build!: Update bdk to rust-bitcoin 0.30.0
This commit is contained in:
parent
0ba6bbe114
commit
958e72877c
20
Cargo.toml
20
Cargo.toml
@ -14,16 +14,16 @@ license = "MIT OR Apache-2.0"
|
|||||||
[dependencies]
|
[dependencies]
|
||||||
bdk-macros = "^0.6"
|
bdk-macros = "^0.6"
|
||||||
log = "0.4"
|
log = "0.4"
|
||||||
miniscript = { version = "9.0", default-features = false, features = ["serde"] }
|
miniscript = { version = "10.0", default-features = false, features = ["serde"] }
|
||||||
bitcoin = { version = "0.29.2", default-features = false, features = ["serde", "base64", "rand"] }
|
bitcoin = { version = "0.30", default-features = false, features = ["serde", "base64", "rand-std"] }
|
||||||
serde = { version = "^1.0", features = ["derive"] }
|
serde = { version = "^1.0", features = ["derive"] }
|
||||||
serde_json = { version = "^1.0" }
|
serde_json = { version = "^1.0" }
|
||||||
rand = "^0.8"
|
rand = "^0.8"
|
||||||
|
|
||||||
# Optional dependencies
|
# Optional dependencies
|
||||||
sled = { version = "0.34", optional = true }
|
sled = { version = "0.34", optional = true }
|
||||||
electrum-client = { version = "0.12", optional = true }
|
electrum-client = { version = "0.18", optional = true }
|
||||||
esplora-client = { version = "0.4", default-features = false, optional = true }
|
esplora-client = { version = "0.6", default-features = false, optional = true }
|
||||||
rusqlite = { version = "0.28.0", optional = true }
|
rusqlite = { version = "0.28.0", optional = true }
|
||||||
ahash = { version = "0.7.6", optional = true }
|
ahash = { version = "0.7.6", optional = true }
|
||||||
futures = { version = "0.3", optional = true }
|
futures = { version = "0.3", optional = true }
|
||||||
@ -31,13 +31,13 @@ async-trait = { version = "0.1", optional = true }
|
|||||||
rocksdb = { version = "0.14", default-features = false, features = ["snappy"], optional = true }
|
rocksdb = { version = "0.14", default-features = false, features = ["snappy"], optional = true }
|
||||||
cc = { version = ">=1.0.64", optional = true }
|
cc = { version = ">=1.0.64", optional = true }
|
||||||
socks = { version = "0.3", optional = true }
|
socks = { version = "0.3", optional = true }
|
||||||
hwi = { version = "0.5", optional = true, features = ["use-miniscript"] }
|
hwi = { version = "0.7", optional = true, features = ["miniscript"] }
|
||||||
|
|
||||||
bip39 = { version = "2.0.0", optional = true }
|
bip39 = { version = "2.0.0", optional = true }
|
||||||
bitcoinconsensus = { version = "0.19.0-3", optional = true }
|
bitcoinconsensus = { version = "0.19.0-3", optional = true }
|
||||||
|
|
||||||
# Needed by bdk_blockchain_tests macro and the `rpc` feature
|
# Needed by bdk_blockchain_tests macro and the `rpc` feature
|
||||||
bitcoincore-rpc = { version = "0.16", optional = true }
|
bitcoincore-rpc = { package="core-rpc", version = "0.17", optional = true }
|
||||||
|
|
||||||
# Platform-specific dependencies
|
# Platform-specific dependencies
|
||||||
[target.'cfg(not(target_arch = "wasm32"))'.dependencies]
|
[target.'cfg(not(target_arch = "wasm32"))'.dependencies]
|
||||||
@ -107,13 +107,11 @@ test-hardware-signer = ["hardware-signer"]
|
|||||||
dev-getrandom-wasm = ["getrandom/js"]
|
dev-getrandom-wasm = ["getrandom/js"]
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
miniscript = { version = "9.0", features = ["std"] }
|
miniscript = { version = "10.0", features = ["std"] }
|
||||||
bitcoin = { version = "0.29.2", features = ["std"] }
|
bitcoin = { version = "0.30", features = ["std"] }
|
||||||
lazy_static = "1.4"
|
lazy_static = "1.4"
|
||||||
env_logger = { version = "0.7", default-features = false }
|
env_logger = { version = "0.7", default-features = false }
|
||||||
electrsd = "0.22"
|
electrsd = "0.24"
|
||||||
# Remove after upgrade to rust-bitcoin ^0.30 where base64 is re-exported
|
|
||||||
base64 = "^0.13"
|
|
||||||
assert_matches = "1.5.0"
|
assert_matches = "1.5.0"
|
||||||
|
|
||||||
[[example]]
|
[[example]]
|
||||||
|
10
README.md
10
README.md
@ -96,7 +96,7 @@ use bdk::blockchain::ElectrumBlockchain;
|
|||||||
use bdk::electrum_client::Client;
|
use bdk::electrum_client::Client;
|
||||||
use bdk::wallet::AddressIndex::New;
|
use bdk::wallet::AddressIndex::New;
|
||||||
|
|
||||||
use base64;
|
use bitcoin::base64;
|
||||||
use bdk::bitcoin::consensus::serialize;
|
use bdk::bitcoin::consensus::serialize;
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
|
|
||||||
@ -123,7 +123,7 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
};
|
};
|
||||||
|
|
||||||
println!("Transaction details: {:#?}", details);
|
println!("Transaction details: {:#?}", details);
|
||||||
println!("Unsigned PSBT: {}", base64::encode(&serialize(&psbt)));
|
println!("Unsigned PSBT: {}", base64::encode(psbt.serialize()));
|
||||||
|
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
@ -134,9 +134,9 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
```rust,no_run
|
```rust,no_run
|
||||||
use bdk::{Wallet, SignOptions, database::MemoryDatabase};
|
use bdk::{Wallet, SignOptions, database::MemoryDatabase};
|
||||||
|
|
||||||
use base64;
|
use bitcoin::base64;
|
||||||
use bdk::bitcoin::consensus::deserialize;
|
use bdk::bitcoin::consensus::deserialize;
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::{psbt::Psbt, Network};
|
||||||
|
|
||||||
fn main() -> Result<(), bdk::Error> {
|
fn main() -> Result<(), bdk::Error> {
|
||||||
let wallet = Wallet::new(
|
let wallet = Wallet::new(
|
||||||
@ -147,7 +147,7 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
)?;
|
)?;
|
||||||
|
|
||||||
let psbt = "...";
|
let psbt = "...";
|
||||||
let mut psbt = deserialize(&base64::decode(psbt).unwrap())?;
|
let mut psbt = Psbt::deserialize(&base64::decode(psbt).unwrap())?;
|
||||||
|
|
||||||
let _finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
let _finalized = wallet.sign(&mut psbt, SignOptions::default())?;
|
||||||
|
|
||||||
|
@ -1,6 +1,6 @@
|
|||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use bdk::bitcoin::util::bip32::ExtendedPrivKey;
|
use bdk::bitcoin::bip32::ExtendedPrivKey;
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||||
use bdk::database::MemoryDatabase;
|
use bdk::database::MemoryDatabase;
|
||||||
@ -10,7 +10,7 @@ use bdk::{KeychainKind, SyncOptions, Wallet};
|
|||||||
|
|
||||||
use bdk::electrum_client::Client;
|
use bdk::electrum_client::Client;
|
||||||
use bdk::wallet::AddressIndex;
|
use bdk::wallet::AddressIndex;
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
pub mod utils;
|
pub mod utils;
|
||||||
|
|
||||||
|
@ -9,7 +9,7 @@ use bdk::{
|
|||||||
KeychainKind, SyncOptions, Wallet,
|
KeychainKind, SyncOptions, Wallet,
|
||||||
};
|
};
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
util::bip32::{self, ExtendedPrivKey},
|
bip32::{self, ExtendedPrivKey},
|
||||||
Network,
|
Network,
|
||||||
};
|
};
|
||||||
|
|
||||||
|
@ -9,7 +9,7 @@ use bdk::{
|
|||||||
KeychainKind, SyncOptions, Wallet,
|
KeychainKind, SyncOptions, Wallet,
|
||||||
};
|
};
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
util::bip32::{self, ExtendedPrivKey},
|
bip32::{self, ExtendedPrivKey},
|
||||||
Network,
|
Network,
|
||||||
};
|
};
|
||||||
|
|
||||||
|
@ -1,7 +1,7 @@
|
|||||||
use bdk::bitcoin::{Address, Network};
|
use bdk::bitcoin::{Address, Network};
|
||||||
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
use bdk::blockchain::{Blockchain, ElectrumBlockchain};
|
||||||
use bdk::database::MemoryDatabase;
|
use bdk::database::MemoryDatabase;
|
||||||
use bdk::hwi::{types::HWIChain, HWIClient};
|
use bdk::hwi::HWIClient;
|
||||||
use bdk::miniscript::{Descriptor, DescriptorPublicKey};
|
use bdk::miniscript::{Descriptor, DescriptorPublicKey};
|
||||||
use bdk::signer::SignerOrdering;
|
use bdk::signer::SignerOrdering;
|
||||||
use bdk::wallet::{hardwaresigner::HWISigner, AddressIndex};
|
use bdk::wallet::{hardwaresigner::HWISigner, AddressIndex};
|
||||||
@ -30,7 +30,7 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
|||||||
}
|
}
|
||||||
let first_device = devices.remove(0)?;
|
let first_device = devices.remove(0)?;
|
||||||
// ...and creating a client out of the first one
|
// ...and creating a client out of the first one
|
||||||
let client = HWIClient::get_client(&first_device, true, HWIChain::Test)?;
|
let client = HWIClient::get_client(&first_device, true, Network::Testnet.into())?;
|
||||||
println!("Look what I found, a {}!", first_device.model);
|
println!("Look what I found, a {}!", first_device.model);
|
||||||
|
|
||||||
// Getting the HW's public descriptors
|
// Getting the HW's public descriptors
|
||||||
@ -41,7 +41,7 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
|||||||
);
|
);
|
||||||
|
|
||||||
// Creating a custom signer from the device
|
// Creating a custom signer from the device
|
||||||
let custom_signer = HWISigner::from_device(&first_device, HWIChain::Test)?;
|
let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
let mut wallet = Wallet::new(
|
let mut wallet = Wallet::new(
|
||||||
descriptors.receive[0].clone(),
|
descriptors.receive[0].clone(),
|
||||||
Some(descriptors.internal[0].clone()),
|
Some(descriptors.internal[0].clone()),
|
||||||
@ -77,7 +77,8 @@ fn main() -> Result<(), Box<dyn std::error::Error>> {
|
|||||||
return Ok(());
|
return Ok(());
|
||||||
}
|
}
|
||||||
|
|
||||||
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?;
|
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
let (mut psbt, _details) = {
|
let (mut psbt, _details) = {
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
|
@ -6,8 +6,8 @@
|
|||||||
// You may not use this file except in accordance with one or both of these
|
// You may not use this file except in accordance with one or both of these
|
||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
|
use bdk::bitcoin::bip32::DerivationPath;
|
||||||
use bdk::bitcoin::secp256k1::Secp256k1;
|
use bdk::bitcoin::secp256k1::Secp256k1;
|
||||||
use bdk::bitcoin::util::bip32::DerivationPath;
|
|
||||||
use bdk::bitcoin::Network;
|
use bdk::bitcoin::Network;
|
||||||
use bdk::descriptor;
|
use bdk::descriptor;
|
||||||
use bdk::descriptor::IntoWalletDescriptor;
|
use bdk::descriptor::IntoWalletDescriptor;
|
||||||
|
@ -92,7 +92,8 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
println!("Creating a PSBT sending 9800 SATs plus fee to the u01.net testnet faucet return address 'tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt'.");
|
println!("Creating a PSBT sending 9800 SATs plus fee to the u01.net testnet faucet return address 'tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt'.");
|
||||||
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?;
|
let return_address = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")?
|
||||||
|
.require_network(Network::Testnet)?;
|
||||||
let mut builder = watch_only_wallet.build_tx();
|
let mut builder = watch_only_wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(return_address.script_pubkey(), 9_800)
|
.add_recipient(return_address.script_pubkey(), 9_800)
|
||||||
|
@ -62,7 +62,10 @@ fn main() -> Result<(), Box<dyn Error>> {
|
|||||||
};
|
};
|
||||||
|
|
||||||
// Get a new core address
|
// Get a new core address
|
||||||
let core_address = bitcoind.client.get_new_address(None, None)?;
|
let core_address = bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)?
|
||||||
|
.require_network(Network::Regtest)?;
|
||||||
|
|
||||||
// Generate 101 blocks and use the above address as coinbase
|
// Generate 101 blocks and use the above address as coinbase
|
||||||
bitcoind.client.generate_to_address(101, &core_address)?;
|
bitcoind.client.generate_to_address(101, &core_address)?;
|
||||||
|
@ -13,7 +13,10 @@ pub(crate) mod tx {
|
|||||||
// Create a transaction builder
|
// Create a transaction builder
|
||||||
let mut tx_builder = wallet.build_tx();
|
let mut tx_builder = wallet.build_tx();
|
||||||
|
|
||||||
let to_address = Address::from_str(recipient_address).unwrap();
|
let to_address = Address::from_str(recipient_address)
|
||||||
|
.unwrap()
|
||||||
|
.require_network(wallet.network())
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
// Set recipient of the transaction
|
// Set recipient of the transaction
|
||||||
tx_builder.set_recipients(vec![(to_address.script_pubkey(), amount)]);
|
tx_builder.set_recipients(vec![(to_address.script_pubkey(), amount)]);
|
||||||
|
@ -355,7 +355,7 @@ impl WalletSync for CompactFiltersBlockchain {
|
|||||||
peer,
|
peer,
|
||||||
|block_hash, filter| {
|
|block_hash, filter| {
|
||||||
if !filter
|
if !filter
|
||||||
.match_any(block_hash, &mut all_scripts.iter().map(AsRef::as_ref))?
|
.match_any(block_hash, all_scripts.iter().map(|s| s.as_slice()))?
|
||||||
{
|
{
|
||||||
return Ok(false);
|
return Ok(false);
|
||||||
}
|
}
|
||||||
@ -570,7 +570,7 @@ pub enum CompactFiltersError {
|
|||||||
/// Internal I/O error
|
/// Internal I/O error
|
||||||
Io(std::io::Error),
|
Io(std::io::Error),
|
||||||
/// Invalid BIP158 filter
|
/// Invalid BIP158 filter
|
||||||
Bip158(bitcoin::util::bip158::Error),
|
Bip158(bitcoin::bip158::Error),
|
||||||
/// Internal system time error
|
/// Internal system time error
|
||||||
Time(std::time::SystemTimeError),
|
Time(std::time::SystemTimeError),
|
||||||
|
|
||||||
@ -608,7 +608,7 @@ impl std::error::Error for CompactFiltersError {}
|
|||||||
|
|
||||||
impl_error!(rocksdb::Error, Db, CompactFiltersError);
|
impl_error!(rocksdb::Error, Db, CompactFiltersError);
|
||||||
impl_error!(std::io::Error, Io, CompactFiltersError);
|
impl_error!(std::io::Error, Io, CompactFiltersError);
|
||||||
impl_error!(bitcoin::util::bip158::Error, Bip158, CompactFiltersError);
|
impl_error!(bitcoin::bip158::Error, Bip158, CompactFiltersError);
|
||||||
impl_error!(std::time::SystemTimeError, Time, CompactFiltersError);
|
impl_error!(std::time::SystemTimeError, Time, CompactFiltersError);
|
||||||
|
|
||||||
impl From<crate::error::Error> for CompactFiltersError {
|
impl From<crate::error::Error> for CompactFiltersError {
|
||||||
|
@ -27,7 +27,7 @@ use bitcoin::network::message::{NetworkMessage, RawNetworkMessage};
|
|||||||
use bitcoin::network::message_blockdata::*;
|
use bitcoin::network::message_blockdata::*;
|
||||||
use bitcoin::network::message_filter::*;
|
use bitcoin::network::message_filter::*;
|
||||||
use bitcoin::network::message_network::VersionMessage;
|
use bitcoin::network::message_network::VersionMessage;
|
||||||
use bitcoin::network::Address;
|
use bitcoin::network::{Address, Magic};
|
||||||
use bitcoin::{Block, Network, Transaction, Txid, Wtxid};
|
use bitcoin::{Block, Network, Transaction, Txid, Wtxid};
|
||||||
|
|
||||||
use super::CompactFiltersError;
|
use super::CompactFiltersError;
|
||||||
@ -242,7 +242,7 @@ impl Peer {
|
|||||||
/// Send a Bitcoin network message
|
/// Send a Bitcoin network message
|
||||||
fn _send(
|
fn _send(
|
||||||
writer: &mut TcpStream,
|
writer: &mut TcpStream,
|
||||||
magic: u32,
|
magic: Magic,
|
||||||
payload: NetworkMessage,
|
payload: NetworkMessage,
|
||||||
) -> Result<(), CompactFiltersError> {
|
) -> Result<(), CompactFiltersError> {
|
||||||
log::trace!("==> {:?}", payload);
|
log::trace!("==> {:?}", payload);
|
||||||
|
@ -21,16 +21,17 @@ use rand::{thread_rng, Rng};
|
|||||||
|
|
||||||
use rocksdb::{Direction, IteratorMode, ReadOptions, WriteBatch, DB};
|
use rocksdb::{Direction, IteratorMode, ReadOptions, WriteBatch, DB};
|
||||||
|
|
||||||
|
use bitcoin::bip158::BlockFilter;
|
||||||
|
use bitcoin::block::Header;
|
||||||
use bitcoin::blockdata::constants::genesis_block;
|
use bitcoin::blockdata::constants::genesis_block;
|
||||||
use bitcoin::consensus::{deserialize, encode::VarInt, serialize, Decodable, Encodable};
|
use bitcoin::consensus::{deserialize, encode::VarInt, serialize, Decodable, Encodable};
|
||||||
use bitcoin::hash_types::{FilterHash, FilterHeader};
|
use bitcoin::hash_types::{FilterHash, FilterHeader};
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
use bitcoin::util::bip158::BlockFilter;
|
use bitcoin::pow::Work;
|
||||||
use bitcoin::util::uint::Uint256;
|
|
||||||
use bitcoin::Block;
|
use bitcoin::Block;
|
||||||
use bitcoin::BlockHash;
|
use bitcoin::BlockHash;
|
||||||
use bitcoin::BlockHeader;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
use bitcoin::ScriptBuf;
|
||||||
|
|
||||||
use super::CompactFiltersError;
|
use super::CompactFiltersError;
|
||||||
|
|
||||||
@ -69,7 +70,7 @@ impl StoreEntry {
|
|||||||
}
|
}
|
||||||
StoreEntry::Block(Some(height)) => prefix.extend_from_slice(&height.to_be_bytes()),
|
StoreEntry::Block(Some(height)) => prefix.extend_from_slice(&height.to_be_bytes()),
|
||||||
StoreEntry::BlockHeaderIndex(Some(hash)) => {
|
StoreEntry::BlockHeaderIndex(Some(hash)) => {
|
||||||
prefix.extend_from_slice(&hash.into_inner())
|
prefix.extend_from_slice(hash.to_raw_hash().as_ref())
|
||||||
}
|
}
|
||||||
StoreEntry::CFilterTable((filter_type, bundle_index)) => {
|
StoreEntry::CFilterTable((filter_type, bundle_index)) => {
|
||||||
prefix.push(*filter_type);
|
prefix.push(*filter_type);
|
||||||
@ -228,7 +229,7 @@ impl ChainStore<Full> {
|
|||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
genesis_key,
|
genesis_key,
|
||||||
(genesis.header, genesis.header.work()).serialize(),
|
(genesis.header, genesis.header.work().to_be_bytes()).serialize(),
|
||||||
);
|
);
|
||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
@ -260,7 +261,7 @@ impl ChainStore<Full> {
|
|||||||
step *= 2;
|
step *= 2;
|
||||||
}
|
}
|
||||||
|
|
||||||
let (header, _): (BlockHeader, Uint256) = SerializeDb::deserialize(
|
let (header, _): (Header, [u8; 32]) = SerializeDb::deserialize(
|
||||||
&store_read
|
&store_read
|
||||||
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(index)).get_key())?
|
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(index)).get_key())?
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
@ -292,11 +293,12 @@ impl ChainStore<Full> {
|
|||||||
let cf_handle = write_store.cf_handle(&self.cf_name).unwrap();
|
let cf_handle = write_store.cf_handle(&self.cf_name).unwrap();
|
||||||
let new_cf_handle = write_store.cf_handle(&new_cf_name).unwrap();
|
let new_cf_handle = write_store.cf_handle(&new_cf_name).unwrap();
|
||||||
|
|
||||||
let (header, work): (BlockHeader, Uint256) = SerializeDb::deserialize(
|
let (header, work): (Header, [u8; 32]) = SerializeDb::deserialize(
|
||||||
&write_store
|
&write_store
|
||||||
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
||||||
.ok_or(CompactFiltersError::DataCorruption)?,
|
.ok_or(CompactFiltersError::DataCorruption)?,
|
||||||
)?;
|
)?;
|
||||||
|
let work = Work::from_be_bytes(work);
|
||||||
|
|
||||||
let mut batch = WriteBatch::default();
|
let mut batch = WriteBatch::default();
|
||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
@ -307,7 +309,7 @@ impl ChainStore<Full> {
|
|||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
new_cf_handle,
|
new_cf_handle,
|
||||||
StoreEntry::BlockHeader(Some(from)).get_key(),
|
StoreEntry::BlockHeader(Some(from)).get_key(),
|
||||||
(header, work).serialize(),
|
(header, work.to_be_bytes()).serialize(),
|
||||||
);
|
);
|
||||||
write_store.write(batch)?;
|
write_store.write(batch)?;
|
||||||
|
|
||||||
@ -381,7 +383,7 @@ impl ChainStore<Full> {
|
|||||||
opts,
|
opts,
|
||||||
IteratorMode::From(&from_key, Direction::Forward),
|
IteratorMode::From(&from_key, Direction::Forward),
|
||||||
) {
|
) {
|
||||||
let (header, _): (BlockHeader, Uint256) = SerializeDb::deserialize(&v)?;
|
let (header, _): (Header, [u8; 32]) = SerializeDb::deserialize(&v)?;
|
||||||
|
|
||||||
batch.delete_cf(
|
batch.delete_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
@ -433,7 +435,7 @@ impl ChainStore<Full> {
|
|||||||
let key = StoreEntry::BlockHeader(Some(height)).get_key();
|
let key = StoreEntry::BlockHeader(Some(height)).get_key();
|
||||||
let data = read_store.get_pinned_cf(cf_handle, key)?;
|
let data = read_store.get_pinned_cf(cf_handle, key)?;
|
||||||
data.map(|data| {
|
data.map(|data| {
|
||||||
let (header, _): (BlockHeader, Uint256) =
|
let (header, _): (Header, [u8; 32]) =
|
||||||
deserialize(&data).map_err(|_| CompactFiltersError::DataCorruption)?;
|
deserialize(&data).map_err(|_| CompactFiltersError::DataCorruption)?;
|
||||||
Ok::<_, CompactFiltersError>(header.block_hash())
|
Ok::<_, CompactFiltersError>(header.block_hash())
|
||||||
})
|
})
|
||||||
@ -496,7 +498,7 @@ impl ChainStore<Full> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<T: StoreType> ChainStore<T> {
|
impl<T: StoreType> ChainStore<T> {
|
||||||
pub fn work(&self) -> Result<Uint256, CompactFiltersError> {
|
pub fn work(&self) -> Result<Work, CompactFiltersError> {
|
||||||
let read_store = self.store.read().unwrap();
|
let read_store = self.store.read().unwrap();
|
||||||
let cf_handle = read_store.cf_handle(&self.cf_name).unwrap();
|
let cf_handle = read_store.cf_handle(&self.cf_name).unwrap();
|
||||||
|
|
||||||
@ -506,12 +508,13 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
Ok(iterator
|
Ok(iterator
|
||||||
.last()
|
.last()
|
||||||
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
||||||
let (_, work): (BlockHeader, Uint256) = SerializeDb::deserialize(&v)?;
|
let (_, work): (Header, [u8; 32]) = SerializeDb::deserialize(&v)?;
|
||||||
|
let work = Work::from_be_bytes(work);
|
||||||
|
|
||||||
Ok(work)
|
Ok(work)
|
||||||
})
|
})
|
||||||
.transpose()?
|
.transpose()?
|
||||||
.unwrap_or_default())
|
.unwrap_or_else(|| Work::from_be_bytes([0; 32])))
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn get_height(&self) -> Result<usize, CompactFiltersError> {
|
pub fn get_height(&self) -> Result<usize, CompactFiltersError> {
|
||||||
@ -546,7 +549,7 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
iterator
|
iterator
|
||||||
.last()
|
.last()
|
||||||
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
.map(|(_, v)| -> Result<_, CompactFiltersError> {
|
||||||
let (header, _): (BlockHeader, Uint256) = SerializeDb::deserialize(&v)?;
|
let (header, _): (Header, [u8; 32]) = SerializeDb::deserialize(&v)?;
|
||||||
|
|
||||||
Ok(header.block_hash())
|
Ok(header.block_hash())
|
||||||
})
|
})
|
||||||
@ -556,7 +559,7 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
pub fn apply(
|
pub fn apply(
|
||||||
&mut self,
|
&mut self,
|
||||||
from: usize,
|
from: usize,
|
||||||
headers: Vec<BlockHeader>,
|
headers: Vec<Header>,
|
||||||
) -> Result<BlockHash, CompactFiltersError> {
|
) -> Result<BlockHash, CompactFiltersError> {
|
||||||
let mut batch = WriteBatch::default();
|
let mut batch = WriteBatch::default();
|
||||||
|
|
||||||
@ -566,7 +569,8 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
let (mut last_hash, mut accumulated_work) = read_store
|
let (mut last_hash, mut accumulated_work) = read_store
|
||||||
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
.get_pinned_cf(cf_handle, StoreEntry::BlockHeader(Some(from)).get_key())?
|
||||||
.map(|result| {
|
.map(|result| {
|
||||||
let (header, work): (BlockHeader, Uint256) = SerializeDb::deserialize(&result)?;
|
let (header, work): (Header, [u8; 32]) = SerializeDb::deserialize(&result)?;
|
||||||
|
let work = Work::from_be_bytes(work);
|
||||||
Ok::<_, CompactFiltersError>((header.block_hash(), work))
|
Ok::<_, CompactFiltersError>((header.block_hash(), work))
|
||||||
})
|
})
|
||||||
.transpose()?
|
.transpose()?
|
||||||
@ -589,7 +593,7 @@ impl<T: StoreType> ChainStore<T> {
|
|||||||
batch.put_cf(
|
batch.put_cf(
|
||||||
cf_handle,
|
cf_handle,
|
||||||
StoreEntry::BlockHeader(Some(height)).get_key(),
|
StoreEntry::BlockHeader(Some(height)).get_key(),
|
||||||
(header, accumulated_work).serialize(),
|
(header, accumulated_work.to_be_bytes()).serialize(),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -641,7 +645,7 @@ impl CfStore {
|
|||||||
let genesis = genesis_block(headers_store.network);
|
let genesis = genesis_block(headers_store.network);
|
||||||
|
|
||||||
let filter = BlockFilter::new_script_filter(&genesis, |utxo| {
|
let filter = BlockFilter::new_script_filter(&genesis, |utxo| {
|
||||||
Err(bitcoin::util::bip158::Error::UtxoMissing(*utxo))
|
Err::<ScriptBuf, _>(bitcoin::bip158::Error::UtxoMissing(*utxo))
|
||||||
})?;
|
})?;
|
||||||
let first_key = StoreEntry::CFilterTable((filter_type, Some(0))).get_key();
|
let first_key = StoreEntry::CFilterTable((filter_type, Some(0))).get_key();
|
||||||
|
|
||||||
@ -653,7 +657,7 @@ impl CfStore {
|
|||||||
&first_key,
|
&first_key,
|
||||||
(
|
(
|
||||||
BundleStatus::Init,
|
BundleStatus::Init,
|
||||||
filter.filter_header(&FilterHeader::from_hash(Hash::all_zeros())),
|
filter.filter_header(&FilterHeader::from_raw_hash(Hash::all_zeros())),
|
||||||
)
|
)
|
||||||
.serialize(),
|
.serialize(),
|
||||||
)?;
|
)?;
|
||||||
|
@ -13,11 +13,11 @@ use std::collections::{BTreeMap, HashMap, VecDeque};
|
|||||||
use std::sync::{Arc, Mutex};
|
use std::sync::{Arc, Mutex};
|
||||||
use std::time::Duration;
|
use std::time::Duration;
|
||||||
|
|
||||||
|
use bitcoin::bip158::BlockFilter;
|
||||||
use bitcoin::hash_types::{BlockHash, FilterHeader};
|
use bitcoin::hash_types::{BlockHash, FilterHeader};
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
use bitcoin::network::message::NetworkMessage;
|
use bitcoin::network::message::NetworkMessage;
|
||||||
use bitcoin::network::message_blockdata::GetHeadersMessage;
|
use bitcoin::network::message_blockdata::GetHeadersMessage;
|
||||||
use bitcoin::util::bip158::BlockFilter;
|
|
||||||
|
|
||||||
use super::peer::*;
|
use super::peer::*;
|
||||||
use super::store::*;
|
use super::store::*;
|
||||||
|
@ -325,8 +325,8 @@ impl ConfigurableBlockchain for ElectrumBlockchain {
|
|||||||
let socks5 = config.socks5.as_ref().map(Socks5Config::new);
|
let socks5 = config.socks5.as_ref().map(Socks5Config::new);
|
||||||
let electrum_config = ConfigBuilder::new()
|
let electrum_config = ConfigBuilder::new()
|
||||||
.retry(config.retry)
|
.retry(config.retry)
|
||||||
.timeout(config.timeout)?
|
.timeout(config.timeout)
|
||||||
.socks5(socks5)?
