2021-03-03 13:22:05 -08:00
|
|
|
// Bitcoin Dev Kit
|
|
|
|
// Written in 2020 by Alekos Filini <alekos.filini@gmail.com>
|
2020-09-18 16:31:03 +02:00
|
|
|
//
|
2021-03-03 13:22:05 -08:00
|
|
|
// Copyright (c) 2020-2021 Bitcoin Dev Kit Developers
|
2020-09-18 16:31:03 +02:00
|
|
|
//
|
2021-03-03 13:22:05 -08:00
|
|
|
// This file is licensed under the Apache License, Version 2.0 <LICENSE-APACHE
|
|
|
|
// or http://www.apache.org/licenses/LICENSE-2.0> or the MIT license
|
|
|
|
// <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your option.
|
|
|
|
// You may not use this file except in accordance with one or both of these
|
|
|
|
// licenses.
|
2020-09-18 16:31:03 +02:00
|
|
|
|
|
|
|
//! Key formats
|
|
|
|
|
2023-01-10 15:10:02 +11:00
|
|
|
use crate::collections::HashSet;
|
|
|
|
use alloc::string::{String, ToString};
|
|
|
|
use alloc::vec::Vec;
|
|
|
|
use core::any::TypeId;
|
2023-03-15 11:44:52 -05:00
|
|
|
use core::fmt;
|
2023-01-10 15:10:02 +11:00
|
|
|
use core::marker::PhantomData;
|
|
|
|
use core::ops::Deref;
|
|
|
|
use core::str::FromStr;
|
2020-09-19 12:08:30 +02:00
|
|
|
|
2021-01-26 11:48:44 -05:00
|
|
|
use bitcoin::secp256k1::{self, Secp256k1, Signing};
|
2020-11-13 16:43:04 +01:00
|
|
|
|
2023-07-19 15:27:48 +02:00
|
|
|
use bitcoin::bip32;
|
|
|
|
use bitcoin::{key::XOnlyPublicKey, Network, PrivateKey, PublicKey};
|
2020-09-18 16:31:03 +02:00
|
|
|
|
2021-02-02 20:06:40 -05:00
|
|
|
use miniscript::descriptor::{Descriptor, DescriptorXKey, Wildcard};
|
2020-10-09 12:03:47 +02:00
|
|
|
pub use miniscript::descriptor::{
|
2022-10-25 11:15:43 +02:00
|
|
|
DescriptorPublicKey, DescriptorSecretKey, KeyMap, SinglePriv, SinglePub, SinglePubKey,
|
|
|
|
SortedMultiVec,
|
2020-10-09 12:03:47 +02:00
|
|
|
};
|
2020-09-19 12:08:30 +02:00
|
|
|
pub use miniscript::ScriptContext;
|
|
|
|
use miniscript::{Miniscript, Terminal};
|
2020-09-18 16:31:03 +02:00
|
|
|
|
2021-01-11 13:12:01 +01:00
|
|
|
use crate::descriptor::{CheckMiniscript, DescriptorError};
|
2020-11-16 22:07:38 +01:00
|
|
|
use crate::wallet::utils::SecpCtx;
|
|
|
|
|
2020-09-18 17:26:58 +02:00
|
|
|
#[cfg(feature = "keys-bip39")]
|
|
|
|
#[cfg_attr(docsrs, doc(cfg(feature = "keys-bip39")))]
|
|
|
|
pub mod bip39;
|
|
|
|
|
2020-09-21 15:44:07 +02:00
|
|
|
/// Set of valid networks for a key
|
|
|
|
pub type ValidNetworks = HashSet<Network>;
|
|
|
|
|
2023-01-19 15:03:37 -05:00
|
|
|
/// Create a set containing mainnet, testnet, signet, and regtest
|
2020-09-21 15:44:07 +02:00
|
|
|
pub fn any_network() -> ValidNetworks {
|
2021-02-05 10:23:17 -05:00
|
|
|
vec![
|
|
|
|
Network::Bitcoin,
|
|
|
|
Network::Testnet,
|
|
|
|
Network::Regtest,
|
|
|
|
Network::Signet,
|
|
|
|
]
|
|
|
|
.into_iter()
|
|
|
|
.collect()
|
2020-09-21 15:44:07 +02:00
|
|
|
}
|
|
|
|
/// Create a set only containing mainnet
|
|
|
|
pub fn mainnet_network() -> ValidNetworks {
|
|
|
|
vec![Network::Bitcoin].into_iter().collect()
|
|
|
|
}
|
|
|
|
/// Create a set containing testnet and regtest
|
|
|
|
pub fn test_networks() -> ValidNetworks {
|
2021-02-05 10:23:17 -05:00
|
|
|
vec![Network::Testnet, Network::Regtest, Network::Signet]
|
2020-09-21 15:44:07 +02:00
|
|
|
.into_iter()
|
|
|
|
.collect()
|
|
|
|
}
|
|
|
|
/// Compute the intersection of two sets
|
|
|
|
pub fn merge_networks(a: &ValidNetworks, b: &ValidNetworks) -> ValidNetworks {
|
|
|
|
a.intersection(b).cloned().collect()
|
|
|
|
}
|
|
|
|
|
2020-09-18 17:26:58 +02:00
|
|
|
/// Container for public or secret keys
|
2020-10-12 09:09:25 -07:00
|
|
|
#[derive(Debug)]
|
2020-09-19 12:08:30 +02:00
|
|
|
pub enum DescriptorKey<Ctx: ScriptContext> {
|
2020-09-21 15:44:07 +02:00
|
|
|
#[doc(hidden)]
|
|
|
|
Public(DescriptorPublicKey, ValidNetworks, PhantomData<Ctx>),
|
|
|
|
#[doc(hidden)]
|
|
|
|
Secret(DescriptorSecretKey, ValidNetworks, PhantomData<Ctx>),
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
|
2020-09-19 12:08:30 +02:00
|
|
|
impl<Ctx: ScriptContext> DescriptorKey<Ctx> {
|
2020-09-21 15:44:07 +02:00
|
|
|
/// Create an instance given a public key and a set of valid networks
|
|
|
|
pub fn from_public(public: DescriptorPublicKey, networks: ValidNetworks) -> Self {
|
|
|
|
DescriptorKey::Public(public, networks, PhantomData)
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Create an instance given a secret key and a set of valid networks
|
|
|
|
pub fn from_secret(secret: DescriptorSecretKey, networks: ValidNetworks) -> Self {
|
|
|
|
DescriptorKey::Secret(secret, networks, PhantomData)
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Override the computed set of valid networks
|
|
|
|
pub fn override_valid_networks(self, networks: ValidNetworks) -> Self {
|
|
|
|
match self {
|
|
|
|
DescriptorKey::Public(key, _, _) => DescriptorKey::Public(key, networks, PhantomData),
|
|
|
|
DescriptorKey::Secret(key, _, _) => DescriptorKey::Secret(key, networks, PhantomData),
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2024-02-06 08:56:31 -06:00
|
|
|
// This method is used internally by `bdk_wallet::fragment!` and `bdk_wallet::descriptor!`. It has to be
|
2023-01-19 15:03:37 -05:00
|
|
|
// public because it is effectively called by external crates once the macros are expanded,
|
2020-09-19 12:08:30 +02:00
|
|
|
// but since it is not meant to be part of the public api we hide it from the docs.
