if `keychain` has never been added to the index
|
/// Panics if `keychain` has never been added to the index
|
||||||
pub fn next_unused_spk(&mut self, keychain: &K) -> ((u32, &Script), DerivationAdditions<K>) {
|
pub fn next_unused_spk(&mut self, keychain: &K) -> ((u32, &Script), super::ChangeSet<K>) {
|
||||||
let need_new = self.unused_spks_of_keychain(keychain).next().is_none();
|
let need_new = self.unused_keychain_spks(keychain).next().is_none();
|
||||||
// this rather strange branch is needed because of some lifetime issues
|
// this rather strange branch is needed because of some lifetime issues
|
||||||
if need_new {
|
if need_new {
|
||||||
self.reveal_next_spk(keychain)
|
self.reveal_next_spk(keychain)
|
||||||
} else {
|
} else {
|
||||||
(
|
(
|
||||||
self.unused_spks_of_keychain(keychain)
|
self.unused_keychain_spks(keychain)
|
||||||
.next()
|
.next()
|
||||||
.expect("we already know next exists"),
|
.expect("we already know next exists"),
|
||||||
DerivationAdditions::default(),
|
super::ChangeSet::default(),
|
||||||
)
|
)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Marks the script pubkey at `index` as used even though the tracker hasn't seen an output with it.
|
/// Iterate over all [`OutPoint`]s that point to `TxOut`s with script pubkeys derived from
|
||||||
/// This only has an effect when the `index` had been added to `self` already and was unused.
|
|
||||||
///
|
|
||||||
/// Returns whether the `index` was initially present as `unused`.
|
|
||||||
///
|
|
||||||
/// This is useful when you want to reserve a script pubkey for something but don't want to add
|
|
||||||
/// the transaction output using it to the index yet. Other callers will consider `index` on
|
|
||||||
/// `keychain` used until you call [`unmark_used`].
|
|
||||||
///
|
|
||||||
/// [`unmark_used`]: Self::unmark_used
|
|
||||||
pub fn mark_used(&mut self, keychain: &K, index: u32) -> bool {
|
|
||||||
self.inner.mark_used(&(keychain.clone(), index))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Undoes the effect of [`mark_used`]. Returns whether the `index` is inserted back into
|
|
||||||
/// `unused`.
|
|
||||||
///
|
|
||||||
/// Note that if `self` has scanned an output with this script pubkey, then this will have no
|
|
||||||
/// effect.
|
|
||||||
///
|
|
||||||
/// [`mark_used`]: Self::mark_used
|
|
||||||
pub fn unmark_used(&mut self, keychain: &K, index: u32) -> bool {
|
|
||||||
self.inner.unmark_used(&(keychain.clone(), index))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Iterates over all unused script pubkeys for a `keychain` stored in the index.
|
|
||||||
pub fn unused_spks_of_keychain(
|
|
||||||
&self,
|
|
||||||
keychain: &K,
|
|
||||||
) -> impl DoubleEndedIterator<Item = (u32, &Script)> {
|
|
||||||
let next_index = self.last_revealed.get(keychain).map_or(0, |&v| v + 1);
|
|
||||||
let range = (keychain.clone(), u32::MIN)..(keychain.clone(), next_index);
|
|
||||||
self.inner
|
|
||||||
.unused_spks(range)
|
|
||||||
.map(|((_, i), script)| (*i, script))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Iterates over all the [`OutPoint`] that have a `TxOut` with a script pubkey derived from
|
|
||||||
/// `keychain`.
|
/// `keychain`.
|
||||||
pub fn txouts_of_keychain(
|
///
|
||||||
|
/// Use [`keychain_outpoints_in_range`](KeychainTxOutIndex::keychain_outpoints_in_range) to
|
||||||
|
/// iterate over a specific derivation range.
|
||||||
|
pub fn keychain_outpoints(
|
||||||
&self,
|
&self,
|
||||||
keychain: &K,
|
keychain: &K,
|
||||||
) -> impl DoubleEndedIterator<Item = (u32, OutPoint)> + '_ {
|
) -> impl DoubleEndedIterator<Item = (u32, OutPoint)> + '_ {
|
||||||
|
self.keychain_outpoints_in_range(keychain, ..)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over [`OutPoint`]s that point to `TxOut`s with script pubkeys derived from
|
||||||
|
/// `keychain` in a given derivation `range`.
|
||||||
|
pub fn keychain_outpoints_in_range(
|
||||||
|
&self,
|
||||||
|
keychain: &K,
|
||||||
|
range: impl RangeBounds<u32>,
|
||||||
|
) -> impl DoubleEndedIterator<Item = (u32, OutPoint)> + '_ {
|
||||||
|
let start = match range.start_bound() {
|
||||||
|
Bound::Included(i) => Bound::Included((keychain.clone(), *i)),
|
||||||
|
Bound::Excluded(i) => Bound::Excluded((keychain.clone(), *i)),
|
||||||
|
Bound::Unbounded => Bound::Unbounded,
|
||||||
|
};
|
||||||
|
let end = match range.end_bound() {
|
||||||
|
Bound::Included(i) => Bound::Included((keychain.clone(), *i)),
|
||||||
|
Bound::Excluded(i) => Bound::Excluded((keychain.clone(), *i)),
|
||||||
|
Bound::Unbounded => Bound::Unbounded,
|
||||||
|
};
|
||||||
self.inner
|
self.inner
|
||||||
.outputs_in_range((keychain.clone(), u32::MIN)..(keychain.clone(), u32::MAX))
|
.outputs_in_range((start, end))
|
||||||
.map(|((_, i), op)| (*i, op))
|
.map(|((_, i), op)| (*i, op))
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the highest derivation index of the `keychain` where [`KeychainTxOutIndex`] has
|
/// Returns the highest derivation index of the `keychain` where [`KeychainTxOutIndex`] has
|
||||||
/// found a [`TxOut`] with it's script pubkey.
|
/// found a [`TxOut`] with it's script pubkey.
|
||||||
pub fn last_used_index(&self, keychain: &K) -> Option<u32> {
|
pub fn last_used_index(&self, keychain: &K) -> Option<u32> {
|
||||||
self.txouts_of_keychain(keychain).last().map(|(i, _)| i)
|
self.keychain_outpoints(keychain).last().map(|(i, _)| i)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the highest derivation index of each keychain that [`KeychainTxOutIndex`] has found
|
/// Returns the highest derivation index of each keychain that [`KeychainTxOutIndex`] has found
|
||||||
@@ -552,39 +669,9 @@ impl<K: Clone + Ord + Debug> KeychainTxOutIndex<K> {
|
|||||||
.collect()
|
.collect()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Applies the derivation additions to the [`KeychainTxOutIndex`], extending the number of
|
/// Applies the derivation changeset to the [`KeychainTxOutIndex`], extending the number of
|
||||||
/// derived scripts per keychain, as specified in the `additions`.
|
/// derived scripts per keychain, as specified in the `changeset`.
|
||||||
pub fn apply_additions(&mut self, additions: DerivationAdditions<K>) {
|
pub fn apply_changeset(&mut self, changeset: super::ChangeSet<K>) {
|
||||||
let _ = self.reveal_to_target_multi(&additions.0);
|
let _ = self.reveal_to_target_multi(&changeset.0);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn range_descriptor_spks<'a, R>(
|
|
||||||
descriptor: Cow<'a, Descriptor<DescriptorPublicKey>>,
|
|
||||||
range: R,
|
|
||||||
) -> impl Iterator<Item = (u32, Script)> + Clone + Send + 'a
|
|
||||||
where
|
|
||||||
R: Iterator<Item = u32> + Clone + Send + 'a,
|
|
||||||
{
|
|
||||||
let secp = Secp256k1::verification_only();
|
|
||||||
let has_wildcard = descriptor.has_wildcard();
|
|
||||||
range
|
|
||||||
.into_iter()
|
|
||||||
// non-wildcard descriptors can only have one derivation index (0)
|
|
||||||
.take_while(move |&index| has_wildcard || index == 0)
|
|
||||||
// we can only iterate over non-hardened indices
|
|
||||||
.take_while(|&index| index <= BIP32_MAX_INDEX)
|
|
||||||
.map(
|
|
||||||
move |index| -> Result<_, miniscript::descriptor::ConversionError> {
|
|
||||||
Ok((
|
|
||||||
index,
|
|
||||||
descriptor
|
|
||||||
.at_derivation_index(index)
|
|
||||||
.derived_descriptor(&secp)?
|
|
||||||
.script_pubkey(),
|
|
||||||
))
|
|
||||||
},
|
|
||||||
)
|
|
||||||
.take_while(Result::is_ok)
|
|
||||||
.map(Result::unwrap)
|
|
||||||
}
|
|
||||||
|
|||||||
@@ -1,4 +1,4 @@
|
|||||||
//! This crate is a collection of core structures for [Bitcoin Dev Kit] (alpha release).
|
//! This crate is a collection of core structures for [Bitcoin Dev Kit].
|
||||||
//!
|
//!
|
||||||
//! The goal of this crate is to give wallets the mechanisms needed to:
|
//! The goal of this crate is to give wallets the mechanisms needed to:
|
||||||
//!
|
//!
|
||||||
@@ -12,23 +12,31 @@
|
|||||||
//! you do it synchronously or asynchronously. If you know a fact about the blockchain, you can just
|
//! you do it synchronously or asynchronously. If you know a fact about the blockchain, you can just
|
||||||
//! tell `bdk_chain`'s APIs about it, and that information will be integrated, if it can be done
|
//! tell `bdk_chain`'s APIs about it, and that information will be integrated, if it can be done
|
||||||
//! consistently.
|
//! consistently.
|
||||||
//! 2. Error-free APIs.
|
//! 2. Data persistence agnostic -- `bdk_chain` does not care where you cache on-chain data, what you
|
||||||
//! 3. Data persistence agnostic -- `bdk_chain` does not care where you cache on-chain data, what you
|
//! cache or how you retrieve it from persistent storage.
|
||||||
//! cache or how you fetch it.
|
|
||||||
//!
|
//!
|
||||||
//! [Bitcoin Dev Kit]: https://bitcoindevkit.org/
|
//! [Bitcoin Dev Kit]: https://bitcoindevkit.org/
|
||||||
|
|
||||||
#![no_std]
|
#![no_std]
|
||||||
|
#![warn(missing_docs)]
|
||||||
|
|
||||||
pub use bitcoin;
|
pub use bitcoin;
|
||||||
pub mod chain_graph;
|
|
||||||
mod spk_txout_index;
|
mod spk_txout_index;
|
||||||
pub use spk_txout_index::*;
|
pub use spk_txout_index::*;
|
||||||
mod chain_data;
|
mod chain_data;
|
||||||
pub use chain_data::*;
|
pub use chain_data::*;
|
||||||
|
pub mod indexed_tx_graph;
|
||||||
|
pub use indexed_tx_graph::IndexedTxGraph;
|
||||||
pub mod keychain;
|
pub mod keychain;
|
||||||
pub mod sparse_chain;
|
pub mod local_chain;
|
||||||
mod tx_data_traits;
|
mod tx_data_traits;
|
||||||
pub mod tx_graph;
|
pub mod tx_graph;
|
||||||
pub use tx_data_traits::*;
|
pub use tx_data_traits::*;
|
||||||
|
pub use tx_graph::TxGraph;
|
||||||
|
mod chain_oracle;
|
||||||
|
pub use chain_oracle::*;
|
||||||
|
mod persist;
|
||||||
|
pub use persist::*;
|
||||||
|
|
||||||
#[doc(hidden)]
|
#[doc(hidden)]
|
||||||
pub mod example_utils;
|
pub mod example_utils;
|
||||||
@@ -39,6 +47,10 @@ pub use miniscript;
|
|||||||
mod descriptor_ext;
|
mod descriptor_ext;
|
||||||
#[cfg(feature = "miniscript")]
|
#[cfg(feature = "miniscript")]
|
||||||
pub use descriptor_ext::DescriptorExt;
|
pub use descriptor_ext::DescriptorExt;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
mod spk_iter;
|
||||||
|
#[cfg(feature = "miniscript")]
|
||||||
|
pub use spk_iter::*;
|
||||||
|
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
#[macro_use]
|
#[macro_use]
|
||||||
|
|||||||
799
crates/chain/src/local_chain.rs
Normal file
799
crates/chain/src/local_chain.rs
Normal file
@@ -0,0 +1,799 @@
|
|||||||
|
//! The [`LocalChain`] is a local implementation of [`ChainOracle`].
|
||||||
|
|
||||||
|
use core::convert::Infallible;
|
||||||
|
|
||||||
|
use crate::collections::BTreeMap;
|
||||||
|
use crate::{BlockId, ChainOracle};
|
||||||
|
use alloc::sync::Arc;
|
||||||
|
use bitcoin::block::Header;
|
||||||
|
use bitcoin::BlockHash;
|
||||||
|
|
||||||
|
/// The [`ChangeSet`] represents changes to [`LocalChain`].
|
||||||
|
///
|
||||||
|
/// The key represents the block height, and the value either represents added a new [`CheckPoint`]
|
||||||
|
/// (if [`Some`]), or removing a [`CheckPoint`] (if [`None`]).
|
||||||
|
pub type ChangeSet = BTreeMap<u32, Option<BlockHash>>;
|
||||||
|
|
||||||
|
/// A [`LocalChain`] checkpoint is used to find the agreement point between two chains and as a
|
||||||
|
/// transaction anchor.
|
||||||
|
///
|
||||||
|
/// Each checkpoint contains the height and hash of a block ([`BlockId`]).
|
||||||
|
///
|
||||||
|
/// Internally, checkpoints are nodes of a reference-counted linked-list. This allows the caller to
|
||||||
|
/// cheaply clone a [`CheckPoint`] without copying the whole list and to view the entire chain
|
||||||
|
/// without holding a lock on [`LocalChain`].
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct CheckPoint(Arc<CPInner>);
|
||||||
|
|
||||||
|
/// The internal contents of [`CheckPoint`].
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
struct CPInner {
|
||||||
|
/// Block id (hash and height).
|
||||||
|
block: BlockId,
|
||||||
|
/// Previous checkpoint (if any).
|
||||||
|
prev: Option<Arc<CPInner>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl CheckPoint {
|
||||||
|
/// Construct a new base block at the front of a linked list.
|
||||||
|
pub fn new(block: BlockId) -> Self {
|
||||||
|
Self(Arc::new(CPInner { block, prev: None }))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a checkpoint from a list of [`BlockId`]s in ascending height order.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// This method will error if any of the follow occurs:
|
||||||
|
///
|
||||||
|
/// - The `blocks` iterator is empty, in which case, the error will be `None`.
|
||||||
|
/// - The `blocks` iterator is not in ascending height order.
|
||||||
|
/// - The `blocks` iterator contains multiple [`BlockId`]s of the same height.
|
||||||
|
///
|
||||||
|
/// The error type is the last successful checkpoint constructed (if any).
|
||||||
|
pub fn from_block_ids(
|
||||||
|
block_ids: impl IntoIterator<Item = BlockId>,
|
||||||
|
) -> Result<Self, Option<Self>> {
|
||||||
|
let mut blocks = block_ids.into_iter();
|
||||||
|
let mut acc = CheckPoint::new(blocks.next().ok_or(None)?);
|
||||||
|
for id in blocks {
|
||||||
|
acc = acc.push(id).map_err(Some)?;
|
||||||
|
}
|
||||||
|
Ok(acc)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a checkpoint from the given `header` and block `height`.
|
||||||
|
///
|
||||||
|
/// If `header` is of the genesis block, the checkpoint won't have a [`prev`] node. Otherwise,
|
||||||
|
/// we return a checkpoint linked with the previous block.
|
||||||
|
///
|
||||||
|
/// [`prev`]: CheckPoint::prev
|
||||||
|
pub fn from_header(header: &bitcoin::block::Header, height: u32) -> Self {
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let this_block_id = BlockId { height, hash };
|
||||||
|
|
||||||
|
let prev_height = match height.checked_sub(1) {
|
||||||
|
Some(h) => h,
|
||||||
|
None => return Self::new(this_block_id),
|
||||||
|
};
|
||||||
|
|
||||||
|
let prev_block_id = BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: header.prev_blockhash,
|
||||||
|
};
|
||||||
|
|
||||||
|
CheckPoint::new(prev_block_id)
|
||||||
|
.push(this_block_id)
|
||||||
|
.expect("must construct checkpoint")
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Convenience method to convert the [`CheckPoint`] into an [`Update`].
|
||||||
|
///
|
||||||
|
/// For more information, refer to [`Update`].
|
||||||
|
pub fn into_update(self, introduce_older_blocks: bool) -> Update {
|
||||||
|
Update {
|
||||||
|
tip: self,
|
||||||
|
introduce_older_blocks,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Puts another checkpoint onto the linked list representing the blockchain.
|
||||||
|
///
|
||||||
|
/// Returns an `Err(self)` if the block you are pushing on is not at a greater height that the one you
|
||||||
|
/// are pushing on to.
|
||||||
|
pub fn push(self, block: BlockId) -> Result<Self, Self> {
|
||||||
|
if self.height() < block.height {
|
||||||
|
Ok(Self(Arc::new(CPInner {
|
||||||
|
block,
|
||||||
|
prev: Some(self.0),
|
||||||
|
})))
|
||||||
|
} else {
|
||||||
|
Err(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Extends the checkpoint linked list by a iterator of block ids.
|
||||||
|
///
|
||||||
|
/// Returns an `Err(self)` if there is block which does not have a greater height than the
|
||||||
|
/// previous one.
|
||||||
|
pub fn extend(self, blocks: impl IntoIterator<Item = BlockId>) -> Result<Self, Self> {
|
||||||
|
let mut curr = self.clone();
|
||||||
|
for block in blocks {
|
||||||
|
curr = curr.push(block).map_err(|_| self.clone())?;
|
||||||
|
}
|
||||||
|
Ok(curr)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the [`BlockId`] of the checkpoint.
|
||||||
|
pub fn block_id(&self) -> BlockId {
|
||||||
|
self.0.block
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the height of the checkpoint.
|
||||||
|
pub fn height(&self) -> u32 {
|
||||||
|
self.0.block.height
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the block hash of the checkpoint.
|
||||||
|
pub fn hash(&self) -> BlockHash {
|
||||||
|
self.0.block.hash
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the previous checkpoint in the chain
|
||||||
|
pub fn prev(&self) -> Option<CheckPoint> {
|
||||||
|
self.0.prev.clone().map(CheckPoint)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate from this checkpoint in descending height.
|
||||||
|
pub fn iter(&self) -> CheckPointIter {
|
||||||
|
self.clone().into_iter()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterates over checkpoints backwards.
|
||||||
|
pub struct CheckPointIter {
|
||||||
|
current: Option<Arc<CPInner>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Iterator for CheckPointIter {
|
||||||
|
type Item = CheckPoint;
|
||||||
|
|
||||||
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
|
let current = self.current.clone()?;
|
||||||
|
self.current = current.prev.clone();
|
||||||
|
Some(CheckPoint(current))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl IntoIterator for CheckPoint {
|
||||||
|
type Item = CheckPoint;
|
||||||
|
type IntoIter = CheckPointIter;
|
||||||
|
|
||||||
|
fn into_iter(self) -> Self::IntoIter {
|
||||||
|
CheckPointIter {
|
||||||
|
current: Some(self.0),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Used to update [`LocalChain`].
|
||||||
|
///
|
||||||
|
/// This is used as input for [`LocalChain::apply_update`]. It contains the update's chain `tip` and
|
||||||
|
/// a flag `introduce_older_blocks` which signals whether this update intends to introduce missing
|
||||||
|
/// blocks to the original chain.
|
||||||
|
///
|
||||||
|
/// Block-by-block syncing mechanisms would typically create updates that builds upon the previous
|
||||||
|
/// tip. In this case, `introduce_older_blocks` would be `false`.
|
||||||
|
///
|
||||||
|
/// Script-pubkey based syncing mechanisms may not introduce transactions in a chronological order
|
||||||
|
/// so some updates require introducing older blocks (to anchor older transactions). For
|
||||||
|
/// script-pubkey based syncing, `introduce_older_blocks` would typically be `true`.
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct Update {
|
||||||
|
/// The update chain's new tip.
|
||||||
|
pub tip: CheckPoint,
|
||||||
|
|
||||||
|
/// Whether the update allows for introducing older blocks.
|
||||||
|
///
|
||||||
|
/// Refer to [struct-level documentation] for more.
|
||||||
|
///
|
||||||
|
/// [struct-level documentation]: Update
|
||||||
|
pub introduce_older_blocks: bool,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// This is a local implementation of [`ChainOracle`].
|
||||||
|
#[derive(Debug, Clone)]
|
||||||
|
pub struct LocalChain {
|
||||||
|
tip: CheckPoint,
|
||||||
|
index: BTreeMap<u32, BlockHash>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl PartialEq for LocalChain {
|
||||||
|
fn eq(&self, other: &Self) -> bool {
|
||||||
|
self.index == other.index
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<LocalChain> for BTreeMap<u32, BlockHash> {
|
||||||
|
fn from(value: LocalChain) -> Self {
|
||||||
|
value.index
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl ChainOracle for LocalChain {
|
||||||
|
type Error = Infallible;
|
||||||
|
|
||||||
|
fn is_block_in_chain(
|
||||||
|
&self,
|
||||||
|
block: BlockId,
|
||||||
|
chain_tip: BlockId,
|
||||||
|
) -> Result<Option<bool>, Self::Error> {
|
||||||
|
if block.height > chain_tip.height {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
Ok(
|
||||||
|
match (
|
||||||
|
self.index.get(&block.height),
|
||||||
|
self.index.get(&chain_tip.height),
|
||||||
|
) {
|
||||||
|
(Some(cp), Some(tip_cp)) => Some(*cp == block.hash && *tip_cp == chain_tip.hash),
|
||||||
|
_ => None,
|
||||||
|
},
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn get_chain_tip(&self) -> Result<BlockId, Self::Error> {
|
||||||
|
Ok(self.tip.block_id())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl LocalChain {
|
||||||
|
/// Get the genesis hash.
|
||||||
|
pub fn genesis_hash(&self) -> BlockHash {
|
||||||
|
self.index.get(&0).copied().expect("must have genesis hash")
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct [`LocalChain`] from genesis `hash`.
|
||||||
|
#[must_use]
|
||||||
|
pub fn from_genesis_hash(hash: BlockHash) -> (Self, ChangeSet) {
|
||||||
|
let height = 0;
|
||||||
|
let chain = Self {
|
||||||
|
tip: CheckPoint::new(BlockId { height, hash }),
|
||||||
|
index: core::iter::once((height, hash)).collect(),
|
||||||
|
};
|
||||||
|
let changeset = chain.initial_changeset();
|
||||||
|
(chain, changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a [`LocalChain`] from an initial `changeset`.
|
||||||
|
pub fn from_changeset(changeset: ChangeSet) -> Result<Self, MissingGenesisError> {
|
||||||
|
let genesis_entry = changeset.get(&0).copied().flatten();
|
||||||
|
let genesis_hash = match genesis_entry {
|
||||||
|
Some(hash) => hash,
|
||||||
|
None => return Err(MissingGenesisError),
|
||||||
|
};
|
||||||
|
|
||||||
|
let (mut chain, _) = Self::from_genesis_hash(genesis_hash);
|
||||||
|
chain.apply_changeset(&changeset)?;
|
||||||
|
|
||||||
|
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||||
|
debug_assert!(chain._check_changeset_is_applied(&changeset));
|
||||||
|
|
||||||
|
Ok(chain)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a [`LocalChain`] from a given `checkpoint` tip.
|
||||||
|
pub fn from_tip(tip: CheckPoint) -> Result<Self, MissingGenesisError> {
|
||||||
|
let mut chain = Self {
|
||||||
|
tip,
|
||||||
|
index: BTreeMap::new(),
|
||||||
|
};
|
||||||
|
chain.reindex(0);
|
||||||
|
|
||||||
|
if chain.index.get(&0).copied().is_none() {
|
||||||
|
return Err(MissingGenesisError);
|
||||||
|
}
|
||||||
|
|
||||||
|
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||||
|
Ok(chain)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Constructs a [`LocalChain`] from a [`BTreeMap`] of height to [`BlockHash`].
|
||||||
|
///
|
||||||
|
/// The [`BTreeMap`] enforces the height order. However, the caller must ensure the blocks are
|
||||||
|
/// all of the same chain.
|
||||||
|
pub fn from_blocks(blocks: BTreeMap<u32, BlockHash>) -> Result<Self, MissingGenesisError> {
|
||||||
|
if !blocks.contains_key(&0) {
|
||||||
|
return Err(MissingGenesisError);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut tip: Option<CheckPoint> = None;
|
||||||
|
|
||||||
|
for block in &blocks {
|
||||||
|
match tip {
|
||||||
|
Some(curr) => {
|
||||||
|
tip = Some(
|
||||||
|
curr.push(BlockId::from(block))
|
||||||
|
.expect("BTreeMap is ordered"),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
None => tip = Some(CheckPoint::new(BlockId::from(block))),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let chain = Self {
|
||||||
|
index: blocks,
|
||||||
|
tip: tip.expect("already checked to have genesis"),
|
||||||
|
};
|
||||||
|
|
||||||
|
debug_assert!(chain._check_index_is_consistent_with_tip());
|
||||||
|
Ok(chain)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the highest checkpoint.
|
||||||
|
pub fn tip(&self) -> CheckPoint {
|
||||||
|
self.tip.clone()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Applies the given `update` to the chain.
|
||||||
|
///
|
||||||
|
/// The method returns [`ChangeSet`] on success. This represents the applied changes to `self`.
|
||||||
|
///
|
||||||
|
/// There must be no ambiguity about which of the existing chain's blocks are still valid and
|
||||||
|
/// which are now invalid. That is, the new chain must implicitly connect to a definite block in
|
||||||
|
/// the existing chain and invalidate the block after it (if it exists) by including a block at
|
||||||
|
/// the same height but with a different hash to explicitly exclude it as a connection point.
|
||||||
|
///
|
||||||
|
/// Additionally, an empty chain can be updated with any chain, and a chain with a single block
|
||||||
|
/// can have it's block invalidated by an update chain with a block at the same height but
|
||||||
|
/// different hash.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// An error will occur if the update does not correctly connect with `self`.
|
||||||
|
///
|
||||||
|
/// Refer to [`Update`] for more about the update struct.
|
||||||
|
///
|
||||||
|
/// [module-level documentation]: crate::local_chain
|
||||||
|
pub fn apply_update(&mut self, update: Update) -> Result<ChangeSet, CannotConnectError> {
|
||||||
|
let changeset = merge_chains(
|
||||||
|
self.tip.clone(),
|
||||||
|
update.tip.clone(),
|
||||||
|
update.introduce_older_blocks,
|
||||||
|
)?;
|
||||||
|
// `._check_index_is_consistent_with_tip` and `._check_changeset_is_applied` is called in
|
||||||
|
// `.apply_changeset`
|
||||||
|
self.apply_changeset(&changeset)
|
||||||
|
.map_err(|_| CannotConnectError {
|
||||||
|
try_include_height: 0,
|
||||||
|
})?;
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Update the chain with a given [`Header`] at `height` which you claim is connected to a existing block in the chain.
|
||||||
|
///
|
||||||
|
/// This is useful when you have a block header that you want to record as part of the chain but
|
||||||
|
/// don't necessarily know that the `prev_blockhash` is in the chain.
|
||||||
|
///
|
||||||
|
/// This will usually insert two new [`BlockId`]s into the chain: the header's block and the
|
||||||
|
/// header's `prev_blockhash` block. `connected_to` must already be in the chain but is allowed
|
||||||
|
/// to be `prev_blockhash` (in which case only one new block id will be inserted).
|
||||||
|
/// To be successful, `connected_to` must be chosen carefully so that `LocalChain`'s [update
|
||||||
|
/// rules][`apply_update`] are satisfied.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// [`ApplyHeaderError::InconsistentBlocks`] occurs if the `connected_to` block and the
|
||||||
|
/// [`Header`] is inconsistent. For example, if the `connected_to` block is the same height as
|
||||||
|
/// `header` or `prev_blockhash`, but has a different block hash. Or if the `connected_to`
|
||||||
|
/// height is greater than the header's `height`.
|
||||||
|
///
|
||||||
|
/// [`ApplyHeaderError::CannotConnect`] occurs if the internal call to [`apply_update`] fails.
|
||||||
|
///
|
||||||
|
/// [`apply_update`]: Self::apply_update
|
||||||
|
pub fn apply_header_connected_to(
|
||||||
|
&mut self,
|
||||||
|
header: &Header,
|
||||||
|
height: u32,
|
||||||
|
connected_to: BlockId,
|
||||||
|
) -> Result<ChangeSet, ApplyHeaderError> {
|
||||||
|
let this = BlockId {
|
||||||
|
height,
|
||||||
|
hash: header.block_hash(),
|
||||||
|
};
|
||||||
|
let prev = height.checked_sub(1).map(|prev_height| BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: header.prev_blockhash,
|
||||||
|
});
|
||||||
|
let conn = match connected_to {
|
||||||
|
// `connected_to` can be ignored if same as `this` or `prev` (duplicate)
|
||||||
|
conn if conn == this || Some(conn) == prev => None,
|
||||||
|
// this occurs if:
|
||||||
|
// - `connected_to` height is the same as `prev`, but different hash
|
||||||
|
// - `connected_to` height is the same as `this`, but different hash
|
||||||
|
// - `connected_to` height is greater than `this` (this is not allowed)
|
||||||
|
conn if conn.height >= height.saturating_sub(1) => {
|
||||||
|
return Err(ApplyHeaderError::InconsistentBlocks)
|
||||||
|
}
|
||||||
|
conn => Some(conn),
|
||||||
|
};
|
||||||
|
|
||||||
|
let update = Update {
|
||||||
|
tip: CheckPoint::from_block_ids([conn, prev, Some(this)].into_iter().flatten())
|
||||||
|
.expect("block ids must be in order"),
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
};
|
||||||
|
|
||||||
|
self.apply_update(update)
|
||||||
|
.map_err(ApplyHeaderError::CannotConnect)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Update the chain with a given [`Header`] connecting it with the previous block.
|
||||||
|
///
|
||||||
|
/// This is a convenience method to call [`apply_header_connected_to`] with the `connected_to`
|
||||||
|
/// parameter being `height-1:prev_blockhash`. If there is no previous block (i.e. genesis), we
|
||||||
|
/// use the current block as `connected_to`.
|
||||||
|
///
|
||||||
|
/// [`apply_header_connected_to`]: LocalChain::apply_header_connected_to
|
||||||
|
pub fn apply_header(
|
||||||
|
&mut self,
|
||||||
|
header: &Header,
|
||||||
|
height: u32,
|
||||||
|
) -> Result<ChangeSet, CannotConnectError> {
|
||||||
|
let connected_to = match height.checked_sub(1) {
|
||||||
|
Some(prev_height) => BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: header.prev_blockhash,
|
||||||
|
},
|
||||||
|
None => BlockId {
|
||||||
|
height,
|
||||||
|
hash: header.block_hash(),
|
||||||
|
},
|
||||||
|
};
|
||||||
|
self.apply_header_connected_to(header, height, connected_to)
|
||||||
|
.map_err(|err| match err {
|
||||||
|
ApplyHeaderError::InconsistentBlocks => {
|
||||||
|
unreachable!("connected_to is derived from the block so is always consistent")
|
||||||
|
}
|
||||||
|
ApplyHeaderError::CannotConnect(err) => err,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Apply the given `changeset`.
|
||||||
|
pub fn apply_changeset(&mut self, changeset: &ChangeSet) -> Result<(), MissingGenesisError> {
|
||||||
|
if let Some(start_height) = changeset.keys().next().cloned() {
|
||||||
|
// changes after point of agreement
|
||||||
|
let mut extension = BTreeMap::default();
|
||||||
|
// point of agreement
|
||||||
|
let mut base: Option<CheckPoint> = None;
|
||||||
|
|
||||||
|
for cp in self.iter_checkpoints() {
|
||||||
|
if cp.height() >= start_height {
|
||||||
|
extension.insert(cp.height(), cp.hash());
|
||||||
|
} else {
|
||||||
|
base = Some(cp);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for (&height, &hash) in changeset {
|
||||||
|
match hash {
|
||||||
|
Some(hash) => {
|
||||||
|
extension.insert(height, hash);
|
||||||
|
}
|
||||||
|
None => {
|
||||||
|
extension.remove(&height);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
let new_tip = match base {
|
||||||
|
Some(base) => base
|
||||||
|
.extend(extension.into_iter().map(BlockId::from))
|
||||||
|
.expect("extension is strictly greater than base"),
|
||||||
|
None => LocalChain::from_blocks(extension)?.tip(),
|
||||||
|
};
|
||||||
|
self.tip = new_tip;
|
||||||
|
self.reindex(start_height);
|
||||||
|
|
||||||
|
debug_assert!(self._check_index_is_consistent_with_tip());
|
||||||
|
debug_assert!(self._check_changeset_is_applied(changeset));
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Insert a [`BlockId`].
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// Replacing the block hash of an existing checkpoint will result in an error.
|
||||||
|
pub fn insert_block(&mut self, block_id: BlockId) -> Result<ChangeSet, AlterCheckPointError> {
|
||||||
|
if let Some(&original_hash) = self.index.get(&block_id.height) {
|
||||||
|
if original_hash != block_id.hash {
|
||||||
|
return Err(AlterCheckPointError {
|
||||||
|
height: block_id.height,
|
||||||
|
original_hash,
|
||||||
|
update_hash: Some(block_id.hash),
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
return Ok(ChangeSet::default());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut changeset = ChangeSet::default();
|
||||||
|
changeset.insert(block_id.height, Some(block_id.hash));
|
||||||
|
self.apply_changeset(&changeset)
|
||||||
|
.map_err(|_| AlterCheckPointError {
|
||||||
|
height: 0,
|
||||||
|
original_hash: self.genesis_hash(),
|
||||||
|
update_hash: changeset.get(&0).cloned().flatten(),
|
||||||
|
})?;
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Removes blocks from (and inclusive of) the given `block_id`.
|
||||||
|
///
|
||||||
|
/// This will remove blocks with a height equal or greater than `block_id`, but only if
|
||||||
|
/// `block_id` exists in the chain.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// This will fail with [`MissingGenesisError`] if the caller attempts to disconnect from the
|
||||||
|
/// genesis block.
|
||||||
|
pub fn disconnect_from(&mut self, block_id: BlockId) -> Result<ChangeSet, MissingGenesisError> {
|
||||||
|
if self.index.get(&block_id.height) != Some(&block_id.hash) {
|
||||||
|
return Ok(ChangeSet::default());
|
||||||
|
}
|
||||||
|
|
||||||
|
let changeset = self
|
||||||
|
.index
|
||||||
|
.range(block_id.height..)
|
||||||
|
.map(|(&height, _)| (height, None))
|
||||||
|
.collect::<ChangeSet>();
|
||||||
|
self.apply_changeset(&changeset).map(|_| changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Reindex the heights in the chain from (and including) `from` height
|
||||||
|
fn reindex(&mut self, from: u32) {
|
||||||
|
let _ = self.index.split_off(&from);
|
||||||
|
for cp in self.iter_checkpoints() {
|
||||||
|
if cp.height() < from {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
self.index.insert(cp.height(), cp.hash());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Derives an initial [`ChangeSet`], meaning that it can be applied to an empty chain to
|
||||||
|
/// recover the current chain.
|
||||||
|
pub fn initial_changeset(&self) -> ChangeSet {
|
||||||
|
self.index.iter().map(|(k, v)| (*k, Some(*v))).collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterate over checkpoints in descending height order.
|
||||||
|
pub fn iter_checkpoints(&self) -> CheckPointIter {
|
||||||
|
CheckPointIter {
|
||||||
|
current: Some(self.tip.0.clone()),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the internal index mapping the height to block hash.
|
||||||
|
pub fn blocks(&self) -> &BTreeMap<u32, BlockHash> {
|
||||||
|
&self.index
|
||||||
|
}
|
||||||
|
|
||||||
|
fn _check_index_is_consistent_with_tip(&self) -> bool {
|
||||||
|
let tip_history = self
|
||||||
|
.tip
|
||||||
|
.iter()
|
||||||
|
.map(|cp| (cp.height(), cp.hash()))
|
||||||
|
.collect::<BTreeMap<_, _>>();
|
||||||
|
self.index == tip_history
|
||||||
|
}
|
||||||
|
|
||||||
|
fn _check_changeset_is_applied(&self, changeset: &ChangeSet) -> bool {
|
||||||
|
for (height, exp_hash) in changeset {
|
||||||
|
if self.index.get(height) != exp_hash.as_ref() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
true
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An error which occurs when a [`LocalChain`] is constructed without a genesis checkpoint.
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
pub struct MissingGenesisError;
|
||||||
|
|
||||||
|
impl core::fmt::Display for MissingGenesisError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"cannot construct `LocalChain` without a genesis checkpoint"
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for MissingGenesisError {}
|
||||||
|
|
||||||
|
/// Represents a failure when trying to insert/remove a checkpoint to/from [`LocalChain`].
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
pub struct AlterCheckPointError {
|
||||||
|
/// The checkpoint's height.
|
||||||
|
pub height: u32,
|
||||||
|
/// The original checkpoint's block hash which cannot be replaced/removed.
|
||||||
|
pub original_hash: BlockHash,
|
||||||
|
/// The attempted update to the `original_block` hash.
|
||||||
|
pub update_hash: Option<BlockHash>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for AlterCheckPointError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self.update_hash {
|
||||||
|
Some(update_hash) => write!(
|
||||||
|
f,
|
||||||
|
"failed to insert block at height {}: original={} update={}",
|
||||||
|
self.height, self.original_hash, update_hash
|
||||||
|
),
|
||||||
|
None => write!(
|
||||||
|
f,
|
||||||
|
"failed to remove block at height {}: original={}",
|
||||||
|
self.height, self.original_hash
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for AlterCheckPointError {}
|
||||||
|
|
||||||
|
/// Occurs when an update does not have a common checkpoint with the original chain.
|
||||||
|
#[derive(Clone, Debug, PartialEq)]
|
||||||
|
pub struct CannotConnectError {
|
||||||
|
/// The suggested checkpoint to include to connect the two chains.
|
||||||
|
pub try_include_height: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for CannotConnectError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"introduced chain cannot connect with the original chain, try include height {}",
|
||||||
|
self.try_include_height,
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for CannotConnectError {}
|
||||||
|
|
||||||
|
/// The error type for [`LocalChain::apply_header_connected_to`].
|
||||||
|
#[derive(Debug, Clone, PartialEq)]
|
||||||
|
pub enum ApplyHeaderError {
|
||||||
|
/// Occurs when `connected_to` block conflicts with either the current block or previous block.
|
||||||
|
InconsistentBlocks,
|
||||||
|
/// Occurs when the update cannot connect with the original chain.
|
||||||
|
CannotConnect(CannotConnectError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for ApplyHeaderError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
ApplyHeaderError::InconsistentBlocks => write!(
|
||||||
|
f,
|
||||||
|
"the `connected_to` block conflicts with either the current or previous block"
|
||||||
|
),
|
||||||
|
ApplyHeaderError::CannotConnect(err) => core::fmt::Display::fmt(err, f),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "std")]
|
||||||
|
impl std::error::Error for ApplyHeaderError {}
|
||||||
|
|
||||||
|
fn merge_chains(
|
||||||
|
original_tip: CheckPoint,
|
||||||
|
update_tip: CheckPoint,
|
||||||
|
introduce_older_blocks: bool,
|
||||||
|
) -> Result<ChangeSet, CannotConnectError> {
|
||||||
|
let mut changeset = ChangeSet::default();
|
||||||
|
let mut orig = original_tip.into_iter();
|
||||||
|
let mut update = update_tip.into_iter();
|
||||||
|
let mut curr_orig = None;
|
||||||
|
let mut curr_update = None;
|
||||||
|
let mut prev_orig: Option<CheckPoint> = None;
|
||||||
|
let mut prev_update: Option<CheckPoint> = None;
|
||||||
|
let mut point_of_agreement_found = false;
|
||||||
|
let mut prev_orig_was_invalidated = false;
|
||||||
|
let mut potentially_invalidated_heights = vec![];
|
||||||
|
|
||||||
|
// To find the difference between the new chain and the original we iterate over both of them
|
||||||
|
// from the tip backwards in tandem. We always dealing with the highest one from either chain
|
||||||
|
// first and move to the next highest. The crucial logic is applied when they have blocks at the
|
||||||
|
// same height.
|
||||||
|
loop {
|
||||||
|
if curr_orig.is_none() {
|
||||||
|
curr_orig = orig.next();
|
||||||
|
}
|
||||||
|
if curr_update.is_none() {
|
||||||
|
curr_update = update.next();
|
||||||
|
}
|
||||||
|
|
||||||
|
match (curr_orig.as_ref(), curr_update.as_ref()) {
|
||||||
|
// Update block that doesn't exist in the original chain
|
||||||
|
(o, Some(u)) if Some(u.height()) > o.map(|o| o.height()) => {
|
||||||
|
changeset.insert(u.height(), Some(u.hash()));
|
||||||
|
prev_update = curr_update.take();
|
||||||
|
}
|
||||||
|
// Original block that isn't in the update
|
||||||
|
(Some(o), u) if Some(o.height()) > u.map(|u| u.height()) => {
|
||||||
|
// this block might be gone if an earlier block gets invalidated
|
||||||
|
potentially_invalidated_heights.push(o.height());
|
||||||
|
prev_orig_was_invalidated = false;
|
||||||
|
prev_orig = curr_orig.take();
|
||||||
|
|
||||||
|
// OPTIMIZATION: we have run out of update blocks so we don't need to continue
|
||||||
|
// iterating because there's no possibility of adding anything to changeset.
|
||||||
|
if u.is_none() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
(Some(o), Some(u)) => {
|
||||||
|
if o.hash() == u.hash() {
|
||||||
|
// We have found our point of agreement 🎉 -- we require that the previous (i.e.
|
||||||
|
// higher because we are iterating backwards) block in the original chain was
|
||||||
|
// invalidated (if it exists). This ensures that there is an unambiguous point of
|
||||||
|
// connection to the original chain from the update chain (i.e. we know the
|
||||||
|
// precisely which original blocks are invalid).
|
||||||
|
if !prev_orig_was_invalidated && !point_of_agreement_found {
|
||||||
|
if let (Some(prev_orig), Some(_prev_update)) = (&prev_orig, &prev_update) {
|
||||||
|
return Err(CannotConnectError {
|
||||||
|
try_include_height: prev_orig.height(),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
point_of_agreement_found = true;
|
||||||
|
prev_orig_was_invalidated = false;
|
||||||
|
// OPTIMIZATION 1 -- If we know that older blocks cannot be introduced without
|
||||||
|
// invalidation, we can break after finding the point of agreement.
|
||||||
|
// OPTIMIZATION 2 -- if we have the same underlying pointer at this point, we
|
||||||
|
// can guarantee that no older blocks are introduced.
|
||||||
|
if !introduce_older_blocks || Arc::as_ptr(&o.0) == Arc::as_ptr(&u.0) {
|
||||||
|
return Ok(changeset);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// We have an invalidation height so we set the height to the updated hash and
|
||||||
|
// also purge all the original chain block hashes above this block.
|
||||||
|
changeset.insert(u.height(), Some(u.hash()));
|
||||||
|
for invalidated_height in potentially_invalidated_heights.drain(..) {
|
||||||
|
changeset.insert(invalidated_height, None);
|
||||||
|
}
|
||||||
|
prev_orig_was_invalidated = true;
|
||||||
|
}
|
||||||
|
prev_update = curr_update.take();
|
||||||
|
prev_orig = curr_orig.take();
|
||||||
|
}
|
||||||
|
(None, None) => {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
_ => {
|
||||||
|
unreachable!("compiler cannot tell that everything has been covered")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// When we don't have a point of agreement you can imagine it is implicitly the
|
||||||
|
// genesis block so we need to do the final connectivity check which in this case
|
||||||
|
// just means making sure the entire original chain was invalidated.
|
||||||
|
if !prev_orig_was_invalidated && !point_of_agreement_found {
|
||||||
|
if let Some(prev_orig) = prev_orig {
|
||||||
|
return Err(CannotConnectError {
|
||||||
|
try_include_height: prev_orig.height(),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
109
crates/chain/src/persist.rs
Normal file
109
crates/chain/src/persist.rs
Normal file
@@ -0,0 +1,109 @@
|
|||||||
|
use core::convert::Infallible;
|
||||||
|
|
||||||
|
use crate::Append;
|
||||||
|
|
||||||
|
/// `Persist` wraps a [`PersistBackend`] (`B`) to create a convenient staging area for changes (`C`)
|
||||||
|
/// before they are persisted.
|
||||||
|
///
|
||||||
|
/// Not all changes to the in-memory representation needs to be written to disk right away, so
|
||||||
|
/// [`Persist::stage`] can be used to *stage* changes first and then [`Persist::commit`] can be used
|
||||||
|
/// to write changes to disk.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct Persist<B, C> {
|
||||||
|
backend: B,
|
||||||
|
stage: C,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<B, C> Persist<B, C>
|
||||||
|
where
|
||||||
|
B: PersistBackend<C>,
|
||||||
|
C: Default + Append,
|
||||||
|
{
|
||||||
|
/// Create a new [`Persist`] from [`PersistBackend`].
|
||||||
|
pub fn new(backend: B) -> Self {
|
||||||
|
Self {
|
||||||
|
backend,
|
||||||
|
stage: Default::default(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Stage a `changeset` to be committed later with [`commit`].
|
||||||
|
///
|
||||||
|
/// [`commit`]: Self::commit
|
||||||
|
pub fn stage(&mut self, changeset: C) {
|
||||||
|
self.stage.append(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the changes that have not been committed yet.
|
||||||
|
pub fn staged(&self) -> &C {
|
||||||
|
&self.stage
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Commit the staged changes to the underlying persistence backend.
|
||||||
|
///
|
||||||
|
/// Changes that are committed (if any) are returned.
|
||||||
|
///
|
||||||
|
/// # Error
|
||||||
|
///
|
||||||
|
/// Returns a backend-defined error if this fails.
|
||||||
|
pub fn commit(&mut self) -> Result<Option<C>, B::WriteError> {
|
||||||
|
if self.stage.is_empty() {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
self.backend
|
||||||
|
.write_changes(&self.stage)
|
||||||
|
// if written successfully, take and return `self.stage`
|
||||||
|
.map(|_| Some(core::mem::take(&mut self.stage)))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Stages a new changeset and commits it (along with any other previously staged changes) to
|
||||||
|
/// the persistence backend
|
||||||
|
///
|
||||||
|
/// Convenience method for calling [`stage`] and then [`commit`].
|
||||||
|
///
|
||||||
|
/// [`stage`]: Self::stage
|
||||||
|
/// [`commit`]: Self::commit
|
||||||
|
pub fn stage_and_commit(&mut self, changeset: C) -> Result<Option<C>, B::WriteError> {
|
||||||
|
self.stage(changeset);
|
||||||
|
self.commit()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A persistence backend for [`Persist`].
|
||||||
|
///
|
||||||
|
/// `C` represents the changeset; a datatype that records changes made to in-memory data structures
|
||||||
|
/// that are to be persisted, or retrieved from persistence.
|
||||||
|
pub trait PersistBackend<C> {
|
||||||
|
/// The error the backend returns when it fails to write.
|
||||||
|
type WriteError: core::fmt::Debug;
|
||||||
|
|
||||||
|
/// The error the backend returns when it fails to load changesets `C`.
|
||||||
|
type LoadError: core::fmt::Debug;
|
||||||
|
|
||||||
|
/// Writes a changeset to the persistence backend.
|
||||||
|
///
|
||||||
|
/// It is up to the backend what it does with this. It could store every changeset in a list or
|
||||||
|
/// it inserts the actual changes into a more structured database. All it needs to guarantee is
|
||||||
|
/// that [`load_from_persistence`] restores a keychain tracker to what it should be if all
|
||||||
|
/// changesets had been applied sequentially.
|
||||||
|
///
|
||||||
|
/// [`load_from_persistence`]: Self::load_from_persistence
|
||||||
|
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError>;
|
||||||
|
|
||||||
|
/// Return the aggregate changeset `C` from persistence.
|
||||||
|
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError>;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> PersistBackend<C> for () {
|
||||||
|
type WriteError = Infallible;
|
||||||
|
|
||||||
|
type LoadError = Infallible;
|
||||||
|
|
||||||
|
fn write_changes(&mut self, _changeset: &C) -> Result<(), Self::WriteError> {
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||||
|
Ok(None)
|
||||||
|
}
|
||||||
|
}
|
||||||
File diff suppressed because it is too large
Load Diff
274
crates/chain/src/spk_iter.rs
Normal file
274
crates/chain/src/spk_iter.rs
Normal file
@@ -0,0 +1,274 @@
|
|||||||
|
use crate::{
|
||||||
|
bitcoin::{secp256k1::Secp256k1, ScriptBuf},
|
||||||
|
miniscript::{Descriptor, DescriptorPublicKey},
|
||||||
|
};
|
||||||
|
use core::{borrow::Borrow, ops::Bound, ops::RangeBounds};
|
||||||
|
|
||||||
|
/// Maximum [BIP32](https://bips.xyz/32) derivation index.
|
||||||
|
pub const BIP32_MAX_INDEX: u32 = (1 << 31) - 1;
|
||||||
|
|
||||||
|
/// An iterator for derived script pubkeys.
|
||||||
|
///
|
||||||
|
/// [`SpkIterator`] is an implementation of the [`Iterator`] trait which possesses its own `next()`
|
||||||
|
/// and `nth()` functions, both of which circumvent the unnecessary intermediate derivations required
|
||||||
|
/// when using their default implementations.
|
||||||
|
///
|
||||||
|
/// ## Examples
|
||||||
|
///
|
||||||
|
/// ```
|
||||||
|
/// use bdk_chain::SpkIterator;
|
||||||
|
/// # use miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
|
/// # use bitcoin::{secp256k1::Secp256k1};
|
||||||
|
/// # use std::str::FromStr;
|
||||||
|
/// # let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
/// # let (descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||||
|
/// # let external_spk_0 = descriptor.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
/// # let external_spk_3 = descriptor.at_derivation_index(3).unwrap().script_pubkey();
|
||||||
|
/// # let external_spk_4 = descriptor.at_derivation_index(4).unwrap().script_pubkey();
|
||||||
|
///
|
||||||
|
/// // Creates a new script pubkey iterator starting at 0 from a descriptor.
|
||||||
|
/// let mut spk_iter = SpkIterator::new(&descriptor);
|
||||||
|
/// assert_eq!(spk_iter.next(), Some((0, external_spk_0)));
|
||||||
|
/// assert_eq!(spk_iter.next(), None);
|
||||||
|
/// ```
|
||||||
|
#[derive(Clone)]
|
||||||
|
pub struct SpkIterator<D> {
|
||||||
|
next_index: u32,
|
||||||
|
end: u32,
|
||||||
|
descriptor: D,
|
||||||
|
secp: Secp256k1<bitcoin::secp256k1::VerifyOnly>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<D> SpkIterator<D>
|
||||||
|
where
|
||||||
|
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||||
|
{
|
||||||
|
/// Create a new script pubkey iterator from `descriptor`.
|
||||||
|
///
|
||||||
|
/// This iterates from derivation index 0 and stops at index 0x7FFFFFFF (as specified in
|
||||||
|
/// BIP-32). Non-wildcard descriptors will only return one script pubkey at derivation index 0.
|
||||||
|
///
|
||||||
|
/// Use [`new_with_range`](SpkIterator::new_with_range) to create an iterator with a specified
|
||||||
|
/// derivation index range.
|
||||||
|
pub fn new(descriptor: D) -> Self {
|
||||||
|
SpkIterator::new_with_range(descriptor, 0..=BIP32_MAX_INDEX)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Create a new script pubkey iterator from `descriptor` and a given `range`.
|
||||||
|
///
|
||||||
|
/// Non-wildcard descriptors will only emit a single script pubkey (at derivation index 0).
|
||||||
|
/// Wildcard descriptors have an end-bound of 0x7FFFFFFF (inclusive).
|
||||||
|
///
|
||||||
|
/// Refer to [`new`](SpkIterator::new) for more.
|
||||||
|
pub fn new_with_range<R>(descriptor: D, range: R) -> Self
|
||||||
|
where
|
||||||
|
R: RangeBounds<u32>,
|
||||||
|
{
|
||||||
|
let start = match range.start_bound() {
|
||||||
|
Bound::Included(start) => *start,
|
||||||
|
Bound::Excluded(start) => *start + 1,
|
||||||
|
Bound::Unbounded => u32::MIN,
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut end = match range.end_bound() {
|
||||||
|
Bound::Included(end) => *end + 1,
|
||||||
|
Bound::Excluded(end) => *end,
|
||||||
|
Bound::Unbounded => u32::MAX,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Because `end` is exclusive, we want the maximum value to be BIP32_MAX_INDEX + 1.
|
||||||
|
end = end.min(BIP32_MAX_INDEX + 1);
|
||||||
|
|
||||||
|
Self {
|
||||||
|
next_index: start,
|
||||||
|
end,
|
||||||
|
descriptor,
|
||||||
|
secp: Secp256k1::verification_only(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the internal descriptor.
|
||||||
|
pub fn descriptor(&self) -> &D {
|
||||||
|
&self.descriptor
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<D> Iterator for SpkIterator<D>
|
||||||
|
where
|
||||||
|
D: Borrow<Descriptor<DescriptorPublicKey>>,
|
||||||
|
{
|
||||||
|
type Item = (u32, ScriptBuf);
|
||||||
|
|
||||||
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
|
// For non-wildcard descriptors, we expect the first element to be Some((0, spk)), then None after.
|
||||||
|
// For wildcard descriptors, we expect it to keep iterating until exhausted.
|
||||||
|
if self.next_index >= self.end {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If the descriptor is non-wildcard, only index 0 will return an spk.
|
||||||
|
if !self.descriptor.borrow().has_wildcard() && self.next_index != 0 {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
let script = self
|
||||||
|
.descriptor
|
||||||
|
.borrow()
|
||||||
|
.derived_descriptor(&self.secp, self.next_index)
|
||||||
|
.expect("the descriptor cannot need hardened derivation")
|
||||||
|
.script_pubkey();
|
||||||
|
let output = (self.next_index, script);
|
||||||
|
|
||||||
|
self.next_index += 1;
|
||||||
|
|
||||||
|
Some(output)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn nth(&mut self, n: usize) -> Option<Self::Item> {
|
||||||
|
self.next_index = self
|
||||||
|
.next_index
|
||||||
|
.saturating_add(u32::try_from(n).unwrap_or(u32::MAX));
|
||||||
|
self.next()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod test {
|
||||||
|
use crate::{
|
||||||
|
bitcoin::secp256k1::Secp256k1,
|
||||||
|
keychain::KeychainTxOutIndex,
|
||||||
|
miniscript::{Descriptor, DescriptorPublicKey},
|
||||||
|
spk_iter::{SpkIterator, BIP32_MAX_INDEX},
|
||||||
|
};
|
||||||
|
|
||||||
|
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||||
|
enum TestKeychain {
|
||||||
|
External,
|
||||||
|
Internal,
|
||||||
|
}
|
||||||
|
|
||||||
|
fn init_txout_index() -> (
|
||||||
|
KeychainTxOutIndex<TestKeychain>,
|
||||||
|
Descriptor<DescriptorPublicKey>,
|
||||||
|
Descriptor<DescriptorPublicKey>,
|
||||||
|
) {
|
||||||
|
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::new(0);
|
||||||
|
|
||||||
|
let secp = Secp256k1::signing_only();
|
||||||
|
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||||
|
let (internal_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/*)").unwrap();
|
||||||
|
|
||||||
|
txout_index.add_keychain(TestKeychain::External, external_descriptor.clone());
|
||||||
|
txout_index.add_keychain(TestKeychain::Internal, internal_descriptor.clone());
|
||||||
|
|
||||||
|
(txout_index, external_descriptor, internal_descriptor)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[allow(clippy::iter_nth_zero)]
|
||||||
|
#[rustfmt::skip]
|
||||||
|
fn test_spkiterator_wildcard() {
|
||||||
|
let (_, external_desc, _) = init_txout_index();
|
||||||
|
let external_spk_0 = external_desc.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
let external_spk_16 = external_desc.at_derivation_index(16).unwrap().script_pubkey();
|
||||||
|
let external_spk_20 = external_desc.at_derivation_index(20).unwrap().script_pubkey();
|
||||||
|
let external_spk_21 = external_desc.at_derivation_index(21).unwrap().script_pubkey();
|
||||||
|
let external_spk_max = external_desc.at_derivation_index(BIP32_MAX_INDEX).unwrap().script_pubkey();
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new(&external_desc);
|
||||||
|
let max_index = BIP32_MAX_INDEX - 22;
|
||||||
|
|
||||||
|
assert_eq!(external_spk.next(), Some((0, external_spk_0)));
|
||||||
|
assert_eq!(external_spk.nth(15), Some((16, external_spk_16)));
|
||||||
|
assert_eq!(external_spk.nth(3), Some((20, external_spk_20.clone())));
|
||||||
|
assert_eq!(external_spk.next(), Some((21, external_spk_21)));
|
||||||
|
assert_eq!(
|
||||||
|
external_spk.nth(max_index as usize),
|
||||||
|
Some((BIP32_MAX_INDEX, external_spk_max))
|
||||||
|
);
|
||||||
|
assert_eq!(external_spk.nth(0), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||||
|
assert_eq!(external_spk.nth(20), Some((20, external_spk_20)));
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&external_desc, 0..21);
|
||||||
|
assert_eq!(external_spk.nth(21), None);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
#[allow(clippy::iter_nth_zero)]
|
||||||
|
fn test_spkiterator_non_wildcard() {
|
||||||
|
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
|
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||||
|
let external_spk_0 = no_wildcard_descriptor
|
||||||
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey();
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.next(), Some((0, external_spk_0.clone())));
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new(&no_wildcard_descriptor);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.nth(0), Some((0, external_spk_0.clone())));
|
||||||
|
assert_eq!(external_spk.nth(0), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..0);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..1);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.nth(0), Some((0, external_spk_0.clone())));
|
||||||
|
assert_eq!(external_spk.next(), None);
|
||||||
|
|
||||||
|
// We test that using new_with_range with range_len > 1 gives back an iterator with
|
||||||
|
// range_len = 1
|
||||||
|
let mut external_spk = SpkIterator::new_with_range(&no_wildcard_descriptor, 0..10);
|
||||||
|
|
||||||
|
assert_eq!(external_spk.nth(0), Some((0, external_spk_0)));
|
||||||
|
assert_eq!(external_spk.nth(0), None);
|
||||||
|
|
||||||
|
// non index-0 should NOT return an spk
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..1).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..=1).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..2).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 1..=2).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 10..11).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
SpkIterator::new_with_range(&no_wildcard_descriptor, 10..=10).next(),
|
||||||
|
None
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// The following dummy traits were created to test if SpkIterator is working properly.
|
||||||
|
trait TestSendStatic: Send + 'static {
|
||||||
|
fn test(&self) -> u32 {
|
||||||
|
20
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestSendStatic for SpkIterator<Descriptor<DescriptorPublicKey>> {
|
||||||
|
fn test(&self) -> u32 {
|
||||||
|
20
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -2,15 +2,16 @@ use core::ops::RangeBounds;
|
|||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
collections::{hash_map::Entry, BTreeMap, BTreeSet, HashMap},
|
collections::{hash_map::Entry, BTreeMap, BTreeSet, HashMap},
|
||||||
ForEachTxOut,
|
indexed_tx_graph::Indexer,
|
||||||
};
|
};
|
||||||
use bitcoin::{self, OutPoint, Script, Transaction, TxOut, Txid};
|
use bitcoin::{self, OutPoint, Script, ScriptBuf, Transaction, TxOut, Txid};
|
||||||
|
|
||||||
/// An index storing [`TxOut`]s that have a script pubkey that matches those in a list.
|
/// An index storing [`TxOut`]s that have a script pubkey that matches those in a list.
|
||||||
///
|
///
|
||||||
/// The basic idea is that you insert script pubkeys you care about into the index with
|
/// The basic idea is that you insert script pubkeys you care about into the index with
|
||||||
/// [`insert_spk`] and then when you call [`scan`], the index will look at any txouts you pass in and
|
/// [`insert_spk`] and then when you call [`Indexer::index_tx`] or [`Indexer::index_txout`], the
|
||||||
/// store and index any txouts matching one of its script pubkeys.
|
/// index will look at any txouts you pass in and store and index any txouts matching one of its
|
||||||
|
/// script pubkeys.
|
||||||
///
|
///
|
||||||
/// Each script pubkey is associated with an application-defined index script index `I`, which must be
|
/// Each script pubkey is associated with an application-defined index script index `I`, which must be
|
||||||
/// [`Ord`]. Usually, this is used to associate the derivation index of the script pubkey or even a
|
/// [`Ord`]. Usually, this is used to associate the derivation index of the script pubkey or even a
|
||||||
@@ -19,19 +20,18 @@ use bitcoin::{self, OutPoint, Script, Transaction, TxOut, Txid};
|
|||||||
/// Note there is no harm in scanning transactions that disappear from the blockchain or were never
|
/// Note there is no harm in scanning transactions that disappear from the blockchain or were never
|
||||||
/// in there in the first place. `SpkTxOutIndex` is intentionally *monotone* -- you cannot delete or
|
/// in there in the first place. `SpkTxOutIndex` is intentionally *monotone* -- you cannot delete or
|
||||||
/// modify txouts that have been indexed. To find out which txouts from the index are actually in the
|
/// modify txouts that have been indexed. To find out which txouts from the index are actually in the
|
||||||
/// chain or unspent, you must use other sources of information like a [`SparseChain`].
|
/// chain or unspent, you must use other sources of information like a [`TxGraph`].
|
||||||
///
|
///
|
||||||
/// [`TxOut`]: bitcoin::TxOut
|
/// [`TxOut`]: bitcoin::TxOut
|
||||||
/// [`insert_spk`]: Self::insert_spk
|
/// [`insert_spk`]: Self::insert_spk
|
||||||
/// [`Ord`]: core::cmp::Ord
|
/// [`Ord`]: core::cmp::Ord
|
||||||
/// [`scan`]: Self::scan
|
/// [`TxGraph`]: crate::tx_graph::TxGraph
|
||||||
/// [`SparseChain`]: crate::sparse_chain::SparseChain
|
|
||||||
#[derive(Clone, Debug)]
|
#[derive(Clone, Debug)]
|
||||||
pub struct SpkTxOutIndex<I> {
|
pub struct SpkTxOutIndex<I> {
|
||||||
/// script pubkeys ordered by index
|
/// script pubkeys ordered by index
|
||||||
spks: BTreeMap<I, Script>,
|
spks: BTreeMap<I, ScriptBuf>,
|
||||||
/// A reverse lookup from spk to spk index
|
/// A reverse lookup from spk to spk index
|
||||||
spk_indices: HashMap<Script, I>,
|
spk_indices: HashMap<ScriptBuf, I>,
|
||||||
/// The set of unused indexes.
|
/// The set of unused indexes.
|
||||||
unused: BTreeSet<I>,
|
unused: BTreeSet<I>,
|
||||||
/// Lookup index and txout by outpoint.
|
/// Lookup index and txout by outpoint.
|
||||||
@@ -52,41 +52,47 @@ impl<I> Default for SpkTxOutIndex<I> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// This macro is used instead of a member function of `SpkTxOutIndex`, which would result in a
|
impl<I: Clone + Ord> Indexer for SpkTxOutIndex<I> {
|
||||||
/// compiler error[E0521]: "borrowed data escapes out of closure" when we attempt to take a
|
type ChangeSet = ();
|
||||||
/// reference out of the `ForEachTxOut` closure during scanning.
|
|
||||||
macro_rules! scan_txout {
|
fn index_txout(&mut self, outpoint: OutPoint, txout: &TxOut) -> Self::ChangeSet {
|
||||||
($self:ident, $op:expr, $txout:expr) => {{
|
self.scan_txout(outpoint, txout);
|
||||||
let spk_i = $self.spk_indices.get(&$txout.script_pubkey);
|
Default::default()
|
||||||
if let Some(spk_i) = spk_i {
|
}
|
||||||
$self.txouts.insert($op, (spk_i.clone(), $txout.clone()));
|
|
||||||
$self.spk_txouts.insert((spk_i.clone(), $op));
|
fn index_tx(&mut self, tx: &Transaction) -> Self::ChangeSet {
|
||||||
$self.unused.remove(&spk_i);
|
self.scan(tx);
|
||||||
}
|
Default::default()
|
||||||
spk_i
|
}
|
||||||
}};
|
|
||||||
|
fn initial_changeset(&self) -> Self::ChangeSet {}
|
||||||
|
|
||||||
|
fn apply_changeset(&mut self, _changeset: Self::ChangeSet) {
|
||||||
|
// This applies nothing.