|
.socks5(socks5)
|
||||||
.validate_domain(config.validate_domain)
|
.validate_domain(config.validate_domain)
|
||||||
.build();
|
.build();
|
||||||
|
|
||||||
|
@ -132,7 +132,7 @@ impl WalletSync for EsploraBlockchain {
|
|||||||
let scripts = script_req
|
let scripts = script_req
|
||||||
.request()
|
.request()
|
||||||
.take(self.concurrency as usize)
|
.take(self.concurrency as usize)
|
||||||
.cloned();
|
.map(bitcoin::ScriptBuf::from);
|
||||||
|
|
||||||
let mut handles = vec![];
|
let mut handles = vec![];
|
||||||
for script in scripts {
|
for script in scripts {
|
||||||
|
@ -31,18 +31,17 @@
|
|||||||
//! let blockchain = RpcBlockchain::from_config(&config);
|
//! let blockchain = RpcBlockchain::from_config(&config);
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
use crate::bitcoin::hashes::hex::ToHex;
|
|
||||||
use crate::bitcoin::{Network, OutPoint, Transaction, TxOut, Txid};
|
use crate::bitcoin::{Network, OutPoint, Transaction, TxOut, Txid};
|
||||||
use crate::blockchain::*;
|
use crate::blockchain::*;
|
||||||
use crate::database::{BatchDatabase, BatchOperations, DatabaseUtils};
|
use crate::database::{BatchDatabase, BatchOperations, DatabaseUtils};
|
||||||
use crate::descriptor::calc_checksum;
|
use crate::descriptor::calc_checksum;
|
||||||
use crate::error::MissingCachedScripts;
|
use crate::error::MissingCachedScripts;
|
||||||
use crate::{BlockTime, Error, FeeRate, KeychainKind, LocalUtxo, TransactionDetails};
|
use crate::{BlockTime, Error, FeeRate, KeychainKind, LocalUtxo, TransactionDetails};
|
||||||
use bitcoin::Script;
|
use bitcoin::{Script, ScriptBuf};
|
||||||
use bitcoincore_rpc::json::{
|
use bitcoincore_rpc::json::{
|
||||||
GetTransactionResultDetailCategory, ImportMultiOptions, ImportMultiRequest,
|
GetTransactionResultDetailCategory, ImportMultiOptions, ImportMultiRequest,
|
||||||
ImportMultiRequestScriptPubkey, ImportMultiRescanSince, ListTransactionResult,
|
ImportMultiRequestScriptPubkey, ListTransactionResult, ListUnspentResultEntry, ScanningDetails,
|
||||||
ListUnspentResultEntry, ScanningDetails,
|
Timestamp,
|
||||||
};
|
};
|
||||||
use bitcoincore_rpc::jsonrpc::serde_json::{json, Value};
|
use bitcoincore_rpc::jsonrpc::serde_json::{json, Value};
|
||||||
use bitcoincore_rpc::Auth as RpcAuth;
|
use bitcoincore_rpc::Auth as RpcAuth;
|
||||||
@ -302,8 +301,8 @@ struct DbState<'a, D> {
|
|||||||
params: &'a RpcSyncParams,
|
params: &'a RpcSyncParams,
|
||||||
prog: &'a dyn Progress,
|
prog: &'a dyn Progress,
|
||||||
|
|
||||||
ext_spks: Vec<Script>,
|
ext_spks: Vec<ScriptBuf>,
|
||||||
int_spks: Vec<Script>,
|
int_spks: Vec<ScriptBuf>,
|
||||||
txs: HashMap<Txid, TransactionDetails>,
|
txs: HashMap<Txid, TransactionDetails>,
|
||||||
utxos: HashSet<LocalUtxo>,
|
utxos: HashSet<LocalUtxo>,
|
||||||
last_indexes: HashMap<KeychainKind, u32>,
|
last_indexes: HashMap<KeychainKind, u32>,
|
||||||
@ -668,7 +667,7 @@ fn import_descriptors<'a, S>(
|
|||||||
scripts_iter: S,
|
scripts_iter: S,
|
||||||
) -> Result<(), Error>
|
) -> Result<(), Error>
|
||||||
where
|
where
|
||||||
S: Iterator<Item = &'a Script>,
|
S: Iterator<Item = &'a ScriptBuf>,
|
||||||
{
|
{
|
||||||
let requests = Value::Array(
|
let requests = Value::Array(
|
||||||
scripts_iter
|
scripts_iter
|
||||||
@ -696,11 +695,11 @@ where
|
|||||||
|
|
||||||
fn import_multi<'a, S>(client: &Client, start_epoch: u64, scripts_iter: S) -> Result<(), Error>
|
fn import_multi<'a, S>(client: &Client, start_epoch: u64, scripts_iter: S) -> Result<(), Error>
|
||||||
where
|
where
|
||||||
S: Iterator<Item = &'a Script>,
|
S: Iterator<Item = &'a ScriptBuf>,
|
||||||
{
|
{
|
||||||
let requests = scripts_iter
|
let requests = scripts_iter
|
||||||
.map(|script| ImportMultiRequest {
|
.map(|script| ImportMultiRequest {
|
||||||
timestamp: ImportMultiRescanSince::Timestamp(start_epoch),
|
timestamp: Timestamp::Time(start_epoch),
|
||||||
script_pubkey: Some(ImportMultiRequestScriptPubkey::Script(script)),
|
script_pubkey: Some(ImportMultiRequestScriptPubkey::Script(script)),
|
||||||
watchonly: Some(true),
|
watchonly: Some(true),
|
||||||
..Default::default()
|
..Default::default()
|
||||||
@ -808,7 +807,7 @@ fn is_wallet_descriptor(client: &Client) -> Result<bool, Error> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn descriptor_from_script_pubkey(script: &Script) -> String {
|
fn descriptor_from_script_pubkey(script: &Script) -> String {
|
||||||
let desc = format!("raw({})", script.to_hex());
|
let desc = format!("raw({})", script.to_hex_string());
|
||||||
format!("{}#{}", desc, calc_checksum(&desc).unwrap())
|
format!("{}#{}", desc, calc_checksum(&desc).unwrap())
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -964,7 +963,7 @@ mod test {
|
|||||||
|
|
||||||
// generate scripts (1 tx per script)
|
// generate scripts (1 tx per script)
|
||||||
let scripts = (0..TX_COUNT)
|
let scripts = (0..TX_COUNT)
|
||||||
.map(|index| desc.at_derivation_index(index).script_pubkey())
|
.map(|index| desc.at_derivation_index(index).unwrap().script_pubkey())
|
||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// import scripts and wait
|
// import scripts and wait
|
||||||
|
@ -9,7 +9,7 @@ use crate::{
|
|||||||
wallet::time::Instant,
|
wallet::time::Instant,
|
||||||
BlockTime, Error, KeychainKind, LocalUtxo, TransactionDetails,
|
BlockTime, Error, KeychainKind, LocalUtxo, TransactionDetails,
|
||||||
};
|
};
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxOut, Txid};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction, TxOut, Txid};
|
||||||
use log::*;
|
use log::*;
|
||||||
use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet, VecDeque};
|
use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet, VecDeque};
|
||||||
|
|
||||||
@ -53,7 +53,7 @@ pub struct ScriptReq<'a, D: BatchDatabase> {
|
|||||||
state: State<'a, D>,
|
state: State<'a, D>,
|
||||||
script_index: usize,
|
script_index: usize,
|
||||||
initial_scripts_needed: usize, // if this is 1, we assume the descriptor is not derivable
|
initial_scripts_needed: usize, // if this is 1, we assume the descriptor is not derivable
|
||||||
scripts_needed: VecDeque<Script>,
|
scripts_needed: VecDeque<ScriptBuf>,
|
||||||
stop_gap: usize,
|
stop_gap: usize,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
next_keychains: Vec<KeychainKind>,
|
next_keychains: Vec<KeychainKind>,
|
||||||
@ -62,7 +62,7 @@ pub struct ScriptReq<'a, D: BatchDatabase> {
|
|||||||
/// The sync starts by returning script pubkeys we are interested in.
|
/// The sync starts by returning script pubkeys we are interested in.
|
||||||
impl<'a, D: BatchDatabase> ScriptReq<'a, D> {
|
impl<'a, D: BatchDatabase> ScriptReq<'a, D> {
|
||||||
pub fn request(&self) -> impl Iterator<Item = &Script> + Clone {
|
pub fn request(&self) -> impl Iterator<Item = &Script> + Clone {
|
||||||
self.scripts_needed.iter()
|
self.scripts_needed.iter().map(|s| s.as_script())
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn satisfy(
|
pub fn satisfy(
|
||||||
|
@ -153,7 +153,7 @@ impl BatchOperations for AnyDatabase {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(
|
impl_inner_method!(
|
||||||
AnyDatabase,
|
AnyDatabase,
|
||||||
self,
|
self,
|
||||||
@ -204,7 +204,7 @@ impl Database for AnyDatabase {
|
|||||||
)
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(AnyDatabase, self, iter_script_pubkeys, keychain)
|
impl_inner_method!(AnyDatabase, self, iter_script_pubkeys, keychain)
|
||||||
}
|
}
|
||||||
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error> {
|
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error> {
|
||||||
@ -221,7 +221,7 @@ impl Database for AnyDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(
|
impl_inner_method!(
|
||||||
AnyDatabase,
|
AnyDatabase,
|
||||||
self,
|
self,
|
||||||
@ -286,7 +286,7 @@ impl BatchOperations for AnyBatch {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
impl_inner_method!(AnyBatch, self, del_script_pubkey_from_path, keychain, child)
|
impl_inner_method!(AnyBatch, self, del_script_pubkey_from_path, keychain, child)
|
||||||
}
|
}
|
||||||
fn del_path_from_script_pubkey(
|
fn del_path_from_script_pubkey(
|
||||||
|
@ -15,7 +15,7 @@ use sled::{Batch, Tree};
|
|||||||
|
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction};
|
||||||
|
|
||||||
use crate::database::memory::MapKey;
|
use crate::database::memory::MapKey;
|
||||||
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
||||||
@ -90,7 +90,7 @@ macro_rules! impl_batch_operations {
|
|||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn del_script_pubkey_from_path(&mut self, keychain: KeychainKind, path: u32) -> Result<Option<Script>, Error> {
|
fn del_script_pubkey_from_path(&mut self, keychain: KeychainKind, path: u32) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
let res = self.remove(key);
|
let res = self.remove(key);
|
||||||
let res = $process_delete!(res);
|
let res = $process_delete!(res);
|
||||||
@ -221,7 +221,7 @@ impl Database for Tree {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((keychain, None)).as_map_key();
|
let key = MapKey::Path((keychain, None)).as_map_key();
|
||||||
self.scan_prefix(key)
|
self.scan_prefix(key)
|
||||||
.map(|x| -> Result<_, Error> {
|
.map(|x| -> Result<_, Error> {
|
||||||
@ -286,7 +286,7 @@ impl Database for Tree {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
Ok(self.get(key)?.map(|b| deserialize(&b)).transpose()?)
|
Ok(self.get(key)?.map(|b| deserialize(&b)).transpose()?)
|
||||||
}
|
}
|
||||||
|
@ -20,7 +20,7 @@ use std::ops::Bound::{Excluded, Included};
|
|||||||
|
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction};
|
||||||
|
|
||||||
use crate::database::{BatchDatabase, BatchOperations, ConfigurableDatabase, Database, SyncTime};
|
use crate::database::{BatchDatabase, BatchOperations, ConfigurableDatabase, Database, SyncTime};
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
@ -136,7 +136,7 @@ impl BatchOperations for MemoryDatabase {
|
|||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<(), Error> {
|
) -> Result<(), Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
self.map.insert(key, Box::new(script.clone()));
|
self.map.insert(key, Box::new(ScriptBuf::from(script)));
|
||||||
|
|
||||||
let key = MapKey::Script(Some(script)).as_map_key();
|
let key = MapKey::Script(Some(script)).as_map_key();
|
||||||
let value = json!({
|
let value = json!({
|
||||||
@ -196,7 +196,7 @@ impl BatchOperations for MemoryDatabase {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
let res = self.map.remove(&key);
|
let res = self.map.remove(&key);
|
||||||
self.deleted_keys.push(key);
|
self.deleted_keys.push(key);
|
||||||
@ -315,7 +315,7 @@ impl Database for MemoryDatabase {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((keychain, None)).as_map_key();
|
let key = MapKey::Path((keychain, None)).as_map_key();
|
||||||
self.map
|
self.map
|
||||||
.range::<Vec<u8>, _>((Included(&key), Excluded(&after(&key))))
|
.range::<Vec<u8>, _>((Included(&key), Excluded(&after(&key))))
|
||||||
@ -368,7 +368,7 @@ impl Database for MemoryDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
path: u32,
|
path: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
let key = MapKey::Path((Some(keychain), Some(path))).as_map_key();
|
||||||
Ok(self
|
Ok(self
|
||||||
.map
|
.map
|
||||||
@ -485,7 +485,6 @@ macro_rules! populate_test_db {
|
|||||||
$crate::populate_test_db!($db, $tx_meta, $current_height, (@coinbase false))
|
$crate::populate_test_db!($db, $tx_meta, $current_height, (@coinbase false))
|
||||||
}};
|
}};
|
||||||
($db:expr, $tx_meta:expr, $current_height:expr, (@coinbase $is_coinbase:expr)$(,)?) => {{
|
($db:expr, $tx_meta:expr, $current_height:expr, (@coinbase $is_coinbase:expr)$(,)?) => {{
|
||||||
use std::str::FromStr;
|
|
||||||
use $crate::database::SyncTime;
|
use $crate::database::SyncTime;
|
||||||
use $crate::database::{BatchOperations, Database};
|
use $crate::database::{BatchOperations, Database};
|
||||||
let mut db = $db;
|
let mut db = $db;
|
||||||
@ -497,7 +496,7 @@ macro_rules! populate_test_db {
|
|||||||
}
|
}
|
||||||
let tx = $crate::bitcoin::Transaction {
|
let tx = $crate::bitcoin::Transaction {
|
||||||
version: 1,
|
version: 1,
|
||||||
lock_time: bitcoin::PackedLockTime(0),
|
lock_time: bitcoin::absolute::LockTime::ZERO,
|
||||||
input,
|
input,
|
||||||
output: tx_meta
|
output: tx_meta
|
||||||
.output
|
.output
|
||||||
@ -506,6 +505,7 @@ macro_rules! populate_test_db {
|
|||||||
value: out_meta.value,
|
value: out_meta.value,
|
||||||
script_pubkey: $crate::bitcoin::Address::from_str(&out_meta.to_address)
|
script_pubkey: $crate::bitcoin::Address::from_str(&out_meta.to_address)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.script_pubkey(),
|
.script_pubkey(),
|
||||||
})
|
})
|
||||||
.collect(),
|
.collect(),
|
||||||
|
@ -27,7 +27,7 @@
|
|||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxOut};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction, TxOut};
|
||||||
|
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
use crate::types::*;
|
use crate::types::*;
|
||||||
@ -83,7 +83,7 @@ pub trait BatchOperations {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error>;
|
) -> Result<Option<ScriptBuf>, Error>;
|
||||||
/// Delete the data related to a specific script_pubkey, meaning the keychain and the child
|
/// Delete the data related to a specific script_pubkey, meaning the keychain and the child
|
||||||
/// number.
|
/// number.
|
||||||
fn del_path_from_script_pubkey(
|
fn del_path_from_script_pubkey(
|
||||||
@ -124,7 +124,7 @@ pub trait Database: BatchOperations {
|
|||||||
) -> Result<(), Error>;
|
) -> Result<(), Error>;
|
||||||
|
|
||||||
/// Return the list of script_pubkeys
|
/// Return the list of script_pubkeys
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error>;
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error>;
|
||||||
/// Return the list of [`LocalUtxo`]s
|
/// Return the list of [`LocalUtxo`]s
|
||||||
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error>;
|
fn iter_utxos(&self) -> Result<Vec<LocalUtxo>, Error>;
|
||||||
/// Return the list of raw transactions
|
/// Return the list of raw transactions
|
||||||
@ -137,7 +137,7 @@ pub trait Database: BatchOperations {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error>;
|
) -> Result<Option<ScriptBuf>, Error>;
|
||||||
/// Fetch the keychain and child number of a given script_pubkey
|
/// Fetch the keychain and child number of a given script_pubkey
|
||||||
fn get_path_from_script_pubkey(
|
fn get_path_from_script_pubkey(
|
||||||
&self,
|
&self,
|
||||||
@ -214,17 +214,17 @@ impl<T: Database> DatabaseUtils for T {}
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub mod test {
|
pub mod test {
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
use bitcoin::consensus::encode::deserialize;
|
use bitcoin::consensus::encode::deserialize;
|
||||||
use bitcoin::consensus::serialize;
|
use bitcoin::consensus::serialize;
|
||||||
use bitcoin::hashes::hex::*;
|
use bitcoin::hashes::hex::*;
|
||||||
|
use bitcoin::Witness;
|
||||||
use bitcoin::*;
|
use bitcoin::*;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
pub fn test_script_pubkey<D: Database>(mut db: D) {
|
pub fn test_script_pubkey<D: Database>(mut db: D) {
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
@ -245,7 +245,7 @@ pub mod test {
|
|||||||
pub fn test_batch_script_pubkey<D: BatchDatabase>(mut db: D) {
|
pub fn test_batch_script_pubkey<D: BatchDatabase>(mut db: D) {
|
||||||
let mut batch = db.begin_batch();
|
let mut batch = db.begin_batch();
|
||||||
|
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
@ -272,7 +272,7 @@ pub mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_iter_script_pubkey<D: Database>(mut db: D) {
|
pub fn test_iter_script_pubkey<D: Database>(mut db: D) {
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
@ -284,7 +284,7 @@ pub mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub fn test_del_script_pubkey<D: Database>(mut db: D) {
|
pub fn test_del_script_pubkey<D: Database>(mut db: D) {
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
@ -302,7 +302,7 @@ pub mod test {
|
|||||||
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let txout = TxOut {
|
let txout = TxOut {
|
||||||
@ -478,7 +478,7 @@ pub mod test {
|
|||||||
pub fn test_del_path_from_script_pubkey<D: Database>(mut db: D) {
|
pub fn test_del_path_from_script_pubkey<D: Database>(mut db: D) {
|
||||||
let keychain = KeychainKind::External;
|
let keychain = KeychainKind::External;
|
||||||
|
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
@ -502,14 +502,14 @@ pub mod test {
|
|||||||
let scripts = db.iter_script_pubkeys(Some(keychain)).unwrap();
|
let scripts = db.iter_script_pubkeys(Some(keychain)).unwrap();
|
||||||
assert!(scripts.is_empty());
|
assert!(scripts.is_empty());
|
||||||
|
|
||||||
let first_script = Script::from(
|
let first_script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
|
|
||||||
db.set_script_pubkey(&first_script, keychain, path).unwrap();
|
db.set_script_pubkey(&first_script, keychain, path).unwrap();
|
||||||
|
|
||||||
let second_script = Script::from(
|
let second_script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("00145c9a1816d38db5cbdd4b067b689dc19eb7d930e2").unwrap(),
|
Vec::<u8>::from_hex("00145c9a1816d38db5cbdd4b067b689dc19eb7d930e2").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 57;
|
let path = 57;
|
||||||
@ -528,7 +528,7 @@ pub mod test {
|
|||||||
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
"5df6e0e2761359d30a8275058e299fcc0381534545f55cf43e41983f5d4c9456:0",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let txout = TxOut {
|
let txout = TxOut {
|
||||||
|
@ -13,7 +13,7 @@ use std::path::PathBuf;
|
|||||||
|
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hash_types::Txid;
|
use bitcoin::hash_types::Txid;
|
||||||
use bitcoin::{OutPoint, Script, Transaction, TxOut};
|
use bitcoin::{OutPoint, Script, ScriptBuf, Transaction, TxOut};
|
||||||
|
|
||||||
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
use crate::database::{BatchDatabase, BatchOperations, Database, SyncTime};
|
||||||
use crate::error::Error;
|
use crate::error::Error;
|
||||||
@ -162,7 +162,7 @@ impl SqliteDatabase {
|
|||||||
None => (None, None),
|
None => (None, None),
|
||||||
};
|
};
|
||||||
|
|
||||||
let txid: &[u8] = &transaction.txid;
|
let txid: &[u8] = transaction.txid.as_ref();
|
||||||
|
|
||||||
let mut statement = self.connection.prepare_cached("INSERT INTO transaction_details (txid, timestamp, received, sent, fee, height) VALUES (:txid, :timestamp, :received, :sent, :fee, :height)")?;
|
let mut statement = self.connection.prepare_cached("INSERT INTO transaction_details (txid, timestamp, received, sent, fee, height) VALUES (:txid, :timestamp, :received, :sent, :fee, :height)")?;
|
||||||
|
|
||||||
@ -187,7 +187,7 @@ impl SqliteDatabase {
|
|||||||
None => (None, None),
|
None => (None, None),
|
||||||
};
|
};
|
||||||
|
|
||||||
let txid: &[u8] = &transaction.txid;
|
let txid: &[u8] = transaction.txid.as_ref();
|
||||||
|
|
||||||
let mut statement = self.connection.prepare_cached("UPDATE transaction_details SET timestamp=:timestamp, received=:received, sent=:sent, fee=:fee, height=:height WHERE txid=:txid")?;
|
let mut statement = self.connection.prepare_cached("UPDATE transaction_details SET timestamp=:timestamp, received=:received, sent=:sent, fee=:fee, height=:height WHERE txid=:txid")?;
|
||||||
|
|
||||||
@ -254,11 +254,11 @@ impl SqliteDatabase {
|
|||||||
Ok(self.connection.last_insert_rowid())
|
Ok(self.connection.last_insert_rowid())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn select_script_pubkeys(&self) -> Result<Vec<Script>, Error> {
|
fn select_script_pubkeys(&self) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let mut statement = self
|
let mut statement = self
|
||||||
.connection
|
.connection
|
||||||
.prepare_cached("SELECT script FROM script_pubkeys")?;
|
.prepare_cached("SELECT script FROM script_pubkeys")?;
|
||||||
let mut scripts: Vec<Script> = vec![];
|
let mut scripts: Vec<ScriptBuf> = vec![];
|
||||||
let mut rows = statement.query([])?;
|
let mut rows = statement.query([])?;
|
||||||
while let Some(row) = rows.next()? {
|
while let Some(row) = rows.next()? {
|
||||||
let raw_script: Vec<u8> = row.get(0)?;
|
let raw_script: Vec<u8> = row.get(0)?;
|
||||||
@ -268,11 +268,11 @@ impl SqliteDatabase {
|
|||||||
Ok(scripts)
|
Ok(scripts)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn select_script_pubkeys_by_keychain(&self, keychain: String) -> Result<Vec<Script>, Error> {
|
fn select_script_pubkeys_by_keychain(&self, keychain: String) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
let mut statement = self
|
let mut statement = self
|
||||||
.connection
|
.connection
|
||||||
.prepare_cached("SELECT script FROM script_pubkeys WHERE keychain=:keychain")?;
|
.prepare_cached("SELECT script FROM script_pubkeys WHERE keychain=:keychain")?;
|
||||||
let mut scripts: Vec<Script> = vec![];
|
let mut scripts: Vec<ScriptBuf> = vec![];
|
||||||
let mut rows = statement.query(named_params! {":keychain": keychain})?;
|
let mut rows = statement.query(named_params! {":keychain": keychain})?;
|
||||||
while let Some(row) = rows.next()? {
|
while let Some(row) = rows.next()? {
|
||||||
let raw_script: Vec<u8> = row.get(0)?;
|
let raw_script: Vec<u8> = row.get(0)?;
|
||||||
@ -286,7 +286,7 @@ impl SqliteDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: String,
|
keychain: String,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let mut statement = self.connection.prepare_cached(
|
let mut statement = self.connection.prepare_cached(
|
||||||
"SELECT script FROM script_pubkeys WHERE keychain=:keychain AND child=:child",
|
"SELECT script FROM script_pubkeys WHERE keychain=:keychain AND child=:child",
|
||||||
)?;
|
)?;
|
||||||
@ -295,7 +295,7 @@ impl SqliteDatabase {
|
|||||||
match rows.next()? {
|
match rows.next()? {
|
||||||
Some(row) => {
|
Some(row) => {
|
||||||
let script: Vec<u8> = row.get(0)?;
|
let script: Vec<u8> = row.get(0)?;
|
||||||
let script: Script = script.into();
|
let script: ScriptBuf = script.into();
|
||||||
Ok(Some(script))
|
Ok(Some(script))
|
||||||
}
|
}
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
@ -362,7 +362,7 @@ impl SqliteDatabase {
|
|||||||
let keychain: String = row.get(1)?;
|
let keychain: String = row.get(1)?;
|
||||||
let keychain: KeychainKind = serde_json::from_str(&keychain)?;
|
let keychain: KeychainKind = serde_json::from_str(&keychain)?;
|
||||||
let script: Vec<u8> = row.get(2)?;
|
let script: Vec<u8> = row.get(2)?;
|
||||||
let script_pubkey: Script = script.into();
|
let script_pubkey: ScriptBuf = script.into();
|
||||||
let is_spent: bool = row.get(3)?;
|
let is_spent: bool = row.get(3)?;
|
||||||
|
|
||||||
Ok(Some(LocalUtxo {
|
Ok(Some(LocalUtxo {
|
||||||
@ -658,7 +658,7 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
utxo.txout.value,
|
utxo.txout.value,
|
||||||
serde_json::to_string(&utxo.keychain)?,
|
serde_json::to_string(&utxo.keychain)?,
|
||||||
utxo.outpoint.vout,
|
utxo.outpoint.vout,
|
||||||
&utxo.outpoint.txid,
|
utxo.outpoint.txid.as_ref(),
|
||||||
utxo.txout.script_pubkey.as_bytes(),
|
utxo.txout.script_pubkey.as_bytes(),
|
||||||
utxo.is_spent,
|
utxo.is_spent,
|
||||||
)?;
|
)?;
|
||||||
@ -666,19 +666,19 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn set_raw_tx(&mut self, transaction: &Transaction) -> Result<(), Error> {
|
fn set_raw_tx(&mut self, transaction: &Transaction) -> Result<(), Error> {
|
||||||
match self.select_transaction_by_txid(&transaction.txid())? {
|
match self.select_transaction_by_txid(transaction.txid().as_ref())? {
|
||||||
Some(_) => {
|
Some(_) => {
|
||||||
self.update_transaction(&transaction.txid(), &serialize(transaction))?;
|
self.update_transaction(transaction.txid().as_ref(), &serialize(transaction))?;
|
||||||
}
|
}
|
||||||
None => {
|
None => {
|
||||||
self.insert_transaction(&transaction.txid(), &serialize(transaction))?;
|
self.insert_transaction(transaction.txid().as_ref(), &serialize(transaction))?;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
fn set_tx(&mut self, transaction: &TransactionDetails) -> Result<(), Error> {
|
fn set_tx(&mut self, transaction: &TransactionDetails) -> Result<(), Error> {
|
||||||
match self.select_transaction_details_by_txid(&transaction.txid)? {
|
match self.select_transaction_details_by_txid(transaction.txid.as_ref())? {
|
||||||
Some(_) => {
|
Some(_) => {
|
||||||
self.update_transaction_details(transaction)?;
|
self.update_transaction_details(transaction)?;
|
||||||
}
|
}
|
||||||
@ -708,7 +708,7 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
&mut self,
|
&mut self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let keychain = serde_json::to_string(&keychain)?;
|
let keychain = serde_json::to_string(&keychain)?;
|
||||||
let script = self.select_script_pubkey_by_path(keychain.clone(), child)?;
|
let script = self.select_script_pubkey_by_path(keychain.clone(), child)?;
|
||||||
match script {
|
match script {
|
||||||
@ -734,9 +734,9 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn del_utxo(&mut self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
fn del_utxo(&mut self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
||||||
match self.select_utxo_by_outpoint(&outpoint.txid, outpoint.vout)? {
|
match self.select_utxo_by_outpoint(outpoint.txid.as_ref(), outpoint.vout)? {
|
||||||
Some(local_utxo) => {
|
Some(local_utxo) => {
|
||||||
self.delete_utxo_by_outpoint(&outpoint.txid, outpoint.vout)?;
|
self.delete_utxo_by_outpoint(outpoint.txid.as_ref(), outpoint.vout)?;
|
||||||
Ok(Some(local_utxo))
|
Ok(Some(local_utxo))
|
||||||
}
|
}
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
@ -744,9 +744,9 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn del_raw_tx(&mut self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
fn del_raw_tx(&mut self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||||
match self.select_transaction_by_txid(txid)? {
|
match self.select_transaction_by_txid(txid.as_ref())? {
|
||||||
Some(tx) => {
|
Some(tx) => {
|
||||||
self.delete_transaction_by_txid(txid)?;
|
self.delete_transaction_by_txid(txid.as_ref())?;
|
||||||
Ok(Some(tx))
|
Ok(Some(tx))
|
||||||
}
|
}
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
@ -758,12 +758,12 @@ impl BatchOperations for SqliteDatabase {
|
|||||||
txid: &Txid,
|
txid: &Txid,
|
||||||
include_raw: bool,
|
include_raw: bool,
|
||||||
) -> Result<Option<TransactionDetails>, Error> {
|
) -> Result<Option<TransactionDetails>, Error> {
|
||||||
match self.select_transaction_details_by_txid(txid)? {
|
match self.select_transaction_details_by_txid(txid.as_ref())? {
|
||||||
Some(mut transaction_details) => {
|
Some(mut transaction_details) => {
|
||||||
self.delete_transaction_details_by_txid(txid)?;
|
self.delete_transaction_details_by_txid(txid.as_ref())?;
|
||||||
|
|
||||||
if include_raw {
|
if include_raw {
|
||||||
self.delete_transaction_by_txid(txid)?;
|
self.delete_transaction_by_txid(txid.as_ref())?;
|
||||||
} else {
|
} else {
|
||||||
transaction_details.transaction = None;
|
transaction_details.transaction = None;
|
||||||
}
|
}
|
||||||
@ -820,7 +820,7 @@ impl Database for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<Script>, Error> {
|
fn iter_script_pubkeys(&self, keychain: Option<KeychainKind>) -> Result<Vec<ScriptBuf>, Error> {
|
||||||
match keychain {
|
match keychain {
|
||||||
Some(keychain) => {
|
Some(keychain) => {
|
||||||
let keychain = serde_json::to_string(&keychain)?;
|
let keychain = serde_json::to_string(&keychain)?;
|
||||||
@ -849,7 +849,7 @@ impl Database for SqliteDatabase {
|
|||||||
&self,
|
&self,
|
||||||
keychain: KeychainKind,
|
keychain: KeychainKind,
|
||||||
child: u32,
|
child: u32,
|
||||||
) -> Result<Option<Script>, Error> {
|
) -> Result<Option<ScriptBuf>, Error> {
|
||||||
let keychain = serde_json::to_string(&keychain)?;
|
let keychain = serde_json::to_string(&keychain)?;
|
||||||
match self.select_script_pubkey_by_path(keychain, child)? {
|
match self.select_script_pubkey_by_path(keychain, child)? {
|
||||||
Some(script) => Ok(Some(script)),
|
Some(script) => Ok(Some(script)),
|
||||||
@ -868,18 +868,18 @@ impl Database for SqliteDatabase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn get_utxo(&self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
fn get_utxo(&self, outpoint: &OutPoint) -> Result<Option<LocalUtxo>, Error> {
|
||||||
self.select_utxo_by_outpoint(&outpoint.txid, outpoint.vout)
|
self.select_utxo_by_outpoint(outpoint.txid.as_ref(), outpoint.vout)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_raw_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
fn get_raw_tx(&self, txid: &Txid) -> Result<Option<Transaction>, Error> {
|
||||||
match self.select_transaction_by_txid(txid)? {
|
match self.select_transaction_by_txid(txid.as_ref())? {
|
||||||
Some(tx) => Ok(Some(tx)),
|
Some(tx) => Ok(Some(tx)),
|
||||||
None => Ok(None),
|
None => Ok(None),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_tx(&self, txid: &Txid, include_raw: bool) -> Result<Option<TransactionDetails>, Error> {
|
fn get_tx(&self, txid: &Txid, include_raw: bool) -> Result<Option<TransactionDetails>, Error> {
|
||||||
match self.select_transaction_details_by_txid(txid)? {
|
match self.select_transaction_details_by_txid(txid.as_ref())? {
|
||||||
Some(mut transaction_details) => {
|
Some(mut transaction_details) => {
|
||||||
if !include_raw {
|
if !include_raw {
|
||||||
transaction_details.transaction = None;
|
transaction_details.transaction = None;
|
||||||
@ -1115,7 +1115,7 @@ pub mod test {
|
|||||||
|
|
||||||
let mut db = get_database();
|
let mut db = get_database();
|
||||||
|
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
Vec::<u8>::from_hex("76a91402306a7c23f3e8010de41e9e591348bb83f11daa88ac").unwrap(),
|
||||||
);
|
);
|
||||||
let path = 42;
|
let path = 42;
|
||||||
|
@ -514,13 +514,14 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
$crate::impl_top_level_pk!(Pkh, $crate::miniscript::Legacy, $key)
|
||||||
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Pkh(a), b, c))
|
||||||
});
|
});
|
||||||
( wpkh ( $key:expr ) ) => ({
|
( wpkh ( $key:expr ) ) => ({
|
||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
.map(|(a, b, c)| (Descriptor::<DescriptorPublicKey>::Wpkh(a), b, c))
|
||||||
});
|
});
|
||||||
( sh ( wpkh ( $key:expr ) ) ) => ({
|
( sh ( wpkh ( $key:expr ) ) ) => ({
|
||||||
@ -530,7 +531,7 @@ macro_rules! descriptor {
|
|||||||
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
use $crate::miniscript::descriptor::{Descriptor, DescriptorPublicKey, Sh};
|
||||||
|
|
||||||
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
$crate::impl_top_level_pk!(Wpkh, $crate::miniscript::Segwitv0, $key)
|
||||||
.and_then(|(a, b, c)| Ok((a?, b, c)))
|
.and_then(|(a, b, c)| Ok((a.map_err(|e| miniscript::Error::from(e))?, b, c)))
|
||||||
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
.and_then(|(a, b, c)| Ok((Descriptor::<DescriptorPublicKey>::Sh(Sh::new_wpkh(a.into_inner())?), b, c)))
|
||||||
});
|
});
|
||||||
( sh ( $( $minisc:tt )* ) ) => ({
|
( sh ( $( $minisc:tt )* ) ) => ({
|
||||||
@ -700,7 +701,7 @@ macro_rules! fragment {
|
|||||||
$crate::keys::make_pkh($key, &secp)
|
$crate::keys::make_pkh($key, &secp)
|
||||||
});
|
});
|
||||||
( after ( $value:expr ) ) => ({
|
( after ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(After, $crate::bitcoin::PackedLockTime($value)) // TODO!! https://github.com/rust-bitcoin/rust-bitcoin/issues/1302
|
$crate::impl_leaf_opcode_value!(After, $crate::miniscript::AbsLockTime::from_consensus($value))
|
||||||
});
|
});
|
||||||
( older ( $value:expr ) ) => ({
|
( older ( $value:expr ) ) => ({
|
||||||
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
$crate::impl_leaf_opcode_value!(Older, $crate::bitcoin::Sequence($value)) // TODO!!