|
2020-09-18 16:31:03 +02:00
|
|
|
#[doc(hidden)]
|
2020-11-16 22:07:38 +01:00
|
|
|
pub fn extract(
|
|
|
|
self,
|
|
|
|
secp: &SecpCtx,
|
|
|
|
) -> Result<(DescriptorPublicKey, KeyMap, ValidNetworks), KeyError> {
|
2020-09-18 16:31:03 +02:00
|
|
|
match self {
|
2020-09-21 15:44:07 +02:00
|
|
|
DescriptorKey::Public(public, valid_networks, _) => {
|
|
|
|
Ok((public, KeyMap::default(), valid_networks))
|
|
|
|
}
|
|
|
|
DescriptorKey::Secret(secret, valid_networks, _) => {
|
2023-10-16 19:51:53 +11:00
|
|
|
let mut key_map = KeyMap::new();
|
2020-09-18 16:31:03 +02:00
|
|
|
|
|
|
|
let public = secret
|
2022-10-25 11:15:43 +02:00
|
|
|
.to_public(secp)
|
2020-09-18 16:31:03 +02:00
|
|
|
.map_err(|e| miniscript::Error::Unexpected(e.to_string()))?;
|
|
|
|
key_map.insert(public.clone(), secret);
|
|
|
|
|
2020-09-21 15:44:07 +02:00
|
|
|
Ok((public, key_map, valid_networks))
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-21 15:44:07 +02:00
|
|
|
/// Enum representation of the known valid [`ScriptContext`]s
|
2020-09-19 12:08:30 +02:00
|
|
|
#[derive(Debug, Eq, PartialEq, Copy, Clone)]
|
|
|
|
pub enum ScriptContextEnum {
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Legacy scripts
|
2020-09-19 12:08:30 +02:00
|
|
|
Legacy,
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Segwitv0 scripts
|
2020-09-19 12:08:30 +02:00
|
|
|
Segwitv0,
|
2022-04-14 17:20:46 +02:00
|
|
|
/// Taproot scripts
|
|
|
|
Tap,
|
2020-09-19 12:08:30 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
impl ScriptContextEnum {
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Returns whether the script context is [`ScriptContextEnum::Legacy`]
|
2020-09-19 12:08:30 +02:00
|
|
|
pub fn is_legacy(&self) -> bool {
|
|
|
|
self == &ScriptContextEnum::Legacy
|
|
|
|
}
|
|
|
|
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Returns whether the script context is [`ScriptContextEnum::Segwitv0`]
|
2020-09-19 12:08:30 +02:00
|
|
|
pub fn is_segwit_v0(&self) -> bool {
|
|
|
|
self == &ScriptContextEnum::Segwitv0
|
|
|
|
}
|
2022-04-14 17:20:46 +02:00
|
|
|
|
|
|
|
/// Returns whether the script context is [`ScriptContextEnum::Tap`]
|
|
|
|
pub fn is_taproot(&self) -> bool {
|
|
|
|
self == &ScriptContextEnum::Tap
|
|
|
|
}
|
2020-09-19 12:08:30 +02:00
|
|
|
}
|
|
|
|
|
2020-09-21 15:44:07 +02:00
|
|
|
/// Trait that adds extra useful methods to [`ScriptContext`]s
|
2020-09-19 12:08:30 +02:00
|
|
|
pub trait ExtScriptContext: ScriptContext {
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Returns the [`ScriptContext`] as a [`ScriptContextEnum`]
|
2020-09-19 12:08:30 +02:00
|
|
|
fn as_enum() -> ScriptContextEnum;
|
|
|
|
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Returns whether the script context is [`Legacy`](miniscript::Legacy)
|
2020-09-19 12:08:30 +02:00
|
|
|
fn is_legacy() -> bool {
|
|
|
|
Self::as_enum().is_legacy()
|
|
|
|
}
|
|
|
|
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Returns whether the script context is [`Segwitv0`](miniscript::Segwitv0)
|
2020-09-19 12:08:30 +02:00
|
|
|
fn is_segwit_v0() -> bool {
|
|
|
|
Self::as_enum().is_segwit_v0()
|
|
|
|
}
|
2022-04-14 17:20:46 +02:00
|
|
|
|
|
|
|
/// Returns whether the script context is [`Tap`](miniscript::Tap), aka Taproot or Segwit V1
|
|
|
|
fn is_taproot() -> bool {
|
|
|
|
Self::as_enum().is_taproot()
|
|
|
|
}
|
2020-09-19 12:08:30 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
impl<Ctx: ScriptContext + 'static> ExtScriptContext for Ctx {
|
|
|
|
fn as_enum() -> ScriptContextEnum {
|
|
|
|
match TypeId::of::<Ctx>() {
|
|
|
|
t if t == TypeId::of::<miniscript::Legacy>() => ScriptContextEnum::Legacy,
|
|
|
|
t if t == TypeId::of::<miniscript::Segwitv0>() => ScriptContextEnum::Segwitv0,
|
2022-04-14 17:20:46 +02:00
|
|
|
t if t == TypeId::of::<miniscript::Tap>() => ScriptContextEnum::Tap,
|
2020-09-19 12:08:30 +02:00
|
|
|
_ => unimplemented!("Unknown ScriptContext type"),
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-18 17:26:58 +02:00
|
|
|
/// Trait for objects that can be turned into a public or secret [`DescriptorKey`]
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
|
|
|
/// The generic type `Ctx` is used to define the context in which the key is valid: some key
|
|
|
|
/// formats, like the mnemonics used by Electrum wallets, encode internally whether the wallet is
|
|
|
|
/// legacy or segwit. Thus, trying to turn a valid legacy mnemonic into a `DescriptorKey`
|
|
|
|
/// that would become part of a segwit descriptor should fail.
|
|
|
|
///
|
|
|
|
/// For key types that do care about this, the [`ExtScriptContext`] trait provides some useful
|
|
|
|
/// methods that can be used to check at runtime which `Ctx` is being used.
|
|
|
|
///
|
2020-09-21 15:44:07 +02:00
|
|
|
/// For key types that can do this check statically (because they can only work within a
|
2020-09-19 12:08:30 +02:00
|
|
|
/// single `Ctx`), the "specialized" trait can be implemented to make the compiler handle the type
|
|
|
|
/// checking.
|
|
|
|
///
|
2020-09-22 16:12:09 +02:00
|
|
|
/// Keys also have control over the networks they support: constructing the return object with
|
|
|
|
/// [`DescriptorKey::from_public`] or [`DescriptorKey::from_secret`] allows to specify a set of
|
|
|
|
/// [`ValidNetworks`].
|
|
|
|
///
|
2020-09-19 12:08:30 +02:00
|
|
|
/// ## Examples
|
|
|
|
///
|
|
|
|
/// Key type valid in any context:
|
|
|
|
///
|
|
|
|
/// ```
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::bitcoin::PublicKey;
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::keys::{DescriptorKey, IntoDescriptorKey, KeyError, ScriptContext};
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
|
|
|
/// pub struct MyKeyType {
|
|
|
|
/// pubkey: PublicKey,
|
|
|
|
/// }
|
|
|
|
///
|
2021-02-12 23:02:13 -08:00
|
|
|
/// impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for MyKeyType {
|
2021-02-11 11:00:48 -08:00
|
|
|
/// fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
|
|
|
/// self.pubkey.into_descriptor_key()
|
2020-09-19 12:08:30 +02:00
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
/// ```
|
|
|
|
///
|
2020-09-22 16:12:09 +02:00
|
|
|
/// Key type that is only valid on mainnet:
|
|
|
|
///
|
|
|
|
/// ```
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::bitcoin::PublicKey;
|
2020-09-22 16:12:09 +02:00
|
|
|
///
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::keys::{
|
2022-10-25 11:15:43 +02:00
|
|
|
/// mainnet_network, DescriptorKey, DescriptorPublicKey, IntoDescriptorKey, KeyError,
|
|
|
|
/// ScriptContext, SinglePub, SinglePubKey,
|
2020-12-16 14:19:37 -08:00
|
|
|
/// };
|
2020-09-22 16:12:09 +02:00
|
|
|
///
|
|
|
|
/// pub struct MyKeyType {
|
|
|
|
/// pubkey: PublicKey,
|
|
|
|
/// }
|
|
|
|
///
|
2021-02-12 23:02:13 -08:00
|
|
|
/// impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for MyKeyType {
|
2021-02-11 11:00:48 -08:00
|
|
|
/// fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2020-12-16 14:19:37 -08:00
|
|
|
/// Ok(DescriptorKey::from_public(
|
2022-10-25 11:15:43 +02:00
|
|
|
/// DescriptorPublicKey::Single(SinglePub {
|
2020-12-16 14:19:37 -08:00
|
|
|
/// origin: None,
|
2022-04-14 17:20:46 +02:00
|
|
|
/// key: SinglePubKey::FullKey(self.pubkey),
|
2020-12-16 14:19:37 -08:00
|
|
|
/// }),
|
|
|
|
/// mainnet_network(),
|
|
|
|
/// ))
|
2020-09-22 16:12:09 +02:00
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
/// ```
|
|
|
|
///
|
2020-09-19 12:08:30 +02:00
|
|
|
/// Key type that internally encodes in which context it's valid. The context is checked at runtime:
|
|
|
|
///
|
|
|
|
/// ```
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::bitcoin::PublicKey;
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::keys::{
|
|
|
|
/// DescriptorKey, ExtScriptContext, IntoDescriptorKey, KeyError, ScriptContext,
|
|
|
|
/// };
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
|
|
|
/// pub struct MyKeyType {
|
|
|
|
/// is_legacy: bool,
|
|
|
|
/// pubkey: PublicKey,
|
|
|
|
/// }
|
|
|
|
///
|
2021-02-12 23:02:13 -08:00
|
|
|
/// impl<Ctx: ScriptContext + 'static> IntoDescriptorKey<Ctx> for MyKeyType {
|
2021-02-11 11:00:48 -08:00
|
|
|
/// fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2020-09-19 12:08:30 +02:00
|
|
|
/// if Ctx::is_legacy() == self.is_legacy {
|
2021-02-11 11:00:48 -08:00
|
|
|
/// self.pubkey.into_descriptor_key()
|
2020-09-19 12:08:30 +02:00
|
|
|
/// } else {
|
2020-09-21 15:44:07 +02:00
|
|
|
/// Err(KeyError::InvalidScriptContext)
|
2020-09-19 12:08:30 +02:00
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
/// ```
|
|
|
|
///
|
|
|
|
/// Key type that can only work within [`miniscript::Segwitv0`] context. Only the specialized version
|
|
|
|
/// of the trait is implemented.