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_tx_relevant(&self, tx: &Transaction) -> bool {
|
||||||
|
self.is_relevant(tx)
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
||||||
/// Scans an object containing many txouts.
|
/// Scans a transaction's outputs for matching script pubkeys.
|
||||||
///
|
///
|
||||||
/// Typically, this is used in two situations:
|
/// Typically, this is used in two situations:
|
||||||
///
|
///
|
||||||
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
/// 1. After loading transaction data from the disk, you may scan over all the txouts to restore all
|
||||||
/// your txouts.
|
/// your txouts.
|
||||||
/// 2. When getting new data from the chain, you usually scan it before incorporating it into your chain state.
|
/// 2. When getting new data from the chain, you usually scan it before incorporating it into your chain state.
|
||||||
///
|
pub fn scan(&mut self, tx: &Transaction) -> BTreeSet<I> {
|
||||||
/// See [`ForEachTxout`] for the types that support this.
|
|
||||||
///
|
|
||||||
/// [`ForEachTxout`]: crate::ForEachTxOut
|
|
||||||
pub fn scan(&mut self, txouts: &impl ForEachTxOut) -> BTreeSet<I> {
|
|
||||||
let mut scanned_indices = BTreeSet::new();
|
let mut scanned_indices = BTreeSet::new();
|
||||||
|
let txid = tx.txid();
|
||||||
txouts.for_each_txout(|(op, txout)| {
|
for (i, txout) in tx.output.iter().enumerate() {
|
||||||
if let Some(spk_i) = scan_txout!(self, op, txout) {
|
let op = OutPoint::new(txid, i as u32);
|
||||||
|
if let Some(spk_i) = self.scan_txout(op, txout) {
|
||||||
scanned_indices.insert(spk_i.clone());
|
scanned_indices.insert(spk_i.clone());
|
||||||
}
|
}
|
||||||
});
|
}
|
||||||
|
|
||||||
scanned_indices
|
scanned_indices
|
||||||
}
|
}
|
||||||
@@ -94,7 +100,18 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
|||||||
/// Scan a single `TxOut` for a matching script pubkey and returns the index that matches the
|
/// Scan a single `TxOut` for a matching script pubkey and returns the index that matches the
|
||||||
/// script pubkey (if any).
|
/// script pubkey (if any).
|
||||||
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> Option<&I> {
|
pub fn scan_txout(&mut self, op: OutPoint, txout: &TxOut) -> Option<&I> {
|
||||||
scan_txout!(self, op, txout)
|
let spk_i = self.spk_indices.get(&txout.script_pubkey);
|
||||||
|
if let Some(spk_i) = spk_i {
|
||||||
|
self.txouts.insert(op, (spk_i.clone(), txout.clone()));
|
||||||
|
self.spk_txouts.insert((spk_i.clone(), op));
|
||||||
|
self.unused.remove(spk_i);
|
||||||
|
}
|
||||||
|
spk_i
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get a reference to the set of indexed outpoints.
|
||||||
|
pub fn outpoints(&self) -> &BTreeSet<(I, OutPoint)> {
|
||||||
|
&self.spk_txouts
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Iterate over all known txouts that spend to tracked script pubkeys.
|
/// Iterate over all known txouts that spend to tracked script pubkeys.
|
||||||
@@ -124,11 +141,11 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
|||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
use core::ops::Bound::*;
|
use core::ops::Bound::*;
|
||||||
let min_op = OutPoint {
|
let min_op = OutPoint {
|
||||||
txid: Txid::from_inner([0x00; 32]),
|
txid: Txid::all_zeros(),
|
||||||
vout: u32::MIN,
|
vout: u32::MIN,
|
||||||
};
|
};
|
||||||
let max_op = OutPoint {
|
let max_op = OutPoint {
|
||||||
txid: Txid::from_inner([0xff; 32]),
|
txid: Txid::from_byte_array([0xff; Txid::LEN]),
|
||||||
vout: u32::MAX,
|
vout: u32::MAX,
|
||||||
};
|
};
|
||||||
|
|
||||||
@@ -151,27 +168,25 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
|||||||
///
|
///
|
||||||
/// Returns `None` if the `TxOut` hasn't been scanned or if nothing matching was found there.
|
/// Returns `None` if the `TxOut` hasn't been scanned or if nothing matching was found there.
|
||||||
pub fn txout(&self, outpoint: OutPoint) -> Option<(&I, &TxOut)> {
|
pub fn txout(&self, outpoint: OutPoint) -> Option<(&I, &TxOut)> {
|
||||||
self.txouts
|
self.txouts.get(&outpoint).map(|v| (&v.0, &v.1))
|
||||||
.get(&outpoint)
|
|
||||||
.map(|(spk_i, txout)| (spk_i, txout))
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the script that has been inserted at the `index`.
|
/// Returns the script that has been inserted at the `index`.
|
||||||
///
|
///
|
||||||
/// If that index hasn't been inserted yet, it will return `None`.
|
/// If that index hasn't been inserted yet, it will return `None`.
|
||||||
pub fn spk_at_index(&self, index: &I) -> Option<&Script> {
|
pub fn spk_at_index(&self, index: &I) -> Option<&Script> {
|
||||||
self.spks.get(index)
|
self.spks.get(index).map(|s| s.as_script())
|
||||||
}
|
}
|
||||||
|
|
||||||
/// The script pubkeys that are being tracked by the index.
|
/// The script pubkeys that are being tracked by the index.
|
||||||
pub fn all_spks(&self) -> &BTreeMap<I, Script> {
|
pub fn all_spks(&self) -> &BTreeMap<I, ScriptBuf> {
|
||||||
&self.spks
|
&self.spks
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Adds a script pubkey to scan for. Returns `false` and does nothing if spk already exists in the map
|
/// Adds a script pubkey to scan for. Returns `false` and does nothing if spk already exists in the map
|
||||||
///
|
///
|
||||||
/// the index will look for outputs spending to this spk whenever it scans new data.
|
/// the index will look for outputs spending to this spk whenever it scans new data.
|
||||||
pub fn insert_spk(&mut self, index: I, spk: Script) -> bool {
|
pub fn insert_spk(&mut self, index: I, spk: ScriptBuf) -> bool {
|
||||||
match self.spk_indices.entry(spk.clone()) {
|
match self.spk_indices.entry(spk.clone()) {
|
||||||
Entry::Vacant(value) => {
|
Entry::Vacant(value) => {
|
||||||
value.insert(index.clone());
|
value.insert(index.clone());
|
||||||
@@ -200,7 +215,7 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
|||||||
/// let unused_change_spks =
|
/// let unused_change_spks =
|
||||||
/// txout_index.unused_spks((change_index, u32::MIN)..(change_index, u32::MAX));
|
/// txout_index.unused_spks((change_index, u32::MIN)..(change_index, u32::MAX));
|
||||||
/// ```
|
/// ```
|
||||||
pub fn unused_spks<R>(&self, range: R) -> impl DoubleEndedIterator<Item = (&I, &Script)>
|
pub fn unused_spks<R>(&self, range: R) -> impl DoubleEndedIterator<Item = (&I, &Script)> + Clone
|
||||||
where
|
where
|
||||||
R: RangeBounds<I>,
|
R: RangeBounds<I>,
|
||||||
{
|
{
|
||||||
@@ -258,8 +273,8 @@ impl<I: Clone + Ord> SpkTxOutIndex<I> {
|
|||||||
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
/// Computes total input value going from script pubkeys in the index (sent) and the total output
|
||||||
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
/// value going to script pubkeys in the index (received) in `tx`. For the `sent` to be computed
|
||||||
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
/// correctly, the output being spent must have already been scanned by the index. Calculating
|
||||||
/// received just uses the transaction outputs directly, so it will be correct even if it has not
|
/// received just uses the [`Transaction`] outputs directly, so it will be correct even if it has
|
||||||
/// been scanned.
|
/// not been scanned.
|
||||||
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
pub fn sent_and_received(&self, tx: &Transaction) -> (u64, u64) {
|
||||||
let mut sent = 0;
|
let mut sent = 0;
|
||||||
let mut received = 0;
|
let mut received = 0;
|
||||||
|
|||||||
@@ -1,33 +1,185 @@
|
|||||||
use bitcoin::{Block, OutPoint, Transaction, TxOut};
|
use crate::collections::BTreeMap;
|
||||||
|
use crate::collections::BTreeSet;
|
||||||
|
use crate::BlockId;
|
||||||
|
use alloc::vec::Vec;
|
||||||
|
|
||||||
/// Trait to do something with every txout contained in a structure.
|
/// Trait that "anchors" blockchain data to a specific block of height and hash.
|
||||||
///
|
///
|
||||||
/// We would prefer to just work with things that can give us an `Iterator<Item=(OutPoint, &TxOut)>`
|
/// If transaction A is anchored in block B, and block B is in the best chain, we can
|
||||||
/// here, but rust's type system makes it extremely hard to do this (without trait objects).
|
/// assume that transaction A is also confirmed in the best chain. This does not necessarily mean
|
||||||
pub trait ForEachTxOut {
|
/// that transaction A is confirmed in block B. It could also mean transaction A is confirmed in a
|
||||||
/// The provided closure `f` will be called with each `outpoint/txout` pair.
|
/// parent block of B.
|
||||||
fn for_each_txout(&self, f: impl FnMut((OutPoint, &TxOut)));
|
///
|
||||||
|
/// Every [`Anchor`] implementation must contain a [`BlockId`] parameter, and must implement
|
||||||
|
/// [`Ord`]. When implementing [`Ord`], the anchors' [`BlockId`]s should take precedence
|
||||||
|
/// over other elements inside the [`Anchor`]s for comparison purposes, i.e., you should first
|
||||||
|
/// compare the anchors' [`BlockId`]s and then care about the rest.
|
||||||
|
///
|
||||||
|
/// The example shows different types of anchors:
|
||||||
|
/// ```
|
||||||
|
/// # use bdk_chain::local_chain::LocalChain;
|
||||||
|
/// # use bdk_chain::tx_graph::TxGraph;
|
||||||
|
/// # use bdk_chain::BlockId;
|
||||||
|
/// # use bdk_chain::ConfirmationHeightAnchor;
|
||||||
|
/// # use bdk_chain::ConfirmationTimeHeightAnchor;
|
||||||
|
/// # use bdk_chain::example_utils::*;
|
||||||
|
/// # use bitcoin::hashes::Hash;
|
||||||
|
/// // Initialize the local chain with two blocks.
|
||||||
|
/// let chain = LocalChain::from_blocks(
|
||||||
|
/// [
|
||||||
|
/// (1, Hash::hash("first".as_bytes())),
|
||||||
|
/// (2, Hash::hash("second".as_bytes())),
|
||||||
|
/// ]
|
||||||
|
/// .into_iter()
|
||||||
|
/// .collect(),
|
||||||
|
/// );
|
||||||
|
///
|
||||||
|
/// // Transaction to be inserted into `TxGraph`s with different anchor types.
|
||||||
|
/// let tx = tx_from_hex(RAW_TX_1);
|
||||||
|
///
|
||||||
|
/// // Insert `tx` into a `TxGraph` that uses `BlockId` as the anchor type.
|
||||||
|
/// // When a transaction is anchored with `BlockId`, the anchor block and the confirmation block of
|
||||||
|
/// // the transaction is the same block.
|
||||||
|
/// let mut graph_a = TxGraph::<BlockId>::default();
|
||||||
|
/// let _ = graph_a.insert_tx(tx.clone());
|
||||||
|
/// graph_a.insert_anchor(
|
||||||
|
/// tx.txid(),
|
||||||
|
/// BlockId {
|
||||||
|
/// height: 1,
|
||||||
|
/// hash: Hash::hash("first".as_bytes()),
|
||||||
|
/// },
|
||||||
|
/// );
|
||||||
|
///
|
||||||
|
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationHeightAnchor` as the anchor type.
|
||||||
|
/// // This anchor records the anchor block and the confirmation height of the transaction.
|
||||||
|
/// // When a transaction is anchored with `ConfirmationHeightAnchor`, the anchor block and
|
||||||
|
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||||
|
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||||
|
/// let mut graph_b = TxGraph::<ConfirmationHeightAnchor>::default();
|
||||||
|
/// let _ = graph_b.insert_tx(tx.clone());
|
||||||
|
/// graph_b.insert_anchor(
|
||||||
|
/// tx.txid(),
|
||||||
|
/// ConfirmationHeightAnchor {
|
||||||
|
/// anchor_block: BlockId {
|
||||||
|
/// height: 2,
|
||||||
|
/// hash: Hash::hash("second".as_bytes()),
|
||||||
|
/// },
|
||||||
|
/// confirmation_height: 1,
|
||||||
|
/// },
|
||||||
|
/// );
|
||||||
|
///
|
||||||
|
/// // Insert `tx` into a `TxGraph` that uses `ConfirmationTimeHeightAnchor` as the anchor type.
|
||||||
|
/// // This anchor records the anchor block, the confirmation height and time of the transaction.
|
||||||
|
/// // When a transaction is anchored with `ConfirmationTimeHeightAnchor`, the anchor block and
|
||||||
|
/// // confirmation block can be different. However, the confirmation block cannot be higher than
|
||||||
|
/// // the anchor block and both blocks must be in the same chain for the anchor to be valid.
|
||||||
|
/// let mut graph_c = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||||
|
/// let _ = graph_c.insert_tx(tx.clone());
|
||||||
|
/// graph_c.insert_anchor(
|
||||||
|
/// tx.txid(),
|
||||||
|
/// ConfirmationTimeHeightAnchor {
|
||||||
|
/// anchor_block: BlockId {
|
||||||
|
/// height: 2,
|
||||||
|
/// hash: Hash::hash("third".as_bytes()),
|
||||||
|
/// },
|
||||||
|
/// confirmation_height: 1,
|
||||||
|
/// confirmation_time: 123,
|
||||||
|
/// },
|
||||||
|
/// );
|
||||||
|
/// ```
|
||||||
|
pub trait Anchor: core::fmt::Debug + Clone + Eq + PartialOrd + Ord + core::hash::Hash {
|
||||||
|
/// Returns the [`BlockId`] that the associated blockchain data is "anchored" in.
|
||||||
|
fn anchor_block(&self) -> BlockId;
|
||||||
|
|
||||||
|
/// Get the upper bound of the chain data's confirmation height.
|
||||||
|
///
|
||||||
|
/// The default definition gives a pessimistic answer. This can be overridden by the `Anchor`
|
||||||
|
/// implementation for a more accurate value.
|
||||||
|
fn confirmation_height_upper_bound(&self) -> u32 {
|
||||||
|
self.anchor_block().height
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ForEachTxOut for Block {
|
impl<'a, A: Anchor> Anchor for &'a A {
|
||||||
fn for_each_txout(&self, mut f: impl FnMut((OutPoint, &TxOut))) {
|
fn anchor_block(&self) -> BlockId {
|
||||||
for tx in self.txdata.iter() {
|
<A as Anchor>::anchor_block(self)
|
||||||
tx.for_each_txout(&mut f)
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// An [`Anchor`] that can be constructed from a given block, block height and transaction position
|
||||||
|
/// within the block.
|
||||||
|
pub trait AnchorFromBlockPosition: Anchor {
|
||||||
|
/// Construct the anchor from a given `block`, block height and `tx_pos` within the block.
|
||||||
|
fn from_block_position(block: &bitcoin::Block, block_id: BlockId, tx_pos: usize) -> Self;
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Trait that makes an object appendable.
|
||||||
|
pub trait Append {
|
||||||
|
/// Append another object of the same type onto `self`.
|
||||||
|
fn append(&mut self, other: Self);
|
||||||
|
|
||||||
|
/// Returns whether the structure is considered empty.
|
||||||
|
fn is_empty(&self) -> bool;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<K: Ord, V> Append for BTreeMap<K, V> {
|
||||||
|
fn append(&mut self, other: Self) {
|
||||||
|
// We use `extend` instead of `BTreeMap::append` due to performance issues with `append`.
|
||||||
|
// Refer to https://github.com/rust-lang/rust/issues/34666#issuecomment-675658420
|
||||||
|
BTreeMap::extend(self, other)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
BTreeMap::is_empty(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<T: Ord> Append for BTreeSet<T> {
|
||||||
|
fn append(&mut self, other: Self) {
|
||||||
|
// We use `extend` instead of `BTreeMap::append` due to performance issues with `append`.
|
||||||
|
// Refer to https://github.com/rust-lang/rust/issues/34666#issuecomment-675658420
|
||||||
|
BTreeSet::extend(self, other)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
BTreeSet::is_empty(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<T> Append for Vec<T> {
|
||||||
|
fn append(&mut self, mut other: Self) {
|
||||||
|
Vec::append(self, &mut other)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
Vec::is_empty(self)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
macro_rules! impl_append_for_tuple {
|
||||||
|
($($a:ident $b:tt)*) => {
|
||||||
|
impl<$($a),*> Append for ($($a,)*) where $($a: Append),* {
|
||||||
|
|
||||||
|
fn append(&mut self, _other: Self) {
|
||||||
|
$(Append::append(&mut self.$b, _other.$b) );*
|
||||||
|
}
|
||||||
|
|
||||||
|
fn is_empty(&self) -> bool {
|
||||||
|
$(Append::is_empty(&self.$b) && )* true
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ForEachTxOut for Transaction {
|
impl_append_for_tuple!();
|
||||||
fn for_each_txout(&self, mut f: impl FnMut((OutPoint, &TxOut))) {
|
impl_append_for_tuple!(T0 0);
|
||||||
let txid = self.txid();
|
impl_append_for_tuple!(T0 0 T1 1);
|
||||||
for (i, txout) in self.output.iter().enumerate() {
|
impl_append_for_tuple!(T0 0 T1 1 T2 2);
|
||||||
f((
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3);
|
||||||
OutPoint {
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4);
|
||||||
txid,
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5);
|
||||||
vout: i as u32,
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6);
|
||||||
},
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7);
|
||||||
txout,
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8);
|
||||||
))
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8 T9 9);
|
||||||
}
|
impl_append_for_tuple!(T0 0 T1 1 T2 2 T3 3 T4 4 T5 5 T6 6 T7 7 T8 8 T9 9 T10 10);
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
@@ -1,3 +1,17 @@
|
|||||||
|
mod tx_template;
|
||||||
|
#[allow(unused_imports)]
|
||||||
|
pub use tx_template::*;
|
||||||
|
|
||||||
|
#[allow(unused_macros)]
|
||||||
|
macro_rules! block_id {
|
||||||
|
($height:expr, $hash:literal) => {{
|
||||||
|
bdk_chain::BlockId {
|
||||||
|
height: $height,
|
||||||
|
hash: bitcoin::hashes::Hash::hash($hash.as_bytes()),
|
||||||
|
}
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
#[allow(unused_macros)]
|
#[allow(unused_macros)]
|
||||||
macro_rules! h {
|
macro_rules! h {
|
||||||
($index:literal) => {{
|
($index:literal) => {{
|
||||||
@@ -6,20 +20,24 @@ macro_rules! h {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[allow(unused_macros)]
|
#[allow(unused_macros)]
|
||||||
macro_rules! chain {
|
macro_rules! local_chain {
|
||||||
($([$($tt:tt)*]),*) => { chain!( checkpoints: [$([$($tt)*]),*] ) };
|
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||||
(checkpoints: $($tail:tt)*) => { chain!( index: TxHeight, checkpoints: $($tail)*) };
|
|
||||||
(index: $ind:ty, checkpoints: [ $([$height:expr, $block_hash:expr]),* ] $(,txids: [$(($txid:expr, $tx_height:expr)),*])?) => {{
|
|
||||||
#[allow(unused_mut)]
|
#[allow(unused_mut)]
|
||||||
let mut chain = bdk_chain::sparse_chain::SparseChain::<$ind>::from_checkpoints([$(($height, $block_hash).into()),*]);
|
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*].into_iter().collect())
|
||||||
|
.expect("chain must have genesis block")
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
$(
|
#[allow(unused_macros)]
|
||||||
$(
|
macro_rules! chain_update {
|
||||||
let _ = chain.insert_tx($txid, $tx_height).expect("should succeed");
|
[ $(($height:expr, $hash:expr)), * ] => {{
|
||||||
)*
|
#[allow(unused_mut)]
|
||||||
)?
|
bdk_chain::local_chain::Update {
|
||||||
|
tip: bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $hash).into()),*].into_iter().collect())
|
||||||
chain
|
.expect("chain must have genesis block")
|
||||||
|
.tip(),
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
}
|
||||||
}};
|
}};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -53,7 +71,7 @@ macro_rules! changeset {
|
|||||||
pub fn new_tx(lt: u32) -> bitcoin::Transaction {
|
pub fn new_tx(lt: u32) -> bitcoin::Transaction {
|
||||||
bitcoin::Transaction {
|
bitcoin::Transaction {
|
||||||
version: 0x00,
|
version: 0x00,
|
||||||
lock_time: bitcoin::PackedLockTime(lt),
|
lock_time: bitcoin::absolute::LockTime::from_consensus(lt),
|
||||||
input: vec![],
|
input: vec![],
|
||||||
output: vec![],
|
output: vec![],
|
||||||
}
|
}
|
||||||
|
|||||||
136
crates/chain/tests/common/tx_template.rs
Normal file
136
crates/chain/tests/common/tx_template.rs
Normal file
@@ -0,0 +1,136 @@
|
|||||||
|
use rand::distributions::{Alphanumeric, DistString};
|
||||||
|
use std::collections::HashMap;
|
||||||
|
|
||||||
|
use bdk_chain::{tx_graph::TxGraph, Anchor, SpkTxOutIndex};
|
||||||
|
use bitcoin::{
|
||||||
|
locktime::absolute::LockTime, secp256k1::Secp256k1, OutPoint, ScriptBuf, Sequence, Transaction,
|
||||||
|
TxIn, TxOut, Txid, Witness,
|
||||||
|
};
|
||||||
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
|
/// Template for creating a transaction in `TxGraph`.
|
||||||
|
///
|
||||||
|
/// The incentive for transaction templates is to create a transaction history in a simple manner to
|
||||||
|
/// avoid having to explicitly hash previous transactions to form previous outpoints of later
|
||||||
|
/// transactions.
|
||||||
|
#[derive(Clone, Copy, Default)]
|
||||||
|
pub struct TxTemplate<'a, A> {
|
||||||
|
/// Uniquely identifies the transaction, before it can have a txid.
|
||||||
|
pub tx_name: &'a str,
|
||||||
|
pub inputs: &'a [TxInTemplate<'a>],
|
||||||
|
pub outputs: &'a [TxOutTemplate],
|
||||||
|
pub anchors: &'a [A],
|
||||||
|
pub last_seen: Option<u64>,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
pub enum TxInTemplate<'a> {
|
||||||
|
/// This will give a random txid and vout.
|
||||||
|
Bogus,
|
||||||
|
|
||||||
|
/// This is used for coinbase transactions because they do not have previous outputs.
|
||||||
|
Coinbase,
|
||||||
|
|
||||||
|
/// Contains the `tx_name` and `vout` that we are spending. The rule is that we must only spend
|
||||||
|
/// from tx of a previous `TxTemplate`.
|
||||||
|
PrevTx(&'a str, usize),
|
||||||
|
}
|
||||||
|
|
||||||
|
pub struct TxOutTemplate {
|
||||||
|
pub value: u64,
|
||||||
|
pub spk_index: Option<u32>, // some = get spk from SpkTxOutIndex, none = random spk
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(unused)]
|
||||||
|
impl TxOutTemplate {
|
||||||
|
pub fn new(value: u64, spk_index: Option<u32>) -> Self {
|
||||||
|
TxOutTemplate { value, spk_index }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
pub fn init_graph<'a, A: Anchor + Clone + 'a>(
|
||||||
|
tx_templates: impl IntoIterator<Item = &'a TxTemplate<'a, A>>,
|
||||||
|
) -> (TxGraph<A>, SpkTxOutIndex<u32>, HashMap<&'a str, Txid>) {
|
||||||
|
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/0/*)").unwrap();
|
||||||
|
let mut graph = TxGraph::<A>::default();
|
||||||
|
let mut spk_index = SpkTxOutIndex::default();
|
||||||
|
(0..10).for_each(|index| {
|
||||||
|
spk_index.insert_spk(
|
||||||
|
index,
|
||||||
|
descriptor
|
||||||
|
.at_derivation_index(index)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey(),
|
||||||
|
);
|
||||||
|
});
|
||||||
|
let mut tx_ids = HashMap::<&'a str, Txid>::new();
|
||||||
|
|
||||||
|
for (bogus_txin_vout, tx_tmp) in tx_templates.into_iter().enumerate() {
|
||||||
|
let tx = Transaction {
|
||||||
|
version: 0,
|
||||||
|
lock_time: LockTime::ZERO,
|
||||||
|
input: tx_tmp
|
||||||
|
.inputs
|
||||||
|
.iter()
|
||||||
|
.map(|input| match input {
|
||||||
|
TxInTemplate::Bogus => TxIn {
|
||||||
|
previous_output: OutPoint::new(
|
||||||
|
bitcoin::hashes::Hash::hash(
|
||||||
|
Alphanumeric
|
||||||
|
.sample_string(&mut rand::thread_rng(), 20)
|
||||||
|
.as_bytes(),
|
||||||
|
),
|
||||||
|
bogus_txin_vout as u32,
|
||||||
|
),
|
||||||
|
script_sig: ScriptBuf::new(),
|
||||||
|
sequence: Sequence::default(),
|
||||||
|
witness: Witness::new(),
|
||||||
|
},
|
||||||
|
TxInTemplate::Coinbase => TxIn {
|
||||||
|
previous_output: OutPoint::null(),
|
||||||
|
script_sig: ScriptBuf::new(),
|
||||||
|
sequence: Sequence::MAX,
|
||||||
|
witness: Witness::new(),
|
||||||
|
},
|
||||||
|
TxInTemplate::PrevTx(prev_name, prev_vout) => {
|
||||||
|
let prev_txid = tx_ids.get(prev_name).expect(
|
||||||
|
"txin template must spend from tx of template that comes before",
|
||||||
|
);
|
||||||
|
TxIn {
|
||||||
|
previous_output: OutPoint::new(*prev_txid, *prev_vout as _),
|
||||||
|
script_sig: ScriptBuf::new(),
|
||||||
|
sequence: Sequence::default(),
|
||||||
|
witness: Witness::new(),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
output: tx_tmp
|
||||||
|
.outputs
|
||||||
|
.iter()
|
||||||
|
.map(|output| match &output.spk_index {
|
||||||
|
None => TxOut {
|
||||||
|
value: output.value,
|
||||||
|
script_pubkey: ScriptBuf::new(),
|
||||||
|
},
|
||||||
|
Some(index) => TxOut {
|
||||||
|
value: output.value,
|
||||||
|
script_pubkey: spk_index.spk_at_index(index).unwrap().to_owned(),
|
||||||
|
},
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
};
|
||||||
|
|
||||||
|
tx_ids.insert(tx_tmp.tx_name, tx.txid());
|
||||||
|
spk_index.scan(&tx);
|
||||||
|
let _ = graph.insert_tx(tx.clone());
|
||||||
|
for anchor in tx_tmp.anchors.iter() {
|
||||||
|
let _ = graph.insert_anchor(tx.txid(), anchor.clone());
|
||||||
|
}
|
||||||
|
if let Some(seen_at) = tx_tmp.last_seen {
|
||||||
|
let _ = graph.insert_seen_at(tx.txid(), seen_at);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
(graph, spk_index, tx_ids)
|
||||||
|
}
|
||||||
@@ -1,653 +0,0 @@
|
|||||||
#[macro_use]
|
|
||||||
mod common;
|
|
||||||
|
|
||||||
use bdk_chain::{
|
|
||||||
chain_graph::*,
|
|
||||||
collections::HashSet,
|
|
||||||
sparse_chain,
|
|
||||||
tx_graph::{self, TxGraph},
|
|
||||||
BlockId, TxHeight,
|
|
||||||
};
|
|
||||||
use bitcoin::{OutPoint, PackedLockTime, Script, Sequence, Transaction, TxIn, TxOut, Witness};
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_spent_by() {
|
|
||||||
let tx1 = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let op = OutPoint {
|
|
||||||
txid: tx1.txid(),
|
|
||||||
vout: 0,
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx2 = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: op,
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![],
|
|
||||||
};
|
|
||||||
let tx3 = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(42),
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: op,
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![],
|
|
||||||
};
|
|
||||||
|
|
||||||
let mut cg1 = ChainGraph::default();
|
|
||||||
let _ = cg1
|
|
||||||
.insert_tx(tx1, TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert");
|
|
||||||
let mut cg2 = cg1.clone();
|
|
||||||
let _ = cg1
|
|
||||||
.insert_tx(tx2.clone(), TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert");
|
|
||||||
let _ = cg2
|
|
||||||
.insert_tx(tx3.clone(), TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert");
|
|
||||||
|
|
||||||
assert_eq!(cg1.spent_by(op), Some((&TxHeight::Unconfirmed, tx2.txid())));
|
|
||||||
assert_eq!(cg2.spent_by(op), Some((&TxHeight::Unconfirmed, tx3.txid())));
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn update_evicts_conflicting_tx() {
|
|
||||||
let cp_a = BlockId {
|
|
||||||
height: 0,
|
|
||||||
hash: h!("A"),
|
|
||||||
};
|
|
||||||
let cp_b = BlockId {
|
|
||||||
height: 1,
|
|
||||||
hash: h!("B"),
|
|
||||||
};
|
|
||||||
let cp_b2 = BlockId {
|
|
||||||
height: 1,
|
|
||||||
hash: h!("B'"),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_a = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_b = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_a.txid(), 0),
|
|
||||||
script_sig: Script::new(),
|
|
||||||
sequence: Sequence::default(),
|
|
||||||
witness: Witness::new(),
|
|
||||||
}],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_b2 = Transaction {
|
|
||||||
version: 0x02,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_a.txid(), 0),
|
|
||||||
script_sig: Script::new(),
|
|
||||||
sequence: Sequence::default(),
|
|
||||||
witness: Witness::new(),
|
|
||||||
}],
|
|
||||||
output: vec![TxOut::default(), TxOut::default()],
|
|
||||||
};
|
|
||||||
{
|
|
||||||
let mut cg1 = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg.insert_checkpoint(cp_a).expect("should insert cp");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_a.clone(), TxHeight::Confirmed(0))
|
|
||||||
.expect("should insert tx");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_b.clone(), TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert tx");
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
let cg2 = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_b2.clone(), TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert tx");
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
|
|
||||||
let changeset = ChangeSet::<TxHeight> {
|
|
||||||
chain: sparse_chain::ChangeSet {
|
|
||||||
checkpoints: Default::default(),
|
|
||||||
txids: [
|
|
||||||
(tx_b.txid(), None),
|
|
||||||
(tx_b2.txid(), Some(TxHeight::Unconfirmed)),
|
|
||||||
]
|
|
||||||
.into(),
|
|
||||||
},
|
|
||||||
graph: tx_graph::Additions {
|
|
||||||
tx: [tx_b2.clone()].into(),
|
|
||||||
txout: [].into(),
|
|
||||||
},
|
|
||||||
};
|
|
||||||
assert_eq!(
|
|
||||||
cg1.determine_changeset(&cg2),
|
|
||||||
Ok(changeset.clone()),
|
|
||||||
"tx should be evicted from mempool"
|
|
||||||
);
|
|
||||||
|
|
||||||
cg1.apply_changeset(changeset);
|
|
||||||
}
|
|
||||||
|
|
||||||
{
|
|
||||||
let cg1 = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg.insert_checkpoint(cp_a).expect("should insert cp");
|
|
||||||
let _ = cg.insert_checkpoint(cp_b).expect("should insert cp");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_a.clone(), TxHeight::Confirmed(0))
|
|
||||||
.expect("should insert tx");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_b.clone(), TxHeight::Confirmed(1))
|
|
||||||
.expect("should insert tx");
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
let cg2 = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_b2.clone(), TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert tx");
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
assert_eq!(
|
|
||||||
cg1.determine_changeset(&cg2),
|
|
||||||
Err(UpdateError::UnresolvableConflict(UnresolvableConflict {
|
|
||||||
already_confirmed_tx: (TxHeight::Confirmed(1), tx_b.txid()),
|
|
||||||
update_tx: (TxHeight::Unconfirmed, tx_b2.txid()),
|
|
||||||
})),
|
|
||||||
"fail if tx is evicted from valid block"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
{
|
|
||||||
// Given 2 blocks `{A, B}`, and an update that invalidates block B with
|
|
||||||
// `{A, B'}`, we expect txs that exist in `B` that conflicts with txs
|
|
||||||
// introduced in the update to be successfully evicted.
|
|
||||||
let mut cg1 = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg.insert_checkpoint(cp_a).expect("should insert cp");
|
|
||||||
let _ = cg.insert_checkpoint(cp_b).expect("should insert cp");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_a, TxHeight::Confirmed(0))
|
|
||||||
.expect("should insert tx");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_b.clone(), TxHeight::Confirmed(1))
|
|
||||||
.expect("should insert tx");
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
let cg2 = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg.insert_checkpoint(cp_a).expect("should insert cp");
|
|
||||||
let _ = cg.insert_checkpoint(cp_b2).expect("should insert cp");
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(tx_b2.clone(), TxHeight::Unconfirmed)
|
|
||||||
.expect("should insert tx");
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
|
|
||||||
let changeset = ChangeSet::<TxHeight> {
|
|
||||||
chain: sparse_chain::ChangeSet {
|
|
||||||
checkpoints: [(1, Some(h!("B'")))].into(),
|
|
||||||
txids: [
|
|
||||||
(tx_b.txid(), None),
|
|
||||||
(tx_b2.txid(), Some(TxHeight::Unconfirmed)),
|
|
||||||
]
|
|
||||||
.into(),
|
|
||||||
},
|
|
||||||
graph: tx_graph::Additions {
|
|
||||||
tx: [tx_b2].into(),
|
|
||||||
txout: [].into(),
|
|
||||||
},
|
|
||||||
};
|
|
||||||
assert_eq!(
|
|
||||||
cg1.determine_changeset(&cg2),
|
|
||||||
Ok(changeset.clone()),
|
|
||||||
"tx should be evicted from B",
|
|
||||||
);
|
|
||||||
|
|
||||||
cg1.apply_changeset(changeset);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn chain_graph_new_missing() {
|
|
||||||
let tx_a = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
let tx_b = Transaction {
|
|
||||||
version: 0x02,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let update = chain!(
|
|
||||||
index: TxHeight,
|
|
||||||
checkpoints: [[0, h!("A")]],
|
|
||||||
txids: [
|
|
||||||
(tx_a.txid(), TxHeight::Confirmed(0)),
|
|
||||||
(tx_b.txid(), TxHeight::Confirmed(0))
|
|
||||||
]
|
|
||||||
);
|
|
||||||
let mut graph = TxGraph::default();
|
|
||||||
|
|
||||||
let mut expected_missing = HashSet::new();
|
|
||||||
expected_missing.insert(tx_a.txid());
|
|
||||||
expected_missing.insert(tx_b.txid());
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
ChainGraph::new(update.clone(), graph.clone()),
|
|
||||||
Err(NewError::Missing(expected_missing.clone()))
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = graph.insert_tx(tx_b.clone());
|
|
||||||
expected_missing.remove(&tx_b.txid());
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
ChainGraph::new(update.clone(), graph.clone()),
|
|
||||||
Err(NewError::Missing(expected_missing.clone()))
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = graph.insert_txout(
|
|
||||||
OutPoint {
|
|
||||||
txid: tx_a.txid(),
|
|
||||||
vout: 0,
|
|
||||||
},
|
|
||||||
tx_a.output[0].clone(),
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
ChainGraph::new(update.clone(), graph.clone()),
|
|
||||||
Err(NewError::Missing(expected_missing)),
|
|
||||||
"inserting an output instead of full tx doesn't satisfy constraint"
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = graph.insert_tx(tx_a.clone());
|
|
||||||
|
|
||||||
let new_graph = ChainGraph::new(update.clone(), graph.clone()).unwrap();
|
|
||||||
let expected_graph = {
|
|
||||||
let mut cg = ChainGraph::<TxHeight>::default();
|
|
||||||
let _ = cg
|
|
||||||
.insert_checkpoint(update.latest_checkpoint().unwrap())
|
|
||||||
.unwrap();
|
|
||||||
let _ = cg.insert_tx(tx_a, TxHeight::Confirmed(0)).unwrap();
|
|
||||||
let _ = cg.insert_tx(tx_b, TxHeight::Confirmed(0)).unwrap();
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
|
|
||||||
assert_eq!(new_graph, expected_graph);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn chain_graph_new_conflicts() {
|
|
||||||
let tx_a = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_b = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_a.txid(), 0),
|
|
||||||
script_sig: Script::new(),
|
|
||||||
sequence: Sequence::default(),
|
|
||||||
witness: Witness::new(),
|
|
||||||
}],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_b2 = Transaction {
|
|
||||||
version: 0x02,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_a.txid(), 0),
|
|
||||||
script_sig: Script::new(),
|
|
||||||
sequence: Sequence::default(),
|
|
||||||
witness: Witness::new(),
|
|
||||||
}],
|
|
||||||
output: vec![TxOut::default(), TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let chain = chain!(
|
|
||||||
index: TxHeight,
|
|
||||||
checkpoints: [[5, h!("A")]],
|
|
||||||
txids: [
|
|
||||||
(tx_a.txid(), TxHeight::Confirmed(1)),
|
|
||||||
(tx_b.txid(), TxHeight::Confirmed(2)),
|
|
||||||
(tx_b2.txid(), TxHeight::Confirmed(3))
|
|
||||||
]
|
|
||||||
);
|
|
||||||
|
|
||||||
let graph = TxGraph::new([tx_a, tx_b, tx_b2]);
|
|
||||||
|
|
||||||
assert!(matches!(
|
|
||||||
ChainGraph::new(chain, graph),
|
|
||||||
Err(NewError::Conflict { .. })
|
|
||||||
));
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_get_tx_in_chain() {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let tx = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
};
|
|
||||||
|
|
||||||
let _ = cg.insert_tx(tx.clone(), TxHeight::Unconfirmed).unwrap();
|
|
||||||
assert_eq!(
|
|
||||||
cg.get_tx_in_chain(tx.txid()),
|
|
||||||
Some((&TxHeight::Unconfirmed, &tx))
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_iterate_transactions() {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let txs = (0..3)
|
|
||||||
.map(|i| Transaction {
|
|
||||||
version: i,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut::default()],
|
|
||||||
})
|
|
||||||
.collect::<Vec<_>>();
|
|
||||||
let _ = cg
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: 1,
|
|
||||||
hash: h!("A"),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(txs[0].clone(), TxHeight::Confirmed(1))
|
|
||||||
.unwrap();
|
|
||||||
let _ = cg.insert_tx(txs[1].clone(), TxHeight::Unconfirmed).unwrap();
|
|
||||||
let _ = cg
|
|
||||||
.insert_tx(txs[2].clone(), TxHeight::Confirmed(0))
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
cg.transactions_in_chain().collect::<Vec<_>>(),
|
|
||||||
vec![
|
|
||||||
(&TxHeight::Confirmed(0), &txs[2]),
|
|
||||||
(&TxHeight::Confirmed(1), &txs[0]),
|
|
||||||
(&TxHeight::Unconfirmed, &txs[1]),
|
|
||||||
]
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Start with: block1, block2a, tx1, tx2a
|
|
||||||
/// Update 1: block2a -> block2b , tx2a -> tx2b
|
|
||||||
/// Update 2: block2b -> block2c , tx2b -> tx2a
|
|
||||||
#[test]
|
|
||||||
fn test_apply_changes_reintroduce_tx() {
|
|
||||||
let block1 = BlockId {
|
|
||||||
height: 1,
|
|
||||||
hash: h!("block 1"),
|
|
||||||
};
|
|
||||||
let block2a = BlockId {
|
|
||||||
height: 2,
|
|
||||||
hash: h!("block 2a"),
|
|
||||||
};
|
|
||||||
let block2b = BlockId {
|
|
||||||
height: 2,
|
|
||||||
hash: h!("block 2b"),
|
|
||||||
};
|
|
||||||
let block2c = BlockId {
|
|
||||||
height: 2,
|
|
||||||
hash: h!("block 2c"),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx1 = Transaction {
|
|
||||||
version: 0,
|
|
||||||
lock_time: PackedLockTime(1),
|
|
||||||
input: Vec::new(),
|
|
||||||
output: [TxOut {
|
|
||||||
value: 1,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
}]
|
|
||||||
.into(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx2a = Transaction {
|
|
||||||
version: 0,
|
|
||||||
lock_time: PackedLockTime('a'.into()),
|
|
||||||
input: [TxIn {
|
|
||||||
previous_output: OutPoint::new(tx1.txid(), 0),
|
|
||||||
..Default::default()
|
|
||||||
}]
|
|
||||||
.into(),
|
|
||||||
output: [TxOut {
|
|
||||||
value: 0,
|
|
||||||
..Default::default()
|
|
||||||
}]
|
|
||||||
.into(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx2b = Transaction {
|
|
||||||
lock_time: PackedLockTime('b'.into()),
|
|
||||||
..tx2a.clone()
|
|
||||||
};
|
|
||||||
|
|
||||||
// block1, block2a, tx1, tx2a
|
|
||||||
let mut cg = {
|
|
||||||
let mut cg = ChainGraph::default();
|
|
||||||
let _ = cg.insert_checkpoint(block1).unwrap();
|
|
||||||
let _ = cg.insert_checkpoint(block2a).unwrap();
|
|
||||||
let _ = cg.insert_tx(tx1, TxHeight::Confirmed(1)).unwrap();
|
|
||||||
let _ = cg.insert_tx(tx2a.clone(), TxHeight::Confirmed(2)).unwrap();
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
|
|
||||||
// block2a -> block2b , tx2a -> tx2b
|
|
||||||
let update = {
|
|
||||||
let mut update = ChainGraph::default();
|
|
||||||
let _ = update.insert_checkpoint(block1).unwrap();
|
|
||||||
let _ = update.insert_checkpoint(block2b).unwrap();
|
|
||||||
let _ = update
|
|
||||||
.insert_tx(tx2b.clone(), TxHeight::Confirmed(2))
|
|
||||||
.unwrap();
|
|
||||||
update
|
|
||||||
};
|
|
||||||
assert_eq!(
|
|
||||||
cg.apply_update(update).expect("should update"),
|
|
||||||
ChangeSet {
|
|
||||||
chain: changeset! {
|
|
||||||
checkpoints: [(2, Some(block2b.hash))],
|
|
||||||
txids: [(tx2a.txid(), None), (tx2b.txid(), Some(TxHeight::Confirmed(2)))]
|
|
||||||
},
|
|
||||||
graph: tx_graph::Additions {
|
|
||||||
tx: [tx2b.clone()].into(),
|
|
||||||
..Default::default()
|
|
||||||
},
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
// block2b -> block2c , tx2b -> tx2a
|
|
||||||
let update = {
|
|
||||||
let mut update = ChainGraph::default();
|
|
||||||
let _ = update.insert_checkpoint(block1).unwrap();
|
|
||||||
let _ = update.insert_checkpoint(block2c).unwrap();
|
|
||||||
let _ = update
|
|
||||||
.insert_tx(tx2a.clone(), TxHeight::Confirmed(2))
|
|
||||||
.unwrap();
|
|
||||||
update
|
|
||||||
};
|
|
||||||
assert_eq!(
|
|
||||||
cg.apply_update(update).expect("should update"),
|
|
||||||
ChangeSet {
|
|
||||||
chain: changeset! {
|
|
||||||
checkpoints: [(2, Some(block2c.hash))],
|
|
||||||
txids: [(tx2b.txid(), None), (tx2a.txid(), Some(TxHeight::Confirmed(2)))]
|
|
||||||
},
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_evict_descendants() {
|
|
||||||
let block_1 = BlockId {
|
|
||||||
height: 1,
|
|
||||||
hash: h!("block 1"),
|
|
||||||
};
|
|
||||||
|
|
||||||
let block_2a = BlockId {
|
|
||||||
height: 2,
|
|
||||||
hash: h!("block 2 a"),
|
|
||||||
};
|
|
||||||
|
|
||||||
let block_2b = BlockId {
|
|
||||||
height: 2,
|
|
||||||
hash: h!("block 2 b"),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_1 = Transaction {
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(h!("fake tx"), 0),
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 10_000,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
}],
|
|
||||||
..common::new_tx(1)
|
|
||||||
};
|
|
||||||
let tx_2 = Transaction {
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_1.txid(), 0),
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![
|
|
||||||
TxOut {
|
|
||||||
value: 20_000,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
},
|
|
||||||
TxOut {
|
|
||||||
value: 30_000,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
},
|
|
||||||
],
|
|
||||||
..common::new_tx(2)
|
|
||||||
};
|
|
||||||
let tx_3 = Transaction {
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_2.txid(), 0),
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 40_000,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
}],
|
|
||||||
..common::new_tx(3)
|
|
||||||
};
|
|
||||||
let tx_4 = Transaction {
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_2.txid(), 1),
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 40_000,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
}],
|
|
||||||
..common::new_tx(4)
|
|
||||||
};
|
|
||||||
let tx_5 = Transaction {
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_4.txid(), 0),
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 40_000,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
}],
|
|
||||||
..common::new_tx(5)
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_conflict = Transaction {
|
|
||||||
input: vec![TxIn {
|
|
||||||
previous_output: OutPoint::new(tx_1.txid(), 0),
|
|
||||||
..Default::default()
|
|
||||||
}],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 12345,
|
|
||||||
script_pubkey: Script::new(),
|
|
||||||
}],
|
|
||||||
..common::new_tx(6)
|
|
||||||
};
|
|
||||||
|
|
||||||
// 1 is spent by 2, 2 is spent by 3 and 4, 4 is spent by 5
|
|
||||||
let _txid_1 = tx_1.txid();
|
|
||||||
let txid_2 = tx_2.txid();
|
|
||||||
let txid_3 = tx_3.txid();
|
|
||||||
let txid_4 = tx_4.txid();
|
|
||||||
let txid_5 = tx_5.txid();
|
|
||||||
|
|
||||||
// this tx conflicts with 2
|
|
||||||
let txid_conflict = tx_conflict.txid();
|
|
||||||
|
|
||||||
let cg = {
|
|
||||||
let mut cg = ChainGraph::<TxHeight>::default();
|
|
||||||
let _ = cg.insert_checkpoint(block_1);
|
|
||||||
let _ = cg.insert_checkpoint(block_2a);
|
|
||||||
let _ = cg.insert_tx(tx_1, TxHeight::Confirmed(1));
|
|
||||||
let _ = cg.insert_tx(tx_2, TxHeight::Confirmed(2));
|
|
||||||
let _ = cg.insert_tx(tx_3, TxHeight::Confirmed(2));
|
|
||||||
let _ = cg.insert_tx(tx_4, TxHeight::Confirmed(2));
|
|
||||||
let _ = cg.insert_tx(tx_5, TxHeight::Confirmed(2));
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
|
|
||||||
let update = {
|
|
||||||
let mut cg = ChainGraph::<TxHeight>::default();
|
|
||||||
let _ = cg.insert_checkpoint(block_1);
|
|
||||||
let _ = cg.insert_checkpoint(block_2b);
|
|
||||||
let _ = cg.insert_tx(tx_conflict.clone(), TxHeight::Confirmed(2));
|
|
||||||
cg
|
|
||||||
};
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
cg.determine_changeset(&update),
|
|
||||||
Ok(ChangeSet {
|
|
||||||
chain: changeset! {
|
|
||||||
checkpoints: [(2, Some(block_2b.hash))],
|
|
||||||
txids: [(txid_2, None), (txid_3, None), (txid_4, None), (txid_5, None), (txid_conflict, Some(TxHeight::Confirmed(2)))]
|
|
||||||
},
|
|
||||||
graph: tx_graph::Additions {
|
|
||||||
tx: [tx_conflict.clone()].into(),
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
})
|
|
||||||
);
|
|
||||||
|
|
||||||
let err = cg
|
|
||||||
.insert_tx_preview(tx_conflict, TxHeight::Unconfirmed)
|
|
||||||
.expect_err("must fail due to conflicts");
|
|
||||||
assert!(matches!(err, InsertTxError::UnresolvableConflict(_)));
|
|
||||||
}
|
|
||||||
467
crates/chain/tests/test_indexed_tx_graph.rs
Normal file
467
crates/chain/tests/test_indexed_tx_graph.rs
Normal file
@@ -0,0 +1,467 @@
|
|||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
|
||||||
|
use std::collections::BTreeSet;
|
||||||
|
|
||||||
|
use bdk_chain::{
|
||||||
|
indexed_tx_graph::{self, IndexedTxGraph},
|
||||||
|
keychain::{self, Balance, KeychainTxOutIndex},
|
||||||
|
local_chain::LocalChain,
|
||||||
|
tx_graph, BlockId, ChainPosition, ConfirmationHeightAnchor,
|
||||||
|
};
|
||||||
|
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, ScriptBuf, Transaction, TxIn, TxOut};
|
||||||
|
use miniscript::Descriptor;
|
||||||
|
|
||||||
|
/// Ensure [`IndexedTxGraph::insert_relevant_txs`] can successfully index transactions NOT presented
|
||||||
|
/// in topological order.