|
||||||
@ -793,7 +794,6 @@ macro_rules! fragment {
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
use bitcoin::hashes::hex::ToHex;
|
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
use miniscript::descriptor::{DescriptorPublicKey, KeyMap};
|
||||||
use miniscript::{Descriptor, Legacy, Segwitv0};
|
use miniscript::{Descriptor, Legacy, Segwitv0};
|
||||||
@ -802,8 +802,8 @@ mod test {
|
|||||||
|
|
||||||
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
use crate::descriptor::{DescriptorError, DescriptorMeta};
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey, ValidNetworks};
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
use bitcoin::network::constants::Network::{Bitcoin, Regtest, Signet, Testnet};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::PrivateKey;
|
use bitcoin::PrivateKey;
|
||||||
|
|
||||||
// test the descriptor!() macro
|
// test the descriptor!() macro
|
||||||
@ -819,18 +819,15 @@ mod test {
|
|||||||
assert_eq!(desc.is_witness(), is_witness);
|
assert_eq!(desc.is_witness(), is_witness);
|
||||||
assert_eq!(!desc.has_wildcard(), is_fixed);
|
assert_eq!(!desc.has_wildcard(), is_fixed);
|
||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let child_desc = desc
|
||||||
let child_desc = if !desc.has_wildcard() {
|
.at_derivation_index(i as u32)
|
||||||
desc.at_derivation_index(0)
|
.expect("i is not hardened");
|
||||||
} else {
|
|
||||||
desc.at_derivation_index(index)
|
|
||||||
};
|
|
||||||
let address = child_desc.address(Regtest);
|
let address = child_desc.address(Regtest);
|
||||||
if let Ok(address) = address {
|
if let Ok(address) = address {
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
} else {
|
} else {
|
||||||
let script = child_desc.script_pubkey();
|
let script = child_desc.script_pubkey();
|
||||||
assert_eq!(script.to_hex().as_str(), *expected.get(i).unwrap());
|
assert_eq!(script.to_hex_string(), *expected.get(i).unwrap());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -1175,9 +1172,7 @@ mod test {
|
|||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
#[should_panic(
|
#[should_panic(expected = "Miniscript(ContextError(UncompressedKeysNotAllowed))")]
|
||||||
expected = "Miniscript(ContextError(CompressedOnly(\"04b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a87378ec38ff91d43e8c2092ebda601780485263da089465619e0358a5c1be7ac91f4\")))"
|
|
||||||
)]
|
|
||||||
fn test_dsl_miniscript_checks() {
|
fn test_dsl_miniscript_checks() {
|
||||||
let mut uncompressed_pk =
|
let mut uncompressed_pk =
|
||||||
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
PrivateKey::from_wif("L5EZftvrYaSudiozVRzTqLcHLNDoVn7H5HSfM9BAN6tMJX8oTWz6").unwrap();
|
||||||
|
@ -30,11 +30,11 @@ pub enum Error {
|
|||||||
InvalidDescriptorCharacter(u8),
|
InvalidDescriptorCharacter(u8),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Error during base58 decoding
|
/// Error during base58 decoding
|
||||||
Base58(bitcoin::util::base58::Error),
|
Base58(bitcoin::base58::Error),
|
||||||
/// Key-related error
|
/// Key-related error
|
||||||
Pk(bitcoin::util::key::Error),
|
Pk(bitcoin::key::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
/// Hex decoding error
|
/// Hex decoding error
|
||||||
@ -78,9 +78,9 @@ impl std::fmt::Display for Error {
|
|||||||
|
|
||||||
impl std::error::Error for Error {}
|
impl std::error::Error for Error {}
|
||||||
|
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
impl_error!(bitcoin::bip32::Error, Bip32);
|
||||||
impl_error!(bitcoin::util::base58::Error, Base58);
|
impl_error!(bitcoin::base58::Error, Base58);
|
||||||
impl_error!(bitcoin::util::key::Error, Pk);
|
impl_error!(bitcoin::key::Error, Pk);
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
impl_error!(miniscript::Error, Miniscript);
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
||||||
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
impl_error!(crate::descriptor::policy::PolicyError, Policy);
|
||||||
|
@ -16,17 +16,17 @@
|
|||||||
|
|
||||||
use std::collections::BTreeMap;
|
use std::collections::BTreeMap;
|
||||||
|
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPubKey, Fingerprint, KeySource};
|
||||||
use bitcoin::util::{psbt, taproot};
|
use bitcoin::{key::XOnlyPublicKey, secp256k1, PublicKey};
|
||||||
use bitcoin::{secp256k1, PublicKey, XOnlyPublicKey};
|
use bitcoin::{psbt, taproot};
|
||||||
use bitcoin::{Network, TxOut};
|
use bitcoin::{Network, TxOut};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DefiniteDescriptorKey, DescriptorSecretKey, DescriptorType, InnerXKey, SinglePubKey,
|
DefiniteDescriptorKey, DescriptorMultiXKey, DescriptorSecretKey, DescriptorType,
|
||||||
|
DescriptorXKey, InnerXKey, KeyMap, SinglePubKey, Wildcard,
|
||||||
};
|
};
|
||||||
pub use miniscript::{
|
pub use miniscript::{
|
||||||
descriptor::DescriptorXKey, descriptor::KeyMap, descriptor::Wildcard, Descriptor,
|
Descriptor, DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
||||||
DescriptorPublicKey, Legacy, Miniscript, ScriptContext, Segwitv0,
|
|
||||||
};
|
};
|
||||||
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
use miniscript::{ForEachKey, MiniscriptKey, TranslatePk};
|
||||||
|
|
||||||
@ -57,16 +57,16 @@ pub type DerivedDescriptor = Descriptor<DefiniteDescriptorKey>;
|
|||||||
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent derivation paths in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
pub type HdKeyPaths = BTreeMap<secp256k1::PublicKey, KeySource>;
|
||||||
|
|
||||||
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
/// Alias for the type of maps that represent taproot key origins in a [`psbt::Input`] or
|
||||||
/// [`psbt::Output`]
|
/// [`psbt::Output`]
|
||||||
///
|
///
|
||||||
/// [`psbt::Input`]: bitcoin::util::psbt::Input
|
/// [`psbt::Input`]: bitcoin::psbt::Input
|
||||||
/// [`psbt::Output`]: bitcoin::util::psbt::Output
|
/// [`psbt::Output`]: bitcoin::psbt::Output
|
||||||
pub type TapKeyOrigins = BTreeMap<bitcoin::XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
pub type TapKeyOrigins = BTreeMap<XOnlyPublicKey, (Vec<taproot::TapLeafHash>, KeySource)>;
|
||||||
|
|
||||||
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
/// Trait for types which can be converted into an [`ExtendedDescriptor`] and a [`KeyMap`] usable by a wallet in a specific [`Network`]
|
||||||
pub trait IntoWalletDescriptor {
|
pub trait IntoWalletDescriptor {
|
||||||
@ -134,14 +134,10 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
network: Network,
|
network: Network,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl<'s, 'd>
|
impl<'s, 'd> miniscript::Translator<DescriptorPublicKey, String, DescriptorError>
|
||||||
miniscript::Translator<DescriptorPublicKey, miniscript::DummyKey, DescriptorError>
|
|
||||||
for Translator<'s, 'd>
|
for Translator<'s, 'd>
|
||||||
{
|
{
|
||||||
fn pk(
|
fn pk(&mut self, pk: &DescriptorPublicKey) -> Result<String, DescriptorError> {
|
||||||
&mut self,
|
|
||||||
pk: &DescriptorPublicKey,
|
|
||||||
) -> Result<miniscript::DummyKey, DescriptorError> {
|
|
||||||
let secp = &self.secp;
|
let secp = &self.secp;
|
||||||
|
|
||||||
let (_, _, networks) = if self.descriptor.is_taproot() {
|
let (_, _, networks) = if self.descriptor.is_taproot() {
|
||||||
@ -159,7 +155,7 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
};
|
};
|
||||||
|
|
||||||
if networks.contains(&self.network) {
|
if networks.contains(&self.network) {
|
||||||
Ok(miniscript::DummyKey)
|
Ok(Default::default())
|
||||||
} else {
|
} else {
|
||||||
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
Err(DescriptorError::Key(KeyError::InvalidNetwork))
|
||||||
}
|
}
|
||||||
@ -167,35 +163,40 @@ impl IntoWalletDescriptor for (ExtendedDescriptor, KeyMap) {
|
|||||||
fn sha256(
|
fn sha256(
|
||||||
&mut self,
|
&mut self,
|
||||||
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
_sha256: &<DescriptorPublicKey as MiniscriptKey>::Sha256,
|
||||||
) -> Result<miniscript::DummySha256Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn hash256(
|
fn hash256(
|
||||||
&mut self,
|
&mut self,
|
||||||
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
_hash256: &<DescriptorPublicKey as MiniscriptKey>::Hash256,
|
||||||
) -> Result<miniscript::DummyHash256Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn ripemd160(
|
fn ripemd160(
|
||||||
&mut self,
|
&mut self,
|
||||||
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
_ripemd160: &<DescriptorPublicKey as MiniscriptKey>::Ripemd160,
|
||||||
) -> Result<miniscript::DummyRipemd160Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
fn hash160(
|
fn hash160(
|
||||||
&mut self,
|
&mut self,
|
||||||
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
_hash160: &<DescriptorPublicKey as MiniscriptKey>::Hash160,
|
||||||
) -> Result<miniscript::DummyHash160Hash, DescriptorError> {
|
) -> Result<String, DescriptorError> {
|
||||||
Ok(Default::default())
|
Ok(Default::default())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
// check the network for the keys
|
// check the network for the keys
|
||||||
self.0.translate_pk(&mut Translator {
|
use miniscript::TranslateErr;
|
||||||
|
match self.0.translate_pk(&mut Translator {
|
||||||
secp,
|
secp,
|
||||||
network,
|
network,
|
||||||
descriptor: &self.0,
|
descriptor: &self.0,
|
||||||
})?;
|
}) {
|
||||||
|
Ok(_) => {}
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
}
|
||||||
|
|
||||||
Ok(self)
|
Ok(self)
|
||||||
}
|
}
|
||||||
@ -249,7 +250,12 @@ impl IntoWalletDescriptor for DescriptorTemplateOut {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// fixup the network for keys that need it in the descriptor
|
// fixup the network for keys that need it in the descriptor
|
||||||
let translated = desc.translate_pk(&mut Translator { network })?;
|
use miniscript::TranslateErr;
|
||||||
|
let translated = match desc.translate_pk(&mut Translator { network }) {
|
||||||
|
Ok(descriptor) => descriptor,
|
||||||
|
Err(TranslateErr::TranslatorErr(e)) => return Err(e),
|
||||||
|
Err(TranslateErr::OuterError(e)) => return Err(e.into()),
|
||||||
|
};
|
||||||
// ...and in the key map
|
// ...and in the key map
|
||||||
let fixed_keymap = keymap
|
let fixed_keymap = keymap
|
||||||
.into_iter()
|
.into_iter()
|
||||||
@ -338,6 +344,18 @@ pub(crate) trait XKeyUtils {
|
|||||||
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
impl<T> XKeyUtils for DescriptorMultiXKey<T>
|
||||||
|
where
|
||||||
|
T: InnerXKey,
|
||||||
|
{
|
||||||
|
fn root_fingerprint(&self, secp: &SecpCtx) -> Fingerprint {
|
||||||
|
match self.origin {
|
||||||
|
Some((fingerprint, _)) => fingerprint,
|
||||||
|
None => self.xkey.xkey_fingerprint(secp),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl<T> XKeyUtils for DescriptorXKey<T>
|
impl<T> XKeyUtils for DescriptorXKey<T>
|
||||||
where
|
where
|
||||||
T: InnerXKey,
|
T: InnerXKey,
|
||||||
@ -492,7 +510,10 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
false
|
false
|
||||||
});
|
});
|
||||||
|
|
||||||
path_found.map(|path| self.at_derivation_index(path))
|
path_found.map(|path| {
|
||||||
|
self.at_derivation_index(path)
|
||||||
|
.expect("We ignore hardened wildcards")
|
||||||
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
fn derive_from_hd_keypaths<'s>(
|
fn derive_from_hd_keypaths<'s>(
|
||||||
@ -543,7 +564,7 @@ impl DescriptorMeta for ExtendedDescriptor {
|
|||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
let descriptor = self.at_derivation_index(0);
|
let descriptor = self.at_derivation_index(0).expect("0 is not hardened");
|
||||||
match descriptor.desc_type() {
|
match descriptor.desc_type() {
|
||||||
// TODO: add pk() here
|
// TODO: add pk() here
|
||||||
DescriptorType::Pkh
|
DescriptorType::Pkh
|
||||||
@ -582,11 +603,10 @@ mod test {
|
|||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::consensus::encode::deserialize;
|
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::{bip32, psbt};
|
use bitcoin::ScriptBuf;
|
||||||
use bitcoin::Script;
|
use bitcoin::{bip32, psbt::Psbt};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::psbt::PsbtUtils;
|
use crate::psbt::PsbtUtils;
|
||||||
@ -597,7 +617,7 @@ mod test {
|
|||||||
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
"wpkh(02b4632d08485ff1df2db55b9dafd23347d1c47a457072a1e87be26896549a8737)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
"70736274ff010052010000000162307be8e431fbaff807cdf9cdc3fde44d7402\
|
||||||
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
11bc8342c31ffd6ec11fe35bcc0100000000ffffffff01328601000000000016\
|
||||||
@ -620,7 +640,7 @@ mod test {
|
|||||||
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
"pkh([0f056943/44h/0h/0h]tpubDDpWvmUrPZrhSPmUzCMBHffvC3HyMAPnWDSAQNBTnj1iZeJa7BZQEttFiP4DS4GCcXQHezdXhn86Hj6LHX5EDstXPWrMaSneRWM8yUf6NFd/10/*)",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
"70736274ff010053010000000145843b86be54a3cd8c9e38444e1162676c00df\
|
||||||
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
e7964122a70df491ea12fd67090100000000ffffffff01c19598000000000017\
|
||||||
@ -651,7 +671,7 @@ mod test {
|
|||||||
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
"wsh(and_v(v:pk(03b6633fef2397a0a9de9d7b6f23aef8368a6e362b0581f0f0af70d5ecfd254b14),older(6)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
"70736274ff01005302000000011c8116eea34408ab6529223c9a176606742207\
|
||||||
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
67a1ff1d46a6e3c4a88243ea6e01000000000600000001109698000000000017\
|
||||||
@ -675,7 +695,7 @@ mod test {
|
|||||||
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
"sh(and_v(v:pk(021403881a5587297818fcaf17d239cefca22fce84a45b3b1d23e836c4af671dbb),after(630000)))",
|
||||||
)
|
)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
let psbt: psbt::PartiallySignedTransaction = deserialize(
|
let psbt = Psbt::deserialize(
|
||||||
&Vec::<u8>::from_hex(
|
&Vec::<u8>::from_hex(
|
||||||
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
"70736274ff0100530100000001bc8c13df445dfadcc42afa6dc841f85d22b01d\
|
||||||
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
a6270ebf981740f4b7b1d800390000000000feffffff01ba9598000000000017\
|
||||||
@ -858,9 +878,9 @@ mod test {
|
|||||||
let (descriptor, _) =
|
let (descriptor, _) =
|
||||||
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
into_wallet_descriptor_checked(descriptor, &secp, Network::Testnet).unwrap();
|
||||||
|
|
||||||
let descriptor = descriptor.at_derivation_index(0);
|
let descriptor = descriptor.at_derivation_index(0).unwrap();
|
||||||
|
|
||||||
let script = Script::from_str("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
let script = ScriptBuf::from_hex("5321022f533b667e2ea3b36e21961c9fe9dca340fbe0af5210173a83ae0337ab20a57621026bb53a98e810bd0ee61a0ed1164ba6c024786d76554e793e202dc6ce9c78c4ea2102d5b8a7d66a41ffdb6f4c53d61994022e886b4f45001fb158b95c9164d45f8ca3210324b75eead2c1f9c60e8adeb5e7009fec7a29afcdb30d829d82d09562fe8bae8521032d34f8932200833487bd294aa219dcbe000b9f9b3d824799541430009f0fa55121037468f8ea99b6c64788398b5ad25480cad08f4b0d65be54ce3a55fd206b5ae4722103f72d3d96663b0ea99b0aeb0d7f273cab11a8de37885f1dddc8d9112adb87169357ae").unwrap();
|
||||||
|
|
||||||
let mut psbt_input = psbt::Input::default();
|
let mut psbt_input = psbt::Input::default();
|
||||||
psbt_input
|
psbt_input
|
||||||
|
@ -43,9 +43,9 @@ use std::fmt;
|
|||||||
use serde::ser::SerializeMap;
|
use serde::ser::SerializeMap;
|
||||||
use serde::{Serialize, Serializer};
|
use serde::{Serialize, Serializer};
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
use bitcoin::hashes::{hash160, ripemd160, sha256};
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
use bitcoin::{absolute, key::XOnlyPublicKey, PublicKey, Sequence};
|
||||||
use bitcoin::{LockTime, PublicKey, Sequence, XOnlyPublicKey};
|
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
DescriptorPublicKey, ShInner, SinglePub, SinglePubKey, SortedMultiVec, WshInner,
|
||||||
@ -66,7 +66,7 @@ use crate::wallet::utils::{After, Older, SecpCtx};
|
|||||||
use super::checksum::calc_checksum;
|
use super::checksum::calc_checksum;
|
||||||
use super::error::Error;
|
use super::error::Error;
|
||||||
use super::XKeyUtils;
|
use super::XKeyUtils;
|
||||||
use bitcoin::util::psbt::{Input as PsbtInput, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, Psbt};
|
||||||
use miniscript::psbt::PsbtInputSatisfier;
|
use miniscript::psbt::PsbtInputSatisfier;
|
||||||
|
|
||||||
/// A unique identifier for a key
|
/// A unique identifier for a key
|
||||||
@ -93,6 +93,9 @@ impl PkOrF {
|
|||||||
..
|
..
|
||||||
}) => PkOrF::XOnlyPubkey(*pk),
|
}) => PkOrF::XOnlyPubkey(*pk),
|
||||||
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
DescriptorPublicKey::XPub(xpub) => PkOrF::Fingerprint(xpub.root_fingerprint(secp)),
|
||||||
|
DescriptorPublicKey::MultiXPub(multi) => {
|
||||||
|
PkOrF::Fingerprint(multi.root_fingerprint(secp))
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@ -129,7 +132,7 @@ pub enum SatisfiableItem {
|
|||||||
/// Absolute timeclock timestamp
|
/// Absolute timeclock timestamp
|
||||||
AbsoluteTimelock {
|
AbsoluteTimelock {
|
||||||
/// The timelock value
|
/// The timelock value
|
||||||
value: LockTime,
|
value: absolute::LockTime,
|
||||||
},
|
},
|
||||||
/// Relative timelock locktime
|
/// Relative timelock locktime
|
||||||
RelativeTimelock {
|
RelativeTimelock {
|
||||||
@ -449,11 +452,14 @@ pub struct Condition {
|
|||||||
pub csv: Option<Sequence>,
|
pub csv: Option<Sequence>,
|
||||||
/// Optional timelock condition
|
/// Optional timelock condition
|
||||||
#[serde(skip_serializing_if = "Option::is_none")]
|
#[serde(skip_serializing_if = "Option::is_none")]
|
||||||
pub timelock: Option<LockTime>,
|
pub timelock: Option<absolute::LockTime>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Condition {
|
impl Condition {
|
||||||
fn merge_nlocktime(a: LockTime, b: LockTime) -> Result<LockTime, PolicyError> {
|
fn merge_nlocktime(
|
||||||
|
a: absolute::LockTime,
|
||||||
|
b: absolute::LockTime,
|
||||||
|
) -> Result<absolute::LockTime, PolicyError> {
|
||||||
if !a.is_same_unit(b) {
|
if !a.is_same_unit(b) {
|
||||||
Err(PolicyError::MixedTimelockUnits)
|
Err(PolicyError::MixedTimelockUnits)
|
||||||
} else if a > b {
|
} else if a > b {
|
||||||
@ -746,6 +752,7 @@ fn signer_id(key: &DescriptorPublicKey, secp: &SecpCtx) -> SignerId {
|
|||||||
..
|
..
|
||||||
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
}) => pk.to_pubkeyhash(SigType::Ecdsa).into(),
|
||||||
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
DescriptorPublicKey::XPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => xpub.root_fingerprint(secp).into(),
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -783,9 +790,9 @@ fn make_generic_signature<M: Fn() -> SatisfiableItem, F: Fn(&Psbt) -> bool>(
|
|||||||
fn generic_sig_in_psbt<
|
fn generic_sig_in_psbt<
|
||||||
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
// C is for "check", it's a closure we use to *check* if a psbt input contains the signature
|
||||||
// for a specific key
|
// for a specific key
|
||||||
C: Fn(&PsbtInput, &SinglePubKey) -> bool,
|
C: Fn(&psbt::Input, &SinglePubKey) -> bool,
|
||||||
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
// E is for "extract", it extracts a key from the bip32 derivations found in the psbt input
|
||||||
E: Fn(&PsbtInput, Fingerprint) -> Option<SinglePubKey>,
|
E: Fn(&psbt::Input, Fingerprint) -> Option<SinglePubKey>,
|
||||||
>(
|
>(
|
||||||
psbt: &Psbt,
|
psbt: &Psbt,
|
||||||
key: &DescriptorPublicKey,
|
key: &DescriptorPublicKey,
|
||||||
@ -803,6 +810,13 @@ fn generic_sig_in_psbt<
|
|||||||
None => false,
|
None => false,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
DescriptorPublicKey::MultiXPub(xpub) => {
|
||||||
|
//TODO check actual derivation matches
|
||||||
|
match extract(input, xpub.root_fingerprint(secp)) {
|
||||||
|
Some(pubkey) => check(input, &pubkey),
|
||||||
|
None => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -908,12 +922,12 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
}
|
}
|
||||||
Terminal::After(value) => {
|
Terminal::After(value) => {
|
||||||
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
let mut policy: Policy = SatisfiableItem::AbsoluteTimelock {
|
||||||
value: value.into(),
|
value: (*value).into(),
|
||||||
}
|
}
|
||||||
.into();
|
.into();
|
||||||
policy.contribution = Satisfaction::Complete {
|
policy.contribution = Satisfaction::Complete {
|
||||||
condition: Condition {
|
condition: Condition {
|
||||||
timelock: Some(value.into()),
|
timelock: Some((*value).into()),
|
||||||
csv: None,
|
csv: None,
|
||||||
},
|
},
|
||||||
};
|
};
|
||||||
@ -925,9 +939,9 @@ impl<Ctx: ScriptContext + 'static> ExtractPolicy for Miniscript<DescriptorPublic
|
|||||||
{
|
{
|
||||||
let after = After::new(Some(current_height), false);
|
let after = After::new(Some(current_height), false);
|
||||||
let after_sat =
|
let after_sat =
|
||||||
Satisfier::<bitcoin::PublicKey>::check_after(&after, value.into());
|
Satisfier::<bitcoin::PublicKey>::check_after(&after, (*value).into());
|
||||||
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
let inputs_sat = psbt_inputs_sat(psbt).all(|sat| {
|
||||||
Satisfier::<bitcoin::PublicKey>::check_after(&sat, value.into())
|
Satisfier::<bitcoin::PublicKey>::check_after(&sat, (*value).into())
|
||||||
});
|
});
|
||||||
if after_sat && inputs_sat {
|
if after_sat && inputs_sat {
|
||||||
policy.satisfaction = policy.contribution.clone();
|
policy.satisfaction = policy.contribution.clone();
|
||||||
@ -1152,8 +1166,8 @@ mod test {
|
|||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
use crate::wallet::signer::SignersContainer;
|
use crate::wallet::signer::SignersContainer;
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
use std::sync::Arc;
|
use std::sync::Arc;
|
||||||
@ -1572,6 +1586,7 @@ mod test {
|
|||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@ -1638,6 +1653,7 @@ mod test {
|
|||||||
|
|
||||||
let addr = wallet_desc
|
let addr = wallet_desc
|
||||||
.at_derivation_index(0)
|
.at_derivation_index(0)
|
||||||
|
.unwrap()
|
||||||
.address(Network::Testnet)
|
.address(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
|
@ -14,7 +14,7 @@
|
|||||||
//! This module contains the definition of various common script templates that are ready to be
|
//! This module contains the definition of various common script templates that are ready to be
|
||||||
//! used. See the documentation of each template for an example.