|
|
|
|
///
|
|
|
|
/// This example deliberately fails to compile, to demonstrate how the compiler can catch when keys
|
|
|
|
/// are misused. In this case, the "segwit-only" key is used to build a `pkh()` descriptor, which
|
|
|
|
/// makes the compiler (correctly) fail.
|
|
|
|
///
|
|
|
|
/// ```compile_fail
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::bitcoin::PublicKey;
|
2023-01-10 15:10:02 +11:00
|
|
|
/// use core::str::FromStr;
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::keys::{DescriptorKey, IntoDescriptorKey, KeyError};
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
|
|
|
/// pub struct MySegwitOnlyKeyType {
|
|
|
|
/// pubkey: PublicKey,
|
|
|
|
/// }
|
|
|
|
///
|
2024-02-06 08:56:31 -06:00
|
|
|
/// impl IntoDescriptorKey<bdk_wallet::miniscript::Segwitv0> for MySegwitOnlyKeyType {
|
|
|
|
/// fn into_descriptor_key(self) -> Result<DescriptorKey<bdk_wallet::miniscript::Segwitv0>, KeyError> {
|
2021-02-11 11:00:48 -08:00
|
|
|
/// self.pubkey.into_descriptor_key()
|
2020-09-19 12:08:30 +02:00
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
///
|
|
|
|
/// let key = MySegwitOnlyKeyType {
|
|
|
|
/// pubkey: PublicKey::from_str("...")?,
|
|
|
|
/// };
|
2024-02-06 08:56:31 -06:00
|
|
|
/// let (descriptor, _, _) = bdk_wallet::descriptor!(pkh(key))?;
|
|
|
|
/// // ^^^^^ changing this to `wpkh` would make it compile
|
2020-09-19 12:08:30 +02:00
|
|
|
///
|
|
|
|
/// # Ok::<_, Box<dyn std::error::Error>>(())
|
|
|
|
/// ```
|
2021-02-12 23:02:13 -08:00
|
|
|
pub trait IntoDescriptorKey<Ctx: ScriptContext>: Sized {
|
2020-09-19 12:08:30 +02:00
|
|
|
/// Turn the key into a [`DescriptorKey`] within the requested [`ScriptContext`]
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError>;
|
2020-09-21 15:44:07 +02:00
|
|
|
}
|
2020-09-19 12:08:30 +02:00
|
|
|
|
2021-01-26 11:48:44 -05:00
|
|
|
/// Enum for extended keys that can be either `xprv` or `xpub`
|
|
|
|
///
|
2023-10-16 19:51:53 +11:00
|
|
|
/// An instance of [`ExtendedKey`] can be constructed from an [`Xpriv`](bip32::Xpriv)
|
|
|
|
/// or an [`Xpub`](bip32::Xpub) by using the `From` trait.
|
2021-01-26 11:48:44 -05:00
|
|
|
///
|
|
|
|
/// Defaults to the [`Legacy`](miniscript::Legacy) context.
|
|
|
|
pub enum ExtendedKey<Ctx: ScriptContext = miniscript::Legacy> {
|
|
|
|
/// A private extended key, aka an `xprv`
|
2023-10-16 19:51:53 +11:00
|
|
|
Private((bip32::Xpriv, PhantomData<Ctx>)),
|
2021-01-26 11:48:44 -05:00
|
|
|
/// A public extended key, aka an `xpub`
|
2023-10-16 19:51:53 +11:00
|
|
|
Public((bip32::Xpub, PhantomData<Ctx>)),
|
2021-01-26 11:48:44 -05:00
|
|
|
}
|
|
|
|
|
|
|
|
impl<Ctx: ScriptContext> ExtendedKey<Ctx> {
|
|
|
|
/// Return whether or not the key contains the private data
|
|
|
|
pub fn has_secret(&self) -> bool {
|
|
|
|
match self {
|
|
|
|
ExtendedKey::Private(_) => true,
|
|
|
|
ExtendedKey::Public(_) => false,
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
/// Transform the [`ExtendedKey`] into an [`Xpriv`](bip32::Xpriv) for the
|
2021-01-26 11:48:44 -05:00
|
|
|
/// given [`Network`], if the key contains the private data
|
2023-10-16 19:51:53 +11:00
|
|
|
pub fn into_xprv(self, network: Network) -> Option<bip32::Xpriv> {
|
2021-01-26 11:48:44 -05:00
|
|
|
match self {
|
|
|
|
ExtendedKey::Private((mut xprv, _)) => {
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
xprv.network = network.into();
|
2021-01-26 11:48:44 -05:00
|
|
|
Some(xprv)
|
|
|
|
}
|
|
|
|
ExtendedKey::Public(_) => None,
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
/// Transform the [`ExtendedKey`] into an [`Xpub`](bip32::Xpub) for the
|
2021-01-26 11:48:44 -05:00
|
|
|
/// given [`Network`]
|
|
|
|
pub fn into_xpub<C: Signing>(
|
|
|
|
self,
|
|
|
|
network: bitcoin::Network,
|
|
|
|
secp: &Secp256k1<C>,
|
2023-10-16 19:51:53 +11:00
|
|
|
) -> bip32::Xpub {
|
2021-01-26 11:48:44 -05:00
|
|
|
let mut xpub = match self {
|
2023-10-16 19:51:53 +11:00
|
|
|
ExtendedKey::Private((xprv, _)) => bip32::Xpub::from_priv(secp, &xprv),
|
2021-01-26 11:48:44 -05:00
|
|
|
ExtendedKey::Public((xpub, _)) => xpub,
|
|
|
|
};
|
|
|
|
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
xpub.network = network.into();
|
2021-01-26 11:48:44 -05:00
|
|
|
xpub
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
impl<Ctx: ScriptContext> From<bip32::Xpub> for ExtendedKey<Ctx> {
|
|
|
|
fn from(xpub: bip32::Xpub) -> Self {
|
2021-01-26 11:48:44 -05:00
|
|
|
ExtendedKey::Public((xpub, PhantomData))
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
impl<Ctx: ScriptContext> From<bip32::Xpriv> for ExtendedKey<Ctx> {
|
|
|
|
fn from(xprv: bip32::Xpriv) -> Self {
|
2021-01-26 11:48:44 -05:00
|
|
|
ExtendedKey::Private((xprv, PhantomData))
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-22 16:12:09 +02:00
|
|
|
/// Trait for keys that can be derived.
|
|
|
|
///
|
2021-11-23 13:40:58 -05:00
|
|
|
/// When extra metadata are provided, a [`DerivableKey`] can be transformed into a
|
2021-02-12 23:02:13 -08:00
|
|
|
/// [`DescriptorKey`]: the trait [`IntoDescriptorKey`] is automatically implemented
|
2020-09-22 16:12:09 +02:00
|
|
|
/// for `(DerivableKey, DerivationPath)` and
|
2020-12-11 11:14:30 +01:00
|
|
|
/// `(DerivableKey, KeySource, DerivationPath)` tuples.
|
2020-09-22 16:12:09 +02:00
|
|
|
///
|
|
|
|
/// For key types that don't encode any indication about the path to use (like bip39), it's
|
2023-01-19 15:03:37 -05:00
|
|
|
/// generally recommended to implement this trait instead of [`IntoDescriptorKey`]. The same
|
2020-09-22 16:12:09 +02:00
|
|
|
/// rules regarding script context and valid networks apply.