|
||||||
|
///
|
||||||
|
/// Given 3 transactions (A, B, C), where A has 2 owned outputs. B and C spends an output each of A.
|
||||||
|
/// Typically, we would only know whether B and C are relevant if we have indexed A (A's outpoints
|
||||||
|
/// are associated with owned spks in the index). Ensure insertion and indexing is topological-
|
||||||
|
/// agnostic.
|
||||||
|
#[test]
|
||||||
|
fn insert_relevant_txs() {
|
||||||
|
const DESCRIPTOR: &str = "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)";
|
||||||
|
let (descriptor, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), DESCRIPTOR)
|
||||||
|
.expect("must be valid");
|
||||||
|
let spk_0 = descriptor.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
|
let spk_1 = descriptor.at_derivation_index(9).unwrap().script_pubkey();
|
||||||
|
|
||||||
|
let mut graph = IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<()>>::new(
|
||||||
|
KeychainTxOutIndex::new(10),
|
||||||
|
);
|
||||||
|
graph.index.add_keychain((), descriptor);
|
||||||
|
|
||||||
|
let tx_a = Transaction {
|
||||||
|
output: vec![
|
||||||
|
TxOut {
|
||||||
|
value: 10_000,
|
||||||
|
script_pubkey: spk_0,
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
value: 20_000,
|
||||||
|
script_pubkey: spk_1,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_b = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::new(tx_a.txid(), 0),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
..common::new_tx(1)
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_c = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::new(tx_a.txid(), 1),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
..common::new_tx(2)
|
||||||
|
};
|
||||||
|
|
||||||
|
let txs = [tx_c, tx_b, tx_a];
|
||||||
|
|
||||||
|
let changeset = indexed_tx_graph::ChangeSet {
|
||||||
|
graph: tx_graph::ChangeSet {
|
||||||
|
txs: txs.clone().into(),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
indexer: keychain::ChangeSet([((), 9_u32)].into()),
|
||||||
|
};
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
graph.batch_insert_relevant(txs.iter().map(|tx| (tx, None))),
|
||||||
|
changeset,
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(graph.initial_changeset(), changeset,);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
/// Ensure consistency IndexedTxGraph list_* and balance methods. These methods lists
|
||||||
|
/// relevant txouts and utxos from the information fetched from a ChainOracle (here a LocalChain).
|
||||||
|
///
|
||||||
|
/// Test Setup:
|
||||||
|
///
|
||||||
|
/// Local Chain => <0> ----- <1> ----- <2> ----- <3> ---- ... ---- <150>
|
||||||
|
///
|
||||||
|
/// Keychains:
|
||||||
|
///
|
||||||
|
/// keychain_1: Trusted
|
||||||
|
/// keychain_2: Untrusted
|
||||||
|
///
|
||||||
|
/// Transactions:
|
||||||
|
///
|
||||||
|
/// tx1: A Coinbase, sending 70000 sats to "trusted" address. [Block 0]
|
||||||
|
/// tx2: A external Receive, sending 30000 sats to "untrusted" address. [Block 1]
|
||||||
|
/// tx3: Internal Spend. Spends tx2 and returns change of 10000 to "trusted" address. [Block 2]
|
||||||
|
/// tx4: Mempool tx, sending 20000 sats to "trusted" address.
|
||||||
|
/// tx5: Mempool tx, sending 15000 sats to "untested" address.
|
||||||
|
/// tx6: Complete unrelated tx. [Block 3]
|
||||||
|
///
|
||||||
|
/// Different transactions are added via `insert_relevant_txs`.
|
||||||
|
/// `list_owned_txout`, `list_owned_utxos` and `balance` method is asserted
|
||||||
|
/// with expected values at Block height 0, 1, and 2.
|
||||||
|
///
|
||||||
|
/// Finally Add more blocks to local chain until tx1 coinbase maturity hits.
|
||||||
|
/// Assert maturity at coinbase maturity inflection height. Block height 98 and 99.
|
||||||
|
|
||||||
|
fn test_list_owned_txouts() {
|
||||||
|
// Create Local chains
|
||||||
|
let local_chain = LocalChain::from_blocks((0..150).map(|i| (i as u32, h!("random"))).collect())
|
||||||
|
.expect("must have genesis hash");
|
||||||
|
|
||||||
|
// Initiate IndexedTxGraph
|
||||||
|
|
||||||
|
let (desc_1, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/0/*)").unwrap();
|
||||||
|
let (desc_2, _) = Descriptor::parse_descriptor(&Secp256k1::signing_only(), "tr(tprv8ZgxMBicQKsPd3krDUsBAmtnRsK3rb8u5yi1zhQgMhF1tR8MW7xfE4rnrbbsrbPR52e7rKapu6ztw1jXveJSCGHEriUGZV7mCe88duLp5pj/86'/1'/0'/1/*)").unwrap();
|
||||||
|
|
||||||
|
let mut graph = IndexedTxGraph::<ConfirmationHeightAnchor, KeychainTxOutIndex<String>>::new(
|
||||||
|
KeychainTxOutIndex::new(10),
|
||||||
|
);
|
||||||
|
|
||||||
|
graph.index.add_keychain("keychain_1".into(), desc_1);
|
||||||
|
graph.index.add_keychain("keychain_2".into(), desc_2);
|
||||||
|
|
||||||
|
// Get trusted and untrusted addresses
|
||||||
|
|
||||||
|
let mut trusted_spks: Vec<ScriptBuf> = Vec::new();
|
||||||
|
let mut untrusted_spks: Vec<ScriptBuf> = Vec::new();
|
||||||
|
|
||||||
|
{
|
||||||
|
// we need to scope here to take immutanble reference of the graph
|
||||||
|
for _ in 0..10 {
|
||||||
|
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_1".to_string());
|
||||||
|
// TODO Assert indexes
|
||||||
|
trusted_spks.push(script.to_owned());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
{
|
||||||
|
for _ in 0..10 {
|
||||||
|
let ((_, script), _) = graph.index.reveal_next_spk(&"keychain_2".to_string());
|
||||||
|
untrusted_spks.push(script.to_owned());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Create test transactions
|
||||||
|
|
||||||
|
// tx1 is the genesis coinbase
|
||||||
|
let tx1 = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::null(),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 70000,
|
||||||
|
script_pubkey: trusted_spks[0].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx2 is an incoming transaction received at untrusted keychain at block 1.
|
||||||
|
let tx2 = Transaction {
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 30000,
|
||||||
|
script_pubkey: untrusted_spks[0].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx3 spends tx2 and gives a change back in trusted keychain. Confirmed at Block 2.
|
||||||
|
let tx3 = Transaction {
|
||||||
|
input: vec![TxIn {
|
||||||
|
previous_output: OutPoint::new(tx2.txid(), 0),
|
||||||
|
..Default::default()
|
||||||
|
}],
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 10000,
|
||||||
|
script_pubkey: trusted_spks[1].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx4 is an external transaction receiving at untrusted keychain, unconfirmed.
|
||||||
|
let tx4 = Transaction {
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 20000,
|
||||||
|
script_pubkey: untrusted_spks[1].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx5 is spending tx3 and receiving change at trusted keychain, unconfirmed.
|
||||||
|
let tx5 = Transaction {
|
||||||
|
output: vec![TxOut {
|
||||||
|
value: 15000,
|
||||||
|
script_pubkey: trusted_spks[2].to_owned(),
|
||||||
|
}],
|
||||||
|
..common::new_tx(0)
|
||||||
|
};
|
||||||
|
|
||||||
|
// tx6 is an unrelated transaction confirmed at 3.
|
||||||
|
let tx6 = common::new_tx(0);
|
||||||
|
|
||||||
|
// Insert transactions into graph with respective anchors
|
||||||
|
// For unconfirmed txs we pass in `None`.
|
||||||
|
|
||||||
|
let _ =
|
||||||
|
graph.batch_insert_relevant([&tx1, &tx2, &tx3, &tx6].iter().enumerate().map(|(i, tx)| {
|
||||||
|
let height = i as u32;
|
||||||
|
(
|
||||||
|
*tx,
|
||||||
|
local_chain
|
||||||
|
.blocks()
|
||||||
|
.get(&height)
|
||||||
|
.cloned()
|
||||||
|
.map(|hash| BlockId { height, hash })
|
||||||
|
.map(|anchor_block| ConfirmationHeightAnchor {
|
||||||
|
anchor_block,
|
||||||
|
confirmation_height: anchor_block.height,
|
||||||
|
}),
|
||||||
|
)
|
||||||
|
}));
|
||||||
|
|
||||||
|
let _ = graph.batch_insert_relevant_unconfirmed([&tx4, &tx5].iter().map(|tx| (*tx, 100)));
|
||||||
|
|
||||||
|
// A helper lambda to extract and filter data from the graph.
|
||||||
|
let fetch =
|
||||||
|
|height: u32,
|
||||||
|
graph: &IndexedTxGraph<ConfirmationHeightAnchor, KeychainTxOutIndex<String>>| {
|
||||||
|
let chain_tip = local_chain
|
||||||
|
.blocks()
|
||||||
|
.get(&height)
|
||||||
|
.map(|&hash| BlockId { height, hash })
|
||||||
|
.unwrap_or_else(|| panic!("block must exist at {}", height));
|
||||||
|
let txouts = graph
|
||||||
|
.graph()
|
||||||
|
.filter_chain_txouts(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let utxos = graph
|
||||||
|
.graph()
|
||||||
|
.filter_chain_unspents(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
|
let balance = graph.graph().balance(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|_, spk: &Script| trusted_spks.contains(&spk.to_owned()),
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(txouts.len(), 5);
|
||||||
|
assert_eq!(utxos.len(), 4);
|
||||||
|
|
||||||
|
let confirmed_txouts_txid = txouts
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Confirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let unconfirmed_txouts_txid = txouts
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Unconfirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let confirmed_utxos_txid = utxos
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Confirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let unconfirmed_utxos_txid = utxos
|
||||||
|
.iter()
|
||||||
|
.filter_map(|(_, full_txout)| {
|
||||||
|
if matches!(full_txout.chain_position, ChainPosition::Unconfirmed(_)) {
|
||||||
|
Some(full_txout.outpoint.txid)
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
(
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
|
||||||
|
// ----- TEST BLOCK -----
|
||||||
|
|
||||||
|
// AT Block 0
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(0, &graph);
|
||||||
|
|
||||||
|
assert_eq!(confirmed_txouts_txid, [tx1.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
[tx2.txid(), tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 25000, // tx3 + tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 0 // Nothing is confirmed yet
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 1
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(1, &graph);
|
||||||
|
|
||||||
|
// tx2 gets into confirmed txout set
|
||||||
|
assert_eq!(confirmed_txouts_txid, [tx1.txid(), tx2.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
// tx2 doesn't get into confirmed utxos set
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid()].into());
|
||||||
|
assert_eq!(
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
[tx3.txid(), tx4.txid(), tx5.txid()].into()
|
||||||
|
);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 25000, // tx3 + tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 0 // Nothing is confirmed yet
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 2
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(2, &graph);
|
||||||
|
|
||||||
|
// tx3 now gets into the confirmed txout set
|
||||||
|
assert_eq!(
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
[tx1.txid(), tx2.txid(), tx3.txid()].into()
|
||||||
|
);
|
||||||
|
assert_eq!(unconfirmed_txouts_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
// tx3 also gets into confirmed utxo set
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid(), tx3.txid()].into());
|
||||||
|
assert_eq!(unconfirmed_utxos_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 15000, // tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 10000 // tx3 got confirmed
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 98
|
||||||
|
{
|
||||||
|
let (
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
unconfirmed_txouts_txid,
|
||||||
|
confirmed_utxos_txid,
|
||||||
|
unconfirmed_utxos_txid,
|
||||||
|
balance,
|
||||||
|
) = fetch(98, &graph);
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
confirmed_txouts_txid,
|
||||||
|
[tx1.txid(), tx2.txid(), tx3.txid()].into()
|
||||||
|
);
|
||||||
|
assert_eq!(unconfirmed_txouts_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
assert_eq!(confirmed_utxos_txid, [tx1.txid(), tx3.txid()].into());
|
||||||
|
assert_eq!(unconfirmed_utxos_txid, [tx4.txid(), tx5.txid()].into());
|
||||||
|
|
||||||
|
// Coinbase is still immature
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 70000, // immature coinbase
|
||||||
|
trusted_pending: 15000, // tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 10000 // tx1 got matured
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// AT Block 99
|
||||||
|
{
|
||||||
|
let (_, _, _, _, balance) = fetch(100, &graph);
|
||||||
|
|
||||||
|
// Coinbase maturity hits
|
||||||
|
assert_eq!(
|
||||||
|
balance,
|
||||||
|
Balance {
|
||||||
|
immature: 0, // coinbase matured
|
||||||
|
trusted_pending: 15000, // tx5
|
||||||
|
untrusted_pending: 20000, // tx4
|
||||||
|
confirmed: 80000 // tx1 + tx3
|
||||||
|
}
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,239 +0,0 @@
|
|||||||
#![cfg(feature = "miniscript")]
|
|
||||||
#[macro_use]
|
|
||||||
mod common;
|
|
||||||
use bdk_chain::{
|
|
||||||
keychain::{Balance, KeychainTracker},
|
|
||||||
miniscript::{
|
|
||||||
bitcoin::{secp256k1::Secp256k1, OutPoint, PackedLockTime, Transaction, TxOut},
|
|
||||||
Descriptor,
|
|
||||||
},
|
|
||||||
BlockId, ConfirmationTime, TxHeight,
|
|
||||||
};
|
|
||||||
use bitcoin::TxIn;
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_insert_tx() {
|
|
||||||
let mut tracker = KeychainTracker::default();
|
|
||||||
let secp = Secp256k1::new();
|
|
||||||
let (descriptor, _) = Descriptor::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
|
||||||
tracker.add_keychain((), descriptor.clone());
|
|
||||||
let txout = TxOut {
|
|
||||||
value: 100_000,
|
|
||||||
script_pubkey: descriptor.at_derivation_index(5).script_pubkey(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![txout],
|
|
||||||
};
|
|
||||||
|
|
||||||
let _ = tracker.txout_index.reveal_to_target(&(), 5);
|
|
||||||
|
|
||||||
let changeset = tracker
|
|
||||||
.insert_tx_preview(tx.clone(), ConfirmationTime::Unconfirmed)
|
|
||||||
.unwrap();
|
|
||||||
tracker.apply_changeset(changeset);
|
|
||||||
assert_eq!(
|
|
||||||
tracker
|
|
||||||
.chain_graph()
|
|
||||||
.transactions_in_chain()
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
vec![(&ConfirmationTime::Unconfirmed, &tx)]
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker
|
|
||||||
.txout_index
|
|
||||||
.txouts_of_keychain(&())
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
vec![(
|
|
||||||
5,
|
|
||||||
OutPoint {
|
|
||||||
txid: tx.txid(),
|
|
||||||
vout: 0
|
|
||||||
}
|
|
||||||
)]
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn test_balance() {
|
|
||||||
use core::str::FromStr;
|
|
||||||
#[derive(Debug, Clone, PartialEq, Eq, Ord, PartialOrd)]
|
|
||||||
enum Keychain {
|
|
||||||
One,
|
|
||||||
Two,
|
|
||||||
}
|
|
||||||
let mut tracker = KeychainTracker::<Keychain, TxHeight>::default();
|
|
||||||
let one = Descriptor::from_str("tr([73c5da0a/86'/0'/0']xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ/0/*)#rg247h69").unwrap();
|
|
||||||
let two = Descriptor::from_str("tr([73c5da0a/86'/0'/0']xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ/1/*)#ju05rz2a").unwrap();
|
|
||||||
tracker.add_keychain(Keychain::One, one);
|
|
||||||
tracker.add_keychain(Keychain::Two, two);
|
|
||||||
|
|
||||||
let tx1 = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 13_000,
|
|
||||||
script_pubkey: tracker
|
|
||||||
.txout_index
|
|
||||||
.reveal_next_spk(&Keychain::One)
|
|
||||||
.0
|
|
||||||
.1
|
|
||||||
.clone(),
|
|
||||||
}],
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx2 = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 7_000,
|
|
||||||
script_pubkey: tracker
|
|
||||||
.txout_index
|
|
||||||
.reveal_next_spk(&Keychain::Two)
|
|
||||||
.0
|
|
||||||
.1
|
|
||||||
.clone(),
|
|
||||||
}],
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_coinbase = Transaction {
|
|
||||||
version: 0x01,
|
|
||||||
lock_time: PackedLockTime(0),
|
|
||||||
input: vec![TxIn::default()],
|
|
||||||
output: vec![TxOut {
|
|
||||||
value: 11_000,
|
|
||||||
script_pubkey: tracker
|
|
||||||
.txout_index
|
|
||||||
.reveal_next_spk(&Keychain::Two)
|
|
||||||
.0
|
|
||||||
.1
|
|
||||||
.clone(),
|
|
||||||
}],
|
|
||||||
};
|
|
||||||
|
|
||||||
assert!(tx_coinbase.is_coin_base());
|
|
||||||
|
|
||||||
let _ = tracker
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: 5,
|
|
||||||
hash: h!("1"),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
let should_trust = |keychain: &Keychain| match *keychain {
|
|
||||||
Keychain::One => false,
|
|
||||||
Keychain::Two => true,
|
|
||||||
};
|
|
||||||
|
|
||||||
assert_eq!(tracker.balance(should_trust), Balance::default());
|
|
||||||
|
|
||||||
let _ = tracker
|
|
||||||
.insert_tx(tx1.clone(), TxHeight::Unconfirmed)
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
untrusted_pending: 13_000,
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = tracker
|
|
||||||
.insert_tx(tx2.clone(), TxHeight::Unconfirmed)
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
trusted_pending: 7_000,
|
|
||||||
untrusted_pending: 13_000,
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = tracker
|
|
||||||
.insert_tx(tx_coinbase, TxHeight::Confirmed(0))
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
trusted_pending: 7_000,
|
|
||||||
untrusted_pending: 13_000,
|
|
||||||
immature: 11_000,
|
|
||||||
..Default::default()
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = tracker.insert_tx(tx1, TxHeight::Confirmed(1)).unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
trusted_pending: 7_000,
|
|
||||||
untrusted_pending: 0,
|
|
||||||
immature: 11_000,
|
|
||||||
confirmed: 13_000,
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = tracker.insert_tx(tx2, TxHeight::Confirmed(2)).unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
trusted_pending: 0,
|
|
||||||
untrusted_pending: 0,
|
|
||||||
immature: 11_000,
|
|
||||||
confirmed: 20_000,
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = tracker
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: 98,
|
|
||||||
hash: h!("98"),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
trusted_pending: 0,
|
|
||||||
untrusted_pending: 0,
|
|
||||||
immature: 11_000,
|
|
||||||
confirmed: 20_000,
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
let _ = tracker
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: 99,
|
|
||||||
hash: h!("99"),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
tracker.balance(should_trust),
|
|
||||||
Balance {
|
|
||||||
trusted_pending: 0,
|
|
||||||
untrusted_pending: 0,
|
|
||||||
immature: 0,
|
|
||||||
confirmed: 31_000,
|
|
||||||
}
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(tracker.balance_at(0), 0);
|
|
||||||
assert_eq!(tracker.balance_at(1), 13_000);
|
|
||||||
assert_eq!(tracker.balance_at(2), 20_000);
|
|
||||||
assert_eq!(tracker.balance_at(98), 20_000);
|
|
||||||
assert_eq!(tracker.balance_at(99), 31_000);
|
|
||||||
assert_eq!(tracker.balance_at(100), 31_000);
|
|
||||||
}
|
|
||||||
@@ -4,10 +4,12 @@
|
|||||||
mod common;
|
mod common;
|
||||||
use bdk_chain::{
|
use bdk_chain::{
|
||||||
collections::BTreeMap,
|
collections::BTreeMap,
|
||||||
keychain::{DerivationAdditions, KeychainTxOutIndex},
|
indexed_tx_graph::Indexer,
|
||||||
|
keychain::{self, KeychainTxOutIndex},
|
||||||
|
Append,
|
||||||
};
|
};
|
||||||
|
|
||||||
use bitcoin::{secp256k1::Secp256k1, OutPoint, Script, Transaction, TxOut};
|
use bitcoin::{secp256k1::Secp256k1, OutPoint, ScriptBuf, Transaction, TxOut};
|
||||||
use miniscript::{Descriptor, DescriptorPublicKey};
|
use miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
#[derive(Clone, Debug, PartialEq, Eq, Ord, PartialOrd)]
|
||||||
@@ -16,12 +18,14 @@ enum TestKeychain {
|
|||||||
Internal,
|
Internal,
|
||||||
}
|
}
|
||||||
|
|
||||||
fn init_txout_index() -> (
|
fn init_txout_index(
|
||||||
|
lookahead: u32,
|
||||||
|
) -> (
|
||||||
bdk_chain::keychain::KeychainTxOutIndex<TestKeychain>,
|
bdk_chain::keychain::KeychainTxOutIndex<TestKeychain>,
|
||||||
Descriptor<DescriptorPublicKey>,
|
Descriptor<DescriptorPublicKey>,
|
||||||
Descriptor<DescriptorPublicKey>,
|
Descriptor<DescriptorPublicKey>,
|
||||||
) {
|
) {
|
||||||
let mut txout_index = bdk_chain::keychain::KeychainTxOutIndex::<TestKeychain>::default();
|
let mut txout_index = bdk_chain::keychain::KeychainTxOutIndex::<TestKeychain>::new(lookahead);
|
||||||
|
|
||||||
let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
let secp = bdk_chain::bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
let (external_descriptor,_) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "tr([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/0/*)").unwrap();
|
||||||
@@ -33,7 +37,7 @@ fn init_txout_index() -> (
|
|||||||
(txout_index, external_descriptor, internal_descriptor)
|
(txout_index, external_descriptor, internal_descriptor)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> Script {
|
fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> ScriptBuf {
|
||||||
descriptor
|
descriptor
|
||||||
.derived_descriptor(&Secp256k1::verification_only(), index)
|
.derived_descriptor(&Secp256k1::verification_only(), index)
|
||||||
.expect("must derive")
|
.expect("must derive")
|
||||||
@@ -42,7 +46,9 @@ fn spk_at_index(descriptor: &Descriptor<DescriptorPublicKey>, index: u32) -> Scr
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_set_all_derivation_indices() {
|
fn test_set_all_derivation_indices() {
|
||||||
let (mut txout_index, _, _) = init_txout_index();
|
use bdk_chain::indexed_tx_graph::Indexer;
|
||||||
|
|
||||||
|
let (mut txout_index, _, _) = init_txout_index(0);
|
||||||
let derive_to: BTreeMap<_, _> =
|
let derive_to: BTreeMap<_, _> =
|
||||||
[(TestKeychain::External, 12), (TestKeychain::Internal, 24)].into();
|
[(TestKeychain::External, 12), (TestKeychain::Internal, 24)].into();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -52,83 +58,75 @@ fn test_set_all_derivation_indices() {
|
|||||||
assert_eq!(txout_index.last_revealed_indices(), &derive_to);
|
assert_eq!(txout_index.last_revealed_indices(), &derive_to);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index.reveal_to_target_multi(&derive_to).1,
|
txout_index.reveal_to_target_multi(&derive_to).1,
|
||||||
DerivationAdditions::default(),
|
keychain::ChangeSet::default(),
|
||||||
"no changes if we set to the same thing"
|
"no changes if we set to the same thing"
|
||||||
);
|
);
|
||||||
|
assert_eq!(txout_index.initial_changeset().as_inner(), &derive_to);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_lookahead() {
|
fn test_lookahead() {
|
||||||
let (mut txout_index, external_desc, internal_desc) = init_txout_index();
|
let (mut txout_index, external_desc, internal_desc) = init_txout_index(10);
|
||||||
|
|
||||||
// ensure it does not break anything if lookahead is set multiple times
|
|
||||||
(0..=10).for_each(|lookahead| txout_index.set_lookahead(&TestKeychain::External, lookahead));
|
|
||||||
(0..=20)
|
|
||||||
.filter(|v| v % 2 == 0)
|
|
||||||
.for_each(|lookahead| txout_index.set_lookahead(&TestKeychain::Internal, lookahead));
|
|
||||||
|
|
||||||
assert_eq!(txout_index.inner().all_spks().len(), 30);
|
|
||||||
|
|
||||||
// given:
|
// given:
|
||||||
// - external lookahead set to 10
|
// - external lookahead set to 10
|
||||||
// - internal lookahead set to 20
|
|
||||||
// when:
|
// when:
|
||||||
// - set external derivation index to value higher than last, but within the lookahead value
|
// - set external derivation index to value higher than last, but within the lookahead value
|
||||||
// expect:
|
// expect:
|
||||||
// - scripts cached in spk_txout_index should increase correctly
|
// - scripts cached in spk_txout_index should increase correctly
|
||||||
// - stored scripts of external keychain should be of expected counts
|
// - stored scripts of external keychain should be of expected counts
|
||||||
for index in (0..20).skip_while(|i| i % 2 == 1) {
|
for index in (0..20).skip_while(|i| i % 2 == 1) {
|
||||||
let (revealed_spks, revealed_additions) =
|
let (revealed_spks, revealed_changeset) =
|
||||||
txout_index.reveal_to_target(&TestKeychain::External, index);
|
txout_index.reveal_to_target(&TestKeychain::External, index);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
revealed_spks.collect::<Vec<_>>(),
|
revealed_spks.collect::<Vec<_>>(),
|
||||||
vec![(index, spk_at_index(&external_desc, index))],
|
vec![(index, spk_at_index(&external_desc, index))],
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
revealed_additions.as_inner(),
|
revealed_changeset.as_inner(),
|
||||||
&[(TestKeychain::External, index)].into()
|
&[(TestKeychain::External, index)].into()
|
||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index.inner().all_spks().len(),
|
txout_index.inner().all_spks().len(),
|
||||||
10 /* external lookahead */ +
|
10 /* external lookahead */ +
|
||||||
20 /* internal lookahead */ +
|
10 /* internal lookahead */ +
|
||||||
index as usize + 1 /* `derived` count */
|
index as usize + 1 /* `derived` count */
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.revealed_spks_of_keychain(&TestKeychain::External)
|
.revealed_keychain_spks(&TestKeychain::External)
|
||||||
.count(),
|
.count(),
|
||||||
index as usize + 1,
|
index as usize + 1,
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.revealed_spks_of_keychain(&TestKeychain::Internal)
|
.revealed_keychain_spks(&TestKeychain::Internal)
|
||||||
.count(),
|
.count(),
|
||||||
0,
|
0,
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.unused_spks_of_keychain(&TestKeychain::External)
|
.unused_keychain_spks(&TestKeychain::External)
|
||||||
.count(),
|
.count(),
|
||||||
index as usize + 1,
|
index as usize + 1,
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.unused_spks_of_keychain(&TestKeychain::Internal)
|
.unused_keychain_spks(&TestKeychain::Internal)
|
||||||
.count(),
|
.count(),
|
||||||
0,
|
0,
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
// given:
|
// given:
|
||||||
// - internal lookahead is 20
|
// - internal lookahead is 10
|
||||||
// - internal derivation index is `None`
|
// - internal derivation index is `None`
|
||||||
// when:
|
// when:
|
||||||
// - derivation index is set ahead of current derivation index + lookahead
|
// - derivation index is set ahead of current derivation index + lookahead
|
||||||
// expect:
|
// expect:
|
||||||
// - scripts cached in spk_txout_index should increase correctly, a.k.a. no scripts are skipped
|
// - scripts cached in spk_txout_index should increase correctly, a.k.a. no scripts are skipped
|
||||||
let (revealed_spks, revealed_additions) =
|
let (revealed_spks, revealed_changeset) =
|
||||||
txout_index.reveal_to_target(&TestKeychain::Internal, 24);
|
txout_index.reveal_to_target(&TestKeychain::Internal, 24);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
revealed_spks.collect::<Vec<_>>(),
|
revealed_spks.collect::<Vec<_>>(),
|
||||||
@@ -137,19 +135,19 @@ fn test_lookahead() {
|
|||||||
.collect::<Vec<_>>(),
|
.collect::<Vec<_>>(),
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
revealed_additions.as_inner(),
|
revealed_changeset.as_inner(),
|
||||||
&[(TestKeychain::Internal, 24)].into()
|
&[(TestKeychain::Internal, 24)].into()
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index.inner().all_spks().len(),
|
txout_index.inner().all_spks().len(),
|
||||||
10 /* external lookahead */ +
|
10 /* external lookahead */ +
|
||||||
20 /* internal lookahead */ +
|
10 /* internal lookahead */ +
|
||||||
20 /* external stored index count */ +
|
20 /* external stored index count */ +
|
||||||
25 /* internal stored index count */
|
25 /* internal stored index count */
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.revealed_spks_of_keychain(&TestKeychain::Internal)
|
.revealed_keychain_spks(&TestKeychain::Internal)
|
||||||
.count(),
|
.count(),
|
||||||
25,
|
25,
|
||||||
);
|
);
|
||||||
@@ -176,19 +174,21 @@ fn test_lookahead() {
|
|||||||
TxOut {
|
TxOut {
|
||||||
script_pubkey: external_desc
|
script_pubkey: external_desc
|
||||||
.at_derivation_index(external_index)
|
.at_derivation_index(external_index)
|
||||||
|
.unwrap()
|
||||||
.script_pubkey(),
|
.script_pubkey(),
|
||||||
value: 10_000,
|
value: 10_000,
|
||||||
},
|
},
|
||||||
TxOut {
|
TxOut {
|
||||||
script_pubkey: internal_desc
|
script_pubkey: internal_desc
|
||||||
.at_derivation_index(internal_index)
|
.at_derivation_index(internal_index)
|
||||||
|
.unwrap()
|
||||||
.script_pubkey(),
|
.script_pubkey(),
|
||||||
value: 10_000,
|
value: 10_000,
|
||||||
},
|
},
|
||||||
],
|
],
|
||||||
..common::new_tx(external_index)
|
..common::new_tx(external_index)
|
||||||
};
|
};
|
||||||
assert_eq!(txout_index.scan(&tx), DerivationAdditions::default());
|
assert_eq!(txout_index.index_tx(&tx), keychain::ChangeSet::default());
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index.last_revealed_index(&TestKeychain::External),
|
txout_index.last_revealed_index(&TestKeychain::External),
|
||||||
Some(last_external_index)
|
Some(last_external_index)
|
||||||
@@ -199,13 +199,13 @@ fn test_lookahead() {
|
|||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.revealed_spks_of_keychain(&TestKeychain::External)
|
.revealed_keychain_spks(&TestKeychain::External)
|
||||||
.count(),
|
.count(),
|
||||||
last_external_index as usize + 1,
|
last_external_index as usize + 1,
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
txout_index
|
txout_index
|
||||||
.revealed_spks_of_keychain(&TestKeychain::Internal)
|
.revealed_keychain_spks(&TestKeychain::Internal)
|
||||||
.count(),
|
.count(),
|
||||||
last_internal_index as usize + 1,
|
last_internal_index as usize + 1,
|
||||||
);
|
);
|
||||||
@@ -219,12 +219,19 @@ fn test_lookahead() {
|
|||||||
// - last used index should change as expected
|
// - last used index should change as expected
|
||||||
#[test]
|
#[test]
|
||||||
fn test_scan_with_lookahead() {
|
fn test_scan_with_lookahead() {
|
||||||
let (mut txout_index, external_desc, _) = init_txout_index();
|
let (mut txout_index, external_desc, _) = init_txout_index(10);
|
||||||
txout_index.set_lookahead_for_all(10);
|
|
||||||
|
|
||||||
let spks: BTreeMap<u32, Script> = [0, 10, 20, 30]
|
let spks: BTreeMap<u32, ScriptBuf> = [0, 10, 20, 30]
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.map(|i| (i, external_desc.at_derivation_index(i).script_pubkey()))
|
.map(|i| {
|
||||||
|
(
|
||||||
|
i,
|
||||||
|
external_desc
|
||||||
|
.at_derivation_index(i)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey(),
|
||||||
|
)
|
||||||
|
})
|
||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
for (&spk_i, spk) in &spks {
|
for (&spk_i, spk) in &spks {
|
||||||
@@ -234,9 +241,9 @@ fn test_scan_with_lookahead() {
|
|||||||
value: 0,
|
value: 0,
|
||||||
};
|
};
|
||||||
|
|
||||||
let additions = txout_index.scan_txout(op, &txout);
|
let changeset = txout_index.index_txout(op, &txout);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
additions.as_inner(),
|
changeset.as_inner(),
|
||||||
&[(TestKeychain::External, spk_i)].into()
|
&[(TestKeychain::External, spk_i)].into()
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -250,36 +257,40 @@ fn test_scan_with_lookahead() {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// now try with index 41 (lookahead surpassed), we expect that the txout to not be indexed
|
// now try with index 41 (lookahead surpassed), we expect that the txout to not be indexed
|
||||||
let spk_41 = external_desc.at_derivation_index(41).script_pubkey();
|
let spk_41 = external_desc
|
||||||
|
.at_derivation_index(41)
|
||||||
|
.unwrap()
|
||||||
|
.script_pubkey();
|
||||||
let op = OutPoint::new(h!("fake tx"), 41);
|
let op = OutPoint::new(h!("fake tx"), 41);
|
||||||
let txout = TxOut {
|
let txout = TxOut {
|
||||||
script_pubkey: spk_41,
|
script_pubkey: spk_41,
|
||||||
value: 0,
|
value: 0,
|
||||||
};
|
};
|
||||||
let additions = txout_index.scan_txout(op, &txout);
|
let changeset = txout_index.index_txout(op, &txout);
|
||||||
assert!(additions.is_empty());
|
assert!(changeset.is_empty());
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
|
#[rustfmt::skip]
|
||||||
fn test_wildcard_derivations() {
|
fn test_wildcard_derivations() {
|
||||||
let (mut txout_index, external_desc, _) = init_txout_index();
|
let (mut txout_index, external_desc, _) = init_txout_index(0);
|
||||||
let external_spk_0 = external_desc.at_derivation_index(0).script_pubkey();
|
let external_spk_0 = external_desc.at_derivation_index(0).unwrap().script_pubkey();
|
||||||
let external_spk_16 = external_desc.at_derivation_index(16).script_pubkey();
|
let external_spk_16 = external_desc.at_derivation_index(16).unwrap().script_pubkey();
|
||||||
let external_spk_26 = external_desc.at_derivation_index(26).script_pubkey();
|
let external_spk_26 = external_desc.at_derivation_index(26).unwrap().script_pubkey();
|
||||||
let external_spk_27 = external_desc.at_derivation_index(27).script_pubkey();
|
let external_spk_27 = external_desc.at_derivation_index(27).unwrap().script_pubkey();
|
||||||
|
|
||||||
// - nothing is derived
|
// - nothing is derived
|
||||||
// - unused list is also empty
|
// - unused list is also empty
|
||||||
//
|
//
|
||||||
// - next_derivation_index() == (0, true)
|
// - next_derivation_index() == (0, true)
|
||||||
// - derive_new() == ((0, <spk>), DerivationAdditions)
|
// - derive_new() == ((0, <spk>), keychain::ChangeSet)
|
||||||
// - next_unused() == ((0, <spk>), DerivationAdditions:is_empty())
|
// - next_unused() == ((0, <spk>), keychain::ChangeSet:is_empty())
|
||||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (0_u32, &external_spk_0));
|
assert_eq!(spk, (0_u32, external_spk_0.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (0_u32, &external_spk_0));
|
assert_eq!(spk, (0_u32, external_spk_0.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[].into());
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
// - derived till 25
|
// - derived till 25
|
||||||
@@ -288,45 +299,45 @@ fn test_wildcard_derivations() {
|
|||||||
// - unused list: [16, 18, 19, 21, 22, 24, 25]
|
// - unused list: [16, 18, 19, 21, 22, 24, 25]
|
||||||
|
|
||||||
// - next_derivation_index() = (26, true)
|
// - next_derivation_index() = (26, true)
|
||||||
// - derive_new() = ((26, <spk>), DerivationAdditions)
|
// - derive_new() = ((26, <spk>), keychain::ChangeSet)
|
||||||
// - next_unused() == ((16, <spk>), DerivationAdditions::is_empty())
|
// - next_unused() == ((16, <spk>), keychain::ChangeSet::is_empty())
|
||||||
let _ = txout_index.reveal_to_target(&TestKeychain::External, 25);
|
let _ = txout_index.reveal_to_target(&TestKeychain::External, 25);
|
||||||
|
|
||||||
(0..=15)
|
(0..=15)
|
||||||
.into_iter()
|
.chain([17, 20, 23])
|
||||||
.chain(vec![17, 20, 23].into_iter())
|
.for_each(|index| assert!(txout_index.mark_used(TestKeychain::External, index)));
|
||||||
.for_each(|index| assert!(txout_index.mark_used(&TestKeychain::External, index)));
|
|
||||||
|
|
||||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (26, true));
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (26, true));
|
||||||
|
|
||||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (26, &external_spk_26));
|
assert_eq!(spk, (26, external_spk_26.as_script()));
|
||||||
|
|
||||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 26)].into());
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 26)].into());
|
||||||
|
|
||||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (16, &external_spk_16));
|
assert_eq!(spk, (16, external_spk_16.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[].into());
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
// - Use all the derived till 26.
|
// - Use all the derived till 26.
|
||||||
// - next_unused() = ((27, <spk>), DerivationAdditions)
|
// - next_unused() = ((27, <spk>), keychain::ChangeSet)
|
||||||
(0..=26).into_iter().for_each(|index| {
|
(0..=26).for_each(|index| {
|
||||||
txout_index.mark_used(&TestKeychain::External, index);
|
txout_index.mark_used(TestKeychain::External, index);
|
||||||
});
|
});
|
||||||
|
|
||||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (27, &external_spk_27));
|
assert_eq!(spk, (27, external_spk_27.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 27)].into());
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 27)].into());
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_non_wildcard_derivations() {
|
fn test_non_wildcard_derivations() {
|
||||||
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::default();
|
let mut txout_index = KeychainTxOutIndex::<TestKeychain>::new(0);
|
||||||
|
|
||||||
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
let secp = bitcoin::secp256k1::Secp256k1::signing_only();
|
||||||
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
let (no_wildcard_descriptor, _) = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, "wpkh([73c5da0a/86'/0'/0']xprv9xgqHN7yz9MwCkxsBPN5qetuNdQSUttZNKw1dcYTV4mkaAFiBVGQziHs3NRSWMkCzvgjEe3n9xV8oYywvM8at9yRqyaZVz6TYYhX98VjsUk/1/0)").unwrap();
|
||||||
let external_spk = no_wildcard_descriptor
|
let external_spk = no_wildcard_descriptor
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
|
|
||||||
txout_index.add_keychain(TestKeychain::External, no_wildcard_descriptor);
|
txout_index.add_keychain(TestKeychain::External, no_wildcard_descriptor);
|
||||||
@@ -339,11 +350,11 @@ fn test_non_wildcard_derivations() {
|
|||||||
// - when we get the next unused script, script @ index 0
|
// - when we get the next unused script, script @ index 0
|
||||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, true));
|
||||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (0, &external_spk));
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
assert_eq!(changeset.as_inner(), &[(TestKeychain::External, 0)].into());
|
||||||
|
|
||||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (0, &external_spk));
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[].into());
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
// given:
|
// given:
|
||||||
@@ -351,19 +362,127 @@ fn test_non_wildcard_derivations() {
|
|||||||
// expect:
|
// expect:
|
||||||
// - next derivation index should not be new
|
// - next derivation index should not be new
|
||||||
// - derive new and next unused should return the old script
|
// - derive new and next unused should return the old script
|
||||||
// - store_up_to should not panic and return empty additions
|
// - store_up_to should not panic and return empty changeset
|
||||||
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, false));
|
assert_eq!(txout_index.next_index(&TestKeychain::External), (0, false));
|
||||||
txout_index.mark_used(&TestKeychain::External, 0);
|
txout_index.mark_used(TestKeychain::External, 0);
|
||||||
|
|
||||||
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.reveal_next_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (0, &external_spk));
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[].into());
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
|
|
||||||
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
let (spk, changeset) = txout_index.next_unused_spk(&TestKeychain::External);
|
||||||
assert_eq!(spk, (0, &external_spk));
|
assert_eq!(spk, (0, external_spk.as_script()));
|
||||||
assert_eq!(changeset.as_inner(), &[].into());
|
assert_eq!(changeset.as_inner(), &[].into());
|
||||||
let (revealed_spks, revealed_additions) =
|
let (revealed_spks, revealed_changeset) =
|
||||||
txout_index.reveal_to_target(&TestKeychain::External, 200);
|
txout_index.reveal_to_target(&TestKeychain::External, 200);
|
||||||
assert_eq!(revealed_spks.count(), 0);
|
assert_eq!(revealed_spks.count(), 0);
|
||||||
assert!(revealed_additions.is_empty());
|
assert!(revealed_changeset.is_empty());
|
||||||
|
|
||||||
|
// we check that spks_of_keychain returns a SpkIterator with just one element
|
||||||
|
assert_eq!(
|
||||||
|
txout_index
|
||||||
|
.revealed_keychain_spks(&TestKeychain::External)
|
||||||
|
.count(),
|
||||||
|
1,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Check that calling `lookahead_to_target` stores the expected spks.
|
||||||
|
#[test]
|
||||||
|
fn lookahead_to_target() {
|
||||||
|
#[derive(Default)]
|
||||||
|
struct TestCase {
|
||||||
|
/// Global lookahead value.
|
||||||
|
lookahead: u32,
|
||||||
|
/// Last revealed index for external keychain.
|
||||||
|
external_last_revealed: Option<u32>,
|
||||||
|
/// Last revealed index for internal keychain.
|
||||||
|
internal_last_revealed: Option<u32>,
|
||||||
|
/// Call `lookahead_to_target(External, u32)`.
|
||||||
|
external_target: Option<u32>,
|
||||||
|
/// Call `lookahead_to_target(Internal, u32)`.
|
||||||
|
internal_target: Option<u32>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = &[
|
||||||
|
TestCase {
|
||||||
|
lookahead: 0,
|
||||||
|
external_target: Some(100),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
lookahead: 10,
|
||||||
|
internal_target: Some(99),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
lookahead: 100,
|
||||||
|
internal_target: Some(9),
|
||||||
|
external_target: Some(10),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
lookahead: 12,
|
||||||
|
external_last_revealed: Some(2),
|
||||||
|
internal_last_revealed: Some(2),
|
||||||
|
internal_target: Some(15),
|
||||||
|
external_target: Some(13),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
lookahead: 13,
|
||||||
|
external_last_revealed: Some(100),
|
||||||
|
internal_last_revealed: Some(21),
|
||||||
|
internal_target: Some(120),
|
||||||
|
external_target: Some(130),
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for t in test_cases {
|
||||||
|
let (mut index, _, _) = init_txout_index(t.lookahead);
|
||||||
|
|
||||||
|
if let Some(last_revealed) = t.external_last_revealed {
|
||||||
|
let _ = index.reveal_to_target(&TestKeychain::External, last_revealed);
|
||||||
|
}
|
||||||
|
if let Some(last_revealed) = t.internal_last_revealed {
|
||||||
|
let _ = index.reveal_to_target(&TestKeychain::Internal, last_revealed);
|
||||||
|
}
|
||||||
|
|
||||||
|
let keychain_test_cases = [
|
||||||
|
(
|
||||||
|
TestKeychain::External,
|
||||||
|
t.external_last_revealed,
|
||||||
|
t.external_target,
|
||||||
|
),
|
||||||
|
(
|
||||||
|
TestKeychain::Internal,
|
||||||
|
t.internal_last_revealed,
|
||||||
|
t.internal_target,
|
||||||
|
),
|
||||||
|
];
|
||||||
|
for (keychain, last_revealed, target) in keychain_test_cases {
|
||||||
|
if let Some(target) = target {
|
||||||
|
let original_last_stored_index = match last_revealed {
|
||||||
|
Some(last_revealed) => Some(last_revealed + t.lookahead),
|
||||||
|
None => t.lookahead.checked_sub(1),
|
||||||
|
};
|
||||||
|
let exp_last_stored_index = match original_last_stored_index {
|
||||||
|
Some(original_last_stored_index) => {
|
||||||
|
Ord::max(target, original_last_stored_index)
|
||||||
|
}
|
||||||
|
None => target,
|
||||||
|
};
|
||||||
|
index.lookahead_to_target(&keychain, target);
|
||||||
|
let keys = index
|
||||||
|
.inner()
|
||||||
|
.all_spks()
|
||||||
|
.range((keychain.clone(), 0)..=(keychain.clone(), u32::MAX))
|
||||||
|
.map(|(k, _)| k.clone())
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
let exp_keys = core::iter::repeat(keychain)
|
||||||
|
.zip(0_u32..=exp_last_stored_index)
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
assert_eq!(keys, exp_keys);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
681
crates/chain/tests/test_local_chain.rs
Normal file
681
crates/chain/tests/test_local_chain.rs
Normal file
@@ -0,0 +1,681 @@
|
|||||||
|
use bdk_chain::{
|
||||||
|
local_chain::{
|
||||||
|
AlterCheckPointError, ApplyHeaderError, CannotConnectError, ChangeSet, CheckPoint,
|
||||||
|
LocalChain, MissingGenesisError, Update,
|
||||||
|
},
|
||||||
|
BlockId,
|
||||||
|
};
|
||||||
|
use bitcoin::{block::Header, hashes::Hash, BlockHash};
|
||||||
|
|
||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
struct TestLocalChain<'a> {
|
||||||
|
name: &'static str,
|
||||||
|
chain: LocalChain,
|
||||||
|
update: Update,
|
||||||
|
exp: ExpectedResult<'a>,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Debug, PartialEq)]
|
||||||
|
enum ExpectedResult<'a> {
|
||||||
|
Ok {
|
||||||
|
changeset: &'a [(u32, Option<BlockHash>)],
|
||||||
|
init_changeset: &'a [(u32, Option<BlockHash>)],
|
||||||
|
},
|
||||||
|
Err(CannotConnectError),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'a> TestLocalChain<'a> {
|
||||||
|
fn run(mut self) {
|
||||||
|
println!("[TestLocalChain] test: {}", self.name);
|
||||||
|
let got_changeset = match self.chain.apply_update(self.update) {
|
||||||
|
Ok(changeset) => changeset,
|
||||||
|
Err(got_err) => {
|
||||||
|
assert_eq!(
|
||||||
|
ExpectedResult::Err(got_err),
|
||||||
|
self.exp,
|
||||||
|
"{}: unexpected error",
|
||||||
|
self.name
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
match self.exp {
|
||||||
|
ExpectedResult::Ok {
|
||||||
|
changeset,
|
||||||
|
init_changeset,
|
||||||
|
} => {
|
||||||
|
assert_eq!(
|
||||||
|
got_changeset,
|
||||||
|
changeset.iter().cloned().collect(),
|
||||||
|
"{}: unexpected changeset",
|
||||||
|
self.name
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
self.chain.initial_changeset(),
|
||||||
|
init_changeset.iter().cloned().collect(),
|
||||||
|
"{}: unexpected initial changeset",
|
||||||
|
self.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
ExpectedResult::Err(err) => panic!(
|
||||||
|
"{}: expected error ({}), got non-error result: {:?}",
|
||||||
|
self.name, err, got_changeset
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn update_local_chain() {
|
||||||
|
[
|
||||||
|
TestLocalChain {
|
||||||
|
name: "add first tip",
|
||||||
|
chain: local_chain![(0, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("A"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[],
|
||||||
|
init_changeset: &[(0, Some(h!("A")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "add second tip",
|
||||||
|
chain: local_chain![(0, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("A")), (1, h!("B"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("A"))), (1, Some(h!("B")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "two disjoint chains cannot merge",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError {
|
||||||
|
try_include_height: 1,
|
||||||
|
}),
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "two disjoint chains cannot merge (existing chain longer)",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("B"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError {
|
||||||
|
try_include_height: 2,
|
||||||
|
}),
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "duplicate chains should merge",
|
||||||
|
chain: local_chain![(0, h!("A"))],
|
||||||
|
update: chain_update![(0, h!("A"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[],
|
||||||
|
init_changeset: &[(0, Some(h!("A")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Introduce an older checkpoint (B)
|
||||||
|
// | 0 | 1 | 2 | 3
|
||||||
|
// chain | _ C D
|
||||||
|
// update | _ B C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "can introduce older checkpoint",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("C")), (3, h!("D"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("B")), (2, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("B"))), (2, Some(h!("C"))), (3, Some(h!("D")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Introduce an older checkpoint (A) that is not directly behind PoA
|
||||||
|
// | 0 | 2 | 3 | 4
|
||||||
|
// chain | _ B C
|
||||||
|
// update | _ A C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "can introduce older checkpoint 2",
|
||||||
|
chain: local_chain![(0, h!("_")), (3, h!("B")), (4, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("A")), (4, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(2, Some(h!("A")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (2, Some(h!("A"))), (3, Some(h!("B"))), (4, Some(h!("C")))],
|
||||||
|
}
|
||||||
|
},
|
||||||
|
// Introduce an older checkpoint (B) that is not the oldest checkpoint
|
||||||
|
// | 0 | 1 | 2 | 3
|
||||||
|
// chain | _ A C
|
||||||
|
// update | _ B C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "can introduce older checkpoint 3",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("A")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(2, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||||
|
}
|
||||||
|
},
|
||||||
|
// Introduce two older checkpoints below the PoA
|
||||||
|
// | 0 | 1 | 2 | 3
|
||||||
|
// chain | _ C
|
||||||
|
// update | _ A B C
|
||||||
|
TestLocalChain {
|
||||||
|
name: "introduce two older checkpoints below PoA",
|
||||||
|
chain: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("A"))), (2, Some(h!("B")))],
|
||||||
|
init_changeset: &[(0, Some(h!("_"))), (1, Some(h!("A"))), (2, Some(h!("B"))), (3, Some(h!("C")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
TestLocalChain {
|
||||||
|
name: "fix blockhash before agreement point",
|
||||||
|
chain: local_chain![(0, h!("im-wrong")), (1, h!("we-agree"))],
|
||||||
|
update: chain_update![(0, h!("fix")), (1, h!("we-agree"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(0, Some(h!("fix")))],
|
||||||
|
init_changeset: &[(0, Some(h!("fix"))), (1, Some(h!("we-agree")))],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// B and C are in both chain and update
|
||||||
|
// | 0 | 1 | 2 | 3 | 4
|
||||||
|
// chain | _ B C
|
||||||
|
// update | _ A B C D
|
||||||
|
// This should succeed with the point of agreement being C and A should be added in addition.
|
||||||
|
TestLocalChain {
|
||||||
|
name: "two points of agreement",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[(1, Some(h!("A"))), (4, Some(h!("D")))],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(1, Some(h!("A"))),
|
||||||
|
(2, Some(h!("B"))),
|
||||||
|
(3, Some(h!("C"))),
|
||||||
|
(4, Some(h!("D"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Update and chain does not connect:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4
|
||||||
|
// chain | _ B C
|
||||||
|
// update | _ A B D
|
||||||
|
// This should fail as we cannot figure out whether C & D are on the same chain
|
||||||
|
TestLocalChain {
|
||||||
|
name: "update and chain does not connect",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("A")), (2, h!("B")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError {
|
||||||
|
try_include_height: 3,
|
||||||
|
}),
|
||||||
|
},
|
||||||
|
// Transient invalidation:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | _ B C E
|
||||||
|
// update | _ B' C' D
|
||||||
|
// This should succeed and invalidate B,C and E with point of agreement being A.
|
||||||
|
TestLocalChain {
|
||||||
|
name: "transitive invalidation applies to checkpoints higher than invalidation",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(2, Some(h!("B'"))),
|
||||||
|
(3, Some(h!("C'"))),
|
||||||
|
(4, Some(h!("D"))),
|
||||||
|
(5, None),
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(2, Some(h!("B'"))),
|
||||||
|
(3, Some(h!("C'"))),
|
||||||
|
(4, Some(h!("D"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Transient invalidation:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4
|
||||||
|
// chain | _ B C E
|
||||||
|
// update | _ B' C' D
|
||||||
|
// This should succeed and invalidate B, C and E with no point of agreement
|
||||||
|
TestLocalChain {
|
||||||
|
name: "transitive invalidation applies to checkpoints higher than invalidation no point of agreement",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("B")), (2, h!("C")), (4, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("_")), (1, h!("B'")), (2, h!("C'")), (3, h!("D"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(1, Some(h!("B'"))),
|
||||||
|
(2, Some(h!("C'"))),
|
||||||
|
(3, Some(h!("D"))),
|
||||||
|
(4, None)
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(1, Some(h!("B'"))),
|
||||||
|
(2, Some(h!("C'"))),
|
||||||
|
(3, Some(h!("D"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Transient invalidation:
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | _ A B C E
|
||||||
|
// update | _ B' C' D
|
||||||
|
// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
||||||
|
// A was invalid.