|
//! used. See the documentation of each template for an example.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::{Legacy, Segwitv0, Tap};
|
use miniscript::{Legacy, Segwitv0, Tap};
|
||||||
@ -215,7 +215,7 @@ impl<K: IntoDescriptorKey<Tap>> DescriptorTemplate for P2TR<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44;
|
/// use bdk::template::Bip44;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip44(key.clone(), KeychainKind::External),
|
/// Bip44(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip44(key, KeychainKind::Internal)),
|
/// Some(Bip44(key, KeychainKind::Internal)),
|
||||||
@ -254,8 +254,8 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip44Public;
|
/// use bdk::template::Bip44Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip44Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip44Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@ -294,7 +294,7 @@ impl<K: DerivableKey<Legacy>> DescriptorTemplate for Bip44Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49;
|
/// use bdk::template::Bip49;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip49(key.clone(), KeychainKind::External),
|
/// Bip49(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip49(key, KeychainKind::Internal)),
|
/// Some(Bip49(key, KeychainKind::Internal)),
|
||||||
@ -333,8 +333,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip49Public;
|
/// use bdk::template::Bip49Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip49Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip49Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@ -373,7 +373,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip49Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84;
|
/// use bdk::template::Bip84;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip84(key.clone(), KeychainKind::External),
|
/// Bip84(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip84(key, KeychainKind::Internal)),
|
/// Some(Bip84(key, KeychainKind::Internal)),
|
||||||
@ -412,8 +412,8 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip84Public;
|
/// use bdk::template::Bip84Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let wallet = Wallet::new(
|
/// let wallet = Wallet::new(
|
||||||
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip84Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip84Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@ -452,7 +452,7 @@ impl<K: DerivableKey<Segwitv0>> DescriptorTemplate for Bip84Public<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip86;
|
/// use bdk::template::Bip86;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
/// let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPeZRHk4rTG6orPS2CRNFX3njhUXx5vj9qGog5ZMH4uGReDWN5kCkY3jmWEtWause41CDvBRXD1shKknAMKxT99o9qUTRVC6m")?;
|
||||||
/// let mut wallet = Wallet::new(
|
/// let mut wallet = Wallet::new(
|
||||||
/// Bip86(key.clone(), KeychainKind::External),
|
/// Bip86(key.clone(), KeychainKind::External),
|
||||||
/// Some(Bip86(key, KeychainKind::Internal)),
|
/// Some(Bip86(key, KeychainKind::Internal)),
|
||||||
@ -491,8 +491,8 @@ impl<K: DerivableKey<Tap>> DescriptorTemplate for Bip86<K> {
|
|||||||
/// # use bdk::wallet::AddressIndex::New;
|
/// # use bdk::wallet::AddressIndex::New;
|
||||||
/// use bdk::template::Bip86Public;
|
/// use bdk::template::Bip86Public;
|
||||||
///
|
///
|
||||||
/// let key = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
/// let key = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q")?;
|
||||||
/// let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f")?;
|
/// let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f")?;
|
||||||
/// let mut wallet = Wallet::new(
|
/// let mut wallet = Wallet::new(
|
||||||
/// Bip86Public(key.clone(), fingerprint, KeychainKind::External),
|
/// Bip86Public(key.clone(), fingerprint, KeychainKind::External),
|
||||||
/// Some(Bip86Public(key, fingerprint, KeychainKind::Internal)),
|
/// Some(Bip86Public(key, fingerprint, KeychainKind::Internal)),
|
||||||
@ -599,30 +599,30 @@ mod test {
|
|||||||
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/{0,1}'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template_cointype() {
|
fn test_bip44_template_cointype() {
|
||||||
use bitcoin::util::bip32::ChildNumber::{self, Hardened};
|
use bitcoin::bip32::ChildNumber::{self, Hardened};
|
||||||
|
|
||||||
let xprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
let xprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K2fpbqApQL69a4oKdGVnVN52R82Ft7d1pSqgKmajF62acJo3aMszZb6qQ22QsVECSFxvf9uyxFUvFYQMq3QbtwtRSMjLAhMf").unwrap();
|
||||||
assert_eq!(Network::Bitcoin, xprvkey.network);
|
assert_eq!(Network::Bitcoin, xprvkey.network);
|
||||||
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
let xdesc = Bip44(xprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Bitcoin)
|
.build(Network::Bitcoin)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = xdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.get(0).unwrap();
|
||||||
assert_matches!(purpose, Hardened { index: 44 });
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
assert_matches!(coin_type, Hardened { index: 0 });
|
assert_matches!(coin_type, Hardened { index: 0 });
|
||||||
}
|
}
|
||||||
|
|
||||||
let tprvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let tprvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
assert_eq!(Network::Testnet, tprvkey.network);
|
assert_eq!(Network::Testnet, tprvkey.network);
|
||||||
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
let tdesc = Bip44(tprvkey, KeychainKind::Internal)
|
||||||
.build(Network::Testnet)
|
.build(Network::Testnet)
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
if let ExtendedDescriptor::Pkh(pkh) = tdesc.0 {
|
||||||
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().into();
|
let path: Vec<ChildNumber> = pkh.into_inner().full_derivation_path().unwrap().into();
|
||||||
let purpose = path.get(0).unwrap();
|
let purpose = path.get(0).unwrap();
|
||||||
assert_matches!(purpose, Hardened { index: 44 });
|
assert_matches!(purpose, Hardened { index: 44 });
|
||||||
let coin_type = path.get(1).unwrap();
|
let coin_type = path.get(1).unwrap();
|
||||||
@ -646,9 +646,9 @@ mod test {
|
|||||||
for i in 0..expected.len() {
|
for i in 0..expected.len() {
|
||||||
let index = i as u32;
|
let index = i as u32;
|
||||||
let child_desc = if !desc.has_wildcard() {
|
let child_desc = if !desc.has_wildcard() {
|
||||||
desc.at_derivation_index(0)
|
desc.at_derivation_index(0).unwrap()
|
||||||
} else {
|
} else {
|
||||||
desc.at_derivation_index(index)
|
desc.at_derivation_index(index).unwrap()
|
||||||
};
|
};
|
||||||
let address = child_desc.address(network).unwrap();
|
let address = child_desc.address(network).unwrap();
|
||||||
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
assert_eq!(address.to_string(), *expected.get(i).unwrap());
|
||||||
@ -774,7 +774,7 @@ mod test {
|
|||||||
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
// BIP44 `pkh(key/44'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_template() {
|
fn test_bip44_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip44(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
@ -804,8 +804,8 @@ mod test {
|
|||||||
// BIP44 public `pkh(key/{0,1}/*)`
|
// BIP44 public `pkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip44_public_template() {
|
fn test_bip44_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDDDzQ31JkZB7VxUr9bjvBivDdqoFLrDPyLWtLapArAi51ftfmCb2DPxwLQzX65iNcXz1DGaVvyvo6JQ6rTU73r2gqdEo8uov9QKRb7nKCSU").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip44Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
@ -835,7 +835,7 @@ mod test {
|
|||||||
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
// BIP49 `sh(wpkh(key/49'/0'/0'/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_template() {
|
fn test_bip49_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip49(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
@ -865,8 +865,8 @@ mod test {
|
|||||||
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
// BIP49 public `sh(wpkh(key/{0,1}/*))`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip49_public_template() {
|
fn test_bip49_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC49r947KGK52X5rBWS4BLs5m9SRY3pYHnvRrm7HcybZ3BfdEsGFyzCMzayi1u58eT82ZeyFZwH7DD6Q83E3fM9CpfMtmnTygnLfP59jL9L").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip49Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
@ -896,7 +896,7 @@ mod test {
|
|||||||
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
// BIP84 `wpkh(key/84'/0'/0'/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_template() {
|
fn test_bip84_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip84(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
@ -926,8 +926,8 @@ mod test {
|
|||||||
// BIP84 public `wpkh(key/{0,1}/*)`
|
// BIP84 public `wpkh(key/{0,1}/*)`
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip84_public_template() {
|
fn test_bip84_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("tpubDC2Qwo2TFsaNC4ju8nrUJ9mqVT3eSgdmy1yPqhgkjwmke3PRXutNGRYAUo6RCHTcVQaDR3ohNU9we59brGHuEKPvH1ags2nevW5opEE9Z5Q").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("c55b303f").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip84Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
true,
|
true,
|
||||||
@ -958,7 +958,7 @@ mod test {
|
|||||||
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip86_template() {
|
fn test_bip86_template() {
|
||||||
let prvkey = bitcoin::util::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
let prvkey = bitcoin::bip32::ExtendedPrivKey::from_str("xprv9s21ZrQH143K3GJpoapnV8SFfukcVBSfeCficPSGfubmSFDxo1kuHnLisriDvSnRRuL2Qrg5ggqHKNVpxR86QEC8w35uxmGoggxtQTPvfUu").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip86(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
Bip86(prvkey, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
@ -989,8 +989,8 @@ mod test {
|
|||||||
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
// Used addresses in test vector in https://github.com/bitcoin/bips/blob/master/bip-0086.mediawiki
|
||||||
#[test]
|
#[test]
|
||||||
fn test_bip86_public_template() {
|
fn test_bip86_public_template() {
|
||||||
let pubkey = bitcoin::util::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
let pubkey = bitcoin::bip32::ExtendedPubKey::from_str("xpub6BgBgsespWvERF3LHQu6CnqdvfEvtMcQjYrcRzx53QJjSxarj2afYWcLteoGVky7D3UKDP9QyrLprQ3VCECoY49yfdDEHGCtMMj92pReUsQ").unwrap();
|
||||||
let fingerprint = bitcoin::util::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
let fingerprint = bitcoin::bip32::Fingerprint::from_str("73c5da0a").unwrap();
|
||||||
check(
|
check(
|
||||||
Bip86Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
Bip86Public(pubkey, fingerprint, KeychainKind::External).build(Network::Bitcoin),
|
||||||
false,
|
false,
|
||||||
|
15
src/error.rs
15
src/error.rs
@ -86,6 +86,8 @@ pub enum Error {
|
|||||||
/// found network, for example the network of the bitcoin node
|
/// found network, for example the network of the bitcoin node
|
||||||
found: Network,
|
found: Network,
|
||||||
},
|
},
|
||||||
|
/// The address requested comes from an hardened index
|
||||||
|
HardenedIndex,
|
||||||
#[cfg(feature = "verify")]
|
#[cfg(feature = "verify")]
|
||||||
/// Transaction verification error
|
/// Transaction verification error
|
||||||
Verification(crate::wallet::verify::VerifyError),
|
Verification(crate::wallet::verify::VerifyError),
|
||||||
@ -106,7 +108,7 @@ pub enum Error {
|
|||||||
/// Miniscript PSBT error
|
/// Miniscript PSBT error
|
||||||
MiniscriptPsbt(MiniscriptPsbtError),
|
MiniscriptPsbt(MiniscriptPsbtError),
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// A secp256k1 error
|
/// A secp256k1 error
|
||||||
Secp256k1(bitcoin::secp256k1::Error),
|
Secp256k1(bitcoin::secp256k1::Error),
|
||||||
/// Error serializing or deserializing JSON data
|
/// Error serializing or deserializing JSON data
|
||||||
@ -114,9 +116,9 @@ pub enum Error {
|
|||||||
/// Hex decoding error
|
/// Hex decoding error
|
||||||
Hex(bitcoin::hashes::hex::Error),
|
Hex(bitcoin::hashes::hex::Error),
|
||||||
/// Partially signed bitcoin transaction error
|
/// Partially signed bitcoin transaction error
|
||||||
Psbt(bitcoin::util::psbt::Error),
|
Psbt(bitcoin::psbt::Error),
|
||||||
/// Partially signed bitcoin transaction parse error
|
/// Partially signed bitcoin transaction parse error
|
||||||
PsbtParse(bitcoin::util::psbt::PsbtParseError),
|
PsbtParse(bitcoin::psbt::PsbtParseError),
|
||||||
|
|
||||||
//KeyMismatch(bitcoin::secp256k1::PublicKey, bitcoin::secp256k1::PublicKey),
|
//KeyMismatch(bitcoin::secp256k1::PublicKey, bitcoin::secp256k1::PublicKey),
|
||||||
//MissingInputUTXO(usize),
|
//MissingInputUTXO(usize),
|
||||||
@ -228,6 +230,7 @@ impl fmt::Display for Error {
|
|||||||
"Invalid network: requested {} but found {}",
|
"Invalid network: requested {} but found {}",
|
||||||
requested, found
|
requested, found
|
||||||
),
|
),
|
||||||
|
Self::HardenedIndex => write!(f, "Requested address from an hardened index"),
|
||||||
#[cfg(feature = "verify")]
|
#[cfg(feature = "verify")]
|
||||||
Self::Verification(err) => write!(f, "Transaction verification error: {}", err),
|
Self::Verification(err) => write!(f, "Transaction verification error: {}", err),
|
||||||
Self::InvalidProgressValue(progress) => {
|
Self::InvalidProgressValue(progress) => {
|
||||||
@ -304,12 +307,12 @@ impl From<crate::keys::KeyError> for Error {
|
|||||||
impl_error!(bitcoin::consensus::encode::Error, Encode);
|
impl_error!(bitcoin::consensus::encode::Error, Encode);
|
||||||
impl_error!(miniscript::Error, Miniscript);
|
impl_error!(miniscript::Error, Miniscript);
|
||||||
impl_error!(MiniscriptPsbtError, MiniscriptPsbt);
|
impl_error!(MiniscriptPsbtError, MiniscriptPsbt);
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32);
|
impl_error!(bitcoin::bip32::Error, Bip32);
|
||||||
impl_error!(bitcoin::secp256k1::Error, Secp256k1);
|
impl_error!(bitcoin::secp256k1::Error, Secp256k1);
|
||||||
impl_error!(serde_json::Error, Json);
|
impl_error!(serde_json::Error, Json);
|
||||||
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
impl_error!(bitcoin::hashes::hex::Error, Hex);
|
||||||
impl_error!(bitcoin::util::psbt::Error, Psbt);
|
impl_error!(bitcoin::psbt::Error, Psbt);
|
||||||
impl_error!(bitcoin::util::psbt::PsbtParseError, PsbtParse);
|
impl_error!(bitcoin::psbt::PsbtParseError, PsbtParse);
|
||||||
|
|
||||||
#[cfg(feature = "electrum")]
|
#[cfg(feature = "electrum")]
|
||||||
impl_error!(electrum_client::Error, Electrum);
|
impl_error!(electrum_client::Error, Electrum);
|
||||||
|
@ -14,7 +14,7 @@
|
|||||||
// TODO: maybe write our own implementation of bip39? Seems stupid to have an extra dependency for
|
// TODO: maybe write our own implementation of bip39? Seems stupid to have an extra dependency for
|
||||||
// something that should be fairly simple to re-implement.
|
// something that should be fairly simple to re-implement.
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
|
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
@ -141,7 +141,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
(word_count, language): Self::Options,
|
(word_count, language): Self::Options,
|
||||||
entropy: Self::Entropy,
|
entropy: Self::Entropy,
|
||||||
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
||||||
let entropy = &entropy.as_ref()[..(word_count as usize / 8)];
|
let entropy = &entropy[..(word_count as usize / 8)];
|
||||||
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
let mnemonic = Mnemonic::from_entropy_in(language, entropy)?;
|
||||||
|
|
||||||
Ok(GeneratedKey::new(mnemonic, any_network()))
|
Ok(GeneratedKey::new(mnemonic, any_network()))
|
||||||
@ -152,7 +152,7 @@ impl<Ctx: ScriptContext> GeneratableKey<Ctx> for Mnemonic {
|
|||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use bip39::{Language, Mnemonic};
|
use bip39::{Language, Mnemonic};
|
||||||
|
|
||||||
|
@ -19,8 +19,8 @@ use std::str::FromStr;
|
|||||||
|
|
||||||
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
||||||
|
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
use bitcoin::{Network, PrivateKey, PublicKey, XOnlyPublicKey};
|
use bitcoin::{key::XOnlyPublicKey, Network, PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
||||||
pub use miniscript::descriptor::{
|
pub use miniscript::descriptor::{
|
||||||
@ -385,12 +385,12 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
/// use bdk::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// network: bitcoin::Network,
|
/// network: bitcoin::Network,
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
@ -401,7 +401,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@ -416,14 +416,14 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
///
|
///
|
||||||
/// ```
|
/// ```
|
||||||
/// use bdk::bitcoin;
|
/// use bdk::bitcoin;
|
||||||
/// use bdk::bitcoin::util::bip32;
|
/// use bdk::bitcoin::bip32;
|
||||||
/// use bdk::keys::{
|
/// use bdk::keys::{
|
||||||
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
/// struct MyCustomKeyType {
|
/// struct MyCustomKeyType {
|
||||||
/// key_data: bitcoin::PrivateKey,
|
/// key_data: bitcoin::PrivateKey,
|
||||||
/// chain_code: Vec<u8>,
|
/// chain_code: [u8; 32],
|
||||||
/// }
|
/// }
|
||||||
///
|
///
|
||||||
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
||||||
@ -433,7 +433,7 @@ impl<Ctx: ScriptContext> From<bip32::ExtendedPrivKey> for ExtendedKey<Ctx> {
|
|||||||
/// depth: 0,
|
/// depth: 0,
|
||||||
/// parent_fingerprint: bip32::Fingerprint::default(),
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
||||||
/// private_key: self.key_data.inner,
|
/// private_key: self.key_data.inner,
|
||||||
/// chain_code: bip32::ChainCode::from(self.chain_code.as_ref()),
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
||||||
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@ -925,13 +925,13 @@ pub enum KeyError {
|
|||||||
Message(String),
|
Message(String),
|
||||||
|
|
||||||
/// BIP32 error
|
/// BIP32 error
|
||||||
Bip32(bitcoin::util::bip32::Error),
|
Bip32(bitcoin::bip32::Error),
|
||||||
/// Miniscript error
|
/// Miniscript error
|
||||||
Miniscript(miniscript::Error),
|
Miniscript(miniscript::Error),
|
||||||
}
|
}
|
||||||
|
|
||||||
impl_error!(miniscript::Error, Miniscript, KeyError);
|
impl_error!(miniscript::Error, Miniscript, KeyError);
|
||||||
impl_error!(bitcoin::util::bip32::Error, Bip32, KeyError);
|
impl_error!(bitcoin::bip32::Error, Bip32, KeyError);
|
||||||
|
|
||||||
impl std::fmt::Display for KeyError {
|
impl std::fmt::Display for KeyError {
|
||||||
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
fn fmt(&self, f: &mut std::fmt::Formatter<'_>) -> std::fmt::Result {
|
||||||
@ -950,7 +950,7 @@ impl std::error::Error for KeyError {}
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub mod test {
|
pub mod test {
|
||||||
use bitcoin::util::bip32;
|
use bitcoin::bip32;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
|
@ -149,7 +149,7 @@ fn main() -> Result<(), bdk::Error> {
|
|||||||
//! ```no_run
|
//! ```no_run
|
||||||
//! use std::str::FromStr;
|
//! use std::str::FromStr;
|
||||||
//!
|
//!
|
||||||
//! use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
//! use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
//!
|
//!
|
||||||
//! use bdk::{Wallet, SignOptions};
|
//! use bdk::{Wallet, SignOptions};
|
||||||
//! use bdk::database::MemoryDatabase;
|
//! use bdk::database::MemoryDatabase;
|
||||||
|
@ -12,7 +12,7 @@
|
|||||||
//! Additional functions on the `rust-bitcoin` `PartiallySignedTransaction` structure.
|
//! Additional functions on the `rust-bitcoin` `PartiallySignedTransaction` structure.
|
||||||
|
|
||||||
use crate::FeeRate;
|
use crate::FeeRate;
|
||||||
use bitcoin::util::psbt::PartiallySignedTransaction as Psbt;
|
use bitcoin::psbt::PartiallySignedTransaction as Psbt;
|
||||||
use bitcoin::TxOut;
|
use bitcoin::TxOut;
|
||||||
|
|
||||||
// TODO upstream the functions here to `rust-bitcoin`?
|
// TODO upstream the functions here to `rust-bitcoin`?
|
||||||
|
@ -10,13 +10,13 @@
|
|||||||
|
|
||||||
use crate::testutils::TestIncomingTx;
|
use crate::testutils::TestIncomingTx;
|
||||||
use bitcoin::consensus::encode::{deserialize, serialize};
|
use bitcoin::consensus::encode::{deserialize, serialize};
|
||||||
use bitcoin::hashes::hex::{FromHex, ToHex};
|
|
||||||
use bitcoin::hashes::sha256d;
|
use bitcoin::hashes::sha256d;
|
||||||
use bitcoin::{Address, Amount, PackedLockTime, Script, Sequence, Transaction, Txid, Witness};
|
use bitcoin::{absolute, Address, Amount, Script, ScriptBuf, Sequence, Transaction, Txid, Witness};
|
||||||
pub use bitcoincore_rpc::bitcoincore_rpc_json::AddressType;
|
pub use bitcoincore_rpc::json::AddressType;
|
||||||
pub use bitcoincore_rpc::{Auth, Client as RpcClient, RpcApi};
|
pub use bitcoincore_rpc::{Auth, Client as RpcClient, RpcApi};
|
||||||
use core::str::FromStr;
|
use core::str::FromStr;
|
||||||
use electrsd::bitcoind::BitcoinD;
|
use electrsd::bitcoind::BitcoinD;
|
||||||
|
use electrsd::electrum_client::ElectrumApi as _;
|
||||||
use electrsd::{bitcoind, ElectrsD};
|
use electrsd::{bitcoind, ElectrsD};
|
||||||
pub use electrum_client::{Client as ElectrumClient, ElectrumApi};
|
pub use electrum_client::{Client as ElectrumClient, ElectrumApi};
|
||||||
#[allow(unused_imports)]
|
#[allow(unused_imports)]
|
||||||
@ -45,7 +45,11 @@ impl TestClient {
|
|||||||
|
|
||||||
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &conf).unwrap();
|
let electrsd = ElectrsD::with_conf(electrs_exe, &bitcoind, &conf).unwrap();
|
||||||
|
|
||||||
let node_address = bitcoind.client.get_new_address(None, None).unwrap();
|
let node_address = bitcoind
|
||||||
|
.client
|
||||||
|
.get_new_address(None, None)
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
bitcoind
|
bitcoind
|
||||||
.client
|
.client
|
||||||
.generate_to_address(101, &node_address)
|
.generate_to_address(101, &node_address)
|
||||||
@ -107,7 +111,7 @@ impl TestClient {
|
|||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
if self.get_balance(None, None).unwrap() < Amount::from_sat(required_balance) {
|
if self.get_balance(None, None).unwrap() < Amount::from_sat(required_balance) {
|
||||||
panic!("Insufficient funds in bitcoind. Please generate a few blocks with: `bitcoin-cli generatetoaddress 10 {}`", self.get_new_address(None, None).unwrap());
|
panic!("Insufficient funds in bitcoind. Please generate a few blocks with: `bitcoin-cli generatetoaddress 10 {}`", self.get_new_address(None, None).unwrap().assume_checked());
|
||||||
}
|
}
|
||||||
|
|
||||||
// FIXME: core can't create a tx with two outputs to the same address
|
// FIXME: core can't create a tx with two outputs to the same address
|
||||||
@ -143,6 +147,7 @@ impl TestClient {
|
|||||||
|
|
||||||
let monitor_script = Address::from_str(&meta_tx.output[0].to_address)
|
let monitor_script = Address::from_str(&meta_tx.output[0].to_address)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
self.wait_for_tx(txid, &monitor_script);
|
self.wait_for_tx(txid, &monitor_script);
|
||||||
|
|
||||||
@ -161,7 +166,7 @@ impl TestClient {
|
|||||||
|
|
||||||
let bumped: serde_json::Value = self.call("bumpfee", &[txid.to_string().into()]).unwrap();
|
let bumped: serde_json::Value = self.call("bumpfee", &[txid.to_string().into()]).unwrap();
|
||||||
let new_txid = Txid::from_str(&bumped["txid"].as_str().unwrap().to_string()).unwrap();
|
let new_txid = Txid::from_str(&bumped["txid"].as_str().unwrap().to_string()).unwrap();
|
||||||
let monitor_script = Script::from_hex(&mut tx.vout[0].script_pub_key.hex.to_hex()).unwrap();
|
let monitor_script = ScriptBuf::from_bytes(tx.vout[0].script_pub_key.hex.clone());
|
||||||
self.wait_for_tx(new_txid, &monitor_script);
|
self.wait_for_tx(new_txid, &monitor_script);
|
||||||
|
|
||||||
debug!("Bumped {}, new txid {}", txid, new_txid);
|
debug!("Bumped {}, new txid {}", txid, new_txid);
|
||||||
@ -170,41 +175,44 @@ impl TestClient {
|
|||||||
}
|
}
|
||||||
|
|
||||||
pub fn generate_manually(&mut self, txs: Vec<Transaction>) -> String {
|
pub fn generate_manually(&mut self, txs: Vec<Transaction>) -> String {
|
||||||
use bitcoin::blockdata::block::{Block, BlockHeader};
|
use bitcoin::blockdata::block::{Block, Header, Version};
|
||||||
use bitcoin::blockdata::script::Builder;
|
use bitcoin::blockdata::script::Builder;
|
||||||
use bitcoin::blockdata::transaction::{OutPoint, TxIn, TxOut};
|
use bitcoin::blockdata::transaction::{OutPoint, TxIn, TxOut};
|
||||||
use bitcoin::hash_types::{BlockHash, TxMerkleNode};
|
use bitcoin::hash_types::{BlockHash, TxMerkleNode};
|
||||||
use bitcoin::hashes::Hash;
|
use bitcoin::hashes::Hash;
|
||||||
|
use bitcoin::pow::CompactTarget;
|
||||||
|
|
||||||
let block_template: serde_json::Value = self
|
let block_template: serde_json::Value = self
|
||||||
.call("getblocktemplate", &[json!({"rules": ["segwit"]})])
|
.call("getblocktemplate", &[json!({"rules": ["segwit"]})])
|
||||||
.unwrap();
|
.unwrap();
|
||||||
trace!("getblocktemplate: {:#?}", block_template);
|
trace!("getblocktemplate: {:#?}", block_template);
|
||||||
|
|
||||||
let header = BlockHeader {
|
let header = Header {
|
||||||
version: block_template["version"].as_i64().unwrap() as i32,
|
version: Version::from_consensus(block_template["version"].as_i64().unwrap() as i32),
|
||||||
prev_blockhash: BlockHash::from_hex(
|
prev_blockhash: BlockHash::from_str(
|
||||||
block_template["previousblockhash"].as_str().unwrap(),
|
block_template["previousblockhash"].as_str().unwrap(),
|
||||||
)
|
)
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
merkle_root: TxMerkleNode::all_zeros(),
|
merkle_root: TxMerkleNode::all_zeros(),
|
||||||
time: block_template["curtime"].as_u64().unwrap() as u32,
|
time: block_template["curtime"].as_u64().unwrap() as u32,
|
||||||
bits: u32::from_str_radix(block_template["bits"].as_str().unwrap(), 16).unwrap(),
|
bits: CompactTarget::from_consensus(
|
||||||
|
u32::from_str_radix(block_template["bits"].as_str().unwrap(), 16).unwrap(),
|
||||||
|
),
|
||||||
nonce: 0,
|
nonce: 0,
|
||||||
};
|
};
|
||||||
debug!("header: {:#?}", header);
|
debug!("header: {:#?}", header);
|
||||||
|
|
||||||
let height = block_template["height"].as_u64().unwrap() as i64;
|
let height = block_template["height"].as_u64().unwrap() as i64;
|
||||||
let witness_reserved_value: Vec<u8> = sha256d::Hash::all_zeros().as_ref().into();
|
let witness_reserved_value = sha256d::Hash::all_zeros().as_byte_array().to_vec();
|
||||||
// burn block subsidy and fees, not a big deal
|
// burn block subsidy and fees, not a big deal
|
||||||
let mut coinbase_tx = Transaction {
|
let mut coinbase_tx = Transaction {
|
||||||
version: 1,
|
version: 1,
|
||||||
lock_time: PackedLockTime(0),
|
lock_time: absolute::LockTime::ZERO,
|
||||||
input: vec![TxIn {
|
input: vec![TxIn {
|
||||||
previous_output: OutPoint::null(),
|
previous_output: OutPoint::null(),
|
||||||
script_sig: Builder::new().push_int(height).into_script(),
|
script_sig: Builder::new().push_int(height).into_script(),
|
||||||
sequence: Sequence(0xFFFFFFFF),
|
sequence: Sequence(0xFFFFFFFF),
|
||||||
witness: Witness::from_vec(vec![witness_reserved_value]),
|
witness: Witness::from_slice(&vec![witness_reserved_value]),
|
||||||
}],
|
}],
|
||||||
output: vec![],
|
output: vec![],
|
||||||
};
|
};
|
||||||
@ -225,7 +233,7 @@ impl TestClient {
|
|||||||
|
|
||||||
// now update and replace the coinbase tx
|
// now update and replace the coinbase tx
|
||||||
let mut coinbase_witness_commitment_script = vec![0x6a, 0x24, 0xaa, 0x21, 0xa9, 0xed];
|
let mut coinbase_witness_commitment_script = vec![0x6a, 0x24, 0xaa, 0x21, 0xa9, 0xed];
|
||||||
coinbase_witness_commitment_script.extend_from_slice(&witness_commitment);
|
coinbase_witness_commitment_script.extend_from_slice(witness_commitment.as_ref());
|
||||||
|
|
||||||
coinbase_tx.output.push(TxOut {
|
coinbase_tx.output.push(TxOut {
|
||||||
value: 0,
|
value: 0,
|
||||||
@ -245,11 +253,11 @@ impl TestClient {
|
|||||||
|
|
||||||
// now do PoW :)
|
// now do PoW :)
|
||||||
let target = block.header.target();
|
let target = block.header.target();
|
||||||
while block.header.validate_pow(&target).is_err() {
|
while block.header.validate_pow(target).is_err() {
|
||||||
block.header.nonce = block.header.nonce.checked_add(1).unwrap(); // panic if we run out of nonces
|
block.header.nonce = block.header.nonce.checked_add(1).unwrap(); // panic if we run out of nonces
|
||||||
}
|
}
|
||||||
|
|
||||||
let block_hex: String = serialize(&block).to_hex();
|
let block_hex: String = bitcoin::consensus::encode::serialize_hex(&block);
|
||||||
debug!("generated block hex: {}", block_hex);
|
debug!("generated block hex: {}", block_hex);
|
||||||
|
|
||||||
self.electrsd.client.block_headers_subscribe().unwrap();
|
self.electrsd.client.block_headers_subscribe().unwrap();
|
||||||
@ -265,11 +273,12 @@ impl TestClient {
|
|||||||
|
|
||||||
self.wait_for_block(height as usize);
|
self.wait_for_block(height as usize);
|
||||||
|
|
||||||
block.header.block_hash().to_hex()
|
block.header.block_hash().to_string()
|
||||||
}
|
}
|
||||||
|
|
||||||
pub fn generate(&mut self, num_blocks: u64, address: Option<Address>) {
|
pub fn generate(&mut self, num_blocks: u64, address: Option<Address>) {
|
||||||
let address = address.unwrap_or_else(|| self.get_new_address(None, None).unwrap());
|
let address =
|
||||||
|
address.unwrap_or_else(|| self.get_new_address(None, None).unwrap().assume_checked());
|
||||||
let hashes = self.generate_to_address(num_blocks, &address).unwrap();
|
let hashes = self.generate_to_address(num_blocks, &address).unwrap();
|
||||||
let best_hash = hashes.last().unwrap();
|
let best_hash = hashes.last().unwrap();
|
||||||
let height = self.get_block_info(best_hash).unwrap().height;
|
let height = self.get_block_info(best_hash).unwrap().height;
|
||||||
@ -317,9 +326,11 @@ impl TestClient {
|
|||||||
&self
|
&self
|
||||||
.get_new_address(None, address_type)
|
.get_new_address(None, address_type)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.to_string(),
|
.to_string(),
|
||||||
)
|
)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -378,7 +389,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
fn $_fn_name:ident ( $( $test_client:ident : &TestClient )? $(,)? ) -> $blockchain:ty $block:block) => {
|
fn $_fn_name:ident ( $( $test_client:ident : &TestClient )? $(,)? ) -> $blockchain:ty $block:block) => {
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod bdk_blockchain_tests {
|
mod bdk_blockchain_tests {
|
||||||
use $crate::bitcoin::{Transaction, Network};
|
use $crate::bitcoin::{Transaction, Network, blockdata::script::PushBytesBuf};
|
||||||
use $crate::testutils::blockchain_tests::TestClient;
|
use $crate::testutils::blockchain_tests::TestClient;
|
||||||
use $crate::blockchain::Blockchain;
|
use $crate::blockchain::Blockchain;
|
||||||
use $crate::database::MemoryDatabase;
|
use $crate::database::MemoryDatabase;
|
||||||
@ -386,6 +397,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
use $crate::wallet::AddressIndex;
|
use $crate::wallet::AddressIndex;
|
||||||
use $crate::{Wallet, FeeRate, SyncOptions};
|
use $crate::{Wallet, FeeRate, SyncOptions};
|
||||||
use $crate::testutils;
|
use $crate::testutils;
|
||||||
|
use std::convert::TryFrom;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
@ -1058,7 +1070,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
assert_eq!(wallet.get_balance().unwrap().untrusted_pending, 50_000, "incorrect balance");
|
assert_eq!(wallet.get_balance().unwrap().untrusted_pending, 50_000, "incorrect balance");
|
||||||
|
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
let data = [42u8;80];
|
let data = PushBytesBuf::try_from(vec![42u8;80]).unwrap();
|
||||||
builder.add_data(&data);
|
builder.add_data(&data);
|
||||||
let (mut psbt, details) = builder.finish().unwrap();
|
let (mut psbt, details) = builder.finish().unwrap();
|
||||||
|
|
||||||
@ -1066,7 +1078,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
assert!(finalized, "Cannot finalize transaction");
|
assert!(finalized, "Cannot finalize transaction");
|
||||||
let tx = psbt.extract_tx();
|
let tx = psbt.extract_tx();
|
||||||
let serialized_tx = bitcoin::consensus::encode::serialize(&tx);
|
let serialized_tx = bitcoin::consensus::encode::serialize(&tx);
|
||||||
assert!(serialized_tx.windows(data.len()).any(|e| e==data), "cannot find op_return data in transaction");
|
assert!(serialized_tx.windows(data.len()).any(|e| e==data.as_bytes()), "cannot find op_return data in transaction");
|
||||||
blockchain.broadcast(&tx).unwrap();
|
blockchain.broadcast(&tx).unwrap();
|
||||||
test_client.generate(1, Some(node_addr));
|
test_client.generate(1, Some(node_addr));
|
||||||
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
wallet.sync(&blockchain, SyncOptions::default()).unwrap();
|
||||||
@ -1165,8 +1177,9 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
// 2. Get a new bech32m address from test bitcoind node taproot wallet
|
// 2. Get a new bech32m address from test bitcoind node taproot wallet
|
||||||
|
|
||||||
// TODO replace once rust-bitcoincore-rpc with PR 199 released
|
// TODO replace once rust-bitcoincore-rpc with PR 199 released
|
||||||
let node_addr: bitcoin::Address = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).unwrap();
|
let node_addr: bitcoin::Address<bitcoin::address::NetworkUnchecked> = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).unwrap();
|
||||||
assert_eq!(node_addr, bitcoin::Address::from_str("bcrt1pj5y3f0fu4y7g98k4v63j9n0xvj3lmln0cpwhsjzknm6nt0hr0q7qnzwsy9").unwrap());
|
let node_addr = node_addr.assume_checked();
|
||||||
|
assert_eq!(node_addr, bitcoin::Address::from_str("bcrt1pj5y3f0fu4y7g98k4v63j9n0xvj3lmln0cpwhsjzknm6nt0hr0q7qnzwsy9").unwrap().assume_checked());
|
||||||
|
|
||||||
// 3. Send 50_000 sats from test bitcoind node to test BDK wallet
|
// 3. Send 50_000 sats from test bitcoind node to test BDK wallet
|
||||||
|
|
||||||
@ -1215,7 +1228,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
|
|
||||||
let (wallet, blockchain, _, mut test_client) = init_single_sig();
|
let (wallet, blockchain, _, mut test_client) = init_single_sig();
|
||||||
let bdk_address = wallet.get_address(AddressIndex::New).unwrap().address;
|
let bdk_address = wallet.get_address(AddressIndex::New).unwrap().address;
|
||||||
let core_address = test_client.get_new_address(None, None).unwrap();
|
let core_address = test_client.get_new_address(None, None).unwrap().assume_checked();
|
||||||
let tx = testutils! {
|
let tx = testutils! {
|
||||||
@tx ( (@addr bdk_address.clone()) => 50_000, (@addr core_address.clone()) => 40_000 )
|
@tx ( (@addr bdk_address.clone()) => 50_000, (@addr core_address.clone()) => 40_000 )
|
||||||
};
|
};
|
||||||
@ -1407,8 +1420,8 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
"label":"taproot key spend",
|
"label":"taproot key spend",
|
||||||
}]);
|
}]);
|
||||||
let _importdescriptors_result: Value = taproot_wallet_client.call("importdescriptors", &[import_descriptor_args]).expect("import wallet");
|
let _importdescriptors_result: Value = taproot_wallet_client.call("importdescriptors", &[import_descriptor_args]).expect("import wallet");
|
||||||
let generate_to_address: bitcoin::Address = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).expect("new address");
|
let generate_to_address: bitcoin::Address<bitcoin::address::NetworkUnchecked> = taproot_wallet_client.call("getnewaddress", &["test address".into(), "bech32m".into()]).expect("new address");
|
||||||
let _generatetoaddress_result = taproot_wallet_client.generate_to_address(101, &generate_to_address).expect("generated to address");
|
let _generatetoaddress_result = taproot_wallet_client.generate_to_address(101, &generate_to_address.assume_checked()).expect("generated to address");
|
||||||
let send_to_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
let send_to_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
||||||
let change_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
let change_address = wallet.get_address($crate::wallet::AddressIndex::New).unwrap().address.to_string();
|
||||||
let send_addr_amounts = json!([{
|
let send_addr_amounts = json!([{
|
||||||
@ -1421,7 +1434,7 @@ macro_rules! bdk_blockchain_tests {
|
|||||||
let send_result: Value = taproot_wallet_client.call("send", &[send_addr_amounts, Value::Null, "unset".into(), Value::Null, send_options]).expect("send psbt");
|
let send_result: Value = taproot_wallet_client.call("send", &[send_addr_amounts, Value::Null, "unset".into(), Value::Null, send_options]).expect("send psbt");
|
||||||
let core_psbt = send_result["psbt"].as_str().expect("core psbt str");
|
let core_psbt = send_result["psbt"].as_str().expect("core psbt str");
|
||||||
|
|
||||||
use bitcoin::util::psbt::PartiallySignedTransaction;
|
use bitcoin::psbt::PartiallySignedTransaction;
|
||||||
|
|
||||||
// Test parsing core created PSBT
|
// Test parsing core created PSBT
|
||||||
let mut psbt = PartiallySignedTransaction::from_str(&core_psbt).expect("core taproot psbt");
|
let mut psbt = PartiallySignedTransaction::from_str(&core_psbt).expect("core taproot psbt");
|
||||||
|
@ -106,7 +106,7 @@ macro_rules! testutils {
|
|||||||
let secp = Secp256k1::new();
|
let secp = Secp256k1::new();
|
||||||
|
|
||||||
let parsed = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &$descriptors.0).expect("Failed to parse descriptor in `testutils!(@external)`").0;
|
let parsed = Descriptor::<DescriptorPublicKey>::parse_descriptor(&secp, &$descriptors.0).expect("Failed to parse descriptor in `testutils!(@external)`").0;
|
||||||
parsed.at_derivation_index($child).address(bitcoin::Network::Regtest).expect("No address form")
|
parsed.at_derivation_index($child).unwrap().address(bitcoin::Network::Regtest).expect("No address form")
|
||||||
});
|
});
|
||||||
( @internal $descriptors:expr, $child:expr ) => ({
|
( @internal $descriptors:expr, $child:expr ) => ({
|
||||||
use $crate::bitcoin::secp256k1::Secp256k1;
|
use $crate::bitcoin::secp256k1::Secp256k1;
|
||||||
@ -146,7 +146,7 @@ macro_rules! testutils {
|
|||||||
let mut seed = [0u8; 32];
|
let mut seed = [0u8; 32];
|
||||||
rand::thread_rng().fill(&mut seed[..]);
|
rand::thread_rng().fill(&mut seed[..]);
|
||||||
|
|
||||||
let key = $crate::bitcoin::util::bip32::ExtendedPrivKey::new_master(
|
let key = $crate::bitcoin::bip32::ExtendedPrivKey::new_master(
|
||||||
$crate::bitcoin::Network::Testnet,
|
$crate::bitcoin::Network::Testnet,
|
||||||
&seed,
|
&seed,
|
||||||
);
|
);
|
||||||
|
18
src/types.rs
18
src/types.rs
@ -13,7 +13,7 @@ use std::convert::AsRef;
|
|||||||
use std::ops::Sub;
|
use std::ops::Sub;
|
||||||
|
|
||||||
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
use bitcoin::blockdata::transaction::{OutPoint, Transaction, TxOut};
|
||||||
use bitcoin::{hash_types::Txid, util::psbt};
|
use bitcoin::{hash_types::Txid, psbt, Weight};
|
||||||
|
|
||||||
use serde::{Deserialize, Serialize};
|
use serde::{Deserialize, Serialize};
|
||||||
|
|
||||||
@ -97,8 +97,8 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and weight units (`wu`).