|
|
|
|
///
|
2021-01-26 11:48:44 -05:00
|
|
|
/// ## Examples
|
|
|
|
///
|
2023-10-16 19:51:53 +11:00
|
|
|
/// Key types that can be directly converted into an [`Xpriv`] or
|
|
|
|
/// an [`Xpub`] can implement only the required `into_extended_key()` method.
|
2021-01-26 11:48:44 -05:00
|
|
|
///
|
|
|
|
/// ```
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::bitcoin;
|
|
|
|
/// use bdk_wallet::bitcoin::bip32;
|
|
|
|
/// use bdk_wallet::keys::{DerivableKey, ExtendedKey, KeyError, ScriptContext};
|
2021-01-26 11:48:44 -05:00
|
|
|
///
|
|
|
|
/// struct MyCustomKeyType {
|
|
|
|
/// key_data: bitcoin::PrivateKey,
|
2023-07-19 15:27:48 +02:00
|
|
|
/// chain_code: [u8; 32],
|
2021-01-26 11:48:44 -05:00
|
|
|
/// network: bitcoin::Network,
|
|
|
|
/// }
|
|
|
|
///
|
|
|
|
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
|
|
|
/// fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError> {
|
2023-10-16 19:51:53 +11:00
|
|
|
/// let xprv = bip32::Xpriv {
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
/// network: self.network.into(),
|
2021-01-26 11:48:44 -05:00
|
|
|
/// depth: 0,
|
|
|
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
2022-04-14 17:20:46 +02:00
|
|
|
/// private_key: self.key_data.inner,
|
2023-07-19 15:27:48 +02:00
|
|
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
2021-01-26 11:48:44 -05:00
|
|
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
|
|
|
/// };
|
|
|
|
///
|
|
|
|
/// xprv.into_extended_key()
|
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
/// ```
|
|
|
|
///
|
2023-11-16 10:22:37 -06:00
|
|
|
/// Types that don't internally encode the [`Network`] in which they are valid need some extra
|
2021-01-26 11:48:44 -05:00
|
|
|
/// steps to override the set of valid networks, otherwise only the network specified in the
|
2023-10-16 19:51:53 +11:00
|
|
|
/// [`Xpriv`] or [`Xpub`] will be considered valid.
|
2021-01-26 11:48:44 -05:00
|
|
|
///
|
|
|
|
/// ```
|
2024-02-06 08:56:31 -06:00
|
|
|
/// use bdk_wallet::bitcoin;
|
|
|
|
/// use bdk_wallet::bitcoin::bip32;
|
|
|
|
/// use bdk_wallet::keys::{
|
2021-01-26 11:48:44 -05:00
|
|
|
/// any_network, DerivableKey, DescriptorKey, ExtendedKey, KeyError, ScriptContext,
|
|
|
|
/// };
|
|
|
|
///
|
|
|
|
/// struct MyCustomKeyType {
|
|
|
|
/// key_data: bitcoin::PrivateKey,
|
2023-07-19 15:27:48 +02:00
|
|
|
/// chain_code: [u8; 32],
|
2021-01-26 11:48:44 -05:00
|
|
|
/// }
|
|
|
|
///
|
|
|
|
/// impl<Ctx: ScriptContext> DerivableKey<Ctx> for MyCustomKeyType {
|
|
|
|
/// fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError> {
|
2023-10-16 19:51:53 +11:00
|
|
|
/// let xprv = bip32::Xpriv {
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
/// network: bitcoin::Network::Bitcoin.into(), // pick an arbitrary network here
|
2021-01-26 11:48:44 -05:00
|
|
|
/// depth: 0,
|
|
|
|
/// parent_fingerprint: bip32::Fingerprint::default(),
|
2022-04-14 17:20:46 +02:00
|
|
|
/// private_key: self.key_data.inner,
|
2023-07-19 15:27:48 +02:00
|
|
|
/// chain_code: bip32::ChainCode::from(&self.chain_code),
|
2021-01-26 11:48:44 -05:00
|
|
|
/// child_number: bip32::ChildNumber::Normal { index: 0 },
|
|
|
|
/// };
|
|
|
|
///
|
|
|
|
/// xprv.into_extended_key()
|
|
|
|
/// }
|
|
|
|
///
|
|
|
|
/// fn into_descriptor_key(
|
|
|
|
/// self,
|
|
|
|
/// source: Option<bip32::KeySource>,
|
|
|
|
/// derivation_path: bip32::DerivationPath,
|
|
|
|
/// ) -> Result<DescriptorKey<Ctx>, KeyError> {
|
|
|
|
/// let descriptor_key = self
|
|
|
|
/// .into_extended_key()?
|
|
|
|
/// .into_descriptor_key(source, derivation_path)?;
|
|
|
|
///
|
|
|
|
/// // Override the set of valid networks here
|
|
|
|
/// Ok(descriptor_key.override_valid_networks(any_network()))
|
|
|
|
/// }
|
|
|
|
/// }
|
|
|
|
/// ```
|
|
|
|
///
|
2020-09-22 16:12:09 +02:00
|
|
|
/// [`DerivationPath`]: (bip32::DerivationPath)
|
2023-10-16 19:51:53 +11:00
|
|
|
/// [`Xpriv`]: (bip32::Xpriv)
|
|
|
|
/// [`Xpub`]: (bip32::Xpub)
|
2021-01-26 11:48:44 -05:00
|
|
|
pub trait DerivableKey<Ctx: ScriptContext = miniscript::Legacy>: Sized {
|
|
|
|
/// Consume `self` and turn it into an [`ExtendedKey`]
|
|
|
|
#[cfg_attr(
|
|
|
|
feature = "keys-bip39",
|
|
|
|
doc = r##"
|
2023-02-21 17:34:53 +11:00
|
|
|
This can be used to get direct access to `xprv`s and `xpub`s for types that implement this trait,
|
|
|
|
like [`Mnemonic`](bip39::Mnemonic) when the `keys-bip39` feature is enabled.
|
2021-01-26 11:48:44 -05:00
|
|
|
```rust
|
2024-02-06 08:56:31 -06:00
|
|
|
use bdk_wallet::bitcoin::Network;
|
|
|
|
use bdk_wallet::keys::{DerivableKey, ExtendedKey};
|
|
|
|
use bdk_wallet::keys::bip39::{Mnemonic, Language};
|
2021-01-26 11:48:44 -05:00
|
|
|
|
|
|
|
# fn main() -> Result<(), Box<dyn std::error::Error>> {
|
|
|
|
let xkey: ExtendedKey =
|
2021-11-02 15:41:51 +05:30
|
|
|
Mnemonic::parse_in(
|
|
|
|
Language::English,
|
2021-01-26 11:48:44 -05:00
|
|
|
"jelly crash boy whisper mouse ecology tuna soccer memory million news short",
|
|
|
|
)?