|
||||||
|
TestLocalChain {
|
||||||
|
name: "invalidation but no connection",
|
||||||
|
chain: local_chain![(0, h!("_")), (1, h!("A")), (2, h!("B")), (3, h!("C")), (5, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("B'")), (3, h!("C'")), (4, h!("D"))],
|
||||||
|
exp: ExpectedResult::Err(CannotConnectError { try_include_height: 1 }),
|
||||||
|
},
|
||||||
|
// Introduce blocks between two points of agreement
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | A B D E
|
||||||
|
// update | A C E F
|
||||||
|
TestLocalChain {
|
||||||
|
name: "introduce blocks between two points of agreement",
|
||||||
|
chain: local_chain![(0, h!("A")), (1, h!("B")), (3, h!("D")), (4, h!("E"))],
|
||||||
|
update: chain_update![(0, h!("A")), (2, h!("C")), (4, h!("E")), (5, h!("F"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(2, Some(h!("C"))),
|
||||||
|
(5, Some(h!("F"))),
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("A"))),
|
||||||
|
(1, Some(h!("B"))),
|
||||||
|
(2, Some(h!("C"))),
|
||||||
|
(3, Some(h!("D"))),
|
||||||
|
(4, Some(h!("E"))),
|
||||||
|
(5, Some(h!("F"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
// Allow update that is shorter than original chain
|
||||||
|
// | 0 | 1 | 2 | 3 | 4 | 5
|
||||||
|
// chain | A C D E F
|
||||||
|
// update | A C D'
|
||||||
|
TestLocalChain {
|
||||||
|
name: "allow update that is shorter than original chain",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("C")), (3, h!("D")), (4, h!("E")), (5, h!("F"))],
|
||||||
|
update: chain_update![(0, h!("_")), (2, h!("C")), (3, h!("D'"))],
|
||||||
|
exp: ExpectedResult::Ok {
|
||||||
|
changeset: &[
|
||||||
|
(3, Some(h!("D'"))),
|
||||||
|
(4, None),
|
||||||
|
(5, None),
|
||||||
|
],
|
||||||
|
init_changeset: &[
|
||||||
|
(0, Some(h!("_"))),
|
||||||
|
(2, Some(h!("C"))),
|
||||||
|
(3, Some(h!("D'"))),
|
||||||
|
],
|
||||||
|
},
|
||||||
|
},
|
||||||
|
]
|
||||||
|
.into_iter()
|
||||||
|
.for_each(TestLocalChain::run);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn local_chain_insert_block() {
|
||||||
|
struct TestCase {
|
||||||
|
original: LocalChain,
|
||||||
|
insert: (u32, BlockHash),
|
||||||
|
expected_result: Result<ChangeSet, AlterCheckPointError>,
|
||||||
|
expected_final: LocalChain,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_"))],
|
||||||
|
insert: (5, h!("block5")),
|
||||||
|
expected_result: Ok([(5, Some(h!("block5")))].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (5, h!("block5"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (3, h!("A"))],
|
||||||
|
insert: (4, h!("B")),
|
||||||
|
expected_result: Ok([(4, Some(h!("B")))].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (4, h!("B"))],
|
||||||
|
insert: (3, h!("A")),
|
||||||
|
expected_result: Ok([(3, Some(h!("A")))].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (3, h!("A")), (4, h!("B"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
insert: (2, h!("K")),
|
||||||
|
expected_result: Ok([].into()),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
insert: (2, h!("J")),
|
||||||
|
expected_result: Err(AlterCheckPointError {
|
||||||
|
height: 2,
|
||||||
|
original_hash: h!("K"),
|
||||||
|
update_hash: Some(h!("J")),
|
||||||
|
}),
|
||||||
|
expected_final: local_chain![(0, h!("_")), (2, h!("K"))],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
let mut chain = t.original;
|
||||||
|
assert_eq!(
|
||||||
|
chain.insert_block(t.insert.into()),
|
||||||
|
t.expected_result,
|
||||||
|
"[{}] unexpected result when inserting block",
|
||||||
|
i,
|
||||||
|
);
|
||||||
|
assert_eq!(chain, t.expected_final, "[{}] unexpected final chain", i,);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn local_chain_disconnect_from() {
|
||||||
|
struct TestCase {
|
||||||
|
name: &'static str,
|
||||||
|
original: LocalChain,
|
||||||
|
disconnect_from: (u32, BlockHash),
|
||||||
|
exp_result: Result<ChangeSet, MissingGenesisError>,
|
||||||
|
exp_final: LocalChain,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "try_replace_genesis_should_fail",
|
||||||
|
original: local_chain![(0, h!("_"))],
|
||||||
|
disconnect_from: (0, h!("_")),
|
||||||
|
exp_result: Err(MissingGenesisError),
|
||||||
|
exp_final: local_chain![(0, h!("_"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "try_replace_genesis_should_fail_2",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
disconnect_from: (0, h!("_")),
|
||||||
|
exp_result: Err(MissingGenesisError),
|
||||||
|
exp_final: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "from_does_not_exist",
|
||||||
|
original: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||||
|
disconnect_from: (2, h!("B")),
|
||||||
|
exp_result: Ok(ChangeSet::default()),
|
||||||
|
exp_final: local_chain![(0, h!("_")), (3, h!("C"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "from_has_different_blockhash",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
disconnect_from: (2, h!("not_B")),
|
||||||
|
exp_result: Ok(ChangeSet::default()),
|
||||||
|
exp_final: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "disconnect_one",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
disconnect_from: (2, h!("B")),
|
||||||
|
exp_result: Ok(ChangeSet::from_iter([(2, None)])),
|
||||||
|
exp_final: local_chain![(0, h!("_"))],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "disconnect_three",
|
||||||
|
original: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C")), (4, h!("D"))],
|
||||||
|
disconnect_from: (2, h!("B")),
|
||||||
|
exp_result: Ok(ChangeSet::from_iter([(2, None), (3, None), (4, None)])),
|
||||||
|
exp_final: local_chain![(0, h!("_"))],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("Case {}: {}", i, t.name);
|
||||||
|
|
||||||
|
let mut chain = t.original;
|
||||||
|
let result = chain.disconnect_from(t.disconnect_from.into());
|
||||||
|
assert_eq!(
|
||||||
|
result, t.exp_result,
|
||||||
|
"[{}:{}] unexpected changeset result",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
chain, t.exp_final,
|
||||||
|
"[{}:{}] unexpected final chain",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn checkpoint_from_block_ids() {
|
||||||
|
struct TestCase<'a> {
|
||||||
|
name: &'a str,
|
||||||
|
blocks: &'a [(u32, BlockHash)],
|
||||||
|
exp_result: Result<(), Option<(u32, BlockHash)>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "in_order",
|
||||||
|
blocks: &[(0, h!("A")), (1, h!("B")), (3, h!("D"))],
|
||||||
|
exp_result: Ok(()),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "with_duplicates",
|
||||||
|
blocks: &[(1, h!("B")), (2, h!("C")), (2, h!("C'"))],
|
||||||
|
exp_result: Err(Some((2, h!("C")))),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "not_in_order",
|
||||||
|
blocks: &[(1, h!("B")), (3, h!("D")), (2, h!("C"))],
|
||||||
|
exp_result: Err(Some((3, h!("D")))),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "empty",
|
||||||
|
blocks: &[],
|
||||||
|
exp_result: Err(None),
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "single",
|
||||||
|
blocks: &[(21, h!("million"))],
|
||||||
|
exp_result: Ok(()),
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("running test case {}: '{}'", i, t.name);
|
||||||
|
let result = CheckPoint::from_block_ids(
|
||||||
|
t.blocks
|
||||||
|
.iter()
|
||||||
|
.map(|&(height, hash)| BlockId { height, hash }),
|
||||||
|
);
|
||||||
|
match t.exp_result {
|
||||||
|
Ok(_) => {
|
||||||
|
assert!(result.is_ok(), "[{}:{}] should be Ok", i, t.name);
|
||||||
|
let result_vec = {
|
||||||
|
let mut v = result
|
||||||
|
.unwrap()
|
||||||
|
.into_iter()
|
||||||
|
.map(|cp| (cp.height(), cp.hash()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
v.reverse();
|
||||||
|
v
|
||||||
|
};
|
||||||
|
assert_eq!(
|
||||||
|
&result_vec, t.blocks,
|
||||||
|
"[{}:{}] not equal to original block ids",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
Err(exp_last) => {
|
||||||
|
assert!(result.is_err(), "[{}:{}] should be Err", i, t.name);
|
||||||
|
let err = result.unwrap_err();
|
||||||
|
assert_eq!(
|
||||||
|
err.as_ref()
|
||||||
|
.map(|last_cp| (last_cp.height(), last_cp.hash())),
|
||||||
|
exp_last,
|
||||||
|
"[{}:{}] error's last cp height should be {:?}, got {:?}",
|
||||||
|
i,
|
||||||
|
t.name,
|
||||||
|
exp_last,
|
||||||
|
err
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn local_chain_apply_header_connected_to() {
|
||||||
|
fn header_from_prev_blockhash(prev_blockhash: BlockHash) -> Header {
|
||||||
|
Header {
|
||||||
|
version: bitcoin::block::Version::default(),
|
||||||
|
prev_blockhash,
|
||||||
|
merkle_root: bitcoin::hash_types::TxMerkleNode::all_zeros(),
|
||||||
|
time: 0,
|
||||||
|
bits: bitcoin::CompactTarget::default(),
|
||||||
|
nonce: 0,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
struct TestCase {
|
||||||
|
name: &'static str,
|
||||||
|
chain: LocalChain,
|
||||||
|
header: Header,
|
||||||
|
height: u32,
|
||||||
|
connected_to: BlockId,
|
||||||
|
exp_result: Result<Vec<(u32, Option<BlockHash>)>, ApplyHeaderError>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(h!("A"));
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let height = 2;
|
||||||
|
let connected_to = BlockId { height, hash };
|
||||||
|
TestCase {
|
||||||
|
name: "connected_to_self_header_applied_to_self",
|
||||||
|
chain: local_chain![(0, h!("_")), (height, hash)],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Ok(vec![]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let prev_hash = h!("A");
|
||||||
|
let prev_height = 1;
|
||||||
|
let header = header_from_prev_blockhash(prev_hash);
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let height = prev_height + 1;
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: prev_hash,
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "connected_to_prev_header_applied_to_self",
|
||||||
|
chain: local_chain![(0, h!("_")), (prev_height, prev_hash)],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Ok(vec![(height, Some(hash))]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(BlockHash::all_zeros());
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let height = 0;
|
||||||
|
let connected_to = BlockId { height, hash };
|
||||||
|
TestCase {
|
||||||
|
name: "genesis_applied_to_self",
|
||||||
|
chain: local_chain![(0, hash)],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Ok(vec![]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(h!("Z"));
|
||||||
|
let height = 10;
|
||||||
|
let hash = header.block_hash();
|
||||||
|
let prev_height = height - 1;
|
||||||
|
let prev_hash = header.prev_blockhash;
|
||||||
|
TestCase {
|
||||||
|
name: "connect_at_connected_to",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B")), (3, h!("C"))],
|
||||||
|
header,
|
||||||
|
height: 10,
|
||||||
|
connected_to: BlockId {
|
||||||
|
height: 3,
|
||||||
|
hash: h!("C"),
|
||||||
|
},
|
||||||
|
exp_result: Ok(vec![(prev_height, Some(prev_hash)), (height, Some(hash))]),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let prev_hash = h!("A");
|
||||||
|
let prev_height = 1;
|
||||||
|
let header = header_from_prev_blockhash(prev_hash);
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height: prev_height,
|
||||||
|
hash: h!("not_prev_hash"),
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "inconsistent_prev_hash",
|
||||||
|
chain: local_chain![(0, h!("_")), (prev_height, h!("not_prev_hash"))],
|
||||||
|
header,
|
||||||
|
height: prev_height + 1,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Err(ApplyHeaderError::InconsistentBlocks),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let prev_hash = h!("A");
|
||||||
|
let prev_height = 1;
|
||||||
|
let header = header_from_prev_blockhash(prev_hash);
|
||||||
|
let height = prev_height + 1;
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height,
|
||||||
|
hash: h!("not_current_hash"),
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "inconsistent_current_block",
|
||||||
|
chain: local_chain![(0, h!("_")), (height, h!("not_current_hash"))],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Err(ApplyHeaderError::InconsistentBlocks),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
{
|
||||||
|
let header = header_from_prev_blockhash(h!("B"));
|
||||||
|
let height = 3;
|
||||||
|
let connected_to = BlockId {
|
||||||
|
height: 4,
|
||||||
|
hash: h!("D"),
|
||||||
|
};
|
||||||
|
TestCase {
|
||||||
|
name: "connected_to_is_greater",
|
||||||
|
chain: local_chain![(0, h!("_")), (2, h!("B"))],
|
||||||
|
header,
|
||||||
|
height,
|
||||||
|
connected_to,
|
||||||
|
exp_result: Err(ApplyHeaderError::InconsistentBlocks),
|
||||||
|
}
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("running test case {}: '{}'", i, t.name);
|
||||||
|
let mut chain = t.chain;
|
||||||
|
let result = chain.apply_header_connected_to(&t.header, t.height, t.connected_to);
|
||||||
|
let exp_result = t
|
||||||
|
.exp_result
|
||||||
|
.map(|cs| cs.iter().cloned().collect::<ChangeSet>());
|
||||||
|
assert_eq!(result, exp_result, "[{}:{}] unexpected result", i, t.name);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,773 +0,0 @@
|
|||||||
#[macro_use]
|
|
||||||
mod common;
|
|
||||||
|
|
||||||
use bdk_chain::{collections::BTreeSet, sparse_chain::*, BlockId, TxHeight};
|
|
||||||
use bitcoin::{hashes::Hash, Txid};
|
|
||||||
use core::ops::Bound;
|
|
||||||
|
|
||||||
#[derive(Debug, Clone, Copy, PartialEq, Eq, Ord, PartialOrd, Hash)]
|
|
||||||
pub struct TestIndex(TxHeight, u32);
|
|
||||||
|
|
||||||
impl ChainPosition for TestIndex {
|
|
||||||
fn height(&self) -> TxHeight {
|
|
||||||
self.0
|
|
||||||
}
|
|
||||||
|
|
||||||
fn max_ord_of_height(height: TxHeight) -> Self {
|
|
||||||
Self(height, u32::MAX)
|
|
||||||
}
|
|
||||||
|
|
||||||
fn min_ord_of_height(height: TxHeight) -> Self {
|
|
||||||
Self(height, u32::MIN)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl TestIndex {
|
|
||||||
pub fn new<H>(height: H, ext: u32) -> Self
|
|
||||||
where
|
|
||||||
H: Into<TxHeight>,
|
|
||||||
{
|
|
||||||
Self(height.into(), ext)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn add_first_checkpoint() {
|
|
||||||
let chain = SparseChain::default();
|
|
||||||
assert_eq!(
|
|
||||||
chain.determine_changeset(&chain!([0, h!("A")])),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("A")))],
|
|
||||||
txids: []
|
|
||||||
},),
|
|
||||||
"add first tip"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn add_second_tip() {
|
|
||||||
let chain = chain!([0, h!("A")]);
|
|
||||||
assert_eq!(
|
|
||||||
chain.determine_changeset(&chain!([0, h!("A")], [1, h!("B")])),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(1, Some(h!("B")))],
|
|
||||||
txids: []
|
|
||||||
},),
|
|
||||||
"extend tip by one"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn two_disjoint_chains_cannot_merge() {
|
|
||||||
let chain1 = chain!([0, h!("A")]);
|
|
||||||
let chain2 = chain!([1, h!("B")]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Err(UpdateError::NotConnected(0))
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn duplicate_chains_should_merge() {
|
|
||||||
let chain1 = chain!([0, h!("A")]);
|
|
||||||
let chain2 = chain!([0, h!("A")]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(ChangeSet::default())
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn duplicate_chains_with_txs_should_merge() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(ChangeSet::default())
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn duplicate_chains_with_different_txs_should_merge() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx1"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [],
|
|
||||||
txids: [(h!("tx1"), Some(TxHeight::Confirmed(0)))]
|
|
||||||
})
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn invalidate_first_and_only_checkpoint_without_tx_changes() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A'")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("A'")))],
|
|
||||||
txids: []
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn invalidate_first_and_only_checkpoint_with_tx_move_forward() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A'")],[1, h!("B")]], txids: [(h!("tx0"), TxHeight::Confirmed(1))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("A'"))), (1, Some(h!("B")))],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(1)))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn invalidate_first_and_only_checkpoint_with_tx_move_backward() {
|
|
||||||
let chain1 = chain!(checkpoints: [[1,h!("B")]], txids: [(h!("tx0"), TxHeight::Confirmed(1))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A")],[1, h!("B'")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("A"))), (1, Some(h!("B'")))],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(0)))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn invalidate_a_checkpoint_and_try_and_move_tx_when_it_wasnt_within_invalidation() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0, h!("A")], [1, h!("B")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0, h!("A")], [1, h!("B'")]], txids: [(h!("tx0"), TxHeight::Confirmed(1))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Err(UpdateError::TxInconsistent {
|
|
||||||
txid: h!("tx0"),
|
|
||||||
original_pos: TxHeight::Confirmed(0),
|
|
||||||
update_pos: TxHeight::Confirmed(1),
|
|
||||||
})
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// This test doesn't make much sense. We're invalidating a block at height 1 and moving it to
|
|
||||||
/// height 0. It should be impossible for it to be at height 1 at any point if it was at height 0
|
|
||||||
/// all along.
|
|
||||||
#[test]
|
|
||||||
fn move_invalidated_tx_into_earlier_checkpoint() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0, h!("A")], [1, h!("B")]], txids: [(h!("tx0"), TxHeight::Confirmed(1))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0, h!("A")], [1, h!("B'")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(1, Some(h!("B'")))],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(0)))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn invalidate_first_and_only_checkpoint_with_tx_move_to_mempool() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A'")]], txids: [(h!("tx0"), TxHeight::Unconfirmed)]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("A'")))],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Unconfirmed))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn confirm_tx_without_extending_chain() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Unconfirmed)]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(0)))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn confirm_tx_backwards_while_extending_chain() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Unconfirmed)]);
|
|
||||||
let chain2 = chain!(checkpoints: [[0,h!("A")],[1,h!("B")]], txids: [(h!("tx0"), TxHeight::Confirmed(0))]);
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(1, Some(h!("B")))],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(0)))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn confirm_tx_in_new_block() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0,h!("A")]], txids: [(h!("tx0"), TxHeight::Unconfirmed)]);
|
|
||||||
let chain2 = chain! {
|
|
||||||
checkpoints: [[0,h!("A")], [1,h!("B")]],
|
|
||||||
txids: [(h!("tx0"), TxHeight::Confirmed(1))]
|
|
||||||
};
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(1, Some(h!("B")))],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(1)))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn merging_mempool_of_empty_chains_doesnt_fail() {
|
|
||||||
let chain1 = chain!(checkpoints: [], txids: [(h!("tx0"), TxHeight::Unconfirmed)]);
|
|
||||||
let chain2 = chain!(checkpoints: [], txids: [(h!("tx1"), TxHeight::Unconfirmed)]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [],
|
|
||||||
txids: [(h!("tx1"), Some(TxHeight::Unconfirmed))]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn cannot_insert_confirmed_tx_without_checkpoints() {
|
|
||||||
let chain = SparseChain::default();
|
|
||||||
assert_eq!(
|
|
||||||
chain.insert_tx_preview(h!("A"), TxHeight::Confirmed(0)),
|
|
||||||
Err(InsertTxError::TxTooHigh {
|
|
||||||
txid: h!("A"),
|
|
||||||
tx_height: 0,
|
|
||||||
tip_height: None
|
|
||||||
})
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn empty_chain_can_add_unconfirmed_transactions() {
|
|
||||||
let chain1 = chain!(checkpoints: [[0, h!("A")]], txids: []);
|
|
||||||
let chain2 = chain!(checkpoints: [], txids: [(h!("tx0"), TxHeight::Unconfirmed)]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [],
|
|
||||||
txids: [ (h!("tx0"), Some(TxHeight::Unconfirmed)) ]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn can_update_with_shorter_chain() {
|
|
||||||
let chain1 = chain!(checkpoints: [[1, h!("B")],[2, h!("C")]], txids: []);
|
|
||||||
let chain2 = chain!(checkpoints: [[1, h!("B")]], txids: [(h!("tx0"), TxHeight::Confirmed(1))]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [],
|
|
||||||
txids: [(h!("tx0"), Some(TxHeight::Confirmed(1)))]
|
|
||||||
},)
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn can_introduce_older_checkpoints() {
|
|
||||||
let chain1 = chain!(checkpoints: [[2, h!("C")], [3, h!("D")]], txids: []);
|
|
||||||
let chain2 = chain!(checkpoints: [[1, h!("B")], [2, h!("C")]], txids: []);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(1, Some(h!("B")))],
|
|
||||||
txids: []
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn fix_blockhash_before_agreement_point() {
|
|
||||||
let chain1 = chain!([0, h!("im-wrong")], [1, h!("we-agree")]);
|
|
||||||
let chain2 = chain!([0, h!("fix")], [1, h!("we-agree")]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("fix")))],
|
|
||||||
txids: []
|
|
||||||
},)
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
// TODO: Use macro
|
|
||||||
#[test]
|
|
||||||
fn cannot_change_ext_index_of_confirmed_tx() {
|
|
||||||
let chain1 = chain!(
|
|
||||||
index: TestIndex,
|
|
||||||
checkpoints: [[1, h!("A")]],
|
|
||||||
txids: [(h!("tx0"), TestIndex(TxHeight::Confirmed(1), 10))]
|
|
||||||
);
|
|
||||||
let chain2 = chain!(
|
|
||||||
index: TestIndex,
|
|
||||||
checkpoints: [[1, h!("A")]],
|
|
||||||
txids: [(h!("tx0"), TestIndex(TxHeight::Confirmed(1), 20))]
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Err(UpdateError::TxInconsistent {
|
|
||||||
txid: h!("tx0"),
|
|
||||||
original_pos: TestIndex(TxHeight::Confirmed(1), 10),
|
|
||||||
update_pos: TestIndex(TxHeight::Confirmed(1), 20),
|
|
||||||
}),
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn can_change_index_of_unconfirmed_tx() {
|
|
||||||
let chain1 = chain!(
|
|
||||||
index: TestIndex,
|
|
||||||
checkpoints: [[1, h!("A")]],
|
|
||||||
txids: [(h!("tx1"), TestIndex(TxHeight::Unconfirmed, 10))]
|
|
||||||
);
|
|
||||||
let chain2 = chain!(
|
|
||||||
index: TestIndex,
|
|
||||||
checkpoints: [[1, h!("A")]],
|
|
||||||
txids: [(h!("tx1"), TestIndex(TxHeight::Unconfirmed, 20))]
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(ChangeSet {
|
|
||||||
checkpoints: [].into(),
|
|
||||||
txids: [(h!("tx1"), Some(TestIndex(TxHeight::Unconfirmed, 20)),)].into()
|
|
||||||
},),
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// B and C are in both chain and update
|
|
||||||
/// ```
|
|
||||||
/// | 0 | 1 | 2 | 3 | 4
|
|
||||||
/// chain | B C
|
|
||||||
/// update | A B C D
|
|
||||||
/// ```
|
|
||||||
/// This should succeed with the point of agreement being C and A should be added in addition.
|
|
||||||
#[test]
|
|
||||||
fn two_points_of_agreement() {
|
|
||||||
let chain1 = chain!([1, h!("B")], [2, h!("C")]);
|
|
||||||
let chain2 = chain!([0, h!("A")], [1, h!("B")], [2, h!("C")], [3, h!("D")]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [(0, Some(h!("A"))), (3, Some(h!("D")))]
|
|
||||||
},),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Update and chain does not connect:
|
|
||||||
/// ```
|
|
||||||
/// | 0 | 1 | 2 | 3 | 4
|
|
||||||
/// chain | B C
|
|
||||||
/// update | A B D
|
|
||||||
/// ```
|
|
||||||
/// This should fail as we cannot figure out whether C & D are on the same chain
|
|
||||||
#[test]
|
|
||||||
fn update_and_chain_does_not_connect() {
|
|
||||||
let chain1 = chain!([1, h!("B")], [2, h!("C")]);
|
|
||||||
let chain2 = chain!([0, h!("A")], [1, h!("B")], [3, h!("D")]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Err(UpdateError::NotConnected(2)),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Transient invalidation:
|
|
||||||
/// ```
|
|
||||||
/// | 0 | 1 | 2 | 3 | 4 | 5
|
|
||||||
/// chain | A B C E
|
|
||||||
/// update | A B' C' D
|
|
||||||
/// ```
|
|
||||||
/// This should succeed and invalidate B,C and E with point of agreement being A.
|
|
||||||
/// It should also invalidate transactions at height 1.
|
|
||||||
#[test]
|
|
||||||
fn transitive_invalidation_applies_to_checkpoints_higher_than_invalidation() {
|
|
||||||
let chain1 = chain! {
|
|
||||||
checkpoints: [[0, h!("A")], [2, h!("B")], [3, h!("C")], [5, h!("E")]],
|
|
||||||
txids: [
|
|
||||||
(h!("a"), TxHeight::Confirmed(0)),
|
|
||||||
(h!("b1"), TxHeight::Confirmed(1)),
|
|
||||||
(h!("b2"), TxHeight::Confirmed(2)),
|
|
||||||
(h!("d"), TxHeight::Confirmed(3)),
|
|
||||||
(h!("e"), TxHeight::Confirmed(5))
|
|
||||||
]
|
|
||||||
};
|
|
||||||
let chain2 = chain! {
|
|
||||||
checkpoints: [[0, h!("A")], [2, h!("B'")], [3, h!("C'")], [4, h!("D")]],
|
|
||||||
txids: [(h!("b1"), TxHeight::Confirmed(4)), (h!("b2"), TxHeight::Confirmed(3))]
|
|
||||||
};
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [
|
|
||||||
(2, Some(h!("B'"))),
|
|
||||||
(3, Some(h!("C'"))),
|
|
||||||
(4, Some(h!("D"))),
|
|
||||||
(5, None)
|
|
||||||
],
|
|
||||||
txids: [
|
|
||||||
(h!("b1"), Some(TxHeight::Confirmed(4))),
|
|
||||||
(h!("b2"), Some(TxHeight::Confirmed(3))),
|
|
||||||
(h!("d"), Some(TxHeight::Unconfirmed)),
|
|
||||||
(h!("e"), Some(TxHeight::Unconfirmed))
|
|
||||||
]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Transient invalidation:
|
|
||||||
/// ```
|
|
||||||
/// | 0 | 1 | 2 | 3 | 4
|
|
||||||
/// chain | B C E
|
|
||||||
/// update | B' C' D
|
|
||||||
/// ```
|
|
||||||
///
|
|
||||||
/// This should succeed and invalidate B, C and E with no point of agreement
|
|
||||||
#[test]
|
|
||||||
fn transitive_invalidation_applies_to_checkpoints_higher_than_invalidation_no_point_of_agreement() {
|
|
||||||
let chain1 = chain!([1, h!("B")], [2, h!("C")], [4, h!("E")]);
|
|
||||||
let chain2 = chain!([1, h!("B'")], [2, h!("C'")], [3, h!("D")]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [
|
|
||||||
(1, Some(h!("B'"))),
|
|
||||||
(2, Some(h!("C'"))),
|
|
||||||
(3, Some(h!("D"))),
|
|
||||||
(4, None)
|
|
||||||
]
|
|
||||||
},)
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Transient invalidation:
|
|
||||||
/// ```
|
|
||||||
/// | 0 | 1 | 2 | 3 | 4
|
|
||||||
/// chain | A B C E
|
|
||||||
/// update | B' C' D
|
|
||||||
/// ```
|
|
||||||
///
|
|
||||||
/// This should fail since although it tells us that B and C are invalid it doesn't tell us whether
|
|
||||||
/// A was invalid.
|
|
||||||
#[test]
|
|
||||||
fn invalidation_but_no_connection() {
|
|
||||||
let chain1 = chain!([0, h!("A")], [1, h!("B")], [2, h!("C")], [4, h!("E")]);
|
|
||||||
let chain2 = chain!([1, h!("B'")], [2, h!("C'")], [3, h!("D")]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Err(UpdateError::NotConnected(0))
|
|
||||||
)
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn checkpoint_limit_is_respected() {
|
|
||||||
let mut chain1 = SparseChain::default();
|
|
||||||
let _ = chain1
|
|
||||||
.apply_update(chain!(
|
|
||||||
[1, h!("A")],
|
|
||||||
[2, h!("B")],
|
|
||||||
[3, h!("C")],
|
|
||||||
[4, h!("D")],
|
|
||||||
[5, h!("E")]
|
|
||||||
))
|
|
||||||
.unwrap();
|
|
||||||
|
|
||||||
assert_eq!(chain1.checkpoints().len(), 5);
|
|
||||||
chain1.set_checkpoint_limit(Some(4));
|
|
||||||
assert_eq!(chain1.checkpoints().len(), 4);
|
|
||||||
|
|
||||||
let _ = chain1
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: 6,
|
|
||||||
hash: h!("F"),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
assert_eq!(chain1.checkpoints().len(), 4);
|
|
||||||
|
|
||||||
let changeset = chain1.determine_changeset(&chain!([6, h!("F")], [7, h!("G")]));
|
|
||||||
assert_eq!(changeset, Ok(changeset!(checkpoints: [(7, Some(h!("G")))])));
|
|
||||||
|
|
||||||
chain1.apply_changeset(changeset.unwrap());
|
|
||||||
|
|
||||||
assert_eq!(chain1.checkpoints().len(), 4);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn range_txids_by_height() {
|
|
||||||
let mut chain = chain!(index: TestIndex, checkpoints: [[1, h!("block 1")], [2, h!("block 2")]]);
|
|
||||||
|
|
||||||
let txids: [(TestIndex, Txid); 4] = [
|
|
||||||
(
|
|
||||||
TestIndex(TxHeight::Confirmed(1), u32::MIN),
|
|
||||||
Txid::from_inner([0x00; 32]),
|
|
||||||
),
|
|
||||||
(
|
|
||||||
TestIndex(TxHeight::Confirmed(1), u32::MAX),
|
|
||||||
Txid::from_inner([0xfe; 32]),
|
|
||||||
),
|
|
||||||
(
|
|
||||||
TestIndex(TxHeight::Confirmed(2), u32::MIN),
|
|
||||||
Txid::from_inner([0x01; 32]),
|
|
||||||
),
|
|
||||||
(
|
|
||||||
TestIndex(TxHeight::Confirmed(2), u32::MAX),
|
|
||||||
Txid::from_inner([0xff; 32]),
|
|
||||||
),
|
|
||||||
];
|
|
||||||
|
|
||||||
// populate chain with txids
|
|
||||||
for (index, txid) in txids {
|
|
||||||
let _ = chain.insert_tx(txid, index).expect("should succeed");
|
|
||||||
}
|
|
||||||
|
|
||||||
// inclusive start
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_height(TxHeight::Confirmed(1)..)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids.iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
|
|
||||||
// exclusive start
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_height((Bound::Excluded(TxHeight::Confirmed(1)), Bound::Unbounded,))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[2..].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
|
|
||||||
// inclusive end
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_height((Bound::Unbounded, Bound::Included(TxHeight::Confirmed(2))))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[..4].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
|
|
||||||
// exclusive end
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_height(..TxHeight::Confirmed(2))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[..2].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn range_txids_by_index() {
|
|
||||||
let mut chain = chain!(index: TestIndex, checkpoints: [[1, h!("block 1")],[2, h!("block 2")]]);
|
|
||||||
|
|
||||||
let txids: [(TestIndex, Txid); 4] = [
|
|
||||||
(TestIndex(TxHeight::Confirmed(1), u32::MIN), h!("tx 1 min")),
|
|
||||||
(TestIndex(TxHeight::Confirmed(1), u32::MAX), h!("tx 1 max")),
|
|
||||||
(TestIndex(TxHeight::Confirmed(2), u32::MIN), h!("tx 2 min")),
|
|
||||||
(TestIndex(TxHeight::Confirmed(2), u32::MAX), h!("tx 2 max")),
|
|
||||||
];
|
|
||||||
|
|
||||||
// populate chain with txids
|
|
||||||
for (index, txid) in txids {
|
|
||||||
let _ = chain.insert_tx(txid, index).expect("should succeed");
|
|
||||||
}
|
|
||||||
|
|
||||||
// inclusive start
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position(TestIndex(TxHeight::Confirmed(1), u32::MIN)..)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids.iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position(TestIndex(TxHeight::Confirmed(1), u32::MAX)..)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[1..].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
|
|
||||||
// exclusive start
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position((
|
|
||||||
Bound::Excluded(TestIndex(TxHeight::Confirmed(1), u32::MIN)),
|
|
||||||
Bound::Unbounded
|
|
||||||
))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[1..].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position((
|
|
||||||
Bound::Excluded(TestIndex(TxHeight::Confirmed(1), u32::MAX)),
|
|
||||||
Bound::Unbounded
|
|
||||||
))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[2..].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
|
|
||||||
// inclusive end
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position((
|
|
||||||
Bound::Unbounded,
|
|
||||||
Bound::Included(TestIndex(TxHeight::Confirmed(2), u32::MIN))
|
|
||||||
))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[..3].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position((
|
|
||||||
Bound::Unbounded,
|
|
||||||
Bound::Included(TestIndex(TxHeight::Confirmed(2), u32::MAX))
|
|
||||||
))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[..4].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
|
|
||||||
// exclusive end
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position(..TestIndex(TxHeight::Confirmed(2), u32::MIN))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[..2].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids_by_position(..TestIndex(TxHeight::Confirmed(2), u32::MAX))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids[..3].iter().collect::<Vec<_>>(),
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn range_txids() {
|
|
||||||
let mut chain = SparseChain::default();
|
|
||||||
|
|
||||||
let txids = (0..100)
|
|
||||||
.map(|v| Txid::hash(v.to_string().as_bytes()))
|
|
||||||
.collect::<BTreeSet<Txid>>();
|
|
||||||
|
|
||||||
// populate chain
|
|
||||||
for txid in &txids {
|
|
||||||
let _ = chain
|
|
||||||
.insert_tx(*txid, TxHeight::Unconfirmed)
|
|
||||||
.expect("should succeed");
|
|
||||||
}
|
|
||||||
|
|
||||||
for txid in &txids {
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids((TxHeight::Unconfirmed, *txid)..)
|
|
||||||
.map(|(_, txid)| txid)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids.range(*txid..).collect::<Vec<_>>(),
|
|
||||||
"range with inclusive start should succeed"
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids((
|
|
||||||
Bound::Excluded((TxHeight::Unconfirmed, *txid)),
|
|
||||||
Bound::Unbounded,
|
|
||||||
))
|
|
||||||
.map(|(_, txid)| txid)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids
|
|
||||||
.range((Bound::Excluded(*txid), Bound::Unbounded,))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
"range with exclusive start should succeed"
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids(..(TxHeight::Unconfirmed, *txid))
|
|
||||||
.map(|(_, txid)| txid)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids.range(..*txid).collect::<Vec<_>>(),
|
|
||||||
"range with exclusive end should succeed"
|
|
||||||
);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain
|
|
||||||
.range_txids((
|
|
||||||
Bound::Included((TxHeight::Unconfirmed, *txid)),
|
|
||||||
Bound::Unbounded,
|
|
||||||
))
|
|
||||||
.map(|(_, txid)| txid)
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
txids
|
|
||||||
.range((Bound::Included(*txid), Bound::Unbounded,))
|
|
||||||
.collect::<Vec<_>>(),
|
|
||||||
"range with inclusive end should succeed"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn invalidated_txs_move_to_unconfirmed() {
|
|
||||||
let chain1 = chain! {
|
|
||||||
checkpoints: [[0, h!("A")], [1, h!("B")], [2, h!("C")]],
|
|
||||||
txids: [
|
|
||||||
(h!("a"), TxHeight::Confirmed(0)),
|
|
||||||
(h!("b"), TxHeight::Confirmed(1)),
|
|
||||||
(h!("c"), TxHeight::Confirmed(2)),
|
|
||||||
(h!("d"), TxHeight::Unconfirmed)
|
|
||||||
]
|
|
||||||
};
|
|
||||||
|
|
||||||
let chain2 = chain!([0, h!("A")], [1, h!("B'")]);
|
|
||||||
|
|
||||||
assert_eq!(
|
|
||||||
chain1.determine_changeset(&chain2),
|
|
||||||
Ok(changeset! {
|
|
||||||
checkpoints: [
|
|
||||||
(1, Some(h!("B'"))),
|
|
||||||
(2, None)
|
|
||||||
],
|
|
||||||
txids: [
|
|
||||||
(h!("b"), Some(TxHeight::Unconfirmed)),
|
|
||||||
(h!("c"), Some(TxHeight::Unconfirmed))
|
|
||||||
]
|
|
||||||
},)
|
|
||||||
);
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn change_tx_position_from_unconfirmed_to_confirmed() {
|
|
||||||
let mut chain = SparseChain::<TxHeight>::default();
|
|
||||||
let txid = h!("txid");
|
|
||||||
|
|
||||||
let _ = chain.insert_tx(txid, TxHeight::Unconfirmed).unwrap();
|
|
||||||
|
|
||||||
assert_eq!(chain.tx_position(txid), Some(&TxHeight::Unconfirmed));
|
|
||||||
let _ = chain
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: 0,
|
|
||||||
hash: h!("0"),
|
|
||||||
})
|
|
||||||
.unwrap();
|
|
||||||
let _ = chain.insert_tx(txid, TxHeight::Confirmed(0)).unwrap();
|
|
||||||
|
|
||||||
assert_eq!(chain.tx_position(txid), Some(&TxHeight::Confirmed(0)));
|
|
||||||
}
|
|
||||||
@@ -1,10 +1,10 @@
|
|||||||
use bdk_chain::SpkTxOutIndex;
|
use bdk_chain::{indexed_tx_graph::Indexer, SpkTxOutIndex};
|
||||||
use bitcoin::{hashes::hex::FromHex, OutPoint, PackedLockTime, Script, Transaction, TxIn, TxOut};
|
use bitcoin::{absolute, OutPoint, ScriptBuf, Transaction, TxIn, TxOut};
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn spk_txout_sent_and_received() {
|
fn spk_txout_sent_and_received() {
|
||||||
let spk1 = Script::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
let spk1 = ScriptBuf::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||||
let spk2 = Script::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
let spk2 = ScriptBuf::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||||
|
|
||||||
let mut index = SpkTxOutIndex::default();
|
let mut index = SpkTxOutIndex::default();
|
||||||
index.insert_spk(0, spk1.clone());
|
index.insert_spk(0, spk1.clone());
|
||||||
@@ -12,7 +12,7 @@ fn spk_txout_sent_and_received() {
|
|||||||
|
|
||||||
let tx1 = Transaction {
|
let tx1 = Transaction {
|
||||||
version: 0x02,
|
version: 0x02,
|
||||||
lock_time: PackedLockTime(0),
|
lock_time: absolute::LockTime::ZERO,
|
||||||
input: vec![],
|
input: vec![],
|
||||||
output: vec![TxOut {
|
output: vec![TxOut {
|
||||||
value: 42_000,
|
value: 42_000,
|
||||||
@@ -22,7 +22,7 @@ fn spk_txout_sent_and_received() {
|
|||||||
|
|
||||||
assert_eq!(index.sent_and_received(&tx1), (0, 42_000));
|
assert_eq!(index.sent_and_received(&tx1), (0, 42_000));
|
||||||
assert_eq!(index.net_value(&tx1), 42_000);
|
assert_eq!(index.net_value(&tx1), 42_000);
|
||||||
index.scan(&tx1);
|
index.index_tx(&tx1);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
index.sent_and_received(&tx1),
|
index.sent_and_received(&tx1),
|
||||||
(0, 42_000),
|
(0, 42_000),
|
||||||
@@ -31,7 +31,7 @@ fn spk_txout_sent_and_received() {
|
|||||||
|
|
||||||
let tx2 = Transaction {
|
let tx2 = Transaction {
|
||||||
version: 0x1,
|
version: 0x1,
|
||||||
lock_time: PackedLockTime(0),
|
lock_time: absolute::LockTime::ZERO,
|
||||||
input: vec![TxIn {
|
input: vec![TxIn {
|
||||||
previous_output: OutPoint {
|
previous_output: OutPoint {
|
||||||
txid: tx1.txid(),
|
txid: tx1.txid(),
|
||||||
@@ -57,8 +57,8 @@ fn spk_txout_sent_and_received() {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn mark_used() {
|
fn mark_used() {
|
||||||
let spk1 = Script::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
let spk1 = ScriptBuf::from_hex("001404f1e52ce2bab3423c6a8c63b7cd730d8f12542c").unwrap();
|
||||||
let spk2 = Script::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
let spk2 = ScriptBuf::from_hex("00142b57404ae14f08c3a0c903feb2af7830605eb00f").unwrap();
|
||||||
|
|
||||||
let mut spk_index = SpkTxOutIndex::default();
|
let mut spk_index = SpkTxOutIndex::default();
|
||||||
spk_index.insert_spk(1, spk1.clone());
|
spk_index.insert_spk(1, spk1.clone());
|
||||||
@@ -74,7 +74,7 @@ fn mark_used() {
|
|||||||
|
|
||||||
let tx1 = Transaction {
|
let tx1 = Transaction {
|
||||||
version: 0x02,
|
version: 0x02,
|
||||||
lock_time: PackedLockTime(0),
|
lock_time: absolute::LockTime::ZERO,
|
||||||
input: vec![],
|
input: vec![],
|
||||||
output: vec![TxOut {
|
output: vec![TxOut {
|
||||||
value: 42_000,
|
value: 42_000,
|
||||||
@@ -82,7 +82,7 @@ fn mark_used() {
|
|||||||
}],
|
}],
|
||||||
};
|
};
|
||||||
|
|
||||||
spk_index.scan(&tx1);
|
spk_index.index_tx(&tx1);
|
||||||
spk_index.unmark_used(&1);
|
spk_index.unmark_used(&1);
|
||||||
assert!(
|
assert!(
|
||||||
spk_index.is_used(&1),
|
spk_index.is_used(&1),
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
668
crates/chain/tests/test_tx_graph_conflicts.rs
Normal file
668
crates/chain/tests/test_tx_graph_conflicts.rs
Normal file
@@ -0,0 +1,668 @@
|
|||||||
|
#[macro_use]
|
||||||
|
mod common;
|
||||||
|
|
||||||
|
use std::collections::{BTreeSet, HashSet};
|
||||||
|
|
||||||
|
use bdk_chain::{keychain::Balance, BlockId};
|
||||||
|
use bitcoin::{OutPoint, Script};
|
||||||
|
use common::*;
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
struct Scenario<'a> {
|
||||||
|
/// Name of the test scenario
|
||||||
|
name: &'a str,
|
||||||
|
/// Transaction templates
|
||||||
|
tx_templates: &'a [TxTemplate<'a, BlockId>],
|
||||||
|
/// Names of txs that must exist in the output of `list_chain_txs`
|
||||||
|
exp_chain_txs: HashSet<&'a str>,
|
||||||
|
/// Outpoints that must exist in the output of `filter_chain_txouts`
|
||||||
|
exp_chain_txouts: HashSet<(&'a str, u32)>,
|
||||||
|
/// Outpoints of UTXOs that must exist in the output of `filter_chain_unspents`
|
||||||
|
exp_unspents: HashSet<(&'a str, u32)>,
|
||||||
|
/// Expected balances
|
||||||
|
exp_balance: Balance,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// This test ensures that [`TxGraph`] will reliably filter out irrelevant transactions when
|
||||||
|
/// presented with multiple conflicting transaction scenarios using the [`TxTemplate`] structure.
|
||||||
|
/// This test also checks that [`TxGraph::list_chain_txs`], [`TxGraph::filter_chain_txouts`],
|
||||||
|
/// [`TxGraph::filter_chain_unspents`], and [`TxGraph::balance`] return correct data.
|
||||||
|
#[test]
|
||||||
|
fn test_tx_conflict_handling() {
|
||||||
|
// Create Local chains
|
||||||
|
let local_chain = local_chain!(
|
||||||
|
(0, h!("A")),
|
||||||
|
(1, h!("B")),
|
||||||
|
(2, h!("C")),
|
||||||
|
(3, h!("D")),
|
||||||
|
(4, h!("E")),
|
||||||
|
(5, h!("F")),
|
||||||
|
(6, h!("G"))
|
||||||
|
);
|
||||||
|
let chain_tip = local_chain.tip().block_id();
|
||||||
|
|
||||||
|
let scenarios = [
|
||||||
|
Scenario {
|
||||||
|
name: "coinbase tx cannot be in mempool and be unconfirmed",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "unconfirmed_coinbase",
|
||||||
|
inputs: &[TxInTemplate::Coinbase],
|
||||||
|
outputs: &[TxOutTemplate::new(5000, Some(0))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "confirmed_genesis",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(1))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "unconfirmed_conflict",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("confirmed_genesis", 0),
|
||||||
|
TxInTemplate::PrevTx("unconfirmed_coinbase", 0)
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "confirmed_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("confirmed_genesis", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||||
|
anchors: &[block_id!(4, "E")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["confirmed_genesis", "confirmed_conflict"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("confirmed_genesis", 0), ("confirmed_conflict", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("confirmed_conflict", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 20000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "2 unconfirmed txs with same last_seens conflict",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
outputs: &[TxOutTemplate::new(40000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// the txgraph is going to pick tx_conflict_2 because of higher lexicographical txid
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_2", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "2 unconfirmed txs with different last_seens conflict",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0)), TxOutTemplate::new(10000, Some(1))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::PrevTx("tx1", 1)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_2"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx1", 1), ("tx_conflict_2", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_2", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "3 unconfirmed txs with different last_seens conflict",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_3",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(40000, Some(3))],
|
||||||
|
last_seen: Some(400),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_3"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_3", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_3", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 40000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "unconfirmed tx conflicts with tx in orphaned block, orphaned higher last_seen",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_orphaned_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "Orphaned Block")],
|
||||||
|
last_seen: Some(300),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_orphaned_conflict"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_orphaned_conflict", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_orphaned_conflict", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "unconfirmed tx conflicts with tx in orphaned block, orphaned lower last_seen",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_orphaned_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "Orphaned Block")],
|
||||||
|
last_seen: Some(100),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_conflict_1"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_conflict_1", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_conflict_1", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 20000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "multiple unconfirmed txs conflict with a confirmed tx",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx1",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_1",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_2",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_conflict_3",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(40000, Some(3))],
|
||||||
|
last_seen: Some(400),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "tx_confirmed_conflict",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("tx1", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
exp_chain_txs: HashSet::from(["tx1", "tx_confirmed_conflict"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("tx1", 0), ("tx_confirmed_conflict", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("tx_confirmed_conflict", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 50000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends B, all the transactions are unconfirmed, B' has higher last_seen than B",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
last_seen: Some(22),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(23),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
last_seen: Some(24),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("B", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
last_seen: Some(25),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// A, B, C will appear in the list methods
|
||||||
|
// This is because B' has a higher last seen than B, but C has a higher
|
||||||
|
// last seen than B', so B and C are considered canonical
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B", "C"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B", 0), ("C", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("C", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends B, A and B' are in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "E")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("B", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// B and C should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 20000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends B', A and B' are in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(2))],
|
||||||
|
anchors: &[block_id!(4, "E")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("B'", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(3))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// B should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'", "C"]),
|
||||||
|
exp_chain_txouts: HashSet::from([
|
||||||
|
("A", 0),
|
||||||
|
("B'", 0),
|
||||||
|
("C", 0),
|
||||||
|
]),
|
||||||
|
exp_unspents: HashSet::from([("C", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, C spends both B and B', A is in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(30000, Some(2))],
|
||||||
|
last_seen: Some(300),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("B", 0),
|
||||||
|
TxInTemplate::PrevTx("B'", 0),
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(3))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// C should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 30000,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 0,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, B' is confirmed, C spends both B and B', A is in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("B", 0),
|
||||||
|
TxInTemplate::PrevTx("B'", 0),
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(5))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// C should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 50000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
Scenario {
|
||||||
|
name: "B and B' spend A and conflict, B' is confirmed, C spends both B and B', D spends C, A is in best chain",
|
||||||
|
tx_templates: &[
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "A",
|
||||||
|
inputs: &[TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(10000, Some(0))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
last_seen: None,
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0), TxInTemplate::Bogus],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(1))],
|
||||||
|
last_seen: Some(200),
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "B'",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("A", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(50000, Some(4))],
|
||||||
|
anchors: &[block_id!(1, "B")],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "C",
|
||||||
|
inputs: &[
|
||||||
|
TxInTemplate::PrevTx("B", 0),
|
||||||
|
TxInTemplate::PrevTx("B'", 0),
|
||||||
|
],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(5))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
TxTemplate {
|
||||||
|
tx_name: "D",
|
||||||
|
inputs: &[TxInTemplate::PrevTx("C", 0)],
|
||||||
|
outputs: &[TxOutTemplate::new(20000, Some(6))],
|
||||||
|
..Default::default()
|
||||||
|
},
|
||||||
|
],
|
||||||
|
// D should not appear in the list methods
|
||||||
|
exp_chain_txs: HashSet::from(["A", "B'"]),
|
||||||
|
exp_chain_txouts: HashSet::from([("A", 0), ("B'", 0)]),
|
||||||
|
exp_unspents: HashSet::from([("B'", 0)]),
|
||||||
|
exp_balance: Balance {
|
||||||
|
immature: 0,
|
||||||
|
trusted_pending: 0,
|
||||||
|
untrusted_pending: 0,
|
||||||
|
confirmed: 50000,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for scenario in scenarios {
|
||||||
|
let (tx_graph, spk_index, exp_tx_ids) = init_graph(scenario.tx_templates.iter());
|
||||||
|
|
||||||
|
let txs = tx_graph
|
||||||
|
.list_chain_txs(&local_chain, chain_tip)
|
||||||
|
.map(|tx| tx.tx_node.txid)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_txs = scenario
|
||||||
|
.exp_chain_txs
|
||||||
|
.iter()
|
||||||
|
.map(|txid| *exp_tx_ids.get(txid).expect("txid must exist"))
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
txs, exp_txs,
|
||||||
|
"\n[{}] 'list_chain_txs' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let txouts = tx_graph
|
||||||
|
.filter_chain_txouts(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
spk_index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.map(|(_, full_txout)| full_txout.outpoint)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_txouts = scenario
|
||||||
|
.exp_chain_txouts
|
||||||
|
.iter()
|
||||||
|
.map(|(txid, vout)| OutPoint {
|
||||||
|
txid: *exp_tx_ids.get(txid).expect("txid must exist"),
|
||||||
|
vout: *vout,
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
txouts, exp_txouts,
|
||||||
|
"\n[{}] 'filter_chain_txouts' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let utxos = tx_graph
|
||||||
|
.filter_chain_unspents(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
spk_index.outpoints().iter().cloned(),
|
||||||
|
)
|
||||||
|
.map(|(_, full_txout)| full_txout.outpoint)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
let exp_utxos = scenario
|
||||||
|
.exp_unspents
|
||||||
|
.iter()
|
||||||
|
.map(|(txid, vout)| OutPoint {
|
||||||
|
txid: *exp_tx_ids.get(txid).expect("txid must exist"),
|
||||||
|
vout: *vout,
|
||||||
|
})
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
assert_eq!(
|
||||||
|
utxos, exp_utxos,
|
||||||
|
"\n[{}] 'filter_chain_unspents' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let balance = tx_graph.balance(
|
||||||
|
&local_chain,
|
||||||
|
chain_tip,
|
||||||
|
spk_index.outpoints().iter().cloned(),
|
||||||
|
|_, spk: &Script| spk_index.index_of_spk(spk).is_some(),
|
||||||
|
);
|
||||||
|
assert_eq!(
|
||||||
|
balance, scenario.exp_balance,
|
||||||
|
"\n[{}] 'balance' failed",
|
||||||
|
scenario.name
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bdk_electrum"
|
name = "bdk_electrum"
|
||||||
version = "0.2.0"
|
version = "0.9.0"
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
homepage = "https://bitcoindevkit.org"
|
homepage = "https://bitcoindevkit.org"
|
||||||
repository = "https://github.com/bitcoindevkit/bdk"
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
@@ -12,5 +12,6 @@ readme = "README.md"
|
|||||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
bdk_chain = { path = "../chain", version = "0.4.0", features = ["serde", "miniscript"] }
|
bdk_chain = { path = "../chain", version = "0.11.0", default-features = false }
|
||||||
electrum-client = { version = "0.12" }
|
electrum-client = { version = "0.18" }
|
||||||
|
#rustls = { version = "=0.21.1", optional = true, features = ["dangerous_configuration"] }
|
||||||
|
|||||||
@@ -1,3 +1,7 @@
|
|||||||
# BDK Electrum
|
# BDK Electrum
|
||||||
|
|
||||||
BDK Electrum client library for updating the keychain tracker.
|
BDK Electrum extends [`electrum-client`] to update [`bdk_chain`] structures
|
||||||
|
from an Electrum server.
|
||||||
|
|
||||||
|
[`electrum-client`]: https://docs.rs/electrum-client/
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||||
|
|||||||
559
crates/electrum/src/electrum_ext.rs
Normal file
559
crates/electrum/src/electrum_ext.rs
Normal file
@@ -0,0 +1,559 @@
|
|||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{OutPoint, ScriptBuf, Transaction, Txid},
|
||||||
|
local_chain::{self, CheckPoint},
|
||||||
|
tx_graph::{self, TxGraph},
|
||||||
|
Anchor, BlockId, ConfirmationHeightAnchor, ConfirmationTimeHeightAnchor,
|
||||||
|
};
|
||||||
|
use electrum_client::{Client, ElectrumApi, Error, HeaderNotification};
|
||||||
|
use std::{
|
||||||
|
collections::{BTreeMap, BTreeSet, HashMap, HashSet},
|
||||||
|
fmt::Debug,
|
||||||
|
str::FromStr,
|
||||||
|
};
|
||||||
|
|
||||||
|
/// We include a chain suffix of a certain length for the purpose of robustness.
|
||||||
|
const CHAIN_SUFFIX_LENGTH: u32 = 8;
|
||||||
|
|
||||||
|
/// Represents updates fetched from an Electrum server, but excludes full transactions.
|
||||||
|
///
|
||||||
|
/// To provide a complete update to [`TxGraph`], you'll need to call [`Self::missing_full_txs`] to
|
||||||
|
/// determine the full transactions missing from [`TxGraph`]. Then call [`Self::into_tx_graph`] to
|
||||||
|
/// fetch the full transactions from Electrum and finalize the update.
|
||||||
|
#[derive(Debug, Default, Clone)]
|
||||||
|
pub struct RelevantTxids(HashMap<Txid, BTreeSet<ConfirmationHeightAnchor>>);
|
||||||
|
|
||||||
|
impl RelevantTxids {
|
||||||
|
/// Determine the full transactions that are missing from `graph`.
|
||||||
|
///
|
||||||
|
/// Refer to [`RelevantTxids`] for more details.
|
||||||
|
pub fn missing_full_txs<A: Anchor>(&self, graph: &TxGraph<A>) -> Vec<Txid> {
|
||||||
|
self.0
|
||||||
|
.keys()
|
||||||
|
.filter(move |&&txid| graph.as_ref().get_tx(txid).is_none())
|
||||||
|
.cloned()
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finalizes the [`TxGraph`] update by fetching `missing` txids from the `client`.
|
||||||
|
///
|
||||||
|
/// Refer to [`RelevantTxids`] for more details.
|
||||||
|
pub fn into_tx_graph(
|
||||||
|
self,
|
||||||
|
client: &Client,
|
||||||
|
seen_at: Option<u64>,
|
||||||
|
missing: Vec<Txid>,
|
||||||
|
) -> Result<TxGraph<ConfirmationHeightAnchor>, Error> {
|
||||||
|
let new_txs = client.batch_transaction_get(&missing)?;
|
||||||
|
let mut graph = TxGraph::<ConfirmationHeightAnchor>::new(new_txs);
|
||||||
|
for (txid, anchors) in self.0 {
|
||||||
|
if let Some(seen_at) = seen_at {
|
||||||
|
let _ = graph.insert_seen_at(txid, seen_at);
|
||||||
|
}
|
||||||
|
for anchor in anchors {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(graph)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Finalizes the update by fetching `missing` txids from the `client`, where the
|
||||||
|
/// resulting [`TxGraph`] has anchors of type [`ConfirmationTimeHeightAnchor`].
|
||||||
|
///
|
||||||
|
/// Refer to [`RelevantTxids`] for more details.
|
||||||
|
///
|
||||||
|
/// **Note:** The confirmation time might not be precisely correct if there has been a reorg.
|
||||||
|
// Electrum's API intends that we use the merkle proof API, we should change `bdk_electrum` to
|
||||||
|
// use it.
|
||||||
|
pub fn into_confirmation_time_tx_graph(
|
||||||
|
self,
|
||||||
|
client: &Client,
|
||||||
|
seen_at: Option<u64>,
|
||||||
|
missing: Vec<Txid>,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||||
|
let graph = self.into_tx_graph(client, seen_at, missing)?;
|
||||||
|
|
||||||
|
let relevant_heights = {
|
||||||
|
let mut visited_heights = HashSet::new();
|
||||||
|
graph
|
||||||
|
.all_anchors()
|
||||||
|
.iter()
|
||||||
|
.map(|(a, _)| a.confirmation_height_upper_bound())
|
||||||
|
.filter(move |&h| visited_heights.insert(h))
|
||||||
|
.collect::<Vec<_>>()
|
||||||
|
};
|
||||||
|
|
||||||
|
let height_to_time = relevant_heights
|
||||||
|
.clone()
|
||||||
|
.into_iter()
|
||||||
|
.zip(
|
||||||
|
client
|
||||||
|
.batch_block_header(relevant_heights)?
|
||||||
|
.into_iter()
|
||||||
|
.map(|bh| bh.time as u64),
|
||||||
|
)
|
||||||
|
.collect::<HashMap<u32, u64>>();
|
||||||
|
|
||||||
|
let graph_changeset = {
|
||||||
|
let old_changeset = TxGraph::default().apply_update(graph);
|
||||||
|
tx_graph::ChangeSet {
|
||||||
|
txs: old_changeset.txs,
|
||||||
|
txouts: old_changeset.txouts,
|
||||||
|
last_seen: old_changeset.last_seen,
|
||||||
|
anchors: old_changeset
|
||||||
|
.anchors
|
||||||
|
.into_iter()
|
||||||
|
.map(|(height_anchor, txid)| {
|
||||||
|
let confirmation_height = height_anchor.confirmation_height;
|
||||||
|
let confirmation_time = height_to_time[&confirmation_height];
|
||||||
|
let time_anchor = ConfirmationTimeHeightAnchor {
|
||||||
|
anchor_block: height_anchor.anchor_block,
|
||||||
|
confirmation_height,
|
||||||
|
confirmation_time,
|
||||||
|
};
|
||||||
|
(time_anchor, txid)
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut new_graph = TxGraph::default();
|
||||||
|
new_graph.apply_changeset(graph_changeset);
|
||||||
|
Ok(new_graph)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Combination of chain and transactions updates from electrum
|
||||||
|
///
|
||||||
|
/// We have to update the chain and the txids at the same time since we anchor the txids to
|
||||||
|
/// the same chain tip that we check before and after we gather the txids.