|
/// Calculate fee rate from `fee` and weight units (`wu`).
|
||||||
pub fn from_wu(fee: u64, wu: usize) -> FeeRate {
|
pub fn from_wu(fee: u64, wu: Weight) -> FeeRate {
|
||||||
Self::from_vb(fee, wu.vbytes())
|
Self::from_vb(fee, wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate fee rate from `fee` and `vbytes`.
|
/// Calculate fee rate from `fee` and `vbytes`.
|
||||||
@ -113,8 +113,8 @@ impl FeeRate {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in weight units.
|
/// Calculate absolute fee in Satoshis using size in weight units.
|
||||||
pub fn fee_wu(&self, wu: usize) -> u64 {
|
pub fn fee_wu(&self, wu: Weight) -> u64 {
|
||||||
self.fee_vb(wu.vbytes())
|
self.fee_vb(wu.to_vbytes_ceil() as usize)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
/// Calculate absolute fee in Satoshis using size in virtual bytes.
|
||||||
@ -405,7 +405,7 @@ mod tests {
|
|||||||
|
|
||||||
let tx_details_a = TransactionDetails {
|
let tx_details_a = TransactionDetails {
|
||||||
transaction: None,
|
transaction: None,
|
||||||
txid: Txid::from_inner([0; 32]),
|
txid: Txid::all_zeros(),
|
||||||
received: 0,
|
received: 0,
|
||||||
sent: 0,
|
sent: 0,
|
||||||
fee: None,
|
fee: None,
|
||||||
@ -414,7 +414,7 @@ mod tests {
|
|||||||
|
|
||||||
let tx_details_b = TransactionDetails {
|
let tx_details_b = TransactionDetails {
|
||||||
transaction: None,
|
transaction: None,
|
||||||
txid: Txid::from_inner([0; 32]),
|
txid: Txid::all_zeros(),
|
||||||
received: 0,
|
received: 0,
|
||||||
sent: 0,
|
sent: 0,
|
||||||
fee: None,
|
fee: None,
|
||||||
@ -423,7 +423,7 @@ mod tests {
|
|||||||
|
|
||||||
let tx_details_c = TransactionDetails {
|
let tx_details_c = TransactionDetails {
|
||||||
transaction: None,
|
transaction: None,
|
||||||
txid: Txid::from_inner([0; 32]),
|
txid: Txid::all_zeros(),
|
||||||
received: 0,
|
received: 0,
|
||||||
sent: 0,
|
sent: 0,
|
||||||
fee: None,
|
fee: None,
|
||||||
@ -432,7 +432,7 @@ mod tests {
|
|||||||
|
|
||||||
let tx_details_d = TransactionDetails {
|
let tx_details_d = TransactionDetails {
|
||||||
transaction: None,
|
transaction: None,
|
||||||
txid: Txid::from_inner([1; 32]),
|
txid: Txid::from_byte_array([1; Txid::LEN]),
|
||||||
received: 0,
|
received: 0,
|
||||||
sent: 0,
|
sent: 0,
|
||||||
fee: None,
|
fee: None,
|
||||||
|
@ -40,12 +40,12 @@
|
|||||||
//! database: &D,
|
//! database: &D,
|
||||||
//! required_utxos: Vec<WeightedUtxo>,
|
//! required_utxos: Vec<WeightedUtxo>,
|
||||||
//! optional_utxos: Vec<WeightedUtxo>,
|
//! optional_utxos: Vec<WeightedUtxo>,
|
||||||
//! fee_rate: FeeRate,
|
//! fee_rate: bdk::FeeRate,
|
||||||
//! target_amount: u64,
|
//! target_amount: u64,
|
||||||
//! drain_script: &Script,
|
//! drain_script: &Script,
|
||||||
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
//! ) -> Result<CoinSelectionResult, bdk::Error> {
|
||||||
//! let mut selected_amount = 0;
|
//! let mut selected_amount = 0;
|
||||||
//! let mut additional_weight = 0;
|
//! let mut additional_weight = Weight::ZERO;
|
||||||
//! let all_utxos_selected = required_utxos
|
//! let all_utxos_selected = required_utxos
|
||||||
//! .into_iter()
|
//! .into_iter()
|
||||||
//! .chain(optional_utxos)
|
//! .chain(optional_utxos)
|
||||||
@ -53,7 +53,9 @@
|
|||||||
//! (&mut selected_amount, &mut additional_weight),
|
//! (&mut selected_amount, &mut additional_weight),
|
||||||
//! |(selected_amount, additional_weight), weighted_utxo| {
|
//! |(selected_amount, additional_weight), weighted_utxo| {
|
||||||
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
//! **selected_amount += weighted_utxo.utxo.txout().value;
|
||||||
//! **additional_weight += TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight;
|
//! **additional_weight += Weight::from_wu(
|
||||||
|
//! (TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
//! );
|
||||||
//! Some(weighted_utxo.utxo)
|
//! Some(weighted_utxo.utxo)
|
||||||
//! },
|
//! },
|
||||||
//! )
|
//! )
|
||||||
@ -82,7 +84,10 @@
|
|||||||
//! # let wallet = doctest_wallet!();
|
//! # let wallet = doctest_wallet!();
|
||||||
//! // create wallet, sync, ...
|
//! // create wallet, sync, ...
|
||||||
//!
|
//!
|
||||||
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
//! .unwrap()
|
||||||
|
//! .require_network(Network::Testnet)
|
||||||
|
//! .unwrap();
|
||||||
//! let (psbt, details) = {
|
//! let (psbt, details) = {
|
||||||
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
//! let mut builder = wallet.build_tx().coin_selection(AlwaysSpendEverything);
|
||||||
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
//! builder.add_recipient(to_address.script_pubkey(), 50_000);
|
||||||
@ -100,7 +105,7 @@ use crate::{database::Database, WeightedUtxo};
|
|||||||
use crate::{error::Error, Utxo};
|
use crate::{error::Error, Utxo};
|
||||||
|
|
||||||
use bitcoin::consensus::encode::serialize;
|
use bitcoin::consensus::encode::serialize;
|
||||||
use bitcoin::Script;
|
use bitcoin::{Script, Weight};
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
@ -337,8 +342,9 @@ fn select_sorted_utxos(
|
|||||||
(&mut selected_amount, &mut fee_amount),
|
(&mut selected_amount, &mut fee_amount),
|
||||||
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
|(selected_amount, fee_amount), (must_use, weighted_utxo)| {
|
||||||
if must_use || **selected_amount < target_amount + **fee_amount {
|
if must_use || **selected_amount < target_amount + **fee_amount {
|
||||||
**fee_amount +=
|
**fee_amount += fee_rate.fee_wu(Weight::from_wu(
|
||||||
fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
));
|
||||||
**selected_amount += weighted_utxo.utxo.txout().value;
|
**selected_amount += weighted_utxo.utxo.txout().value;
|
||||||
|
|
||||||
log::debug!(
|
log::debug!(
|
||||||
@ -386,7 +392,9 @@ struct OutputGroup {
|
|||||||
|
|
||||||
impl OutputGroup {
|
impl OutputGroup {
|
||||||
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
fn new(weighted_utxo: WeightedUtxo, fee_rate: FeeRate) -> Self {
|
||||||
let fee = fee_rate.fee_wu(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight);
|
let fee = fee_rate.fee_wu(Weight::from_wu(
|
||||||
|
(TXIN_BASE_WEIGHT + weighted_utxo.satisfaction_weight) as u64,
|
||||||
|
));
|
||||||
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
let effective_value = weighted_utxo.utxo.txout().value as i64 - fee as i64;
|
||||||
OutputGroup {
|
OutputGroup {
|
||||||
weighted_utxo,
|
weighted_utxo,
|
||||||
@ -724,7 +732,7 @@ impl BranchAndBoundCoinSelection {
|
|||||||
mod test {
|
mod test {
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
|
||||||
use bitcoin::{OutPoint, Script, TxOut};
|
use bitcoin::{OutPoint, ScriptBuf, TxOut};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
use crate::database::{BatchOperations, MemoryDatabase};
|
use crate::database::{BatchOperations, MemoryDatabase};
|
||||||
@ -754,7 +762,7 @@ mod test {
|
|||||||
outpoint,
|
outpoint,
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value,
|
value,
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@ -837,7 +845,7 @@ mod test {
|
|||||||
.unwrap(),
|
.unwrap(),
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value: rng.gen_range(0..200000000),
|
value: rng.gen_range(0..200000000),
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@ -857,7 +865,7 @@ mod test {
|
|||||||
.unwrap(),
|
.unwrap(),
|
||||||
txout: TxOut {
|
txout: TxOut {
|
||||||
value: utxos_value,
|
value: utxos_value,
|
||||||
script_pubkey: Script::new(),
|
script_pubkey: ScriptBuf::new(),
|
||||||
},
|
},
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
is_spent: false,
|
is_spent: false,
|
||||||
@ -879,7 +887,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_success() {
|
fn test_largest_first_coin_selection_success() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection::default()
|
||||||
@ -902,7 +910,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_use_all() {
|
fn test_largest_first_coin_selection_use_all() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection::default()
|
||||||
@ -925,7 +933,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_use_only_necessary() {
|
fn test_largest_first_coin_selection_use_only_necessary() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = LargestFirstCoinSelection::default()
|
let result = LargestFirstCoinSelection::default()
|
||||||
@ -949,7 +957,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_insufficient_funds() {
|
fn test_largest_first_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 500_000 + FEE_AMOUNT;
|
let target_amount = 500_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
LargestFirstCoinSelection::default()
|
LargestFirstCoinSelection::default()
|
||||||
@ -969,7 +977,7 @@ mod test {
|
|||||||
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
fn test_largest_first_coin_selection_insufficient_funds_high_fees() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
LargestFirstCoinSelection::default()
|
LargestFirstCoinSelection::default()
|
||||||
@ -988,7 +996,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_success() {
|
fn test_oldest_first_coin_selection_success() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 180_000 + FEE_AMOUNT;
|
let target_amount = 180_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection::default()
|
||||||
@ -1013,7 +1021,7 @@ mod test {
|
|||||||
let utxo1 = utxo(120_000, 1);
|
let utxo1 = utxo(120_000, 1);
|
||||||
let utxo2 = utxo(80_000, 2);
|
let utxo2 = utxo(80_000, 2);
|
||||||
let utxo3 = utxo(300_000, 3);
|
let utxo3 = utxo(300_000, 3);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
|
|
||||||
@ -1070,7 +1078,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_use_all() {
|
fn test_oldest_first_coin_selection_use_all() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection::default()
|
||||||
@ -1093,7 +1101,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_use_only_necessary() {
|
fn test_oldest_first_coin_selection_use_only_necessary() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = OldestFirstCoinSelection::default()
|
let result = OldestFirstCoinSelection::default()
|
||||||
@ -1117,7 +1125,7 @@ mod test {
|
|||||||
fn test_oldest_first_coin_selection_insufficient_funds() {
|
fn test_oldest_first_coin_selection_insufficient_funds() {
|
||||||
let mut database = MemoryDatabase::default();
|
let mut database = MemoryDatabase::default();
|
||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 600_000 + FEE_AMOUNT;
|
let target_amount = 600_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
OldestFirstCoinSelection::default()
|
OldestFirstCoinSelection::default()
|
||||||
@ -1139,7 +1147,7 @@ mod test {
|
|||||||
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
let utxos = setup_database_and_get_oldest_first_test_utxos(&mut database);
|
||||||
|
|
||||||
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
let target_amount: u64 = utxos.iter().map(|wu| wu.utxo.txout().value).sum::<u64>() - 50;
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
OldestFirstCoinSelection::default()
|
OldestFirstCoinSelection::default()
|
||||||
.coin_select(
|
.coin_select(
|
||||||
@ -1160,7 +1168,7 @@ mod test {
|
|||||||
let utxos = generate_same_value_utxos(100_000, 20);
|
let utxos = generate_same_value_utxos(100_000, 20);
|
||||||
|
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
@ -1184,7 +1192,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_required_are_enough() {
|
fn test_bnb_coin_selection_required_are_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default()
|
let result = BranchAndBoundCoinSelection::default()
|
||||||
@ -1207,7 +1215,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_optional_are_enough() {
|
fn test_bnb_coin_selection_optional_are_enough() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 299756 + FEE_AMOUNT;
|
let target_amount = 299756 + FEE_AMOUNT;
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default()
|
let result = BranchAndBoundCoinSelection::default()
|
||||||
@ -1241,7 +1249,7 @@ mod test {
|
|||||||
assert_eq!(amount, 100_000);
|
assert_eq!(amount, 100_000);
|
||||||
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
let amount: u64 = optional.iter().map(|u| u.utxo.txout().value).sum();
|
||||||
assert!(amount > 150_000);
|
assert!(amount > 150_000);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let target_amount = 150_000 + FEE_AMOUNT;
|
let target_amount = 150_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
@ -1266,7 +1274,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_insufficient_funds() {
|
fn test_bnb_coin_selection_insufficient_funds() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 500_000 + FEE_AMOUNT;
|
let target_amount = 500_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::default()
|
BranchAndBoundCoinSelection::default()
|
||||||
@ -1286,7 +1294,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
fn test_bnb_coin_selection_insufficient_funds_high_fees() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 250_000 + FEE_AMOUNT;
|
let target_amount = 250_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::default()
|
BranchAndBoundCoinSelection::default()
|
||||||
@ -1305,7 +1313,7 @@ mod test {
|
|||||||
fn test_bnb_coin_selection_check_fee_rate() {
|
fn test_bnb_coin_selection_check_fee_rate() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 99932; // first utxo's effective value
|
let target_amount = 99932; // first utxo's effective value
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
@ -1335,7 +1343,7 @@ mod test {
|
|||||||
for _i in 0..200 {
|
for _i in 0..200 {
|
||||||
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
let mut optional_utxos = generate_random_utxos(&mut rng, 16);
|
||||||
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
let target_amount = sum_random_utxos(&mut rng, &mut optional_utxos);
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
.coin_select(
|
.coin_select(
|
||||||
&database,
|
&database,
|
||||||
@ -1364,7 +1372,7 @@ mod test {
|
|||||||
let size_of_change = 31;
|
let size_of_change = 31;
|
||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
BranchAndBoundCoinSelection::new(size_of_change)
|
BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@ -1395,7 +1403,7 @@ mod test {
|
|||||||
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
let cost_of_change = size_of_change as f32 * fee_rate.as_sat_per_vb();
|
||||||
let target_amount = 20_000 + FEE_AMOUNT;
|
let target_amount = 20_000 + FEE_AMOUNT;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
BranchAndBoundCoinSelection::new(size_of_change)
|
BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@ -1431,7 +1439,7 @@ mod test {
|
|||||||
// cost_of_change + 5.
|
// cost_of_change + 5.
|
||||||
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
let target_amount = 2 * 50_000 - 2 * 67 - cost_of_change.ceil() as i64 + 5;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
let result = BranchAndBoundCoinSelection::new(size_of_change)
|
||||||
.bnb(
|
.bnb(
|
||||||
@ -1471,7 +1479,7 @@ mod test {
|
|||||||
let target_amount =
|
let target_amount =
|
||||||
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
optional_utxos[3].effective_value + optional_utxos[23].effective_value;
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::new(0)
|
let result = BranchAndBoundCoinSelection::new(0)
|
||||||
.bnb(
|
.bnb(
|
||||||
@ -1502,7 +1510,7 @@ mod test {
|
|||||||
.map(|u| OutputGroup::new(u, fee_rate))
|
.map(|u| OutputGroup::new(u, fee_rate))
|
||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
let result = BranchAndBoundCoinSelection::default().single_random_draw(
|
||||||
vec![],
|
vec![],
|
||||||
@ -1521,7 +1529,7 @@ mod test {
|
|||||||
fn test_bnb_exclude_negative_effective_value() {
|
fn test_bnb_exclude_negative_effective_value() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
&database,
|
&database,
|
||||||
@ -1545,7 +1553,7 @@ mod test {
|
|||||||
fn test_bnb_include_negative_effective_value_when_required() {
|
fn test_bnb_include_negative_effective_value_when_required() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let (required, optional) = utxos
|
let (required, optional) = utxos
|
||||||
.into_iter()
|
.into_iter()
|
||||||
@ -1573,7 +1581,7 @@ mod test {
|
|||||||
fn test_bnb_sum_of_effective_value_negative() {
|
fn test_bnb_sum_of_effective_value_negative() {
|
||||||
let utxos = get_test_utxos();
|
let utxos = get_test_utxos();
|
||||||
let database = MemoryDatabase::default();
|
let database = MemoryDatabase::default();
|
||||||
let drain_script = Script::default();
|
let drain_script = ScriptBuf::default();
|
||||||
|
|
||||||
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
let selection = BranchAndBoundCoinSelection::default().coin_select(
|
||||||
&database,
|
&database,
|
||||||
|
@ -20,7 +20,7 @@
|
|||||||
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
//! # use bdk::wallet::hardwaresigner::HWISigner;
|
||||||
//! # use bdk::wallet::AddressIndex::New;
|
//! # use bdk::wallet::AddressIndex::New;
|
||||||
//! # use bdk::{FeeRate, KeychainKind, SignOptions, SyncOptions, Wallet};
|
//! # use bdk::{FeeRate, KeychainKind, SignOptions, SyncOptions, Wallet};
|
||||||
//! # use hwi::{types::HWIChain, HWIClient};
|
//! # use hwi::HWIClient;
|
||||||
//! # use std::sync::Arc;
|
//! # use std::sync::Arc;
|
||||||
//! #
|
//! #
|
||||||
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
//! # fn main() -> Result<(), Box<dyn std::error::Error>> {
|
||||||
@ -29,7 +29,7 @@
|
|||||||
//! panic!("No devices found!");
|
//! panic!("No devices found!");
|
||||||
//! }
|
//! }
|
||||||
//! let first_device = devices.remove(0)?;
|
//! let first_device = devices.remove(0)?;
|
||||||
//! let custom_signer = HWISigner::from_device(&first_device, HWIChain::Test)?;
|
//! let custom_signer = HWISigner::from_device(&first_device, Network::Testnet.into())?;
|
||||||
//!
|
//!
|
||||||
//! # let mut wallet = Wallet::new(
|
//! # let mut wallet = Wallet::new(
|
||||||
//! # "",
|
//! # "",
|
||||||
@ -49,9 +49,9 @@
|
|||||||
//! # }
|
//! # }
|
||||||
//! ```
|
//! ```
|
||||||
|
|
||||||
|
use bitcoin::bip32::Fingerprint;
|
||||||
use bitcoin::psbt::PartiallySignedTransaction;
|
use bitcoin::psbt::PartiallySignedTransaction;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32::Fingerprint;
|
|
||||||
|
|
||||||
use hwi::error::Error;
|
use hwi::error::Error;
|
||||||
use hwi::types::{HWIChain, HWIDevice};
|
use hwi::types::{HWIChain, HWIDevice};
|
||||||
|
@ -24,10 +24,11 @@ use std::sync::Arc;
|
|||||||
use bitcoin::secp256k1::Secp256k1;
|
use bitcoin::secp256k1::Secp256k1;
|
||||||
|
|
||||||
use bitcoin::consensus::encode::serialize;
|
use bitcoin::consensus::encode::serialize;
|
||||||
use bitcoin::util::psbt;
|
use bitcoin::psbt;
|
||||||
|
use bitcoin::sighash::{EcdsaSighashType, TapSighashType};
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
Address, EcdsaSighashType, LockTime, Network, OutPoint, SchnorrSighashType, Script, Sequence,
|
absolute, Address, Network, OutPoint, Script, ScriptBuf, Sequence, Transaction, TxOut, Txid,
|
||||||
Transaction, TxOut, Txid, Witness,
|
Weight, Witness,
|
||||||
};
|
};
|
||||||
|
|
||||||
use miniscript::psbt::{PsbtExt, PsbtInputExt, PsbtInputSatisfier};
|
use miniscript::psbt::{PsbtExt, PsbtInputExt, PsbtInputSatisfier};
|
||||||
@ -116,13 +117,15 @@ pub enum AddressIndex {
|
|||||||
/// web page.
|
/// web page.
|
||||||
LastUnused,
|
LastUnused,
|
||||||
/// Return the address for a specific descriptor index. Does not change the current descriptor
|
/// Return the address for a specific descriptor index. Does not change the current descriptor
|
||||||
/// index used by `AddressIndex::New` and `AddressIndex::LastUsed`.
|
/// index used by `AddressIndex::New` and `AddressIndex::LastUsed`. The index must be non-hardened,
|
||||||
|
/// i.e., < 2**31.
|
||||||
///
|
///
|
||||||
/// Use with caution, if an index is given that is less than the current descriptor index
|
/// Use with caution, if an index is given that is less than the current descriptor index
|
||||||
/// then the returned address may have already been used.
|
/// then the returned address may have already been used.
|
||||||
Peek(u32),
|
Peek(u32),
|
||||||
/// Return the address for a specific descriptor index and reset the current descriptor index
|
/// Return the address for a specific descriptor index and reset the current descriptor index
|
||||||
/// used by `AddressIndex::New` and `AddressIndex::LastUsed` to this value.
|
/// used by `AddressIndex::New` and `AddressIndex::LastUsed` to this value. The index must be
|
||||||
|
/// non-hardened, i.e. < 2**31
|
||||||
///
|
///
|
||||||
/// Use with caution, if an index is given that is less than the current descriptor index
|
/// Use with caution, if an index is given that is less than the current descriptor index
|
||||||
/// then the returned address and subsequent addresses returned by calls to `AddressIndex::New`
|
/// then the returned address and subsequent addresses returned by calls to `AddressIndex::New`
|
||||||
@ -257,6 +260,7 @@ where
|
|||||||
let address_result = self
|
let address_result = self
|
||||||
.get_descriptor_for_keychain(keychain)
|
.get_descriptor_for_keychain(keychain)
|
||||||
.at_derivation_index(incremented_index)
|
.at_derivation_index(incremented_index)
|
||||||
|
.expect("can't be hardened")
|
||||||
.address(self.network);
|
.address(self.network);
|
||||||
|
|
||||||
address_result
|
address_result
|
||||||
@ -275,7 +279,8 @@ where
|
|||||||
|
|
||||||
let derived_key = self
|
let derived_key = self
|
||||||
.get_descriptor_for_keychain(keychain)
|
.get_descriptor_for_keychain(keychain)
|
||||||
.at_derivation_index(current_index);
|
.at_derivation_index(current_index)
|
||||||
|
.expect("can't be hardened");
|
||||||
|
|
||||||
let script_pubkey = derived_key.script_pubkey();
|
let script_pubkey = derived_key.script_pubkey();
|
||||||
|
|
||||||
@ -304,6 +309,7 @@ where
|
|||||||
fn peek_address(&self, index: u32, keychain: KeychainKind) -> Result<AddressInfo, Error> {
|
fn peek_address(&self, index: u32, keychain: KeychainKind) -> Result<AddressInfo, Error> {
|
||||||
self.get_descriptor_for_keychain(keychain)
|
self.get_descriptor_for_keychain(keychain)
|
||||||
.at_derivation_index(index)
|
.at_derivation_index(index)
|
||||||
|
.map_err(|_| Error::HardenedIndex)?