|
|
|
|
.into_extended_key()?;
|
|
|
|
let xprv = xkey.into_xprv(Network::Bitcoin).unwrap();
|
|
|
|
# Ok(()) }
|
|
|
|
```
|
|
|
|
"##
|
|
|
|
)]
|
|
|
|
fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError>;
|
|
|
|
|
|
|
|
/// Consume `self` and turn it into a [`DescriptorKey`] by adding the extra metadata, such as
|
|
|
|
/// key origin and derivation path
|
|
|
|
fn into_descriptor_key(
|
2020-09-22 16:12:09 +02:00
|
|
|
self,
|
2020-12-11 11:14:30 +01:00
|
|
|
origin: Option<bip32::KeySource>,
|
2020-09-22 16:12:09 +02:00
|
|
|
derivation_path: bip32::DerivationPath,
|
2021-01-26 11:48:44 -05:00
|
|
|
) -> Result<DescriptorKey<Ctx>, KeyError> {
|
|
|
|
match self.into_extended_key()? {
|
|
|
|
ExtendedKey::Private((xprv, _)) => DescriptorSecretKey::XPrv(DescriptorXKey {
|
|
|
|
origin,
|
|
|
|
xkey: xprv,
|
|
|
|
derivation_path,
|
2021-02-02 20:06:40 -05:00
|
|
|
wildcard: Wildcard::Unhardened,
|
2021-01-26 11:48:44 -05:00
|
|
|
})
|
2021-02-11 11:00:48 -08:00
|
|
|
.into_descriptor_key(),
|
2021-01-26 11:48:44 -05:00
|
|
|
ExtendedKey::Public((xpub, _)) => DescriptorPublicKey::XPub(DescriptorXKey {
|
|
|
|
origin,
|
|
|
|
xkey: xpub,
|
|
|
|
derivation_path,
|
2021-02-02 20:06:40 -05:00
|
|
|
wildcard: Wildcard::Unhardened,
|
2021-01-26 11:48:44 -05:00
|
|
|
})
|
2021-02-11 11:00:48 -08:00
|
|
|
.into_descriptor_key(),
|
2021-01-26 11:48:44 -05:00
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Identity conversion
|
|
|
|
impl<Ctx: ScriptContext> DerivableKey<Ctx> for ExtendedKey<Ctx> {
|
|
|
|
fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError> {
|
|
|
|
Ok(self)
|
|
|
|
}
|
2020-09-22 16:12:09 +02:00
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
impl<Ctx: ScriptContext> DerivableKey<Ctx> for bip32::Xpub {
|
2021-01-26 11:48:44 -05:00
|
|
|
fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError> {
|
|
|
|
Ok(self.into())
|
2020-09-22 16:12:09 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
impl<Ctx: ScriptContext> DerivableKey<Ctx> for bip32::Xpriv {
|
2021-01-26 11:48:44 -05:00
|
|
|
fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError> {
|
|
|
|
Ok(self.into())
|
2020-09-22 16:12:09 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-24 09:52:59 +02:00
|
|
|
/// Output of a [`GeneratableKey`] key generation
|
|
|
|
pub struct GeneratedKey<K, Ctx: ScriptContext> {
|
|
|
|
key: K,
|
|
|
|
valid_networks: ValidNetworks,
|
|
|
|
phantom: PhantomData<Ctx>,
|
|
|
|
}
|
|
|
|
|
|
|
|
impl<K, Ctx: ScriptContext> GeneratedKey<K, Ctx> {
|
2020-12-10 11:39:01 +01:00
|
|
|
fn new(key: K, valid_networks: ValidNetworks) -> Self {
|
2020-09-24 09:52:59 +02:00
|
|
|
GeneratedKey {
|
|
|
|
key,
|
|
|
|
valid_networks,
|
|
|
|
phantom: PhantomData,
|
|
|
|
}
|
|
|
|
}
|
2020-11-13 17:27:36 +01:00
|
|
|
|
|
|
|
/// Consumes `self` and returns the key
|
|
|
|
pub fn into_key(self) -> K {
|
|
|
|
self.key
|
|
|
|
}
|
2020-09-24 09:52:59 +02:00
|
|
|
}
|
|
|
|
|
|
|
|
impl<K, Ctx: ScriptContext> Deref for GeneratedKey<K, Ctx> {
|
|
|
|
type Target = K;
|
|
|
|
|
|
|
|
fn deref(&self) -> &Self::Target {
|
|
|
|
&self.key
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2022-04-13 12:55:23 +02:00
|
|
|
impl<K: Clone, Ctx: ScriptContext> Clone for GeneratedKey<K, Ctx> {
|
|
|
|
fn clone(&self) -> GeneratedKey<K, Ctx> {
|
|
|
|
GeneratedKey {
|
|
|
|
key: self.key.clone(),
|
|
|
|
valid_networks: self.valid_networks.clone(),
|
|
|
|
phantom: self.phantom,
|
|
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-11-13 17:27:36 +01:00
|
|
|
// Make generated "derivable" keys themselves "derivable". Also make sure they are assigned the
|
|
|
|
// right `valid_networks`.
|
2020-09-24 09:52:59 +02:00
|
|
|
impl<Ctx, K> DerivableKey<Ctx> for GeneratedKey<K, Ctx>
|
|
|
|
where
|
|
|
|
Ctx: ScriptContext,
|
2020-11-13 17:27:36 +01:00
|
|
|
K: DerivableKey<Ctx>,
|
2020-09-24 09:52:59 +02:00
|
|
|
{
|
2021-01-26 11:48:44 -05:00
|
|
|
fn into_extended_key(self) -> Result<ExtendedKey<Ctx>, KeyError> {
|
|
|
|
self.key.into_extended_key()
|
|
|
|
}
|
|
|
|
|
|
|
|
fn into_descriptor_key(
|
2020-09-24 09:52:59 +02:00
|
|
|
self,
|
2020-12-11 11:14:30 +01:00
|
|
|
origin: Option<bip32::KeySource>,
|
2020-09-24 09:52:59 +02:00
|
|
|
derivation_path: bip32::DerivationPath,
|
|
|
|
) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2021-01-26 11:48:44 -05:00
|
|
|
let descriptor_key = self.key.into_descriptor_key(origin, derivation_path)?;
|
2020-09-24 09:52:59 +02:00
|
|
|
Ok(descriptor_key.override_valid_networks(self.valid_networks))
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-11-13 17:27:36 +01:00
|
|
|
// Make generated keys directly usable in descriptors, and make sure they get assigned the right
|
|
|
|
// `valid_networks`.
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx, K> IntoDescriptorKey<Ctx> for GeneratedKey<K, Ctx>
|
2020-11-13 17:27:36 +01:00
|
|
|
where
|
|
|
|
Ctx: ScriptContext,
|
2021-02-12 23:02:13 -08:00
|
|
|
K: IntoDescriptorKey<Ctx>,
|
2020-11-13 17:27:36 +01:00
|
|
|
{
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
|
|
|
let desc_key = self.key.into_descriptor_key()?;
|
2020-11-13 17:27:36 +01:00
|
|
|
Ok(desc_key.override_valid_networks(self.valid_networks))
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-24 09:52:59 +02:00
|
|
|
/// Trait for keys that can be generated
|
|
|
|
///
|
2021-02-12 23:02:13 -08:00
|
|
|
/// The same rules about [`ScriptContext`] and [`ValidNetworks`] from [`IntoDescriptorKey`] apply.
|
2020-09-24 09:52:59 +02:00
|
|
|
///
|
|
|
|
/// This trait is particularly useful when combined with [`DerivableKey`]: if `Self`
|
2020-11-13 17:27:36 +01:00
|
|
|
/// implements it, the returned [`GeneratedKey`] will also implement it. The same is true for
|
2021-02-12 23:02:13 -08:00
|
|
|
/// [`IntoDescriptorKey`]: the generated keys can be directly used in descriptors if `Self` is also
|
|
|
|
/// [`IntoDescriptorKey`].
|
2020-09-24 09:52:59 +02:00
|
|
|
pub trait GeneratableKey<Ctx: ScriptContext>: Sized {
|
2021-01-04 16:20:47 -08:00
|
|
|
/// Type specifying the amount of entropy required e.g. `[u8;32]`
|
2020-09-30 08:17:49 +10:00
|
|
|
type Entropy: AsMut<[u8]> + Default;
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
/// Extra options required by the `generate_with_entropy`
|
|
|
|
type Options;
|
|
|
|
/// Returned error in case of failure
|
2023-01-10 15:10:02 +11:00
|
|
|
type Error: core::fmt::Debug;
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
/// Generate a key given the extra options and the entropy
|
2020-09-30 08:17:49 +10:00
|
|
|
fn generate_with_entropy(
|
2020-09-24 09:52:59 +02:00
|
|
|
options: Self::Options,
|
2020-09-30 08:17:49 +10:00
|
|
|
entropy: Self::Entropy,
|
2020-09-24 09:52:59 +02:00
|
|
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error>;
|
|
|
|
|
|
|
|
/// Generate a key given the options with a random entropy
|
|
|
|
fn generate(options: Self::Options) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
|
|
|
use rand::{thread_rng, Rng};
|
|
|
|
|
2020-09-30 08:17:49 +10:00
|
|
|
let mut entropy = Self::Entropy::default();
|
|
|
|
thread_rng().fill(entropy.as_mut());
|
|
|
|
Self::generate_with_entropy(options, entropy)
|
2020-09-24 09:52:59 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-11-13 17:43:57 +01:00
|
|
|
/// Trait that allows generating a key with the default options
|
|
|
|
///
|
|
|
|
/// This trait is automatically implemented if the [`GeneratableKey::Options`] implements [`Default`].