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct ElectrumUpdate {
|
||||||
|
/// Chain update
|
||||||
|
pub chain_update: local_chain::Update,
|
||||||
|
/// Transaction updates from electrum
|
||||||
|
pub relevant_txids: RelevantTxids,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Trait to extend [`Client`] functionality.
|
||||||
|
pub trait ElectrumExt {
|
||||||
|
/// Full scan the keychain scripts specified with the blockchain (via an Electrum client) and
|
||||||
|
/// returns updates for [`bdk_chain`] data structures.
|
||||||
|
///
|
||||||
|
/// - `prev_tip`: the most recent blockchain tip present locally
|
||||||
|
/// - `keychain_spks`: keychains that we want to scan transactions for
|
||||||
|
///
|
||||||
|
/// The full scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||||
|
/// transactions. `batch_size` specifies the max number of script pubkeys to request for in a
|
||||||
|
/// single batch request.
|
||||||
|
fn full_scan<K: Ord + Clone>(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
|
stop_gap: usize,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<(ElectrumUpdate, BTreeMap<K, u32>), Error>;
|
||||||
|
|
||||||
|
/// Sync a set of scripts with the blockchain (via an Electrum client) for the data specified
|
||||||
|
/// and returns updates for [`bdk_chain`] data structures.
|
||||||
|
///
|
||||||
|
/// - `prev_tip`: the most recent blockchain tip present locally
|
||||||
|
/// - `misc_spks`: an iterator of scripts we want to sync transactions for
|
||||||
|
/// - `txids`: transactions for which we want updated [`Anchor`]s
|
||||||
|
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||||
|
/// want to include in the update
|
||||||
|
///
|
||||||
|
/// `batch_size` specifies the max number of script pubkeys to request for in a single batch
|
||||||
|
/// request.
|
||||||
|
///
|
||||||
|
/// If the scripts to sync are unknown, such as when restoring or importing a keychain that
|
||||||
|
/// may include scripts that have been used, use [`full_scan`] with the keychain.
|
||||||
|
///
|
||||||
|
/// [`full_scan`]: ElectrumExt::full_scan
|
||||||
|
fn sync(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<ElectrumUpdate, Error>;
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<A: ElectrumApi> ElectrumExt for A {
|
||||||
|
fn full_scan<K: Ord + Clone>(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
|
stop_gap: usize,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<(ElectrumUpdate, BTreeMap<K, u32>), Error> {
|
||||||
|
let mut request_spks = keychain_spks
|
||||||
|
.into_iter()
|
||||||
|
.map(|(k, s)| (k.clone(), s.into_iter()))
|
||||||
|
.collect::<BTreeMap<K, _>>();
|
||||||
|
let mut scanned_spks = BTreeMap::<(K, u32), (ScriptBuf, bool)>::new();
|
||||||
|
|
||||||
|
let (electrum_update, keychain_update) = loop {
|
||||||
|
let (tip, _) = construct_update_tip(self, prev_tip.clone())?;
|
||||||
|
let mut relevant_txids = RelevantTxids::default();
|
||||||
|
let cps = tip
|
||||||
|
.iter()
|
||||||
|
.take(10)
|
||||||
|
.map(|cp| (cp.height(), cp))
|
||||||
|
.collect::<BTreeMap<u32, CheckPoint>>();
|
||||||
|
|
||||||
|
if !request_spks.is_empty() {
|
||||||
|
if !scanned_spks.is_empty() {
|
||||||
|
scanned_spks.append(&mut populate_with_spks(
|
||||||
|
self,
|
||||||
|
&cps,
|
||||||
|
&mut relevant_txids,
|
||||||
|
&mut scanned_spks
|
||||||
|
.iter()
|
||||||
|
.map(|(i, (spk, _))| (i.clone(), spk.clone())),
|
||||||
|
stop_gap,
|
||||||
|
batch_size,
|
||||||
|
)?);
|
||||||
|
}
|
||||||
|
for (keychain, keychain_spks) in &mut request_spks {
|
||||||
|
scanned_spks.extend(
|
||||||
|
populate_with_spks(
|
||||||
|
self,
|
||||||
|
&cps,
|
||||||
|
&mut relevant_txids,
|
||||||
|
keychain_spks,
|
||||||
|
stop_gap,
|
||||||
|
batch_size,
|
||||||
|
)?
|
||||||
|
.into_iter()
|
||||||
|
.map(|(spk_i, spk)| ((keychain.clone(), spk_i), spk)),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// check for reorgs during scan process
|
||||||
|
let server_blockhash = self.block_header(tip.height() as usize)?.block_hash();
|
||||||
|
if tip.hash() != server_blockhash {
|
||||||
|
continue; // reorg
|
||||||
|
}
|
||||||
|
|
||||||
|
let chain_update = local_chain::Update {
|
||||||
|
tip,
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
};
|
||||||
|
|
||||||
|
let keychain_update = request_spks
|
||||||
|
.into_keys()
|
||||||
|
.filter_map(|k| {
|
||||||
|
scanned_spks
|
||||||
|
.range((k.clone(), u32::MIN)..=(k.clone(), u32::MAX))
|
||||||
|
.rev()
|
||||||
|
.find(|(_, (_, active))| *active)
|
||||||
|
.map(|((_, i), _)| (k, *i))
|
||||||
|
})
|
||||||
|
.collect::<BTreeMap<_, _>>();
|
||||||
|
|
||||||
|
break (
|
||||||
|
ElectrumUpdate {
|
||||||
|
chain_update,
|
||||||
|
relevant_txids,
|
||||||
|
},
|
||||||
|
keychain_update,
|
||||||
|
);
|
||||||
|
};
|
||||||
|
|
||||||
|
Ok((electrum_update, keychain_update))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn sync(
|
||||||
|
&self,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<ElectrumUpdate, Error> {
|
||||||
|
let spk_iter = misc_spks
|
||||||
|
.into_iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, spk)| (i as u32, spk));
|
||||||
|
|
||||||
|
let (mut electrum_update, _) = self.full_scan(
|
||||||
|
prev_tip.clone(),
|
||||||
|
[((), spk_iter)].into(),
|
||||||
|
usize::MAX,
|
||||||
|
batch_size,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let (tip, _) = construct_update_tip(self, prev_tip)?;
|
||||||
|
let cps = tip
|
||||||
|
.iter()
|
||||||
|
.take(10)
|
||||||
|
.map(|cp| (cp.height(), cp))
|
||||||
|
.collect::<BTreeMap<u32, CheckPoint>>();
|
||||||
|
|
||||||
|
populate_with_txids(self, &cps, &mut electrum_update.relevant_txids, txids)?;
|
||||||
|
|
||||||
|
let _txs =
|
||||||
|
populate_with_outpoints(self, &cps, &mut electrum_update.relevant_txids, outpoints)?;
|
||||||
|
|
||||||
|
Ok(electrum_update)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Return a [`CheckPoint`] of the latest tip, that connects with `prev_tip`.
|
||||||
|
fn construct_update_tip(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
prev_tip: CheckPoint,
|
||||||
|
) -> Result<(CheckPoint, Option<u32>), Error> {
|
||||||
|
let HeaderNotification { height, .. } = client.block_headers_subscribe()?;
|
||||||
|
let new_tip_height = height as u32;
|
||||||
|
|
||||||
|
// If electrum returns a tip height that is lower than our previous tip, then checkpoints do
|
||||||
|
// not need updating. We just return the previous tip and use that as the point of agreement.
|
||||||
|
if new_tip_height < prev_tip.height() {
|
||||||
|
return Ok((prev_tip.clone(), Some(prev_tip.height())));
|
||||||
|
}
|
||||||
|
|
||||||
|
// Atomically fetch the latest `CHAIN_SUFFIX_LENGTH` count of blocks from Electrum. We use this
|
||||||
|
// to construct our checkpoint update.
|
||||||
|
let mut new_blocks = {
|
||||||
|
let start_height = new_tip_height.saturating_sub(CHAIN_SUFFIX_LENGTH - 1);
|
||||||
|
let hashes = client
|
||||||
|
.block_headers(start_height as _, CHAIN_SUFFIX_LENGTH as _)?
|
||||||
|
.headers
|
||||||
|
.into_iter()
|
||||||
|
.map(|h| h.block_hash());
|
||||||
|
(start_height..).zip(hashes).collect::<BTreeMap<u32, _>>()
|
||||||
|
};
|
||||||
|
|
||||||
|
// Find the "point of agreement" (if any).
|
||||||
|
let agreement_cp = {
|
||||||
|
let mut agreement_cp = Option::<CheckPoint>::None;
|
||||||
|
for cp in prev_tip.iter() {
|
||||||
|
let cp_block = cp.block_id();
|
||||||
|
let hash = match new_blocks.get(&cp_block.height) {
|
||||||
|
Some(&hash) => hash,
|
||||||
|
None => {
|
||||||
|
assert!(
|
||||||
|
new_tip_height >= cp_block.height,
|
||||||
|
"already checked that electrum's tip cannot be smaller"
|
||||||
|
);
|
||||||
|
let hash = client.block_header(cp_block.height as _)?.block_hash();
|
||||||
|
new_blocks.insert(cp_block.height, hash);
|
||||||
|
hash
|
||||||
|
}
|
||||||
|
};
|
||||||
|
if hash == cp_block.hash {
|
||||||
|
agreement_cp = Some(cp);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
agreement_cp
|
||||||
|
};
|
||||||
|
|
||||||
|
let agreement_height = agreement_cp.as_ref().map(CheckPoint::height);
|
||||||
|
|
||||||
|
let new_tip = new_blocks
|
||||||
|
.into_iter()
|
||||||
|
// Prune `new_blocks` to only include blocks that are actually new.
|
||||||
|
.filter(|(height, _)| Some(*height) > agreement_height)
|
||||||
|
.map(|(height, hash)| BlockId { height, hash })
|
||||||
|
.fold(agreement_cp, |prev_cp, block| {
|
||||||
|
Some(match prev_cp {
|
||||||
|
Some(cp) => cp.push(block).expect("must extend checkpoint"),
|
||||||
|
None => CheckPoint::new(block),
|
||||||
|
})
|
||||||
|
})
|
||||||
|
.expect("must have at least one checkpoint");
|
||||||
|
|
||||||
|
Ok((new_tip, agreement_height))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A [tx status] comprises of a concatenation of `tx_hash:height:`s. We transform a single one of
|
||||||
|
/// these concatenations into a [`ConfirmationHeightAnchor`] if possible.
|
||||||
|
///
|
||||||
|
/// We use the lowest possible checkpoint as the anchor block (from `cps`). If an anchor block
|
||||||
|
/// cannot be found, or the transaction is unconfirmed, [`None`] is returned.
|
||||||
|
///
|
||||||
|
/// [tx status](https://electrumx-spesmilo.readthedocs.io/en/latest/protocol-basics.html#status)
|
||||||
|
fn determine_tx_anchor(
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
raw_height: i32,
|
||||||
|
txid: Txid,
|
||||||
|
) -> Option<ConfirmationHeightAnchor> {
|
||||||
|
// The electrum API has a weird quirk where an unconfirmed transaction is presented with a
|
||||||
|
// height of 0. To avoid invalid representation in our data structures, we manually set
|
||||||
|
// transactions residing in the genesis block to have height 0, then interpret a height of 0 as
|
||||||
|
// unconfirmed for all other transactions.
|
||||||
|
if txid
|
||||||
|
== Txid::from_str("4a5e1e4baab89f3a32518a88c31bc87f618f76673e2cc77ab2127b7afdeda33b")
|
||||||
|
.expect("must deserialize genesis coinbase txid")
|
||||||
|
{
|
||||||
|
let anchor_block = cps.values().next()?.block_id();
|
||||||
|
return Some(ConfirmationHeightAnchor {
|
||||||
|
anchor_block,
|
||||||
|
confirmation_height: 0,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
match raw_height {
|
||||||
|
h if h <= 0 => {
|
||||||
|
debug_assert!(h == 0 || h == -1, "unexpected height ({}) from electrum", h);
|
||||||
|
None
|
||||||
|
}
|
||||||
|
h => {
|
||||||
|
let h = h as u32;
|
||||||
|
let anchor_block = cps.range(h..).next().map(|(_, cp)| cp.block_id())?;
|
||||||
|
if h > anchor_block.height {
|
||||||
|
None
|
||||||
|
} else {
|
||||||
|
Some(ConfirmationHeightAnchor {
|
||||||
|
anchor_block,
|
||||||
|
confirmation_height: h,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn populate_with_outpoints(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
relevant_txids: &mut RelevantTxids,
|
||||||
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
|
) -> Result<HashMap<Txid, Transaction>, Error> {
|
||||||
|
let mut full_txs = HashMap::new();
|
||||||
|
for outpoint in outpoints {
|
||||||
|
let txid = outpoint.txid;
|
||||||
|
let tx = client.transaction_get(&txid)?;
|
||||||
|
debug_assert_eq!(tx.txid(), txid);
|
||||||
|
let txout = match tx.output.get(outpoint.vout as usize) {
|
||||||
|
Some(txout) => txout,
|
||||||
|
None => continue,
|
||||||
|
};
|
||||||
|
// attempt to find the following transactions (alongside their chain positions), and
|
||||||
|
// add to our sparsechain `update`:
|
||||||
|
let mut has_residing = false; // tx in which the outpoint resides
|
||||||
|
let mut has_spending = false; // tx that spends the outpoint
|
||||||
|
for res in client.script_get_history(&txout.script_pubkey)? {
|
||||||
|
if has_residing && has_spending {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
if res.tx_hash == txid {
|
||||||
|
if has_residing {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
has_residing = true;
|
||||||
|
full_txs.insert(res.tx_hash, tx.clone());
|
||||||
|
} else {
|
||||||
|
if has_spending {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
let res_tx = match full_txs.get(&res.tx_hash) {
|
||||||
|
Some(tx) => tx,
|
||||||
|
None => {
|
||||||
|
let res_tx = client.transaction_get(&res.tx_hash)?;
|
||||||
|
full_txs.insert(res.tx_hash, res_tx);
|
||||||
|
full_txs.get(&res.tx_hash).expect("just inserted")
|
||||||
|
}
|
||||||
|
};
|
||||||
|
has_spending = res_tx
|
||||||
|
.input
|
||||||
|
.iter()
|
||||||
|
.any(|txin| txin.previous_output == outpoint);
|
||||||
|
if !has_spending {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let anchor = determine_tx_anchor(cps, res.height, res.tx_hash);
|
||||||
|
let tx_entry = relevant_txids.0.entry(res.tx_hash).or_default();
|
||||||
|
if let Some(anchor) = anchor {
|
||||||
|
tx_entry.insert(anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(full_txs)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn populate_with_txids(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
relevant_txids: &mut RelevantTxids,
|
||||||
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
|
) -> Result<(), Error> {
|
||||||
|
for txid in txids {
|
||||||
|
let tx = match client.transaction_get(&txid) {
|
||||||
|
Ok(tx) => tx,
|
||||||
|
Err(electrum_client::Error::Protocol(_)) => continue,
|
||||||
|
Err(other_err) => return Err(other_err),
|
||||||
|
};
|
||||||
|
|
||||||
|
let spk = tx
|
||||||
|
.output
|
||||||
|
.first()
|
||||||
|
.map(|txo| &txo.script_pubkey)
|
||||||
|
.expect("tx must have an output");
|
||||||
|
|
||||||
|
let anchor = match client
|
||||||
|
.script_get_history(spk)?
|
||||||
|
.into_iter()
|
||||||
|
.find(|r| r.tx_hash == txid)
|
||||||
|
{
|
||||||
|
Some(r) => determine_tx_anchor(cps, r.height, txid),
|
||||||
|
None => continue,
|
||||||
|
};
|
||||||
|
|
||||||
|
let tx_entry = relevant_txids.0.entry(txid).or_default();
|
||||||
|
if let Some(anchor) = anchor {
|
||||||
|
tx_entry.insert(anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn populate_with_spks<I: Ord + Clone>(
|
||||||
|
client: &impl ElectrumApi,
|
||||||
|
cps: &BTreeMap<u32, CheckPoint>,
|
||||||
|
relevant_txids: &mut RelevantTxids,
|
||||||
|
spks: &mut impl Iterator<Item = (I, ScriptBuf)>,
|
||||||
|
stop_gap: usize,
|
||||||
|
batch_size: usize,
|
||||||
|
) -> Result<BTreeMap<I, (ScriptBuf, bool)>, Error> {
|
||||||
|
let mut unused_spk_count = 0_usize;
|
||||||
|
let mut scanned_spks = BTreeMap::new();
|
||||||
|
|
||||||
|
loop {
|
||||||
|
let spks = (0..batch_size)
|
||||||
|
.map_while(|_| spks.next())
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
if spks.is_empty() {
|
||||||
|
return Ok(scanned_spks);
|
||||||
|
}
|
||||||
|
|
||||||
|
let spk_histories =
|
||||||
|
client.batch_script_get_history(spks.iter().map(|(_, s)| s.as_script()))?;
|
||||||
|
|
||||||
|
for ((spk_index, spk), spk_history) in spks.into_iter().zip(spk_histories) {
|
||||||
|
if spk_history.is_empty() {
|
||||||
|
scanned_spks.insert(spk_index, (spk, false));
|
||||||
|
unused_spk_count += 1;
|
||||||
|
if unused_spk_count > stop_gap {
|
||||||
|
return Ok(scanned_spks);
|
||||||
|
}
|
||||||
|
continue;
|
||||||
|
} else {
|
||||||
|
scanned_spks.insert(spk_index, (spk, true));
|
||||||
|
unused_spk_count = 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
for tx in spk_history {
|
||||||
|
let tx_entry = relevant_txids.0.entry(tx.tx_hash).or_default();
|
||||||
|
if let Some(anchor) = determine_tx_anchor(cps, tx.height, tx.tx_hash) {
|
||||||
|
tx_entry.insert(anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,588 +1,30 @@
|
|||||||
//! This crate is used for updating structures of the [`bdk_chain`] crate with data from electrum.
|
//! This crate is used for updating structures of [`bdk_chain`] with data from an Electrum server.
|
||||||
//!
|
//!
|
||||||
//! The star of the show is the [`ElectrumExt::scan`] method, which scans for relevant blockchain
|
//! The two primary methods are [`ElectrumExt::sync`] and [`ElectrumExt::full_scan`]. In most cases
|
||||||
//! data (via electrum) and outputs an [`ElectrumUpdate`].
|
//! [`ElectrumExt::sync`] is used to sync the transaction histories of scripts that the application
|
||||||
|
//! cares about, for example the scripts for all the receive addresses of a Wallet's keychain that it
|
||||||
|
//! has shown a user. [`ElectrumExt::full_scan`] is meant to be used when importing or restoring a
|
||||||
|
//! keychain where the range of possibly used scripts is not known. In this case it is necessary to
|
||||||
|
//! scan all keychain scripts until a number (the "stop gap") of unused scripts is discovered. For a
|
||||||
|
//! sync or full scan the user receives relevant blockchain data and output updates for
|
||||||
|
//! [`bdk_chain`] including [`RelevantTxids`].
|
||||||
//!
|
//!
|
||||||
//! An [`ElectrumUpdate`] only includes `txid`s and no full transactions. The caller is responsible
|
//! The [`RelevantTxids`] only includes `txid`s and not full transactions. The caller is responsible
|
||||||
//! for obtaining full transactions before applying. This can be done with
|
//! for obtaining full transactions before applying new data to their [`bdk_chain`]. This can be
|
||||||
//! these steps:
|
//! done with these steps:
|
||||||
//!
|
//!
|
||||||
//! 1. Determine which full transactions are missing. The method [`missing_full_txs`] of
|
//! 1. Determine which full transactions are missing. Use [`RelevantTxids::missing_full_txs`].
|
||||||
//! [`ElectrumUpdate`] can be used.
|
|
||||||
//!
|
//!
|
||||||
//! 2. Obtaining the full transactions. To do this via electrum, the method
|
//! 2. Obtaining the full transactions. To do this via electrum use [`ElectrumApi::batch_transaction_get`].
|
||||||
//! [`batch_transaction_get`] can be used.
|
|
||||||
//!
|
//!
|
||||||
//! Refer to [`bdk_electrum_example`] for a complete example.
|
//! Refer to [`example_electrum`] for a complete example.
|
||||||
//!
|
//!
|
||||||
//! [`ElectrumClient::scan`]: ElectrumClient::scan
|
//! [`ElectrumApi::batch_transaction_get`]: electrum_client::ElectrumApi::batch_transaction_get
|
||||||
//! [`missing_full_txs`]: ElectrumUpdate::missing_full_txs
|
//! [`example_electrum`]: https://github.com/bitcoindevkit/bdk/tree/master/example-crates/example_electrum
|
||||||
//! [`batch_transaction_get`]: ElectrumApi::batch_transaction_get
|
|
||||||
//! [`bdk_electrum_example`]: https://github.com/LLFourn/bdk_core_staging/tree/master/bdk_electrum_example
|
|
||||||
|
|
||||||
use std::{
|
#![warn(missing_docs)]
|
||||||
collections::{BTreeMap, HashMap},
|
|
||||||
fmt::Debug,
|
|
||||||
};
|
|
||||||
|
|
||||||
|
mod electrum_ext;
|
||||||
pub use bdk_chain;
|
pub use bdk_chain;
|
||||||
use bdk_chain::{
|
|
||||||
bitcoin::{hashes::hex::FromHex, BlockHash, OutPoint, Script, Transaction, Txid},
|
|
||||||
chain_graph::{self, ChainGraph},
|
|
||||||
keychain::KeychainScan,
|
|
||||||
sparse_chain::{self, ChainPosition, SparseChain},
|
|
||||||
tx_graph::TxGraph,
|
|
||||||
BlockId, ConfirmationTime, TxHeight,
|
|
||||||
};
|
|
||||||
pub use electrum_client;
|
pub use electrum_client;
|
||||||
use electrum_client::{Client, ElectrumApi, Error};
|
pub use electrum_ext::*;
|
||||||
|
|
||||||
/// Trait to extend [`electrum_client::Client`] functionality.
|
|
||||||
///
|
|
||||||
/// Refer to [crate-level documentation] for more.
|
|
||||||
///
|
|
||||||
/// [crate-level documentation]: crate
|
|
||||||
pub trait ElectrumExt {
|
|
||||||
/// Fetch the latest block height.
|
|
||||||
fn get_tip(&self) -> Result<(u32, BlockHash), Error>;
|
|
||||||
|
|
||||||
/// Scan the blockchain (via electrum) for the data specified. This returns a [`ElectrumUpdate`]
|
|
||||||
/// which can be transformed into a [`KeychainScan`] after we find all the missing full
|
|
||||||
/// transactions.
|
|
||||||
///
|
|
||||||
/// - `local_chain`: the most recent block hashes present locally
|
|
||||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
|
||||||
/// - `txids`: transactions for which we want the updated [`ChainPosition`]s
|
|
||||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
|
||||||
/// want to included in the update
|
|
||||||
fn scan<K: Ord + Clone>(
|
|
||||||
&self,
|
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
|
||||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
|
||||||
txids: impl IntoIterator<Item = Txid>,
|
|
||||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
|
||||||
stop_gap: usize,
|
|
||||||
batch_size: usize,
|
|
||||||
) -> Result<ElectrumUpdate<K, TxHeight>, Error>;
|
|
||||||
|
|
||||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
|
||||||
///
|
|
||||||
/// [`scan`]: ElectrumExt::scan
|
|
||||||
fn scan_without_keychain(
|
|
||||||
&self,
|
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
|
||||||
misc_spks: impl IntoIterator<Item = Script>,
|
|
||||||
txids: impl IntoIterator<Item = Txid>,
|
|
||||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
|
||||||
batch_size: usize,
|
|
||||||
) -> Result<SparseChain, Error> {
|
|
||||||
let spk_iter = misc_spks
|
|
||||||
.into_iter()
|
|
||||||
.enumerate()
|
|
||||||
.map(|(i, spk)| (i as u32, spk));
|
|
||||||
|
|
||||||
self.scan(
|
|
||||||
local_chain,
|
|
||||||
[((), spk_iter)].into(),
|
|
||||||
txids,
|
|
||||||
outpoints,
|
|
||||||
usize::MAX,
|
|
||||||
batch_size,
|
|
||||||
)
|
|
||||||
.map(|u| u.chain_update)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ElectrumExt for Client {
|
|
||||||
fn get_tip(&self) -> Result<(u32, BlockHash), Error> {
|
|
||||||
// TODO: unsubscribe when added to the client, or is there a better call to use here?
|
|
||||||
self.block_headers_subscribe()
|
|
||||||
.map(|data| (data.height as u32, data.header.block_hash()))
|
|
||||||
}
|
|
||||||
|
|
||||||
fn scan<K: Ord + Clone>(
|
|
||||||
&self,
|
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
|
||||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
|
||||||
txids: impl IntoIterator<Item = Txid>,
|
|
||||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
|
||||||
stop_gap: usize,
|
|
||||||
batch_size: usize,
|
|
||||||
) -> Result<ElectrumUpdate<K, TxHeight>, Error> {
|
|
||||||
let mut request_spks = keychain_spks
|
|
||||||
.into_iter()
|
|
||||||
.map(|(k, s)| {
|
|
||||||
let iter = s.into_iter();
|
|
||||||
(k, iter)
|
|
||||||
})
|
|
||||||
.collect::<BTreeMap<K, _>>();
|
|
||||||
let mut scanned_spks = BTreeMap::<(K, u32), (Script, bool)>::new();
|
|
||||||
|
|
||||||
let txids = txids.into_iter().collect::<Vec<_>>();
|
|
||||||
let outpoints = outpoints.into_iter().collect::<Vec<_>>();
|
|
||||||
|
|
||||||
let update = loop {
|
|
||||||
let mut update = prepare_update(self, local_chain)?;
|
|
||||||
|
|
||||||
if !request_spks.is_empty() {
|
|
||||||
if !scanned_spks.is_empty() {
|
|
||||||
let mut scanned_spk_iter = scanned_spks
|
|
||||||
.iter()
|
|
||||||
.map(|(i, (spk, _))| (i.clone(), spk.clone()));
|
|
||||||
match populate_with_spks::<K, _, _>(
|
|
||||||
self,
|
|
||||||
&mut update,
|
|
||||||
&mut scanned_spk_iter,
|
|
||||||
stop_gap,
|
|
||||||
batch_size,
|
|
||||||
) {
|
|
||||||
Err(InternalError::Reorg) => continue,
|
|
||||||
Err(InternalError::ElectrumError(e)) => return Err(e),
|
|
||||||
Ok(mut spks) => scanned_spks.append(&mut spks),
|
|
||||||
};
|
|
||||||
}
|
|
||||||
for (keychain, keychain_spks) in &mut request_spks {
|
|
||||||
match populate_with_spks::<K, u32, _>(
|
|
||||||
self,
|
|
||||||
&mut update,
|
|
||||||
keychain_spks,
|
|
||||||
stop_gap,
|
|
||||||
batch_size,
|
|
||||||
) {
|
|
||||||
Err(InternalError::Reorg) => continue,
|
|
||||||
Err(InternalError::ElectrumError(e)) => return Err(e),
|
|
||||||
Ok(spks) => scanned_spks.extend(
|
|
||||||
spks.into_iter()
|
|
||||||
.map(|(spk_i, spk)| ((keychain.clone(), spk_i), spk)),
|
|
||||||
),
|
|
||||||
};
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
match populate_with_txids(self, &mut update, &mut txids.iter().cloned()) {
|
|
||||||
Err(InternalError::Reorg) => continue,
|
|
||||||
Err(InternalError::ElectrumError(e)) => return Err(e),
|
|
||||||
Ok(_) => {}
|
|
||||||
}
|
|
||||||
|
|
||||||
match populate_with_outpoints(self, &mut update, &mut outpoints.iter().cloned()) {
|
|
||||||
Err(InternalError::Reorg) => continue,
|
|
||||||
Err(InternalError::ElectrumError(e)) => return Err(e),
|
|
||||||
Ok(_txs) => { /* [TODO] cache full txs to reduce bandwidth */ }
|
|
||||||
}
|
|
||||||
|
|
||||||
// check for reorgs during scan process
|
|
||||||
let our_tip = update
|
|
||||||
.latest_checkpoint()
|
|
||||||
.expect("update must have atleast one checkpoint");
|
|
||||||
let server_blockhash = self.block_header(our_tip.height as usize)?.block_hash();
|
|
||||||
if our_tip.hash != server_blockhash {
|
|
||||||
continue; // reorg
|
|
||||||
} else {
|
|
||||||
break update;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
let last_active_index = request_spks
|
|
||||||
.into_keys()
|
|
||||||
.filter_map(|k| {
|
|
||||||
scanned_spks
|
|
||||||
.range((k.clone(), u32::MIN)..=(k.clone(), u32::MAX))
|
|
||||||
.rev()
|
|
||||||
.find(|(_, (_, active))| *active)
|
|
||||||
.map(|((_, i), _)| (k, *i))
|
|
||||||
})
|
|
||||||
.collect::<BTreeMap<_, _>>();
|
|
||||||
|
|
||||||
Ok(ElectrumUpdate {
|
|
||||||
chain_update: update,
|
|
||||||
last_active_indices: last_active_index,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// The result of [`ElectrumExt::scan`].
|
|
||||||
pub struct ElectrumUpdate<K, P> {
|
|
||||||
/// The internal [`SparseChain`] update.
|
|
||||||
pub chain_update: SparseChain<P>,
|
|
||||||
/// The last keychain script pubkey indices, which had transaction histories.
|
|
||||||
pub last_active_indices: BTreeMap<K, u32>,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> Default for ElectrumUpdate<K, P> {
|
|
||||||
fn default() -> Self {
|
|
||||||
Self {
|
|
||||||
chain_update: Default::default(),
|
|
||||||
last_active_indices: Default::default(),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> AsRef<SparseChain<P>> for ElectrumUpdate<K, P> {
|
|
||||||
fn as_ref(&self) -> &SparseChain<P> {
|
|
||||||
&self.chain_update
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K: Ord + Clone + Debug, P: ChainPosition> ElectrumUpdate<K, P> {
|
|
||||||
/// Return a list of missing full transactions that are required to [`inflate_update`].
|
|
||||||
///
|
|
||||||
/// [`inflate_update`]: bdk_chain::chain_graph::ChainGraph::inflate_update
|
|
||||||
pub fn missing_full_txs<G>(&self, graph: G) -> Vec<&Txid>
|
|
||||||
where
|
|
||||||
G: AsRef<TxGraph>,
|
|
||||||
{
|
|
||||||
self.chain_update
|
|
||||||
.txids()
|
|
||||||
.filter(|(_, txid)| graph.as_ref().get_tx(*txid).is_none())
|
|
||||||
.map(|(_, txid)| txid)
|
|
||||||
.collect()
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Transform the [`ElectrumUpdate`] into a [`KeychainScan`], which can be applied to a
|
|
||||||
/// `tracker`.
|
|
||||||
///
|
|
||||||
/// This will fail if there are missing full transactions not provided via `new_txs`.
|
|
||||||
pub fn into_keychain_scan<CG>(
|
|
||||||
self,
|
|
||||||
new_txs: Vec<Transaction>,
|
|
||||||
chain_graph: &CG,
|
|
||||||
) -> Result<KeychainScan<K, P>, chain_graph::NewError<P>>
|
|
||||||
where
|
|
||||||
CG: AsRef<ChainGraph<P>>,
|
|
||||||
{
|
|
||||||
Ok(KeychainScan {
|
|
||||||
update: chain_graph
|
|
||||||
.as_ref()
|
|
||||||
.inflate_update(self.chain_update, new_txs)?,
|
|
||||||
last_active_indices: self.last_active_indices,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K: Ord + Clone + Debug> ElectrumUpdate<K, TxHeight> {
|
|
||||||
/// Creates [`ElectrumUpdate<K, ConfirmationTime>`] from [`ElectrumUpdate<K, TxHeight>`].
|
|
||||||
pub fn into_confirmation_time_update(
|
|
||||||
self,
|
|
||||||
client: &electrum_client::Client,
|
|
||||||
) -> Result<ElectrumUpdate<K, ConfirmationTime>, Error> {
|
|
||||||
let heights = self
|
|
||||||
.chain_update
|
|
||||||
.range_txids_by_height(..TxHeight::Unconfirmed)
|
|
||||||
.map(|(h, _)| match h {
|
|
||||||
TxHeight::Confirmed(h) => *h,
|
|
||||||
_ => unreachable!("already filtered out unconfirmed"),
|
|
||||||
})
|
|
||||||
.collect::<Vec<u32>>();
|
|
||||||
|
|
||||||
let height_to_time = heights
|
|
||||||
.clone()
|
|
||||||
.into_iter()
|
|
||||||
.zip(
|
|
||||||
client
|
|
||||||
.batch_block_header(heights)?
|
|
||||||
.into_iter()
|
|
||||||
.map(|bh| bh.time as u64),
|
|
||||||
)
|
|
||||||
.collect::<HashMap<u32, u64>>();
|
|
||||||
|
|
||||||
let mut new_update = SparseChain::<ConfirmationTime>::from_checkpoints(
|
|
||||||
self.chain_update.range_checkpoints(..),
|
|
||||||
);
|
|
||||||
|
|
||||||
for &(tx_height, txid) in self.chain_update.txids() {
|
|
||||||
let conf_time = match tx_height {
|
|
||||||
TxHeight::Confirmed(height) => ConfirmationTime::Confirmed {
|
|
||||||
height,
|
|
||||||
time: height_to_time[&height],
|
|
||||||
},
|
|
||||||
TxHeight::Unconfirmed => ConfirmationTime::Unconfirmed,
|
|
||||||
};
|
|
||||||
let _ = new_update.insert_tx(txid, conf_time).expect("must insert");
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(ElectrumUpdate {
|
|
||||||
chain_update: new_update,
|
|
||||||
last_active_indices: self.last_active_indices,
|
|
||||||
})
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[derive(Debug)]
|
|
||||||
enum InternalError {
|
|
||||||
ElectrumError(Error),
|
|
||||||
Reorg,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl From<electrum_client::Error> for InternalError {
|
|
||||||
fn from(value: electrum_client::Error) -> Self {
|
|
||||||
Self::ElectrumError(value)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
fn get_tip(client: &Client) -> Result<(u32, BlockHash), Error> {
|
|
||||||
// TODO: unsubscribe when added to the client, or is there a better call to use here?
|
|
||||||
client
|
|
||||||
.block_headers_subscribe()
|
|
||||||
.map(|data| (data.height as u32, data.header.block_hash()))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Prepare an update sparsechain "template" based on the checkpoints of the `local_chain`.
|
|
||||||
fn prepare_update(
|
|
||||||
client: &Client,
|
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
|
||||||
) -> Result<SparseChain, Error> {
|
|
||||||
let mut update = SparseChain::default();
|
|
||||||
|
|
||||||
// Find the local chain block that is still there so our update can connect to the local chain.
|
|
||||||
for (&existing_height, &existing_hash) in local_chain.iter().rev() {
|
|
||||||
// TODO: a batch request may be safer, as a reorg that happens when we are obtaining
|
|
||||||
// `block_header`s will result in inconsistencies
|
|
||||||
let current_hash = client.block_header(existing_height as usize)?.block_hash();
|
|
||||||
let _ = update
|
|
||||||
.insert_checkpoint(BlockId {
|
|
||||||
height: existing_height,
|
|
||||||
hash: current_hash,
|
|
||||||
})
|
|
||||||
.expect("This never errors because we are working with a fresh chain");
|
|
||||||
|
|
||||||
if current_hash == existing_hash {
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Insert the new tip so new transactions will be accepted into the sparsechain.
|
|
||||||
let tip = {
|
|
||||||
let (height, hash) = get_tip(client)?;
|
|
||||||
BlockId { height, hash }
|
|
||||||
};
|
|
||||||
if let Err(failure) = update.insert_checkpoint(tip) {
|
|
||||||
match failure {
|
|
||||||
sparse_chain::InsertCheckpointError::HashNotMatching { .. } => {
|
|
||||||
// There has been a re-org before we even begin scanning addresses.
|
|
||||||
// Just recursively call (this should never happen).
|
|
||||||
return prepare_update(client, local_chain);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(update)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// This atrocity is required because electrum thinks a height of 0 means "unconfirmed", but there is
|
|
||||||
/// such thing as a genesis block.
|
|
||||||
///
|
|
||||||
/// We contain an expectation for the genesis coinbase txid to always have a chain position of
|
|
||||||
/// [`TxHeight::Confirmed(0)`].
|
|
||||||
fn determine_tx_height(raw_height: i32, tip_height: u32, txid: Txid) -> TxHeight {
|
|
||||||
if txid
|
|
||||||
== Txid::from_hex("4a5e1e4baab89f3a32518a88c31bc87f618f76673e2cc77ab2127b7afdeda33b")
|
|
||||||
.expect("must deserialize genesis coinbase txid")
|
|
||||||
{
|
|
||||||
return TxHeight::Confirmed(0);
|
|
||||||
}
|
|
||||||
match raw_height {
|
|
||||||
h if h <= 0 => {
|
|
||||||
debug_assert!(
|
|
||||||
h == 0 || h == -1,
|
|
||||||
"unexpected height ({}) from electrum server",
|
|
||||||
h
|
|
||||||
);
|
|
||||||
TxHeight::Unconfirmed
|
|
||||||
}
|
|
||||||
h => {
|
|
||||||
let h = h as u32;
|
|
||||||
if h > tip_height {
|
|
||||||
TxHeight::Unconfirmed
|
|
||||||
} else {
|
|
||||||
TxHeight::Confirmed(h)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Populates the update [`SparseChain`] with related transactions and associated [`ChainPosition`]s
|
|
||||||
/// of the provided `outpoints` (this is the tx which contains the outpoint and the one spending the
|
|
||||||
/// outpoint).
|
|
||||||
///
|
|
||||||
/// Unfortunately, this is awkward to implement as electrum does not provide such an API. Instead, we
|
|
||||||
/// will get the tx history of the outpoint's spk and try to find the containing tx and the
|
|
||||||
/// spending tx.
|
|
||||||
fn populate_with_outpoints(
|
|
||||||
client: &Client,
|
|
||||||
update: &mut SparseChain,
|
|
||||||
outpoints: &mut impl Iterator<Item = OutPoint>,
|
|
||||||
) -> Result<HashMap<Txid, Transaction>, InternalError> {
|
|
||||||
let tip = update
|
|
||||||
.latest_checkpoint()
|
|
||||||
.expect("update must atleast have one checkpoint");
|
|
||||||
|
|
||||||
let mut full_txs = HashMap::new();
|
|
||||||
for outpoint in outpoints {
|
|
||||||
let txid = outpoint.txid;
|
|
||||||
let tx = client.transaction_get(&txid)?;
|
|
||||||
debug_assert_eq!(tx.txid(), txid);
|
|
||||||
let txout = match tx.output.get(outpoint.vout as usize) {
|
|
||||||
Some(txout) => txout,
|
|
||||||
None => continue,
|
|
||||||
};
|
|
||||||
|
|
||||||
// attempt to find the following transactions (alongside their chain positions), and
|
|
||||||
// add to our sparsechain `update`:
|
|
||||||
let mut has_residing = false; // tx in which the outpoint resides
|
|
||||||
let mut has_spending = false; // tx that spends the outpoint
|
|
||||||
for res in client.script_get_history(&txout.script_pubkey)? {
|
|
||||||
if has_residing && has_spending {
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
|
|
||||||
if res.tx_hash == txid {
|
|
||||||
if has_residing {
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
has_residing = true;
|
|
||||||
full_txs.insert(res.tx_hash, tx.clone());
|
|
||||||
} else {
|
|
||||||
if has_spending {
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
let res_tx = match full_txs.get(&res.tx_hash) {
|
|
||||||
Some(tx) => tx,
|
|
||||||
None => {
|
|
||||||
let res_tx = client.transaction_get(&res.tx_hash)?;
|
|
||||||
full_txs.insert(res.tx_hash, res_tx);
|
|
||||||
full_txs.get(&res.tx_hash).expect("just inserted")
|
|
||||||
}
|
|
||||||
};
|
|
||||||
has_spending = res_tx
|
|
||||||
.input
|
|
||||||
.iter()
|
|
||||||
.any(|txin| txin.previous_output == outpoint);
|
|
||||||
if !has_spending {
|
|
||||||
continue;
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
let tx_height = determine_tx_height(res.height, tip.height, res.tx_hash);
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(res.tx_hash, tx_height) {
|
|
||||||
match failure {
|
|
||||||
sparse_chain::InsertTxError::TxTooHigh { .. } => {
|
|
||||||
unreachable!("we should never encounter this as we ensured height <= tip");
|
|
||||||
}
|
|
||||||
sparse_chain::InsertTxError::TxMovedUnexpectedly { .. } => {
|
|
||||||
return Err(InternalError::Reorg);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
Ok(full_txs)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Populate an update [`SparseChain`] with transactions (and associated block positions) from
|
|
||||||
/// the given `txids`.
|
|
||||||
fn populate_with_txids(
|
|
||||||
client: &Client,
|
|
||||||
update: &mut SparseChain,
|
|
||||||
txids: &mut impl Iterator<Item = Txid>,
|
|
||||||
) -> Result<(), InternalError> {
|
|
||||||
let tip = update
|
|
||||||
.latest_checkpoint()
|
|
||||||
.expect("update must have atleast one checkpoint");
|
|
||||||
for txid in txids {
|
|
||||||
let tx = match client.transaction_get(&txid) {
|
|
||||||
Ok(tx) => tx,
|
|
||||||
Err(electrum_client::Error::Protocol(_)) => continue,
|
|
||||||
Err(other_err) => return Err(other_err.into()),
|
|
||||||
};
|
|
||||||
|
|
||||||
let spk = tx
|
|
||||||
.output
|
|
||||||
.get(0)
|
|
||||||
.map(|txo| &txo.script_pubkey)
|
|
||||||
.expect("tx must have an output");
|
|
||||||
|
|
||||||
let tx_height = match client
|
|
||||||
.script_get_history(spk)?
|
|
||||||
.into_iter()
|
|
||||||
.find(|r| r.tx_hash == txid)
|
|
||||||
{
|
|
||||||
Some(r) => determine_tx_height(r.height, tip.height, r.tx_hash),
|
|
||||||
None => continue,
|
|
||||||
};
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(txid, tx_height) {
|
|
||||||
match failure {
|
|
||||||
sparse_chain::InsertTxError::TxTooHigh { .. } => {
|
|
||||||
unreachable!("we should never encounter this as we ensured height <= tip");
|
|
||||||
}
|
|
||||||
sparse_chain::InsertTxError::TxMovedUnexpectedly { .. } => {
|
|
||||||
return Err(InternalError::Reorg);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Populate an update [`SparseChain`] with transactions (and associated block positions) from
|
|
||||||
/// the transaction history of the provided `spk`s.
|
|
||||||
fn populate_with_spks<K, I, S>(
|
|
||||||
client: &Client,
|
|
||||||
update: &mut SparseChain,
|
|
||||||
spks: &mut S,
|
|
||||||
stop_gap: usize,
|
|
||||||
batch_size: usize,
|
|
||||||
) -> Result<BTreeMap<I, (Script, bool)>, InternalError>
|
|
||||||
where
|
|
||||||
K: Ord + Clone,
|
|
||||||
I: Ord + Clone,
|
|
||||||
S: Iterator<Item = (I, Script)>,
|
|
||||||
{
|
|
||||||
let tip = update.latest_checkpoint().map_or(0, |cp| cp.height);
|
|
||||||
let mut unused_spk_count = 0_usize;
|
|
||||||
let mut scanned_spks = BTreeMap::new();
|
|
||||||
|
|
||||||
loop {
|
|
||||||
let spks = (0..batch_size)
|
|
||||||
.map_while(|_| spks.next())
|
|
||||||
.collect::<Vec<_>>();
|
|
||||||
if spks.is_empty() {
|
|
||||||
return Ok(scanned_spks);
|
|
||||||
}
|
|
||||||
|
|
||||||
let spk_histories = client.batch_script_get_history(spks.iter().map(|(_, s)| s))?;
|
|
||||||
|
|
||||||
for ((spk_index, spk), spk_history) in spks.into_iter().zip(spk_histories) {
|
|
||||||
if spk_history.is_empty() {
|
|
||||||
scanned_spks.insert(spk_index, (spk, false));
|
|
||||||
unused_spk_count += 1;
|
|
||||||
if unused_spk_count > stop_gap {
|
|
||||||
return Ok(scanned_spks);
|
|
||||||
}
|
|
||||||
continue;
|
|
||||||
} else {
|
|
||||||
scanned_spks.insert(spk_index, (spk, true));
|
|
||||||
unused_spk_count = 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
for tx in spk_history {
|
|
||||||
let tx_height = determine_tx_height(tx.height, tip, tx.tx_hash);
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(tx.tx_hash, tx_height) {
|
|
||||||
match failure {
|
|
||||||
sparse_chain::InsertTxError::TxTooHigh { .. } => {
|
|
||||||
unreachable!(
|
|
||||||
"we should never encounter this as we ensured height <= tip"
|
|
||||||
);
|
|
||||||
}
|
|
||||||
sparse_chain::InsertTxError::TxMovedUnexpectedly { .. } => {
|
|
||||||
return Err(InternalError::Reorg);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bdk_esplora"
|
name = "bdk_esplora"
|
||||||
version = "0.2.0"
|
version = "0.9.0"
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
homepage = "https://bitcoindevkit.org"
|
homepage = "https://bitcoindevkit.org"
|
||||||
repository = "https://github.com/bitcoindevkit/bdk"
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
@@ -12,13 +12,23 @@ readme = "README.md"
|
|||||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
bdk_chain = { path = "../chain", version = "0.4.0", features = ["serde", "miniscript"] }
|
bdk_chain = { path = "../chain", version = "0.11.0", default-features = false }
|
||||||
esplora-client = { version = "0.3", default-features = false }
|
esplora-client = { version = "0.6.0", default-features = false }
|
||||||
async-trait = { version = "0.1.66", optional = true }
|
async-trait = { version = "0.1.66", optional = true }
|
||||||
futures = { version = "0.3.26", optional = true }
|
futures = { version = "0.3.26", optional = true }
|
||||||
|
|
||||||
|
# use these dependencies if you need to enable their /no-std features
|
||||||
|
bitcoin = { version = "0.30.0", optional = true, default-features = false }
|
||||||
|
miniscript = { version = "10.0.0", optional = true, default-features = false }
|
||||||
|
|
||||||
|
[target.'cfg(not(target_arch = "wasm32"))'.dev-dependencies]
|
||||||
|
electrsd = { version= "0.25.0", features = ["bitcoind_25_0", "esplora_a33e97e1", "legacy"] }
|
||||||
|
tokio = { version = "1", features = ["rt", "rt-multi-thread", "macros"] }
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
default = ["async-https", "blocking"]
|
default = ["std", "async-https", "blocking"]
|
||||||
|
std = ["bdk_chain/std"]
|
||||||
async = ["async-trait", "futures", "esplora-client/async"]
|
async = ["async-trait", "futures", "esplora-client/async"]
|
||||||
async-https = ["async", "esplora-client/async-https"]
|
async-https = ["async", "esplora-client/async-https"]
|
||||||
|
async-https-rustls = ["async", "esplora-client/async-https-rustls"]
|
||||||
blocking = ["esplora-client/blocking"]
|
blocking = ["esplora-client/blocking"]
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
# BDK Esplora
|
# BDK Esplora
|
||||||
|
|
||||||
BDK Esplora extends [`esplora_client`](crate::esplora_client) to update [`bdk_chain`] structures
|
BDK Esplora extends [`esplora-client`] to update [`bdk_chain`] structures
|
||||||
from an Esplora server.
|
from an Esplora server.
|
||||||
|
|
||||||
## Usage
|
## Usage
|
||||||
@@ -9,17 +9,17 @@ There are two versions of the extension trait (blocking and async).
|
|||||||
|
|
||||||
For blocking-only:
|
For blocking-only:
|
||||||
```toml
|
```toml
|
||||||
bdk_esplora = { version = "0.1", features = ["blocking"] }
|
bdk_esplora = { version = "0.3", features = ["blocking"] }
|
||||||
```
|
```
|
||||||
|
|
||||||
For async-only:
|
For async-only:
|
||||||
```toml
|
```toml
|
||||||
bdk_esplora = { version = "0.1", features = ["async"] }
|
bdk_esplora = { version = "0.3", features = ["async"] }
|
||||||
```
|
```
|
||||||
|
|
||||||
For async-only (with https):
|
For async-only (with https):
|
||||||
```toml
|
```toml
|
||||||
bdk_esplora = { version = "0.1", features = ["async-https"] }
|
bdk_esplora = { version = "0.3", features = ["async-https"] }
|
||||||
```
|
```
|
||||||
|
|
||||||
To use the extension traits:
|
To use the extension traits:
|
||||||
@@ -27,7 +27,10 @@ To use the extension traits:
|
|||||||
// for blocking
|
// for blocking
|
||||||
use bdk_esplora::EsploraExt;
|
use bdk_esplora::EsploraExt;
|
||||||
// for async
|
// for async
|
||||||
use bdk_esplora::EsploraAsyncExt;
|
// use bdk_esplora::EsploraAsyncExt;
|
||||||
```
|
```
|
||||||
|
|
||||||
For full examples, refer to [`example-crates/wallet_esplora`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora) (blocking) and [`example-crates/wallet_esplora_async`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_async).
|
For full examples, refer to [`example-crates/wallet_esplora_blocking`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_blocking) and [`example-crates/wallet_esplora_async`](https://github.com/bitcoindevkit/bdk/tree/master/example-crates/wallet_esplora_async).
|
||||||
|
|
||||||
|
[`esplora-client`]: https://docs.rs/esplora-client/
|
||||||
|
[`bdk_chain`]: https://docs.rs/bdk-chain/
|
||||||
|
|||||||
@@ -1,70 +1,258 @@
|
|||||||
use std::collections::BTreeMap;
|
|
||||||
|
|
||||||
use async_trait::async_trait;
|
use async_trait::async_trait;
|
||||||
|
use bdk_chain::collections::btree_map;
|
||||||
use bdk_chain::{
|
use bdk_chain::{
|
||||||
bitcoin::{BlockHash, OutPoint, Script, Txid},
|
bitcoin::{BlockHash, OutPoint, ScriptBuf, TxOut, Txid},
|
||||||
chain_graph::ChainGraph,
|
collections::BTreeMap,
|
||||||
keychain::KeychainScan,
|
local_chain::{self, CheckPoint},
|
||||||
sparse_chain, BlockId, ConfirmationTime,
|
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||||
};
|
};
|
||||||
use esplora_client::{Error, OutputStatus};
|
use esplora_client::TxStatus;
|
||||||
use futures::stream::{FuturesOrdered, TryStreamExt};
|
use futures::{stream::FuturesOrdered, TryStreamExt};
|
||||||
|
|
||||||
use crate::map_confirmation_time;
|
use crate::anchor_from_status;
|
||||||
|
|
||||||
/// Trait to extend [`esplora_client::AsyncClient`] functionality.
|
/// [`esplora_client::Error`]
|
||||||
|
type Error = Box<esplora_client::Error>;
|
||||||
|
|
||||||
|
/// Trait to extend the functionality of [`esplora_client::AsyncClient`].
|
||||||
///
|
///
|
||||||
/// This is the async version of [`EsploraExt`]. Refer to
|
/// Refer to [crate-level documentation] for more.
|
||||||
/// [crate-level documentation] for more.
|
|
||||||
///
|
///
|
||||||
/// [`EsploraExt`]: crate::EsploraExt
|
|
||||||
/// [crate-level documentation]: crate
|
/// [crate-level documentation]: crate
|
||||||
#[cfg(feature = "async")]
|
|
||||||
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||||
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||||
pub trait EsploraAsyncExt {
|
pub trait EsploraAsyncExt {
|
||||||
/// Scan the blockchain (via esplora) for the data specified and returns a [`KeychainScan`].
|
/// Prepare a [`LocalChain`] update with blocks fetched from Esplora.
|
||||||
///
|
///
|
||||||
/// - `local_chain`: the most recent block hashes present locally
|
/// * `local_tip` is the previous tip of [`LocalChain::tip`].
|
||||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
/// * `request_heights` is the block heights that we are interested in fetching from Esplora.
|
||||||
/// - `txids`: transactions for which we want updated [`ChainPosition`]s
|
|
||||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
|
||||||
/// want to included in the update
|
|
||||||
///
|
///
|
||||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
/// The result of this method can be applied to [`LocalChain::apply_update`].
|
||||||
|
///
|
||||||
|
/// ## Consistency
|
||||||
|
///
|
||||||
|
/// The chain update returned is guaranteed to be consistent as long as there is not a *large* re-org
|
||||||
|
/// during the call. The size of re-org we can tollerate is server dependent but will be at
|
||||||
|
/// least 10.
|
||||||
|
///
|
||||||
|
/// [`LocalChain`]: bdk_chain::local_chain::LocalChain
|
||||||
|
/// [`LocalChain::tip`]: bdk_chain::local_chain::LocalChain::tip
|
||||||
|
/// [`LocalChain::apply_update`]: bdk_chain::local_chain::LocalChain::apply_update
|
||||||
|
async fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||||
|
) -> Result<local_chain::Update, Error>;
|
||||||
|
|
||||||
|
/// Full scan the keychain scripts specified with the blockchain (via an Esplora client) and
|
||||||
|
/// returns a [`TxGraph`] and a map of last active indices.
|
||||||
|
///
|
||||||
|
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||||
|
///
|
||||||
|
/// The full scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||||
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||||
/// parallel.
|
/// parallel.
|
||||||
///
|
async fn full_scan<K: Ord + Clone + Send>(
|
||||||
/// [`ChainPosition`]: bdk_chain::sparse_chain::ChainPosition
|
|
||||||
#[allow(clippy::result_large_err)] // FIXME
|
|
||||||
async fn scan<K: Ord + Clone + Send>(
|
|
||||||
&self,
|
&self,
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
|
||||||
keychain_spks: BTreeMap<
|
keychain_spks: BTreeMap<
|
||||||
K,
|
K,
|
||||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, Script)> + Send> + Send,
|
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, ScriptBuf)> + Send> + Send,
|
||||||
>,
|
>,
|
||||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
|
||||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
|
||||||
stop_gap: usize,
|
stop_gap: usize,
|
||||||
parallel_requests: usize,
|
parallel_requests: usize,
|
||||||
) -> Result<KeychainScan<K, ConfirmationTime>, Error>;
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||||
|
|
||||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
/// Sync a set of scripts with the blockchain (via an Esplora client) for the data
|
||||||
|
/// specified and return a [`TxGraph`].
|
||||||
///
|
///
|
||||||
/// [`scan`]: EsploraAsyncExt::scan
|
/// * `misc_spks`: scripts that we want to sync transactions for
|
||||||
#[allow(clippy::result_large_err)] // FIXME
|
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||||
async fn scan_without_keychain(
|
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||||
|
/// want to include in the update
|
||||||
|
///
|
||||||
|
/// If the scripts to sync are unknown, such as when restoring or importing a keychain that
|
||||||
|
/// may include scripts that have been used, use [`full_scan`] with the keychain.
|
||||||
|
///
|
||||||
|
/// [`full_scan`]: EsploraAsyncExt::full_scan
|
||||||
|
async fn sync(
|
||||||
&self,
|
&self,
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = ScriptBuf> + Send> + Send,
|
||||||
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = Script> + Send> + Send,
|
|
||||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||||
parallel_requests: usize,
|
parallel_requests: usize,
|
||||||
) -> Result<ChainGraph<ConfirmationTime>, Error> {
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error>;
|
||||||
let wallet_scan = self
|
}
|
||||||
.scan(
|
|
||||||
local_chain,
|
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
||||||
|
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
||||||
|
impl EsploraAsyncExt for esplora_client::AsyncClient {
|
||||||
|
async fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<IntoIter = impl Iterator<Item = u32> + Send> + Send,
|
||||||
|
) -> Result<local_chain::Update, Error> {
|
||||||
|
// Fetch latest N (server dependent) blocks from Esplora. The server guarantees these are
|
||||||
|
// consistent.
|
||||||
|
let mut fetched_blocks = self
|
||||||
|
.get_blocks(None)
|
||||||
|
.await?
|
||||||
|
.into_iter()
|
||||||
|
.map(|b| (b.time.height, b.id))
|
||||||
|
.collect::<BTreeMap<u32, BlockHash>>();
|
||||||
|
let new_tip_height = fetched_blocks
|
||||||
|
.keys()
|
||||||
|
.last()
|
||||||
|
.copied()
|
||||||
|
.expect("must have atleast one block");
|
||||||
|
|
||||||
|
// Fetch blocks of heights that the caller is interested in, skipping blocks that are
|
||||||
|
// already fetched when constructing `fetched_blocks`.
|
||||||
|
for height in request_heights {
|
||||||
|
// do not fetch blocks higher than remote tip
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// only fetch what is missing
|
||||||
|
if let btree_map::Entry::Vacant(entry) = fetched_blocks.entry(height) {
|
||||||
|
// ❗The return value of `get_block_hash` is not strictly guaranteed to be consistent
|
||||||
|
// with the chain at the time of `get_blocks` above (there could have been a deep
|
||||||
|
// re-org). Since `get_blocks` returns 10 (or so) blocks we are assuming that it's
|
||||||
|
// not possible to have a re-org deeper than that.
|
||||||
|
entry.insert(self.get_block_hash(height).await?);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Ensure `fetched_blocks` can create an update that connects with the original chain by
|
||||||
|
// finding a "Point of Agreement".
|
||||||
|
for (height, local_hash) in local_tip.iter().map(|cp| (cp.height(), cp.hash())) {
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
let fetched_hash = match fetched_blocks.entry(height) {
|
||||||
|
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||||
|
btree_map::Entry::Vacant(entry) => {
|
||||||
|
*entry.insert(self.get_block_hash(height).await?)