|
||||||
.address(self.network)
|
.address(self.network)
|
||||||
.map(|address| AddressInfo {
|
.map(|address| AddressInfo {
|
||||||
index,
|
index,
|
||||||
@ -320,6 +326,7 @@ where
|
|||||||
|
|
||||||
self.get_descriptor_for_keychain(keychain)
|
self.get_descriptor_for_keychain(keychain)
|
||||||
.at_derivation_index(index)
|
.at_derivation_index(index)
|
||||||
|
.map_err(|_| Error::HardenedIndex)?
|
||||||
.address(self.network)
|
.address(self.network)
|
||||||
.map(|address| AddressInfo {
|
.map(|address| AddressInfo {
|
||||||
index,
|
index,
|
||||||
@ -567,7 +574,7 @@ where
|
|||||||
/// # use bdk::database::*;
|
/// # use bdk::database::*;
|
||||||
/// # let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
/// # let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// let (psbt, details) = {
|
/// let (psbt, details) = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder
|
/// builder
|
||||||
@ -669,7 +676,8 @@ where
|
|||||||
let current_height = match params.current_height {
|
let current_height = match params.current_height {
|
||||||
// If they didn't tell us the current height, we assume it's the latest sync height.
|
// If they didn't tell us the current height, we assume it's the latest sync height.
|
||||||
None => self.database().get_sync_time()?.map(|sync_time| {
|
None => self.database().get_sync_time()?.map(|sync_time| {
|
||||||
LockTime::from_height(sync_time.block_time.height).expect("Invalid height")
|
absolute::LockTime::from_height(sync_time.block_time.height)
|
||||||
|
.expect("Invalid height")
|
||||||
}),
|
}),
|
||||||
h => h,
|
h => h,
|
||||||
};
|
};
|
||||||
@ -680,7 +688,7 @@ where
|
|||||||
// Fee sniping can be partially prevented by setting the timelock
|
// Fee sniping can be partially prevented by setting the timelock
|
||||||
// to current_height. If we don't know the current_height,
|
// to current_height. If we don't know the current_height,
|
||||||
// we default to 0.
|
// we default to 0.
|
||||||
let fee_sniping_height = current_height.unwrap_or(LockTime::ZERO);
|
let fee_sniping_height = current_height.unwrap_or(absolute::LockTime::ZERO);
|
||||||
|
|
||||||
// We choose the biggest between the required nlocktime and the fee sniping
|
// We choose the biggest between the required nlocktime and the fee sniping
|
||||||
// height
|
// height
|
||||||
@ -688,7 +696,7 @@ where
|
|||||||
// No requirement, just use the fee_sniping_height
|
// No requirement, just use the fee_sniping_height
|
||||||
None => fee_sniping_height,
|
None => fee_sniping_height,
|
||||||
// There's a block-based requirement, but the value is lower than the fee_sniping_height
|
// There's a block-based requirement, but the value is lower than the fee_sniping_height
|
||||||
Some(value @ LockTime::Blocks(_)) if value < fee_sniping_height => fee_sniping_height,
|
Some(value @ absolute::LockTime::Blocks(_)) if value < fee_sniping_height => fee_sniping_height,
|
||||||
// There's a time-based requirement or a block-based requirement greater
|
// There's a time-based requirement or a block-based requirement greater
|
||||||
// than the fee_sniping_height use that value
|
// than the fee_sniping_height use that value
|
||||||
Some(value) => value,
|
Some(value) => value,
|
||||||
@ -704,7 +712,9 @@ where
|
|||||||
|
|
||||||
let n_sequence = match (params.rbf, requirements.csv) {
|
let n_sequence = match (params.rbf, requirements.csv) {
|
||||||
// No RBF or CSV but there's an nLockTime, so the nSequence cannot be final
|
// No RBF or CSV but there's an nLockTime, so the nSequence cannot be final
|
||||||
(None, None) if lock_time != LockTime::ZERO => Sequence::ENABLE_LOCKTIME_NO_RBF,
|
(None, None) if lock_time != absolute::LockTime::ZERO => {
|
||||||
|
Sequence::ENABLE_LOCKTIME_NO_RBF
|
||||||
|
}
|
||||||
// No RBF, CSV or nLockTime, make the transaction final
|
// No RBF, CSV or nLockTime, make the transaction final
|
||||||
(None, None) => Sequence::MAX,
|
(None, None) => Sequence::MAX,
|
||||||
|
|
||||||
@ -767,7 +777,7 @@ where
|
|||||||
|
|
||||||
let mut tx = Transaction {
|
let mut tx = Transaction {
|
||||||
version,
|
version,
|
||||||
lock_time: lock_time.into(),
|
lock_time,
|
||||||
input: vec![],
|
input: vec![],
|
||||||
output: vec![],
|
output: vec![],
|
||||||
};
|
};
|
||||||
@ -815,7 +825,7 @@ where
|
|||||||
// end up with a transaction with a slightly higher fee rate than the requested one.
|
// end up with a transaction with a slightly higher fee rate than the requested one.
|
||||||
// If, instead, we undershoot, we may end up with a feerate lower than the requested one
|
// If, instead, we undershoot, we may end up with a feerate lower than the requested one
|
||||||
// - we might come up with non broadcastable txs!
|
// - we might come up with non broadcastable txs!
|
||||||
fee_amount += fee_rate.fee_wu(2);
|
fee_amount += fee_rate.fee_wu(Weight::from_wu(2));
|
||||||
|
|
||||||
if params.change_policy != tx_builder::ChangeSpendPolicy::ChangeAllowed
|
if params.change_policy != tx_builder::ChangeSpendPolicy::ChangeAllowed
|
||||||
&& self.change_descriptor.is_none()
|
&& self.change_descriptor.is_none()
|
||||||
@ -832,7 +842,7 @@ where
|
|||||||
params.drain_wallet,
|
params.drain_wallet,
|
||||||
params.manually_selected_only,
|
params.manually_selected_only,
|
||||||
params.bumping_fee.is_some(), // we mandate confirmed transactions if we're bumping the fee
|
params.bumping_fee.is_some(), // we mandate confirmed transactions if we're bumping the fee
|
||||||
current_height.map(LockTime::to_consensus_u32),
|
current_height.map(absolute::LockTime::to_consensus_u32),
|
||||||
)?;
|
)?;
|
||||||
|
|
||||||
// get drain script
|
// get drain script
|
||||||
@ -860,7 +870,7 @@ where
|
|||||||
.iter()
|
.iter()
|
||||||
.map(|u| bitcoin::TxIn {
|
.map(|u| bitcoin::TxIn {
|
||||||
previous_output: u.outpoint(),
|
previous_output: u.outpoint(),
|
||||||
script_sig: Script::default(),
|
script_sig: ScriptBuf::default(),
|
||||||
sequence: n_sequence,
|
sequence: n_sequence,
|
||||||
witness: Witness::new(),
|
witness: Witness::new(),
|
||||||
})
|
})
|
||||||
@ -949,7 +959,8 @@ where
|
|||||||
/// # use bdk::database::*;
|
/// # use bdk::database::*;
|
||||||
/// # let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
/// # let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// let (mut psbt, _) = {
|
/// let (mut psbt, _) = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder
|
/// builder
|
||||||
@ -963,7 +974,7 @@ where
|
|||||||
/// let (mut psbt, _) = {
|
/// let (mut psbt, _) = {
|
||||||
/// let mut builder = wallet.build_fee_bump(tx.txid())?;
|
/// let mut builder = wallet.build_fee_bump(tx.txid())?;
|
||||||
/// builder
|
/// builder
|
||||||
/// .fee_rate(FeeRate::from_sat_per_vb(5.0));
|
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0));
|
||||||
/// builder.finish()?
|
/// builder.finish()?
|
||||||
/// };
|
/// };
|
||||||
///
|
///
|
||||||
@ -1010,6 +1021,7 @@ where
|
|||||||
.borrow()
|
.borrow()
|
||||||
.get_path_from_script_pubkey(&txout.script_pubkey)?
|
.get_path_from_script_pubkey(&txout.script_pubkey)?
|
||||||
{
|
{
|
||||||
|
#[allow(deprecated)]
|
||||||
Some((keychain, _)) => (
|
Some((keychain, _)) => (
|
||||||
self._get_descriptor_for_keychain(keychain)
|
self._get_descriptor_for_keychain(keychain)
|
||||||
.0
|
.0
|
||||||
@ -1100,7 +1112,7 @@ where
|
|||||||
/// # use bdk::database::*;
|
/// # use bdk::database::*;
|
||||||
/// # let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
/// # let descriptor = "wpkh(tpubD6NzVbkrYhZ4Xferm7Pz4VnjdcDPFyjVu5K4iZXQ4pVN8Cks4pHVowTBXBKRhX64pkRyJZJN5xAKj4UDNnLPb5p2sSKXhewoYx5GbTdUFWq/*)";
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// let (mut psbt, _) = {
|
/// let (mut psbt, _) = {
|
||||||
/// let mut builder = wallet.build_tx();
|
/// let mut builder = wallet.build_tx();
|
||||||
/// builder.add_recipient(to_address.script_pubkey(), 50_000);
|
/// builder.add_recipient(to_address.script_pubkey(), 50_000);
|
||||||
@ -1137,8 +1149,8 @@ where
|
|||||||
&& !psbt.inputs.iter().all(|i| {
|
&& !psbt.inputs.iter().all(|i| {
|
||||||
i.sighash_type.is_none()
|
i.sighash_type.is_none()
|
||||||
|| i.sighash_type == Some(EcdsaSighashType::All.into())
|
|| i.sighash_type == Some(EcdsaSighashType::All.into())
|
||||||
|| i.sighash_type == Some(SchnorrSighashType::All.into())
|
|| i.sighash_type == Some(TapSighashType::All.into())
|
||||||
|| i.sighash_type == Some(SchnorrSighashType::Default.into())
|
|| i.sighash_type == Some(TapSighashType::Default.into())
|
||||||
})
|
})
|
||||||
{
|
{
|
||||||
return Err(Error::Signer(signer::SignerError::NonStandardSighash));
|
return Err(Error::Signer(signer::SignerError::NonStandardSighash));
|
||||||
@ -1323,7 +1335,10 @@ where
|
|||||||
.borrow()
|
.borrow()
|
||||||
.get_path_from_script_pubkey(&txout.script_pubkey)?
|
.get_path_from_script_pubkey(&txout.script_pubkey)?
|
||||||
.map(|(keychain, child)| (self.get_descriptor_for_keychain(keychain), child))
|
.map(|(keychain, child)| (self.get_descriptor_for_keychain(keychain), child))
|
||||||
.map(|(desc, child)| desc.at_derivation_index(child)))
|
.map(|(desc, child)| {
|
||||||
|
desc.at_derivation_index(child)
|
||||||
|
.expect("child is not hardened")
|
||||||
|
}))
|
||||||
}
|
}
|
||||||
|
|
||||||
fn fetch_and_increment_index(&self, keychain: KeychainKind) -> Result<u32, Error> {
|
fn fetch_and_increment_index(&self, keychain: KeychainKind) -> Result<u32, Error> {
|
||||||
@ -1384,7 +1399,10 @@ where
|
|||||||
let start_time = time::Instant::new();
|
let start_time = time::Instant::new();
|
||||||
for i in from..(from + count) {
|
for i in from..(from + count) {
|
||||||
address_batch.set_script_pubkey(
|
address_batch.set_script_pubkey(
|
||||||
&descriptor.at_derivation_index(i).script_pubkey(),
|
&descriptor
|
||||||
|
.at_derivation_index(i)
|
||||||
|
.expect("i is not hardened")
|
||||||
|
.script_pubkey(),
|
||||||
keychain,
|
keychain,
|
||||||
i,
|
i,
|
||||||
)?;
|
)?;
|
||||||
@ -1410,6 +1428,7 @@ where
|
|||||||
let keychain = utxo.keychain;
|
let keychain = utxo.keychain;
|
||||||
(
|
(
|
||||||
utxo,
|
utxo,
|
||||||
|
#[allow(deprecated)]
|
||||||
self.get_descriptor_for_keychain(keychain)
|
self.get_descriptor_for_keychain(keychain)
|
||||||
.max_satisfaction_weight()
|
.max_satisfaction_weight()
|
||||||
.unwrap(),
|
.unwrap(),
|
||||||
@ -1614,7 +1633,9 @@ where
|
|||||||
};
|
};
|
||||||
|
|
||||||
let desc = self.get_descriptor_for_keychain(keychain);
|
let desc = self.get_descriptor_for_keychain(keychain);
|
||||||
let derived_descriptor = desc.at_derivation_index(child);
|
let derived_descriptor = desc
|
||||||
|
.at_derivation_index(child)
|
||||||
|
.expect("child can't be hardened");
|
||||||
|
|
||||||
psbt_input
|
psbt_input
|
||||||
.update_with_descriptor_unchecked(&derived_descriptor)
|
.update_with_descriptor_unchecked(&derived_descriptor)
|
||||||
@ -1665,7 +1686,9 @@ where
|
|||||||
);
|
);
|
||||||
|
|
||||||
let desc = self.get_descriptor_for_keychain(keychain);
|
let desc = self.get_descriptor_for_keychain(keychain);
|
||||||
let desc = desc.at_derivation_index(child);
|
let desc = desc
|
||||||
|
.at_derivation_index(child)
|
||||||
|
.expect("child can't be hardened");
|
||||||
|
|
||||||
if is_input {
|
if is_input {
|
||||||
psbt.update_input_with_descriptor(index, &desc)
|
psbt.update_input_with_descriptor(index, &desc)
|
||||||
@ -1830,6 +1853,7 @@ pub fn get_funded_wallet(
|
|||||||
.set_script_pubkey(
|
.set_script_pubkey(
|
||||||
&bitcoin::Address::from_str(&tx_meta.output.get(0).unwrap().to_address)
|
&bitcoin::Address::from_str(&tx_meta.output.get(0).unwrap().to_address)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
|
.assume_checked()
|
||||||
.script_pubkey(),
|
.script_pubkey(),
|
||||||
KeychainKind::External,
|
KeychainKind::External,
|
||||||
funding_address_kix,
|
funding_address_kix,
|
||||||
@ -1849,7 +1873,7 @@ pub fn get_funded_wallet(
|
|||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub(crate) mod test {
|
pub(crate) mod test {
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
use bitcoin::{util::psbt, Network, PackedLockTime, Sequence};
|
use bitcoin::{absolute, blockdata::script::PushBytes, psbt, Network, Sequence};
|
||||||
|
|
||||||
use crate::database::Database;
|
use crate::database::Database;
|
||||||
use crate::types::KeychainKind;
|
use crate::types::KeychainKind;
|
||||||
@ -2185,7 +2209,7 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
// Since we never synced the wallet we don't have a last_sync_height
|
// Since we never synced the wallet we don't have a last_sync_height
|
||||||
// we could use to try to prevent fee sniping. We default to 0.
|
// we could use to try to prevent fee sniping. We default to 0.
|
||||||
assert_eq!(psbt.unsigned_tx.lock_time, PackedLockTime(0));
|
assert_eq!(psbt.unsigned_tx.lock_time, absolute::LockTime::ZERO);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@ -2210,7 +2234,10 @@ pub(crate) mod test {
|
|||||||
let (psbt, _) = builder.finish().unwrap();
|
let (psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
// current_height will override the last sync height
|
// current_height will override the last sync height
|
||||||
assert_eq!(psbt.unsigned_tx.lock_time, PackedLockTime(current_height));
|
assert_eq!(
|
||||||
|
psbt.unsigned_tx.lock_time,
|
||||||
|
absolute::LockTime::from_height(current_height).unwrap()
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@ -2235,7 +2262,7 @@ pub(crate) mod test {
|
|||||||
// If there's no current_height we're left with using the last sync height
|
// If there's no current_height we're left with using the last sync height
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.unsigned_tx.lock_time,
|
psbt.unsigned_tx.lock_time,
|
||||||
PackedLockTime(sync_time.block_time.height)
|
absolute::LockTime::from_height(sync_time.block_time.height).unwrap()
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -2247,7 +2274,10 @@ pub(crate) mod test {
|
|||||||
builder.add_recipient(addr.script_pubkey(), 25_000);
|
builder.add_recipient(addr.script_pubkey(), 25_000);
|
||||||
let (psbt, _) = builder.finish().unwrap();
|
let (psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
assert_eq!(psbt.unsigned_tx.lock_time, PackedLockTime(100_000));
|
assert_eq!(
|
||||||
|
psbt.unsigned_tx.lock_time,
|
||||||
|
absolute::LockTime::from_height(100_000).unwrap()
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@ -2258,13 +2288,16 @@ pub(crate) mod test {
|
|||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 25_000)
|
.add_recipient(addr.script_pubkey(), 25_000)
|
||||||
.current_height(630_001)
|
.current_height(630_001)
|
||||||
.nlocktime(LockTime::from_height(630_000).unwrap());
|
.nlocktime(absolute::LockTime::from_height(630_000).unwrap());
|
||||||
let (psbt, _) = builder.finish().unwrap();
|
let (psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
// When we explicitly specify a nlocktime
|
// When we explicitly specify a nlocktime
|
||||||
// we don't try any fee sniping prevention trick
|
// we don't try any fee sniping prevention trick
|
||||||
// (we ignore the current_height)
|
// (we ignore the current_height)
|
||||||
assert_eq!(psbt.unsigned_tx.lock_time, PackedLockTime(630_000));
|
assert_eq!(
|
||||||
|
psbt.unsigned_tx.lock_time,
|
||||||
|
absolute::LockTime::from_height(630_000).unwrap()
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@ -2274,10 +2307,13 @@ pub(crate) mod test {
|
|||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 25_000)
|
.add_recipient(addr.script_pubkey(), 25_000)
|
||||||
.nlocktime(LockTime::from_height(630_000).unwrap());
|
.nlocktime(absolute::LockTime::from_height(630_000).unwrap());
|
||||||
let (psbt, _) = builder.finish().unwrap();
|
let (psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
assert_eq!(psbt.unsigned_tx.lock_time, PackedLockTime(630_000));
|
assert_eq!(
|
||||||
|
psbt.unsigned_tx.lock_time,
|
||||||
|
absolute::LockTime::from_height(630_000).unwrap()
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@ -2290,7 +2326,7 @@ pub(crate) mod test {
|
|||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 25_000)
|
.add_recipient(addr.script_pubkey(), 25_000)
|
||||||
.nlocktime(LockTime::from_height(50000).unwrap());
|
.nlocktime(absolute::LockTime::from_height(50000).unwrap());
|
||||||
builder.finish().unwrap();
|
builder.finish().unwrap();
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -2428,7 +2464,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_create_tx_drain_wallet_and_drain_to_and_with_recipient() {
|
fn test_create_tx_drain_wallet_and_drain_to_and_with_recipient() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
let addr = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let drain_addr = wallet.get_address(New).unwrap();
|
let drain_addr = wallet.get_address(New).unwrap();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
@ -2645,19 +2683,18 @@ pub(crate) mod test {
|
|||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 30_000)
|
.add_recipient(addr.script_pubkey(), 30_000)
|
||||||
.sighash(bitcoin::EcdsaSighashType::Single.into());
|
.sighash(bitcoin::sighash::EcdsaSighashType::Single.into());
|
||||||
let (psbt, _) = builder.finish().unwrap();
|
let (psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.inputs[0].sighash_type,
|
psbt.inputs[0].sighash_type,
|
||||||
Some(bitcoin::EcdsaSighashType::Single.into())
|
Some(bitcoin::sighash::EcdsaSighashType::Single.into())
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_create_tx_input_hd_keypaths() {
|
fn test_create_tx_input_hd_keypaths() {
|
||||||
use bitcoin::util::bip32::{DerivationPath, Fingerprint};
|
use bitcoin::bip32::{DerivationPath, Fingerprint};
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet("wpkh([d34db33f/44'/0'/0']tpubDEnoLuPdBep9bzw5LoGYpsxUQYheRQ9gcgrJhJEcdKFB9cWQRyYmkCyRoTqeD4tJYiVVgt6A3rN6rWn9RYhR9sBsGxji29LYWHuKKbdb1ev/0/*)");
|
let (wallet, _, _) = get_funded_wallet("wpkh([d34db33f/44'/0'/0']tpubDEnoLuPdBep9bzw5LoGYpsxUQYheRQ9gcgrJhJEcdKFB9cWQRyYmkCyRoTqeD4tJYiVVgt6A3rN6rWn9RYhR9sBsGxji29LYWHuKKbdb1ev/0/*)");
|
||||||
let addr = wallet.get_address(New).unwrap();
|
let addr = wallet.get_address(New).unwrap();
|
||||||
@ -2677,8 +2714,7 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_create_tx_output_hd_keypaths() {
|
fn test_create_tx_output_hd_keypaths() {
|
||||||
use bitcoin::util::bip32::{DerivationPath, Fingerprint};
|
use bitcoin::bip32::{DerivationPath, Fingerprint};
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
let (wallet, descriptors, _) = get_funded_wallet("wpkh([d34db33f/44'/0'/0']tpubDEnoLuPdBep9bzw5LoGYpsxUQYheRQ9gcgrJhJEcdKFB9cWQRyYmkCyRoTqeD4tJYiVVgt6A3rN6rWn9RYhR9sBsGxji29LYWHuKKbdb1ev/0/*)");
|
let (wallet, descriptors, _) = get_funded_wallet("wpkh([d34db33f/44'/0'/0']tpubDEnoLuPdBep9bzw5LoGYpsxUQYheRQ9gcgrJhJEcdKFB9cWQRyYmkCyRoTqeD4tJYiVVgt6A3rN6rWn9RYhR9sBsGxji29LYWHuKKbdb1ev/0/*)");
|
||||||
// cache some addresses
|
// cache some addresses
|
||||||
@ -2712,7 +2748,7 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.inputs[0].redeem_script,
|
psbt.inputs[0].redeem_script,
|
||||||
Some(Script::from(
|
Some(ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex(
|
Vec::<u8>::from_hex(
|
||||||
"21032b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3ac"
|
"21032b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3ac"
|
||||||
)
|
)
|
||||||
@ -2736,7 +2772,7 @@ pub(crate) mod test {
|
|||||||
assert_eq!(psbt.inputs[0].redeem_script, None);
|
assert_eq!(psbt.inputs[0].redeem_script, None);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.inputs[0].witness_script,
|
psbt.inputs[0].witness_script,
|
||||||
Some(Script::from(
|
Some(ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex(
|
Vec::<u8>::from_hex(
|
||||||
"21032b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3ac"
|
"21032b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3ac"
|
||||||
)
|
)
|
||||||
@ -2756,7 +2792,7 @@ pub(crate) mod test {
|
|||||||
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
builder.drain_to(addr.script_pubkey()).drain_wallet();
|
||||||
let (psbt, _) = builder.finish().unwrap();
|
let (psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
let script = Script::from(
|
let script = ScriptBuf::from(
|
||||||
Vec::<u8>::from_hex(
|
Vec::<u8>::from_hex(
|
||||||
"21032b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3ac",
|
"21032b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3ac",
|
||||||
)
|
)
|
||||||
@ -2830,7 +2866,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 30_000)
|
.add_recipient(addr.script_pubkey(), 30_000)
|
||||||
@ -2859,7 +2897,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 30_000)
|
.add_recipient(addr.script_pubkey(), 30_000)
|
||||||
@ -2877,7 +2917,9 @@ pub(crate) mod test {
|
|||||||
fn test_create_tx_policy_path_required() {
|
fn test_create_tx_policy_path_required() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_a_or_b_plus_csv());
|
let (wallet, _, _) = get_funded_wallet(get_test_a_or_b_plus_csv());
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.add_recipient(addr.script_pubkey(), 30_000);
|
builder.add_recipient(addr.script_pubkey(), 30_000);
|
||||||
builder.finish().unwrap();
|
builder.finish().unwrap();
|
||||||
@ -2907,7 +2949,9 @@ pub(crate) mod test {
|
|||||||
// child #0 is just the key "A"
|
// child #0 is just the key "A"
|
||||||
let path = vec![(root_id, vec![0])].into_iter().collect();
|
let path = vec![(root_id, vec![0])].into_iter().collect();
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 30_000)
|
.add_recipient(addr.script_pubkey(), 30_000)
|
||||||
@ -2926,7 +2970,9 @@ pub(crate) mod test {
|
|||||||
// child #1 is or(pk(B),older(144))
|
// child #1 is or(pk(B),older(144))
|
||||||
let path = vec![(root_id, vec![1])].into_iter().collect();
|
let path = vec![(root_id, vec![1])].into_iter().collect();
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 30_000)
|
.add_recipient(addr.script_pubkey(), 30_000)
|
||||||
@ -2945,7 +2991,9 @@ pub(crate) mod test {
|
|||||||
// child #0 is pk(cRjo6jqfVNP33HhSS76UhXETZsGTZYx8FMFvR9kpbtCSV1PmdZdu)
|
// child #0 is pk(cRjo6jqfVNP33HhSS76UhXETZsGTZYx8FMFvR9kpbtCSV1PmdZdu)
|
||||||
let path = vec![(root_id, vec![0])].into_iter().collect();
|
let path = vec![(root_id, vec![0])].into_iter().collect();
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 30_000)
|
.add_recipient(addr.script_pubkey(), 30_000)
|
||||||
@ -2957,8 +3005,8 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_create_tx_global_xpubs_with_origin() {
|
fn test_create_tx_global_xpubs_with_origin() {
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::util::bip32;
|
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet("wpkh([73756c7f/48'/0'/0'/2']tpubDCKxNyM3bLgbEX13Mcd8mYxbVg9ajDkWXMh29hMWBurKfVmBfWAM96QVP3zaUcN51HvkZ3ar4VwP82kC8JZhhux8vFQoJintSpVBwpFvyU3/0/*)");
|
let (wallet, _, _) = get_funded_wallet("wpkh([73756c7f/48'/0'/0'/2']tpubDCKxNyM3bLgbEX13Mcd8mYxbVg9ajDkWXMh29hMWBurKfVmBfWAM96QVP3zaUcN51HvkZ3ar4VwP82kC8JZhhux8vFQoJintSpVBwpFvyU3/0/*)");
|
||||||
let addr = wallet.get_address(New).unwrap();
|
let addr = wallet.get_address(New).unwrap();
|
||||||
@ -2982,8 +3030,11 @@ pub(crate) mod test {
|
|||||||
let (wallet2, _, _) =
|
let (wallet2, _, _) =
|
||||||
get_funded_wallet("wpkh(cVbZ8ovhye9AoAHFsqobCf7LxbXDAECy9Kb8TZdfsDYMZGBUyCnm)");
|
get_funded_wallet("wpkh(cVbZ8ovhye9AoAHFsqobCf7LxbXDAECy9Kb8TZdfsDYMZGBUyCnm)");
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let utxo = wallet2.list_unspent().unwrap().remove(0);
|
let utxo = wallet2.list_unspent().unwrap().remove(0);
|
||||||
|
#[allow(deprecated)]
|
||||||
let foreign_utxo_satisfaction = wallet2
|
let foreign_utxo_satisfaction = wallet2
|
||||||
.get_descriptor_for_keychain(KeychainKind::External)
|
.get_descriptor_for_keychain(KeychainKind::External)
|
||||||
.max_satisfaction_weight()
|
.max_satisfaction_weight()
|
||||||
@ -3049,6 +3100,7 @@ pub(crate) mod test {
|
|||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
let outpoint = wallet.list_unspent().unwrap()[0].outpoint;
|
let outpoint = wallet.list_unspent().unwrap()[0].outpoint;
|
||||||
|
#[allow(deprecated)]
|
||||||
let foreign_utxo_satisfaction = wallet
|
let foreign_utxo_satisfaction = wallet
|
||||||
.get_descriptor_for_keychain(KeychainKind::External)
|
.get_descriptor_for_keychain(KeychainKind::External)
|
||||||
.max_satisfaction_weight()
|
.max_satisfaction_weight()
|
||||||
@ -3082,6 +3134,7 @@ pub(crate) mod test {
|
|||||||
.transaction
|
.transaction
|
||||||
.unwrap();
|
.unwrap();
|
||||||
|
|
||||||
|
#[allow(deprecated)]
|
||||||
let satisfaction_weight = wallet2
|
let satisfaction_weight = wallet2
|
||||||
.get_descriptor_for_keychain(KeychainKind::External)
|
.get_descriptor_for_keychain(KeychainKind::External)
|
||||||
.max_satisfaction_weight()
|
.max_satisfaction_weight()
|
||||||
@ -3121,9 +3174,12 @@ pub(crate) mod test {
|
|||||||
let (wallet1, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet1, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let (wallet2, _, txid2) =
|
let (wallet2, _, txid2) =
|
||||||
get_funded_wallet("wpkh(cVbZ8ovhye9AoAHFsqobCf7LxbXDAECy9Kb8TZdfsDYMZGBUyCnm)");
|
get_funded_wallet("wpkh(cVbZ8ovhye9AoAHFsqobCf7LxbXDAECy9Kb8TZdfsDYMZGBUyCnm)");
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let utxo2 = wallet2.list_unspent().unwrap().remove(0);
|
let utxo2 = wallet2.list_unspent().unwrap().remove(0);
|
||||||
|
|
||||||
|
#[allow(deprecated)]
|
||||||
let satisfaction_weight = wallet2
|
let satisfaction_weight = wallet2
|
||||||
.get_descriptor_for_keychain(KeychainKind::External)
|
.get_descriptor_for_keychain(KeychainKind::External)
|
||||||
.max_satisfaction_weight()
|
.max_satisfaction_weight()
|
||||||
@ -3213,8 +3269,8 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_create_tx_global_xpubs_master_without_origin() {
|
fn test_create_tx_global_xpubs_master_without_origin() {
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::util::bip32;
|
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet("wpkh(tpubD6NzVbkrYhZ4Y55A58Gv9RSNF5hy84b5AJqYy7sCcjFrkcLpPre8kmgfit6kY1Zs3BLgeypTDBZJM222guPpdz7Cup5yzaMu62u7mYGbwFL/0/*)");
|
let (wallet, _, _) = get_funded_wallet("wpkh(tpubD6NzVbkrYhZ4Y55A58Gv9RSNF5hy84b5AJqYy7sCcjFrkcLpPre8kmgfit6kY1Zs3BLgeypTDBZJM222guPpdz7Cup5yzaMu62u7mYGbwFL/0/*)");
|
||||||
let addr = wallet.get_address(New).unwrap();
|
let addr = wallet.get_address(New).unwrap();
|
||||||
@ -3343,7 +3399,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bump_fee_reduce_change() {
|
fn test_bump_fee_reduce_change() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 25_000)
|
.add_recipient(addr.script_pubkey(), 25_000)
|
||||||
@ -3403,7 +3461,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bump_fee_absolute_reduce_change() {
|
fn test_bump_fee_absolute_reduce_change() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 25_000)
|
.add_recipient(addr.script_pubkey(), 25_000)
|
||||||
@ -3469,7 +3529,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bump_fee_reduce_single_recipient() {
|
fn test_bump_fee_reduce_single_recipient() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
@ -3513,7 +3575,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_bump_fee_absolute_reduce_single_recipient() {
|
fn test_bump_fee_absolute_reduce_single_recipient() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
@ -3567,7 +3631,9 @@ pub(crate) mod test {
|
|||||||
txid: incoming_txid,
|
txid: incoming_txid,
|
||||||
vout: 0,
|
vout: 0,
|
||||||
};
|
};
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
@ -3624,7 +3690,9 @@ pub(crate) mod test {
|
|||||||
txid: incoming_txid,
|
txid: incoming_txid,
|
||||||
vout: 0,
|
vout: 0,
|
||||||
};
|
};
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
@ -3667,7 +3735,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -3730,7 +3800,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -3794,7 +3866,9 @@ pub(crate) mod test {
|
|||||||
);
|
);
|
||||||
|
|
||||||
// initially make a tx without change by using `drain_to`
|
// initially make a tx without change by using `drain_to`
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
@ -3870,7 +3944,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -3907,7 +3983,7 @@ pub(crate) mod test {
|
|||||||
// + extra input weight: 160 WU = (32 (prevout) + 4 (vout) + 4 (nsequence)) * 4
|
// + extra input weight: 160 WU = (32 (prevout) + 4 (vout) + 4 (nsequence)) * 4
|
||||||
// + input satisfaction weight: 112 WU = 106 (witness) + 2 (witness len) + (1 (script len)) * 4
|
// + input satisfaction weight: 112 WU = 106 (witness) + 2 (witness len) + (1 (script len)) * 4
|
||||||
// - change output weight: 124 WU = (8 (value) + 1 (script len) + 22 (script)) * 4
|
// - change output weight: 124 WU = (8 (value) + 1 (script len) + 22 (script)) * 4
|
||||||
let new_tx_weight = original_tx_weight + 160 + 112 - 124;
|
let new_tx_weight = original_tx_weight + Weight::from_wu(160 + 112 - 124);
|
||||||
// two inputs (50k, 25k) and one output (45k) - epsilon
|
// two inputs (50k, 25k) and one output (45k) - epsilon
|
||||||
// We use epsilon here to avoid asking for a slightly too high feerate
|
// We use epsilon here to avoid asking for a slightly too high feerate
|
||||||
let fee_abs = 50_000 + 25_000 - 45_000 - 10;
|
let fee_abs = 50_000 + 25_000 - 45_000 - 10;
|
||||||
@ -3947,7 +4023,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -4018,7 +4096,9 @@ pub(crate) mod test {
|
|||||||
Some(100),
|
Some(100),
|
||||||
);
|
);
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -4090,7 +4170,9 @@ pub(crate) mod test {
|
|||||||
// The replacement transaction may only include an unconfirmed input
|
// The replacement transaction may only include an unconfirmed input
|
||||||
// if that input was included in one of the original transactions.