|
|
|
|
pub trait GeneratableDefaultOptions<Ctx>: GeneratableKey<Ctx>
|
|
|
|
where
|
|
|
|
Ctx: ScriptContext,
|
|
|
|
<Self as GeneratableKey<Ctx>>::Options: Default,
|
|
|
|
{
|
|
|
|
/// Generate a key with the default options and a given entropy
|
|
|
|
fn generate_with_entropy_default(
|
|
|
|
entropy: Self::Entropy,
|
|
|
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
|
|
|
Self::generate_with_entropy(Default::default(), entropy)
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Generate a key with the default options and a random entropy
|
|
|
|
fn generate_default() -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
|
|
|
Self::generate(Default::default())
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
/// Automatic implementation of [`GeneratableDefaultOptions`] for [`GeneratableKey`]s where
|
|
|
|
/// `Options` implements `Default`
|
|
|
|
impl<Ctx, K> GeneratableDefaultOptions<Ctx> for K
|
|
|
|
where
|
|
|
|
Ctx: ScriptContext,
|
|
|
|
K: GeneratableKey<Ctx>,
|
|
|
|
<K as GeneratableKey<Ctx>>::Options: Default,
|
|
|
|
{
|
|
|
|
}
|
|
|
|
|
2023-10-16 19:51:53 +11:00
|
|
|
impl<Ctx: ScriptContext> GeneratableKey<Ctx> for bip32::Xpriv {
|
2020-09-30 08:17:49 +10:00
|
|
|
type Entropy = [u8; 32];
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
type Options = ();
|
|
|
|
type Error = bip32::Error;
|
|
|
|
|
2020-09-30 08:17:49 +10:00
|
|
|
fn generate_with_entropy(
|
2020-09-24 09:52:59 +02:00
|
|
|
_: Self::Options,
|
2020-09-30 08:17:49 +10:00
|
|
|
entropy: Self::Entropy,
|
2020-09-24 09:52:59 +02:00
|
|
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
2020-09-30 08:17:49 +10:00
|
|
|
// pick a arbitrary network here, but say that we support all of them
|
2023-10-16 19:51:53 +11:00
|
|
|
let xprv = bip32::Xpriv::new_master(Network::Bitcoin, entropy.as_ref())?;
|
2020-09-24 09:52:59 +02:00
|
|
|
Ok(GeneratedKey::new(xprv, any_network()))
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-11-13 17:43:57 +01:00
|
|
|
/// Options for generating a [`PrivateKey`]
|
|
|
|
///
|
|
|
|
/// Defaults to creating compressed keys, which save on-chain bytes and fees
|
|
|
|
#[derive(Debug, Copy, Clone)]
|
|
|
|
pub struct PrivateKeyGenerateOptions {
|
2020-12-10 11:39:01 +01:00
|
|
|
/// Whether the generated key should be "compressed" or not
|
2020-11-13 17:43:57 +01:00
|
|
|
pub compressed: bool,
|
|
|
|
}
|
|
|
|
|
|
|
|
impl Default for PrivateKeyGenerateOptions {
|
|
|
|
fn default() -> Self {
|
|
|
|
PrivateKeyGenerateOptions { compressed: true }
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-11-13 16:43:04 +01:00
|
|
|
impl<Ctx: ScriptContext> GeneratableKey<Ctx> for PrivateKey {
|
|
|
|
type Entropy = [u8; secp256k1::constants::SECRET_KEY_SIZE];
|
|
|
|
|
2020-11-13 17:43:57 +01:00
|
|
|
type Options = PrivateKeyGenerateOptions;
|
2020-11-13 16:43:04 +01:00
|
|
|
type Error = bip32::Error;
|
|
|
|
|
|
|
|
fn generate_with_entropy(
|
2020-11-13 17:43:57 +01:00
|
|
|
options: Self::Options,
|
2020-11-13 16:43:04 +01:00
|
|
|
entropy: Self::Entropy,
|
|
|
|
) -> Result<GeneratedKey<Self, Ctx>, Self::Error> {
|
|
|
|
// pick a arbitrary network here, but say that we support all of them
|
2022-04-14 17:20:46 +02:00
|
|
|
let inner = secp256k1::SecretKey::from_slice(&entropy)?;
|
2020-11-13 16:43:04 +01:00
|
|
|
let private_key = PrivateKey {
|
2020-11-13 17:43:57 +01:00
|
|
|
compressed: options.compressed,
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
network: Network::Bitcoin.into(),
|
2022-04-14 17:20:46 +02:00
|
|
|
inner,
|
2020-11-13 16:43:04 +01:00
|
|
|
};
|
|
|
|
|
|
|
|
Ok(GeneratedKey::new(private_key, any_network()))
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext, T: DerivableKey<Ctx>> IntoDescriptorKey<Ctx>
|
|
|
|
for (T, bip32::DerivationPath)
|
|
|
|
{
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2021-01-26 11:48:44 -05:00
|
|
|
self.0.into_descriptor_key(None, self.1)
|
2020-09-22 16:12:09 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext, T: DerivableKey<Ctx>> IntoDescriptorKey<Ctx>
|
2020-12-11 11:14:30 +01:00
|
|
|
for (T, bip32::KeySource, bip32::DerivationPath)
|
2020-09-22 16:12:09 +02:00
|
|
|
{
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2021-01-26 11:48:44 -05:00
|
|
|
self.0.into_descriptor_key(Some(self.1), self.2)
|
2020-09-22 16:12:09 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
fn expand_multi_keys<Pk: IntoDescriptorKey<Ctx>, Ctx: ScriptContext>(
|
2020-11-17 23:40:31 +01:00
|
|
|
pks: Vec<Pk>,
|
|
|
|
secp: &SecpCtx,
|
|
|
|
) -> Result<(Vec<DescriptorPublicKey>, KeyMap, ValidNetworks), KeyError> {
|
|
|
|
let (pks, key_maps_networks): (Vec<_>, Vec<_>) = pks
|
|
|
|
.into_iter()
|
2021-02-10 10:20:06 +11:00
|
|
|
.map(|key| key.into_descriptor_key()?.extract(secp))
|
2020-11-17 23:40:31 +01:00
|
|
|
.collect::<Result<Vec<_>, _>>()?
|
|
|
|
.into_iter()
|
|
|
|
.map(|(a, b, c)| (a, (b, c)))
|
|
|
|
.unzip();
|
|
|
|
|
|
|
|
let (key_map, valid_networks) = key_maps_networks.into_iter().fold(
|
|
|
|
(KeyMap::default(), any_network()),
|
|
|
|
|(mut keys_acc, net_acc), (key, net)| {
|
2023-07-26 19:46:40 -05:00
|
|
|
keys_acc.extend(key);
|
2020-11-17 23:40:31 +01:00
|
|
|
let net_acc = merge_networks(&net_acc, &net);
|
|
|
|
|
|
|
|
(keys_acc, net_acc)
|
|
|
|
},
|
|
|
|
);
|
|
|
|
|
|
|
|
Ok((pks, key_map, valid_networks))
|
|
|
|
}
|
|
|
|
|
2024-02-06 08:56:31 -06:00
|
|
|
// Used internally by `bdk_wallet::fragment!` to build `pk_k()` fragments
|
2020-09-21 15:44:07 +02:00
|
|
|
#[doc(hidden)]
|
2021-02-12 23:02:13 -08:00
|
|
|
pub fn make_pk<Pk: IntoDescriptorKey<Ctx>, Ctx: ScriptContext>(
|
2020-09-21 15:44:07 +02:00
|
|
|
descriptor_key: Pk,
|
2020-11-16 22:07:38 +01:00
|
|
|
secp: &SecpCtx,
|
2021-01-11 13:12:01 +01:00
|
|
|
) -> Result<(Miniscript<DescriptorPublicKey, Ctx>, KeyMap, ValidNetworks), DescriptorError> {
|
2021-02-11 11:00:48 -08:00