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// We have found point of agreement so the update will connect!
|
||||||
|
if fetched_hash == local_hash {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(local_chain::Update {
|
||||||
|
tip: CheckPoint::from_block_ids(fetched_blocks.into_iter().map(BlockId::from))
|
||||||
|
.expect("must be in height order"),
|
||||||
|
introduce_older_blocks: true,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn full_scan<K: Ord + Clone + Send>(
|
||||||
|
&self,
|
||||||
|
keychain_spks: BTreeMap<
|
||||||
|
K,
|
||||||
|
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, ScriptBuf)> + Send> + Send,
|
||||||
|
>,
|
||||||
|
stop_gap: usize,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||||
|
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||||
|
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||||
|
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||||
|
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||||
|
|
||||||
|
for (keychain, spks) in keychain_spks {
|
||||||
|
let mut spks = spks.into_iter();
|
||||||
|
let mut last_index = Option::<u32>::None;
|
||||||
|
let mut last_active_index = Option::<u32>::None;
|
||||||
|
|
||||||
|
loop {
|
||||||
|
let handles = spks
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.map(|(spk_index, spk)| {
|
||||||
|
let client = self.clone();
|
||||||
|
async move {
|
||||||
|
let mut last_seen = None;
|
||||||
|
let mut spk_txs = Vec::new();
|
||||||
|
loop {
|
||||||
|
let txs = client.scripthash_txs(&spk, last_seen).await?;
|
||||||
|
let tx_count = txs.len();
|
||||||
|
last_seen = txs.last().map(|tx| tx.txid);
|
||||||
|
spk_txs.extend(txs);
|
||||||
|
if tx_count < 25 {
|
||||||
|
break Result::<_, Error>::Ok((spk_index, spk_txs));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.collect::<FuturesOrdered<_>>();
|
||||||
|
|
||||||
|
if handles.is_empty() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
for (index, txs) in handles.try_collect::<Vec<TxsOfSpkIndex>>().await? {
|
||||||
|
last_index = Some(index);
|
||||||
|
if !txs.is_empty() {
|
||||||
|
last_active_index = Some(index);
|
||||||
|
}
|
||||||
|
for tx in txs {
|
||||||
|
let _ = graph.insert_tx(tx.to_tx());
|
||||||
|
if let Some(anchor) = anchor_from_status(&tx.status) {
|
||||||
|
let _ = graph.insert_anchor(tx.txid, anchor);
|
||||||
|
}
|
||||||
|
|
||||||
|
let previous_outputs = tx.vin.iter().filter_map(|vin| {
|
||||||
|
let prevout = vin.prevout.as_ref()?;
|
||||||
|
Some((
|
||||||
|
OutPoint {
|
||||||
|
txid: vin.txid,
|
||||||
|
vout: vin.vout,
|
||||||
|
},
|
||||||
|
TxOut {
|
||||||
|
script_pubkey: prevout.scriptpubkey.clone(),
|
||||||
|
value: prevout.value,
|
||||||
|
},
|
||||||
|
))
|
||||||
|
});
|
||||||
|
|
||||||
|
for (outpoint, txout) in previous_outputs {
|
||||||
|
let _ = graph.insert_txout(outpoint, txout);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||||
|
let past_gap_limit = if let Some(i) = last_active_index {
|
||||||
|
last_index > i.saturating_add(stop_gap as u32)
|
||||||
|
} else {
|
||||||
|
last_index >= stop_gap as u32
|
||||||
|
};
|
||||||
|
if past_gap_limit {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(last_active_index) = last_active_index {
|
||||||
|
last_active_indexes.insert(keychain, last_active_index);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok((graph, last_active_indexes))
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn sync(
|
||||||
|
&self,
|
||||||
|
misc_spks: impl IntoIterator<IntoIter = impl Iterator<Item = ScriptBuf> + Send> + Send,
|
||||||
|
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
||||||
|
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
||||||
|
parallel_requests: usize,
|
||||||
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||||
|
let mut graph = self
|
||||||
|
.full_scan(
|
||||||
[(
|
[(
|
||||||
(),
|
(),
|
||||||
misc_spks
|
misc_spks
|
||||||
@@ -73,244 +261,60 @@ pub trait EsploraAsyncExt {
|
|||||||
.map(|(i, spk)| (i as u32, spk)),
|
.map(|(i, spk)| (i as u32, spk)),
|
||||||
)]
|
)]
|
||||||
.into(),
|
.into(),
|
||||||
txids,
|
|
||||||
outpoints,
|
|
||||||
usize::MAX,
|
usize::MAX,
|
||||||
parallel_requests,
|
parallel_requests,
|
||||||
)
|
)
|
||||||
.await?;
|
.await
|
||||||
|
.map(|(g, _)| g)?;
|
||||||
|
|
||||||
Ok(wallet_scan.update)
|
let mut txids = txids.into_iter();
|
||||||
}
|
loop {
|
||||||
}
|
let handles = txids
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.filter(|&txid| graph.get_tx(txid).is_none())
|
||||||
|
.map(|txid| {
|
||||||
|
let client = self.clone();
|
||||||
|
async move { client.get_tx_status(&txid).await.map(|s| (txid, s)) }
|
||||||
|
})
|
||||||
|
.collect::<FuturesOrdered<_>>();
|
||||||
|
|
||||||
#[cfg(feature = "async")]
|
if handles.is_empty() {
|
||||||
#[cfg_attr(target_arch = "wasm32", async_trait(?Send))]
|
|
||||||
#[cfg_attr(not(target_arch = "wasm32"), async_trait)]
|
|
||||||
impl EsploraAsyncExt for esplora_client::AsyncClient {
|
|
||||||
#[allow(clippy::result_large_err)] // FIXME
|
|
||||||
async fn scan<K: Ord + Clone + Send>(
|
|
||||||
&self,
|
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
|
||||||
keychain_spks: BTreeMap<
|
|
||||||
K,
|
|
||||||
impl IntoIterator<IntoIter = impl Iterator<Item = (u32, Script)> + Send> + Send,
|
|
||||||
>,
|
|
||||||
txids: impl IntoIterator<IntoIter = impl Iterator<Item = Txid> + Send> + Send,
|
|
||||||
outpoints: impl IntoIterator<IntoIter = impl Iterator<Item = OutPoint> + Send> + Send,
|
|
||||||
stop_gap: usize,
|
|
||||||
parallel_requests: usize,
|
|
||||||
) -> Result<KeychainScan<K, ConfirmationTime>, Error> {
|
|
||||||
let txids = txids.into_iter();
|
|
||||||
let outpoints = outpoints.into_iter();
|
|
||||||
let parallel_requests = parallel_requests.max(1);
|
|
||||||
let mut scan = KeychainScan::default();
|
|
||||||
let update = &mut scan.update;
|
|
||||||
let last_active_indices = &mut scan.last_active_indices;
|
|
||||||
|
|
||||||
for (&height, &original_hash) in local_chain.iter().rev() {
|
|
||||||
let update_block_id = BlockId {
|
|
||||||
height,
|
|
||||||
hash: self.get_block_hash(height).await?,
|
|
||||||
};
|
|
||||||
let _ = update
|
|
||||||
.insert_checkpoint(update_block_id)
|
|
||||||
.expect("cannot repeat height here");
|
|
||||||
if update_block_id.hash == original_hash {
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
|
||||||
let tip_at_start = BlockId {
|
for (txid, status) in handles.try_collect::<Vec<(Txid, TxStatus)>>().await? {
|
||||||
height: self.get_height().await?,
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
hash: self.get_tip_hash().await?,
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
};
|
|
||||||
if let Err(failure) = update.insert_checkpoint(tip_at_start) {
|
|
||||||
match failure {
|
|
||||||
sparse_chain::InsertCheckpointError::HashNotMatching { .. } => {
|
|
||||||
// there was a re-org before we started scanning. We haven't consumed any iterators, so calling this function recursively is safe.
|
|
||||||
return EsploraAsyncExt::scan(
|
|
||||||
self,
|
|
||||||
local_chain,
|
|
||||||
keychain_spks,
|
|
||||||
txids,
|
|
||||||
outpoints,
|
|
||||||
stop_gap,
|
|
||||||
parallel_requests,
|
|
||||||
)
|
|
||||||
.await;
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
for (keychain, spks) in keychain_spks {
|
for op in outpoints.into_iter() {
|
||||||
let mut spks = spks.into_iter();
|
if graph.get_tx(op.txid).is_none() {
|
||||||
let mut last_active_index = None;
|
if let Some(tx) = self.get_tx(&op.txid).await? {
|
||||||
let mut empty_scripts = 0;
|
let _ = graph.insert_tx(tx);
|
||||||
type IndexWithTxs = (u32, Vec<esplora_client::Tx>);
|
}
|
||||||
|
let status = self.get_tx_status(&op.txid).await?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(op.txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
loop {
|
if let Some(op_status) = self.get_output_status(&op.txid, op.vout as _).await? {
|
||||||
let futures: FuturesOrdered<_> = (0..parallel_requests)
|
if let Some(txid) = op_status.txid {
|
||||||
.filter_map(|_| {
|
if graph.get_tx(txid).is_none() {
|
||||||
let (index, script) = spks.next()?;
|
if let Some(tx) = self.get_tx(&txid).await? {
|
||||||
let client = self.clone();
|
let _ = graph.insert_tx(tx);
|
||||||
Some(async move {
|
|
||||||
let mut related_txs = client.scripthash_txs(&script, None).await?;
|
|
||||||
|
|
||||||
let n_confirmed =
|
|
||||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
|
||||||
// esplora pages on 25 confirmed transactions. If there are 25 or more we
|
|
||||||
// keep requesting to see if there's more.
|
|
||||||
if n_confirmed >= 25 {
|
|
||||||
loop {
|
|
||||||
let new_related_txs = client
|
|
||||||
.scripthash_txs(
|
|
||||||
&script,
|
|
||||||
Some(related_txs.last().unwrap().txid),
|
|
||||||
)
|
|
||||||
.await?;
|
|
||||||
let n = new_related_txs.len();
|
|
||||||
related_txs.extend(new_related_txs);
|
|
||||||
// we've reached the end
|
|
||||||
if n < 25 {
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
Result::<_, esplora_client::Error>::Ok((index, related_txs))
|
|
||||||
})
|
|
||||||
})
|
|
||||||
.collect();
|
|
||||||
|
|
||||||
let n_futures = futures.len();
|
|
||||||
|
|
||||||
let idx_with_tx: Vec<IndexWithTxs> = futures.try_collect().await?;
|
|
||||||
|
|
||||||
for (index, related_txs) in idx_with_tx {
|
|
||||||
if related_txs.is_empty() {
|
|
||||||
empty_scripts += 1;
|
|
||||||
} else {
|
|
||||||
last_active_index = Some(index);
|
|
||||||
empty_scripts = 0;
|
|
||||||
}
|
|
||||||
for tx in related_txs {
|
|
||||||
let confirmation_time =
|
|
||||||
map_confirmation_time(&tx.status, tip_at_start.height);
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(tx.to_tx(), confirmation_time) {
|
|
||||||
use bdk_chain::{
|
|
||||||
chain_graph::InsertTxError, sparse_chain::InsertTxError::*,
|
|
||||||
};
|
|
||||||
match failure {
|
|
||||||
InsertTxError::Chain(TxTooHigh { .. }) => {
|
|
||||||
unreachable!("chain position already checked earlier")
|
|
||||||
}
|
|
||||||
InsertTxError::Chain(TxMovedUnexpectedly { .. })
|
|
||||||
| InsertTxError::UnresolvableConflict(_) => {
|
|
||||||
/* implies reorg during a scan. We deal with that below */
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
let status = self.get_tx_status(&txid).await?;
|
||||||
}
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
if n_futures == 0 || empty_scripts >= stop_gap {
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if let Some(last_active_index) = last_active_index {
|
|
||||||
last_active_indices.insert(keychain, last_active_index);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for txid in txids {
|
|
||||||
let (tx, tx_status) =
|
|
||||||
match (self.get_tx(&txid).await?, self.get_tx_status(&txid).await?) {
|
|
||||||
(Some(tx), Some(tx_status)) => (tx, tx_status),
|
|
||||||
_ => continue,
|
|
||||||
};
|
|
||||||
|
|
||||||
let confirmation_time = map_confirmation_time(&tx_status, tip_at_start.height);
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(tx, confirmation_time) {
|
|
||||||
use bdk_chain::{chain_graph::InsertTxError, sparse_chain::InsertTxError::*};
|
|
||||||
match failure {
|
|
||||||
InsertTxError::Chain(TxTooHigh { .. }) => {
|
|
||||||
unreachable!("chain position already checked earlier")
|
|
||||||
}
|
|
||||||
InsertTxError::Chain(TxMovedUnexpectedly { .. })
|
|
||||||
| InsertTxError::UnresolvableConflict(_) => {
|
|
||||||
/* implies reorg during a scan. We deal with that below */
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for op in outpoints {
|
|
||||||
let mut op_txs = Vec::with_capacity(2);
|
|
||||||
if let (Some(tx), Some(tx_status)) = (
|
|
||||||
self.get_tx(&op.txid).await?,
|
|
||||||
self.get_tx_status(&op.txid).await?,
|
|
||||||
) {
|
|
||||||
op_txs.push((tx, tx_status));
|
|
||||||
if let Some(OutputStatus {
|
|
||||||
txid: Some(txid),
|
|
||||||
status: Some(spend_status),
|
|
||||||
..
|
|
||||||
}) = self.get_output_status(&op.txid, op.vout as _).await?
|
|
||||||
{
|
|
||||||
if let Some(spend_tx) = self.get_tx(&txid).await? {
|
|
||||||
op_txs.push((spend_tx, spend_status));
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for (tx, status) in op_txs {
|
|
||||||
let confirmation_time = map_confirmation_time(&status, tip_at_start.height);
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(tx, confirmation_time) {
|
|
||||||
use bdk_chain::{chain_graph::InsertTxError, sparse_chain::InsertTxError::*};
|
|
||||||
match failure {
|
|
||||||
InsertTxError::Chain(TxTooHigh { .. }) => {
|
|
||||||
unreachable!("chain position already checked earlier")
|
|
||||||
}
|
|
||||||
InsertTxError::Chain(TxMovedUnexpectedly { .. })
|
|
||||||
| InsertTxError::UnresolvableConflict(_) => {
|
|
||||||
/* implies reorg during a scan. We deal with that below */
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
Ok(graph)
|
||||||
let reorg_occurred = {
|
|
||||||
if let Some(checkpoint) = update.chain().latest_checkpoint() {
|
|
||||||
self.get_block_hash(checkpoint.height).await? != checkpoint.hash
|
|
||||||
} else {
|
|
||||||
false
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
if reorg_occurred {
|
|
||||||
// A reorg occurred, so let's find out where all the txids we found are in the chain now.
|
|
||||||
// XXX: collect required because of weird type naming issues
|
|
||||||
let txids_found = update
|
|
||||||
.chain()
|
|
||||||
.txids()
|
|
||||||
.map(|(_, txid)| *txid)
|
|
||||||
.collect::<Vec<_>>();
|
|
||||||
scan.update = EsploraAsyncExt::scan_without_keychain(
|
|
||||||
self,
|
|
||||||
local_chain,
|
|
||||||
[],
|
|
||||||
txids_found,
|
|
||||||
[],
|
|
||||||
parallel_requests,
|
|
||||||
)
|
|
||||||
.await?;
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(scan)
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,290 +1,317 @@
|
|||||||
use std::collections::BTreeMap;
|
use std::thread::JoinHandle;
|
||||||
|
|
||||||
|
use bdk_chain::collections::btree_map;
|
||||||
|
use bdk_chain::collections::BTreeMap;
|
||||||
use bdk_chain::{
|
use bdk_chain::{
|
||||||
bitcoin::{BlockHash, OutPoint, Script, Txid},
|
bitcoin::{BlockHash, OutPoint, ScriptBuf, TxOut, Txid},
|
||||||
chain_graph::ChainGraph,
|
local_chain::{self, CheckPoint},
|
||||||
keychain::KeychainScan,
|
BlockId, ConfirmationTimeHeightAnchor, TxGraph,
|
||||||
sparse_chain, BlockId, ConfirmationTime,
|
|
||||||
};
|
};
|
||||||
use esplora_client::{Error, OutputStatus};
|
use esplora_client::TxStatus;
|
||||||
|
|
||||||
use crate::map_confirmation_time;
|
use crate::anchor_from_status;
|
||||||
|
|
||||||
/// Trait to extend [`esplora_client::BlockingClient`] functionality.
|
/// [`esplora_client::Error`]
|
||||||
|
type Error = Box<esplora_client::Error>;
|
||||||
|
|
||||||
|
/// Trait to extend the functionality of [`esplora_client::BlockingClient`].
|
||||||
///
|
///
|
||||||
/// Refer to [crate-level documentation] for more.
|
/// Refer to [crate-level documentation] for more.
|
||||||
///
|
///
|
||||||
/// [crate-level documentation]: crate
|
/// [crate-level documentation]: crate
|
||||||
pub trait EsploraExt {
|
pub trait EsploraExt {
|
||||||
/// Scan the blockchain (via esplora) for the data specified and returns a [`KeychainScan`].
|
/// Prepare a [`LocalChain`] update with blocks fetched from Esplora.
|
||||||
///
|
///
|
||||||
/// - `local_chain`: the most recent block hashes present locally
|
/// * `local_tip` is the previous tip of [`LocalChain::tip`].
|
||||||
/// - `keychain_spks`: keychains that we want to scan transactions for
|
/// * `request_heights` is the block heights that we are interested in fetching from Esplora.
|
||||||
/// - `txids`: transactions for which we want updated [`ChainPosition`]s
|
|
||||||
/// - `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
|
||||||
/// want to included in the update
|
|
||||||
///
|
///
|
||||||
/// The scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
/// The result of this method can be applied to [`LocalChain::apply_update`].
|
||||||
|
///
|
||||||
|
/// ## Consistency
|
||||||
|
///
|
||||||
|
/// The chain update returned is guaranteed to be consistent as long as there is not a *large* re-org
|
||||||
|
/// during the call. The size of re-org we can tollerate is server dependent but will be at
|
||||||
|
/// least 10.
|
||||||
|
///
|
||||||
|
/// [`LocalChain`]: bdk_chain::local_chain::LocalChain
|
||||||
|
/// [`LocalChain::tip`]: bdk_chain::local_chain::LocalChain::tip
|
||||||
|
/// [`LocalChain::apply_update`]: bdk_chain::local_chain::LocalChain::apply_update
|
||||||
|
fn update_local_chain(
|
||||||
|
&self,
|
||||||
|
local_tip: CheckPoint,
|
||||||
|
request_heights: impl IntoIterator<Item = u32>,
|
||||||
|
) -> Result<local_chain::Update, Error>;
|
||||||
|
|
||||||
|
/// Full scan the keychain scripts specified with the blockchain (via an Esplora client) and
|
||||||
|
/// returns a [`TxGraph`] and a map of last active indices.
|
||||||
|
///
|
||||||
|
/// * `keychain_spks`: keychains that we want to scan transactions for
|
||||||
|
///
|
||||||
|
/// The full scan for each keychain stops after a gap of `stop_gap` script pubkeys with no associated
|
||||||
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
/// transactions. `parallel_requests` specifies the max number of HTTP requests to make in
|
||||||
/// parallel.
|
/// parallel.
|
||||||
///
|
fn full_scan<K: Ord + Clone>(
|
||||||
/// [`ChainPosition`]: bdk_chain::sparse_chain::ChainPosition
|
|
||||||
#[allow(clippy::result_large_err)] // FIXME
|
|
||||||
fn scan<K: Ord + Clone>(
|
|
||||||
&self,
|
&self,
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
|
||||||
txids: impl IntoIterator<Item = Txid>,
|
|
||||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
|
||||||
stop_gap: usize,
|
stop_gap: usize,
|
||||||
parallel_requests: usize,
|
parallel_requests: usize,
|
||||||
) -> Result<KeychainScan<K, ConfirmationTime>, Error>;
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error>;
|
||||||
|
|
||||||
/// Convenience method to call [`scan`] without requiring a keychain.
|
/// Sync a set of scripts with the blockchain (via an Esplora client) for the data
|
||||||
|
/// specified and return a [`TxGraph`].
|
||||||
///
|
///
|
||||||
/// [`scan`]: EsploraExt::scan
|
/// * `misc_spks`: scripts that we want to sync transactions for
|
||||||
#[allow(clippy::result_large_err)] // FIXME
|
/// * `txids`: transactions for which we want updated [`ConfirmationTimeHeightAnchor`]s
|
||||||
fn scan_without_keychain(
|
/// * `outpoints`: transactions associated with these outpoints (residing, spending) that we
|
||||||
|
/// want to include in the update
|
||||||
|
///
|
||||||
|
/// If the scripts to sync are unknown, such as when restoring or importing a keychain that
|
||||||
|
/// may include scripts that have been used, use [`full_scan`] with the keychain.
|
||||||
|
///
|
||||||
|
/// [`full_scan`]: EsploraExt::full_scan
|
||||||
|
fn sync(
|
||||||
&self,
|
&self,
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
misc_spks: impl IntoIterator<Item = Script>,
|
|
||||||
txids: impl IntoIterator<Item = Txid>,
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
parallel_requests: usize,
|
parallel_requests: usize,
|
||||||
) -> Result<ChainGraph<ConfirmationTime>, Error> {
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error>;
|
||||||
let wallet_scan = self.scan(
|
|
||||||
local_chain,
|
|
||||||
[(
|
|
||||||
(),
|
|
||||||
misc_spks
|
|
||||||
.into_iter()
|
|
||||||
.enumerate()
|
|
||||||
.map(|(i, spk)| (i as u32, spk)),
|
|
||||||
)]
|
|
||||||
.into(),
|
|
||||||
txids,
|
|
||||||
outpoints,
|
|
||||||
usize::MAX,
|
|
||||||
parallel_requests,
|
|
||||||
)?;
|
|
||||||
|
|
||||||
Ok(wallet_scan.update)
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl EsploraExt for esplora_client::BlockingClient {
|
impl EsploraExt for esplora_client::BlockingClient {
|
||||||
fn scan<K: Ord + Clone>(
|
fn update_local_chain(
|
||||||
&self,
|
&self,
|
||||||
local_chain: &BTreeMap<u32, BlockHash>,
|
local_tip: CheckPoint,
|
||||||
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, Script)>>,
|
request_heights: impl IntoIterator<Item = u32>,
|
||||||
txids: impl IntoIterator<Item = Txid>,
|
) -> Result<local_chain::Update, Error> {
|
||||||
outpoints: impl IntoIterator<Item = OutPoint>,
|
// Fetch latest N (server dependent) blocks from Esplora. The server guarantees these are
|
||||||
stop_gap: usize,
|
// consistent.
|
||||||
parallel_requests: usize,
|
let mut fetched_blocks = self
|
||||||
) -> Result<KeychainScan<K, ConfirmationTime>, Error> {
|
.get_blocks(None)?
|
||||||
let parallel_requests = parallel_requests.max(1);
|
.into_iter()
|
||||||
let mut scan = KeychainScan::default();
|
.map(|b| (b.time.height, b.id))
|
||||||
let update = &mut scan.update;
|
.collect::<BTreeMap<u32, BlockHash>>();
|
||||||
let last_active_indices = &mut scan.last_active_indices;
|
let new_tip_height = fetched_blocks
|
||||||
|
.keys()
|
||||||
|
.last()
|
||||||
|
.copied()
|
||||||
|
.expect("must atleast have one block");
|
||||||
|
|
||||||
for (&height, &original_hash) in local_chain.iter().rev() {
|
// Fetch blocks of heights that the caller is interested in, skipping blocks that are
|
||||||
let update_block_id = BlockId {
|
// already fetched when constructing `fetched_blocks`.
|
||||||
height,
|
for height in request_heights {
|
||||||
hash: self.get_block_hash(height)?,
|
// do not fetch blocks higher than remote tip
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// only fetch what is missing
|
||||||
|
if let btree_map::Entry::Vacant(entry) = fetched_blocks.entry(height) {
|
||||||
|
// ❗The return value of `get_block_hash` is not strictly guaranteed to be consistent
|
||||||
|
// with the chain at the time of `get_blocks` above (there could have been a deep
|
||||||
|
// re-org). Since `get_blocks` returns 10 (or so) blocks we are assuming that it's
|
||||||
|
// not possible to have a re-org deeper than that.
|
||||||
|
entry.insert(self.get_block_hash(height)?);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Ensure `fetched_blocks` can create an update that connects with the original chain by
|
||||||
|
// finding a "Point of Agreement".
|
||||||
|
for (height, local_hash) in local_tip.iter().map(|cp| (cp.height(), cp.hash())) {
|
||||||
|
if height > new_tip_height {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
let fetched_hash = match fetched_blocks.entry(height) {
|
||||||
|
btree_map::Entry::Occupied(entry) => *entry.get(),
|
||||||
|
btree_map::Entry::Vacant(entry) => *entry.insert(self.get_block_hash(height)?),
|
||||||
};
|
};
|
||||||
let _ = update
|
|
||||||
.insert_checkpoint(update_block_id)
|
// We have found point of agreement so the update will connect!
|
||||||
.expect("cannot repeat height here");
|
if fetched_hash == local_hash {
|
||||||
if update_block_id.hash == original_hash {
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
let tip_at_start = BlockId {
|
|
||||||
height: self.get_height()?,
|
Ok(local_chain::Update {
|
||||||
hash: self.get_tip_hash()?,
|
tip: CheckPoint::from_block_ids(fetched_blocks.into_iter().map(BlockId::from))
|
||||||
};
|
.expect("must be in height order"),
|
||||||
if let Err(failure) = update.insert_checkpoint(tip_at_start) {
|
introduce_older_blocks: true,
|
||||||
match failure {
|
})
|
||||||
sparse_chain::InsertCheckpointError::HashNotMatching { .. } => {
|
}
|
||||||
// there was a re-org before we started scanning. We haven't consumed any iterators, so calling this function recursively is safe.
|
|
||||||
return EsploraExt::scan(
|
fn full_scan<K: Ord + Clone>(
|
||||||
self,
|
&self,
|
||||||
local_chain,
|
keychain_spks: BTreeMap<K, impl IntoIterator<Item = (u32, ScriptBuf)>>,
|
||||||
keychain_spks,
|
stop_gap: usize,
|
||||||
txids,
|
parallel_requests: usize,
|
||||||
outpoints,
|
) -> Result<(TxGraph<ConfirmationTimeHeightAnchor>, BTreeMap<K, u32>), Error> {
|
||||||
stop_gap,
|
type TxsOfSpkIndex = (u32, Vec<esplora_client::Tx>);
|
||||||
parallel_requests,
|
let parallel_requests = Ord::max(parallel_requests, 1);
|
||||||
);
|
let mut graph = TxGraph::<ConfirmationTimeHeightAnchor>::default();
|
||||||
}
|
let mut last_active_indexes = BTreeMap::<K, u32>::new();
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for (keychain, spks) in keychain_spks {
|
for (keychain, spks) in keychain_spks {
|
||||||
let mut spks = spks.into_iter();
|
let mut spks = spks.into_iter();
|
||||||
let mut last_active_index = None;
|
let mut last_index = Option::<u32>::None;
|
||||||
let mut empty_scripts = 0;
|
let mut last_active_index = Option::<u32>::None;
|
||||||
type IndexWithTxs = (u32, Vec<esplora_client::Tx>);
|
|
||||||
|
|
||||||
loop {
|
loop {
|
||||||
let handles = (0..parallel_requests)
|
let handles = spks
|
||||||
.filter_map(
|
.by_ref()
|
||||||
|_| -> Option<std::thread::JoinHandle<Result<IndexWithTxs, _>>> {
|
.take(parallel_requests)
|
||||||
let (index, script) = spks.next()?;
|
.map(|(spk_index, spk)| {
|
||||||
|
std::thread::spawn({
|
||||||
let client = self.clone();
|
let client = self.clone();
|
||||||
Some(std::thread::spawn(move || {
|
move || -> Result<TxsOfSpkIndex, Error> {
|
||||||
let mut related_txs = client.scripthash_txs(&script, None)?;
|
let mut last_seen = None;
|
||||||
|
let mut spk_txs = Vec::new();
|
||||||
let n_confirmed =
|
loop {
|
||||||
related_txs.iter().filter(|tx| tx.status.confirmed).count();
|
let txs = client.scripthash_txs(&spk, last_seen)?;
|
||||||
// esplora pages on 25 confirmed transactions. If there are 25 or more we
|
let tx_count = txs.len();
|
||||||
// keep requesting to see if there's more.
|
last_seen = txs.last().map(|tx| tx.txid);
|
||||||
if n_confirmed >= 25 {
|
spk_txs.extend(txs);
|
||||||
loop {
|
if tx_count < 25 {
|
||||||
let new_related_txs = client.scripthash_txs(
|
break Ok((spk_index, spk_txs));
|
||||||
&script,
|
|
||||||
Some(related_txs.last().unwrap().txid),
|
|
||||||
)?;
|
|
||||||
let n = new_related_txs.len();
|
|
||||||
related_txs.extend(new_related_txs);
|
|
||||||
// we've reached the end
|
|
||||||
if n < 25 {
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
})
|
||||||
|
})
|
||||||
|
.collect::<Vec<JoinHandle<Result<TxsOfSpkIndex, Error>>>>();
|
||||||
|
|
||||||
Result::<_, esplora_client::Error>::Ok((index, related_txs))
|
if handles.is_empty() {
|
||||||
}))
|
break;
|
||||||
},
|
}
|
||||||
)
|
|
||||||
.collect::<Vec<_>>();
|
|
||||||
|
|
||||||
let n_handles = handles.len();
|
|
||||||
|
|
||||||
for handle in handles {
|
for handle in handles {
|
||||||
let (index, related_txs) = handle.join().unwrap()?; // TODO: don't unwrap
|
let (index, txs) = handle.join().expect("thread must not panic")?;
|
||||||
if related_txs.is_empty() {
|
last_index = Some(index);
|
||||||
empty_scripts += 1;
|
if !txs.is_empty() {
|
||||||
} else {
|
|
||||||
last_active_index = Some(index);
|
last_active_index = Some(index);
|
||||||
empty_scripts = 0;
|
|
||||||
}
|
}
|
||||||
for tx in related_txs {
|
for tx in txs {
|
||||||
let confirmation_time =
|
let _ = graph.insert_tx(tx.to_tx());
|
||||||
map_confirmation_time(&tx.status, tip_at_start.height);
|
if let Some(anchor) = anchor_from_status(&tx.status) {
|
||||||
|
let _ = graph.insert_anchor(tx.txid, anchor);
|
||||||
|
}
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(tx.to_tx(), confirmation_time) {
|
let previous_outputs = tx.vin.iter().filter_map(|vin| {
|
||||||
use bdk_chain::{
|
let prevout = vin.prevout.as_ref()?;
|
||||||
chain_graph::InsertTxError, sparse_chain::InsertTxError::*,
|
Some((
|
||||||
};
|
OutPoint {
|
||||||
match failure {
|
txid: vin.txid,
|
||||||
InsertTxError::Chain(TxTooHigh { .. }) => {
|
vout: vin.vout,
|
||||||
unreachable!("chain position already checked earlier")
|
},
|
||||||
}
|
TxOut {
|
||||||
InsertTxError::Chain(TxMovedUnexpectedly { .. })
|
script_pubkey: prevout.scriptpubkey.clone(),
|
||||||
| InsertTxError::UnresolvableConflict(_) => {
|
value: prevout.value,
|
||||||
/* implies reorg during a scan. We deal with that below */
|
},
|
||||||
}
|
))
|
||||||
}
|
});
|
||||||
|
|
||||||
|
for (outpoint, txout) in previous_outputs {
|
||||||
|
let _ = graph.insert_txout(outpoint, txout);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if n_handles == 0 || empty_scripts >= stop_gap {
|
let last_index = last_index.expect("Must be set since handles wasn't empty.");
|
||||||
|
let past_gap_limit = if let Some(i) = last_active_index {
|
||||||
|
last_index > i.saturating_add(stop_gap as u32)
|
||||||
|
} else {
|
||||||
|
last_index >= stop_gap as u32
|
||||||
|
};
|
||||||
|
if past_gap_limit {
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
if let Some(last_active_index) = last_active_index {
|
if let Some(last_active_index) = last_active_index {
|
||||||
last_active_indices.insert(keychain, last_active_index);
|
last_active_indexes.insert(keychain, last_active_index);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
for txid in txids.into_iter() {
|
Ok((graph, last_active_indexes))
|
||||||
let (tx, tx_status) = match (self.get_tx(&txid)?, self.get_tx_status(&txid)?) {
|
}
|
||||||
(Some(tx), Some(tx_status)) => (tx, tx_status),
|
|
||||||
_ => continue,
|
|
||||||
};
|
|
||||||
|
|
||||||
let confirmation_time = map_confirmation_time(&tx_status, tip_at_start.height);
|
fn sync(
|
||||||
|
&self,
|
||||||
if let Err(failure) = update.insert_tx(tx, confirmation_time) {
|
misc_spks: impl IntoIterator<Item = ScriptBuf>,
|
||||||
use bdk_chain::{chain_graph::InsertTxError, sparse_chain::InsertTxError::*};
|
txids: impl IntoIterator<Item = Txid>,
|
||||||
match failure {
|
outpoints: impl IntoIterator<Item = OutPoint>,
|
||||||
InsertTxError::Chain(TxTooHigh { .. }) => {
|
parallel_requests: usize,
|
||||||
unreachable!("chain position already checked earlier")
|
) -> Result<TxGraph<ConfirmationTimeHeightAnchor>, Error> {
|
||||||
}
|
let mut graph = self
|
||||||
InsertTxError::Chain(TxMovedUnexpectedly { .. })
|
.full_scan(
|
||||||
| InsertTxError::UnresolvableConflict(_) => {
|
[(
|
||||||
/* implies reorg during a scan. We deal with that below */
|
(),
|
||||||
}
|
misc_spks
|
||||||
}
|
.into_iter()
|
||||||
}
|
.enumerate()
|
||||||
}
|
.map(|(i, spk)| (i as u32, spk)),
|
||||||
|
)]
|
||||||
for op in outpoints.into_iter() {
|
.into(),
|
||||||
let mut op_txs = Vec::with_capacity(2);
|
usize::MAX,
|
||||||
if let (Some(tx), Some(tx_status)) =
|
|
||||||
(self.get_tx(&op.txid)?, self.get_tx_status(&op.txid)?)
|
|
||||||
{
|
|
||||||
op_txs.push((tx, tx_status));
|
|
||||||
if let Some(OutputStatus {
|
|
||||||
txid: Some(txid),
|
|
||||||
status: Some(spend_status),
|
|
||||||
..
|
|
||||||
}) = self.get_output_status(&op.txid, op.vout as _)?
|
|
||||||
{
|
|
||||||
if let Some(spend_tx) = self.get_tx(&txid)? {
|
|
||||||
op_txs.push((spend_tx, spend_status));
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
for (tx, status) in op_txs {
|
|
||||||
let confirmation_time = map_confirmation_time(&status, tip_at_start.height);
|
|
||||||
|
|
||||||
if let Err(failure) = update.insert_tx(tx, confirmation_time) {
|
|
||||||
use bdk_chain::{chain_graph::InsertTxError, sparse_chain::InsertTxError::*};
|
|
||||||
match failure {
|
|
||||||
InsertTxError::Chain(TxTooHigh { .. }) => {
|
|
||||||
unreachable!("chain position already checked earlier")
|
|
||||||
}
|
|
||||||
InsertTxError::Chain(TxMovedUnexpectedly { .. })
|
|
||||||
| InsertTxError::UnresolvableConflict(_) => {
|
|
||||||
/* implies reorg during a scan. We deal with that below */
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
let reorg_occurred = {
|
|
||||||
if let Some(checkpoint) = update.chain().latest_checkpoint() {
|
|
||||||
self.get_block_hash(checkpoint.height)? != checkpoint.hash
|
|
||||||
} else {
|
|
||||||
false
|
|
||||||
}
|
|
||||||
};
|
|
||||||
|
|
||||||
if reorg_occurred {
|
|
||||||
// A reorg occurred, so let's find out where all the txids we found are now in the chain.
|
|
||||||
// XXX: collect required because of weird type naming issues
|
|
||||||
let txids_found = update
|
|
||||||
.chain()
|
|
||||||
.txids()
|
|
||||||
.map(|(_, txid)| *txid)
|
|
||||||
.collect::<Vec<_>>();
|
|
||||||
scan.update = EsploraExt::scan_without_keychain(
|
|
||||||
self,
|
|
||||||
local_chain,
|
|
||||||
[],
|
|
||||||
txids_found,
|
|
||||||
[],
|
|
||||||
parallel_requests,
|
parallel_requests,
|
||||||
)?;
|
)
|
||||||
|
.map(|(g, _)| g)?;
|
||||||
|
|
||||||
|
let mut txids = txids.into_iter();
|
||||||
|
loop {
|
||||||
|
let handles = txids
|
||||||
|
.by_ref()
|
||||||
|
.take(parallel_requests)
|
||||||
|
.filter(|&txid| graph.get_tx(txid).is_none())
|
||||||
|
.map(|txid| {
|
||||||
|
std::thread::spawn({
|
||||||
|
let client = self.clone();
|
||||||
|
move || {
|
||||||
|
client
|
||||||
|
.get_tx_status(&txid)
|
||||||
|
.map_err(Box::new)
|
||||||
|
.map(|s| (txid, s))
|
||||||
|
}
|
||||||
|
})
|
||||||
|
})
|
||||||
|
.collect::<Vec<JoinHandle<Result<(Txid, TxStatus), Error>>>>();
|
||||||
|
|
||||||
|
if handles.is_empty() {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
for handle in handles {
|
||||||
|
let (txid, status) = handle.join().expect("thread must not panic")?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(scan)
|
for op in outpoints {
|
||||||
|
if graph.get_tx(op.txid).is_none() {
|
||||||
|
if let Some(tx) = self.get_tx(&op.txid)? {
|
||||||
|
let _ = graph.insert_tx(tx);
|
||||||
|
}
|
||||||
|
let status = self.get_tx_status(&op.txid)?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(op.txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(op_status) = self.get_output_status(&op.txid, op.vout as _)? {
|
||||||
|
if let Some(txid) = op_status.txid {
|
||||||
|
if graph.get_tx(txid).is_none() {
|
||||||
|
if let Some(tx) = self.get_tx(&txid)? {
|
||||||
|
let _ = graph.insert_tx(tx);
|
||||||
|
}
|
||||||
|
let status = self.get_tx_status(&txid)?;
|
||||||
|
if let Some(anchor) = anchor_from_status(&status) {
|
||||||
|
let _ = graph.insert_anchor(txid, anchor);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(graph)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,22 @@
|
|||||||
#![doc = include_str!("../README.md")]
|
#![doc = include_str!("../README.md")]
|
||||||
use bdk_chain::ConfirmationTime;
|
|
||||||
|
//! This crate is used for updating structures of [`bdk_chain`] with data from an Esplora server.
|
||||||
|
//!
|
||||||
|
//! The two primary methods are [`EsploraExt::sync`] and [`EsploraExt::full_scan`]. In most cases
|
||||||
|
//! [`EsploraExt::sync`] is used to sync the transaction histories of scripts that the application
|
||||||
|
//! cares about, for example the scripts for all the receive addresses of a Wallet's keychain that it
|
||||||
|
//! has shown a user. [`EsploraExt::full_scan`] is meant to be used when importing or restoring a
|
||||||
|
//! keychain where the range of possibly used scripts is not known. In this case it is necessary to
|
||||||
|
//! scan all keychain scripts until a number (the "stop gap") of unused scripts is discovered. For a
|
||||||
|
//! sync or full scan the user receives relevant blockchain data and output updates for [`bdk_chain`]
|
||||||
|
//! via a new [`TxGraph`] to be appended to any existing [`TxGraph`] data.
|
||||||
|
//!
|
||||||
|
//! Refer to [`example_esplora`] for a complete example.
|
||||||
|
//!
|
||||||
|
//! [`TxGraph`]: bdk_chain::tx_graph::TxGraph
|
||||||
|
//! [`example_esplora`]: https://github.com/bitcoindevkit/bdk/tree/master/example-crates/example_esplora
|
||||||
|
|
||||||
|
use bdk_chain::{BlockId, ConfirmationTimeHeightAnchor};
|
||||||
use esplora_client::TxStatus;
|
use esplora_client::TxStatus;
|
||||||
|
|
||||||
pub use esplora_client;
|
pub use esplora_client;
|
||||||
@@ -14,14 +31,20 @@ mod async_ext;
|
|||||||
#[cfg(feature = "async")]
|
#[cfg(feature = "async")]
|
||||||
pub use async_ext::*;
|
pub use async_ext::*;
|
||||||
|
|
||||||
pub(crate) fn map_confirmation_time(
|
fn anchor_from_status(status: &TxStatus) -> Option<ConfirmationTimeHeightAnchor> {
|
||||||
tx_status: &TxStatus,
|
if let TxStatus {
|
||||||
height_at_start: u32,
|
block_height: Some(height),
|
||||||
) -> ConfirmationTime {
|
block_hash: Some(hash),
|
||||||
match (tx_status.block_time, tx_status.block_height) {
|
block_time: Some(time),
|
||||||
(Some(time), Some(height)) if height <= height_at_start => {
|
..
|
||||||
ConfirmationTime::Confirmed { height, time }
|
} = status.clone()
|
||||||
}
|
{
|
||||||
_ => ConfirmationTime::Unconfirmed,
|
Some(ConfirmationTimeHeightAnchor {
|
||||||
|
anchor_block: BlockId { height, hash },
|
||||||
|
confirmation_height: height,
|
||||||
|
confirmation_time: time,
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
None
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
228
crates/esplora/tests/async_ext.rs
Normal file
228
crates/esplora/tests/async_ext.rs
Normal file
@@ -0,0 +1,228 @@
|
|||||||
|
use bdk_esplora::EsploraAsyncExt;
|
||||||
|
use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||||
|
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||||
|
use electrsd::{Conf, ElectrsD};
|
||||||
|
use esplora_client::{self, AsyncClient, Builder};
|
||||||
|
use std::collections::{BTreeMap, HashSet};
|
||||||
|
use std::str::FromStr;
|
||||||
|
use std::thread::sleep;
|
||||||
|
use std::time::Duration;
|
||||||
|
|
||||||
|
use bdk_chain::bitcoin::{Address, Amount, BlockHash, Txid};
|
||||||
|
|
||||||
|
struct TestEnv {
|
||||||
|
bitcoind: BitcoinD,
|
||||||
|
#[allow(dead_code)]
|
||||||
|
electrsd: ElectrsD,
|
||||||
|
client: AsyncClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestEnv {
|
||||||
|
fn new() -> Result<Self, anyhow::Error> {
|
||||||
|
let bitcoind_exe =
|
||||||
|
bitcoind::downloaded_exe_path().expect("bitcoind version feature must be enabled");
|
||||||
|
let bitcoind = BitcoinD::new(bitcoind_exe).unwrap();
|
||||||
|
|
||||||
|
let mut electrs_conf = Conf::default();
|
||||||
|
electrs_conf.http_enabled = true;
|
||||||
|
let electrs_exe =
|
||||||
|
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||||
|
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &electrs_conf)?;
|
||||||
|
|
||||||
|
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||||
|
let client = Builder::new(base_url.as_str()).build_async()?;
|
||||||
|
|
||||||
|
Ok(Self {
|
||||||
|
bitcoind,
|
||||||
|
electrsd,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_blocks(
|
||||||
|
&self,
|
||||||
|
count: usize,
|
||||||
|
address: Option<Address>,
|
||||||
|
) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let coinbase_address = match address {
|
||||||
|
Some(address) => address,
|
||||||
|
None => self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)?
|
||||||
|
.assume_checked(),
|
||||||
|
};
|
||||||
|
let block_hashes = self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.generate_to_address(count as _, &coinbase_address)?;
|
||||||
|
Ok(block_hashes)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[tokio::test]
|
||||||
|
pub async fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let receive_address0 =
|
||||||
|
Address::from_str("bcrt1qc6fweuf4xjvz4x3gx3t9e0fh4hvqyu2qw4wvxm")?.assume_checked();
|
||||||
|
let receive_address1 =
|
||||||
|
Address::from_str("bcrt1qfjg5lv3dvc9az8patec8fjddrs4aqtauadnagr")?.assume_checked();
|
||||||
|
|
||||||
|
let misc_spks = [
|
||||||
|
receive_address0.script_pubkey(),
|
||||||
|
receive_address1.script_pubkey(),
|
||||||
|
];
|
||||||
|
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
let txid1 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address1,
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let txid2 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address0,
|
||||||
|
Amount::from_sat(20000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().await.unwrap() < 102 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph_update = env
|
||||||
|
.client
|
||||||
|
.sync(
|
||||||
|
misc_spks.into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
1,
|
||||||
|
)
|
||||||
|
.await?;
|
||||||
|
|
||||||
|
// Check to see if we have the floating txouts available from our two created transactions'
|
||||||
|
// previous outputs in order to calculate transaction fees.
|
||||||
|
for tx in graph_update.full_txs() {
|
||||||
|
// Retrieve the calculated fee from `TxGraph`, which will panic if we do not have the
|
||||||
|
// floating txouts available from the transactions' previous outputs.
|
||||||
|
let fee = graph_update.calculate_fee(tx.tx).expect("Fee must exist");
|
||||||
|
|
||||||
|
// Retrieve the fee in the transaction data from `bitcoind`.
|
||||||
|
let tx_fee = env
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.get_transaction(&tx.txid, None)
|
||||||
|
.expect("Tx must exist")
|
||||||
|
.fee
|
||||||
|
.expect("Fee must exist")
|
||||||
|
.abs()
|
||||||
|
.to_sat() as u64;
|
||||||
|
|
||||||
|
// Check that the calculated fee matches the fee from the transaction data.
|
||||||
|
assert_eq!(fee, tx_fee);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut graph_update_txids: Vec<Txid> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
graph_update_txids.sort();
|
||||||
|
let mut expected_txids = vec![txid1, txid2];
|
||||||
|
expected_txids.sort();
|
||||||
|
assert_eq!(graph_update_txids, expected_txids);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Test the bounds of the address scan depending on the gap limit.
|
||||||
|
#[tokio::test]
|
||||||
|
pub async fn test_async_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
|
||||||
|
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||||
|
let addresses = [
|
||||||
|
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||||
|
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||||
|
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||||
|
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||||
|
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||||
|
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||||
|
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||||
|
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||||
|
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||||
|
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||||
|
];
|
||||||
|
let addresses: Vec<_> = addresses
|
||||||
|
.into_iter()
|
||||||
|
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||||
|
.collect();
|
||||||
|
let spks: Vec<_> = addresses
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||||
|
.collect();
|
||||||
|
let mut keychains = BTreeMap::new();
|
||||||
|
keychains.insert(0, spks);
|
||||||
|
|
||||||
|
// Then receive coins on the 4th address.
|
||||||
|
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[3],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().await.unwrap() < 103 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||||
|
// will.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 2, 1).await?;
|
||||||
|
assert!(graph_update.full_txs().next().is_none());
|
||||||
|
assert!(active_indices.is_empty());
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 3, 1).await?;
|
||||||
|
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
|
||||||
|
// Now receive a coin on the last address.
|
||||||
|
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[addresses.len() - 1],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().await.unwrap() < 104 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||||
|
// The last active indice won't be updated in the first case but will in the second one.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 4, 1).await?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 1);
|
||||||
|
assert!(txs.contains(&txid_4th_addr));
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains, 5, 1).await?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 2);
|
||||||
|
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||||
|
assert_eq!(active_indices[&0], 9);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
433
crates/esplora/tests/blocking_ext.rs
Normal file
433
crates/esplora/tests/blocking_ext.rs
Normal file
@@ -0,0 +1,433 @@
|
|||||||
|
use bdk_chain::local_chain::LocalChain;
|
||||||
|
use bdk_chain::BlockId;
|
||||||
|
use bdk_esplora::EsploraExt;
|
||||||
|
use electrsd::bitcoind::bitcoincore_rpc::RpcApi;
|
||||||
|
use electrsd::bitcoind::{self, anyhow, BitcoinD};
|
||||||
|
use electrsd::{Conf, ElectrsD};
|
||||||
|
use esplora_client::{self, BlockingClient, Builder};
|
||||||
|
use std::collections::{BTreeMap, BTreeSet, HashSet};
|
||||||
|
use std::str::FromStr;
|
||||||
|
use std::thread::sleep;
|
||||||
|
use std::time::Duration;
|
||||||
|
|
||||||
|
use bdk_chain::bitcoin::{Address, Amount, BlockHash, Txid};
|
||||||
|
|
||||||
|
macro_rules! h {
|
||||||
|
($index:literal) => {{
|
||||||
|
bdk_chain::bitcoin::hashes::Hash::hash($index.as_bytes())
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
macro_rules! local_chain {
|
||||||
|
[ $(($height:expr, $block_hash:expr)), * ] => {{
|
||||||
|
#[allow(unused_mut)]
|
||||||
|
bdk_chain::local_chain::LocalChain::from_blocks([$(($height, $block_hash).into()),*].into_iter().collect())
|
||||||
|
.expect("chain must have genesis block")
|
||||||
|
}};
|
||||||
|
}
|
||||||
|
|
||||||
|
struct TestEnv {
|
||||||
|
bitcoind: BitcoinD,
|
||||||
|
#[allow(dead_code)]
|
||||||
|
electrsd: ElectrsD,
|
||||||
|
client: BlockingClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TestEnv {
|
||||||
|
fn new() -> Result<Self, anyhow::Error> {
|
||||||
|
let bitcoind_exe =
|
||||||
|
bitcoind::downloaded_exe_path().expect("bitcoind version feature must be enabled");
|
||||||
|
let bitcoind = BitcoinD::new(bitcoind_exe).unwrap();
|
||||||
|
|
||||||
|
let mut electrs_conf = Conf::default();
|
||||||
|
electrs_conf.http_enabled = true;
|
||||||
|
let electrs_exe =
|
||||||
|
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||||
|
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &electrs_conf)?;
|
||||||
|
|
||||||
|
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||||
|
let client = Builder::new(base_url.as_str()).build_blocking()?;
|
||||||
|
|
||||||
|
Ok(Self {
|
||||||
|
bitcoind,
|
||||||
|
electrsd,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
fn reset_electrsd(mut self) -> anyhow::Result<Self> {
|
||||||
|
let mut electrs_conf = Conf::default();
|
||||||
|
electrs_conf.http_enabled = true;
|
||||||
|
let electrs_exe =
|
||||||
|
electrsd::downloaded_exe_path().expect("electrs version feature must be enabled");
|
||||||
|
let electrsd = ElectrsD::with_conf(electrs_exe, &self.bitcoind, &electrs_conf)?;
|
||||||
|
|
||||||
|
let base_url = format!("http://{}", &electrsd.esplora_url.clone().unwrap());
|
||||||
|
let client = Builder::new(base_url.as_str()).build_blocking()?;
|
||||||
|
self.electrsd = electrsd;
|
||||||
|
self.client = client;
|
||||||
|
Ok(self)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn mine_blocks(
|
||||||
|
&self,
|
||||||
|
count: usize,
|
||||||
|
address: Option<Address>,
|
||||||
|
) -> anyhow::Result<Vec<BlockHash>> {
|
||||||
|
let coinbase_address = match address {
|
||||||
|
Some(address) => address,
|
||||||
|
None => self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)?
|
||||||
|
.assume_checked(),
|
||||||
|
};
|
||||||
|
let block_hashes = self
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.generate_to_address(count as _, &coinbase_address)?;
|
||||||
|
Ok(block_hashes)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
pub fn test_update_tx_graph_without_keychain() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let receive_address0 =
|
||||||
|
Address::from_str("bcrt1qc6fweuf4xjvz4x3gx3t9e0fh4hvqyu2qw4wvxm")?.assume_checked();
|
||||||
|
let receive_address1 =
|
||||||
|
Address::from_str("bcrt1qfjg5lv3dvc9az8patec8fjddrs4aqtauadnagr")?.assume_checked();
|
||||||
|
|
||||||
|
let misc_spks = [
|
||||||
|
receive_address0.script_pubkey(),
|
||||||
|
receive_address1.script_pubkey(),
|
||||||
|
];
|
||||||
|
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
let txid1 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address1,
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let txid2 = env.bitcoind.client.send_to_address(
|
||||||
|
&receive_address0,
|
||||||
|
Amount::from_sat(20000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().unwrap() < 102 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
let graph_update = env.client.sync(
|
||||||
|
misc_spks.into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
vec![].into_iter(),
|
||||||
|
1,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
// Check to see if we have the floating txouts available from our two created transactions'
|
||||||
|
// previous outputs in order to calculate transaction fees.
|
||||||
|
for tx in graph_update.full_txs() {
|
||||||
|
// Retrieve the calculated fee from `TxGraph`, which will panic if we do not have the
|
||||||
|
// floating txouts available from the transactions' previous outputs.
|
||||||
|
let fee = graph_update.calculate_fee(tx.tx).expect("Fee must exist");
|
||||||
|
|
||||||
|
// Retrieve the fee in the transaction data from `bitcoind`.
|
||||||
|
let tx_fee = env
|
||||||
|
.bitcoind
|
||||||
|
.client
|
||||||
|
.get_transaction(&tx.txid, None)
|
||||||
|
.expect("Tx must exist")
|
||||||
|
.fee
|
||||||
|
.expect("Fee must exist")
|
||||||
|
.abs()
|
||||||
|
.to_sat() as u64;
|
||||||
|
|
||||||
|
// Check that the calculated fee matches the fee from the transaction data.
|
||||||
|
assert_eq!(fee, tx_fee);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut graph_update_txids: Vec<Txid> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
graph_update_txids.sort();
|
||||||
|
let mut expected_txids = vec![txid1, txid2];
|
||||||
|
expected_txids.sort();
|
||||||
|
assert_eq!(graph_update_txids, expected_txids);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Test the bounds of the address scan depending on the gap limit.
|
||||||
|
#[test]
|
||||||
|
pub fn test_update_tx_graph_gap_limit() -> anyhow::Result<()> {
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let _block_hashes = env.mine_blocks(101, None)?;
|
||||||
|
|
||||||
|
// Now let's test the gap limit. First of all get a chain of 10 addresses.
|
||||||
|
let addresses = [
|
||||||
|
"bcrt1qj9f7r8r3p2y0sqf4r3r62qysmkuh0fzep473d2ar7rcz64wqvhssjgf0z4",
|
||||||
|
"bcrt1qmm5t0ch7vh2hryx9ctq3mswexcugqe4atkpkl2tetm8merqkthas3w7q30",
|
||||||
|
"bcrt1qut9p7ej7l7lhyvekj28xknn8gnugtym4d5qvnp5shrsr4nksmfqsmyn87g",
|
||||||
|
"bcrt1qqz0xtn3m235p2k96f5wa2dqukg6shxn9n3txe8arlrhjh5p744hsd957ww",
|
||||||
|
"bcrt1q9c0t62a8l6wfytmf2t9lfj35avadk3mm8g4p3l84tp6rl66m48sqrme7wu",
|
||||||
|
"bcrt1qkmh8yrk2v47cklt8dytk8f3ammcwa4q7dzattedzfhqzvfwwgyzsg59zrh",
|
||||||
|
"bcrt1qvgrsrzy07gjkkfr5luplt0azxtfwmwq5t62gum5jr7zwcvep2acs8hhnp2",
|
||||||
|
"bcrt1qw57edarcg50ansq8mk3guyrk78rk0fwvrds5xvqeupteu848zayq549av8",
|
||||||
|
"bcrt1qvtve5ekf6e5kzs68knvnt2phfw6a0yjqrlgat392m6zt9jsvyxhqfx67ef",
|
||||||
|
"bcrt1qw03ddumfs9z0kcu76ln7jrjfdwam20qtffmkcral3qtza90sp9kqm787uk",
|
||||||
|
];
|
||||||
|
let addresses: Vec<_> = addresses
|
||||||
|
.into_iter()
|
||||||
|
.map(|s| Address::from_str(s).unwrap().assume_checked())
|
||||||
|
.collect();
|
||||||
|
let spks: Vec<_> = addresses
|
||||||
|
.iter()
|
||||||
|
.enumerate()
|
||||||
|
.map(|(i, addr)| (i as u32, addr.script_pubkey()))
|
||||||
|
.collect();
|
||||||
|
let mut keychains = BTreeMap::new();
|
||||||
|
keychains.insert(0, spks);
|
||||||
|
|
||||||
|
// Then receive coins on the 4th address.
|
||||||
|
let txid_4th_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[3],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().unwrap() < 103 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with a gap limit of 2 won't find the transaction, but a scan with a gap limit of 3
|
||||||
|
// will.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 2, 1)?;
|
||||||
|
assert!(graph_update.full_txs().next().is_none());
|
||||||
|
assert!(active_indices.is_empty());
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 3, 1)?;
|
||||||
|
assert_eq!(graph_update.full_txs().next().unwrap().txid, txid_4th_addr);
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
|
||||||
|
// Now receive a coin on the last address.
|
||||||
|
let txid_last_addr = env.bitcoind.client.send_to_address(
|
||||||
|
&addresses[addresses.len() - 1],
|
||||||
|
Amount::from_sat(10000),
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
Some(1),
|
||||||
|
None,
|
||||||
|
)?;
|
||||||
|
let _block_hashes = env.mine_blocks(1, None)?;
|
||||||
|
while env.client.get_height().unwrap() < 104 {
|
||||||
|
sleep(Duration::from_millis(10))
|
||||||
|
}
|
||||||
|
|
||||||
|
// A scan with gap limit 4 won't find the second transaction, but a scan with gap limit 5 will.
|
||||||
|
// The last active indice won't be updated in the first case but will in the second one.