|
// if that input was included in one of the original transactions.
|
||||||
let (wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_wallet()
|
.drain_wallet()
|
||||||
@ -4134,7 +4216,9 @@ pub(crate) mod test {
|
|||||||
// always fee bump with an unconfirmed input if it was included in the
|
// always fee bump with an unconfirmed input if it was included in the
|
||||||
// original transaction)
|
// original transaction)
|
||||||
let (wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
// We receive a tx with 0 confirmations, which will be used as an input
|
// We receive a tx with 0 confirmations, which will be used as an input
|
||||||
// in the drain tx.
|
// in the drain tx.
|
||||||
crate::populate_test_db!(
|
crate::populate_test_db!(
|
||||||
@ -4184,7 +4268,9 @@ pub(crate) mod test {
|
|||||||
// for a transaction.
|
// for a transaction.
|
||||||
// See https://github.com/bitcoindevkit/bdk/issues/660
|
// See https://github.com/bitcoindevkit/bdk/issues/660
|
||||||
let (wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, descriptors, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let send_to = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt").unwrap();
|
let send_to = Address::from_str("tb1ql7w62elx9ucw4pj5lgw4l028hmuw80sndtntxt")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let fee_rate = FeeRate::from_sat_per_vb(2.01);
|
let fee_rate = FeeRate::from_sat_per_vb(2.01);
|
||||||
let incoming_txid = crate::populate_test_db!(
|
let incoming_txid = crate::populate_test_db!(
|
||||||
wallet.database.borrow_mut(),
|
wallet.database.borrow_mut(),
|
||||||
@ -4302,7 +4388,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_include_output_redeem_witness_script() {
|
fn test_include_output_redeem_witness_script() {
|
||||||
let (wallet, _, _) = get_funded_wallet("sh(wsh(multi(1,cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW,cRjo6jqfVNP33HhSS76UhXETZsGTZYx8FMFvR9kpbtCSV1PmdZdu)))");
|
let (wallet, _, _) = get_funded_wallet("sh(wsh(multi(1,cVpPVruEDdmutPzisEsYvtST1usBR3ntr8pXSyt6D2YYqXRyPcFW,cRjo6jqfVNP33HhSS76UhXETZsGTZYx8FMFvR9kpbtCSV1PmdZdu)))");
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -4319,7 +4407,9 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_signing_only_one_of_multiple_inputs() {
|
fn test_signing_only_one_of_multiple_inputs() {
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), 45_000)
|
.add_recipient(addr.script_pubkey(), 45_000)
|
||||||
@ -4327,7 +4417,7 @@ pub(crate) mod test {
|
|||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let (mut psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
// add another input to the psbt that is at least passable.
|
// add another input to the psbt that is at least passable.
|
||||||
let dud_input = bitcoin::util::psbt::Input {
|
let dud_input = bitcoin::psbt::Input {
|
||||||
witness_utxo: Some(TxOut {
|
witness_utxo: Some(TxOut {
|
||||||
value: 100_000,
|
value: 100_000,
|
||||||
script_pubkey: miniscript::Descriptor::<bitcoin::PublicKey>::from_str(
|
script_pubkey: miniscript::Descriptor::<bitcoin::PublicKey>::from_str(
|
||||||
@ -4619,7 +4709,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(New).unwrap(),
|
wallet.get_address(New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 0,
|
index: 0,
|
||||||
address: Address::from_str("tb1q6yn66vajcctph75pvylgkksgpp6nq04ppwct9a").unwrap(),
|
address: Address::from_str("tb1q6yn66vajcctph75pvylgkksgpp6nq04ppwct9a")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4629,7 +4721,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(New).unwrap(),
|
wallet.get_address(New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 1,
|
index: 1,
|
||||||
address: Address::from_str("tb1q4er7kxx6sssz3q7qp7zsqsdx4erceahhax77d7").unwrap(),
|
address: Address::from_str("tb1q4er7kxx6sssz3q7qp7zsqsdx4erceahhax77d7")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4639,7 +4733,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(Peek(25)).unwrap(),
|
wallet.get_address(Peek(25)).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 25,
|
index: 25,
|
||||||
address: Address::from_str("tb1qsp7qu0knx3sl6536dzs0703u2w2ag6ppl9d0c2").unwrap(),
|
address: Address::from_str("tb1qsp7qu0knx3sl6536dzs0703u2w2ag6ppl9d0c2")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4649,7 +4745,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(New).unwrap(),
|
wallet.get_address(New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 2,
|
index: 2,
|
||||||
address: Address::from_str("tb1qzntf2mqex4ehwkjlfdyy3ewdlk08qkvkvrz7x2").unwrap(),
|
address: Address::from_str("tb1qzntf2mqex4ehwkjlfdyy3ewdlk08qkvkvrz7x2")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4659,7 +4757,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(Reset(1)).unwrap(),
|
wallet.get_address(Reset(1)).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 1,
|
index: 1,
|
||||||
address: Address::from_str("tb1q4er7kxx6sssz3q7qp7zsqsdx4erceahhax77d7").unwrap(),
|
address: Address::from_str("tb1q4er7kxx6sssz3q7qp7zsqsdx4erceahhax77d7")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4669,7 +4769,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(New).unwrap(),
|
wallet.get_address(New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 2,
|
index: 2,
|
||||||
address: Address::from_str("tb1qzntf2mqex4ehwkjlfdyy3ewdlk08qkvkvrz7x2").unwrap(),
|
address: Address::from_str("tb1qzntf2mqex4ehwkjlfdyy3ewdlk08qkvkvrz7x2")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4680,7 +4782,8 @@ pub(crate) mod test {
|
|||||||
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let addr =
|
let addr =
|
||||||
Address::from_str("tb1pqqqqp399et2xygdj5xreqhjjvcmzhxw4aywxecjdzew6hylgvsesf3hn0c")
|
Address::from_str("tb1pqqqqp399et2xygdj5xreqhjjvcmzhxw4aywxecjdzew6hylgvsesf3hn0c")
|
||||||
.unwrap();
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder.add_recipient(addr.script_pubkey(), 45_000);
|
builder.add_recipient(addr.script_pubkey(), 45_000);
|
||||||
builder.finish().unwrap();
|
builder.finish().unwrap();
|
||||||
@ -4689,7 +4792,7 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_get_address() {
|
fn test_get_address() {
|
||||||
use crate::descriptor::template::Bip84;
|
use crate::descriptor::template::Bip84;
|
||||||
let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
let wallet = Wallet::new(
|
let wallet = Wallet::new(
|
||||||
Bip84(key, KeychainKind::External),
|
Bip84(key, KeychainKind::External),
|
||||||
Some(Bip84(key, KeychainKind::Internal)),
|
Some(Bip84(key, KeychainKind::Internal)),
|
||||||
@ -4702,7 +4805,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_address(AddressIndex::New).unwrap(),
|
wallet.get_address(AddressIndex::New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 0,
|
index: 0,
|
||||||
address: Address::from_str("bcrt1qrhgaqu0zvf5q2d0gwwz04w0dh0cuehhqvzpp4w").unwrap(),
|
address: Address::from_str("bcrt1qrhgaqu0zvf5q2d0gwwz04w0dh0cuehhqvzpp4w")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::External,
|
keychain: KeychainKind::External,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4711,7 +4816,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_internal_address(AddressIndex::New).unwrap(),
|
wallet.get_internal_address(AddressIndex::New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 0,
|
index: 0,
|
||||||
address: Address::from_str("bcrt1q0ue3s5y935tw7v3gmnh36c5zzsaw4n9c9smq79").unwrap(),
|
address: Address::from_str("bcrt1q0ue3s5y935tw7v3gmnh36c5zzsaw4n9c9smq79")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::Internal,
|
keychain: KeychainKind::Internal,
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
@ -4728,7 +4835,9 @@ pub(crate) mod test {
|
|||||||
wallet.get_internal_address(AddressIndex::New).unwrap(),
|
wallet.get_internal_address(AddressIndex::New).unwrap(),
|
||||||
AddressInfo {
|
AddressInfo {
|
||||||
index: 0,
|
index: 0,
|
||||||
address: Address::from_str("bcrt1qrhgaqu0zvf5q2d0gwwz04w0dh0cuehhqvzpp4w").unwrap(),
|
address: Address::from_str("bcrt1qrhgaqu0zvf5q2d0gwwz04w0dh0cuehhqvzpp4w")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked(),
|
||||||
keychain: KeychainKind::Internal,
|
keychain: KeychainKind::Internal,
|
||||||
},
|
},
|
||||||
"when there's no internal descriptor it should just use external"
|
"when there's no internal descriptor it should just use external"
|
||||||
@ -4740,7 +4849,7 @@ pub(crate) mod test {
|
|||||||
use crate::descriptor::template::Bip84;
|
use crate::descriptor::template::Bip84;
|
||||||
use std::collections::HashSet;
|
use std::collections::HashSet;
|
||||||
|
|
||||||
let key = bitcoin::util::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
let key = bitcoin::bip32::ExtendedPrivKey::from_str("tprv8ZgxMBicQKsPcx5nBGsR63Pe8KnRUqmbJNENAfGftF3yuXoMMoVJJcYeUw5eVkm9WBPjWYt6HMWYJNesB5HaNVBaFc1M6dRjWSYnmewUMYy").unwrap();
|
||||||
let wallet = Wallet::new(
|
let wallet = Wallet::new(
|
||||||
Bip84(key, KeychainKind::External),
|
Bip84(key, KeychainKind::External),
|
||||||
None,
|
None,
|
||||||
@ -4803,7 +4912,7 @@ pub(crate) mod test {
|
|||||||
let (wallet, _, _) = get_funded_wallet(get_test_tr_repeated_key());
|
let (wallet, _, _) = get_funded_wallet(get_test_tr_repeated_key());
|
||||||
let addr = wallet.get_address(AddressIndex::New).unwrap();
|
let addr = wallet.get_address(AddressIndex::New).unwrap();
|
||||||
|
|
||||||
let path = vec![("e5mmg3xh".to_string(), vec![0])]
|
let path = vec![("rn4nre9c".to_string(), vec![0])]
|
||||||
.into_iter()
|
.into_iter()
|
||||||
.collect();
|
.collect();
|
||||||
|
|
||||||
@ -4823,13 +4932,6 @@ pub(crate) mod test {
|
|||||||
assert_eq!(
|
assert_eq!(
|
||||||
input_key_origins,
|
input_key_origins,
|
||||||
vec![
|
vec![
|
||||||
(
|
|
||||||
from_str!("b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55"),
|
|
||||||
(
|
|
||||||
vec![],
|
|
||||||
(FromStr::from_str("871fd295").unwrap(), vec![].into())
|
|
||||||
)
|
|
||||||
),
|
|
||||||
(
|
(
|
||||||
from_str!("2b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3"),
|
from_str!("2b0558078bec38694a84933d659303e2575dae7e91685911454115bfd64487e3"),
|
||||||
(
|
(
|
||||||
@ -4843,7 +4945,14 @@ pub(crate) mod test {
|
|||||||
],
|
],
|
||||||
(FromStr::from_str("ece52657").unwrap(), vec![].into())
|
(FromStr::from_str("ece52657").unwrap(), vec![].into())
|
||||||
)
|
)
|
||||||
)
|
),
|
||||||
|
(
|
||||||
|
from_str!("b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55"),
|
||||||
|
(
|
||||||
|
vec![],
|
||||||
|
(FromStr::from_str("871fd295").unwrap(), vec![].into())
|
||||||
|
)
|
||||||
|
),
|
||||||
],
|
],
|
||||||
"Wrong input tap_key_origins"
|
"Wrong input tap_key_origins"
|
||||||
);
|
);
|
||||||
@ -4863,10 +4972,8 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_taproot_psbt_input_tap_tree() {
|
fn test_taproot_psbt_input_tap_tree() {
|
||||||
use crate::bitcoin::psbt::serialize::Deserialize;
|
|
||||||
use crate::bitcoin::psbt::TapTree;
|
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
use bitcoin::util::taproot;
|
use bitcoin::taproot;
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_tr_with_taptree());
|
let (wallet, _, _) = get_funded_wallet(get_test_tr_with_taptree());
|
||||||
let addr = wallet.get_address(AddressIndex::Peek(0)).unwrap();
|
let addr = wallet.get_address(AddressIndex::Peek(0)).unwrap();
|
||||||
@ -4878,7 +4985,7 @@ pub(crate) mod test {
|
|||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.inputs[0].tap_merkle_root,
|
psbt.inputs[0].tap_merkle_root,
|
||||||
Some(
|
Some(
|
||||||
FromHex::from_hex(
|
taproot::TapNodeHash::from_str(
|
||||||
"61f81509635053e52d9d1217545916167394490da2287aca4693606e43851986"
|
"61f81509635053e52d9d1217545916167394490da2287aca4693606e43851986"
|
||||||
)
|
)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
@ -4887,9 +4994,9 @@ pub(crate) mod test {
|
|||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.inputs[0].tap_scripts.clone().into_iter().collect::<Vec<_>>(),
|
psbt.inputs[0].tap_scripts.clone().into_iter().collect::<Vec<_>>(),
|
||||||
vec![
|
vec![
|
||||||
(taproot::ControlBlock::from_slice(&Vec::<u8>::from_hex("c0b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55b7ef769a745e625ed4b9a4982a4dc08274c59187e73e6f07171108f455081cb2").unwrap()).unwrap(), (from_str!("208aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642ac"), taproot::LeafVersion::TapScript)),
|
(taproot::ControlBlock::decode(&Vec::<u8>::from_hex("c0b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55b7ef769a745e625ed4b9a4982a4dc08274c59187e73e6f07171108f455081cb2").unwrap()).unwrap(), (ScriptBuf::from_hex("208aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642ac").unwrap(), taproot::LeafVersion::TapScript)),
|
||||||
(taproot::ControlBlock::from_slice(&Vec::<u8>::from_hex("c0b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55b9a515f7be31a70186e3c5937ee4a70cc4b4e1efe876c1d38e408222ffc64834").unwrap()).unwrap(), (from_str!("2051494dc22e24a32fe9dcfbd7e85faf345fa1df296fb49d156e859ef345201295ac"), taproot::LeafVersion::TapScript)),
|
(taproot::ControlBlock::decode(&Vec::<u8>::from_hex("c0b511bd5771e47ee27558b1765e87b541668304ec567721c7b880edc0a010da55b9a515f7be31a70186e3c5937ee4a70cc4b4e1efe876c1d38e408222ffc64834").unwrap()).unwrap(), (ScriptBuf::from_hex("2051494dc22e24a32fe9dcfbd7e85faf345fa1df296fb49d156e859ef345201295ac").unwrap(), taproot::LeafVersion::TapScript)),
|
||||||
],
|
],
|
||||||
);
|
);
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
psbt.inputs[0].tap_internal_key,
|
psbt.inputs[0].tap_internal_key,
|
||||||
@ -4905,10 +5012,8 @@ pub(crate) mod test {
|
|||||||
psbt.outputs[0].tap_internal_key
|
psbt.outputs[0].tap_internal_key
|
||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(
|
let tap_tree: bitcoin::taproot::TapTree = serde_json::from_str(r#"[1,{"Script":["2051494dc22e24a32fe9dcfbd7e85faf345fa1df296fb49d156e859ef345201295ac",192]},1,{"Script":["208aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642ac",192]}]"#).unwrap();
|
||||||
psbt.outputs[0].tap_tree,
|
assert_eq!(psbt.outputs[0].tap_tree, Some(tap_tree));
|
||||||
Some(TapTree::deserialize(&Vec::<u8>::from_hex("01c022208aee2b8120a5f157f1223f72b5e62b825831a27a9fdf427db7cc697494d4a642ac01c0222051494dc22e24a32fe9dcfbd7e85faf345fa1df296fb49d156e859ef345201295ac",).unwrap()).unwrap())
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@ -4979,9 +5084,12 @@ pub(crate) mod test {
|
|||||||
let (wallet1, _, _) = get_funded_wallet(get_test_wpkh());
|
let (wallet1, _, _) = get_funded_wallet(get_test_wpkh());
|
||||||
let (wallet2, _, _) = get_funded_wallet(get_test_tr_single_sig());
|
let (wallet2, _, _) = get_funded_wallet(get_test_tr_single_sig());
|
||||||
|
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let utxo = wallet2.list_unspent().unwrap().remove(0);
|
let utxo = wallet2.list_unspent().unwrap().remove(0);
|
||||||
let psbt_input = wallet2.get_psbt_input(utxo.clone(), None, false).unwrap();
|
let psbt_input = wallet2.get_psbt_input(utxo.clone(), None, false).unwrap();
|
||||||
|
#[allow(deprecated)]
|
||||||
let foreign_utxo_satisfaction = wallet2
|
let foreign_utxo_satisfaction = wallet2
|
||||||
.get_descriptor_for_keychain(KeychainKind::External)
|
.get_descriptor_for_keychain(KeychainKind::External)
|
||||||
.max_satisfaction_weight()
|
.max_satisfaction_weight()
|
||||||
@ -5102,7 +5210,7 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_taproot_script_spend_sign_include_some_leaves() {
|
fn test_taproot_script_spend_sign_include_some_leaves() {
|
||||||
use crate::signer::TapLeavesOptions;
|
use crate::signer::TapLeavesOptions;
|
||||||
use bitcoin::util::taproot::TapLeafHash;
|
use bitcoin::taproot::TapLeafHash;
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_tr_with_taptree_both_priv());
|
let (wallet, _, _) = get_funded_wallet(get_test_tr_with_taptree_both_priv());
|
||||||
let addr = wallet.get_address(AddressIndex::New).unwrap();
|
let addr = wallet.get_address(AddressIndex::New).unwrap();
|
||||||
@ -5144,7 +5252,7 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_taproot_script_spend_sign_exclude_some_leaves() {
|
fn test_taproot_script_spend_sign_exclude_some_leaves() {
|
||||||
use crate::signer::TapLeavesOptions;
|
use crate::signer::TapLeavesOptions;
|
||||||
use bitcoin::util::taproot::TapLeafHash;
|
use bitcoin::taproot::TapLeafHash;
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_tr_with_taptree_both_priv());
|
let (wallet, _, _) = get_funded_wallet(get_test_tr_with_taptree_both_priv());
|
||||||
let addr = wallet.get_address(AddressIndex::New).unwrap();
|
let addr = wallet.get_address(AddressIndex::New).unwrap();
|
||||||
@ -5240,7 +5348,7 @@ pub(crate) mod test {
|
|||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
.sighash(SchnorrSighashType::All.into())
|
.sighash(TapSighashType::All.into())
|
||||||
.drain_wallet();
|
.drain_wallet();
|
||||||
let (mut psbt, _) = builder.finish().unwrap();
|
let (mut psbt, _) = builder.finish().unwrap();
|
||||||
|
|
||||||
@ -5253,7 +5361,7 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_taproot_sign_non_default_sighash() {
|
fn test_taproot_sign_non_default_sighash() {
|
||||||
let sighash = SchnorrSighashType::NonePlusAnyoneCanPay;
|
let sighash = TapSighashType::NonePlusAnyoneCanPay;
|
||||||
|
|
||||||
let (wallet, _, _) = get_funded_wallet(get_test_tr_single_sig());
|
let (wallet, _, _) = get_funded_wallet(get_test_tr_single_sig());
|
||||||
let addr = wallet.get_address(New).unwrap();
|
let addr = wallet.get_address(New).unwrap();
|
||||||
@ -5367,7 +5475,9 @@ pub(crate) mod test {
|
|||||||
|
|
||||||
// We try to create a transaction, only to notice that all
|
// We try to create a transaction, only to notice that all
|
||||||
// our funds are unspendable
|
// our funds are unspendable
|
||||||
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX").unwrap();
|
let addr = Address::from_str("2N1Ffz3WaNzbeLFBb51xyFMHYSEUXcbiSoX")
|
||||||
|
.unwrap()
|
||||||
|
.assume_checked();
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
builder
|
builder
|
||||||
.add_recipient(addr.script_pubkey(), balance.immature / 2)
|
.add_recipient(addr.script_pubkey(), balance.immature / 2)
|
||||||
@ -5453,7 +5563,7 @@ pub(crate) mod test {
|
|||||||
let addr = wallet.get_address(New).unwrap();
|
let addr = wallet.get_address(New).unwrap();
|
||||||
let fee_rate = FeeRate::from_sat_per_vb(1.0);
|
let fee_rate = FeeRate::from_sat_per_vb(1.0);
|
||||||
let mut builder = wallet.build_tx();
|
let mut builder = wallet.build_tx();
|
||||||
let mut data = vec![0];
|
let data: &PushBytes = From::<&[u8; 1]>::from(&[0; 1]);
|
||||||
builder
|
builder
|
||||||
.drain_to(addr.script_pubkey())
|
.drain_to(addr.script_pubkey())
|
||||||
.drain_wallet()
|
.drain_wallet()
|
||||||
@ -5473,8 +5583,8 @@ pub(crate) mod test {
|
|||||||
while sig_len < 71 {
|
while sig_len < 71 {
|
||||||
// Changing the OP_RETURN data will make the signature change (but not the fee, until
|
// Changing the OP_RETURN data will make the signature change (but not the fee, until
|
||||||
// data[0] is small enough)
|
// data[0] is small enough)
|
||||||
data[0] += 1;
|
let data: &PushBytes = From::<&[u8; 1]>::from(&[1; 1]);
|
||||||
psbt.unsigned_tx.output[op_return_vout].script_pubkey = Script::new_op_return(&data);
|
psbt.unsigned_tx.output[op_return_vout].script_pubkey = ScriptBuf::new_op_return(&data);
|
||||||
// Clearing the previous signature
|
// Clearing the previous signature
|
||||||
psbt.inputs[0].partial_sigs.clear();
|
psbt.inputs[0].partial_sigs.clear();
|
||||||
// Signing
|
// Signing
|
||||||
@ -5545,7 +5655,6 @@ pub(crate) mod test {
|
|||||||
#[test]
|
#[test]
|
||||||
fn test_create_signer() {
|
fn test_create_signer() {
|
||||||
use crate::wallet::hardwaresigner::HWISigner;
|
use crate::wallet::hardwaresigner::HWISigner;
|
||||||
use hwi::types::HWIChain;
|
|
||||||
use hwi::HWIClient;
|
use hwi::HWIClient;
|
||||||
|
|
||||||
let mut devices = HWIClient::enumerate().unwrap();
|
let mut devices = HWIClient::enumerate().unwrap();
|
||||||
@ -5553,9 +5662,9 @@ pub(crate) mod test {
|
|||||||
panic!("No devices found!");
|
panic!("No devices found!");
|
||||||
}
|
}
|
||||||
let device = devices.remove(0).unwrap();
|
let device = devices.remove(0).unwrap();
|
||||||
let client = HWIClient::get_client(&device, true, HWIChain::Regtest).unwrap();
|
let client = HWIClient::get_client(&device, true, Network::Regtest.into()).unwrap();
|
||||||
let descriptors = client.get_descriptors::<String>(None).unwrap();
|
let descriptors = client.get_descriptors::<String>(None).unwrap();
|
||||||
let custom_signer = HWISigner::from_device(&device, HWIChain::Regtest).unwrap();
|
let custom_signer = HWISigner::from_device(&device, Network::Regtest.into()).unwrap();
|
||||||
|
|
||||||
let (mut wallet, _, _) = get_funded_wallet(&descriptors.internal[0]);
|
let (mut wallet, _, _) = get_funded_wallet(&descriptors.internal[0]);
|
||||||
wallet.add_signer(
|
wallet.add_signer(
|
||||||
|
@ -19,7 +19,7 @@
|
|||||||
//! # use std::str::FromStr;
|
//! # use std::str::FromStr;
|
||||||
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
//! # use bitcoin::secp256k1::{Secp256k1, All};
|
||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bitcoin::util::psbt;
|
//! # use bitcoin::psbt;
|
||||||
//! # use bdk::signer::*;
|
//! # use bdk::signer::*;
|
||||||
//! # use bdk::database::*;
|
//! # use bdk::database::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
@ -86,18 +86,17 @@ use std::fmt;
|
|||||||
use std::ops::{Bound::Included, Deref};
|
use std::ops::{Bound::Included, Deref};
|
||||||
use std::sync::Arc;
|
use std::sync::Arc;
|
||||||
|
|
||||||
use bitcoin::blockdata::opcodes;
|
use bitcoin::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
||||||
use bitcoin::blockdata::script::Builder as ScriptBuilder;
|
use bitcoin::hashes::hash160;
|
||||||
use bitcoin::hashes::{hash160, Hash};
|
|
||||||
use bitcoin::secp256k1::Message;
|
use bitcoin::secp256k1::Message;
|
||||||
use bitcoin::util::bip32::{ChildNumber, DerivationPath, ExtendedPrivKey, Fingerprint};
|
use bitcoin::sighash::{EcdsaSighashType, TapSighash, TapSighashType};
|
||||||
use bitcoin::util::{ecdsa, psbt, schnorr, sighash, taproot};
|
use bitcoin::{ecdsa, psbt, sighash, taproot};
|
||||||
use bitcoin::{secp256k1, XOnlyPublicKey};
|
use bitcoin::{key::TapTweak, key::XOnlyPublicKey, secp256k1};
|
||||||
use bitcoin::{EcdsaSighashType, PrivateKey, PublicKey, SchnorrSighashType, Script};
|
use bitcoin::{PrivateKey, PublicKey};
|
||||||
|
|
||||||
use miniscript::descriptor::{
|
use miniscript::descriptor::{
|
||||||
Descriptor, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey, KeyMap, SinglePriv,
|
Descriptor, DescriptorMultiXKey, DescriptorPublicKey, DescriptorSecretKey, DescriptorXKey,
|
||||||
SinglePubKey,
|
InnerXKey, KeyMap, SinglePriv, SinglePubKey,
|
||||||
};
|
};
|
||||||
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
use miniscript::{Legacy, Segwitv0, SigType, Tap, ToPublicKey};
|
||||||
|
|
||||||
@ -130,7 +129,7 @@ impl From<Fingerprint> for SignerId {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/// Signing error
|
/// Signing error
|
||||||
#[derive(Debug, PartialEq, Eq, Clone)]
|
#[derive(Debug)]
|
||||||
pub enum SignerError {
|
pub enum SignerError {
|
||||||
/// The private key is missing for the required public key
|
/// The private key is missing for the required public key
|
||||||
MissingKey,
|
MissingKey,
|
||||||
@ -382,6 +381,49 @@ impl InputSigner for SignerWrapper<DescriptorXKey<ExtendedPrivKey>> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
fn multikey_to_xkeys<K: InnerXKey + Clone>(
|
||||||
|
multikey: DescriptorMultiXKey<K>,
|
||||||
|
) -> Vec<DescriptorXKey<K>> {
|
||||||
|
multikey
|
||||||
|
.derivation_paths
|
||||||
|
.clone()
|
||||||
|
.into_paths()
|
||||||
|
.into_iter()
|
||||||
|
.map(|derivation_path| DescriptorXKey {
|
||||||
|
origin: multikey.origin.clone(),
|
||||||
|
xkey: multikey.xkey.clone(),
|
||||||
|
derivation_path,
|
||||||
|
wildcard: multikey.wildcard,
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignerCommon for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
|
SignerId::from(self.root_fingerprint(secp))
|
||||||
|
}
|
||||||
|
|
||||||
|
fn descriptor_secret_key(&self) -> Option<DescriptorSecretKey> {
|
||||||
|
Some(DescriptorSecretKey::MultiXPrv(self.signer.clone()))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl InputSigner for SignerWrapper<DescriptorMultiXKey<ExtendedPrivKey>> {
|
||||||
|
fn sign_input(
|
||||||
|
&self,
|
||||||
|
psbt: &mut psbt::PartiallySignedTransaction,
|
||||||
|
input_index: usize,
|
||||||
|
sign_options: &SignOptions,
|
||||||
|
secp: &SecpCtx,
|
||||||
|
) -> Result<(), SignerError> {
|
||||||
|
let xkeys = multikey_to_xkeys(self.signer.clone());
|
||||||
|
for xkey in xkeys {
|
||||||
|
SignerWrapper::new(xkey, self.ctx).sign_input(psbt, input_index, sign_options, secp)?