|
|
|
let (key, key_map, valid_networks) = descriptor_key.into_descriptor_key()?.extract(secp)?;
|
2021-01-11 13:12:01 +01:00
|
|
|
let minisc = Miniscript::from_ast(Terminal::PkK(key))?;
|
2020-09-19 12:08:30 +02:00
|
|
|
|
2021-11-23 12:59:08 -05:00
|
|
|
minisc.check_miniscript()?;
|
2021-01-11 13:12:01 +01:00
|
|
|
|
|
|
|
Ok((minisc, key_map, valid_networks))
|
2020-09-19 12:08:30 +02:00
|
|
|
}
|
|
|
|
|
2024-02-06 08:56:31 -06:00
|
|
|
// Used internally by `bdk_wallet::fragment!` to build `pk_h()` fragments
|
2021-09-15 10:35:01 +02:00
|
|
|
#[doc(hidden)]
|
|
|
|
pub fn make_pkh<Pk: IntoDescriptorKey<Ctx>, Ctx: ScriptContext>(
|
|
|
|
descriptor_key: Pk,
|
|
|
|
secp: &SecpCtx,
|
|
|
|
) -> Result<(Miniscript<DescriptorPublicKey, Ctx>, KeyMap, ValidNetworks), DescriptorError> {
|
|
|
|
let (key, key_map, valid_networks) = descriptor_key.into_descriptor_key()?.extract(secp)?;
|
|
|
|
let minisc = Miniscript::from_ast(Terminal::PkH(key))?;
|
|
|
|
|
2021-11-23 12:59:08 -05:00
|
|
|
minisc.check_miniscript()?;
|
2021-09-15 10:35:01 +02:00
|
|
|
|
|
|
|
Ok((minisc, key_map, valid_networks))
|
|
|
|
}
|
|
|
|
|
2024-02-06 08:56:31 -06:00
|
|
|
// Used internally by `bdk_wallet::fragment!` to build `multi()` fragments
|
2020-09-19 12:08:30 +02:00
|
|
|
#[doc(hidden)]
|
2022-04-29 15:38:45 +02:00
|
|
|
pub fn make_multi<
|
|
|
|
Pk: IntoDescriptorKey<Ctx>,
|
|
|
|
Ctx: ScriptContext,
|
|
|
|
V: Fn(usize, Vec<DescriptorPublicKey>) -> Terminal<DescriptorPublicKey, Ctx>,
|
|
|
|
>(
|
2020-09-19 12:08:30 +02:00
|
|
|
thresh: usize,
|
2022-04-29 15:38:45 +02:00
|
|
|
variant: V,
|
2020-09-19 12:08:30 +02:00
|
|
|
pks: Vec<Pk>,
|
2020-11-16 22:07:38 +01:00
|
|
|
secp: &SecpCtx,
|
2021-01-11 13:12:01 +01:00
|
|
|
) -> Result<(Miniscript<DescriptorPublicKey, Ctx>, KeyMap, ValidNetworks), DescriptorError> {
|
2020-11-17 23:40:31 +01:00
|
|
|
let (pks, key_map, valid_networks) = expand_multi_keys(pks, secp)?;
|
2022-04-29 15:38:45 +02:00
|
|
|
let minisc = Miniscript::from_ast(variant(thresh, pks))?;
|
2021-01-11 13:12:01 +01:00
|
|
|
|
2021-11-23 12:59:08 -05:00
|
|
|
minisc.check_miniscript()?;
|
2020-09-21 15:44:07 +02:00
|
|
|
|
2021-01-11 13:12:01 +01:00
|
|
|
Ok((minisc, key_map, valid_networks))
|
2020-09-18 17:26:58 +02:00
|
|
|
}
|
|
|
|
|
2024-02-06 08:56:31 -06:00
|
|
|
// Used internally by `bdk_wallet::descriptor!` to build `sortedmulti()` fragments
|
2020-11-17 23:40:31 +01:00
|
|
|
#[doc(hidden)]
|
2021-02-02 20:06:40 -05:00
|
|
|
pub fn make_sortedmulti<Pk, Ctx, F>(
|
2020-11-17 23:40:31 +01:00
|
|
|
thresh: usize,
|
|
|
|
pks: Vec<Pk>,
|
2021-02-02 20:06:40 -05:00
|
|
|
build_desc: F,
|
2020-11-17 23:40:31 +01:00
|
|
|
secp: &SecpCtx,
|
2021-02-02 20:06:40 -05:00
|
|
|
) -> Result<(Descriptor<DescriptorPublicKey>, KeyMap, ValidNetworks), DescriptorError>
|
|
|
|
where
|
2021-02-12 23:02:13 -08:00
|
|
|
Pk: IntoDescriptorKey<Ctx>,
|
2021-02-02 20:06:40 -05:00
|
|
|
Ctx: ScriptContext,
|
|
|
|
F: Fn(
|
|
|
|
usize,
|
|
|
|
Vec<DescriptorPublicKey>,
|
|
|
|
) -> Result<(Descriptor<DescriptorPublicKey>, PhantomData<Ctx>), DescriptorError>,
|
|
|
|
{
|
2020-11-17 23:40:31 +01:00
|
|
|
let (pks, key_map, valid_networks) = expand_multi_keys(pks, secp)?;
|
2021-02-02 20:06:40 -05:00
|
|
|
let descriptor = build_desc(thresh, pks)?.0;
|
2021-01-11 13:12:01 +01:00
|
|
|
|
2021-02-02 20:06:40 -05:00
|
|
|
Ok((descriptor, key_map, valid_networks))
|
2020-11-17 23:40:31 +01:00
|
|
|
}
|
|
|
|
|
2024-02-06 08:56:31 -06:00
|
|
|
/// The "identity" conversion is used internally by some `bdk_wallet::fragment`s
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorKey<Ctx> {
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2020-09-18 17:26:58 +02:00
|
|
|
Ok(self)
|
|
|
|
}
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorPublicKey {
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2020-09-21 15:44:07 +02:00
|
|
|
let networks = match self {
|
2022-10-25 11:15:43 +02:00
|
|
|
DescriptorPublicKey::Single(_) => any_network(),
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
DescriptorPublicKey::XPub(DescriptorXKey { xkey, .. }) if xkey.network.is_mainnet() => {
|
2020-09-21 15:44:07 +02:00
|
|
|
mainnet_network()
|
|
|
|
}
|
|
|
|
_ => test_networks(),
|
|
|
|
};
|
|
|
|
|
|
|
|
Ok(DescriptorKey::from_public(self, networks))
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PublicKey {
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2022-10-25 11:15:43 +02:00
|
|
|
DescriptorPublicKey::Single(SinglePub {
|
2022-04-14 17:20:46 +02:00
|
|
|
key: SinglePubKey::FullKey(self),
|
|
|
|
origin: None,
|
|
|
|
})
|
|
|
|
.into_descriptor_key()
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for XOnlyPublicKey {
|
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2022-10-25 11:15:43 +02:00
|
|
|
DescriptorPublicKey::Single(SinglePub {
|
2022-04-14 17:20:46 +02:00
|
|
|
key: SinglePubKey::XOnly(self),
|
2020-10-09 12:03:47 +02:00
|
|
|
origin: None,
|
|
|
|
})
|
2021-02-11 11:00:48 -08:00
|
|
|
.into_descriptor_key()
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for DescriptorSecretKey {
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2020-10-09 12:03:47 +02:00
|
|
|
let networks = match &self {
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
DescriptorSecretKey::Single(sk) if sk.key.network.is_mainnet() => mainnet_network(),
|
|
|
|
DescriptorSecretKey::XPrv(DescriptorXKey { xkey, .. }) if xkey.network.is_mainnet() => {
|
2020-09-21 15:44:07 +02:00
|
|
|
mainnet_network()
|
|
|
|
}
|
|
|
|
_ => test_networks(),
|
|
|
|
};
|
|
|
|
|
|
|
|
Ok(DescriptorKey::from_secret(self, networks))
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for &'_ str {
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2020-12-16 19:01:16 +01:00
|
|
|
DescriptorSecretKey::from_str(self)
|
|
|
|
.map_err(|e| KeyError::Message(e.to_string()))?