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains.clone(), 4, 1)?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 1);
|
||||||
|
assert!(txs.contains(&txid_4th_addr));
|
||||||
|
assert_eq!(active_indices[&0], 3);
|
||||||
|
let (graph_update, active_indices) = env.client.full_scan(keychains, 5, 1)?;
|
||||||
|
let txs: HashSet<_> = graph_update.full_txs().map(|tx| tx.txid).collect();
|
||||||
|
assert_eq!(txs.len(), 2);
|
||||||
|
assert!(txs.contains(&txid_4th_addr) && txs.contains(&txid_last_addr));
|
||||||
|
assert_eq!(active_indices[&0], 9);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn update_local_chain() -> anyhow::Result<()> {
|
||||||
|
const TIP_HEIGHT: u32 = 50;
|
||||||
|
|
||||||
|
let env = TestEnv::new()?;
|
||||||
|
let blocks = {
|
||||||
|
let bitcoind_client = &env.bitcoind.client;
|
||||||
|
assert_eq!(bitcoind_client.get_block_count()?, 1);
|
||||||
|
[
|
||||||
|
(0, bitcoind_client.get_block_hash(0)?),
|
||||||
|
(1, bitcoind_client.get_block_hash(1)?),
|
||||||
|
]
|
||||||
|
.into_iter()
|
||||||
|
.chain((2..).zip(env.mine_blocks((TIP_HEIGHT - 1) as usize, None)?))
|
||||||
|
.collect::<BTreeMap<_, _>>()
|
||||||
|
};
|
||||||
|
// so new blocks can be seen by Electrs
|
||||||
|
let env = env.reset_electrsd()?;
|
||||||
|
|
||||||
|
struct TestCase {
|
||||||
|
name: &'static str,
|
||||||
|
chain: LocalChain,
|
||||||
|
request_heights: &'static [u32],
|
||||||
|
exp_update_heights: &'static [u32],
|
||||||
|
}
|
||||||
|
|
||||||
|
let test_cases = [
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_blocks",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (21, blocks[&21])],
|
||||||
|
request_heights: &[22, 25, 28],
|
||||||
|
exp_update_heights: &[21, 22, 25, 28],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_prev_blocks",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (1, blocks[&1]), (5, blocks[&5])],
|
||||||
|
request_heights: &[4],
|
||||||
|
exp_update_heights: &[4, 5],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_prev_blocks_2",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (1, blocks[&1]), (10, blocks[&10])],
|
||||||
|
request_heights: &[4, 6],
|
||||||
|
exp_update_heights: &[4, 6, 10],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_and_prev_blocks",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (7, blocks[&7]), (11, blocks[&11])],
|
||||||
|
request_heights: &[8, 9, 15],
|
||||||
|
exp_update_heights: &[8, 9, 11, 15],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_tip_only",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (5, blocks[&5]), (49, blocks[&49])],
|
||||||
|
request_heights: &[TIP_HEIGHT],
|
||||||
|
exp_update_heights: &[49],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_nothing",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (13, blocks[&13]), (23, blocks[&23])],
|
||||||
|
request_heights: &[],
|
||||||
|
exp_update_heights: &[23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_nothing_during_reorg",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (13, blocks[&13]), (23, h!("23"))],
|
||||||
|
request_heights: &[],
|
||||||
|
exp_update_heights: &[13, 23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_nothing_during_reorg_2",
|
||||||
|
chain: local_chain![
|
||||||
|
(0, blocks[&0]),
|
||||||
|
(21, blocks[&21]),
|
||||||
|
(22, h!("22")),
|
||||||
|
(23, h!("23"))
|
||||||
|
],
|
||||||
|
request_heights: &[],
|
||||||
|
exp_update_heights: &[21, 22, 23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_prev_blocks_during_reorg",
|
||||||
|
chain: local_chain![
|
||||||
|
(0, blocks[&0]),
|
||||||
|
(21, blocks[&21]),
|
||||||
|
(22, h!("22")),
|
||||||
|
(23, h!("23"))
|
||||||
|
],
|
||||||
|
request_heights: &[17, 20],
|
||||||
|
exp_update_heights: &[17, 20, 21, 22, 23],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_blocks_during_reorg",
|
||||||
|
chain: local_chain![
|
||||||
|
(0, blocks[&0]),
|
||||||
|
(9, blocks[&9]),
|
||||||
|
(22, h!("22")),
|
||||||
|
(23, h!("23"))
|
||||||
|
],
|
||||||
|
request_heights: &[25, 27],
|
||||||
|
exp_update_heights: &[9, 22, 23, 25, 27],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_blocks_during_reorg_2",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (9, h!("9"))],
|
||||||
|
request_heights: &[10],
|
||||||
|
exp_update_heights: &[0, 9, 10],
|
||||||
|
},
|
||||||
|
TestCase {
|
||||||
|
name: "request_later_and_prev_blocks_during_reorg",
|
||||||
|
chain: local_chain![(0, blocks[&0]), (1, blocks[&1]), (9, h!("9"))],
|
||||||
|
request_heights: &[8, 11],
|
||||||
|
exp_update_heights: &[1, 8, 9, 11],
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
for (i, t) in test_cases.into_iter().enumerate() {
|
||||||
|
println!("Case {}: {}", i, t.name);
|
||||||
|
let mut chain = t.chain;
|
||||||
|
|
||||||
|
let update = env
|
||||||
|
.client
|
||||||
|
.update_local_chain(chain.tip(), t.request_heights.iter().copied())
|
||||||
|
.map_err(|err| {
|
||||||
|
anyhow::format_err!("[{}:{}] `update_local_chain` failed: {}", i, t.name, err)
|
||||||
|
})?;
|
||||||
|
|
||||||
|
let update_blocks = update
|
||||||
|
.tip
|
||||||
|
.iter()
|
||||||
|
.map(|cp| cp.block_id())
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
let exp_update_blocks = t
|
||||||
|
.exp_update_heights
|
||||||
|
.iter()
|
||||||
|
.map(|&height| {
|
||||||
|
let hash = blocks[&height];
|
||||||
|
BlockId { height, hash }
|
||||||
|
})
|
||||||
|
.chain(
|
||||||
|
// Electrs Esplora `get_block` call fetches 10 blocks which is included in the
|
||||||
|
// update
|
||||||
|
blocks
|
||||||
|
.range(TIP_HEIGHT - 9..)
|
||||||
|
.map(|(&height, &hash)| BlockId { height, hash }),
|
||||||
|
)
|
||||||
|
.collect::<BTreeSet<_>>();
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
update_blocks, exp_update_blocks,
|
||||||
|
"[{}:{}] unexpected update",
|
||||||
|
i, t.name
|
||||||
|
);
|
||||||
|
|
||||||
|
let _ = chain
|
||||||
|
.apply_update(update)
|
||||||
|
.unwrap_or_else(|err| panic!("[{}:{}] update failed to apply: {}", i, t.name, err));
|
||||||
|
|
||||||
|
// all requested heights must exist in the final chain
|
||||||
|
for height in t.request_heights {
|
||||||
|
let exp_blockhash = blocks.get(height).expect("block must exist in bitcoind");
|
||||||
|
assert_eq!(
|
||||||
|
chain.blocks().get(height),
|
||||||
|
Some(exp_blockhash),
|
||||||
|
"[{}:{}] block {}:{} must exist in final chain",
|
||||||
|
i,
|
||||||
|
t.name,
|
||||||
|
height,
|
||||||
|
exp_blockhash
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bdk_file_store"
|
name = "bdk_file_store"
|
||||||
version = "0.1.0"
|
version = "0.7.0"
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
license = "MIT OR Apache-2.0"
|
license = "MIT OR Apache-2.0"
|
||||||
repository = "https://github.com/bitcoindevkit/bdk"
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
@@ -11,7 +11,7 @@ authors = ["Bitcoin Dev Kit Developers"]
|
|||||||
readme = "README.md"
|
readme = "README.md"
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
bdk_chain = { path = "../chain", version = "0.4.0", features = [ "serde", "miniscript" ] }
|
bdk_chain = { path = "../chain", version = "0.11.0", features = [ "serde", "miniscript" ] }
|
||||||
bincode = { version = "1" }
|
bincode = { version = "1" }
|
||||||
serde = { version = "1", features = ["derive"] }
|
serde = { version = "1", features = ["derive"] }
|
||||||
|
|
||||||
|
|||||||
@@ -1,9 +1,9 @@
|
|||||||
# BDK File Store
|
# BDK File Store
|
||||||
|
|
||||||
This is a simple append-only flat file implementation of
|
This is a simple append-only flat file implementation of
|
||||||
[`Persist`](`bdk_chain::keychain::persist::Persist`).
|
[`Persist`](`bdk_chain::Persist`).
|
||||||
|
|
||||||
The main structure is [`KeychainStore`](`crate::KeychainStore`), which can be used with [`bdk`]'s
|
The main structure is [`Store`](`crate::Store`), which can be used with [`bdk`]'s
|
||||||
`Wallet` to persist wallet data into a flat file.
|
`Wallet` to persist wallet data into a flat file.
|
||||||
|
|
||||||
[`bdk`]: https://docs.rs/bdk/latest
|
[`bdk`]: https://docs.rs/bdk/latest
|
||||||
|
|||||||
108
crates/file_store/src/entry_iter.rs
Normal file
108
crates/file_store/src/entry_iter.rs
Normal file
@@ -0,0 +1,108 @@
|
|||||||
|
use bincode::Options;
|
||||||
|
use std::{
|
||||||
|
fs::File,
|
||||||
|
io::{self, BufReader, Seek},
|
||||||
|
marker::PhantomData,
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::bincode_options;
|
||||||
|
|
||||||
|
/// Iterator over entries in a file store.
|
||||||
|
///
|
||||||
|
/// Reads and returns an entry each time [`next`] is called. If an error occurs while reading the
|
||||||
|
/// iterator will yield a `Result::Err(_)` instead and then `None` for the next call to `next`.
|
||||||
|
///
|
||||||
|
/// [`next`]: Self::next
|
||||||
|
pub struct EntryIter<'t, T> {
|
||||||
|
/// Buffered reader around the file
|
||||||
|
db_file: BufReader<&'t mut File>,
|
||||||
|
finished: bool,
|
||||||
|
/// The file position for the first read of `db_file`.
|
||||||
|
start_pos: Option<u64>,
|
||||||
|
types: PhantomData<T>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'t, T> EntryIter<'t, T> {
|
||||||
|
pub fn new(start_pos: u64, db_file: &'t mut File) -> Self {
|
||||||
|
Self {
|
||||||
|
db_file: BufReader::new(db_file),
|
||||||
|
start_pos: Some(start_pos),
|
||||||
|
finished: false,
|
||||||
|
types: PhantomData,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'t, T> Iterator for EntryIter<'t, T>
|
||||||
|
where
|
||||||
|
T: serde::de::DeserializeOwned,
|
||||||
|
{
|
||||||
|
type Item = Result<T, IterError>;
|
||||||
|
|
||||||
|
fn next(&mut self) -> Option<Self::Item> {
|
||||||
|
if self.finished {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
(|| {
|
||||||
|
if let Some(start) = self.start_pos.take() {
|
||||||
|
self.db_file.seek(io::SeekFrom::Start(start))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let pos_before_read = self.db_file.stream_position()?;
|
||||||
|
match bincode_options().deserialize_from(&mut self.db_file) {
|
||||||
|
Ok(changeset) => Ok(Some(changeset)),
|
||||||
|
Err(e) => {
|
||||||
|
self.finished = true;
|
||||||
|
let pos_after_read = self.db_file.stream_position()?;
|
||||||
|
// allow unexpected EOF if 0 bytes were read
|
||||||
|
if let bincode::ErrorKind::Io(inner) = &*e {
|
||||||
|
if inner.kind() == io::ErrorKind::UnexpectedEof
|
||||||
|
&& pos_after_read == pos_before_read
|
||||||
|
{
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
self.db_file.seek(io::SeekFrom::Start(pos_before_read))?;
|
||||||
|
Err(IterError::Bincode(*e))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
})()
|
||||||
|
.transpose()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<'t, T> Drop for EntryIter<'t, T> {
|
||||||
|
fn drop(&mut self) {
|
||||||
|
// This syncs the underlying file's offset with the buffer's position. This way, we
|
||||||
|
// maintain the correct position to start the next read/write.
|
||||||
|
if let Ok(pos) = self.db_file.stream_position() {
|
||||||
|
let _ = self.db_file.get_mut().seek(io::SeekFrom::Start(pos));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Error type for [`EntryIter`].
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub enum IterError {
|
||||||
|
/// Failure to read from the file.
|
||||||
|
Io(io::Error),
|
||||||
|
/// Failure to decode data from the file.
|
||||||
|
Bincode(bincode::ErrorKind),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for IterError {
|
||||||
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
IterError::Io(e) => write!(f, "io error trying to read entry {}", e),
|
||||||
|
IterError::Bincode(e) => write!(f, "bincode error while reading entry {}", e),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<io::Error> for IterError {
|
||||||
|
fn from(value: io::Error) -> Self {
|
||||||
|
IterError::Io(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl std::error::Error for IterError {}
|
||||||
@@ -1,404 +0,0 @@
|
|||||||
//! Module for persisting data on disk.
|
|
||||||
//!
|
|
||||||
//! The star of the show is [`KeychainStore`], which maintains an append-only file of
|
|
||||||
//! [`KeychainChangeSet`]s which can be used to restore a [`KeychainTracker`].
|
|
||||||
use bdk_chain::{
|
|
||||||
keychain::{KeychainChangeSet, KeychainTracker},
|
|
||||||
sparse_chain,
|
|
||||||
};
|
|
||||||
use bincode::{DefaultOptions, Options};
|
|
||||||
use core::marker::PhantomData;
|
|
||||||
use std::{
|
|
||||||
fs::{File, OpenOptions},
|
|
||||||
io::{self, Read, Seek, Write},
|
|
||||||
path::Path,
|
|
||||||
};
|
|
||||||
|
|
||||||
/// BDK File Store magic bytes length.
|
|
||||||
const MAGIC_BYTES_LEN: usize = 12;
|
|
||||||
|
|
||||||
/// BDK File Store magic bytes.
|
|
||||||
const MAGIC_BYTES: [u8; MAGIC_BYTES_LEN] = [98, 100, 107, 102, 115, 48, 48, 48, 48, 48, 48, 48];
|
|
||||||
|
|
||||||
/// Persists an append only list of `KeychainChangeSet<K,P>` to a single file.
|
|
||||||
/// [`KeychainChangeSet<K,P>`] record the changes made to a [`KeychainTracker<K,P>`].
|
|
||||||
#[derive(Debug)]
|
|
||||||
pub struct KeychainStore<K, P> {
|
|
||||||
db_file: File,
|
|
||||||
changeset_type_params: core::marker::PhantomData<(K, P)>,
|
|
||||||
}
|
|
||||||
|
|
||||||
fn bincode() -> impl bincode::Options {
|
|
||||||
DefaultOptions::new().with_varint_encoding()
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<K, P> KeychainStore<K, P>
|
|
||||||
where
|
|
||||||
K: Ord + Clone + core::fmt::Debug,
|
|
||||||
P: sparse_chain::ChainPosition,
|
|
||||||
KeychainChangeSet<K, P>: serde::Serialize + serde::de::DeserializeOwned,
|
|
||||||
{
|
|
||||||
/// Creates a new store from a [`File`].
|
|
||||||
///
|
|
||||||
/// The file must have been opened with read and write permissions.
|
|
||||||
///
|
|
||||||
/// [`File`]: std::fs::File
|
|
||||||
pub fn new(mut file: File) -> Result<Self, FileError> {
|
|
||||||
file.rewind()?;
|
|
||||||
|
|
||||||
let mut magic_bytes = [0_u8; MAGIC_BYTES_LEN];
|
|
||||||
file.read_exact(&mut magic_bytes)?;
|
|
||||||
|
|
||||||
if magic_bytes != MAGIC_BYTES {
|
|
||||||
return Err(FileError::InvalidMagicBytes(magic_bytes));
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(Self {
|
|
||||||
db_file: file,
|
|
||||||
changeset_type_params: Default::default(),
|
|
||||||
})
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Creates or loads a store from `db_path`. If no file exists there, it will be created.
|
|
||||||
pub fn new_from_path<D: AsRef<Path>>(db_path: D) -> Result<Self, FileError> {
|
|
||||||
let already_exists = db_path.as_ref().exists();
|
|
||||||
|
|
||||||
let mut db_file = OpenOptions::new()
|
|
||||||
.read(true)
|
|
||||||
.write(true)
|
|
||||||
.create(true)
|
|
||||||
.open(db_path)?;
|
|
||||||
|
|
||||||
if !already_exists {
|
|
||||||
db_file.write_all(&MAGIC_BYTES)?;
|
|
||||||
}
|
|
||||||
|
|
||||||
Self::new(db_file)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Iterates over the stored changeset from first to last, changing the seek position at each
|
|
||||||
/// iteration.
|
|
||||||
///
|
|
||||||
/// The iterator may fail to read an entry and therefore return an error. However, the first time
|
|
||||||
/// it returns an error will be the last. After doing so, the iterator will always yield `None`.
|
|
||||||
///
|
|
||||||
/// **WARNING**: This method changes the write position in the underlying file. You should
|
|
||||||
/// always iterate over all entries until `None` is returned if you want your next write to go
|
|
||||||
/// at the end; otherwise, you will write over existing entries.
|
|
||||||
pub fn iter_changesets(&mut self) -> Result<EntryIter<'_, KeychainChangeSet<K, P>>, io::Error> {
|
|
||||||
self.db_file
|
|
||||||
.seek(io::SeekFrom::Start(MAGIC_BYTES_LEN as _))?;
|
|
||||||
|
|
||||||
Ok(EntryIter::new(&mut self.db_file))
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Loads all the changesets that have been stored as one giant changeset.
|
|
||||||
///
|
|
||||||
/// This function returns a tuple of the aggregate changeset and a result that indicates
|
|
||||||
/// whether an error occurred while reading or deserializing one of the entries. If so the
|
|
||||||
/// changeset will consist of all of those it was able to read.
|
|
||||||
///
|
|
||||||
/// You should usually check the error. In many applications, it may make sense to do a full
|
|
||||||
/// wallet scan with a stop-gap after getting an error, since it is likely that one of the
|
|
||||||
/// changesets it was unable to read changed the derivation indices of the tracker.
|
|
||||||
///
|
|
||||||
/// **WARNING**: This method changes the write position of the underlying file. The next
|
|
||||||
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
|
||||||
pub fn aggregate_changeset(&mut self) -> (KeychainChangeSet<K, P>, Result<(), IterError>) {
|
|
||||||
let mut changeset = KeychainChangeSet::default();
|
|
||||||
let result = (|| {
|
|
||||||
let iter_changeset = self.iter_changesets()?;
|
|
||||||
for next_changeset in iter_changeset {
|
|
||||||
changeset.append(next_changeset?);
|
|
||||||
}
|
|
||||||
Ok(())
|
|
||||||
})();
|
|
||||||
|
|
||||||
(changeset, result)
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Reads and applies all the changesets stored sequentially to the tracker, stopping when it fails
|
|
||||||
/// to read the next one.
|
|
||||||
///
|
|
||||||
/// **WARNING**: This method changes the write position of the underlying file. The next
|
|
||||||
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
|
||||||
pub fn load_into_keychain_tracker(
|
|
||||||
&mut self,
|
|
||||||
tracker: &mut KeychainTracker<K, P>,
|
|
||||||
) -> Result<(), IterError> {
|
|
||||||
for changeset in self.iter_changesets()? {
|
|
||||||
tracker.apply_changeset(changeset?)
|
|
||||||
}
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Append a new changeset to the file and truncate the file to the end of the appended changeset.
|
|
||||||
///
|
|
||||||
/// The truncation is to avoid the possibility of having a valid but inconsistent changeset
|
|
||||||
/// directly after the appended changeset.
|
|
||||||
pub fn append_changeset(
|
|
||||||
&mut self,
|
|
||||||
changeset: &KeychainChangeSet<K, P>,
|
|
||||||
) -> Result<(), io::Error> {
|
|
||||||
if changeset.is_empty() {
|
|
||||||
return Ok(());
|
|
||||||
}
|
|
||||||
|
|
||||||
bincode()
|
|
||||||
.serialize_into(&mut self.db_file, changeset)
|
|
||||||
.map_err(|e| match *e {
|
|
||||||
bincode::ErrorKind::Io(inner) => inner,
|
|
||||||
unexpected_err => panic!("unexpected bincode error: {}", unexpected_err),
|
|
||||||
})?;
|
|
||||||
|
|
||||||
// truncate file after this changeset addition
|
|
||||||
// if this is not done, data after this changeset may represent valid changesets, however
|
|
||||||
// applying those changesets on top of this one may result in an inconsistent state
|
|
||||||
let pos = self.db_file.stream_position()?;
|
|
||||||
self.db_file.set_len(pos)?;
|
|
||||||
|
|
||||||
// We want to make sure that derivation indices changes are written to disk as soon as
|
|
||||||
// possible, so you know about the write failure before you give out the address in the application.
|
|
||||||
if !changeset.derivation_indices.is_empty() {
|
|
||||||
self.db_file.sync_data()?;
|
|
||||||
}
|
|
||||||
|
|
||||||
Ok(())
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Error that occurs due to problems encountered with the file.
|
|
||||||
#[derive(Debug)]
|
|
||||||
pub enum FileError {
|
|
||||||
/// IO error, this may mean that the file is too short.
|
|
||||||
Io(io::Error),
|
|
||||||
/// Magic bytes do not match what is expected.
|
|
||||||
InvalidMagicBytes([u8; MAGIC_BYTES_LEN]),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl core::fmt::Display for FileError {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
match self {
|
|
||||||
Self::Io(e) => write!(f, "io error trying to read file: {}", e),
|
|
||||||
Self::InvalidMagicBytes(b) => write!(
|
|
||||||
f,
|
|
||||||
"file has invalid magic bytes: expected={:?} got={:?}",
|
|
||||||
MAGIC_BYTES, b
|
|
||||||
),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl From<io::Error> for FileError {
|
|
||||||
fn from(value: io::Error) -> Self {
|
|
||||||
Self::Io(value)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::error::Error for FileError {}
|
|
||||||
|
|
||||||
/// Error type for [`EntryIter`].
|
|
||||||
#[derive(Debug)]
|
|
||||||
pub enum IterError {
|
|
||||||
/// Failure to read from the file.
|
|
||||||
Io(io::Error),
|
|
||||||
/// Failure to decode data from the file.
|
|
||||||
Bincode(bincode::ErrorKind),
|
|
||||||
}
|
|
||||||
|
|
||||||
impl core::fmt::Display for IterError {
|
|
||||||
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
|
||||||
match self {
|
|
||||||
IterError::Io(e) => write!(f, "io error trying to read entry {}", e),
|
|
||||||
IterError::Bincode(e) => write!(f, "bincode error while reading entry {}", e),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl std::error::Error for IterError {}
|
|
||||||
|
|
||||||
/// Iterator over entries in a file store.
|
|
||||||
///
|
|
||||||
/// Reads and returns an entry each time [`next`] is called. If an error occurs while reading the
|
|
||||||
/// iterator will yield a `Result::Err(_)` instead and then `None` for the next call to `next`.
|
|
||||||
///
|
|
||||||
/// [`next`]: Self::next
|
|
||||||
pub struct EntryIter<'a, V> {
|
|
||||||
db_file: &'a mut File,
|
|
||||||
types: PhantomData<V>,
|
|
||||||
error_exit: bool,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'a, V> EntryIter<'a, V> {
|
|
||||||
pub fn new(db_file: &'a mut File) -> Self {
|
|
||||||
Self {
|
|
||||||
db_file,
|
|
||||||
types: PhantomData,
|
|
||||||
error_exit: false,
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'a, V> Iterator for EntryIter<'a, V>
|
|
||||||
where
|
|
||||||
V: serde::de::DeserializeOwned,
|
|
||||||
{
|
|
||||||
type Item = Result<V, IterError>;
|
|
||||||
|
|
||||||
fn next(&mut self) -> Option<Self::Item> {
|
|
||||||
let result = (|| {
|
|
||||||
let pos = self.db_file.stream_position()?;
|
|
||||||
|
|
||||||
match bincode().deserialize_from(&mut self.db_file) {
|
|
||||||
Ok(changeset) => Ok(Some(changeset)),
|
|
||||||
Err(e) => {
|
|
||||||
if let bincode::ErrorKind::Io(inner) = &*e {
|
|
||||||
if inner.kind() == io::ErrorKind::UnexpectedEof {
|
|
||||||
let eof = self.db_file.seek(io::SeekFrom::End(0))?;
|
|
||||||
if pos == eof {
|
|
||||||
return Ok(None);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
self.db_file.seek(io::SeekFrom::Start(pos))?;
|
|
||||||
Err(IterError::Bincode(*e))
|
|
||||||
}
|
|
||||||
}
|
|
||||||
})();
|
|
||||||
|
|
||||||
let result = result.transpose();
|
|
||||||
|
|
||||||
if let Some(Err(_)) = &result {
|
|
||||||
self.error_exit = true;
|
|
||||||
}
|
|
||||||
|
|
||||||
result
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
impl From<io::Error> for IterError {
|
|
||||||
fn from(value: io::Error) -> Self {
|
|
||||||
IterError::Io(value)
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(test)]
|
|
||||||
mod test {
|
|
||||||
use super::*;
|
|
||||||
use bdk_chain::{
|
|
||||||
keychain::{DerivationAdditions, KeychainChangeSet},
|
|
||||||
TxHeight,
|
|
||||||
};
|
|
||||||
use std::{
|
|
||||||
io::{Read, Write},
|
|
||||||
vec::Vec,
|
|
||||||
};
|
|
||||||
use tempfile::NamedTempFile;
|
|
||||||
#[derive(
|
|
||||||
Debug,
|
|
||||||
Clone,
|
|
||||||
Copy,
|
|
||||||
PartialOrd,
|
|
||||||
Ord,
|
|
||||||
PartialEq,
|
|
||||||
Eq,
|
|
||||||
Hash,
|
|
||||||
serde::Serialize,
|
|
||||||
serde::Deserialize,
|
|
||||||
)]
|
|
||||||
enum TestKeychain {
|
|
||||||
External,
|
|
||||||
Internal,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl core::fmt::Display for TestKeychain {
|
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
|
||||||
match self {
|
|
||||||
Self::External => write!(f, "external"),
|
|
||||||
Self::Internal => write!(f, "internal"),
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn magic_bytes() {
|
|
||||||
assert_eq!(&MAGIC_BYTES, "bdkfs0000000".as_bytes());
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn new_fails_if_file_is_too_short() {
|
|
||||||
let mut file = NamedTempFile::new().unwrap();
|
|
||||||
file.write_all(&MAGIC_BYTES[..MAGIC_BYTES_LEN - 1])
|
|
||||||
.expect("should write");
|
|
||||||
|
|
||||||
match KeychainStore::<TestKeychain, TxHeight>::new(file.reopen().unwrap()) {
|
|
||||||
Err(FileError::Io(e)) => assert_eq!(e.kind(), std::io::ErrorKind::UnexpectedEof),
|
|
||||||
unexpected => panic!("unexpected result: {:?}", unexpected),
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn new_fails_if_magic_bytes_are_invalid() {
|
|
||||||
let invalid_magic_bytes = "ldkfs0000000";
|
|
||||||
|
|
||||||
let mut file = NamedTempFile::new().unwrap();
|
|
||||||
file.write_all(invalid_magic_bytes.as_bytes())
|
|
||||||
.expect("should write");
|
|
||||||
|
|
||||||
match KeychainStore::<TestKeychain, TxHeight>::new(file.reopen().unwrap()) {
|
|
||||||
Err(FileError::InvalidMagicBytes(b)) => {
|
|
||||||
assert_eq!(b, invalid_magic_bytes.as_bytes())
|
|
||||||
}
|
|
||||||
unexpected => panic!("unexpected result: {:?}", unexpected),
|
|
||||||
};
|
|
||||||
}
|
|
||||||
|
|
||||||
#[test]
|
|
||||||
fn append_changeset_truncates_invalid_bytes() {
|
|
||||||
// initial data to write to file (magic bytes + invalid data)
|
|
||||||
let mut data = [255_u8; 2000];
|
|
||||||
data[..MAGIC_BYTES_LEN].copy_from_slice(&MAGIC_BYTES);
|
|
||||||
|
|
||||||
let changeset = KeychainChangeSet {
|
|
||||||
derivation_indices: DerivationAdditions(
|
|
||||||
vec![(TestKeychain::External, 42)].into_iter().collect(),
|
|
||||||
),
|
|
||||||
chain_graph: Default::default(),
|
|
||||||
};
|
|
||||||
|
|
||||||
let mut file = NamedTempFile::new().unwrap();
|
|
||||||
file.write_all(&data).expect("should write");
|
|
||||||
|
|
||||||
let mut store = KeychainStore::<TestKeychain, TxHeight>::new(file.reopen().unwrap())
|
|
||||||
.expect("should open");
|
|
||||||
match store.iter_changesets().expect("seek should succeed").next() {
|
|
||||||
Some(Err(IterError::Bincode(_))) => {}
|
|
||||||
unexpected_res => panic!("unexpected result: {:?}", unexpected_res),
|
|
||||||
}
|
|
||||||
|
|
||||||
store.append_changeset(&changeset).expect("should append");
|
|
||||||
|
|
||||||
drop(store);
|
|
||||||
|
|
||||||
let got_bytes = {
|
|
||||||
let mut buf = Vec::new();
|
|
||||||
file.reopen()
|
|
||||||
.unwrap()
|
|
||||||
.read_to_end(&mut buf)
|
|
||||||
.expect("should read");
|
|
||||||
buf
|
|
||||||
};
|
|
||||||
|
|
||||||
let expected_bytes = {
|
|
||||||
let mut buf = MAGIC_BYTES.to_vec();
|
|
||||||
DefaultOptions::new()
|
|
||||||
.with_varint_encoding()
|
|
||||||
.serialize_into(&mut buf, &changeset)
|
|
||||||
.expect("should encode");
|
|
||||||
buf
|
|
||||||
};
|
|
||||||
|
|
||||||
assert_eq!(got_bytes, expected_bytes);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,32 +1,42 @@
|
|||||||
#![doc = include_str!("../README.md")]
|
#![doc = include_str!("../README.md")]
|
||||||
mod file_store;
|
mod entry_iter;
|
||||||
use bdk_chain::{
|
mod store;
|
||||||
keychain::{KeychainChangeSet, KeychainTracker, PersistBackend},
|
use std::io;
|
||||||
sparse_chain::ChainPosition,
|
|
||||||
};
|
|
||||||
pub use file_store::*;
|
|
||||||
|
|
||||||
impl<K, P> PersistBackend<K, P> for KeychainStore<K, P>
|
use bincode::{DefaultOptions, Options};
|
||||||
where
|
pub use entry_iter::*;
|
||||||
K: Ord + Clone + core::fmt::Debug,
|
pub use store::*;
|
||||||
P: ChainPosition,
|
|
||||||
KeychainChangeSet<K, P>: serde::Serialize + serde::de::DeserializeOwned,
|
|
||||||
{
|
|
||||||
type WriteError = std::io::Error;
|
|
||||||
|
|
||||||
type LoadError = IterError;
|
pub(crate) fn bincode_options() -> impl bincode::Options {
|
||||||
|
DefaultOptions::new().with_varint_encoding()
|
||||||
|
}
|
||||||
|
|
||||||
fn append_changeset(
|
/// Error that occurs due to problems encountered with the file.
|
||||||
&mut self,
|
#[derive(Debug)]
|
||||||
changeset: &KeychainChangeSet<K, P>,
|
pub enum FileError {
|
||||||
) -> Result<(), Self::WriteError> {
|
/// IO error, this may mean that the file is too short.
|
||||||
KeychainStore::append_changeset(self, changeset)
|
Io(io::Error),
|
||||||
}
|
/// Magic bytes do not match what is expected.
|
||||||
|
InvalidMagicBytes { got: Vec<u8>, expected: Vec<u8> },
|
||||||
|
}
|
||||||
|
|
||||||
fn load_into_keychain_tracker(
|
impl core::fmt::Display for FileError {
|
||||||
&mut self,
|
fn fmt(&self, f: &mut core::fmt::Formatter<'_>) -> core::fmt::Result {
|
||||||
tracker: &mut KeychainTracker<K, P>,
|
match self {
|
||||||
) -> Result<(), Self::LoadError> {
|
Self::Io(e) => write!(f, "io error trying to read file: {}", e),
|
||||||
KeychainStore::load_into_keychain_tracker(self, tracker)
|
Self::InvalidMagicBytes { got, expected } => write!(
|
||||||
|
f,
|
||||||
|
"file has invalid magic bytes: expected={:?} got={:?}",
|
||||||
|
expected, got,
|
||||||
|
),
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl From<io::Error> for FileError {
|
||||||
|
fn from(value: io::Error) -> Self {
|
||||||
|
Self::Io(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl std::error::Error for FileError {}
|
||||||
|
|||||||
459
crates/file_store/src/store.rs
Normal file
459
crates/file_store/src/store.rs
Normal file
@@ -0,0 +1,459 @@
|
|||||||
|
use std::{
|
||||||
|
fmt::Debug,
|
||||||
|
fs::{File, OpenOptions},
|
||||||
|
io::{self, Read, Seek, Write},
|
||||||
|
marker::PhantomData,
|
||||||
|
path::Path,
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_chain::{Append, PersistBackend};
|
||||||
|
use bincode::Options;
|
||||||
|
|
||||||
|
use crate::{bincode_options, EntryIter, FileError, IterError};
|
||||||
|
|
||||||
|
/// Persists an append-only list of changesets (`C`) to a single file.
|
||||||
|
///
|
||||||
|
/// The changesets are the results of altering a tracker implementation (`T`).
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct Store<C> {
|
||||||
|
magic_len: usize,
|
||||||
|
db_file: File,
|
||||||
|
marker: PhantomData<C>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> PersistBackend<C> for Store<C>
|
||||||
|
where
|
||||||
|
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||||
|
{
|
||||||
|
type WriteError = std::io::Error;
|
||||||
|
|
||||||
|
type LoadError = IterError;
|
||||||
|
|
||||||
|
fn write_changes(&mut self, changeset: &C) -> Result<(), Self::WriteError> {
|
||||||
|
self.append_changeset(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn load_from_persistence(&mut self) -> Result<Option<C>, Self::LoadError> {
|
||||||
|
self.aggregate_changesets().map_err(|e| e.iter_error)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> Store<C>
|
||||||
|
where
|
||||||
|
C: Append + serde::Serialize + serde::de::DeserializeOwned,
|
||||||
|
{
|
||||||
|
/// Create a new [`Store`] file in write-only mode; error if the file exists.
|
||||||
|
///
|
||||||
|
/// `magic` is the prefixed bytes to write to the new file. This will be checked when opening
|
||||||
|
/// the `Store` in the future with [`open`].
|
||||||
|
///
|
||||||
|
/// [`open`]: Store::open
|
||||||
|
pub fn create_new<P>(magic: &[u8], file_path: P) -> Result<Self, FileError>
|
||||||
|
where
|
||||||
|
P: AsRef<Path>,
|
||||||
|
{
|
||||||
|
if file_path.as_ref().exists() {
|
||||||
|
// `io::Error` is used instead of a variant on `FileError` because there is already a
|
||||||
|
// nightly-only `File::create_new` method
|
||||||
|
return Err(FileError::Io(io::Error::new(
|
||||||
|
io::ErrorKind::Other,
|
||||||
|
"file already exists",
|
||||||
|
)));
|
||||||
|
}
|
||||||
|
let mut f = OpenOptions::new()
|
||||||
|
.create(true)
|
||||||
|
.read(true)
|
||||||
|
.write(true)
|
||||||
|
.open(file_path)?;
|
||||||
|
f.write_all(magic)?;
|
||||||
|
Ok(Self {
|
||||||
|
magic_len: magic.len(),
|
||||||
|
db_file: f,
|
||||||
|
marker: Default::default(),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Open an existing [`Store`].
|
||||||
|
///
|
||||||
|
/// Use [`create_new`] to create a new `Store`.
|
||||||
|
///
|
||||||
|
/// # Errors
|
||||||
|
///
|
||||||
|
/// If the prefixed bytes of the opened file does not match the provided `magic`, the
|
||||||
|
/// [`FileError::InvalidMagicBytes`] error variant will be returned.
|
||||||
|
///
|
||||||
|
/// [`create_new`]: Store::create_new
|
||||||
|
pub fn open<P>(magic: &[u8], file_path: P) -> Result<Self, FileError>
|
||||||
|
where
|
||||||
|
P: AsRef<Path>,
|
||||||
|
{
|
||||||
|
let mut f = OpenOptions::new().read(true).write(true).open(file_path)?;
|
||||||
|
|
||||||
|
let mut magic_buf = vec![0_u8; magic.len()];
|
||||||
|
f.read_exact(&mut magic_buf)?;
|
||||||
|
if magic_buf != magic {
|
||||||
|
return Err(FileError::InvalidMagicBytes {
|
||||||
|
got: magic_buf,
|
||||||
|
expected: magic.to_vec(),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(Self {
|
||||||
|
magic_len: magic.len(),
|
||||||
|
db_file: f,
|
||||||
|
marker: Default::default(),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Attempt to open existing [`Store`] file; create it if the file is non-existent.
|
||||||
|
///
|
||||||
|
/// Internally, this calls either [`open`] or [`create_new`].
|
||||||
|
///
|
||||||
|
/// [`open`]: Store::open
|
||||||
|
/// [`create_new`]: Store::create_new
|
||||||
|
pub fn open_or_create_new<P>(magic: &[u8], file_path: P) -> Result<Self, FileError>
|
||||||
|
where
|
||||||
|
P: AsRef<Path>,
|
||||||
|
{
|
||||||
|
if file_path.as_ref().exists() {
|
||||||
|
Self::open(magic, file_path)
|
||||||
|
} else {
|
||||||
|
Self::create_new(magic, file_path)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Iterates over the stored changeset from first to last, changing the seek position at each
|
||||||
|
/// iteration.
|
||||||
|
///
|
||||||
|
/// The iterator may fail to read an entry and therefore return an error. However, the first time
|
||||||
|
/// it returns an error will be the last. After doing so, the iterator will always yield `None`.
|
||||||
|
///
|
||||||
|
/// **WARNING**: This method changes the write position in the underlying file. You should
|
||||||
|
/// always iterate over all entries until `None` is returned if you want your next write to go
|
||||||
|
/// at the end; otherwise, you will write over existing entries.
|
||||||
|
pub fn iter_changesets(&mut self) -> EntryIter<C> {
|
||||||
|
EntryIter::new(self.magic_len as u64, &mut self.db_file)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Loads all the changesets that have been stored as one giant changeset.
|
||||||
|
///
|
||||||
|
/// This function returns the aggregate changeset, or `None` if nothing was persisted.
|
||||||
|
/// If reading or deserializing any of the entries fails, an error is returned that
|
||||||
|
/// consists of all those it was able to read.
|
||||||
|
///
|
||||||
|
/// You should usually check the error. In many applications, it may make sense to do a full
|
||||||
|
/// wallet scan with a stop-gap after getting an error, since it is likely that one of the
|
||||||
|
/// changesets it was unable to read changed the derivation indices of the tracker.
|
||||||
|
///
|
||||||
|
/// **WARNING**: This method changes the write position of the underlying file. The next
|
||||||
|
/// changeset will be written over the erroring entry (or the end of the file if none existed).
|
||||||
|
pub fn aggregate_changesets(&mut self) -> Result<Option<C>, AggregateChangesetsError<C>> {
|
||||||
|
let mut changeset = Option::<C>::None;
|
||||||
|
for next_changeset in self.iter_changesets() {
|
||||||
|
let next_changeset = match next_changeset {
|
||||||
|
Ok(next_changeset) => next_changeset,
|
||||||
|
Err(iter_error) => {
|
||||||
|
return Err(AggregateChangesetsError {
|
||||||
|
changeset,
|
||||||
|
iter_error,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
};
|
||||||
|
match &mut changeset {
|
||||||
|
Some(changeset) => changeset.append(next_changeset),
|
||||||
|
changeset => *changeset = Some(next_changeset),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(changeset)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Append a new changeset to the file and truncate the file to the end of the appended
|
||||||
|
/// changeset.
|
||||||
|
///
|
||||||
|
/// The truncation is to avoid the possibility of having a valid but inconsistent changeset
|
||||||
|
/// directly after the appended changeset.
|
||||||
|
pub fn append_changeset(&mut self, changeset: &C) -> Result<(), io::Error> {
|
||||||
|
// no need to write anything if changeset is empty
|
||||||
|
if changeset.is_empty() {
|
||||||
|
return Ok(());
|
||||||
|
}
|
||||||
|
|
||||||
|
bincode_options()
|
||||||
|
.serialize_into(&mut self.db_file, changeset)
|
||||||
|
.map_err(|e| match *e {
|
||||||
|
bincode::ErrorKind::Io(inner) => inner,
|
||||||
|
unexpected_err => panic!("unexpected bincode error: {}", unexpected_err),
|
||||||
|
})?;
|
||||||
|
|
||||||
|
// truncate file after this changeset addition
|
||||||
|
// if this is not done, data after this changeset may represent valid changesets, however
|
||||||
|
// applying those changesets on top of this one may result in an inconsistent state
|
||||||
|
let pos = self.db_file.stream_position()?;
|
||||||
|
self.db_file.set_len(pos)?;
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Error type for [`Store::aggregate_changesets`].
|
||||||
|
#[derive(Debug)]
|
||||||
|
pub struct AggregateChangesetsError<C> {
|
||||||
|
/// The partially-aggregated changeset.
|
||||||
|
pub changeset: Option<C>,
|
||||||
|
|
||||||
|
/// The error returned by [`EntryIter`].
|
||||||
|
pub iter_error: IterError,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C> std::fmt::Display for AggregateChangesetsError<C> {
|
||||||
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
|
std::fmt::Display::fmt(&self.iter_error, f)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl<C: std::fmt::Debug> std::error::Error for AggregateChangesetsError<C> {}
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod test {
|
||||||
|
use super::*;
|
||||||
|
|
||||||
|
use bincode::DefaultOptions;
|
||||||
|
use std::{
|
||||||
|
collections::BTreeSet,
|
||||||
|
io::{Read, Write},
|
||||||
|
vec::Vec,
|
||||||
|
};
|
||||||
|
use tempfile::NamedTempFile;
|
||||||
|
|
||||||
|
const TEST_MAGIC_BYTES_LEN: usize = 12;
|
||||||
|
const TEST_MAGIC_BYTES: [u8; TEST_MAGIC_BYTES_LEN] =
|
||||||
|
[98, 100, 107, 102, 115, 49, 49, 49, 49, 49, 49, 49];
|
||||||
|
|
||||||
|
type TestChangeSet = BTreeSet<String>;
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
struct TestTracker;
|
||||||
|
|
||||||
|
/// Check behavior of [`Store::create_new`] and [`Store::open`].
|
||||||
|
#[test]
|
||||||
|
fn construct_store() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
let file_path = temp_dir.path().join("db_file");
|
||||||
|
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect_err("must not open as file does not exist yet");
|
||||||
|
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must create file");
|
||||||
|
// cannot create new as file already exists
|
||||||
|
let _ = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect_err("must fail as file already exists now");
|
||||||
|
let _ = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must open as file exists now");
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn open_or_create_new() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
let file_path = temp_dir.path().join("db_file");
|
||||||
|
let changeset = BTreeSet::from(["hello".to_string(), "world".to_string()]);
|
||||||
|
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must create");
|
||||||
|
assert!(file_path.exists());
|
||||||
|
db.append_changeset(&changeset).expect("must succeed");
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open_or_create_new(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.expect("must recover");
|
||||||
|
let recovered_changeset = db.aggregate_changesets().expect("must succeed");
|
||||||
|
assert_eq!(recovered_changeset, Some(changeset));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn new_fails_if_file_is_too_short() {
|
||||||
|
let mut file = NamedTempFile::new().unwrap();
|
||||||
|
file.write_all(&TEST_MAGIC_BYTES[..TEST_MAGIC_BYTES_LEN - 1])
|
||||||
|
.expect("should write");
|
||||||
|
|
||||||
|
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||||
|
Err(FileError::Io(e)) => assert_eq!(e.kind(), std::io::ErrorKind::UnexpectedEof),
|
||||||
|
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn new_fails_if_magic_bytes_are_invalid() {
|
||||||
|
let invalid_magic_bytes = "ldkfs0000000";
|
||||||
|
|
||||||
|
let mut file = NamedTempFile::new().unwrap();
|
||||||
|
file.write_all(invalid_magic_bytes.as_bytes())
|
||||||
|
.expect("should write");
|
||||||
|
|
||||||
|
match Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()) {
|
||||||
|
Err(FileError::InvalidMagicBytes { got, .. }) => {
|
||||||
|
assert_eq!(got, invalid_magic_bytes.as_bytes())
|
||||||
|
}
|
||||||
|
unexpected => panic!("unexpected result: {:?}", unexpected),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn append_changeset_truncates_invalid_bytes() {
|
||||||
|
// initial data to write to file (magic bytes + invalid data)
|
||||||
|
let mut data = [255_u8; 2000];
|
||||||
|
data[..TEST_MAGIC_BYTES_LEN].copy_from_slice(&TEST_MAGIC_BYTES);
|
||||||
|
|
||||||
|
let changeset = TestChangeSet::from(["one".into(), "two".into(), "three!".into()]);
|
||||||
|
|
||||||
|
let mut file = NamedTempFile::new().unwrap();
|
||||||
|
file.write_all(&data).expect("should write");
|
||||||
|
|
||||||
|
let mut store =
|
||||||
|
Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, file.path()).expect("should open");
|
||||||
|
match store.iter_changesets().next() {
|
||||||
|
Some(Err(IterError::Bincode(_))) => {}
|
||||||
|
unexpected_res => panic!("unexpected result: {:?}", unexpected_res),
|
||||||
|
}
|
||||||
|
|
||||||
|
store.append_changeset(&changeset).expect("should append");
|
||||||
|
|
||||||
|
drop(store);
|
||||||
|
|
||||||
|
let got_bytes = {
|
||||||
|
let mut buf = Vec::new();
|
||||||
|
file.reopen()
|
||||||
|
.unwrap()
|
||||||
|
.read_to_end(&mut buf)
|
||||||
|
.expect("should read");
|
||||||
|
buf
|
||||||
|
};
|
||||||
|
|
||||||
|
let expected_bytes = {
|
||||||
|
let mut buf = TEST_MAGIC_BYTES.to_vec();
|
||||||
|
DefaultOptions::new()
|
||||||
|
.with_varint_encoding()
|
||||||
|
.serialize_into(&mut buf, &changeset)
|
||||||
|
.expect("should encode");
|
||||||
|
buf
|
||||||
|
};
|
||||||
|
|
||||||
|
assert_eq!(got_bytes, expected_bytes);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn last_write_is_short() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
|
||||||
|
let changesets = [
|
||||||
|
TestChangeSet::from(["1".into()]),
|
||||||
|
TestChangeSet::from(["2".into(), "3".into()]),
|
||||||
|
TestChangeSet::from(["4".into(), "5".into(), "6".into()]),
|
||||||
|
];
|
||||||
|
let last_changeset = TestChangeSet::from(["7".into(), "8".into(), "9".into()]);
|
||||||
|
let last_changeset_bytes = bincode_options().serialize(&last_changeset).unwrap();
|
||||||
|
|
||||||
|
for short_write_len in 1..last_changeset_bytes.len() - 1 {
|
||||||
|
let file_path = temp_dir.path().join(format!("{}.dat", short_write_len));
|
||||||
|
println!("Test file: {:?}", file_path);
|
||||||
|
|
||||||
|
// simulate creating a file, writing data where the last write is incomplete
|
||||||
|
{
|
||||||
|
let mut db =
|
||||||
|
Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
for changeset in &changesets {
|
||||||
|
db.append_changeset(changeset).unwrap();
|
||||||
|
}
|
||||||
|
// this is the incomplete write
|
||||||
|
db.db_file
|
||||||
|
.write_all(&last_changeset_bytes[..short_write_len])
|
||||||
|
.unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
// load file again and aggregate changesets
|
||||||
|
// write the last changeset again (this time it succeeds)
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
let err = db
|
||||||
|
.aggregate_changesets()
|
||||||
|
.expect_err("should return error as last read is short");
|
||||||
|
assert_eq!(
|
||||||
|
err.changeset,
|
||||||
|
changesets.iter().cloned().reduce(|mut acc, cs| {
|
||||||
|
Append::append(&mut acc, cs);
|
||||||
|
acc
|
||||||
|
}),
|
||||||
|
"should recover all changesets that are written in full",
|
||||||
|
);
|
||||||
|
db.db_file.write_all(&last_changeset_bytes).unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
// load file again - this time we should successfully aggregate all changesets
|
||||||
|
{
|
||||||
|
let mut db = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
let aggregated_changesets = db
|
||||||
|
.aggregate_changesets()
|
||||||
|
.expect("aggregating all changesets should succeed");
|
||||||
|
assert_eq!(
|
||||||
|
aggregated_changesets,
|
||||||
|
changesets
|
||||||
|
.iter()
|
||||||
|
.cloned()
|
||||||
|
.chain(core::iter::once(last_changeset.clone()))
|
||||||
|
.reduce(|mut acc, cs| {
|
||||||
|
Append::append(&mut acc, cs);
|
||||||
|
acc
|
||||||
|
}),
|
||||||
|
"should recover all changesets",
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn write_after_short_read() {
|
||||||
|
let temp_dir = tempfile::tempdir().unwrap();
|
||||||
|
|
||||||
|
let changesets = (0..20)
|
||||||
|
.map(|n| TestChangeSet::from([format!("{}", n)]))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
let last_changeset = TestChangeSet::from(["last".into()]);
|
||||||
|
|
||||||
|
for read_count in 0..changesets.len() {
|
||||||
|
let file_path = temp_dir.path().join(format!("{}.dat", read_count));
|
||||||
|
println!("Test file: {:?}", file_path);
|
||||||
|
|
||||||
|
// First, we create the file with all the changesets!
|
||||||
|
let mut db = Store::<TestChangeSet>::create_new(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
for changeset in &changesets {
|
||||||
|
db.append_changeset(changeset).unwrap();
|
||||||
|
}
|
||||||
|
drop(db);
|
||||||
|
|
||||||
|
// We re-open the file and read `read_count` number of changesets.
|
||||||
|
let mut db = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path).unwrap();
|
||||||
|
let mut exp_aggregation = db
|
||||||
|
.iter_changesets()
|
||||||
|
.take(read_count)
|
||||||
|
.map(|r| r.expect("must read valid changeset"))
|
||||||
|
.fold(TestChangeSet::default(), |mut acc, v| {
|
||||||
|
Append::append(&mut acc, v);
|
||||||
|
acc
|
||||||
|
});
|
||||||
|
// We write after a short read.
|
||||||
|
db.write_changes(&last_changeset)
|
||||||
|
.expect("last write must succeed");
|
||||||
|
Append::append(&mut exp_aggregation, last_changeset.clone());
|
||||||
|
drop(db);
|
||||||
|
|
||||||
|
// We open the file again and check whether aggregate changeset is expected.
|
||||||
|
let aggregation = Store::<TestChangeSet>::open(&TEST_MAGIC_BYTES, &file_path)
|
||||||
|
.unwrap()
|
||||||
|
.aggregate_changesets()
|
||||||
|
.expect("must aggregate changesets")
|
||||||
|
.unwrap_or_default();
|
||||||
|
assert_eq!(aggregation, exp_aggregation);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1 +0,0 @@
|
|||||||
|
|
||||||
13
crates/hwi/Cargo.toml
Normal file
13
crates/hwi/Cargo.toml
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
[package]
|
||||||
|
name = "bdk_hwi"
|
||||||
|
version = "0.1.0"
|
||||||
|
edition = "2021"
|
||||||
|
homepage = "https://bitcoindevkit.org"
|
||||||
|
repository = "https://github.com/bitcoindevkit/bdk"
|
||||||
|
description = "Utilities to use bdk with hardware wallets"
|
||||||
|
license = "MIT OR Apache-2.0"
|
||||||
|
readme = "README.md"
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk = { path = "../bdk" }
|
||||||
|
hwi = { version = "0.7.0", features = [ "miniscript"] }
|
||||||
42
crates/hwi/src/lib.rs
Normal file
42
crates/hwi/src/lib.rs
Normal file
@@ -0,0 +1,42 @@
|
|||||||
|
//! HWI Signer
|
||||||
|
//!
|
||||||
|
//! This crate contains HWISigner, an implementation of a [`TransactionSigner`] to be
|
||||||
|
//! used with hardware wallets.
|
||||||
|
//! ```no_run
|
||||||
|
//! # use bdk::bitcoin::Network;
|
||||||
|
//! # use bdk::signer::SignerOrdering;
|
||||||
|
//! # use bdk_hwi::HWISigner;
|
||||||
|
//! # use bdk::wallet::AddressIndex::New;
|
||||||
|
//! # use bdk::{FeeRate, KeychainKind, SignOptions, Wallet};
|
||||||
|
//! # use hwi::HWIClient;
|
||||||
|
//! # use std::sync::Arc;
|
||||||
|
//! #
|
||||||
|
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
|
//! let mut devices = HWIClient::enumerate()?;
|
||||||
|
//! if devices.is_empty() {
|
||||||
|
//! panic!("No devices found!");
|
||||||
|
//! }
|
||||||
|
//! let first_device = devices.remove(0)?;
|
||||||
|
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
|
//!
|
||||||
|
//! # let mut wallet = Wallet::new_no_persist(
|
||||||
|
//! # "",
|
||||||
|
//! # None,
|
||||||
|
//! # Network::Testnet,
|
||||||
|
//! # )?;
|
||||||
|
//! #
|
||||||
|
//! // Adding the hardware signer to the BDK wallet
|
||||||
|
//! wallet.add_signer(
|
||||||
|
//! KeychainKind::External,
|
||||||
|
//! SignerOrdering(200),
|
||||||
|
//! Arc::new(custom_signer),
|
||||||
|
//! );
|
||||||
|
//!
|
||||||
|
//! # Ok(())
|
||||||
|
//! # }
|
||||||
|
//! ```
|
||||||
|
//!