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
impl SignerCommon for SignerWrapper<PrivateKey> {
|
impl SignerCommon for SignerWrapper<PrivateKey> {
|
||||||
fn id(&self, secp: &SecpCtx) -> SignerId {
|
fn id(&self, secp: &SecpCtx) -> SignerId {
|
||||||
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
SignerId::from(self.public_key(secp).to_pubkeyhash(SigType::Ecdsa))
|
||||||
@ -476,8 +518,16 @@ impl InputSigner for SignerWrapper<PrivateKey> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let (hash, hash_ty) = match self.ctx {
|
let (hash, hash_ty) = match self.ctx {
|
||||||
SignerContext::Segwitv0 => Segwitv0::sighash(psbt, input_index, ())?,
|
SignerContext::Segwitv0 => {
|
||||||
SignerContext::Legacy => Legacy::sighash(psbt, input_index, ())?,
|
let (h, t) = Segwitv0::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
|
SignerContext::Legacy => {
|
||||||
|
let (h, t) = Legacy::sighash(psbt, input_index, ())?;
|
||||||
|
let h = h.to_raw_hash();
|
||||||
|
(h, t)
|
||||||
|
}
|
||||||
_ => return Ok(()), // handled above
|
_ => return Ok(()), // handled above
|
||||||
};
|
};
|
||||||
sign_psbt_ecdsa(
|
sign_psbt_ecdsa(
|
||||||
@ -498,12 +548,12 @@ fn sign_psbt_ecdsa(
|
|||||||
secret_key: &secp256k1::SecretKey,
|
secret_key: &secp256k1::SecretKey,
|
||||||
pubkey: PublicKey,
|
pubkey: PublicKey,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: bitcoin::Sighash,
|
hash: impl bitcoin::hashes::Hash + bitcoin::secp256k1::ThirtyTwoByteHash,
|
||||||
hash_ty: EcdsaSighashType,
|
hash_ty: EcdsaSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
allow_grinding: bool,
|
allow_grinding: bool,
|
||||||
) {
|
) {
|
||||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
let msg = &Message::from(hash);
|
||||||
let sig = if allow_grinding {
|
let sig = if allow_grinding {
|
||||||
secp.sign_ecdsa_low_r(msg, secret_key)
|
secp.sign_ecdsa_low_r(msg, secret_key)
|
||||||
} else {
|
} else {
|
||||||
@ -512,7 +562,7 @@ fn sign_psbt_ecdsa(
|
|||||||
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
secp.verify_ecdsa(msg, &sig, &pubkey.inner)
|
||||||
.expect("invalid or corrupted ecdsa signature");
|
.expect("invalid or corrupted ecdsa signature");
|
||||||
|
|
||||||
let final_signature = ecdsa::EcdsaSig { sig, hash_ty };
|
let final_signature = ecdsa::Signature { sig, hash_ty };
|
||||||
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
psbt_input.partial_sigs.insert(pubkey, final_signature);
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -522,12 +572,10 @@ fn sign_psbt_schnorr(
|
|||||||
pubkey: XOnlyPublicKey,
|
pubkey: XOnlyPublicKey,
|
||||||
leaf_hash: Option<taproot::TapLeafHash>,
|
leaf_hash: Option<taproot::TapLeafHash>,
|
||||||
psbt_input: &mut psbt::Input,
|
psbt_input: &mut psbt::Input,
|
||||||
hash: taproot::TapSighashHash,
|
hash: TapSighash,
|
||||||
hash_ty: SchnorrSighashType,
|
hash_ty: TapSighashType,
|
||||||
secp: &SecpCtx,
|
secp: &SecpCtx,
|
||||||
) {
|
) {
|
||||||
use schnorr::TapTweak;
|
|
||||||
|
|
||||||
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
let keypair = secp256k1::KeyPair::from_seckey_slice(secp, secret_key.as_ref()).unwrap();
|
||||||
let keypair = match leaf_hash {
|
let keypair = match leaf_hash {
|
||||||
None => keypair
|
None => keypair
|
||||||
@ -536,12 +584,12 @@ fn sign_psbt_schnorr(
|
|||||||
Some(_) => keypair, // no tweak for script spend
|
Some(_) => keypair, // no tweak for script spend
|
||||||
};
|
};
|
||||||
|
|
||||||
let msg = &Message::from_slice(&hash.into_inner()[..]).unwrap();
|
let msg = &Message::from(hash);
|
||||||
let sig = secp.sign_schnorr(msg, &keypair);
|
let sig = secp.sign_schnorr(msg, &keypair);
|
||||||
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
secp.verify_schnorr(&sig, msg, &XOnlyPublicKey::from_keypair(&keypair).0)
|
||||||
.expect("invalid or corrupted schnorr signature");
|
.expect("invalid or corrupted schnorr signature");
|
||||||
|
|
||||||
let final_signature = schnorr::SchnorrSig { sig, hash_ty };
|
let final_signature = taproot::Signature { sig, hash_ty };
|
||||||
|
|
||||||
if let Some(lh) = leaf_hash {
|
if let Some(lh) = leaf_hash {
|
||||||
psbt_input
|
psbt_input
|
||||||
@ -631,6 +679,11 @@ impl SignersContainer {
|
|||||||
SignerOrdering::default(),
|
SignerOrdering::default(),
|
||||||
Arc::new(SignerWrapper::new(xprv, ctx)),
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
),
|
),
|
||||||
|
DescriptorSecretKey::MultiXPrv(xprv) => container.add_external(
|
||||||
|
SignerId::from(xprv.root_fingerprint(secp)),
|
||||||
|
SignerOrdering::default(),
|
||||||
|
Arc::new(SignerWrapper::new(xprv, ctx)),
|
||||||
|
),
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -801,7 +854,7 @@ pub(crate) trait ComputeSighash {
|
|||||||
|
|
||||||
impl ComputeSighash for Legacy {
|
impl ComputeSighash for Legacy {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::LegacySighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@ -848,19 +901,9 @@ impl ComputeSighash for Legacy {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
fn p2wpkh_script_code(script: &Script) -> Script {
|
|
||||||
ScriptBuilder::new()
|
|
||||||
.push_opcode(opcodes::all::OP_DUP)
|
|
||||||
.push_opcode(opcodes::all::OP_HASH160)
|
|
||||||
.push_slice(&script[2..])
|
|
||||||
.push_opcode(opcodes::all::OP_EQUALVERIFY)
|
|
||||||
.push_opcode(opcodes::all::OP_CHECKSIG)
|
|
||||||
.into_script()
|
|
||||||
}
|
|
||||||
|
|
||||||
impl ComputeSighash for Segwitv0 {
|
impl ComputeSighash for Segwitv0 {
|
||||||
type Extra = ();
|
type Extra = ();
|
||||||
type Sighash = bitcoin::Sighash;
|
type Sighash = sighash::SegwitV0Sighash;
|
||||||
type SighashType = EcdsaSighashType;
|
type SighashType = EcdsaSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
@ -907,14 +950,21 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
Some(ref witness_script) => witness_script.clone(),
|
Some(ref witness_script) => witness_script.clone(),
|
||||||
None => {
|
None => {
|
||||||
if utxo.script_pubkey.is_v0_p2wpkh() {
|
if utxo.script_pubkey.is_v0_p2wpkh() {
|
||||||
p2wpkh_script_code(&utxo.script_pubkey)
|
utxo.script_pubkey
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else if psbt_input
|
} else if psbt_input
|
||||||
.redeem_script
|
.redeem_script
|
||||||
.as_ref()
|
.as_ref()
|
||||||
.map(Script::is_v0_p2wpkh)
|
.map(|s| s.is_v0_p2wpkh())
|
||||||
.unwrap_or(false)
|
.unwrap_or(false)
|
||||||
{
|
{
|
||||||
p2wpkh_script_code(psbt_input.redeem_script.as_ref().unwrap())
|
psbt_input
|
||||||
|
.redeem_script
|
||||||
|
.as_ref()
|
||||||
|
.unwrap()
|
||||||
|
.p2wpkh_script_code()
|
||||||
|
.expect("We check above that the spk is a p2wpkh")
|
||||||
} else {
|
} else {
|
||||||
return Err(SignerError::MissingWitnessScript);
|
return Err(SignerError::MissingWitnessScript);
|
||||||
}
|
}
|
||||||
@ -935,14 +985,14 @@ impl ComputeSighash for Segwitv0 {
|
|||||||
|
|
||||||
impl ComputeSighash for Tap {
|
impl ComputeSighash for Tap {
|
||||||
type Extra = Option<taproot::TapLeafHash>;
|
type Extra = Option<taproot::TapLeafHash>;
|
||||||
type Sighash = taproot::TapSighashHash;
|
type Sighash = TapSighash;
|
||||||
type SighashType = SchnorrSighashType;
|
type SighashType = TapSighashType;
|
||||||
|
|
||||||
fn sighash(
|
fn sighash(
|
||||||
psbt: &psbt::PartiallySignedTransaction,
|
psbt: &psbt::PartiallySignedTransaction,
|
||||||
input_index: usize,
|
input_index: usize,
|
||||||
extra: Self::Extra,
|
extra: Self::Extra,
|
||||||
) -> Result<(Self::Sighash, SchnorrSighashType), SignerError> {
|
) -> Result<(Self::Sighash, TapSighashType), SignerError> {
|
||||||
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
if input_index >= psbt.inputs.len() || input_index >= psbt.unsigned_tx.input.len() {
|
||||||
return Err(SignerError::InputIndexOutOfRange);
|
return Err(SignerError::InputIndexOutOfRange);
|
||||||
}
|
}
|
||||||
@ -951,8 +1001,8 @@ impl ComputeSighash for Tap {
|
|||||||
|
|
||||||
let sighash_type = psbt_input
|
let sighash_type = psbt_input
|
||||||
.sighash_type
|
.sighash_type
|
||||||
.unwrap_or_else(|| SchnorrSighashType::Default.into())
|
.unwrap_or_else(|| TapSighashType::Default.into())
|
||||||
.schnorr_hash_ty()
|
.taproot_hash_ty()
|
||||||
.map_err(|_| SignerError::InvalidSighash)?;
|
.map_err(|_| SignerError::InvalidSighash)?;
|
||||||
let witness_utxos = (0..psbt.inputs.len())
|
let witness_utxos = (0..psbt.inputs.len())
|
||||||
.map(|i| psbt.get_utxo_for(i))
|
.map(|i| psbt.get_utxo_for(i))
|
||||||
@ -1014,8 +1064,8 @@ mod signers_container_tests {
|
|||||||
use crate::descriptor::IntoWalletDescriptor;
|
use crate::descriptor::IntoWalletDescriptor;
|
||||||
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
use crate::keys::{DescriptorKey, IntoDescriptorKey};
|
||||||
use assert_matches::assert_matches;
|
use assert_matches::assert_matches;
|
||||||
|
use bitcoin::bip32;
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::util::bip32;
|
|
||||||
use bitcoin::Network;
|
use bitcoin::Network;
|
||||||
use miniscript::ScriptContext;
|
use miniscript::ScriptContext;
|
||||||
use std::str::FromStr;
|
use std::str::FromStr;
|
||||||
|
@ -18,7 +18,7 @@
|
|||||||
//! # use bitcoin::*;
|
//! # use bitcoin::*;
|
||||||
//! # use bdk::*;
|
//! # use bdk::*;
|
||||||
//! # use bdk::wallet::tx_builder::CreateTx;
|
//! # use bdk::wallet::tx_builder::CreateTx;
|
||||||
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
//! # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
//! # let wallet = doctest_wallet!();
|
//! # let wallet = doctest_wallet!();
|
||||||
//! // create a TxBuilder from a wallet
|
//! // create a TxBuilder from a wallet
|
||||||
//! let mut tx_builder = wallet.build_tx();
|
//! let mut tx_builder = wallet.build_tx();
|
||||||
@ -27,7 +27,7 @@
|
|||||||
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
//! // Create a transaction with one output to `to_address` of 50_000 satoshi
|
||||||
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
//! .add_recipient(to_address.script_pubkey(), 50_000)
|
||||||
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
//! // With a custom fee rate of 5.0 satoshi/vbyte
|
||||||
//! .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
//! .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
//! // Only spend non-change outputs
|
//! // Only spend non-change outputs
|
||||||
//! .do_not_spend_change()
|
//! .do_not_spend_change()
|
||||||
//! // Turn on RBF signaling
|
//! // Turn on RBF signaling
|
||||||
@ -41,8 +41,8 @@ use std::collections::HashSet;
|
|||||||
use std::default::Default;
|
use std::default::Default;
|
||||||
use std::marker::PhantomData;
|
use std::marker::PhantomData;
|
||||||
|
|
||||||
use bitcoin::util::psbt::{self, PartiallySignedTransaction as Psbt};
|
use bitcoin::psbt::{self, PartiallySignedTransaction as Psbt};
|
||||||
use bitcoin::{LockTime, OutPoint, Script, Sequence, Transaction};
|
use bitcoin::{absolute, script::PushBytes, OutPoint, ScriptBuf, Sequence, Transaction};
|
||||||
|
|
||||||
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
use super::coin_selection::{CoinSelectionAlgorithm, DefaultCoinSelectionAlgorithm};
|
||||||
use crate::{database::BatchDatabase, Error, Utxo, Wallet};
|
use crate::{database::BatchDatabase, Error, Utxo, Wallet};
|
||||||
@ -79,7 +79,7 @@ impl TxBuilderContext for BumpFee {}
|
|||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use core::str::FromStr;
|
/// # use core::str::FromStr;
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let addr1 = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap().assume_checked();
|
||||||
/// # let addr2 = addr1.clone();
|
/// # let addr2 = addr1.clone();
|
||||||
/// // chaining
|
/// // chaining
|
||||||
/// let (psbt1, details) = {
|
/// let (psbt1, details) = {
|
||||||
@ -126,9 +126,9 @@ pub struct TxBuilder<'a, D, Cs, Ctx> {
|
|||||||
//TODO: TxParams should eventually be exposed publicly.
|
//TODO: TxParams should eventually be exposed publicly.
|
||||||
#[derive(Default, Debug, Clone)]
|
#[derive(Default, Debug, Clone)]
|
||||||
pub(crate) struct TxParams {
|
pub(crate) struct TxParams {
|
||||||
pub(crate) recipients: Vec<(Script, u64)>,
|
pub(crate) recipients: Vec<(ScriptBuf, u64)>,
|
||||||
pub(crate) drain_wallet: bool,
|
pub(crate) drain_wallet: bool,
|
||||||
pub(crate) drain_to: Option<Script>,
|
pub(crate) drain_to: Option<ScriptBuf>,
|
||||||
pub(crate) fee_policy: Option<FeePolicy>,
|
pub(crate) fee_policy: Option<FeePolicy>,
|
||||||
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) internal_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
pub(crate) external_policy_path: Option<BTreeMap<String, Vec<usize>>>,
|
||||||
@ -137,7 +137,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) manually_selected_only: bool,
|
pub(crate) manually_selected_only: bool,
|
||||||
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
pub(crate) sighash: Option<psbt::PsbtSighashType>,
|
||||||
pub(crate) ordering: TxOrdering,
|
pub(crate) ordering: TxOrdering,
|
||||||
pub(crate) locktime: Option<LockTime>,
|
pub(crate) locktime: Option<absolute::LockTime>,
|
||||||
pub(crate) rbf: Option<RbfValue>,
|
pub(crate) rbf: Option<RbfValue>,
|
||||||
pub(crate) version: Option<Version>,
|
pub(crate) version: Option<Version>,
|
||||||
pub(crate) change_policy: ChangeSpendPolicy,
|
pub(crate) change_policy: ChangeSpendPolicy,
|
||||||
@ -145,7 +145,7 @@ pub(crate) struct TxParams {
|
|||||||
pub(crate) add_global_xpubs: bool,
|
pub(crate) add_global_xpubs: bool,
|
||||||
pub(crate) include_output_redeem_witness_script: bool,
|
pub(crate) include_output_redeem_witness_script: bool,
|
||||||
pub(crate) bumping_fee: Option<PreviousFee>,
|
pub(crate) bumping_fee: Option<PreviousFee>,
|
||||||
pub(crate) current_height: Option<LockTime>,
|
pub(crate) current_height: Option<absolute::LockTime>,
|
||||||
pub(crate) allow_dust: bool,
|
pub(crate) allow_dust: bool,
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -241,7 +241,10 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// # use std::collections::BTreeMap;
|
/// # use std::collections::BTreeMap;
|
||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// let mut path = BTreeMap::new();
|
/// let mut path = BTreeMap::new();
|
||||||
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
/// path.insert("aabbccdd".to_string(), vec![0, 1]);
|
||||||
@ -281,6 +284,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
|
|
||||||
for utxo in utxos {
|
for utxo in utxos {
|
||||||
let descriptor = self.wallet.get_descriptor_for_keychain(utxo.keychain);
|
let descriptor = self.wallet.get_descriptor_for_keychain(utxo.keychain);
|
||||||
|
#[allow(deprecated)]
|
||||||
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
let satisfaction_weight = descriptor.max_satisfaction_weight().unwrap();
|
||||||
self.params.utxos.push(WeightedUtxo {
|
self.params.utxos.push(WeightedUtxo {
|
||||||
satisfaction_weight,
|
satisfaction_weight,
|
||||||
@ -424,7 +428,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
/// Use a specific nLockTime while creating the transaction
|
/// Use a specific nLockTime while creating the transaction
|
||||||
///
|
///
|
||||||
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
/// This can cause conflicts if the wallet's descriptors contain an "after" (OP_CLTV) operator.
|
||||||
pub fn nlocktime(&mut self, locktime: LockTime) -> &mut Self {
|
pub fn nlocktime(&mut self, locktime: absolute::LockTime) -> &mut Self {
|
||||||
self.params.locktime = Some(locktime);
|
self.params.locktime = Some(locktime);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@ -463,7 +467,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::util::psbt::Input::witness_utxo) field when spending from
|
/// Only Fill-in the [`psbt::Input::witness_utxo`](bitcoin::psbt::Input::witness_utxo) field when spending from
|
||||||
/// SegWit descriptors.
|
/// SegWit descriptors.
|
||||||
///
|
///
|
||||||
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
/// This reduces the size of the PSBT, but some signers might reject them due to the lack of
|
||||||
@ -473,8 +477,8 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::util::psbt::Output::redeem_script) and
|
/// Fill-in the [`psbt::Output::redeem_script`](bitcoin::psbt::Output::redeem_script) and
|
||||||
/// [`psbt::Output::witness_script`](bitcoin::util::psbt::Output::witness_script) fields.
|
/// [`psbt::Output::witness_script`](bitcoin::psbt::Output::witness_script) fields.
|
||||||
///
|
///
|
||||||
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
/// This is useful for signers which always require it, like ColdCard hardware wallets.
|
||||||
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
pub fn include_output_redeem_witness_script(&mut self) -> &mut Self {
|
||||||
@ -556,7 +560,8 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
///
|
///
|
||||||
/// In both cases, if you don't provide a current height, we use the last sync height.
|
/// In both cases, if you don't provide a current height, we use the last sync height.
|
||||||
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
pub fn current_height(&mut self, height: u32) -> &mut Self {
|
||||||
self.params.current_height = Some(LockTime::from_height(height).expect("Invalid height"));
|
self.params.current_height =
|
||||||
|
Some(absolute::LockTime::from_height(height).expect("Invalid height"));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
@ -571,20 +576,20 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>, Ctx: TxBuilderContext>
|
|||||||
|
|
||||||
impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, CreateTx> {
|
impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, CreateTx> {
|
||||||
/// Replace the recipients already added with a new list
|
/// Replace the recipients already added with a new list
|
||||||
pub fn set_recipients(&mut self, recipients: Vec<(Script, u64)>) -> &mut Self {
|
pub fn set_recipients(&mut self, recipients: Vec<(ScriptBuf, u64)>) -> &mut Self {
|
||||||
self.params.recipients = recipients;
|
self.params.recipients = recipients;
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add a recipient to the internal list
|
/// Add a recipient to the internal list
|
||||||
pub fn add_recipient(&mut self, script_pubkey: Script, amount: u64) -> &mut Self {
|
pub fn add_recipient(&mut self, script_pubkey: ScriptBuf, amount: u64) -> &mut Self {
|
||||||
self.params.recipients.push((script_pubkey, amount));
|
self.params.recipients.push((script_pubkey, amount));
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Add data as an output, using OP_RETURN
|
/// Add data as an output, using OP_RETURN
|
||||||
pub fn add_data(&mut self, data: &[u8]) -> &mut Self {
|
pub fn add_data<T: AsRef<PushBytes>>(&mut self, data: &T) -> &mut Self {
|
||||||
let script = Script::new_op_return(data);
|
let script = ScriptBuf::new_op_return(data);
|
||||||
self.add_recipient(script, 0u64);
|
self.add_recipient(script, 0u64);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@ -614,7 +619,10 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// # use bitcoin::*;
|
/// # use bitcoin::*;
|
||||||
/// # use bdk::*;
|
/// # use bdk::*;
|
||||||
/// # use bdk::wallet::tx_builder::CreateTx;
|
/// # use bdk::wallet::tx_builder::CreateTx;
|
||||||
/// # let to_address = Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt").unwrap();
|
/// # let to_address =
|
||||||
|
/// Address::from_str("2N4eQYCbKUHCCTUjBJeHcJp9ok6J2GZsTDt")
|
||||||
|
/// .unwrap()
|
||||||
|
/// .assume_checked();
|
||||||
/// # let wallet = doctest_wallet!();
|
/// # let wallet = doctest_wallet!();
|
||||||
/// let mut tx_builder = wallet.build_tx();
|
/// let mut tx_builder = wallet.build_tx();
|
||||||
///
|
///
|
||||||
@ -623,7 +631,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// .drain_wallet()
|
/// .drain_wallet()
|
||||||
/// // Send the excess (which is all the coins minus the fee) to this address.
|
/// // Send the excess (which is all the coins minus the fee) to this address.
|
||||||
/// .drain_to(to_address.script_pubkey())
|
/// .drain_to(to_address.script_pubkey())
|
||||||
/// .fee_rate(FeeRate::from_sat_per_vb(5.0))
|
/// .fee_rate(bdk::FeeRate::from_sat_per_vb(5.0))
|
||||||
/// .enable_rbf();
|
/// .enable_rbf();
|
||||||
/// let (psbt, tx_details) = tx_builder.finish()?;
|
/// let (psbt, tx_details) = tx_builder.finish()?;
|
||||||
/// # Ok::<(), bdk::Error>(())
|
/// # Ok::<(), bdk::Error>(())
|
||||||
@ -633,7 +641,7 @@ impl<'a, D: BatchDatabase, Cs: CoinSelectionAlgorithm<D>> TxBuilder<'a, D, Cs, C
|
|||||||
/// [`add_recipient`]: Self::add_recipient
|
/// [`add_recipient`]: Self::add_recipient
|
||||||
/// [`add_utxos`]: Self::add_utxos
|
/// [`add_utxos`]: Self::add_utxos
|
||||||
/// [`drain_wallet`]: Self::drain_wallet
|
/// [`drain_wallet`]: Self::drain_wallet
|
||||||
pub fn drain_to(&mut self, script_pubkey: Script) -> &mut Self {
|
pub fn drain_to(&mut self, script_pubkey: ScriptBuf) -> &mut Self {
|
||||||
self.params.drain_to = Some(script_pubkey);
|
self.params.drain_to = Some(script_pubkey);
|
||||||
self
|
self
|
||||||
}
|
}
|
||||||
@ -651,7 +659,7 @@ impl<'a, D: BatchDatabase> TxBuilder<'a, D, DefaultCoinSelectionAlgorithm, BumpF
|
|||||||
///
|
///
|
||||||
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
/// Returns an `Err` if `script_pubkey` can't be found among the recipients of the
|
||||||
/// transaction we are bumping.
|
/// transaction we are bumping.
|
||||||
pub fn allow_shrinking(&mut self, script_pubkey: Script) -> Result<&mut Self, Error> {
|
pub fn allow_shrinking(&mut self, script_pubkey: ScriptBuf) -> Result<&mut Self, Error> {
|
||||||
match self
|
match self
|
||||||
.params
|
.params
|
||||||
.recipients
|
.recipients
|
||||||
@ -790,6 +798,7 @@ mod test {
|
|||||||
|
|
||||||
use bitcoin::consensus::deserialize;
|
use bitcoin::consensus::deserialize;
|
||||||
use bitcoin::hashes::hex::FromHex;
|
use bitcoin::hashes::hex::FromHex;
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
@ -821,8 +830,6 @@ mod test {
|
|||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_output_ordering_bip69() {
|
fn test_output_ordering_bip69() {
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
let original_tx = ordering_test_tx!();
|
let original_tx = ordering_test_tx!();
|
||||||
let mut tx = original_tx;
|
let mut tx = original_tx;
|
||||||
|
|
||||||
@ -851,8 +858,11 @@ mod test {
|
|||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(tx.output[0].value, 800);
|
assert_eq!(tx.output[0].value, 800);
|
||||||
assert_eq!(tx.output[1].script_pubkey, From::from(vec![0xAA]));
|
assert_eq!(tx.output[1].script_pubkey, ScriptBuf::from(vec![0xAA]));
|
||||||
assert_eq!(tx.output[2].script_pubkey, From::from(vec![0xAA, 0xEE]));
|
assert_eq!(
|
||||||
|
tx.output[2].script_pubkey,
|
||||||
|
ScriptBuf::from(vec![0xAA, 0xEE])
|
||||||
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
fn get_test_utxos() -> Vec<LocalUtxo> {
|
fn get_test_utxos() -> Vec<LocalUtxo> {
|
||||||
@ -861,7 +871,7 @@ mod test {
|
|||||||
vec![
|
vec![
|
||||||
LocalUtxo {
|
LocalUtxo {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 0,
|
vout: 0,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
@ -870,7 +880,7 @@ mod test {
|
|||||||
},
|
},
|
||||||
LocalUtxo {
|
LocalUtxo {
|
||||||
outpoint: OutPoint {
|
outpoint: OutPoint {
|
||||||
txid: bitcoin::Txid::from_inner([0; 32]),
|
txid: bitcoin::Txid::from_slice(&[0; 32]).unwrap(),
|
||||||
vout: 1,
|
vout: 1,
|
||||||
},
|
},
|
||||||
txout: Default::default(),
|
txout: Default::default(),
|
||||||
|
@ -10,7 +10,7 @@
|
|||||||
// licenses.
|
// licenses.
|
||||||
|
|
||||||
use bitcoin::secp256k1::{All, Secp256k1};
|
use bitcoin::secp256k1::{All, Secp256k1};
|
||||||
use bitcoin::{LockTime, Script, Sequence};
|
use bitcoin::{absolute, Script, Sequence};
|
||||||
|
|
||||||
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
use miniscript::{MiniscriptKey, Satisfier, ToPublicKey};
|
||||||
|
|
||||||
@ -65,7 +65,7 @@ pub(crate) fn check_nsequence_rbf(rbf: Sequence, csv: Sequence) -> bool {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
impl<Pk: MiniscriptKey + ToPublicKey> Satisfier<Pk> for After {
|
||||||
fn check_after(&self, n: LockTime) -> bool {
|
fn check_after(&self, n: absolute::LockTime) -> bool {
|
||||||
if let Some(current_height) = self.current_height {
|
if let Some(current_height) = self.current_height {
|
||||||
current_height >= n.to_consensus_u32()
|
current_height >= n.to_consensus_u32()
|
||||||
} else {
|
} else {
|
||||||
@ -114,17 +114,20 @@ pub(crate) type SecpCtx = Secp256k1<All>;
|
|||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
mod test {
|
mod test {
|
||||||
|
use std::str::FromStr;
|
||||||
|
|
||||||
// When nSequence is lower than this flag the timelock is interpreted as block-height-based,
|
// When nSequence is lower than this flag the timelock is interpreted as block-height-based,
|
||||||
// otherwise it's time-based
|
// otherwise it's time-based
|
||||||
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
pub(crate) const SEQUENCE_LOCKTIME_TYPE_FLAG: u32 = 1 << 22;
|
||||||
|
|
||||||
use super::{check_nsequence_rbf, IsDust};
|
use super::{check_nsequence_rbf, IsDust};
|
||||||
use crate::bitcoin::{Address, Sequence};
|
use crate::bitcoin::{Address, Network, Sequence};
|
||||||
use std::str::FromStr;
|
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_is_dust() {
|
fn test_is_dust() {
|
||||||
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
let script_p2pkh = Address::from_str("1GNgwA8JfG7Kc8akJ8opdNWJUihqUztfPe")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2pkh.is_p2pkh());
|
assert!(script_p2pkh.is_p2pkh());
|
||||||
@ -132,6 +135,8 @@ mod test {
|
|||||||
assert!(!546.is_dust(&script_p2pkh));
|
assert!(!546.is_dust(&script_p2pkh));
|
||||||
|
|
||||||
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
let script_p2wpkh = Address::from_str("bc1qxlh2mnc0yqwas76gqq665qkggee5m98t8yskd8")
|
||||||
|
.unwrap()
|
||||||
|
.require_network(Network::Bitcoin)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.script_pubkey();
|
.script_pubkey();
|
||||||
assert!(script_p2wpkh.is_v0_p2wpkh());
|
assert!(script_p2wpkh.is_v0_p2wpkh());
|
||||||
|
Loading…
x
Reference in New Issue
Block a user