|
2021-02-11 11:00:48 -08:00
|
|
|
.into_descriptor_key()
|
2020-12-16 19:01:16 +01:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2021-02-12 23:02:13 -08:00
|
|
|
impl<Ctx: ScriptContext> IntoDescriptorKey<Ctx> for PrivateKey {
|
2021-02-11 11:00:48 -08:00
|
|
|
fn into_descriptor_key(self) -> Result<DescriptorKey<Ctx>, KeyError> {
|
2022-10-25 11:15:43 +02:00
|
|
|
DescriptorSecretKey::Single(SinglePriv {
|
2020-10-09 12:03:47 +02:00
|
|
|
key: self,
|
|
|
|
origin: None,
|
|
|
|
})
|
2021-02-11 11:00:48 -08:00
|
|
|
.into_descriptor_key()
|
2020-09-18 16:31:03 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2020-09-22 16:12:09 +02:00
|
|
|
/// Errors thrown while working with [`keys`](crate::keys)
|
2020-09-21 15:44:07 +02:00
|
|
|
#[derive(Debug)]
|
|
|
|
pub enum KeyError {
|
2020-12-10 11:39:01 +01:00
|
|
|
/// The key cannot exist in the given script context
|
2020-09-21 15:44:07 +02:00
|
|
|
InvalidScriptContext,
|
2020-12-10 11:39:01 +01:00
|
|
|
/// The key is not valid for the given network
|
2020-09-21 15:44:07 +02:00
|
|
|
InvalidNetwork,
|
2020-12-10 11:39:01 +01:00
|
|
|
/// The key has an invalid checksum
|
2020-09-21 15:44:07 +02:00
|
|
|
InvalidChecksum,
|
2020-12-10 11:39:01 +01:00
|
|
|
|
|
|
|
/// Custom error message
|
2020-09-21 15:44:07 +02:00
|
|
|
Message(String),
|
|
|
|
|
2020-12-16 13:57:01 -08:00
|
|
|
/// BIP32 error
|
2023-07-19 15:27:48 +02:00
|
|
|
Bip32(bitcoin::bip32::Error),
|
2020-12-16 13:57:01 -08:00
|
|
|
/// Miniscript error
|
2020-09-21 15:44:07 +02:00
|
|
|
Miniscript(miniscript::Error),
|
|
|
|
}
|
|
|
|
|
2023-11-16 10:22:37 -06:00
|
|
|
impl From<miniscript::Error> for KeyError {
|
|
|
|
fn from(err: miniscript::Error) -> Self {
|
|
|
|
KeyError::Miniscript(err)
|
|
|
|
}
|
|
|
|
}
|
|
|
|
|
|
|
|
impl From<bip32::Error> for KeyError {
|
|
|
|
fn from(err: bip32::Error) -> Self {
|
|
|
|
KeyError::Bip32(err)
|
|
|
|
}
|
|
|
|
}
|
2020-09-21 15:44:07 +02:00
|
|
|
|
2023-03-15 11:44:52 -05:00
|
|
|
impl fmt::Display for KeyError {
|
|
|
|
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
2022-12-07 19:22:45 +01:00
|
|
|
match self {
|
|
|
|
Self::InvalidScriptContext => write!(f, "Invalid script context"),
|
|
|
|
Self::InvalidNetwork => write!(f, "Invalid network"),
|
|
|
|
Self::InvalidChecksum => write!(f, "Invalid checksum"),
|
|
|
|
Self::Message(err) => write!(f, "{}", err),
|
|
|
|
Self::Bip32(err) => write!(f, "BIP32 error: {}", err),
|
|
|
|
Self::Miniscript(err) => write!(f, "Miniscript error: {}", err),
|
|
|
|
}
|
2020-09-21 15:44:07 +02:00
|
|
|
}
|
|
|
|
}
|
|
|
|
|
2023-01-10 15:10:02 +11:00
|
|
|
#[cfg(feature = "std")]
|
2020-09-21 15:44:07 +02:00
|
|
|
impl std::error::Error for KeyError {}
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
#[cfg(test)]
|
|
|
|
pub mod test {
|
2023-07-19 15:27:48 +02:00
|
|
|
use bitcoin::bip32;
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
use super::*;
|
|
|
|
|
2020-10-28 21:34:04 -07:00
|
|
|
pub const TEST_ENTROPY: [u8; 32] = [0xAA; 32];
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
#[test]
|
|
|
|
fn test_keys_generate_xprv() {
|
|
|
|
let generated_xprv: GeneratedKey<_, miniscript::Segwitv0> =
|
2023-10-16 19:51:53 +11:00
|
|
|
bip32::Xpriv::generate_with_entropy_default(TEST_ENTROPY).unwrap();
|
2020-09-24 09:52:59 +02:00
|
|
|
|
|
|
|
assert_eq!(generated_xprv.valid_networks, any_network());
|
|
|
|
assert_eq!(generated_xprv.to_string(), "xprv9s21ZrQH143K4Xr1cJyqTvuL2FWR8eicgY9boWqMBv8MDVUZ65AXHnzBrK1nyomu6wdcabRgmGTaAKawvhAno1V5FowGpTLVx3jxzE5uk3Q");
|
|
|
|
}
|
2020-11-13 16:43:04 +01:00
|
|
|
|
|
|
|
#[test]
|
|
|
|
fn test_keys_generate_wif() {
|
|
|
|
let generated_wif: GeneratedKey<_, miniscript::Segwitv0> =
|
2020-11-13 17:43:57 +01:00
|
|
|
bitcoin::PrivateKey::generate_with_entropy_default(TEST_ENTROPY).unwrap();
|
2020-11-13 16:43:04 +01:00
|
|
|
|
|
|
|
assert_eq!(generated_wif.valid_networks, any_network());
|
|
|
|
assert_eq!(
|
|
|
|
generated_wif.to_string(),
|
|
|
|
"L2wTu6hQrnDMiFNWA5na6jB12ErGQqtXwqpSL7aWquJaZG8Ai3ch"
|
|
|
|
);
|
|
|
|
}
|
2021-12-18 15:08:16 -06:00
|
|
|
|
2021-12-18 15:34:18 -06:00
|
|
|
#[cfg(feature = "keys-bip39")]
|
|
|
|
#[test]
|
|
|
|
fn test_keys_wif_network_bip39() {
|
|
|
|
let xkey: ExtendedKey = bip39::Mnemonic::parse_in(
|
|
|
|
bip39::Language::English,
|
|
|
|
"jelly crash boy whisper mouse ecology tuna soccer memory million news short",
|
|
|
|
)
|
|
|
|
.unwrap()
|
|
|
|
.into_extended_key()
|
|
|
|
.unwrap();
|
|
|
|
let xprv = xkey.into_xprv(Network::Testnet).unwrap();
|
|
|
|
|
deps(bdk): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
deps(chain): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(chain): use `minimal_non_dust()` instead of `dust_value()`
fix(chain): use `compute_txid()` instead of `txid`
deps(testenv): bump `electrsd` to `0.28.0`
deps(electrum): bump `electrum-client` to `0.20.0`
fix(electrum): use `compute_txid()` instead of `txid`
deps(esplora): bump `esplora-client` to `0.8.0`
deps(bitcoind_rpc): bump `bitcoin` to `0.32.0`, `bitcoincore-rpc` to
`0.19.0`
fix(bitcoind_rpc): use `compute_txid()` instead of `txid`
fix(nursery/tmp_plan): use proper `sighash` errors, and fix the expected
`Signature` fields
fix(sqlite): use `compute_txid()` instead of `txid`
deps(hwi): bump `hwi` to `0.9.0`
deps(wallet): bump `bitcoin` to `0.32.0`, miniscript to `12.0.0`
fix(wallet): use `compute_txid()` and `minimal_non_dust()`
- update to use `compute_txid()` instead of deprecated `txid()`
- update to use `minimal_non_dust()` instead of `dust_value()`
- remove unused `bitcoin::hex::FromHex`.
fix(wallet): uses `.into` conversion on `Network` for `NetworkKind`
- uses `.into()` when appropriate, otherwise use the explicit
`NetworkKind`, and it's `.is_mainnet()` method.
fix(wallet): add P2wpkh, Taproot, InputsIndex errors to `SignerError`
fix(wallet): fields on taproot, and ecdsa `Signature` structure
fix(wallet/wallet): convert `Weight` to `usize` for now
- converts the `bitcoin-units::Weight` type to `usize` with help of
`to_wu()` method.
- it should be updated/refactored in the future to handle the `Weight`
type throughout the code instead of current `usize`, only converting
it for now.
- allows the usage of deprecated `is_provably_unspendable()`, needs
further discussion if suggested `is_op_return` is suitable.
- update the expect field to `signature`, as it was renamed from `sig`.
fix(wallet/wallet): use `is_op_return` instead of
`is_provably_unspendable`
fix(wallet/wallet): use `relative::Locktime` instead of `Sequence`
fix(wallet/descriptor): use `ParsePublicKeyError`
fix(wallet/descriptor): use `.into()` to convert from `AbsLockTime` and
`RelLockTime` to `absolute::LockTime` and `relative::LockTime`
fix(wallet/wallet): use `Message::from_digest()` instead of relying on
deprecated `ThirtyTwoByteHash` trait.
fix(wallet/descriptor+wallet): expect `Threshold` type, and handle it
internally
fix(wallet/wallet): remove `0x` prefix from expected `TxId` display
fix(examples): use `compute_txid()` instead of `txid`
fix(ci): remove usage of `bitcoin/no-std` feature
- remove comment: `# The `no-std` feature it's implied when the `std` feature is disabled.`
2024-05-22 18:34:30 -03:00
|
|
|
assert_eq!(xprv.network, Network::Testnet.into());
|
2021-12-18 15:34:18 -06:00
|
|
|
}
|
2020-09-24 09:52:59 +02:00
|
|
|
}
|