|
||||||
|
//! [`TransactionSigner`]: bdk::wallet::signer::TransactionSigner
|
||||||
|
|
||||||
|
mod signer;
|
||||||
|
pub use signer::*;
|
||||||
94
crates/hwi/src/signer.rs
Normal file
94
crates/hwi/src/signer.rs
Normal file
@@ -0,0 +1,94 @@
|
|||||||
|
use bdk::bitcoin::bip32::Fingerprint;
|
||||||
|
use bdk::bitcoin::psbt::PartiallySignedTransaction;
|
||||||
|
use bdk::bitcoin::secp256k1::{All, Secp256k1};
|
||||||
|
|
||||||
|
use hwi::error::Error;
|
||||||
|
use hwi::types::{HWIChain, HWIDevice};
|
||||||
|
use hwi::HWIClient;
|
||||||
|
|
||||||
|
use bdk::signer::{SignerCommon, SignerError, SignerId, TransactionSigner};
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
/// Custom signer for Hardware Wallets
|
||||||
|
///
|
||||||
|
/// This ignores `sign_options` and leaves the decisions up to the hardware wallet.
|
||||||
|
pub struct HWISigner {
|
||||||
|
fingerprint: Fingerprint,
|
||||||
|
client: HWIClient,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl HWISigner {
|
||||||
|
/// Create a instance from the specified device and chain
|
||||||
|
pub fn from_device(device: &HWIDevice, chain: HWIChain) -> Result<HWISigner, Error> {
|
||||||
|
let client = HWIClient::get_client(device, false, chain)?;
|
||||||
|
Ok(HWISigner {
|
||||||
|
fingerprint: device.fingerprint,
|
||||||
|
client,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for HWISigner {
|
||||||
|
fn id(&self, _secp: &Secp256k1<All>) -> SignerId {
|
||||||
|
SignerId::Fingerprint(self.fingerprint)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl TransactionSigner for HWISigner {
|
||||||
|
fn sign_transaction(
|
||||||
|
&self,
|
||||||
|
psbt: &mut PartiallySignedTransaction,
|
||||||
|
_sign_options: &bdk::SignOptions,
|
||||||
|
_secp: &Secp256k1<All>,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
psbt.combine(
|
||||||
|
self.client
|
||||||
|
.sign_tx(psbt)
|
||||||
|
.map_err(|e| {
|
||||||
|
SignerError::External(format!("While signing with hardware wallet: {}", e))
|
||||||
|
})?
|
||||||
|
.psbt,
|
||||||
|
)
|
||||||
|
.expect("Failed to combine HW signed psbt with passed PSBT");
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// TODO: re-enable this once we have the `get_funded_wallet` test util
|
||||||
|
// #[cfg(test)]
|
||||||
|
// mod tests {
|
||||||
|
// #[test]
|
||||||
|
// fn test_hardware_signer() {
|
||||||
|
// use std::sync::Arc;
|
||||||
|
//
|
||||||
|
// use bdk::tests::get_funded_wallet;
|
||||||
|
// use bdk::signer::SignerOrdering;
|
||||||
|
// use bdk::bitcoin::Network;
|
||||||
|
// use crate::HWISigner;
|
||||||
|
// use hwi::HWIClient;
|
||||||
|
//
|
||||||
|
// let mut devices = HWIClient::enumerate().unwrap();
|
||||||
|
// if devices.is_empty() {
|
||||||
|
// panic!("No devices found!");
|
||||||
|
// }
|
||||||
|
// let device = devices.remove(0).unwrap();
|
||||||
|
// let client = HWIClient::get_client(&device, true, Network::Regtest.into()).unwrap();
|
||||||
|
// let descriptors = client.get_descriptors::<String>(None).unwrap();
|
||||||
|
// let custom_signer = HWISigner::from_device(&device, Network::Regtest.into()).unwrap();
|
||||||
|
//
|
||||||
|
// let (mut wallet, _) = get_funded_wallet(&descriptors.internal[0]);
|
||||||
|
// wallet.add_signer(
|
||||||
|
// bdk::KeychainKind::External,
|
||||||
|
// SignerOrdering(200),
|
||||||
|
// Arc::new(custom_signer),
|
||||||
|
// );
|
||||||
|
//
|
||||||
|
// let addr = wallet.get_address(bdk::wallet::AddressIndex::LastUnused);
|
||||||
|
// let mut builder = wallet.build_tx();
|
||||||
|
// builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
|
// let (mut psbt, _) = builder.finish().unwrap();
|
||||||
|
//
|
||||||
|
// let finalized = wallet.sign(&mut psbt, Default::default()).unwrap();
|
||||||
|
// assert!(finalized);
|
||||||
|
// }
|
||||||
|
// }
|
||||||
12
example-crates/example_bitcoind_rpc_polling/Cargo.toml
Normal file
12
example-crates/example_bitcoind_rpc_polling/Cargo.toml
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
[package]
|
||||||
|
name = "example_bitcoind_rpc_polling"
|
||||||
|
version = "0.1.0"
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
bdk_chain = { path = "../../crates/chain", features = ["serde"] }
|
||||||
|
bdk_bitcoind_rpc = { path = "../../crates/bitcoind_rpc" }
|
||||||
|
example_cli = { path = "../example_cli" }
|
||||||
|
ctrlc = { version = "^2" }
|
||||||
68
example-crates/example_bitcoind_rpc_polling/README.md
Normal file
68
example-crates/example_bitcoind_rpc_polling/README.md
Normal file
@@ -0,0 +1,68 @@
|
|||||||
|
# Example RPC CLI
|
||||||
|
|
||||||
|
### Simple Regtest Test
|
||||||
|
|
||||||
|
1. Start local regtest bitcoind.
|
||||||
|
```
|
||||||
|
mkdir -p /tmp/regtest/bitcoind
|
||||||
|
bitcoind -regtest -server -fallbackfee=0.0002 -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -datadir=/tmp/regtest/bitcoind -daemon
|
||||||
|
```
|
||||||
|
2. Create a test bitcoind wallet and set bitcoind env.
|
||||||
|
```
|
||||||
|
bitcoin-cli -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -named createwallet wallet_name="test"
|
||||||
|
export RPC_URL=127.0.0.1:18443
|
||||||
|
export RPC_USER=<your-rpc-username>
|
||||||
|
export RPC_PASS=<your-rpc-password>
|
||||||
|
```
|
||||||
|
3. Get test bitcoind wallet info.
|
||||||
|
```
|
||||||
|
bitcoin-cli -rpcwallet="test" -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -datadir=/tmp/regtest/bitcoind -regtest getwalletinfo
|
||||||
|
```
|
||||||
|
4. Get new test bitcoind wallet address.
|
||||||
|
```
|
||||||
|
BITCOIND_ADDRESS=$(bitcoin-cli -rpcwallet="test" -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> getnewaddress)
|
||||||
|
echo $BITCOIND_ADDRESS
|
||||||
|
```
|
||||||
|
5. Generate 101 blocks with reward to test bitcoind wallet address.
|
||||||
|
```
|
||||||
|
bitcoin-cli -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> generatetoaddress 101 $BITCOIND_ADDRESS
|
||||||
|
```
|
||||||
|
6. Verify test bitcoind wallet balance.
|
||||||
|
```
|
||||||
|
bitcoin-cli -rpcwallet="test" -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> getbalances
|
||||||
|
```
|
||||||
|
7. Set descriptor env and get address from RPC CLI wallet.
|
||||||
|
```
|
||||||
|
export DESCRIPTOR="wpkh(tprv8ZgxMBicQKsPfK9BTf82oQkHhawtZv19CorqQKPFeaHDMA4dXYX6eWsJGNJ7VTQXWmoHdrfjCYuDijcRmNFwSKcVhswzqs4fugE8turndGc/1/*)"
|
||||||
|
cargo run -- --network regtest address next
|
||||||
|
```
|
||||||
|
8. Send 5 test bitcoin to RPC CLI wallet.
|
||||||
|
```
|
||||||
|
bitcoin-cli -rpcwallet="test" -datadir=/tmp/regtest/bitcoind -regtest -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> sendtoaddress <address> 5
|
||||||
|
```
|
||||||
|
9. Sync blockchain with RPC CLI wallet.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest sync
|
||||||
|
<CNTRL-C to stop syncing>
|
||||||
|
```
|
||||||
|
10. Get RPC CLI wallet unconfirmed balances.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest balance
|
||||||
|
```
|
||||||
|
11. Generate 1 block with reward to test bitcoind wallet address.
|
||||||
|
```
|
||||||
|
bitcoin-cli -datadir=/tmp/regtest/bitcoind -rpcuser=<your-rpc-username> -rpcpassword=<your-rpc-password> -regtest generatetoaddress 10 $BITCOIND_ADDRESS
|
||||||
|
```
|
||||||
|
12. Sync the blockchain with RPC CLI wallet.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest sync
|
||||||
|
<CNTRL-C to stop syncing>
|
||||||
|
```
|
||||||
|
13. Get RPC CLI wallet confirmed balances.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest balance
|
||||||
|
```
|
||||||
|
14. Get RPC CLI wallet transactions.
|
||||||
|
```
|
||||||
|
cargo run -- --network regtest txout list
|
||||||
|
```
|
||||||
390
example-crates/example_bitcoind_rpc_polling/src/main.rs
Normal file
390
example-crates/example_bitcoind_rpc_polling/src/main.rs
Normal file
@@ -0,0 +1,390 @@
|
|||||||
|
use std::{
|
||||||
|
path::PathBuf,
|
||||||
|
sync::{
|
||||||
|
atomic::{AtomicBool, Ordering},
|
||||||
|
Arc, Mutex,
|
||||||
|
},
|
||||||
|
time::{Duration, Instant},
|
||||||
|
};
|
||||||
|
|
||||||
|
use bdk_bitcoind_rpc::{
|
||||||
|
bitcoincore_rpc::{Auth, Client, RpcApi},
|
||||||
|
Emitter,
|
||||||
|
};
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{constants::genesis_block, Block, Transaction},
|
||||||
|
indexed_tx_graph, keychain,
|
||||||
|
local_chain::{self, LocalChain},
|
||||||
|
ConfirmationTimeHeightAnchor, IndexedTxGraph,
|
||||||
|
};
|
||||||
|
use example_cli::{
|
||||||
|
anyhow,
|
||||||
|
clap::{self, Args, Subcommand},
|
||||||
|
Keychain,
|
||||||
|
};
|
||||||
|
|
||||||
|
const DB_MAGIC: &[u8] = b"bdk_example_rpc";
|
||||||
|
const DB_PATH: &str = ".bdk_example_rpc.db";
|
||||||
|
|
||||||
|
/// The mpsc channel bound for emissions from [`Emitter`].
|
||||||
|
const CHANNEL_BOUND: usize = 10;
|
||||||
|
/// Delay for printing status to stdout.
|
||||||
|
const STDOUT_PRINT_DELAY: Duration = Duration::from_secs(6);
|
||||||
|
/// Delay between mempool emissions.
|
||||||
|
const MEMPOOL_EMIT_DELAY: Duration = Duration::from_secs(30);
|
||||||
|
/// Delay for committing to persistence.
|
||||||
|
const DB_COMMIT_DELAY: Duration = Duration::from_secs(60);
|
||||||
|
|
||||||
|
type ChangeSet = (
|
||||||
|
local_chain::ChangeSet,
|
||||||
|
indexed_tx_graph::ChangeSet<ConfirmationTimeHeightAnchor, keychain::ChangeSet<Keychain>>,
|
||||||
|
);
|
||||||
|
|
||||||
|
#[derive(Debug)]
|
||||||
|
enum Emission {
|
||||||
|
Block(bdk_bitcoind_rpc::BlockEvent<Block>),
|
||||||
|
Mempool(Vec<(Transaction, u64)>),
|
||||||
|
Tip(u32),
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Args, Debug, Clone)]
|
||||||
|
struct RpcArgs {
|
||||||
|
/// RPC URL
|
||||||
|
#[clap(env = "RPC_URL", long, default_value = "127.0.0.1:8332")]
|
||||||
|
url: String,
|
||||||
|
/// RPC auth cookie file
|
||||||
|
#[clap(env = "RPC_COOKIE", long)]
|
||||||
|
rpc_cookie: Option<PathBuf>,
|
||||||
|
/// RPC auth username
|
||||||
|
#[clap(env = "RPC_USER", long)]
|
||||||
|
rpc_user: Option<String>,
|
||||||
|
/// RPC auth password
|
||||||
|
#[clap(env = "RPC_PASS", long)]
|
||||||
|
rpc_password: Option<String>,
|
||||||
|
/// Starting block height to fallback to if no point of agreement if found
|
||||||
|
#[clap(env = "FALLBACK_HEIGHT", long, default_value = "0")]
|
||||||
|
fallback_height: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl From<RpcArgs> for Auth {
|
||||||
|
fn from(args: RpcArgs) -> Self {
|
||||||
|
match (args.rpc_cookie, args.rpc_user, args.rpc_password) {
|
||||||
|
(None, None, None) => Self::None,
|
||||||
|
(Some(path), _, _) => Self::CookieFile(path),
|
||||||
|
(_, Some(user), Some(pass)) => Self::UserPass(user, pass),
|
||||||
|
(_, Some(_), None) => panic!("rpc auth: missing rpc_pass"),
|
||||||
|
(_, None, Some(_)) => panic!("rpc auth: missing rpc_user"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl RpcArgs {
|
||||||
|
fn new_client(&self) -> anyhow::Result<Client> {
|
||||||
|
Ok(Client::new(
|
||||||
|
&self.url,
|
||||||
|
match (&self.rpc_cookie, &self.rpc_user, &self.rpc_password) {
|
||||||
|
(None, None, None) => Auth::None,
|
||||||
|
(Some(path), _, _) => Auth::CookieFile(path.clone()),
|
||||||
|
(_, Some(user), Some(pass)) => Auth::UserPass(user.clone(), pass.clone()),
|
||||||
|
(_, Some(_), None) => panic!("rpc auth: missing rpc_pass"),
|
||||||
|
(_, None, Some(_)) => panic!("rpc auth: missing rpc_user"),
|
||||||
|
},
|
||||||
|
)?)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
enum RpcCommands {
|
||||||
|
/// Syncs local state with remote state via RPC (starting from last point of agreement) and
|
||||||
|
/// stores/indexes relevant transactions
|
||||||
|
Sync {
|
||||||
|
#[clap(flatten)]
|
||||||
|
rpc_args: RpcArgs,
|
||||||
|
},
|
||||||
|
/// Sync by having the emitter logic in a separate thread
|
||||||
|
Live {
|
||||||
|
#[clap(flatten)]
|
||||||
|
rpc_args: RpcArgs,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
fn main() -> anyhow::Result<()> {
|
||||||
|
let start = Instant::now();
|
||||||
|
let example_cli::Init {
|
||||||
|
args,
|
||||||
|
keymap,
|
||||||
|
index,
|
||||||
|
db,
|
||||||
|
init_changeset,
|
||||||
|
} = example_cli::init::<RpcCommands, RpcArgs, ChangeSet>(DB_MAGIC, DB_PATH)?;
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] loaded initial changeset from db",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
let (init_chain_changeset, init_graph_changeset) = init_changeset;
|
||||||
|
|
||||||
|
let graph = Mutex::new({
|
||||||
|
let mut graph = IndexedTxGraph::new(index);
|
||||||
|
graph.apply_changeset(init_graph_changeset);
|
||||||
|
graph
|
||||||
|
});
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] loaded indexed tx graph from changeset",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
|
||||||
|
let chain = Mutex::new(if init_chain_changeset.is_empty() {
|
||||||
|
let genesis_hash = genesis_block(args.network).block_hash();
|
||||||
|
let (chain, chain_changeset) = LocalChain::from_genesis_hash(genesis_hash);
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
db.stage((chain_changeset, Default::default()));
|
||||||
|
db.commit()?;
|
||||||
|
chain
|
||||||
|
} else {
|
||||||
|
LocalChain::from_changeset(init_chain_changeset)?
|
||||||
|
});
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] loaded local chain from changeset",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
|
||||||
|
let rpc_cmd = match args.command {
|
||||||
|
example_cli::Commands::ChainSpecific(rpc_cmd) => rpc_cmd,
|
||||||
|
general_cmd => {
|
||||||
|
return example_cli::handle_commands(
|
||||||
|
&graph,
|
||||||
|
&db,
|
||||||
|
&chain,
|
||||||
|
&keymap,
|
||||||
|
args.network,
|
||||||
|
|rpc_args, tx| {
|
||||||
|
let client = rpc_args.new_client()?;
|
||||||
|
client.send_raw_transaction(tx)?;
|
||||||
|
Ok(())
|
||||||
|
},
|
||||||
|
general_cmd,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
match rpc_cmd {
|
||||||
|
RpcCommands::Sync { rpc_args } => {
|
||||||
|
let RpcArgs {
|
||||||
|
fallback_height, ..
|
||||||
|
} = rpc_args;
|
||||||
|
|
||||||
|
let chain_tip = chain.lock().unwrap().tip();
|
||||||
|
let rpc_client = rpc_args.new_client()?;
|
||||||
|
let mut emitter = Emitter::new(&rpc_client, chain_tip, fallback_height);
|
||||||
|
|
||||||
|
let mut last_db_commit = Instant::now();
|
||||||
|
let mut last_print = Instant::now();
|
||||||
|
|
||||||
|
while let Some(emission) = emitter.next_block()? {
|
||||||
|
let height = emission.block_height();
|
||||||
|
|
||||||
|
let mut chain = chain.lock().unwrap();
|
||||||
|
let mut graph = graph.lock().unwrap();
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
|
||||||
|
let chain_changeset = chain
|
||||||
|
.apply_update(local_chain::Update {
|
||||||
|
tip: emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
})
|
||||||
|
.expect("must always apply as we receive blocks in order from emitter");
|
||||||
|
let graph_changeset = graph.apply_block_relevant(&emission.block, height);
|
||||||
|
db.stage((chain_changeset, graph_changeset));
|
||||||
|
|
||||||
|
// commit staged db changes in intervals
|
||||||
|
if last_db_commit.elapsed() >= DB_COMMIT_DELAY {
|
||||||
|
last_db_commit = Instant::now();
|
||||||
|
db.commit()?;
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] committed to db (took {}s)",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
last_db_commit.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// print synced-to height and current balance in intervals
|
||||||
|
if last_print.elapsed() >= STDOUT_PRINT_DELAY {
|
||||||
|
last_print = Instant::now();
|
||||||
|
let synced_to = chain.tip();
|
||||||
|
let balance = {
|
||||||
|
graph.graph().balance(
|
||||||
|
&*chain,
|
||||||
|
synced_to.block_id(),
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|(k, _), _| k == &Keychain::Internal,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] synced to {} @ {} | total: {} sats",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
synced_to.hash(),
|
||||||
|
synced_to.height(),
|
||||||
|
balance.total()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let mempool_txs = emitter.mempool()?;
|
||||||
|
let graph_changeset = graph.lock().unwrap().batch_insert_relevant_unconfirmed(
|
||||||
|
mempool_txs.iter().map(|(tx, time)| (tx, *time)),
|
||||||
|
);
|
||||||
|
{
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
db.stage((local_chain::ChangeSet::default(), graph_changeset));
|
||||||
|
db.commit()?; // commit one last time
|
||||||
|
}
|
||||||
|
}
|
||||||
|
RpcCommands::Live { rpc_args } => {
|
||||||
|
let RpcArgs {
|
||||||
|
fallback_height, ..
|
||||||
|
} = rpc_args;
|
||||||
|
let sigterm_flag = start_ctrlc_handler();
|
||||||
|
|
||||||
|
let last_cp = chain.lock().unwrap().tip();
|
||||||
|
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] starting emitter thread...",
|
||||||
|
start.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
let (tx, rx) = std::sync::mpsc::sync_channel::<Emission>(CHANNEL_BOUND);
|
||||||
|
let emission_jh = std::thread::spawn(move || -> anyhow::Result<()> {
|
||||||
|
let rpc_client = rpc_args.new_client()?;
|
||||||
|
let mut emitter = Emitter::new(&rpc_client, last_cp, fallback_height);
|
||||||
|
|
||||||
|
let mut block_count = rpc_client.get_block_count()? as u32;
|
||||||
|
tx.send(Emission::Tip(block_count))?;
|
||||||
|
|
||||||
|
loop {
|
||||||
|
match emitter.next_block()? {
|
||||||
|
Some(block_emission) => {
|
||||||
|
let height = block_emission.block_height();
|
||||||
|
if sigterm_flag.load(Ordering::Acquire) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
if height > block_count {
|
||||||
|
block_count = rpc_client.get_block_count()? as u32;
|
||||||
|
tx.send(Emission::Tip(block_count))?;
|
||||||
|
}
|
||||||
|
tx.send(Emission::Block(block_emission))?;
|
||||||
|
}
|
||||||
|
None => {
|
||||||
|
if await_flag(&sigterm_flag, MEMPOOL_EMIT_DELAY) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
println!("preparing mempool emission...");
|
||||||
|
let now = Instant::now();
|
||||||
|
tx.send(Emission::Mempool(emitter.mempool()?))?;
|
||||||
|
println!("mempool emission prepared in {}s", now.elapsed().as_secs());
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
println!("emitter thread shutting down...");
|
||||||
|
Ok(())
|
||||||
|
});
|
||||||
|
|
||||||
|
let mut tip_height = 0_u32;
|
||||||
|
let mut last_db_commit = Instant::now();
|
||||||
|
let mut last_print = Option::<Instant>::None;
|
||||||
|
|
||||||
|
for emission in rx {
|
||||||
|
let mut db = db.lock().unwrap();
|
||||||
|
let mut graph = graph.lock().unwrap();
|
||||||
|
let mut chain = chain.lock().unwrap();
|
||||||
|
|
||||||
|
let changeset = match emission {
|
||||||
|
Emission::Block(block_emission) => {
|
||||||
|
let height = block_emission.block_height();
|
||||||
|
let chain_update = local_chain::Update {
|
||||||
|
tip: block_emission.checkpoint,
|
||||||
|
introduce_older_blocks: false,
|
||||||
|
};
|
||||||
|
let chain_changeset = chain
|
||||||
|
.apply_update(chain_update)
|
||||||
|
.expect("must always apply as we receive blocks in order from emitter");
|
||||||
|
let graph_changeset =
|
||||||
|
graph.apply_block_relevant(&block_emission.block, height);
|
||||||
|
(chain_changeset, graph_changeset)
|
||||||
|
}
|
||||||
|
Emission::Mempool(mempool_txs) => {
|
||||||
|
let graph_changeset = graph.batch_insert_relevant_unconfirmed(
|
||||||
|
mempool_txs.iter().map(|(tx, time)| (tx, *time)),
|
||||||
|
);
|
||||||
|
(local_chain::ChangeSet::default(), graph_changeset)
|
||||||
|
}
|
||||||
|
Emission::Tip(h) => {
|
||||||
|
tip_height = h;
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
db.stage(changeset);
|
||||||
|
|
||||||
|
if last_db_commit.elapsed() >= DB_COMMIT_DELAY {
|
||||||
|
last_db_commit = Instant::now();
|
||||||
|
db.commit()?;
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] committed to db (took {}s)",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
last_db_commit.elapsed().as_secs_f32()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
if last_print.map_or(Duration::MAX, |i| i.elapsed()) >= STDOUT_PRINT_DELAY {
|
||||||
|
last_print = Some(Instant::now());
|
||||||
|
let synced_to = chain.tip();
|
||||||
|
let balance = {
|
||||||
|
graph.graph().balance(
|
||||||
|
&*chain,
|
||||||
|
synced_to.block_id(),
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|(k, _), _| k == &Keychain::Internal,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
println!(
|
||||||
|
"[{:>10}s] synced to {} @ {} / {} | total: {} sats",
|
||||||
|
start.elapsed().as_secs_f32(),
|
||||||
|
synced_to.hash(),
|
||||||
|
synced_to.height(),
|
||||||
|
tip_height,
|
||||||
|
balance.total()
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
emission_jh.join().expect("must join emitter thread")?;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
fn start_ctrlc_handler() -> Arc<AtomicBool> {
|
||||||
|
let flag = Arc::new(AtomicBool::new(false));
|
||||||
|
let cloned_flag = flag.clone();
|
||||||
|
|
||||||
|
ctrlc::set_handler(move || cloned_flag.store(true, Ordering::Release));
|
||||||
|
|
||||||
|
flag
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(dead_code)]
|
||||||
|
fn await_flag(flag: &AtomicBool, duration: Duration) -> bool {
|
||||||
|
let start = Instant::now();
|
||||||
|
loop {
|
||||||
|
if flag.load(Ordering::Acquire) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if start.elapsed() >= duration {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
std::thread::sleep(Duration::from_secs(1));
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,9 +1,10 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "keychain_tracker_example_cli"
|
name = "example_cli"
|
||||||
version = "0.1.0"
|
version = "0.2.0"
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
|
|
||||||
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
# See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
bdk_chain = { path = "../../crates/chain", features = ["serde", "miniscript"]}
|
bdk_chain = { path = "../../crates/chain", features = ["serde", "miniscript"]}
|
||||||
bdk_file_store = { path = "../../crates/file_store" }
|
bdk_file_store = { path = "../../crates/file_store" }
|
||||||
719
example-crates/example_cli/src/lib.rs
Normal file
719
example-crates/example_cli/src/lib.rs
Normal file
@@ -0,0 +1,719 @@
|
|||||||
|
pub use anyhow;
|
||||||
|
use anyhow::Context;
|
||||||
|
use bdk_coin_select::{coin_select_bnb, CoinSelector, CoinSelectorOpt, WeightedValue};
|
||||||
|
use bdk_file_store::Store;
|
||||||
|
use serde::{de::DeserializeOwned, Serialize};
|
||||||
|
use std::{cmp::Reverse, collections::HashMap, path::PathBuf, sync::Mutex, time::Duration};
|
||||||
|
|
||||||
|
use bdk_chain::{
|
||||||
|
bitcoin::{
|
||||||
|
absolute, address, psbt::Prevouts, secp256k1::Secp256k1, sighash::SighashCache, Address,
|
||||||
|
Network, Sequence, Transaction, TxIn, TxOut,
|
||||||
|
},
|
||||||
|
indexed_tx_graph::{self, IndexedTxGraph},
|
||||||
|
keychain::{self, KeychainTxOutIndex},
|
||||||
|
local_chain,
|
||||||
|
miniscript::{
|
||||||
|
descriptor::{DescriptorSecretKey, KeyMap},
|
||||||
|
Descriptor, DescriptorPublicKey,
|
||||||
|
},
|
||||||
|
Anchor, Append, ChainOracle, DescriptorExt, FullTxOut, Persist, PersistBackend,
|
||||||
|
};
|
||||||
|
pub use bdk_file_store;
|
||||||
|
pub use clap;
|
||||||
|
|
||||||
|
use clap::{Parser, Subcommand};
|
||||||
|
|
||||||
|
pub type KeychainTxGraph<A> = IndexedTxGraph<A, KeychainTxOutIndex<Keychain>>;
|
||||||
|
pub type KeychainChangeSet<A> = (
|
||||||
|
local_chain::ChangeSet,
|
||||||
|
indexed_tx_graph::ChangeSet<A, keychain::ChangeSet<Keychain>>,
|
||||||
|
);
|
||||||
|
pub type Database<C> = Persist<Store<C>, C>;
|
||||||
|
|
||||||
|
#[derive(Parser)]
|
||||||
|
#[clap(author, version, about, long_about = None)]
|
||||||
|
#[clap(propagate_version = true)]
|
||||||
|
pub struct Args<CS: clap::Subcommand, S: clap::Args> {
|
||||||
|
#[clap(env = "DESCRIPTOR")]
|
||||||
|
pub descriptor: String,
|
||||||
|
#[clap(env = "CHANGE_DESCRIPTOR")]
|
||||||
|
pub change_descriptor: Option<String>,
|
||||||
|
|
||||||
|
#[clap(env = "BITCOIN_NETWORK", long, default_value = "signet")]
|
||||||
|
pub network: Network,
|
||||||
|
|
||||||
|
#[clap(env = "BDK_DB_PATH", long, default_value = ".bdk_example_db")]
|
||||||
|
pub db_path: PathBuf,
|
||||||
|
|
||||||
|
#[clap(env = "BDK_CP_LIMIT", long, default_value = "20")]
|
||||||
|
pub cp_limit: usize,
|
||||||
|
|
||||||
|
#[clap(subcommand)]
|
||||||
|
pub command: Commands<CS, S>,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
pub enum Commands<CS: clap::Subcommand, S: clap::Args> {
|
||||||
|
#[clap(flatten)]
|
||||||
|
ChainSpecific(CS),
|
||||||
|
/// Address generation and inspection.
|
||||||
|
Address {
|
||||||
|
#[clap(subcommand)]
|
||||||
|
addr_cmd: AddressCmd,
|
||||||
|
},
|
||||||
|
/// Get the wallet balance.
|
||||||
|
Balance,
|
||||||
|
/// TxOut related commands.
|
||||||
|
#[clap(name = "txout")]
|
||||||
|
TxOut {
|
||||||
|
#[clap(subcommand)]
|
||||||
|
txout_cmd: TxOutCmd,
|
||||||
|
},
|
||||||
|
/// Send coins to an address.
|
||||||
|
Send {
|
||||||
|
/// Amount to send in satoshis
|
||||||
|
value: u64,
|
||||||
|
/// Destination address
|
||||||
|
address: Address<address::NetworkUnchecked>,
|
||||||
|
#[clap(short, default_value = "bnb")]
|
||||||
|
coin_select: CoinSelectionAlgo,
|
||||||
|
#[clap(flatten)]
|
||||||
|
chain_specific: S,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub enum CoinSelectionAlgo {
|
||||||
|
LargestFirst,
|
||||||
|
SmallestFirst,
|
||||||
|
OldestFirst,
|
||||||
|
NewestFirst,
|
||||||
|
BranchAndBound,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Default for CoinSelectionAlgo {
|
||||||
|
fn default() -> Self {
|
||||||
|
Self::LargestFirst
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::str::FromStr for CoinSelectionAlgo {
|
||||||
|
type Err = anyhow::Error;
|
||||||
|
|
||||||
|
fn from_str(s: &str) -> Result<Self, Self::Err> {
|
||||||
|
use CoinSelectionAlgo::*;
|
||||||
|
Ok(match s {
|
||||||
|
"largest-first" => LargestFirst,
|
||||||
|
"smallest-first" => SmallestFirst,
|
||||||
|
"oldest-first" => OldestFirst,
|
||||||
|
"newest-first" => NewestFirst,
|
||||||
|
"bnb" => BranchAndBound,
|
||||||
|
unknown => {
|
||||||
|
return Err(anyhow::anyhow!(
|
||||||
|
"unknown coin selection algorithm '{}'",
|
||||||
|
unknown
|
||||||
|
))
|
||||||
|
}
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for CoinSelectionAlgo {
|
||||||
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
|
use CoinSelectionAlgo::*;
|
||||||
|
write!(
|
||||||
|
f,
|
||||||
|
"{}",
|
||||||
|
match self {
|
||||||
|
LargestFirst => "largest-first",
|
||||||
|
SmallestFirst => "smallest-first",
|
||||||
|
OldestFirst => "oldest-first",
|
||||||
|
NewestFirst => "newest-first",
|
||||||
|
BranchAndBound => "bnb",
|
||||||
|
}
|
||||||
|
)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
pub enum AddressCmd {
|
||||||
|
/// Get the next unused address.
|
||||||
|
Next,
|
||||||
|
/// Get a new address regardless of the existing unused addresses.
|
||||||
|
New,
|
||||||
|
/// List all addresses
|
||||||
|
List {
|
||||||
|
/// List change addresses
|
||||||
|
#[clap(long)]
|
||||||
|
change: bool,
|
||||||
|
},
|
||||||
|
/// Get last revealed address index for each keychain.
|
||||||
|
Index,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Subcommand, Debug, Clone)]
|
||||||
|
pub enum TxOutCmd {
|
||||||
|
/// List transaction outputs.
|
||||||
|
List {
|
||||||
|
/// Return only spent outputs.
|
||||||
|
#[clap(short, long)]
|
||||||
|
spent: bool,
|
||||||
|
/// Return only unspent outputs.
|
||||||
|
#[clap(short, long)]
|
||||||
|
unspent: bool,
|
||||||
|
/// Return only confirmed outputs.
|
||||||
|
#[clap(long)]
|
||||||
|
confirmed: bool,
|
||||||
|
/// Return only unconfirmed outputs.
|
||||||
|
#[clap(long)]
|
||||||
|
unconfirmed: bool,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(
|
||||||
|
Debug, Clone, Copy, PartialOrd, Ord, PartialEq, Eq, serde::Deserialize, serde::Serialize,
|
||||||
|
)]
|
||||||
|
pub enum Keychain {
|
||||||
|
External,
|
||||||
|
Internal,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Display for Keychain {
|
||||||
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Keychain::External => write!(f, "external"),
|
||||||
|
Keychain::Internal => write!(f, "internal"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub struct CreateTxChange {
|
||||||
|
pub index_changeset: keychain::ChangeSet<Keychain>,
|
||||||
|
pub change_keychain: Keychain,
|
||||||
|
pub index: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn create_tx<A: Anchor, O: ChainOracle>(
|
||||||
|
graph: &mut KeychainTxGraph<A>,
|
||||||
|
chain: &O,
|
||||||
|
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||||
|
cs_algorithm: CoinSelectionAlgo,
|
||||||
|
address: Address,
|
||||||
|
value: u64,
|
||||||
|
) -> anyhow::Result<(Transaction, Option<CreateTxChange>)>
|
||||||
|
where
|
||||||
|
O::Error: std::error::Error + Send + Sync + 'static,
|
||||||
|
{
|
||||||
|
let mut changeset = keychain::ChangeSet::default();
|
||||||
|
|
||||||
|
let assets = bdk_tmp_plan::Assets {
|
||||||
|
keys: keymap.iter().map(|(pk, _)| pk.clone()).collect(),
|
||||||
|
..Default::default()
|
||||||
|
};
|
||||||
|
|
||||||
|
// TODO use planning module
|
||||||
|
let mut candidates = planned_utxos(graph, chain, &assets)?;
|
||||||
|
|
||||||
|
// apply coin selection algorithm
|
||||||
|
match cs_algorithm {
|
||||||
|
CoinSelectionAlgo::LargestFirst => {
|
||||||
|
candidates.sort_by_key(|(_, utxo)| Reverse(utxo.txout.value))
|
||||||
|
}
|
||||||
|
CoinSelectionAlgo::SmallestFirst => candidates.sort_by_key(|(_, utxo)| utxo.txout.value),
|
||||||
|
CoinSelectionAlgo::OldestFirst => {
|
||||||
|
candidates.sort_by_key(|(_, utxo)| utxo.chain_position.clone())
|
||||||
|
}
|
||||||
|
CoinSelectionAlgo::NewestFirst => {
|
||||||
|
candidates.sort_by_key(|(_, utxo)| Reverse(utxo.chain_position.clone()))
|
||||||
|
}
|
||||||
|
CoinSelectionAlgo::BranchAndBound => {}
|
||||||
|
}
|
||||||
|
|
||||||
|
// turn the txos we chose into weight and value
|
||||||
|
let wv_candidates = candidates
|
||||||
|
.iter()
|
||||||
|
.map(|(plan, utxo)| {
|
||||||
|
WeightedValue::new(
|
||||||
|
utxo.txout.value,
|
||||||
|
plan.expected_weight() as _,
|
||||||
|
plan.witness_version().is_some(),
|
||||||
|
)
|
||||||
|
})
|
||||||
|
.collect();
|
||||||
|
|
||||||
|
let mut outputs = vec![TxOut {
|
||||||
|
value,
|
||||||
|
script_pubkey: address.script_pubkey(),
|
||||||
|
}];
|
||||||
|
|
||||||
|
let internal_keychain = if graph.index.keychains().get(&Keychain::Internal).is_some() {
|
||||||
|
Keychain::Internal
|
||||||
|
} else {
|
||||||
|
Keychain::External
|
||||||
|
};
|
||||||
|
|
||||||
|
let ((change_index, change_script), change_changeset) =
|
||||||
|
graph.index.next_unused_spk(&internal_keychain);
|
||||||
|
changeset.append(change_changeset);
|
||||||
|
|
||||||
|
// Clone to drop the immutable reference.
|
||||||
|
let change_script = change_script.into();
|
||||||
|
|
||||||
|
let change_plan = bdk_tmp_plan::plan_satisfaction(
|
||||||
|
&graph
|
||||||
|
.index
|
||||||
|
.keychains()
|
||||||
|
.get(&internal_keychain)
|
||||||
|
.expect("must exist")
|
||||||
|
.at_derivation_index(change_index)
|
||||||
|
.expect("change_index can't be hardened"),
|
||||||
|
&assets,
|
||||||
|
)
|
||||||
|
.expect("failed to obtain change plan");
|
||||||
|
|
||||||
|
let mut change_output = TxOut {
|
||||||
|
value: 0,
|
||||||
|
script_pubkey: change_script,
|
||||||
|
};
|
||||||
|
|
||||||
|
let cs_opts = CoinSelectorOpt {
|
||||||
|
target_feerate: 0.5,
|
||||||
|
min_drain_value: graph
|
||||||
|
.index
|
||||||
|
.keychains()
|
||||||
|
.get(&internal_keychain)
|
||||||
|
.expect("must exist")
|
||||||
|
.dust_value(),
|
||||||
|
..CoinSelectorOpt::fund_outputs(
|
||||||
|
&outputs,
|
||||||
|
&change_output,
|
||||||
|
change_plan.expected_weight() as u32,
|
||||||
|
)
|
||||||
|
};
|
||||||
|
|
||||||
|
// TODO: How can we make it easy to shuffle in order of inputs and outputs here?
|
||||||
|
// apply coin selection by saying we need to fund these outputs
|
||||||
|
let mut coin_selector = CoinSelector::new(&wv_candidates, &cs_opts);
|
||||||
|
|
||||||
|
// just select coins in the order provided until we have enough
|
||||||
|
// only use the first result (least waste)
|
||||||
|
let selection = match cs_algorithm {
|
||||||
|
CoinSelectionAlgo::BranchAndBound => {
|
||||||
|
coin_select_bnb(Duration::from_secs(10), coin_selector.clone())
|
||||||
|
.map_or_else(|| coin_selector.select_until_finished(), |cs| cs.finish())?
|
||||||
|
}
|
||||||
|
_ => coin_selector.select_until_finished()?,
|
||||||
|
};
|
||||||
|
let (_, selection_meta) = selection.best_strategy();
|
||||||
|
|
||||||
|
// get the selected utxos
|
||||||
|
let selected_txos = selection.apply_selection(&candidates).collect::<Vec<_>>();
|
||||||
|
|
||||||
|
if let Some(drain_value) = selection_meta.drain_value {
|
||||||
|
change_output.value = drain_value;
|
||||||
|
// if the selection tells us to use change and the change value is sufficient, we add it as an output
|
||||||
|
outputs.push(change_output)
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut transaction = Transaction {
|
||||||
|
version: 0x02,
|
||||||
|
// because the temporary planning module does not support timelocks, we can use the chain
|
||||||
|
// tip as the `lock_time` for anti-fee-sniping purposes
|
||||||
|
lock_time: absolute::LockTime::from_height(chain.get_chain_tip()?.height)
|
||||||
|
.expect("invalid height"),
|
||||||
|
input: selected_txos
|
||||||
|
.iter()
|
||||||
|
.map(|(_, utxo)| TxIn {
|
||||||
|
previous_output: utxo.outpoint,
|
||||||
|
sequence: Sequence::ENABLE_RBF_NO_LOCKTIME,
|
||||||
|
..Default::default()
|
||||||
|
})
|
||||||
|
.collect(),
|
||||||
|
output: outputs,
|
||||||
|
};
|
||||||
|
|
||||||
|
let prevouts = selected_txos
|
||||||
|
.iter()
|
||||||
|
.map(|(_, utxo)| utxo.txout.clone())
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
let sighash_prevouts = Prevouts::All(&prevouts);
|
||||||
|
|
||||||
|
// first, set tx values for the plan so that we don't change them while signing
|
||||||
|
for (i, (plan, _)) in selected_txos.iter().enumerate() {
|
||||||
|
if let Some(sequence) = plan.required_sequence() {
|
||||||
|
transaction.input[i].sequence = sequence
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// create a short lived transaction
|
||||||
|
let _sighash_tx = transaction.clone();
|
||||||
|
let mut sighash_cache = SighashCache::new(&_sighash_tx);
|
||||||
|
|
||||||
|
for (i, (plan, _)) in selected_txos.iter().enumerate() {
|
||||||
|
let requirements = plan.requirements();
|
||||||
|
let mut auth_data = bdk_tmp_plan::SatisfactionMaterial::default();
|
||||||
|
assert!(
|
||||||
|
!requirements.requires_hash_preimages(),
|
||||||
|
"can't have hash pre-images since we didn't provide any."
|
||||||
|
);
|
||||||
|
assert!(
|
||||||
|
requirements.signatures.sign_with_keymap(
|
||||||
|
i,
|
||||||
|
keymap,
|
||||||
|
&sighash_prevouts,
|
||||||
|
None,
|
||||||
|
None,
|
||||||
|
&mut sighash_cache,
|
||||||
|
&mut auth_data,
|
||||||
|
&Secp256k1::default(),
|
||||||
|
)?,
|
||||||
|
"we should have signed with this input."
|
||||||
|
);
|
||||||
|
|
||||||
|
match plan.try_complete(&auth_data) {
|
||||||
|
bdk_tmp_plan::PlanState::Complete {
|
||||||
|
final_script_sig,
|
||||||
|
final_script_witness,
|
||||||
|
} => {
|
||||||
|
if let Some(witness) = final_script_witness {
|
||||||
|
transaction.input[i].witness = witness;
|
||||||
|
}
|
||||||
|
|
||||||
|
if let Some(script_sig) = final_script_sig {
|
||||||
|
transaction.input[i].script_sig = script_sig;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
bdk_tmp_plan::PlanState::Incomplete(_) => {
|
||||||
|
return Err(anyhow::anyhow!(
|
||||||
|
"we weren't able to complete the plan with our keys."
|
||||||
|
));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let change_info = if selection_meta.drain_value.is_some() {
|
||||||
|
Some(CreateTxChange {
|
||||||
|
index_changeset: changeset,
|
||||||
|
change_keychain: internal_keychain,
|
||||||
|
index: change_index,
|
||||||
|
})
|
||||||
|
} else {
|
||||||
|
None
|
||||||
|
};
|
||||||
|
|
||||||
|
Ok((transaction, change_info))
|
||||||
|
}
|
||||||
|
|
||||||
|
// Alias the elements of `Result` of `planned_utxos`
|
||||||
|
pub type PlannedUtxo<K, A> = (bdk_tmp_plan::Plan<K>, FullTxOut<A>);
|
||||||
|
|
||||||
|
pub fn planned_utxos<A: Anchor, O: ChainOracle, K: Clone + bdk_tmp_plan::CanDerive>(
|
||||||
|
graph: &KeychainTxGraph<A>,
|
||||||
|
chain: &O,
|
||||||
|
assets: &bdk_tmp_plan::Assets<K>,
|
||||||
|
) -> Result<Vec<PlannedUtxo<K, A>>, O::Error> {
|
||||||
|
let chain_tip = chain.get_chain_tip()?;
|
||||||
|
let outpoints = graph.index.outpoints().iter().cloned();
|
||||||
|
graph
|
||||||
|
.graph()
|
||||||
|
.try_filter_chain_unspents(chain, chain_tip, outpoints)
|
||||||
|
.filter_map(|r| -> Option<Result<PlannedUtxo<K, A>, _>> {
|
||||||
|
let (k, i, full_txo) = match r {
|
||||||
|
Err(err) => return Some(Err(err)),
|
||||||
|
Ok(((k, i), full_txo)) => (k, i, full_txo),
|
||||||
|
};
|
||||||
|
let desc = graph
|
||||||
|
.index
|
||||||
|
.keychains()
|
||||||
|
.get(&k)
|
||||||
|
.expect("keychain must exist")
|
||||||
|
.at_derivation_index(i)
|
||||||
|
.expect("i can't be hardened");
|
||||||
|
let plan = bdk_tmp_plan::plan_satisfaction(&desc, assets)?;
|
||||||
|
Some(Ok((plan, full_txo)))
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn handle_commands<CS: clap::Subcommand, S: clap::Args, A: Anchor, O: ChainOracle, C>(
|
||||||
|
graph: &Mutex<KeychainTxGraph<A>>,
|
||||||
|
db: &Mutex<Database<C>>,
|
||||||
|
chain: &Mutex<O>,
|
||||||
|
keymap: &HashMap<DescriptorPublicKey, DescriptorSecretKey>,
|
||||||
|
network: Network,
|
||||||
|
broadcast: impl FnOnce(S, &Transaction) -> anyhow::Result<()>,
|
||||||
|
cmd: Commands<CS, S>,
|
||||||
|
) -> anyhow::Result<()>
|
||||||
|
where
|
||||||
|
O::Error: std::error::Error + Send + Sync + 'static,
|
||||||
|
C: Default + Append + DeserializeOwned + Serialize + From<KeychainChangeSet<A>>,
|
||||||
|
{
|
||||||
|
match cmd {
|
||||||
|
Commands::ChainSpecific(_) => unreachable!("example code should handle this!"),
|
||||||
|
Commands::Address { addr_cmd } => {
|
||||||
|
let graph = &mut *graph.lock().unwrap();
|
||||||
|
let index = &mut graph.index;
|
||||||
|
|
||||||
|
match addr_cmd {
|
||||||
|
AddressCmd::Next | AddressCmd::New => {
|
||||||
|
let spk_chooser = match addr_cmd {
|
||||||
|
AddressCmd::Next => KeychainTxOutIndex::next_unused_spk,
|
||||||
|
AddressCmd::New => KeychainTxOutIndex::reveal_next_spk,
|
||||||
|
_ => unreachable!("only these two variants exist in match arm"),
|
||||||
|
};
|
||||||
|
|
||||||
|
let ((spk_i, spk), index_changeset) = spk_chooser(index, &Keychain::External);
|
||||||
|
let db = &mut *db.lock().unwrap();
|
||||||
|
db.stage_and_commit(C::from((
|
||||||
|
local_chain::ChangeSet::default(),
|
||||||
|
indexed_tx_graph::ChangeSet::from(index_changeset),
|
||||||
|
)))?;
|
||||||
|
let addr =
|
||||||
|
Address::from_script(spk, network).context("failed to derive address")?;
|
||||||
|
println!("[address @ {}] {}", spk_i, addr);
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
AddressCmd::Index => {
|
||||||
|
for (keychain, derivation_index) in index.last_revealed_indices() {
|
||||||
|
println!("{:?}: {}", keychain, derivation_index);
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
AddressCmd::List { change } => {
|
||||||
|
let target_keychain = match change {
|
||||||
|
true => Keychain::Internal,
|
||||||
|
false => Keychain::External,
|
||||||
|
};
|
||||||
|
for (spk_i, spk) in index.revealed_keychain_spks(&target_keychain) {
|
||||||
|
let address = Address::from_script(spk, network)
|
||||||
|
.expect("should always be able to derive address");
|
||||||
|
println!(
|
||||||
|
"{:?} {} used:{}",
|
||||||
|
spk_i,
|
||||||
|
address,
|
||||||
|
index.is_used(target_keychain, spk_i)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Commands::Balance => {
|
||||||
|
let graph = &*graph.lock().unwrap();
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
fn print_balances<'a>(
|
||||||
|
title_str: &'a str,
|
||||||
|
items: impl IntoIterator<Item = (&'a str, u64)>,
|
||||||
|
) {
|
||||||
|
println!("{}:", title_str);
|
||||||
|
for (name, amount) in items.into_iter() {
|
||||||
|
println!(" {:<10} {:>12} sats", name, amount)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let balance = graph.graph().try_balance(
|
||||||
|
chain,
|
||||||
|
chain.get_chain_tip()?,
|
||||||
|
graph.index.outpoints().iter().cloned(),
|
||||||
|
|(k, _), _| k == &Keychain::Internal,
|
||||||
|
)?;
|
||||||
|
|
||||||
|
let confirmed_total = balance.confirmed + balance.immature;
|
||||||
|
let unconfirmed_total = balance.untrusted_pending + balance.trusted_pending;
|
||||||
|
|
||||||
|
print_balances(
|
||||||
|
"confirmed",
|
||||||
|
[
|
||||||
|
("total", confirmed_total),
|
||||||
|
("spendable", balance.confirmed),
|
||||||
|
("immature", balance.immature),
|
||||||
|
],
|
||||||
|
);
|
||||||
|
print_balances(
|
||||||
|
"unconfirmed",
|
||||||
|
[
|
||||||
|
("total", unconfirmed_total),
|
||||||
|
("trusted", balance.trusted_pending),
|
||||||
|
("untrusted", balance.untrusted_pending),
|
||||||
|
],
|
||||||
|
);
|
||||||
|
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
Commands::TxOut { txout_cmd } => {
|
||||||
|
let graph = &*graph.lock().unwrap();
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
let chain_tip = chain.get_chain_tip()?;
|
||||||
|
let outpoints = graph.index.outpoints().iter().cloned();
|
||||||
|
|
||||||
|
match txout_cmd {
|
||||||
|
TxOutCmd::List {
|
||||||
|
spent,
|
||||||
|
unspent,
|
||||||
|
confirmed,
|
||||||
|
unconfirmed,
|
||||||
|
} => {
|
||||||
|
let txouts = graph
|
||||||
|
.graph()
|
||||||
|
.try_filter_chain_txouts(chain, chain_tip, outpoints)
|
||||||
|
.filter(|r| match r {
|
||||||
|
Ok((_, full_txo)) => match (spent, unspent) {
|
||||||
|
(true, false) => full_txo.spent_by.is_some(),
|
||||||
|
(false, true) => full_txo.spent_by.is_none(),
|
||||||
|
_ => true,
|
||||||
|
},
|
||||||
|
// always keep errored items
|
||||||
|
Err(_) => true,
|
||||||
|
})
|
||||||
|
.filter(|r| match r {
|
||||||
|
Ok((_, full_txo)) => match (confirmed, unconfirmed) {
|
||||||
|
(true, false) => full_txo.chain_position.is_confirmed(),
|
||||||
|
(false, true) => !full_txo.chain_position.is_confirmed(),
|
||||||
|
_ => true,
|
||||||
|
},
|
||||||
|
// always keep errored items
|
||||||
|
Err(_) => true,
|
||||||
|
})
|
||||||
|
.collect::<Result<Vec<_>, _>>()?;
|
||||||
|
|
||||||
|
for (spk_i, full_txo) in txouts {
|
||||||
|
let addr = Address::from_script(&full_txo.txout.script_pubkey, network)?;
|
||||||
|
println!(
|
||||||
|
"{:?} {} {} {} spent:{:?}",
|
||||||
|
spk_i, full_txo.txout.value, full_txo.outpoint, addr, full_txo.spent_by
|
||||||
|
)
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Commands::Send {
|
||||||
|
value,
|
||||||
|
address,
|
||||||
|
coin_select,
|
||||||
|
chain_specific,
|
||||||
|
} => {
|
||||||
|
let chain = &*chain.lock().unwrap();
|
||||||
|
let address = address.require_network(network)?;
|
||||||
|
let (transaction, change_index) = {
|
||||||
|
let graph = &mut *graph.lock().unwrap();
|
||||||
|
// take mutable ref to construct tx -- it is only open for a short time while building it.
|
||||||
|
let (tx, change_info) =
|
||||||
|
create_tx(graph, chain, keymap, coin_select, address, value)?;
|
||||||
|
|
||||||
|
if let Some(CreateTxChange {
|
||||||
|
index_changeset,
|
||||||
|
change_keychain,
|
||||||
|
index,
|
||||||
|
}) = change_info
|
||||||
|
{
|
||||||
|
// We must first persist to disk the fact that we've got a new address from the
|
||||||
|
// change keychain so future scans will find the tx we're about to broadcast.
|
||||||
|
// If we're unable to persist this, then we don't want to broadcast.
|
||||||
|
{
|
||||||
|
let db = &mut *db.lock().unwrap();
|
||||||
|
db.stage_and_commit(C::from((
|
||||||
|
local_chain::ChangeSet::default(),
|
||||||
|
indexed_tx_graph::ChangeSet::from(index_changeset),
|
||||||
|
)))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
// We don't want other callers/threads to use this address while we're using it
|
||||||
|
// but we also don't want to scan the tx we just created because it's not
|
||||||
|
// technically in the blockchain yet.
|
||||||
|
graph.index.mark_used(change_keychain, index);
|
||||||
|
(tx, Some((change_keychain, index)))
|
||||||
|
} else {
|
||||||
|
(tx, None)
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
match (broadcast)(chain_specific, &transaction) {
|
||||||
|
Ok(_) => {
|
||||||
|
println!("Broadcasted Tx : {}", transaction.txid());
|
||||||
|
|
||||||
|
let keychain_changeset = graph.lock().unwrap().insert_tx(transaction);
|
||||||
|
|
||||||
|
// We know the tx is at least unconfirmed now. Note if persisting here fails,
|
||||||
|
// it's not a big deal since we can always find it again form
|
||||||
|
// blockchain.
|
||||||
|
db.lock().unwrap().stage_and_commit(C::from((
|
||||||
|
local_chain::ChangeSet::default(),
|
||||||
|
keychain_changeset,
|
||||||
|
)))?;
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
Err(e) => {
|
||||||
|
if let Some((keychain, index)) = change_index {
|
||||||
|
// We failed to broadcast, so allow our change address to be used in the future
|
||||||
|
graph.lock().unwrap().index.unmark_used(keychain, index);
|
||||||
|
}
|
||||||
|
Err(e)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The initial state returned by [`init`].
|
||||||
|
pub struct Init<CS: clap::Subcommand, S: clap::Args, C> {
|
||||||
|
/// Arguments parsed by the cli.
|
||||||
|
pub args: Args<CS, S>,
|
||||||
|
/// Descriptor keymap.
|
||||||
|
pub keymap: KeyMap,
|
||||||
|
/// Keychain-txout index.
|
||||||
|
pub index: KeychainTxOutIndex<Keychain>,
|
||||||
|
/// Persistence backend.
|
||||||
|
pub db: Mutex<Database<C>>,
|
||||||
|
/// Initial changeset.
|
||||||
|
pub init_changeset: C,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Parses command line arguments and initializes all components, creating
|
||||||
|
/// a file store with the given parameters, or loading one if it exists.
|
||||||
|
pub fn init<CS: clap::Subcommand, S: clap::Args, C>(
|
||||||
|
db_magic: &[u8],
|
||||||
|
db_default_path: &str,
|
||||||
|
) -> anyhow::Result<Init<CS, S, C>>
|
||||||
|
where
|
||||||
|
C: Default + Append + Serialize + DeserializeOwned,
|
||||||
|
{
|
||||||
|
if std::env::var("BDK_DB_PATH").is_err() {
|
||||||
|
std::env::set_var("BDK_DB_PATH", db_default_path);
|
||||||
|
}
|
||||||
|
let args = Args::<CS, S>::parse();
|
||||||
|
let secp = Secp256k1::default();
|
||||||
|
|
||||||
|
let mut index = KeychainTxOutIndex::<Keychain>::default();
|
||||||
|
|
||||||
|
let (descriptor, mut keymap) =
|
||||||
|
Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &args.descriptor)?;
|
||||||
|
index.add_keychain(Keychain::External, descriptor);
|
||||||
|
|
||||||
|
if let Some((internal_descriptor, internal_keymap)) = args
|
||||||
|
.change_descriptor
|
||||||
|
.as_ref()
|
||||||
|
.map(|desc_str| Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, desc_str))
|
||||||
|
.transpose()?
|
||||||
|
{
|
||||||
|
keymap.extend(internal_keymap);
|
||||||
|
index.add_keychain(Keychain::Internal, internal_descriptor);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut db_backend = match Store::<C>::open_or_create_new(db_magic, &args.db_path) {
|
||||||
|
Ok(db_backend) => db_backend,
|
||||||
|
// we cannot return `err` directly as it has lifetime `'m`
|
||||||
|
Err(err) => return Err(anyhow::anyhow!("failed to init db backend: {:?}", err)),
|
||||||
|
};
|
||||||
|
|
||||||
|
let init_changeset = db_backend.load_from_persistence()?.unwrap_or_default();
|
||||||
|
|
||||||
|
Ok(Init {
|
||||||
|
args,
|
||||||
|
keymap,
|
||||||
|
index,
|
||||||
|
db: Mutex::new(Database::new(db_backend)),
|
||||||
|
init_changeset,
|
||||||
|
})
|
||||||
|
}
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user